{ "document_id": 16592, "filename": "102-Sams-SWM-Report.pdf", "engine": "paddleocr_vl", "source_run_id": 16703, "generated_at": "2026-11-05T00:21:59+00:00", "page_count": 183, "counts_by_type": { "caption": 143, "figure": 127, "footer": 62, "footnote": 90, "form_field": 4, "formula": 7, "header": 209, "heading": 78, "list": 5, "list_item": 17, "table": 147, "table_cell": 2759, "text": 357, "title": 57 }, "timings": { "total_ms": 85674, "structure_ms": 34870, "text_layer_ms": 1185, "build_ms": 1004 }, "pages": [ { "document_id": 16592, "page": 1, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 7, "counts_by_type": { "figure": 1, "footer": 1, "text": 4, "title": 1 }, "build_ms": 0, "items": [ { "id": "p1.1", "order": 1, "type": "text", "bbox": { "l": 55.2, "t": 754.56, "r": 159.84, "b": 729.6 }, "text": "ERIC HALPERT PE\nDRAINAGE NARRATIVE", "reading_order": 0 }, { "id": "p1.2", "order": 2, "type": "title", "bbox": { "l": 173.04, "t": 664.8, "r": 420.96, "b": 627.84 }, "text": "STORMWATER MANAGEMENT REPORT (SWMR)", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p1.3", "order": 3, "type": "text", "bbox": { "l": 143.28, "t": 590.16, "r": 465.84, "b": 509.04 }, "text": "PRELIMINARY AND FINAL MAJOR SUBDIVISION\nBLOCK 20101 LOTS 29 & 30\n102 SAMS ROAD\nTOWNSHIP OF JACKSON\nOCEAN COUNTY, NEW JERSEY", "reading_order": 2 }, { "id": "p1.4", "order": 4, "type": "text", "bbox": { "l": 184.56, "t": 373.92, "r": 405.36, "b": 357.6 }, "text": "PREPARED ON OCTOBER 06, 2025", "reading_order": 3 }, { "id": "p1.5", "order": 5, "type": "text", "bbox": { "l": 234.24, "t": 149.28, "r": 510.96, "b": 105.36 }, "text": "Eric Halpert PE\nProfessional Engineer\n640 Herman Road Unit 1, Jackson, New Jersey 08527", "reading_order": 4 }, { "id": "p1.6", "order": 6, "type": "figure", "bbox": { "l": 241.44, "t": 103.44, "r": 303.12, "b": 66.48 }, "text": "", "attrs": { "block_label": "image" }, "reading_order": 5 }, { "id": "p1.7", "order": 7, "type": "footer", "bbox": { "l": 235.68, "t": 52.32, "r": 302.4, "b": 40.08 }, "text": "NJ LIC # 55771", "attrs": { "block_label": "footer" }, "reading_order": 6 } ] }, { "document_id": 16592, "page": 2, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 5, "counts_by_type": { "heading": 2, "text": 3 }, "build_ms": 0, "items": [ { "id": "p2.1", "order": 1, "type": "heading", "bbox": { "l": 244.8, "t": 710.4, "r": 367.44, "b": 693.6 }, "text": "Table of Contents", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 0 }, { "id": "p2.2", "order": 2, "type": "text", "bbox": { "l": 105.6, "t": 667.2, "r": 540.24, "b": 435.12 }, "text": "Existing Conditions.....1\nSoils.....1\nProposed Conditions .....1\nStormwater Management System.....1\nWater Quality.....2\nWater Quantity.....2\nGroundwater Recharge.....2\nGroundwater Mounding.....3\nStorm Sewers.....3\nSoil Erosion and Sediment Control.....3\nConclusion.....3", "attrs": { "block_label": "content" }, "reading_order": 1 }, { "id": "p2.3", "order": 3, "type": "heading", "bbox": { "l": 264.96, "t": 404.64, "r": 346.56, "b": 385.92 }, "text": "Appendices", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 2 }, { "id": "p2.4", "order": 4, "type": "text", "bbox": { "l": 105.12, "t": 360, "r": 304.8, "b": 179.28 }, "text": "Appendix A – Existing Conditions Analysis\nAppendix B – WQ Analysis\nAppendix C – Proposed Conditions Analysis\nAppendix D – Storm Sewer Calculations\nAppendix E – Conduit Outlet Calculations\nAppendix F – SCD Analysis\nAppendix G – GW Mounding Calculations\nAppendix H – Soils\nAppendix I – DA Maps", "attrs": { "block_label": "content" }, "reading_order": 3 }, { "id": "p2.5", "order": 5, "type": "text", "bbox": { "l": 302.16, "t": 59.76, "r": 309.6, "b": 50.16 }, "text": "2", "attrs": { "block_label": "number" }, "reading_order": 4 } ] }, { "document_id": 16592, "page": 3, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 10, "counts_by_type": { "heading": 4, "text": 6 }, "build_ms": 1, "items": [ { "id": "p3.1", "order": 1, "type": "heading", "bbox": { "l": 70.08, "t": 713.76, "r": 158.64, "b": 701.52 }, "text": "Existing Conditions", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 0 }, { "id": "p3.2", "order": 2, "type": "text", "bbox": { "l": 69.12, "t": 692.64, "r": 549.36, "b": 638.64 }, "text": "The subject property is located almost at the end of Sams Road. The site contains one building with a gravel driveway providing access to Sams Road, a woodland or heavy vegetation area with some dirt roads crossing the property. The site exhibits environmental constraint in the southernmost corner of the property. Runoff from the site flows to the rear site of the lot (POA).", "reading_order": 1 }, { "id": "p3.3", "order": 3, "type": "heading", "bbox": { "l": 69.36, "t": 565.68, "r": 95.04, "b": 553.68 }, "text": "Soils", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 2 }, { "id": "p3.4", "order": 4, "type": "text", "bbox": { "l": 69.12, "t": 545.04, "r": 543.84, "b": 463.44 }, "text": "Based on the NRCS Soil Survey the site is mapped as Downer Loamy Sand, Mullica Sandy Loam and Sassafras sandy loam (HSG A). Preliminary Soil evaluations were conducted on the site including test pits and field percolations tests. The site had a tested permeability rate ranging from 12.2 and 14.5 inches/hr which results in a design permeability rate ranging from 6.1 and 7.25 in/hr. Groundwater table or signs of SHWT were encountered at 7.1 feet below grade (el. 89.0). Test pit logs and infiltration test results are included in the appendix. Additional soil testing shall be undertaken as part of resolution compliance.", "reading_order": 3 }, { "id": "p3.5", "order": 5, "type": "heading", "bbox": { "l": 69.6, "t": 420.72, "r": 166.56, "b": 408 }, "text": "Proposed Conditions", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 4 }, { "id": "p3.6", "order": 6, "type": "text", "bbox": { "l": 69.36, "t": 397.68, "r": 534.72, "b": 369.36 }, "text": "The applicant proposes to construct a Major Subdivision, along with associated site improvements such as new roadway, landscape, lighting, and stormwater management.", "reading_order": 5 }, { "id": "p3.7", "order": 7, "type": "heading", "bbox": { "l": 69.84, "t": 315.84, "r": 223.44, "b": 303.6 }, "text": "Stormwater management system", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 6 }, { "id": "p3.8", "order": 8, "type": "text", "bbox": { "l": 68.4, "t": 293.76, "r": 530.16, "b": 187.2 }, "text": "The stormwater management system consists of 2 surface infiltration basins and individual subsurface basins for each dwelling. Surface runoff from the site is partially directed to the 2 surface basins for water quality treatment and attenuation. Runoff from remaining woodland area of the property is not captured in the proposed stormwater facilities. Each proposed roof runoff is directed to the individual lot subsurface basin. An outlet control structure is proposed in each surface basin which will direct runoff in excess of the water quality storm via a 15\" (Surface #1) and 6\" (Surface #2) outlet pipe to convey excess runoff beyond required reductions to a swale near the property limit.", "reading_order": 7 }, { "id": "p3.9", "order": 9, "type": "text", "bbox": { "l": 69.84, "t": 176.64, "r": 522.24, "b": 147.84 }, "text": "The system was routed using HydroCAD software for the 2, 10, 25, and 100 year events. Calculations are included in the appendix.", "reading_order": 8 }, { "id": "p3.10", "order": 10, "type": "text", "bbox": { "l": 301.92, "t": 59.76, "r": 309.84, "b": 49.92 }, "text": "3", "attrs": { "block_label": "number" }, "reading_order": 9 } ] }, { "document_id": 16592, "page": 4, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 21, "counts_by_type": { "caption": 1, "heading": 3, "table": 1, "table_cell": 10, "text": 6 }, "build_ms": 3, "items": [ { "id": "p4.1", "order": 1, "type": "heading", "bbox": { "l": 70.08, "t": 686.88, "r": 135.6, "b": 674.4 }, "text": "Water quality", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 0 }, { "id": "p4.2", "order": 2, "type": "text", "bbox": { "l": 69.36, "t": 660.24, "r": 544.8, "b": 566.16 }, "text": "Water quality treatment is provided for all proposed motor vehicle surfaces by the surface infiltration basins. A surface infiltration basin is considered green infrastructure and provides 80% TSS Removal. The basins will have a six inch sand layer and a maximum water quality storm depth of 0.61 and 0.70 feet which is below the maximum 2 foot depth allowed by the NJDEP BMP manual. The individual drainage areas to the systems for each lot are less than 2.5 acres and therefore meet the small scale requirements. Roof runoff which does not require water quality treatment, will be conveyed directly to the subsurface system.", "reading_order": 1 }, { "id": "p4.3", "order": 3, "type": "heading", "bbox": { "l": 69.84, "t": 535.92, "r": 144, "b": 523.68 }, "text": "Water Quantity", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 2 }, { "id": "p4.4", "order": 4, "type": "text", "bbox": { "l": 68.4, "t": 518.4, "r": 532.32, "b": 458.4 }, "text": "Water quantity will be met by meeting the runoff reduction requirements to the point of analysis as demonstrated in the table below and the HydroCAD calculations in the appendix. Note that infiltration was included in the water quantity routing as allowed by the NJDEP BMP Manual. The roof runoff does not require pretreatment.", "reading_order": 3 }, { "id": "p4.5", "order": 5, "type": "caption", "bbox": { "l": 70.32, "t": 450.96, "r": 93.12, "b": 440.16 }, "text": "POA", "attrs": { "block_label": "figure_title" }, "reading_order": 4 }, { "id": "p4.6", "order": 6, "type": "table", "bbox": { "l": 71.52, "t": 431.04, "r": 541.2, "b": 358.08 }, "text": "", "attrs": { "block_label": "table", "n_rows": 2, "n_cols": 5, "integrity": { "cells_checked": 10, "cells_flagged": 0 } }, "children": [ { "id": "p4.6.1", "order": 7, "type": "table_cell", "bbox": { "l": 79.080002, "t": 429.410158, "r": 133.209012, "b": 415.966886 }, "text": "Storm Event", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 0 }, { "id": "p4.6.2", "order": 8, "type": "table_cell", "bbox": { "l": 172.503034, "t": 429.410158, "r": 228.778612, "b": 403.366895 }, "text": "Existing Peak Runoff (cfs)", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 1 }, { "id": "p4.6.3", "order": 9, "type": "table_cell", "bbox": { "l": 266.160004, "t": 429.410158, "r": 309.960827, "b": 403.366895 }, "text": "Required Reduction (%)", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 2 }, { "id": "p4.6.4", "order": 10, "type": "table_cell", "bbox": { "l": 359.400009, "t": 429.410158, "r": 425.741469, "b": 403.366895 }, "text": "Allowable Peak Runoff (cfs)", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 3 }, { "id": "p4.6.5", "order": 11, "type": "table_cell", "bbox": { "l": 453, "t": 429.410158, "r": 517.659329, "b": 403.366895 }, "text": "Proposed Peak Runoff (cfs)", "attrs": { "row": 0, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p4.6.6", "order": 12, "type": "table_cell", "bbox": { "l": 78.479999, "t": 402.770143, "r": 95.344156, "b": 361.606901 }, "text": "2\n10\n100", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p4.6.7", "order": 13, "type": "table_cell", "bbox": { "l": 172.680004, "t": 402.770143, "r": 191.588736, "b": 361.606901 }, "text": "1.08\n1.71\n3.02", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p4.6.8", "order": 14, "type": "table_cell", "bbox": { "l": 266.160004, "t": 402.770143, "r": 277.135002, "b": 361.606901 }, "text": "50\n75\n80", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 7 }, { "id": "p4.6.9", "order": 15, "type": "table_cell", "bbox": { "l": 361.919999, "t": 402.770143, "r": 380.829393, "b": 361.606901 }, "text": "0.54\n1.28\n2.42", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 8 }, { "id": "p4.6.10", "order": 16, "type": "table_cell", "bbox": { "l": 455.400009, "t": 402.770143, "r": 474.308742, "b": 361.606901 }, "text": "0.43\n0.67\n2.36", "attrs": { "row": 1, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 9 } ], "reading_order": 5 }, { "id": "p4.7", "order": 17, "type": "heading", "bbox": { "l": 69.84, "t": 333.84, "r": 175.44, "b": 321.12 }, "text": "Groundwater recharge", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 6 }, { "id": "p4.8", "order": 18, "type": "text", "bbox": { "l": 69.6, "t": 312, "r": 475.44, "b": 299.04 }, "text": "Groundwater recharge is provided by infiltrating the increase in 2 year runoff from the site.", "reading_order": 7 }, { "id": "p4.9", "order": 19, "type": "text", "bbox": { "l": 70.08, "t": 289.44, "r": 215.28, "b": 276.24 }, "text": "Existing 2 year runoff – 3,958 cf", "reading_order": 8 }, { "id": "p4.10", "order": 20, "type": "text", "bbox": { "l": 70.08, "t": 266.64, "r": 294.24, "b": 253.44 }, "text": "Proposed 2 year runoff (post infiltration) – 1394 cf", "reading_order": 9 }, { "id": "p4.11", "order": 21, "type": "text", "bbox": { "l": 302.4, "t": 59.76, "r": 309.6, "b": 50.16 }, "text": "4", "attrs": { "block_label": "number" }, "reading_order": 10 } ] }, { "document_id": 16592, "page": 5, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 19, "counts_by_type": { "heading": 5, "table": 1, "table_cell": 4, "text": 9 }, "build_ms": 3, "items": [ { "id": "p5.1", "order": 1, "type": "heading", "bbox": { "l": 68.64, "t": 716.4, "r": 165.12, "b": 705.36 }, "text": "Green Infrastructure", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 0 }, { "id": "p5.2", "order": 2, "type": "text", "bbox": { "l": 67.68, "t": 703.44, "r": 538.56, "b": 636.48 }, "text": "The intent of the green infrastructure requirement is to mimic the natural hydrologic cycle. To do so, the rules require stormwater water runoff to be treated near the source with distributed and small-scale (limited contributory drainage area) green infrastructure BMPs. Small-scale GI BMPs are achieved through the contributory drainage area limitations. The proposed BMP's are considered green infrastructure under BMP manual 9.2 Dry Wells and 9.8 Small Scale infiltration basins.", "reading_order": 1 }, { "id": "p5.3", "order": 3, "type": "heading", "bbox": { "l": 69.6, "t": 618.96, "r": 183.36, "b": 606.96 }, "text": "Groundwater Mounding", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 2 }, { "id": "p5.4", "order": 4, "type": "text", "bbox": { "l": 67.68, "t": 605.52, "r": 529.2, "b": 552.72 }, "text": "A groundwater mounding analysis was performed to confirm that the ground water mound associated with the infiltration basins will not impact the operation of the basins. As the basins are designed to infiltrate the 100 year storm events the mounding analysis was performed based on the full 100 year exfiltration volume.", "reading_order": 3 }, { "id": "p5.5", "order": 5, "type": "text", "bbox": { "l": 67.92, "t": 538.8, "r": 517.2, "b": 511.68 }, "text": "Separate mounding analysis were performed for the surface basin, and of the subsurface basin. The highest SHWT of 89.0 was utilized for groundwater mounding calculations", "reading_order": 4 }, { "id": "p5.6", "order": 6, "type": "table", "bbox": { "l": 71.52, "t": 492, "r": 541.68, "b": 423.84 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 4, "integrity": { "cells_checked": 4, "cells_flagged": 0 } }, "children": [ { "id": "p5.6.1", "order": 7, "type": "table_cell", "bbox": { "l": 79.080002, "t": 491.210153, "r": 132.098774, "b": 424.006887 }, "text": "Basin\nSurface #1\nSurface #2\nSubsurface ( LOT 30.08)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true, "column_header": true, "header_source": "pdf" }, "reading_order": 0 }, { "id": "p5.6.2", "order": 8, "type": "table_cell", "bbox": { "l": 164.279995, "t": 491.210153, "r": 227.754049, "b": 436.366895 }, "text": "Mound Height\n5.901\n1.941\n1.309", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true, "column_header": true, "header_source": "pdf" }, "reading_order": 1 }, { "id": "p5.6.3", "order": 9, "type": "table_cell", "bbox": { "l": 257.400009, "t": 491.210153, "r": 356.195493, "b": 436.366895 }, "text": "Peak Mound elevation\n94.901\n90.941\n90.309", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true, "column_header": true, "header_source": "pdf" }, "reading_order": 2 }, { "id": "p5.6.4", "order": 10, "type": "table_cell", "bbox": { "l": 397.919999, "t": 491.210153, "r": 499.835462, "b": 436.366895 }, "text": "basin bottom elevation\n95.00\n91.00\n90.50", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true, "column_header": true, "header_source": "pdf" }, "reading_order": 3 } ], "reading_order": 5 }, { "id": "p5.7", "order": 11, "type": "heading", "bbox": { "l": 69.6, "t": 408.96, "r": 135.84, "b": 397.2 }, "text": "Storm Sewers", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 6 }, { "id": "p5.8", "order": 12, "type": "text", "bbox": { "l": 69.36, "t": 386.88, "r": 534.48, "b": 359.52 }, "text": "The storm sewers were designed to convey the 25-year storm event. Storm sewers were sized using the rational method and manning equation. See appendix for calculations.", "reading_order": 7 }, { "id": "p5.9", "order": 13, "type": "heading", "bbox": { "l": 69.12, "t": 350.4, "r": 226.08, "b": 337.68 }, "text": "Soil Erosion and Sediment Control", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 8 }, { "id": "p5.10", "order": 14, "type": "text", "bbox": { "l": 68.4, "t": 327.6, "r": 523.44, "b": 300.24 }, "text": "Soil erosion and sediment control measures are incorporated into the design including silt fence, inlet protection, and stabilized construction access", "reading_order": 9 }, { "id": "p5.11", "order": 15, "type": "text", "bbox": { "l": 68.64, "t": 289.92, "r": 537.36, "b": 255.84 }, "text": "A scour hole has been designed for the outfall into the basin in accordance with the methods prescribed in the Standards for Soil Erosion and Sediment Control in New Jersey.", "reading_order": 10 }, { "id": "p5.12", "order": 16, "type": "text", "bbox": { "l": 69.84, "t": 242.64, "r": 349.68, "b": 230.16 }, "text": "Downstream stability is met by meeting peak flow reductions.", "reading_order": 11 }, { "id": "p5.13", "order": 17, "type": "text", "bbox": { "l": 69.6, "t": 219.36, "r": 535.2, "b": 176.88 }, "text": "For point of discharge stability analysis, a failure analysis has been performed assuming the surface infiltration basin does not function and is full to the lowest orifice. The proposed basin(s) discharge to a proposed bubbler outlet which represents a stable discharge", "reading_order": 12 }, { "id": "p5.14", "order": 18, "type": "heading", "bbox": { "l": 70.08, "t": 151.92, "r": 122.4, "b": 139.68 }, "text": "Conclusion", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 13 }, { "id": "p5.15", "order": 19, "type": "text", "bbox": { "l": 69.12, "t": 129.6, "r": 525.6, "b": 87.84 }, "text": "The stormwater management system has been designed to manage the increase in runoff associated with the proposed development. The design conforms to the Township, NJDEP, and Soil Conservation District standards.", "reading_order": 14 } ] }, { "document_id": 16592, "page": 6, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 1, "counts_by_type": { "heading": 1 }, "build_ms": 0, "items": [ { "id": "p6.1", "order": 1, "type": "heading", "bbox": { "l": 252.24, "t": 717.36, "r": 359.52, "b": 697.2 }, "text": "APPENDIX A", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 0 } ] }, { "document_id": 16592, "page": 7, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 4, "counts_by_type": { "caption": 2, "figure": 1, "footer": 1 }, "build_ms": 0, "items": [ { "id": "p7.1", "order": 1, "type": "figure", "bbox": { "l": 54.48, "t": 730.56, "r": 555.36, "b": 57.84 }, "text": "", "attrs": { "block_label": "image" }, "reading_order": 0 }, { "id": "p7.2", "order": 2, "type": "caption", "bbox": { "l": 261.12, "t": 594.72, "r": 350.16, "b": 571.68 }, "text": "EXISTING", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p7.3", "order": 3, "type": "caption", "bbox": { "l": 124.56, "t": 259.2, "r": 257.52, "b": 238.8 }, "text": "DA E3 (Impervious)", "attrs": { "block_label": "figure_title" }, "reading_order": 2 }, { "id": "p7.4", "order": 4, "type": "footer", "bbox": { "l": 288.96, "t": 86.64, "r": 548.16, "b": 56.4 }, "text": "Routing Diagram for 102 Sams -REV 12-02-25\nPrepared by Haler Consulting, Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "footer" }, "reading_order": 3 } ] }, { "document_id": 16592, "page": 8, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 10, "counts_by_type": { "header": 2, "heading": 1, "table": 1, "table_cell": 6 }, "build_ms": 1, "items": [ { "id": "p8.1", "order": 1, "type": "header", "bbox": { "l": 52.08, "t": 737.76, "r": 395.04, "b": 698.64 }, "text": "102 Sams -REV 12-02-25\nPrepared by Haler Consulting\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p8.2", "order": 2, "type": "header", "bbox": { "l": 463.2, "t": 724.8, "r": 560.16, "b": 698.88 }, "text": "Printed 04/12/2025\nPage 2", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p8.3", "order": 3, "type": "heading", "bbox": { "l": 226.32, "t": 687.6, "r": 386.16, "b": 672.96 }, "text": "Area Listing (selected nodes)", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 2 }, { "id": "p8.4", "order": 4, "type": "table", "bbox": { "l": 51.84, "t": 663.36, "r": 380.16, "b": 562.08 }, "text": "", "attrs": { "block_label": "table", "n_rows": 2, "n_cols": 3, "integrity": { "cells_checked": 6, "cells_flagged": 0 } }, "children": [ { "id": "p8.4.1", "order": 5, "type": "table_cell", "bbox": { "l": 116.879997, "t": 661.126246, "r": 143.086498, "b": 636.318852 }, "text": "Area (sq-ft)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 0 }, { "id": "p8.4.2", "order": 6, "type": "table_cell", "bbox": { "l": 165.479999, "t": 661.126246, "r": 179.801438, "b": 650.1188589999999 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 1 }, { "id": "p8.4.3", "order": 7, "type": "table_cell", "bbox": { "l": 200.001374, "t": 661.126246, "r": 311.238628, "b": 636.318852 }, "text": "Description (subcatchment-numbers)", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 2 }, { "id": "p8.4.4", "order": 8, "type": "table_cell", "bbox": { "l": 107.279995, "t": 629.926241, "r": 143.321918, "b": 563.71885 }, "text": "1,873\n8,364\n4,666\n558,777\n573,680", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p8.4.5", "order": 9, "type": "table_cell", "bbox": { "l": 168.821185, "t": 629.926241, "r": 180.111841, "b": 563.71885 }, "text": "98\n98\n98\n30\n32", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p8.4.6", "order": 10, "type": "table_cell", "bbox": { "l": 200.002058, "t": 629.926241, "r": 376.892724, "b": 563.71885 }, "text": "Paved parking, HSG A (124S)\nUnconnected pavement, HSG A (124S)\nUnconnected roofs, HSG A (142S)\nWoods, Good, HSG A (118S)\nTOTAL AREA", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 } ], "reading_order": 3 } ] }, { "document_id": 16592, "page": 9, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 2, "counts_by_type": { "footer": 1, "text": 1 }, "build_ms": 0, "items": [ { "id": "p9.1", "order": 1, "type": "text", "bbox": { "l": 49.68, "t": 692.16, "r": 561.12, "b": 471.36 }, "text": "Time span=0.00-72.00 hrs, dt=0.01 hrs, 7201 points\nRunoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious\nReach routing by Stor-Ind+Trans method - Pond routing by Stor-Ind method\nSubcatchment 118S: DA E1 (Pervious) Runoff Area=558,777 sf 0.00% Impervious Runoff Depth=0.00\"\nFlow Length=1,241' Tc=60.4 min CN=30/0 Runoff=0.00 cfs 0 cf\nSubcatchment 124S: DA E3 (Impervious) Runoff Area=0.235 ac 18.30% Impervious Runoff Depth=3.19\"\nFlow Length=195' Tc=1.6 min CN=98/98 Runoff=0.82 cfs 2,718 cf\nSubcatchment 142S: DA E2 (Roof) Runoff Area=4,666 sf 0.00% Impervious Runoff Depth=3.19\"\nTc=6.0 min CN=98/0 Runoff=0.28 cfs 1,239 cf\nLink 141L: POA\nInflow=1.08 cfs 3,958 cf\nPrimary=1.08 cfs 3,958 cf\nTotal Runoff Area = 573,680 sf Runoff Volume = 3,958 cf Average Runoff Depth = 0.08\"\n99.67% Pervious = 571,807 sf 0.33% Impervious = 1,873 sf", "attrs": { "block_label": "algorithm" }, "reading_order": 0 }, { "id": "p9.2", "order": 2, "type": "footer", "bbox": { "l": 45.36, "t": 739.68, "r": 560.16, "b": 700.08 }, "text": "102 Sams -REV 12-02-25\nPrepared by Haler Consulting\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC\nNOAA 24-hr D 2-Year Rainfall=3.42\"\nPrinted 04/12/2025\nPage 3", "attrs": { "block_label": "footer" }, "reading_order": 1 } ] }, { "document_id": 16592, "page": 10, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 33, "counts_by_type": { "caption": 1, "figure": 2, "footnote": 2, "table": 1, "table_cell": 23, "text": 3, "title": 1 }, "build_ms": 10, "items": [ { "id": "p10.1", "order": 1, "type": "figure", "bbox": { "l": 53.28, "t": 738.48, "r": 560.64, "b": 698.64 }, "text": "", "attrs": { "role": "page_header", "block_label": "header_image", "embedded_text": "102 Sams -REV 12-02-25 NOAA 24-hr D 2-Year Rainfall=3.42\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 4" }, "reading_order": 0 }, { "id": "p10.2", "order": 2, "type": "title", "bbox": { "l": 155.04, "t": 687.6, "r": 457.2, "b": 672.24 }, "text": "Summary for Subcatchment 118S: DA E1 (Pervious)", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p10.3", "order": 3, "type": "text", "bbox": { "l": 53.76, "t": 660.96, "r": 462.96, "b": 636 }, "text": "Runoff = 0.00 cfs @ 0.00 hrs, Volume=\nRouted to Link 141L : POA", "reading_order": 2 }, { "id": "p10.4", "order": 4, "type": "text", "bbox": { "l": 368.16, "t": 660, "r": 463.2, "b": 646.56 }, "text": "0 cf, Depth = 0.00", "reading_order": 3 }, { "id": "p10.5", "order": 5, "type": "text", "bbox": { "l": 52.32, "t": 623.76, "r": 611.04, "b": 598.32 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious, Time Span= 0.00-72.00 hrs, dt= NOAA 24-hr D 2-Year Rainfall=3.42\"", "reading_order": 4 }, { "id": "p10.6", "order": 6, "type": "table", "bbox": { "l": 52.56, "t": 588.96, "r": 558.96, "b": 447.497874 }, "text": "", "attrs": { "block_label": "table", "n_rows": 6, "n_cols": 5, "integrity": { "cells_checked": 21, "cells_flagged": 0 } }, "children": [ { "id": "p10.6.1", "order": 7, "type": "table_cell", "bbox": { "l": 86.520001, "t": 587.142469, "r": 127.590159, "b": 575.177889 }, "text": "Area (sf)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p10.6.2", "order": 8, "type": "table_cell", "bbox": { "l": 144.389888, "t": 587.142469, "r": 159.742288, "b": 575.177889 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p10.6.3", "order": 9, "type": "table_cell", "bbox": { "l": 286.601768, "t": 535.302451, "r": 340.102911, "b": 523.337871 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p10.6.4", "order": 10, "type": "table_cell", "bbox": { "l": 89.399998, "t": 559.302451, "r": 127.714872, "b": 547.337871 }, "text": "558,777", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 3 }, { "id": "p10.6.5", "order": 11, "type": "table_cell", "bbox": { "l": 147.913142, "t": 559.302451, "r": 159.770513, "b": 547.337871 }, "text": "30", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p10.6.6", "order": 12, "type": "table_cell", "bbox": { "l": 174.07226, "t": 573.222448, "r": 278.894506, "b": 561.257868 }, "text": "Woods, Good, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 5 }, { "id": "p10.6.7", "order": 13, "type": "table_cell", "bbox": { "l": 89.399998, "t": 573.222448, "r": 127.714872, "b": 561.257868 }, "text": "558,777", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p10.6.8", "order": 14, "type": "table_cell", "bbox": { "l": 147.913142, "t": 573.222448, "r": 159.770513, "b": 561.257868 }, "text": "30", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p10.6.9", "order": 15, "type": "table_cell", "bbox": { "l": 174.07226, "t": 559.302451, "r": 286.016818, "b": 547.337871 }, "text": "100.00% Pervious Area", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 8 }, { "id": "p10.6.10", "order": 16, "type": "table_cell", "bbox": { "l": 65.040001, "t": 535.302451, "r": 89.492517, "b": 497.417872 }, "text": "Tc (min)\n30.8", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 9 }, { "id": "p10.6.11", "order": 17, "type": "table_cell", "bbox": { "l": 100.248415, "t": 535.302451, "r": 132.697945, "b": 497.417872 }, "text": "Length (feet)\n100", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 10 }, { "id": "p10.6.12", "order": 18, "type": "table_cell", "bbox": { "l": 143.354569, "t": 535.302451, "r": 175.895438, "b": 497.417872 }, "text": "Slope (ft/ft)\n0.0075", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 11 }, { "id": "p10.6.13", "order": 19, "type": "table_cell", "bbox": { "l": 186.552062, "t": 535.302451, "r": 223.968178, "b": 497.417872 }, "text": "Velocity (ft/sec)\n0.05", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 12 }, { "id": "p10.6.14", "order": 20, "type": "table_cell", "bbox": { "l": 234.581918, "t": 535.302451, "r": 512.409343, "b": 461.417872 }, "text": "Capacity (cfs)\nSheet Flow,\\nWoods: Light underbrush n= 0.400 P2= 3.42\"\\nShallow Concentrated Flow,\\nWoodland Kv= 5.0 fps", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 13 }, { "id": "p10.6.15", "order": 21, "type": "table_cell", "bbox": { "l": 68.76, "t": 485.382452, "r": 89.492517, "b": 473.417872 }, "text": "29.6", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p10.6.16", "order": 22, "type": "table_cell", "bbox": { "l": 106.045663, "t": 485.382452, "r": 132.674702, "b": 473.417872 }, "text": "1,141", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p10.6.17", "order": 23, "type": "table_cell", "bbox": { "l": 143.438536, "t": 485.382452, "r": 175.856888, "b": 473.417872 }, "text": "0.0165", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p10.6.18", "order": 24, "type": "table_cell", "bbox": { "l": 203.130985, "t": 485.382452, "r": 223.863501, "b": 473.417872 }, "text": "0.64", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p10.6.19", "order": 25, "type": "table_cell", "bbox": { "l": 68.76, "t": 459.462454, "r": 89.492517, "b": 447.497874 }, "text": "60.4", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p10.6.20", "order": 26, "type": "table_cell", "bbox": { "l": 106.045663, "t": 459.462454, "r": 132.674702, "b": 447.497874 }, "text": "1.241", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p10.6.21", "order": 27, "type": "table_cell", "bbox": { "l": 143.438536, "t": 459.462454, "r": 167.022825, "b": 447.497874 }, "text": "Total", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p10.6.22", "order": 28, "type": "table_cell", "bbox": { "l": 356.4, "t": 471.0857, "r": 457.68, "b": 451.44 }, "text": "", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 21 }, { "id": "p10.6.23", "order": 29, "type": "table_cell", "bbox": { "l": 457.68, "t": 471.0857, "r": 558.96, "b": 451.44 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 22 } ], "reading_order": 5 }, { "id": "p10.7", "order": 30, "type": "caption", "bbox": { "l": 193.2, "t": 435.12, "r": 417.84, "b": 420 }, "text": "Subcatchment 118S: DA E1 (Pervious)", "attrs": { "block_label": "figure_title" }, "reading_order": 6 }, { "id": "p10.8", "order": 31, "type": "figure", "bbox": { "l": 60.24, "t": 419.28, "r": 551.52, "b": 150.48 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n1\nRunoff\nNOAA 24-hr D\n2-Year Rainfall=3.42\"\nRunoff Area=558,777 sf\nRunoff Volume=0 cf\n(cfs)\nRunoff Depth=0.00\"\nFlow\nFlow Length=1,241'\nTc=60.4 min\nCN=30/0\n0.00 cfs\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72" }, "reading_order": 7 }, { "id": "p10.9", "order": 32, "type": "footnote", "bbox": { "l": 63.6, "t": 459.6, "r": 168.72, "b": 446.88 }, "text": "60.4 1,241 Total", "attrs": { "block_label": "vision_footnote" }, "reading_order": 8 }, { "id": "p10.10", "order": 33, "type": "footnote", "bbox": { "l": 84.48, "t": 168.48, "r": 493.2, "b": 148.32 }, "text": "0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72 Time (hours)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 9 } ] }, { "document_id": 16592, "page": 11, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 42, "counts_by_type": { "caption": 1, "figure": 1, "footer": 1, "footnote": 1, "header": 1, "table": 1, "table_cell": 32, "text": 3, "title": 1 }, "build_ms": 5, "items": [ { "id": "p11.1", "order": 1, "type": "header", "bbox": { "l": 53.28, "t": 738.24, "r": 560.88, "b": 698.64 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 2-Year Rainfall=3.42\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 5", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p11.2", "order": 2, "type": "title", "bbox": { "l": 147.12, "t": 687.36, "r": 465.12, "b": 672.24 }, "text": "Summary for Subcatchment 124S: DA E3 (Impervious)", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p11.3", "order": 3, "type": "text", "bbox": { "l": 52.56, "t": 660.24, "r": 463.92, "b": 634.32 }, "text": "Runoff = 0.82 cfs @ 12.10 hrs, Volume= 2,718 cf, Depth= 3.19\"\nRouted to Link 141L : POA", "reading_order": 2 }, { "id": "p11.4", "order": 4, "type": "text", "bbox": { "l": 52.08, "t": 623.76, "r": 611.28, "b": 598.32 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious, Time Span= 0.00-72.00 hrs, dt= NOAA 24-hr D 2-Year Rainfall=3.42\"", "reading_order": 3 }, { "id": "p11.5", "order": 5, "type": "table", "bbox": { "l": 53.04, "t": 587.52, "r": 558.96, "b": 411.497874 }, "text": "", "attrs": { "block_label": "table", "n_rows": 6, "n_cols": 7, "integrity": { "cells_checked": 25, "cells_flagged": 1, "flags": [ { "row": 5, "col": 1, "coverage": 0, "text": "105" } ] } }, "children": [ { "id": "p11.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 69, "t": 587.142469, "r": 112.857606, "b": 575.177889 }, "text": "Area (ac)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p11.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 129.550125, "t": 587.142469, "r": 145.032977, "b": 575.177889 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p11.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 286.601768, "t": 499.302451, "r": 340.102911, "b": 487.337871 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p11.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 53.04, "t": 573.36, "r": 125.3143, "b": 559.2 }, "text": "", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 3 }, { "id": "p11.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 86.399998, "t": 573.222448, "r": 113.029037, "b": 511.337871 }, "text": "0.192\n0.043\n0.235\n0.192\n0.043", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p11.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 133.227307, "t": 573.222448, "r": 145.084677, "b": 511.337871 }, "text": "98\n98\n98\n98\n98", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p11.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 159.386425, "t": 573.222448, "r": 310.746597, "b": 511.337871 }, "text": "Unconnected pavement, HSG A\nPaved parking, HSG A\nWeighted Average\n81.70% Pervious Area\n18.30% Impervious Area", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 4, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p11.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 65.040001, "t": 499.302451, "r": 89.40872, "b": 475.337871 }, "text": "Tc (min)", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p11.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 100.248415, "t": 499.302451, "r": 132.666767, "b": 475.337871 }, "text": "Length (feet)", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p11.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 148.683866, "t": 499.302451, "r": 175.895438, "b": 475.337871 }, "text": "Slope (ft/ft)", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p11.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 186.552062, "t": 499.302451, "r": 223.968178, "b": 475.337871 }, "text": "Velocity (ft/sec)", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p11.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 234.581918, "t": 499.302451, "r": 275.988028, "b": 475.337871 }, "text": "Capacity (cfs)", "attrs": { "row": 2, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 }, { "id": "p11.5.13", "order": 18, "type": "table_cell", "bbox": { "l": 159.377609, "t": 587.142469, "r": 212.780545, "b": 575.177889 }, "text": "Description", "attrs": { "row": 2, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 12 }, { "id": "p11.5.14", "order": 19, "type": "table_cell", "bbox": { "l": 74.639998, "t": 473.382452, "r": 89.475992, "b": 461.417872 }, "text": "1.2", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p11.5.15", "order": 20, "type": "table_cell", "bbox": { "l": 114.927527, "t": 473.382452, "r": 132.68142, "b": 461.417872 }, "text": "100", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p11.5.16", "order": 21, "type": "table_cell", "bbox": { "l": 143.445254, "t": 473.382452, "r": 175.863606, "b": 461.417872 }, "text": "0.0200", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p11.5.17", "order": 22, "type": "table_cell", "bbox": { "l": 203.137703, "t": 473.382452, "r": 223.870219, "b": 461.417872 }, "text": "1.42", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p11.5.18", "order": 23, "type": "table_cell", "bbox": { "l": 342.1371, "t": 488.4, "r": 414.4114, "b": 474.24 }, "text": "", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 17 }, { "id": "p11.5.19", "order": 24, "type": "table_cell", "bbox": { "l": 286.679993, "t": 473.26245, "r": 344.648169, "b": 461.29787 }, "text": "Sheet Flow,", "attrs": { "row": 3, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 18 }, { "id": "p11.5.20", "order": 25, "type": "table_cell", "bbox": { "l": 74.639998, "t": 449.382452, "r": 89.475992, "b": 437.417872 }, "text": "0.4", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p11.5.21", "order": 26, "type": "table_cell", "bbox": { "l": 120.82405, "t": 449.382452, "r": 132.68142, "b": 437.417872 }, "text": "95", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p11.5.22", "order": 27, "type": "table_cell", "bbox": { "l": 143.445254, "t": 449.382452, "r": 175.863606, "b": 437.417872 }, "text": "0.0475", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p11.5.23", "order": 28, "type": "table_cell", "bbox": { "l": 203.137703, "t": 449.382452, "r": 223.870219, "b": 437.417872 }, "text": "4.42", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 22 }, { "id": "p11.5.24", "order": 29, "type": "table_cell", "bbox": { "l": 342.1371, "t": 474.24, "r": 414.4114, "b": 460.08 }, "text": "", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 23 }, { "id": "p11.5.25", "order": 30, "type": "table_cell", "bbox": { "l": 286.679993, "t": 461.382452, "r": 473.002733, "b": 425.417872 }, "text": "Smooth surfaces\\nn= 0.011\\nP2= 3.42\"\nShallow Concentrated Flow,\nPaved Kv= 20.3 fps", "attrs": { "row": 4, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 24 }, { "id": "p11.5.26", "order": 31, "type": "table_cell", "bbox": { "l": 74.639998, "t": 423.462454, "r": 89.475992, "b": 411.497874 }, "text": "1.6", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 25 }, { "id": "p11.5.27", "order": 32, "type": "table_cell", "bbox": { "l": 125.3143, "t": 431.76, "r": 197.5886, "b": 417.6 }, "text": "105", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1 }, "reading_order": 26 }, { "id": "p11.5.28", "order": 33, "type": "table_cell", "bbox": { "l": 143.445254, "t": 423.462454, "r": 167.029543, "b": 411.497874 }, "text": "Total", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 27 }, { "id": "p11.5.29", "order": 34, "type": "table_cell", "bbox": { "l": 269.8629, "t": 431.76, "r": 342.1371, "b": 417.6 }, "text": "", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 28 }, { "id": "p11.5.30", "order": 35, "type": "table_cell", "bbox": { "l": 342.1371, "t": 431.76, "r": 414.4114, "b": 417.6 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 29 }, { "id": "p11.5.31", "order": 36, "type": "table_cell", "bbox": { "l": 414.4114, "t": 431.76, "r": 486.6857, "b": 417.6 }, "text": "", "attrs": { "row": 5, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 30 }, { "id": "p11.5.32", "order": 37, "type": "table_cell", "bbox": { "l": 486.6857, "t": 431.76, "r": 558.96, "b": 417.6 }, "text": "", "attrs": { "row": 5, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 31 } ], "reading_order": 4 }, { "id": "p11.6", "order": 38, "type": "text", "bbox": { "l": 72.48, "t": 423.84, "r": 168.96, "b": 411.12 }, "text": "1.6 195 Total", "reading_order": 5 }, { "id": "p11.7", "order": 39, "type": "caption", "bbox": { "l": 184.8, "t": 398.64, "r": 426.24, "b": 383.52 }, "text": "Subcatchment 124S: DA E3 (Impervious)", "attrs": { "block_label": "figure_title" }, "reading_order": 6 }, { "id": "p11.8", "order": 40, "type": "figure", "bbox": { "l": 62.64, "t": 377.28, "r": 535.2, "b": 114.96 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n0.9\n0.85 0.82 cfs\n0.8 NOAA 24-hr D\n0.75\n0.7 2-Year Rainfall=3.42\"\nRunoff Area=0.235 ac\n0.65\n0.6\n0.55 Runoff Volume=2,718 cf\n(cfs) Runoff Depth=3.19\"\n0.5\n0.45\nFlow 0.4 Flow Length=195'\nTc=1.6 min\n0.35\n0.3\n0.25 CN=98/98\n0.2\n0.15\n0.1\n0.05\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72" }, "reading_order": 7 }, { "id": "p11.9", "order": 41, "type": "footer", "bbox": { "l": 512.4, "t": 356.88, "r": 546.48, "b": 345.84 }, "text": "", "attrs": { "block_label": "footer_image" }, "reading_order": 8 }, { "id": "p11.10", "order": 42, "type": "footnote", "bbox": { "l": 88.8, "t": 130.32, "r": 492.48, "b": 112.32 }, "text": "0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72 Time (hours)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 9 } ] }, { "document_id": 16592, "page": 12, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 21, "counts_by_type": { "caption": 2, "figure": 1, "footer": 1, "footnote": 1, "header": 3, "table": 1, "table_cell": 9, "text": 2, "title": 1 }, "build_ms": 2, "items": [ { "id": "p12.1", "order": 1, "type": "header", "bbox": { "l": 367.44, "t": 738.96, "r": 560.88, "b": 713.28 }, "text": "NOAA 24-hr D 2-Year Rainfall=3.42\"\nPrinted 04/12/2025", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p12.2", "order": 2, "type": "header", "bbox": { "l": 52.8, "t": 737.76, "r": 399.84, "b": 699.12 }, "text": "102 Sams -REV 12-02-25\nPrepared by Haler Consulting\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p12.3", "order": 3, "type": "header", "bbox": { "l": 522.96, "t": 710.88, "r": 559.2, "b": 699.12 }, "text": "Page 6", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 2 }, { "id": "p12.4", "order": 4, "type": "title", "bbox": { "l": 166.56, "t": 687.36, "r": 445.2, "b": 672.24 }, "text": "Summary for Subcatchment 142S: DA E2 (Roof)", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 3 }, { "id": "p12.5", "order": 5, "type": "text", "bbox": { "l": 53.76, "t": 660.24, "r": 463.68, "b": 634.32 }, "text": "Runoff = 0.28 cfs @ 12.14 hrs, Volume= 1,239 cf, Depth= 3.19\"\nRouted to Link 141L : POA", "reading_order": 4 }, { "id": "p12.6", "order": 6, "type": "text", "bbox": { "l": 52.08, "t": 623.76, "r": 611.52, "b": 598.32 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious, Time Span= 0.00-72.00 hrs, dt= NOAA 24-hr D 2-Year Rainfall=3.42\"", "reading_order": 5 }, { "id": "p12.7", "order": 7, "type": "table", "bbox": { "l": 53.28, "t": 587.142469, "r": 559.44, "b": 497.29787 }, "text": "", "attrs": { "block_label": "table", "n_rows": 3, "n_cols": 3, "integrity": { "cells_checked": 9, "cells_flagged": 0 } }, "children": [ { "id": "p12.7.1", "order": 8, "type": "table_cell", "bbox": { "l": 86.520001, "t": 587.142469, "r": 127.590159, "b": 575.177889 }, "text": "Area (sf)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p12.7.2", "order": 9, "type": "table_cell", "bbox": { "l": 144.389888, "t": 587.142469, "r": 159.742288, "b": 575.177889 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p12.7.3", "order": 10, "type": "table_cell", "bbox": { "l": 286.601768, "t": 535.302451, "r": 340.102911, "b": 523.337871 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p12.7.4", "order": 11, "type": "table_cell", "bbox": { "l": 101.160004, "t": 573.222448, "r": 127.789043, "b": 547.337871 }, "text": "4,666\n4,666", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p12.7.5", "order": 12, "type": "table_cell", "bbox": { "l": 147.987313, "t": 573.222448, "r": 159.844683, "b": 547.337871 }, "text": "98\n98", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p12.7.6", "order": 13, "type": "table_cell", "bbox": { "l": 174.146431, "t": 573.222448, "r": 302.745943, "b": 547.337871 }, "text": "Unconnected roofs, HSG A\n100.00% Pervious Area", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p12.7.7", "order": 14, "type": "table_cell", "bbox": { "l": 65.040001, "t": 535.302451, "r": 89.475992, "b": 497.417872 }, "text": "Tc (min)\n6.0", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p12.7.8", "order": 15, "type": "table_cell", "bbox": { "l": 100.248415, "t": 535.302451, "r": 348.647167, "b": 497.29787 }, "text": "Length (feet)\nDirect Entry,", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 7 }, { "id": "p12.7.9", "order": 16, "type": "table_cell", "bbox": { "l": 148.683866, "t": 535.302451, "r": 275.988028, "b": 511.337871 }, "text": "Slope (ft/ft) Velocity (ft/sec) Capacity (cfs)", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 } ], "reading_order": 6 }, { "id": "p12.8", "order": 17, "type": "caption", "bbox": { "l": 205.68, "t": 484.8, "r": 405.84, "b": 469.92 }, "text": "Subcatchment 142S: DA E2 (Roof)", "attrs": { "block_label": "figure_title" }, "reading_order": 7 }, { "id": "p12.9", "order": 18, "type": "caption", "bbox": { "l": 254.88, "t": 464.4, "r": 305.52, "b": 453.6 }, "text": "Hydrograph", "attrs": { "block_label": "figure_title" }, "reading_order": 8 }, { "id": "p12.10", "order": 19, "type": "figure", "bbox": { "l": 63.84, "t": 462, "r": 497.76, "b": 203.52 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n0.3 0.28 cfs\nNOAA 24-hr D\n0.28\n0.26\n2-Year Rainfall=3.42\"\n0.24\n0.22 Runoff Area=4,666 sf\nRunoff Volume=1,239 cf\n0.2\n0.18\n(cfs) 0.16 Runoff Depth=3.19\"\nFlow 0.14 Tc=6.0 min\nCN=98/0\n0.12\n0.1\n0.08\n0.06\n0.04\n0.02\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72" }, "reading_order": 9 }, { "id": "p12.11", "order": 20, "type": "footnote", "bbox": { "l": 90.96, "t": 216.72, "r": 492, "b": 197.52 }, "text": "4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72 Time (hours)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 10 }, { "id": "p12.12", "order": 21, "type": "footer", "bbox": { "l": 509.76, "t": 443.28, "r": 547.68, "b": 430.8 }, "text": "", "attrs": { "block_label": "footer_image" }, "reading_order": 11 } ] }, { "document_id": 16592, "page": 13, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 8, "counts_by_type": { "caption": 1, "figure": 1, "header": 2, "heading": 1, "text": 3 }, "build_ms": 0, "items": [ { "id": "p13.1", "order": 1, "type": "header", "bbox": { "l": 367.2, "t": 738.96, "r": 560.88, "b": 711.6 }, "text": "NOAA 24-hr D 2-Year Rainfall=3.42\"\nPrinted 04/12/2025", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p13.2", "order": 2, "type": "header", "bbox": { "l": 53.04, "t": 738, "r": 394.8, "b": 699.12 }, "text": "102 Sams -REV 12-02-25\nPrepared by Haler Consulting\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p13.3", "order": 3, "type": "text", "bbox": { "l": 522.96, "t": 711.12, "r": 559.68, "b": 699.12 }, "text": "Page 7", "attrs": { "block_label": "number" }, "reading_order": 2 }, { "id": "p13.4", "order": 4, "type": "heading", "bbox": { "l": 220.8, "t": 687.6, "r": 392.16, "b": 672.48 }, "text": "Summary for Link 141L: POA", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 3 }, { "id": "p13.5", "order": 5, "type": "text", "bbox": { "l": 52.32, "t": 660, "r": 516, "b": 621.84 }, "text": "Inflow Area = 573,680 sf, 0.33% Impervious, Inflow Depth = 0.08\" for 2-Year event\nInflow = 1.08 cfs @ 12.10 hrs, Volume = 3,958 cf\nPrimary = 1.08 cfs @ 12.10 hrs, Volume = 3,958 cf, Atten = 0%, Lag = 0.0 min", "reading_order": 4 }, { "id": "p13.6", "order": 6, "type": "text", "bbox": { "l": 52.08, "t": 611.52, "r": 367.2, "b": 597.84 }, "text": "Primary outflow = Inflow, Time Span = 0.00-72.00 hrs, dt = 0.01 hrs", "reading_order": 5 }, { "id": "p13.7", "order": 7, "type": "caption", "bbox": { "l": 259.2, "t": 586.56, "r": 352.56, "b": 572.4 }, "text": "Link 141L: POA", "attrs": { "block_label": "figure_title" }, "reading_order": 6 }, { "id": "p13.8", "order": 8, "type": "figure", "bbox": { "l": 62.88, "t": 566.64, "r": 552.72, "b": 299.04 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nInflow\n1.08 cfs Primary\nInflow Area=573,680 sf\n1.08 cfs\n1\n(cfs)\nFlow\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72\nTime (hours)" }, "reading_order": 7 } ] }, { "document_id": 16592, "page": 14, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 2, "counts_by_type": { "footer": 1, "text": 1 }, "build_ms": 0, "items": [ { "id": "p14.1", "order": 1, "type": "text", "bbox": { "l": 49.68, "t": 691.2, "r": 560.64, "b": 471.36 }, "text": "Time span=0.00-72.00 hrs, dt=0.01 hrs, 7201 points\nRunoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious\nReach routing by Stor-Ind+Trans method - Pond routing by Stor-Ind method\nSubcatchment 118S: DA E1 (Pervious) Runoff Area=558,777 sf 0.00% Impervious Runoff Depth=0.02\"\nFlow Length=1,241' Tc=60.4 min CN=30/0 Runoff=0.04 cfs 985 cf\nSubcatchment 124S: DA E3 (Impervious) Runoff Area=0.235 ac 18.30% Impervious Runoff Depth=5.14\"\nFlow Length=195' Tc=1.6 min CN=98/98 Runoff=1.30 cfs 4,387 cf\nSubcatchment 142S: DA E2 (Roof) Runoff Area=4,666 sf 0.00% Impervious Runoff Depth=5.14\"\nTc=6.0 min CN=98/0 Runoff=0.45 cfs 2,000 cf\nLink 141L: POA\nInflow=1.71 cfs 7,372 cf\nPrimary=1.71 cfs 7,372 cf\nTotal Runoff Area = 573,680 sf Runoff Volume = 7,372 cf Average Runoff Depth = 0.15\"\n99.67% Pervious = 571,807 sf 0.33% Impervious = 1,873 sf", "attrs": { "block_label": "algorithm" }, "reading_order": 0 }, { "id": "p14.2", "order": 2, "type": "footer", "bbox": { "l": 48.48, "t": 739.44, "r": 558.96, "b": 700.08 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 10-Year Rainfall=5.38\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 8", "attrs": { "block_label": "footer" }, "reading_order": 1 } ] }, { "document_id": 16592, "page": 15, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 34, "counts_by_type": { "caption": 2, "figure": 1, "footer": 1, "footnote": 1, "header": 1, "table": 1, "table_cell": 23, "text": 3, "title": 1 }, "build_ms": 4, "items": [ { "id": "p15.1", "order": 1, "type": "header", "bbox": { "l": 53.28, "t": 738.48, "r": 560.64, "b": 698.64 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 10-Year Rainfall=5.38\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 9", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p15.2", "order": 2, "type": "title", "bbox": { "l": 155.04, "t": 687.6, "r": 457.44, "b": 672.24 }, "text": "Summary for Subcatchment 118S: DA E1 (Pervious)", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p15.3", "order": 3, "type": "text", "bbox": { "l": 54, "t": 660.24, "r": 463.44, "b": 634.56 }, "text": "Runoff = 0.04 cfs @ 24.15 hrs, Volume= 985 cf, Depth= 0.02\"\nRouted to Link 141L : POA", "reading_order": 2 }, { "id": "p15.4", "order": 4, "type": "text", "bbox": { "l": 52.08, "t": 623.76, "r": 611.28, "b": 598.32 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious, Time Span= 0.00-72.00 hrs, dt= NOAA 24-hr D 10-Year Rainfall=5.38\"", "reading_order": 3 }, { "id": "p15.5", "order": 5, "type": "table", "bbox": { "l": 52.56, "t": 588.72, "r": 558.96, "b": 447.497874 }, "text": "", "attrs": { "block_label": "table", "n_rows": 6, "n_cols": 5, "integrity": { "cells_checked": 21, "cells_flagged": 0 } }, "children": [ { "id": "p15.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 86.520001, "t": 587.142469, "r": 127.590159, "b": 575.177889 }, "text": "Area (sf)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p15.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 144.389888, "t": 587.142469, "r": 159.742288, "b": 575.177889 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p15.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 286.601768, "t": 535.302451, "r": 340.102911, "b": 523.337871 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p15.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 89.399998, "t": 559.302451, "r": 127.714872, "b": 547.337871 }, "text": "558,777", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 3 }, { "id": "p15.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 147.913142, "t": 559.302451, "r": 159.770513, "b": 547.337871 }, "text": "30", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p15.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 174.07226, "t": 573.222448, "r": 278.894506, "b": 561.257868 }, "text": "Woods, Good, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 5 }, { "id": "p15.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 89.399998, "t": 573.222448, "r": 127.714872, "b": 561.257868 }, "text": "558,777", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p15.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 147.913142, "t": 573.222448, "r": 159.770513, "b": 561.257868 }, "text": "30", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p15.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 174.07226, "t": 559.302451, "r": 286.016818, "b": 547.337871 }, "text": "100.00% Pervious Area", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 8 }, { "id": "p15.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 65.040001, "t": 535.302451, "r": 89.492517, "b": 497.417872 }, "text": "Tc (min)\n30.8", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 9 }, { "id": "p15.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 100.248415, "t": 535.302451, "r": 132.697945, "b": 497.417872 }, "text": "Length (feet)\n100", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 10 }, { "id": "p15.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 143.354569, "t": 535.302451, "r": 175.895438, "b": 497.417872 }, "text": "Slope (ft/ft)\n0.0075", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 11 }, { "id": "p15.5.13", "order": 18, "type": "table_cell", "bbox": { "l": 186.552062, "t": 535.302451, "r": 223.968178, "b": 497.417872 }, "text": "Velocity (ft/sec)\n0.05", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 12 }, { "id": "p15.5.14", "order": 19, "type": "table_cell", "bbox": { "l": 234.581918, "t": 535.302451, "r": 512.409343, "b": 461.417872 }, "text": "Capacity (cfs)\nSheet Flow,\\nWoods: Light underbrush n= 0.400 P2= 3.42\"\\nShallow Concentrated Flow,\\nWoodland Kv= 5.0 fps", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 13 }, { "id": "p15.5.15", "order": 20, "type": "table_cell", "bbox": { "l": 68.76, "t": 485.382452, "r": 89.492517, "b": 473.417872 }, "text": "29.6", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p15.5.16", "order": 21, "type": "table_cell", "bbox": { "l": 106.045663, "t": 485.382452, "r": 132.674702, "b": 473.417872 }, "text": "1,141", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p15.5.17", "order": 22, "type": "table_cell", "bbox": { "l": 143.438536, "t": 485.382452, "r": 175.856888, "b": 473.417872 }, "text": "0.0165", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p15.5.18", "order": 23, "type": "table_cell", "bbox": { "l": 203.130985, "t": 485.382452, "r": 223.863501, "b": 473.417872 }, "text": "0.64", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p15.5.19", "order": 24, "type": "table_cell", "bbox": { "l": 68.76, "t": 459.462454, "r": 89.492517, "b": 447.497874 }, "text": "60.4", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p15.5.20", "order": 25, "type": "table_cell", "bbox": { "l": 106.045663, "t": 459.462454, "r": 132.674702, "b": 447.497874 }, "text": "1,241", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p15.5.21", "order": 26, "type": "table_cell", "bbox": { "l": 143.438536, "t": 459.462454, "r": 167.022825, "b": 447.497874 }, "text": "Total", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p15.5.22", "order": 27, "type": "table_cell", "bbox": { "l": 356.4, "t": 471.6686, "r": 457.68, "b": 452.16 }, "text": "", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 21 }, { "id": "p15.5.23", "order": 28, "type": "table_cell", "bbox": { "l": 457.68, "t": 471.6686, "r": 558.96, "b": 452.16 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 22 } ], "reading_order": 4 }, { "id": "p15.6", "order": 29, "type": "caption", "bbox": { "l": 193.2, "t": 435.12, "r": 417.84, "b": 420 }, "text": "Subcatchment 118S: DA E1 (Pervious)", "attrs": { "block_label": "figure_title" }, "reading_order": 5 }, { "id": "p15.7", "order": 30, "type": "caption", "bbox": { "l": 254.4, "t": 414.48, "r": 306.24, "b": 404.16 }, "text": "Hydrograph", "attrs": { "block_label": "figure_title" }, "reading_order": 6 }, { "id": "p15.8", "order": 31, "type": "figure", "bbox": { "l": 64.32, "t": 411.12, "r": 496.8, "b": 148.56 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "0.048\n0.046 0.04 cfs\n0.042 NOAA 24-hr D\n0.044\n0.04\n0.038 10-Year Rainfall=5.38\"\n0.036\n0.034 Runoff Area=558,777 sf\n0.032\n0.03 Runoff Volume=985 cf\n0.028\n(cfs) 0.026 Runoff Depth=0.02\"\n0.024\nFlow 0.022 Flow Length=1,241'\n0.02\nTc=60.4 min\n0.018\n0.016\nCN=30/0\n0.014\n0.012\n0.01\n0.008\n0.006\n0.004\n0.002\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72\nTime (hours)" }, "reading_order": 7 }, { "id": "p15.9", "order": 32, "type": "text", "bbox": { "l": 269.76, "t": 155.76, "r": 317.76, "b": 146.88 }, "text": "Time (hours)", "attrs": { "block_label": "number" }, "reading_order": 8 }, { "id": "p15.10", "order": 33, "type": "footnote", "bbox": { "l": 64.08, "t": 459.36, "r": 168.72, "b": 447.12 }, "text": "60.4 1,241 Total", "attrs": { "block_label": "vision_footnote" }, "reading_order": 9 }, { "id": "p15.11", "order": 34, "type": "footer", "bbox": { "l": 511.68, "t": 392.64, "r": 546.24, "b": 381.36 }, "text": "", "attrs": { "block_label": "footer_image" }, "reading_order": 10 } ] }, { "document_id": 16592, "page": 16, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 41, "counts_by_type": { "caption": 1, "figure": 1, "footnote": 2, "header": 1, "table": 1, "table_cell": 32, "text": 2, "title": 1 }, "build_ms": 4, "items": [ { "id": "p16.1", "order": 1, "type": "header", "bbox": { "l": 53.28, "t": 738.48, "r": 560.88, "b": 698.64 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 10-Year Rainfall=5.38\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 10", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p16.2", "order": 2, "type": "title", "bbox": { "l": 146.88, "t": 687.6, "r": 465.36, "b": 672 }, "text": "Summary for Subcatchment 124S: DA E3 (Impervious)", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p16.3", "order": 3, "type": "text", "bbox": { "l": 52.8, "t": 660.24, "r": 463.44, "b": 634.56 }, "text": "Runoff = 1.30 cfs @ 12.10 hrs, Volume= 4,387 cf, Depth= 5.14\"\nRouted to Link 141L : POA", "reading_order": 2 }, { "id": "p16.4", "order": 4, "type": "text", "bbox": { "l": 52.08, "t": 623.76, "r": 611.28, "b": 598.32 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious, Time Span= 0.00-72.00 hrs, dt= NOAA 24-hr D 10-Year Rainfall=5.38\"", "reading_order": 3 }, { "id": "p16.5", "order": 5, "type": "table", "bbox": { "l": 53.04, "t": 588, "r": 559.2, "b": 411.497874 }, "text": "", "attrs": { "block_label": "table", "n_rows": 6, "n_cols": 7, "integrity": { "cells_checked": 25, "cells_flagged": 0 } }, "children": [ { "id": "p16.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 69, "t": 587.142469, "r": 112.857606, "b": 575.177889 }, "text": "Area (ac)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p16.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 129.550125, "t": 587.142469, "r": 145.032977, "b": 575.177889 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p16.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 286.601768, "t": 499.302451, "r": 340.102911, "b": 487.337871 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p16.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 53.04, "t": 573.72, "r": 125.3486, "b": 559.44 }, "text": "", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 3 }, { "id": "p16.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 86.399998, "t": 573.222448, "r": 113.029037, "b": 511.337871 }, "text": "0.192\n0.043\n0.235\n0.192\n0.043", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p16.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 133.227307, "t": 573.222448, "r": 145.084677, "b": 511.337871 }, "text": "98\n98\n98\n98\n98", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p16.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 159.386425, "t": 573.222448, "r": 310.746597, "b": 511.337871 }, "text": "Unconnected pavement, HSG A\nPaved parking, HSG A\nWeighted Average\n81.70% Pervious Area\n18.30% Impervious Area", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 4, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p16.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 65.040001, "t": 499.302451, "r": 89.40872, "b": 475.337871 }, "text": "Tc (min)", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p16.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 100.248415, "t": 499.302451, "r": 132.666767, "b": 475.337871 }, "text": "Length (feet)", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p16.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 148.683866, "t": 499.302451, "r": 175.895438, "b": 475.337871 }, "text": "Slope (ft/ft)", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p16.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 186.552062, "t": 499.302451, "r": 223.968178, "b": 475.337871 }, "text": "Velocity (ft/sec)", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p16.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 234.581918, "t": 499.302451, "r": 275.988028, "b": 475.337871 }, "text": "Capacity (cfs)", "attrs": { "row": 2, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 }, { "id": "p16.5.13", "order": 18, "type": "table_cell", "bbox": { "l": 159.377609, "t": 587.142469, "r": 212.780545, "b": 575.177889 }, "text": "Description", "attrs": { "row": 2, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 12 }, { "id": "p16.5.14", "order": 19, "type": "table_cell", "bbox": { "l": 74.639998, "t": 473.382452, "r": 89.475992, "b": 461.417872 }, "text": "1.2", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p16.5.15", "order": 20, "type": "table_cell", "bbox": { "l": 114.927527, "t": 473.382452, "r": 132.68142, "b": 461.417872 }, "text": "100", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p16.5.16", "order": 21, "type": "table_cell", "bbox": { "l": 143.445254, "t": 473.382452, "r": 175.863606, "b": 461.417872 }, "text": "0.0200", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p16.5.17", "order": 22, "type": "table_cell", "bbox": { "l": 203.137703, "t": 473.382452, "r": 223.870219, "b": 461.417872 }, "text": "1.42", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p16.5.18", "order": 23, "type": "table_cell", "bbox": { "l": 342.2743, "t": 488.04, "r": 414.5829, "b": 473.76 }, "text": "", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 17 }, { "id": "p16.5.19", "order": 24, "type": "table_cell", "bbox": { "l": 286.679993, "t": 473.26245, "r": 344.648169, "b": 461.29787 }, "text": "Sheet Flow,", "attrs": { "row": 3, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 18 }, { "id": "p16.5.20", "order": 25, "type": "table_cell", "bbox": { "l": 74.639998, "t": 449.382452, "r": 89.475992, "b": 437.417872 }, "text": "0.4", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p16.5.21", "order": 26, "type": "table_cell", "bbox": { "l": 120.82405, "t": 449.382452, "r": 132.68142, "b": 437.417872 }, "text": "95", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p16.5.22", "order": 27, "type": "table_cell", "bbox": { "l": 143.445254, "t": 449.382452, "r": 175.863606, "b": 437.417872 }, "text": "0.0475", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p16.5.23", "order": 28, "type": "table_cell", "bbox": { "l": 203.137703, "t": 449.382452, "r": 223.870219, "b": 437.417872 }, "text": "4.42", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 22 }, { "id": "p16.5.24", "order": 29, "type": "table_cell", "bbox": { "l": 342.2743, "t": 473.76, "r": 414.5829, "b": 459.48 }, "text": "", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 23 }, { "id": "p16.5.25", "order": 30, "type": "table_cell", "bbox": { "l": 286.679993, "t": 461.382452, "r": 473.002733, "b": 425.417872 }, "text": "Smooth surfaces\\nn= 0.011 P2= 3.42\"\nShallow Concentrated Flow,\nPaved Kv= 20.3 fps", "attrs": { "row": 4, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 24 }, { "id": "p16.5.26", "order": 31, "type": "table_cell", "bbox": { "l": 74.639998, "t": 423.462454, "r": 89.475992, "b": 411.497874 }, "text": "1.6", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 25 }, { "id": "p16.5.27", "order": 32, "type": "table_cell", "bbox": { "l": 114.927527, "t": 423.462454, "r": 132.68142, "b": 411.497874 }, "text": "195", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 26 }, { "id": "p16.5.28", "order": 33, "type": "table_cell", "bbox": { "l": 143.445254, "t": 423.462454, "r": 167.029543, "b": 411.497874 }, "text": "Total", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 27 }, { "id": "p16.5.29", "order": 34, "type": "table_cell", "bbox": { "l": 269.9657, "t": 430.92, "r": 342.2743, "b": 416.64 }, "text": "", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 28 }, { "id": "p16.5.30", "order": 35, "type": "table_cell", "bbox": { "l": 342.2743, "t": 430.92, "r": 414.5829, "b": 416.64 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 29 }, { "id": "p16.5.31", "order": 36, "type": "table_cell", "bbox": { "l": 414.5829, "t": 430.92, "r": 486.8914, "b": 416.64 }, "text": "", "attrs": { "row": 5, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 30 }, { "id": "p16.5.32", "order": 37, "type": "table_cell", "bbox": { "l": 486.8914, "t": 430.92, "r": 559.2, "b": 416.64 }, "text": "", "attrs": { "row": 5, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 31 } ], "reading_order": 4 }, { "id": "p16.6", "order": 38, "type": "caption", "bbox": { "l": 184.8, "t": 398.64, "r": 426, "b": 383.52 }, "text": "Subcatchment 124S: DA E3 (Impervious)", "attrs": { "block_label": "figure_title" }, "reading_order": 5 }, { "id": "p16.7", "order": 39, "type": "figure", "bbox": { "l": 60.96, "t": 377.28, "r": 551.76, "b": 116.4 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nRunoff\n1.30 cfs\nNOAA 24-hr D\n10-Year Rainfall=5.38\"\n1 Runoff Area=0.235 ac\nRunoff Volume=4,387 cf\n(cfs) Runoff Depth=5.14\"\nFlow Flow Length=195'\nTc=1.6 min\nCN=98/98\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72" }, "reading_order": 6 }, { "id": "p16.8", "order": 40, "type": "footnote", "bbox": { "l": 72.24, "t": 424.08, "r": 168.96, "b": 411.12 }, "text": "1.6 195 Total", "attrs": { "block_label": "vision_footnote" }, "reading_order": 7 }, { "id": "p16.9", "order": 41, "type": "footnote", "bbox": { "l": 86.16, "t": 130.32, "r": 492.72, "b": 112.08 }, "text": "0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72 Time (hours)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 8 } ] }, { "document_id": 16592, "page": 17, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 21, "counts_by_type": { "caption": 2, "figure": 1, "footer": 1, "footnote": 1, "header": 2, "table": 1, "table_cell": 9, "text": 3, "title": 1 }, "build_ms": 2, "items": [ { "id": "p17.1", "order": 1, "type": "header", "bbox": { "l": 361.2, "t": 739.2, "r": 560.88, "b": 713.04 }, "text": "NOAA 24-hr D 10-Year Rainfall=5.38\"\nPrinted 04/12/2025", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p17.2", "order": 2, "type": "header", "bbox": { "l": 51.6, "t": 737.52, "r": 395.28, "b": 699.36 }, "text": "102 Sams -REV 12-02-25\nPrepared by Haler Consulting\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p17.3", "order": 3, "type": "text", "bbox": { "l": 517.2, "t": 710.88, "r": 558.48, "b": 699.12 }, "text": "Page 11", "attrs": { "block_label": "number" }, "reading_order": 2 }, { "id": "p17.4", "order": 4, "type": "title", "bbox": { "l": 166.56, "t": 687.36, "r": 445.2, "b": 672.24 }, "text": "Summary for Subcatchment 142S: DA E2 (Roof)", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 3 }, { "id": "p17.5", "order": 5, "type": "text", "bbox": { "l": 54, "t": 660.24, "r": 463.68, "b": 634.32 }, "text": "Runoff = 0.45 cfs @ 12.14 hrs, Volume= 2,000 cf, Depth= 5.14\"\nRouted to Link 141L : POA", "reading_order": 4 }, { "id": "p17.6", "order": 6, "type": "text", "bbox": { "l": 52.08, "t": 623.76, "r": 611.52, "b": 598.32 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious, Time Span= 0.00-72.00 hrs, dt= NOAA 24-hr D 10-Year Rainfall=5.38\"", "reading_order": 5 }, { "id": "p17.7", "order": 7, "type": "table", "bbox": { "l": 53.28, "t": 587.28, "r": 559.68, "b": 497.29787 }, "text": "", "attrs": { "block_label": "table", "n_rows": 3, "n_cols": 3, "integrity": { "cells_checked": 9, "cells_flagged": 0 } }, "children": [ { "id": "p17.7.1", "order": 8, "type": "table_cell", "bbox": { "l": 86.520001, "t": 587.142469, "r": 127.590159, "b": 575.177889 }, "text": "Area (sf)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p17.7.2", "order": 9, "type": "table_cell", "bbox": { "l": 144.389888, "t": 587.142469, "r": 159.742288, "b": 575.177889 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p17.7.3", "order": 10, "type": "table_cell", "bbox": { "l": 286.601768, "t": 535.302451, "r": 340.102911, "b": 523.337871 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p17.7.4", "order": 11, "type": "table_cell", "bbox": { "l": 101.160004, "t": 573.222448, "r": 127.789043, "b": 547.337871 }, "text": "4,666\n4,666", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p17.7.5", "order": 12, "type": "table_cell", "bbox": { "l": 147.987313, "t": 573.222448, "r": 159.844683, "b": 547.337871 }, "text": "98\n98", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p17.7.6", "order": 13, "type": "table_cell", "bbox": { "l": 174.146431, "t": 573.222448, "r": 302.745943, "b": 547.337871 }, "text": "Unconnected roofs, HSG A\n100.00% Pervious Area", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p17.7.7", "order": 14, "type": "table_cell", "bbox": { "l": 65.040001, "t": 535.302451, "r": 89.475992, "b": 497.417872 }, "text": "Tc (min)\n6.0", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p17.7.8", "order": 15, "type": "table_cell", "bbox": { "l": 100.248415, "t": 535.302451, "r": 348.647167, "b": 497.29787 }, "text": "Length (feet)\nDirect Entry,", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 7 }, { "id": "p17.7.9", "order": 16, "type": "table_cell", "bbox": { "l": 148.683866, "t": 535.302451, "r": 275.988028, "b": 511.337871 }, "text": "Slope (ft/ft) Velocity (ft/sec) Capacity (cfs)", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 } ], "reading_order": 6 }, { "id": "p17.8", "order": 17, "type": "caption", "bbox": { "l": 205.44, "t": 484.8, "r": 405.84, "b": 469.92 }, "text": "Subcatchment 142S: DA E2 (Roof)", "attrs": { "block_label": "figure_title" }, "reading_order": 7 }, { "id": "p17.9", "order": 18, "type": "caption", "bbox": { "l": 255.12, "t": 464.4, "r": 305.52, "b": 453.6 }, "text": "Hydrograph", "attrs": { "block_label": "figure_title" }, "reading_order": 8 }, { "id": "p17.10", "order": 19, "type": "figure", "bbox": { "l": 63.36, "t": 462.72, "r": 496.8, "b": 204 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n0.5\n0.48\n0.46 0.45 cfs\nNOAA 24-hr D\n0.44\n0.42\n10-Year Rainfall=5.38\"\n0.4\n0.38\n0.34 Runoff Area=4,666 sf\n0.36\n0.3 Runoff Volume=2,000 cf\n0.32\n(cfs) 0.26 Runoff Depth=5.14\"\n0.28\n0.24\nFlow 0.22 Tc=6.0 min\n0.2\n0.18 CN=98/0\n0.16\n0.14\n0.12\n0.1\n0.08\n0.06\n0.04\n0.02\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72" }, "reading_order": 9 }, { "id": "p17.11", "order": 20, "type": "footnote", "bbox": { "l": 91.68, "t": 216.48, "r": 492.72, "b": 197.76 }, "text": "4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72 Time (hours)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 10 }, { "id": "p17.12", "order": 21, "type": "footer", "bbox": { "l": 510, "t": 443.28, "r": 547.44, "b": 431.04 }, "text": "", "attrs": { "block_label": "footer_image" }, "reading_order": 11 } ] }, { "document_id": 16592, "page": 18, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 8, "counts_by_type": { "caption": 1, "figure": 1, "header": 2, "heading": 1, "text": 3 }, "build_ms": 0, "items": [ { "id": "p18.1", "order": 1, "type": "header", "bbox": { "l": 360.72, "t": 738.96, "r": 561.12, "b": 710.88 }, "text": "NOAA 24-hr D 10-Year Rainfall=5.38\"\nPrinted 04/12/2025", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p18.2", "order": 2, "type": "header", "bbox": { "l": 53.04, "t": 738, "r": 394.08, "b": 699.36 }, "text": "102 Sams -REV 12-02-25 NOAA\nPrepared by Haler Consulting\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p18.3", "order": 3, "type": "text", "bbox": { "l": 516.96, "t": 711.12, "r": 559.44, "b": 699.12 }, "text": "Page 12", "attrs": { "block_label": "number" }, "reading_order": 2 }, { "id": "p18.4", "order": 4, "type": "heading", "bbox": { "l": 220.8, "t": 687.6, "r": 392.4, "b": 672.48 }, "text": "Summary for Link 141L: POA", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 3 }, { "id": "p18.5", "order": 5, "type": "text", "bbox": { "l": 52.08, "t": 660.24, "r": 517.92, "b": 621.6 }, "text": "Inflow Area = 573,680 sf, 0.33% Impervious, Inflow Depth = 0.15\" for 10-Year event\nInflow = 1.71 cfs @ 12.10 hrs, Volume = 7,372 cf\nPrimary = 1.71 cfs @ 12.10 hrs, Volume = 7,372 cf, Atten = 0%, Lag = 0.0 min", "reading_order": 4 }, { "id": "p18.6", "order": 6, "type": "text", "bbox": { "l": 52.08, "t": 611.52, "r": 367.2, "b": 597.84 }, "text": "Primary outflow = Inflow, Time Span = 0.00-72.00 hrs, dt = 0.01 hrs", "reading_order": 5 }, { "id": "p18.7", "order": 7, "type": "caption", "bbox": { "l": 258.96, "t": 586.56, "r": 352.8, "b": 572.4 }, "text": "Link 141L: POA", "attrs": { "block_label": "figure_title" }, "reading_order": 6 }, { "id": "p18.8", "order": 8, "type": "figure", "bbox": { "l": 61.92, "t": 570, "r": 552.96, "b": 298.32 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nInflow\n1.71 cfs Primary\nInflow Area=573,680 sf\n1.71 cfs\n(cfs) 1\nFlow\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72\nTime (hours)" }, "reading_order": 7 } ] }, { "document_id": 16592, "page": 19, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 2, "counts_by_type": { "footer": 1, "text": 1 }, "build_ms": 0, "items": [ { "id": "p19.1", "order": 1, "type": "text", "bbox": { "l": 49.92, "t": 690.72, "r": 561.6, "b": 471.36 }, "text": "Time span=0.00-72.00 hrs, dt=0.01 hrs, 7201 points\nRunoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious\nReach routing by Stor-Ind+Trans method - Pond routing by Stor-Ind method\nSubcatchment 118S: DA E1 (Pervious) Runoff Area=558,777 sf 0.00% Impervious Runoff Depth=0.82\"\nFlow Length=1,241' Tc=60.4 min CN=30/0 Runoff=1.56 cfs 38,329 cf\nSubcatchment 124S: DA E3 (Impervious) Runoff Area=0.235 ac 18.30% Impervious Runoff Depth=9.24\"\nFlow Length=195' Tc=1.6 min CN=98/98 Runoff=2.30 cfs 7,882 cf\nSubcatchment 142S: DA E2 (Roof) Runoff Area=4,666 sf 0.00% Impervious Runoff Depth=9.24\"\nTc=6.0 min CN=98/0 Runoff=0.79 cfs 3,593 cf\nLink 141L: POA\nInflow=3.02 cfs 49,803 cf\nPrimary=3.02 cfs 49,803 cf\nTotal Runoff Area = 573,680 sf Runoff Volume = 49,803 cf Average Runoff Depth = 1.04\"\n99.67% Pervious = 571,807 sf 0.33% Impervious = 1,873 sf", "attrs": { "block_label": "algorithm" }, "reading_order": 0 }, { "id": "p19.2", "order": 2, "type": "footer", "bbox": { "l": 50.4, "t": 739.68, "r": 558.72, "b": 700.32 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 100-Year Rainfall=9.48\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 13", "attrs": { "block_label": "footer" }, "reading_order": 1 } ] }, { "document_id": 16592, "page": 20, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 33, "counts_by_type": { "caption": 1, "figure": 1, "footnote": 1, "header": 3, "table": 1, "table_cell": 23, "text": 2, "title": 1 }, "build_ms": 3, "items": [ { "id": "p20.1", "order": 1, "type": "header", "bbox": { "l": 355.2, "t": 739.2, "r": 560.64, "b": 713.04 }, "text": "NOAA 24-hr D 100-Year Rainfall=9.48\"\nPrinted 04/12/2025", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p20.2", "order": 2, "type": "header", "bbox": { "l": 51.6, "t": 737.76, "r": 392.16, "b": 699.36 }, "text": "102 Sams -REV 12-02-25 NOAA\nPrepared by Haler Consulting\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p20.3", "order": 3, "type": "header", "bbox": { "l": 515.52, "t": 714, "r": 559.92, "b": 700.08 }, "text": "Page 14", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 2 }, { "id": "p20.4", "order": 4, "type": "title", "bbox": { "l": 154.8, "t": 687.6, "r": 457.44, "b": 672.24 }, "text": "Summary for Subcatchment 118S: DA E1 (Pervious)", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 3 }, { "id": "p20.5", "order": 5, "type": "text", "bbox": { "l": 53.76, "t": 660.48, "r": 463.2, "b": 634.56 }, "text": "Runoff = 1.56 cfs @ 13.82 hrs, Volume= 38,329 cf, Depth= 0.82\"\nRouted to Link 141L : POA", "reading_order": 4 }, { "id": "p20.6", "order": 6, "type": "text", "bbox": { "l": 52.08, "t": 623.76, "r": 611.52, "b": 598.32 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious, Time Span= 0.00-72.00 hrs, dt= NOAA 24-hr D 100-Year Rainfall=9.48\"", "reading_order": 5 }, { "id": "p20.7", "order": 7, "type": "table", "bbox": { "l": 52.56, "t": 588.96, "r": 558.96, "b": 447.497874 }, "text": "", "attrs": { "block_label": "table", "n_rows": 6, "n_cols": 5, "integrity": { "cells_checked": 21, "cells_flagged": 0 } }, "children": [ { "id": "p20.7.1", "order": 8, "type": "table_cell", "bbox": { "l": 86.520001, "t": 587.142469, "r": 127.590159, "b": 575.177889 }, "text": "Area (sf)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p20.7.2", "order": 9, "type": "table_cell", "bbox": { "l": 144.389888, "t": 587.142469, "r": 159.742288, "b": 575.177889 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p20.7.3", "order": 10, "type": "table_cell", "bbox": { "l": 286.601768, "t": 535.302451, "r": 340.102911, "b": 523.337871 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p20.7.4", "order": 11, "type": "table_cell", "bbox": { "l": 89.399998, "t": 559.302451, "r": 127.714872, "b": 547.337871 }, "text": "558,777", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 3 }, { "id": "p20.7.5", "order": 12, "type": "table_cell", "bbox": { "l": 147.913142, "t": 559.302451, "r": 159.770513, "b": 547.337871 }, "text": "30", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p20.7.6", "order": 13, "type": "table_cell", "bbox": { "l": 174.07226, "t": 573.222448, "r": 278.894506, "b": 561.257868 }, "text": "Woods, Good, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 5 }, { "id": "p20.7.7", "order": 14, "type": "table_cell", "bbox": { "l": 89.399998, "t": 573.222448, "r": 127.714872, "b": 561.257868 }, "text": "558,777", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p20.7.8", "order": 15, "type": "table_cell", "bbox": { "l": 147.913142, "t": 573.222448, "r": 159.770513, "b": 561.257868 }, "text": "30", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p20.7.9", "order": 16, "type": "table_cell", "bbox": { "l": 174.07226, "t": 559.302451, "r": 286.016818, "b": 547.337871 }, "text": "100.00% Pervious Area", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 8 }, { "id": "p20.7.10", "order": 17, "type": "table_cell", "bbox": { "l": 65.040001, "t": 535.302451, "r": 89.492517, "b": 497.417872 }, "text": "Tc (min)\n30.8", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 9 }, { "id": "p20.7.11", "order": 18, "type": "table_cell", "bbox": { "l": 100.248415, "t": 535.302451, "r": 132.697945, "b": 497.417872 }, "text": "Length (feet)\n100", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 10 }, { "id": "p20.7.12", "order": 19, "type": "table_cell", "bbox": { "l": 143.354569, "t": 535.302451, "r": 175.895438, "b": 497.417872 }, "text": "Slope (ft/ft)\n0.0075", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 11 }, { "id": "p20.7.13", "order": 20, "type": "table_cell", "bbox": { "l": 186.552062, "t": 535.302451, "r": 223.968178, "b": 497.417872 }, "text": "Velocity (ft/sec)\n0.05", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 12 }, { "id": "p20.7.14", "order": 21, "type": "table_cell", "bbox": { "l": 234.581918, "t": 535.302451, "r": 512.409343, "b": 461.417872 }, "text": "Capacity (cfs)\nSheet Flow,\\nWoods: Light underbrush n= 0.400 P2= 3.42\"\\nShallow Concentrated Flow,\\nWoodland Kv= 5.0 fps", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 13 }, { "id": "p20.7.15", "order": 22, "type": "table_cell", "bbox": { "l": 68.76, "t": 485.382452, "r": 89.492517, "b": 473.417872 }, "text": "29.6", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p20.7.16", "order": 23, "type": "table_cell", "bbox": { "l": 106.045663, "t": 485.382452, "r": 132.674702, "b": 473.417872 }, "text": "1,141", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p20.7.17", "order": 24, "type": "table_cell", "bbox": { "l": 143.438536, "t": 485.382452, "r": 175.856888, "b": 473.417872 }, "text": "0.0165", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p20.7.18", "order": 25, "type": "table_cell", "bbox": { "l": 203.130985, "t": 485.382452, "r": 223.863501, "b": 473.417872 }, "text": "0.64", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p20.7.19", "order": 26, "type": "table_cell", "bbox": { "l": 68.76, "t": 459.462454, "r": 89.492517, "b": 447.497874 }, "text": "60.4", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p20.7.20", "order": 27, "type": "table_cell", "bbox": { "l": 106.045663, "t": 459.462454, "r": 132.674702, "b": 447.497874 }, "text": "1.241", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p20.7.21", "order": 28, "type": "table_cell", "bbox": { "l": 143.438536, "t": 459.462454, "r": 167.022825, "b": 447.497874 }, "text": "Total", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p20.7.22", "order": 29, "type": "table_cell", "bbox": { "l": 356.4, "t": 471.0857, "r": 457.68, "b": 451.44 }, "text": "", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 21 }, { "id": "p20.7.23", "order": 30, "type": "table_cell", "bbox": { "l": 457.68, "t": 471.0857, "r": 558.96, "b": 451.44 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 22 } ], "reading_order": 6 }, { "id": "p20.8", "order": 31, "type": "caption", "bbox": { "l": 193.2, "t": 435.12, "r": 417.84, "b": 420 }, "text": "Subcatchment 118S: DA E1 (Pervious)", "attrs": { "block_label": "figure_title" }, "reading_order": 7 }, { "id": "p20.9", "order": 32, "type": "figure", "bbox": { "l": 59.52, "t": 414.48, "r": 550.56, "b": 149.52 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nRunoff\n1.56 cfs\nNOAA 24-hr D\n100-Year Rainfall=9.48\"\nRunoff Area=558,777 sf\nRunoff Volume=38,329 cf\n1\n(cfs) Runoff Depth=0.82\"\nFlow Flow Length=1,241'\nTc=60.4 min\nCN=30/0\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72\nTime (hours)" }, "reading_order": 8 }, { "id": "p20.10", "order": 33, "type": "footnote", "bbox": { "l": 63.6, "t": 459.6, "r": 168.72, "b": 446.88 }, "text": "60.4 1,241 Total", "attrs": { "block_label": "vision_footnote" }, "reading_order": 9 } ] }, { "document_id": 16592, "page": 21, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 49, "counts_by_type": { "caption": 1, "figure": 1, "footnote": 2, "header": 1, "table": 1, "table_cell": 40, "text": 2, "title": 1 }, "build_ms": 5, "items": [ { "id": "p21.1", "order": 1, "type": "header", "bbox": { "l": 53.28, "t": 738.48, "r": 560.64, "b": 698.64 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 100-Year Rainfall=9.48\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 15", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p21.2", "order": 2, "type": "title", "bbox": { "l": 146.88, "t": 687.6, "r": 465.36, "b": 672 }, "text": "Summary for Subcatchment 124S: DA E3 (Impervious)", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p21.3", "order": 3, "type": "text", "bbox": { "l": 52.8, "t": 660.48, "r": 463.2, "b": 634.56 }, "text": "Runoff = 2.30 cfs @ 12.10 hrs, Volume= 7,882 cf, Depth= 9.24\"\nRouted to Link 141L : POA", "reading_order": 2 }, { "id": "p21.4", "order": 4, "type": "text", "bbox": { "l": 52.08, "t": 623.76, "r": 611.52, "b": 598.32 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious, Time Span= 0.00-72.00 hrs, dt= NOAA 24-hr D 100-Year Rainfall=9.48\"", "reading_order": 3 }, { "id": "p21.5", "order": 5, "type": "table", "bbox": { "l": 53.04, "t": 588, "r": 559.2, "b": 411.497874 }, "text": "", "attrs": { "block_label": "table", "n_rows": 8, "n_cols": 7, "integrity": { "cells_checked": 31, "cells_flagged": 0 } }, "children": [ { "id": "p21.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 69, "t": 587.142469, "r": 112.857606, "b": 575.177889 }, "text": "Area (ac)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p21.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 129.550125, "t": 587.142469, "r": 145.032977, "b": 575.177889 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p21.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 286.601768, "t": 499.302451, "r": 340.102911, "b": 487.337871 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p21.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 53.04, "t": 572.4218, "r": 125.3486, "b": 556.8436 }, "text": "", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 3 }, { "id": "p21.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 86.399998, "t": 573.222448, "r": 113.029037, "b": 549.257868 }, "text": "0.192\n0.043", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p21.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 133.227307, "t": 573.222448, "r": 145.084677, "b": 549.257868 }, "text": "98\n98", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p21.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 159.386425, "t": 573.222448, "r": 310.746597, "b": 549.257868 }, "text": "Unconnected pavement, HSG A\nPaved parking, HSG A", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 4, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p21.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 53.04, "t": 541.2655, "r": 125.3486, "b": 525.6873 }, "text": "", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 7 }, { "id": "p21.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 86.399998, "t": 547.302451, "r": 113.029037, "b": 523.337871 }, "text": "0.235\n0.192", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 8 }, { "id": "p21.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 133.227307, "t": 535.302451, "r": 145.084677, "b": 511.337871 }, "text": "98\n98", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 9 }, { "id": "p21.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 159.386425, "t": 547.302451, "r": 265.350494, "b": 523.337871 }, "text": "Weighted Average\n81.70% Pervious Area", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 4, "bbox_refit": true, "merged_continuation": true }, "reading_order": 10 }, { "id": "p21.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 53.04, "t": 510.1091, "r": 125.3486, "b": 494.5309 }, "text": "", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 11 }, { "id": "p21.5.13", "order": 18, "type": "table_cell", "bbox": { "l": 86.399998, "t": 523.302451, "r": 113.029037, "b": 511.337871 }, "text": "0.043", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 12 }, { "id": "p21.5.14", "order": 19, "type": "table_cell", "bbox": { "l": 133.227307, "t": 547.302451, "r": 145.084677, "b": 535.337871 }, "text": "98", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p21.5.15", "order": 20, "type": "table_cell", "bbox": { "l": 159.386425, "t": 523.302451, "r": 275.940991, "b": 511.337871 }, "text": "18.30% Impervious Area", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 4, "bbox_refit": true }, "reading_order": 14 }, { "id": "p21.5.16", "order": 21, "type": "table_cell", "bbox": { "l": 65.040001, "t": 499.302451, "r": 89.40872, "b": 475.337871 }, "text": "Tc (min)", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p21.5.17", "order": 22, "type": "table_cell", "bbox": { "l": 100.248415, "t": 499.302451, "r": 132.666767, "b": 475.337871 }, "text": "Length (feet)", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p21.5.18", "order": 23, "type": "table_cell", "bbox": { "l": 148.683866, "t": 499.302451, "r": 175.895438, "b": 475.337871 }, "text": "Slope (ft/ft)", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p21.5.19", "order": 24, "type": "table_cell", "bbox": { "l": 186.552062, "t": 499.302451, "r": 223.968178, "b": 475.337871 }, "text": "Velocity (ft/sec)", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p21.5.20", "order": 25, "type": "table_cell", "bbox": { "l": 234.581918, "t": 499.302451, "r": 275.988028, "b": 475.337871 }, "text": "Capacity (cfs)", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p21.5.21", "order": 26, "type": "table_cell", "bbox": { "l": 159.377609, "t": 587.142469, "r": 212.780545, "b": 575.177889 }, "text": "Description", "attrs": { "row": 4, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 20 }, { "id": "p21.5.22", "order": 27, "type": "table_cell", "bbox": { "l": 74.639998, "t": 473.382452, "r": 89.475992, "b": 461.417872 }, "text": "1.2", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p21.5.23", "order": 28, "type": "table_cell", "bbox": { "l": 114.927527, "t": 473.382452, "r": 132.68142, "b": 461.417872 }, "text": "100", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 22 }, { "id": "p21.5.24", "order": 29, "type": "table_cell", "bbox": { "l": 143.445254, "t": 473.382452, "r": 175.863606, "b": 461.417872 }, "text": "0.0200", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 23 }, { "id": "p21.5.25", "order": 30, "type": "table_cell", "bbox": { "l": 203.137703, "t": 473.382452, "r": 223.870219, "b": 461.417872 }, "text": "1.42", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 24 }, { "id": "p21.5.26", "order": 31, "type": "table_cell", "bbox": { "l": 342.2743, "t": 478.9527, "r": 414.5829, "b": 463.3745 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 25 }, { "id": "p21.5.27", "order": 32, "type": "table_cell", "bbox": { "l": 286.679993, "t": 473.26245, "r": 344.648169, "b": 461.29787 }, "text": "Sheet Flow,", "attrs": { "row": 5, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 26 }, { "id": "p21.5.28", "order": 33, "type": "table_cell", "bbox": { "l": 74.639998, "t": 449.382452, "r": 89.475992, "b": 437.417872 }, "text": "0.4", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 27 }, { "id": "p21.5.29", "order": 34, "type": "table_cell", "bbox": { "l": 120.82405, "t": 449.382452, "r": 132.68142, "b": 437.417872 }, "text": "95", "attrs": { "row": 6, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 28 }, { "id": "p21.5.30", "order": 35, "type": "table_cell", "bbox": { "l": 143.445254, "t": 449.382452, "r": 175.863606, "b": 437.417872 }, "text": "0.0475", "attrs": { "row": 6, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 29 }, { "id": "p21.5.31", "order": 36, "type": "table_cell", "bbox": { "l": 203.137703, "t": 449.382452, "r": 223.870219, "b": 437.417872 }, "text": "4.42", "attrs": { "row": 6, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 30 }, { "id": "p21.5.32", "order": 37, "type": "table_cell", "bbox": { "l": 342.2743, "t": 463.3745, "r": 414.5829, "b": 447.7964 }, "text": "", "attrs": { "row": 6, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 31 }, { "id": "p21.5.33", "order": 38, "type": "table_cell", "bbox": { "l": 286.679993, "t": 461.382452, "r": 473.002733, "b": 425.417872 }, "text": "Smooth surfaces\\nn= 0.011\\nP2= 3.42\"\nShallow Concentrated Flow,\\nPaved Kv= 20.3 fps", "attrs": { "row": 6, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 32 }, { "id": "p21.5.34", "order": 39, "type": "table_cell", "bbox": { "l": 74.639998, "t": 423.462454, "r": 89.475992, "b": 411.497874 }, "text": "1.6", "attrs": { "row": 7, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 33 }, { "id": "p21.5.35", "order": 40, "type": "table_cell", "bbox": { "l": 114.927527, "t": 423.462454, "r": 132.68142, "b": 411.497874 }, "text": "195", "attrs": { "row": 7, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 34 }, { "id": "p21.5.36", "order": 41, "type": "table_cell", "bbox": { "l": 143.445254, "t": 423.462454, "r": 167.029543, "b": 411.497874 }, "text": "Total", "attrs": { "row": 7, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 35 }, { "id": "p21.5.37", "order": 42, "type": "table_cell", "bbox": { "l": 269.9657, "t": 432.2182, "r": 342.2743, "b": 416.64 }, "text": "", "attrs": { "row": 7, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 36 }, { "id": "p21.5.38", "order": 43, "type": "table_cell", "bbox": { "l": 342.2743, "t": 432.2182, "r": 414.5829, "b": 416.64 }, "text": "", "attrs": { "row": 7, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 37 }, { "id": "p21.5.39", "order": 44, "type": "table_cell", "bbox": { "l": 414.5829, "t": 432.2182, "r": 486.8914, "b": 416.64 }, "text": "", "attrs": { "row": 7, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 38 }, { "id": "p21.5.40", "order": 45, "type": "table_cell", "bbox": { "l": 486.8914, "t": 432.2182, "r": 559.2, "b": 416.64 }, "text": "", "attrs": { "row": 7, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 39 } ], "reading_order": 4 }, { "id": "p21.6", "order": 46, "type": "caption", "bbox": { "l": 184.8, "t": 398.64, "r": 426, "b": 383.52 }, "text": "Subcatchment 124S: DA E3 (Impervious)", "attrs": { "block_label": "figure_title" }, "reading_order": 5 }, { "id": "p21.7", "order": 47, "type": "figure", "bbox": { "l": 61.2, "t": 377.04, "r": 551.52, "b": 116.16 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nRunoff\n2.30 cfs\nNOAA 24-hr D\n2 100-Year Rainfall=9.48\"\nRunoff Area=0.235 ac\nRunoff Volume=7,882 cf\n(cfs) Runoff Depth=9.24\"\nFlow Flow Length=195'\nTc=1.6 min\n1\nCN=98/98\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72" }, "reading_order": 6 }, { "id": "p21.8", "order": 48, "type": "footnote", "bbox": { "l": 72.24, "t": 424.08, "r": 169.2, "b": 411.12 }, "text": "1.6 195 Total", "attrs": { "block_label": "vision_footnote" }, "reading_order": 7 }, { "id": "p21.9", "order": 49, "type": "footnote", "bbox": { "l": 84.72, "t": 130.32, "r": 492.72, "b": 112.08 }, "text": "24681012141618202224262830323436384042444648505254565860626466687072Time (hours)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 8 } ] }, { "document_id": 16592, "page": 22, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 22, "counts_by_type": { "caption": 3, "figure": 1, "footer": 1, "footnote": 1, "header": 2, "table": 1, "table_cell": 9, "text": 3, "title": 1 }, "build_ms": 2, "items": [ { "id": "p22.1", "order": 1, "type": "header", "bbox": { "l": 355.2, "t": 739.2, "r": 560.64, "b": 713.04 }, "text": "NOAA 24-hr D 100-Year Rainfall=9.48\"\nPrinted 04/12/2025", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p22.2", "order": 2, "type": "header", "bbox": { "l": 53.04, "t": 737.76, "r": 395.76, "b": 699.36 }, "text": "102 Sams -REV 12-02-25 NOAA 2\nPrepared by Haler Consulting\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p22.3", "order": 3, "type": "text", "bbox": { "l": 517.2, "t": 710.88, "r": 558.96, "b": 699.12 }, "text": "Page 16", "attrs": { "block_label": "number" }, "reading_order": 2 }, { "id": "p22.4", "order": 4, "type": "title", "bbox": { "l": 166.56, "t": 687.36, "r": 445.44, "b": 672.24 }, "text": "Summary for Subcatchment 142S: DA E2 (Roof)", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 3 }, { "id": "p22.5", "order": 5, "type": "text", "bbox": { "l": 54.24, "t": 660.24, "r": 463.68, "b": 634.32 }, "text": "Runoff = 0.79 cfs @ 12.14 hrs, Volume= 3,593 cf, Depth= 9.24\"\nRouted to Link 141L : POA", "reading_order": 4 }, { "id": "p22.6", "order": 6, "type": "text", "bbox": { "l": 52.08, "t": 623.76, "r": 611.52, "b": 598.32 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious, Time Span= 0.00-72.00 hrs, dt= NOAA 24-hr D 100-Year Rainfall=9.48\"", "reading_order": 5 }, { "id": "p22.7", "order": 7, "type": "table", "bbox": { "l": 53.28, "t": 587.52, "r": 559.68, "b": 497.29787 }, "text": "", "attrs": { "block_label": "table", "n_rows": 3, "n_cols": 3, "integrity": { "cells_checked": 9, "cells_flagged": 0 } }, "children": [ { "id": "p22.7.1", "order": 8, "type": "table_cell", "bbox": { "l": 86.520001, "t": 587.142469, "r": 127.590159, "b": 575.177889 }, "text": "Area (sf)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p22.7.2", "order": 9, "type": "table_cell", "bbox": { "l": 144.389888, "t": 587.142469, "r": 159.742288, "b": 575.177889 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p22.7.3", "order": 10, "type": "table_cell", "bbox": { "l": 286.601768, "t": 535.302451, "r": 340.102911, "b": 523.337871 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p22.7.4", "order": 11, "type": "table_cell", "bbox": { "l": 101.160004, "t": 573.222448, "r": 127.789043, "b": 547.337871 }, "text": "4,666\n4,666", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p22.7.5", "order": 12, "type": "table_cell", "bbox": { "l": 147.987313, "t": 573.222448, "r": 159.844683, "b": 547.337871 }, "text": "98\n98", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p22.7.6", "order": 13, "type": "table_cell", "bbox": { "l": 174.146431, "t": 573.222448, "r": 302.745943, "b": 547.337871 }, "text": "Unconnected roofs, HSG A\n100.00% Pervious Area", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p22.7.7", "order": 14, "type": "table_cell", "bbox": { "l": 65.040001, "t": 535.302451, "r": 89.475992, "b": 497.417872 }, "text": "Tc (min)\n6.0", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p22.7.8", "order": 15, "type": "table_cell", "bbox": { "l": 100.248415, "t": 535.302451, "r": 348.647167, "b": 497.29787 }, "text": "Length (feet)\nDirect Entry", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 7 }, { "id": "p22.7.9", "order": 16, "type": "table_cell", "bbox": { "l": 148.683866, "t": 535.302451, "r": 275.988028, "b": 511.337871 }, "text": "Slope (ft/ft) Velocity (ft/sec) Capacity (cfs)", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 } ], "reading_order": 6 }, { "id": "p22.8", "order": 17, "type": "caption", "bbox": { "l": 285.12, "t": 509.28, "r": 349.44, "b": 496.56 }, "text": "Direct Entry,", "attrs": { "block_label": "figure_title" }, "reading_order": 7 }, { "id": "p22.9", "order": 18, "type": "caption", "bbox": { "l": 205.68, "t": 485.04, "r": 405.84, "b": 469.92 }, "text": "Subcatchment 142S: DA E2 (Roof)", "attrs": { "block_label": "figure_title" }, "reading_order": 8 }, { "id": "p22.10", "order": 19, "type": "caption", "bbox": { "l": 254.88, "t": 464.64, "r": 305.76, "b": 453.6 }, "text": "Hydrograph", "attrs": { "block_label": "figure_title" }, "reading_order": 9 }, { "id": "p22.11", "order": 20, "type": "figure", "bbox": { "l": 63.36, "t": 461.28, "r": 496.08, "b": 203.52 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n0.85\n0.79 cfs\n0.8\n0.75 NOAA 24-hr D\n0.7 100-Year Rainfall=9.48\"\n0.65\n0.6 Runoff Area=4,666 sf\n0.55 Runoff Volume=3,593 cf\n(cfs) 0.45 Runoff Depth=9.24\"\n0.5\nFlow Tc=6.0 min\n0.4\n0.35\n0.3 CN=98/0\n0.25\n0.2\n0.15\n0.1\n0.05\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72" }, "reading_order": 10 }, { "id": "p22.12", "order": 21, "type": "footnote", "bbox": { "l": 91.2, "t": 216.72, "r": 492.48, "b": 197.76 }, "text": "4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72 Time (hours)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 11 }, { "id": "p22.13", "order": 22, "type": "footer", "bbox": { "l": 509.76, "t": 443.28, "r": 547.44, "b": 431.04 }, "text": "", "attrs": { "block_label": "footer_image" }, "reading_order": 12 } ] }, { "document_id": 16592, "page": 23, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 8, "counts_by_type": { "caption": 1, "figure": 1, "header": 2, "heading": 1, "text": 3 }, "build_ms": 0, "items": [ { "id": "p23.1", "order": 1, "type": "header", "bbox": { "l": 354.48, "t": 738.96, "r": 560.88, "b": 712.32 }, "text": "NOAA 24-hr D 100-Year Rainfall=9.48\"\nPrinted 04/12/2025", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p23.2", "order": 2, "type": "header", "bbox": { "l": 50.88, "t": 738, "r": 391.68, "b": 699.12 }, "text": "102 Sams -REV 12-02-25 NOAA\nPrepared by Haler Consulting\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p23.3", "order": 3, "type": "text", "bbox": { "l": 517.2, "t": 711.12, "r": 559.44, "b": 699.12 }, "text": "Page 17", "attrs": { "block_label": "number" }, "reading_order": 2 }, { "id": "p23.4", "order": 4, "type": "heading", "bbox": { "l": 220.8, "t": 687.6, "r": 392.16, "b": 672.48 }, "text": "Summary for Link 141L: POA", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 3 }, { "id": "p23.5", "order": 5, "type": "text", "bbox": { "l": 52.08, "t": 660, "r": 518.4, "b": 622.08 }, "text": "Inflow Area = 573,680 sf, 0.33% Impervious, Inflow Depth = 1.04\" for 100-Year event\nInflow = 3.02 cfs @ 12.10 hrs, Volume = 49,803 cf\nPrimary = 3.02 cfs @ 12.10 hrs, Volume = 49,803 cf, Atten = 0%, Lag = 0.0 min", "reading_order": 4 }, { "id": "p23.6", "order": 6, "type": "text", "bbox": { "l": 52.08, "t": 611.52, "r": 367.2, "b": 597.84 }, "text": "Primary outflow = Inflow, Time Span = 0.00-72.00 hrs, dt = 0.01 hrs", "reading_order": 5 }, { "id": "p23.7", "order": 7, "type": "caption", "bbox": { "l": 258.96, "t": 586.56, "r": 352.56, "b": 572.4 }, "text": "Link 141L: POA", "attrs": { "block_label": "figure_title" }, "reading_order": 6 }, { "id": "p23.8", "order": 8, "type": "figure", "bbox": { "l": 61.92, "t": 566.88, "r": 553.2, "b": 298.56 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nInflow\n3.02 cfs Primary\n3 Inflow Area=573,680 sf\n3.02 cfs\n2\n(cfs)\nFlow\n1\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72\nTime (hours)" }, "reading_order": 7 } ] }, { "document_id": 16592, "page": 24, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 1, "counts_by_type": { "heading": 1 }, "build_ms": 0, "items": [ { "id": "p24.1", "order": 1, "type": "heading", "bbox": { "l": 252.72, "t": 717.12, "r": 358.32, "b": 697.44 }, "text": "APPENDIX B", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 0 } ] }, { "document_id": 16592, "page": 25, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 2, "counts_by_type": { "figure": 1, "text": 1 }, "build_ms": 1, "items": [ { "id": "p25.1", "order": 1, "type": "figure", "bbox": { "l": 58.08, "t": 737.52, "r": 560.88, "b": 56.4 }, "text": "", "attrs": { "alt": "HydroCAD routing diagram of two WQ infiltration basin networks, each fed by two pervious or impervious subcatchments", "kind": "Routing diagram (HydroCAD stormwater network)", "source": "vision-diagram", "description_source": "claude-haiku-5-5" }, "reading_order": 0 }, { "id": "p25.2", "order": 2, "type": "text", "bbox": { "l": 58.08, "t": 56.4, "r": 560.88, "b": 44.4 }, "text": "This is a HydroCAD routing diagram titled \"WQ\", part of \"Routing Diagram for 102 Sams -REV 12-02-25\", prepared by Haler Consulting and printed 04/12/2025 (software footer: HydroCAD 10.20-2h, s/n 10351, © 2024 HydroCAD Software Solutions LLC). It shows two separate water-quality drainage networks, each with two subcatchments draining into one infiltration basin. The arrows show the direction of flow.\n\nLeft network: Subcatchment 171S, labelled \"DA P1 (Impervious)\", sits at lower left and has an arrow running rightward to pond 174P, labelled \"WQ Infiltration Basin #1\". Subcatchment 173S, labelled \"DA P4 (Pervious)\", sits above and to the left and has a diagonal arrow running down and to the right into the same pond 174P.\n\nRight network: Subcatchment 176S, labelled \"DA P3 (Pervious)\", sits at upper right and has a diagonal arrow running down and to the left into pond 177P, labelled \"WQ Infiltration Basin #2\". Subcatchment 175S, labelled \"DA P2 (Impervious)\", sits at lower right and has an arrow running leftward into the same pond 177P.\n\nThe two networks do not connect to each other. Each pond is a terminal point; no arrow leaves either basin. The page has a legend along the bottom left showing the symbols: Subcat (green hexagon), Reach (orange rectangle), Pond (blue triangle), and Link (red irregular shape). The legend and the title block sit outside the flow itself. The top half of the page is blank.", "attrs": { "source": "vision-diagram", "role": "diagram_description" }, "reading_order": 1 } ] }, { "document_id": 16592, "page": 26, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 10, "counts_by_type": { "header": 2, "heading": 1, "table": 1, "table_cell": 6 }, "build_ms": 1, "items": [ { "id": "p26.1", "order": 1, "type": "header", "bbox": { "l": 52.32, "t": 737.52, "r": 395.04, "b": 698.88 }, "text": "102 Sams -REV 12-02-25\nPrepared by Haler Consulting\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p26.2", "order": 2, "type": "header", "bbox": { "l": 463.2, "t": 724.56, "r": 560.16, "b": 698.88 }, "text": "Printed 04/12/2025\nPage 2", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p26.3", "order": 3, "type": "heading", "bbox": { "l": 226.32, "t": 687.36, "r": 386.16, "b": 672.96 }, "text": "Area Listing (selected nodes)", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 2 }, { "id": "p26.4", "order": 4, "type": "table", "bbox": { "l": 52.56, "t": 664.08, "r": 414.96, "b": 590.64 }, "text": "", "attrs": { "block_label": "table", "n_rows": 2, "n_cols": 3, "integrity": { "cells_checked": 6, "cells_flagged": 0 } }, "children": [ { "id": "p26.4.1", "order": 5, "type": "table_cell", "bbox": { "l": 116.879997, "t": 661.126246, "r": 143.086498, "b": 636.318852 }, "text": "Area (sq-ft)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 0 }, { "id": "p26.4.2", "order": 6, "type": "table_cell", "bbox": { "l": 165.479999, "t": 661.126246, "r": 179.801438, "b": 650.1188589999999 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 1 }, { "id": "p26.4.3", "order": 7, "type": "table_cell", "bbox": { "l": 200.001374, "t": 661.126246, "r": 311.238628, "b": 636.318852 }, "text": "Description (subcatchment-numbers)", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 2 }, { "id": "p26.4.4", "order": 8, "type": "table_cell", "bbox": { "l": 107.279995, "t": 629.926241, "r": 143.321918, "b": 591.318863 }, "text": "139,944\n55,095\n195,039", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p26.4.5", "order": 9, "type": "table_cell", "bbox": { "l": 168.786654, "t": 629.926241, "r": 180.111841, "b": 591.318863 }, "text": "39\n98\n56", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p26.4.6", "order": 10, "type": "table_cell", "bbox": { "l": 200.002058, "t": 629.926241, "r": 412.48586, "b": 591.318863 }, "text": ">75% Grass cover, Good, HSG A (173S, 176S)\nPaved parking, HSG A (171S, 175S)\nTOTAL AREA", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 } ], "reading_order": 3 } ] }, { "document_id": 16592, "page": 27, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 2, "counts_by_type": { "footer": 1, "text": 1 }, "build_ms": 0, "items": [ { "id": "p27.1", "order": 1, "type": "text", "bbox": { "l": 50.4, "t": 690.48, "r": 561.12, "b": 399.36 }, "text": "Time span=0.00-72.00 hrs, dt=0.01 hrs, 7201 points\nRunoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious\nReach routing by Stor-Ind+Trans method - Pond routing by Stor-Ind method\nSubcatchment 171S: DA P1 (Impervious) Runoff Area=31,625 sf 100.00% Impervious Runoff Depth=1.03\"\nFlow Length=450' Tc=3.0 min CN=0/98 Runoff=2.10 cfs 2,727 cf\nSubcatchment 173S: DA P4 (Pervious) Runoff Area=76,971 sf 0.00% Impervious Runoff Depth=0.00\"\nFlow Length=196' Slope=0.0100'/' Tc=14.8 min CN=39/0 Runoff=0.00 cfs 0 cf\nSubcatchment 175S: DA P2 (Impervious) Runoff Area=23,470 sf 100.00% Impervious Runoff Depth=1.03\"\nFlow Length=450' Tc=4.9 min CN=0/98 Runoff=1.38 cfs 2,023 cf\nSubcatchment 176S: DA P3 (Pervious) Runoff Area=62,973 sf 0.00% Impervious Runoff Depth=0.00\"\nFlow Length=316' Slope=0.0200'/' Tc=13.1 min CN=39/0 Runoff=0.00 cfs 0 cf\nPond 174P: WQ Infiltration Basin #1 Peak Elev=95.61' Storage=2,726 cf Inflow=2.10 cfs 2,727 cf\nDiscarded=0.00 cfs 0 cf Primary=0.00 cfs 0 cf Outflow=0.00 cfs 0 cf\nPond 177P: WQ Infiltration Basin #2 Peak Elev=91.70' Storage=2,023 cf Inflow=1.38 cfs 2,023 cf\nDiscarded=0.00 cfs 0 cf Primary=0.00 cfs 0 cf Outflow=0.00 cfs 0 cf\nTotal Runoff Area = 195,039 sf Runoff Volume = 4,750 cf Average Runoff Depth = 0.29\"\n71.75% Pervious = 139,944 sf 28.25% Impervious = 55,095 sf", "attrs": { "block_label": "algorithm" }, "reading_order": 0 }, { "id": "p27.2", "order": 2, "type": "footer", "bbox": { "l": 50.4, "t": 739.68, "r": 559.68, "b": 699.36 }, "text": "102 Sams -REV 12-02-25 NJ DEP 2-hr NJDEP Rainfall=1.25\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 3", "attrs": { "block_label": "footer" }, "reading_order": 1 } ] }, { "document_id": 16592, "page": 28, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 40, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "table": 1, "table_cell": 33, "text": 2, "title": 1 }, "build_ms": 5, "items": [ { "id": "p28.1", "order": 1, "type": "header", "bbox": { "l": 53.28, "t": 738.48, "r": 560.64, "b": 698.64 }, "text": "102 Sams -REV 12-02-25 NJ DEP 2-hr NJDEP Rainfall=1.25\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 4", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p28.2", "order": 2, "type": "title", "bbox": { "l": 148.32, "t": 687.36, "r": 463.92, "b": 672.24 }, "text": "Summary for Subcatchment 171S: DA P1 (Impervious)", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p28.3", "order": 3, "type": "text", "bbox": { "l": 53.04, "t": 660, "r": 463.92, "b": 634.08 }, "text": "Runoff = 2.10 cfs @ 1.09 hrs, Volume= 2,727 cf, Depth= 1.03\"\nRouted to Pond 174P : WQ Infiltration Basin #1", "reading_order": 2 }, { "id": "p28.4", "order": 4, "type": "text", "bbox": { "l": 52.08, "t": 623.76, "r": 611.28, "b": 598.08 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious, Time Span= 0.00-72.00 hrs, dt= NJ DEP 2-hr NJDEP Rainfall=1.25\"", "reading_order": 3 }, { "id": "p28.5", "order": 5, "type": "table", "bbox": { "l": 52.56, "t": 588.96, "r": 559.44, "b": 387.497874 }, "text": "", "attrs": { "block_label": "table", "n_rows": 11, "n_cols": 3, "integrity": { "cells_checked": 33, "cells_flagged": 0 } }, "children": [ { "id": "p28.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 86.520001, "t": 587.142469, "r": 127.590159, "b": 575.177889 }, "text": "Area (sf)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p28.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 144.389888, "t": 587.142469, "r": 159.742288, "b": 575.177889 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p28.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 286.601768, "t": 475.302451, "r": 340.102911, "b": 463.337871 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p28.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 95.280001, "t": 573.222448, "r": 127.805562, "b": 561.257868 }, "text": "31,625", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 3 }, { "id": "p28.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 148.003832, "t": 573.222448, "r": 159.753993, "b": 561.257868 }, "text": "98", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p28.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 174.16295, "t": 573.222448, "r": 281.259838, "b": 561.257868 }, "text": "Paved parking, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p28.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 121.799996, "t": 549.222448, "r": 127.760844, "b": 537.257868 }, "text": "0", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p28.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 147.959114, "t": 549.222448, "r": 159.816484, "b": 537.257868 }, "text": "98", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p28.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 174.118232, "t": 549.222448, "r": 325.501647, "b": 537.257868 }, "text": "Unconnected pavement, HSG A", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p28.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 121.799996, "t": 537.222448, "r": 127.760844, "b": 525.2578679999999 }, "text": "0", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p28.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 147.959114, "t": 537.222448, "r": 159.816484, "b": 525.2578679999999 }, "text": "98", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p28.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 174.118232, "t": 525.222448, "r": 325.501647, "b": 513.2578679999999 }, "text": "Unconnected pavement, HSG A", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 }, { "id": "p28.5.13", "order": 18, "type": "table_cell", "bbox": { "l": 121.799996, "t": 525.222448, "r": 127.760844, "b": 513.2578679999999 }, "text": "0", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 12 }, { "id": "p28.5.14", "order": 19, "type": "table_cell", "bbox": { "l": 147.959114, "t": 525.222448, "r": 159.816484, "b": 513.2578679999999 }, "text": "98", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p28.5.15", "order": 20, "type": "table_cell", "bbox": { "l": 174.118232, "t": 537.222448, "r": 281.247366, "b": 525.2578679999999 }, "text": "Paved parking, HSG A", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p28.5.16", "order": 21, "type": "table_cell", "bbox": { "l": 121.799996, "t": 561.222448, "r": 127.760844, "b": 549.257868 }, "text": "0", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p28.5.17", "order": 22, "type": "table_cell", "bbox": { "l": 148.003832, "t": 499.302451, "r": 159.753993, "b": 487.337871 }, "text": "98", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p28.5.18", "order": 23, "type": "table_cell", "bbox": { "l": 174.118232, "t": 561.222448, "r": 325.501647, "b": 549.257868 }, "text": "Unconnected pavement, HSG A", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p28.5.19", "order": 24, "type": "table_cell", "bbox": { "l": 95.280001, "t": 499.302451, "r": 127.805562, "b": 487.337871 }, "text": "31,625", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p28.5.20", "order": 25, "type": "table_cell", "bbox": { "l": 148.003832, "t": 511.302451, "r": 159.753993, "b": 499.337871 }, "text": "98", "attrs": { "row": 6, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p28.5.21", "order": 26, "type": "table_cell", "bbox": { "l": 174.16295, "t": 511.302451, "r": 262.223033, "b": 499.337871 }, "text": "Weighted Average", "attrs": { "row": 6, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p28.5.22", "order": 27, "type": "table_cell", "bbox": { "l": 95.280001, "t": 511.302451, "r": 127.805562, "b": 499.337871 }, "text": "31,625", "attrs": { "row": 7, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p28.5.23", "order": 28, "type": "table_cell", "bbox": { "l": 147.959114, "t": 561.222448, "r": 159.816484, "b": 549.257868 }, "text": "98", "attrs": { "row": 7, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 22 }, { "id": "p28.5.24", "order": 29, "type": "table_cell", "bbox": { "l": 174.16295, "t": 499.302451, "r": 296.664294, "b": 487.337871 }, "text": "100.00% Impervious Area", "attrs": { "row": 7, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 23 }, { "id": "p28.5.25", "order": 30, "type": "table_cell", "bbox": { "l": 65.040001, "t": 475.302451, "r": 89.475992, "b": 437.417872 }, "text": "Tc (min)\n1.2", "attrs": { "row": 8, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 24 }, { "id": "p28.5.26", "order": 31, "type": "table_cell", "bbox": { "l": 100.248415, "t": 475.302451, "r": 132.68142, "b": 437.417872 }, "text": "Length (feet)\n100", "attrs": { "row": 8, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 25 }, { "id": "p28.5.27", "order": 32, "type": "table_cell", "bbox": { "l": 143.445254, "t": 475.302451, "r": 275.988028, "b": 437.417872 }, "text": "Slope (ft/ft) Velocity (ft/sec) Capacity (cfs)\n0.0200 1.42", "attrs": { "row": 8, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 26 }, { "id": "p28.5.28", "order": 33, "type": "table_cell", "bbox": { "l": 74.639998, "t": 425.382452, "r": 89.475992, "b": 413.417872 }, "text": "1.8", "attrs": { "row": 9, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 27 }, { "id": "p28.5.29", "order": 34, "type": "table_cell", "bbox": { "l": 114.927527, "t": 425.382452, "r": 132.68142, "b": 413.417872 }, "text": "350", "attrs": { "row": 9, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 28 }, { "id": "p28.5.30", "order": 35, "type": "table_cell", "bbox": { "l": 143.445254, "t": 425.382452, "r": 223.870219, "b": 413.417872 }, "text": "0.0250 3.21", "attrs": { "row": 9, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 29 }, { "id": "p28.5.31", "order": 36, "type": "table_cell", "bbox": { "l": 74.639998, "t": 399.462454, "r": 89.475992, "b": 387.497874 }, "text": "3.0", "attrs": { "row": 10, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 30 }, { "id": "p28.5.32", "order": 37, "type": "table_cell", "bbox": { "l": 114.927527, "t": 399.462454, "r": 132.68142, "b": 387.497874 }, "text": "450", "attrs": { "row": 10, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 31 }, { "id": "p28.5.33", "order": 38, "type": "table_cell", "bbox": { "l": 143.445254, "t": 399.462454, "r": 167.029543, "b": 387.497874 }, "text": "Total", "attrs": { "row": 10, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 32 } ], "reading_order": 4 }, { "id": "p28.6", "order": 39, "type": "caption", "bbox": { "l": 186.72, "t": 374.64, "r": 424.32, "b": 359.76 }, "text": "Subcatchment 171S: DA P1 (Impervious)", "attrs": { "block_label": "figure_title" }, "reading_order": 5 }, { "id": "p28.7", "order": 40, "type": "figure", "bbox": { "l": 61.44, "t": 359.52, "r": 551.52, "b": 88.32 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nRunoff\n2.10 cfs\n2 NJ DEP 2-hr\nNJDEP Rainfall=1.25\"\nRunoff Area=31,625 sf\nRunoff Volume=2,727 cf\n(cfs) Runoff Depth=1.03\"\nFlow 1 Flow Length=450'\nTc=3.0 min\nCN=0/98\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72\nTime (hours)" }, "reading_order": 6 } ] }, { "document_id": 16592, "page": 29, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 43, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "table": 1, "table_cell": 33, "text": 5, "title": 1 }, "build_ms": 4, "items": [ { "id": "p29.1", "order": 1, "type": "header", "bbox": { "l": 53.28, "t": 738.48, "r": 560.64, "b": 698.64 }, "text": "102 Sams -REV 12-02-25 NJ DEP 2-hr NJDEP Rainfall=1.25\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 5", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p29.2", "order": 2, "type": "title", "bbox": { "l": 155.04, "t": 687.6, "r": 457.2, "b": 672.24 }, "text": "Summary for Subcatchment 173S: DA P4 (Pervious)", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p29.3", "order": 3, "type": "text", "bbox": { "l": 52.56, "t": 659.52, "r": 303.84, "b": 647.04 }, "text": "Runoff = 0.00 cfs @ 0.00 hrs, Volume=0 cf, Depth=0.00\"", "reading_order": 2 }, { "id": "p29.4", "order": 4, "type": "text", "bbox": { "l": 65.52, "t": 647.28, "r": 294, "b": 634.56 }, "text": "Routed to Pond 174P : WQ Infiltration Basin #1", "reading_order": 3 }, { "id": "p29.5", "order": 5, "type": "text", "bbox": { "l": 368.16, "t": 659.76, "r": 463.44, "b": 646.8 }, "text": "0 cf. Depth= 0.00\"", "reading_order": 4 }, { "id": "p29.6", "order": 6, "type": "text", "bbox": { "l": 52.08, "t": 623.76, "r": 611.04, "b": 598.08 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious, Time Span= 0.00-72.00 hrs, dt= NJ DEP 2-hr NJDEP Rainfall=1.25\"", "reading_order": 5 }, { "id": "p29.7", "order": 7, "type": "table", "bbox": { "l": 52.32, "t": 588.72, "r": 558.96, "b": 447.497874 }, "text": "", "attrs": { "block_label": "table", "n_rows": 7, "n_cols": 6, "integrity": { "cells_checked": 28, "cells_flagged": 0 } }, "children": [ { "id": "p29.7.1", "order": 8, "type": "table_cell", "bbox": { "l": 86.520001, "t": 587.142469, "r": 127.590159, "b": 575.177889 }, "text": "Area (sf)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p29.7.2", "order": 9, "type": "table_cell", "bbox": { "l": 144.389888, "t": 587.142469, "r": 159.742288, "b": 575.177889 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p29.7.3", "order": 10, "type": "table_cell", "bbox": { "l": 286.601768, "t": 535.302451, "r": 340.102911, "b": 523.337871 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p29.7.4", "order": 11, "type": "table_cell", "bbox": { "l": 95.280001, "t": 559.302451, "r": 127.805562, "b": 547.337871 }, "text": "76,971", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 3 }, { "id": "p29.7.5", "order": 12, "type": "table_cell", "bbox": { "l": 148.003832, "t": 559.302451, "r": 159.753993, "b": 547.337871 }, "text": "39", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p29.7.6", "order": 13, "type": "table_cell", "bbox": { "l": 174.16295, "t": 573.222448, "r": 333.31717, "b": 561.257868 }, "text": ">75% Grass cover, Good, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 5 }, { "id": "p29.7.7", "order": 14, "type": "table_cell", "bbox": { "l": 95.280001, "t": 573.222448, "r": 127.805562, "b": 561.257868 }, "text": "76,971", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 6 }, { "id": "p29.7.8", "order": 15, "type": "table_cell", "bbox": { "l": 148.003832, "t": 573.222448, "r": 159.753993, "b": 561.257868 }, "text": "39", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p29.7.9", "order": 16, "type": "table_cell", "bbox": { "l": 174.16295, "t": 559.302451, "r": 286.000299, "b": 547.337871 }, "text": "100.00% Pervious Area", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 8 }, { "id": "p29.7.10", "order": 17, "type": "table_cell", "bbox": { "l": 65.040001, "t": 535.302451, "r": 89.40872, "b": 511.337871 }, "text": "Tc (min)", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p29.7.11", "order": 18, "type": "table_cell", "bbox": { "l": 100.248415, "t": 535.302451, "r": 132.666767, "b": 511.337871 }, "text": "Length (feet)", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p29.7.12", "order": 19, "type": "table_cell", "bbox": { "l": 148.683866, "t": 535.302451, "r": 175.895438, "b": 511.337871 }, "text": "Slope (ft/ft)", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 }, { "id": "p29.7.13", "order": 20, "type": "table_cell", "bbox": { "l": 186.552062, "t": 535.302451, "r": 223.968178, "b": 511.337871 }, "text": "Velocity (ft/sec)", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 12 }, { "id": "p29.7.14", "order": 21, "type": "table_cell", "bbox": { "l": 234.581918, "t": 535.302451, "r": 275.988028, "b": 511.337871 }, "text": "Capacity (cfs)", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p29.7.15", "order": 22, "type": "table_cell", "bbox": { "l": 174.08692, "t": 587.142469, "r": 227.564819, "b": 575.177889 }, "text": "Description", "attrs": { "row": 3, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p29.7.16", "order": 23, "type": "table_cell", "bbox": { "l": 68.76, "t": 509.382452, "r": 89.492517, "b": 497.417872 }, "text": "12.5", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p29.7.17", "order": 24, "type": "table_cell", "bbox": { "l": 114.944052, "t": 509.382452, "r": 132.697945, "b": 497.417872 }, "text": "100", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p29.7.18", "order": 25, "type": "table_cell", "bbox": { "l": 143.354569, "t": 509.382452, "r": 175.880131, "b": 497.417872 }, "text": "0.0100", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p29.7.19", "order": 26, "type": "table_cell", "bbox": { "l": 203.154228, "t": 509.382452, "r": 223.886744, "b": 497.417872 }, "text": "0.13", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p29.7.20", "order": 27, "type": "table_cell", "bbox": { "l": 390.08, "t": 509.5886, "r": 474.52, "b": 489.8057 }, "text": "", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 19 }, { "id": "p29.7.21", "order": 28, "type": "table_cell", "bbox": { "l": 286.679993, "t": 509.26245, "r": 452.820335, "b": 485.417872 }, "text": "Sheet Flow, Grass: Short n= 0.150 P2= 3.42\"", "attrs": { "row": 4, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p29.7.22", "order": 29, "type": "table_cell", "bbox": { "l": 74.639998, "t": 485.382452, "r": 89.475992, "b": 473.417872 }, "text": "2.3", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p29.7.23", "order": 30, "type": "table_cell", "bbox": { "l": 120.82405, "t": 485.382452, "r": 132.68142, "b": 473.417872 }, "text": "96", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 22 }, { "id": "p29.7.24", "order": 31, "type": "table_cell", "bbox": { "l": 143.445254, "t": 485.382452, "r": 175.863606, "b": 473.417872 }, "text": "0.0100", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 23 }, { "id": "p29.7.25", "order": 32, "type": "table_cell", "bbox": { "l": 203.137703, "t": 485.382452, "r": 223.870219, "b": 473.417872 }, "text": "0.70", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 24 }, { "id": "p29.7.26", "order": 33, "type": "table_cell", "bbox": { "l": 390.08, "t": 489.8057, "r": 474.52, "b": 470.0229 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 25 }, { "id": "p29.7.27", "order": 34, "type": "table_cell", "bbox": { "l": 286.679993, "t": 485.26245, "r": 446.147004, "b": 461.417872 }, "text": "Shallow Concentrated Flow, Short Grass Pasture Kv= 7.0 fps", "attrs": { "row": 5, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 26 }, { "id": "p29.7.28", "order": 35, "type": "table_cell", "bbox": { "l": 68.76, "t": 459.462454, "r": 89.492517, "b": 447.497874 }, "text": "14.8", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 27 }, { "id": "p29.7.29", "order": 36, "type": "table_cell", "bbox": { "l": 114.944052, "t": 459.462454, "r": 132.697945, "b": 447.497874 }, "text": "196", "attrs": { "row": 6, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 28 }, { "id": "p29.7.30", "order": 37, "type": "table_cell", "bbox": { "l": 143.354569, "t": 459.462454, "r": 166.947862, "b": 447.497874 }, "text": "Total", "attrs": { "row": 6, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 29 }, { "id": "p29.7.31", "order": 38, "type": "table_cell", "bbox": { "l": 305.64, "t": 470.0229, "r": 390.08, "b": 450.24 }, "text": "", "attrs": { "row": 6, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 30 }, { "id": "p29.7.32", "order": 39, "type": "table_cell", "bbox": { "l": 390.08, "t": 470.0229, "r": 474.52, "b": 450.24 }, "text": "", "attrs": { "row": 6, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 31 }, { "id": "p29.7.33", "order": 40, "type": "table_cell", "bbox": { "l": 474.52, "t": 470.0229, "r": 558.96, "b": 450.24 }, "text": "", "attrs": { "row": 6, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 32 } ], "reading_order": 6 }, { "id": "p29.8", "order": 41, "type": "caption", "bbox": { "l": 192.96, "t": 435.12, "r": 418.08, "b": 419.76 }, "text": "Subcatchment 173S: DA P4 (Pervious)", "attrs": { "block_label": "figure_title" }, "reading_order": 7 }, { "id": "p29.9", "order": 42, "type": "figure", "bbox": { "l": 60.96, "t": 421.44, "r": 553.2, "b": 150.24 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n1\nRunoff\nNJ DEP 2-hr\nNJDEP Rainfall=1.25\"\nRunoff Area=76,971 sf\nRunoff Volume=0 cf\n(cfs) Runoff Depth=0.00\"\nFlow Flow Length=196'\nSlope=0.0100 '/'\nTc=14.8 min\nCN=39/0\n0.00 cfs\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72\nTime (hours)" }, "reading_order": 8 }, { "id": "p29.10", "order": 43, "type": "text", "bbox": { "l": 265.44, "t": 156, "r": 312.96, "b": 146.88 }, "text": "Time (hours)", "attrs": { "block_label": "number" }, "reading_order": 9 } ] }, { "document_id": 16592, "page": 30, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 50, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "table": 1, "table_cell": 43, "text": 2, "title": 1 }, "build_ms": 5, "items": [ { "id": "p30.1", "order": 1, "type": "header", "bbox": { "l": 53.28, "t": 738.48, "r": 560.88, "b": 698.64 }, "text": "102 Sams -REV 12-02-25 NJ DEP 2-hr NJDEP Rainfall=1.25\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 6", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p30.2", "order": 2, "type": "title", "bbox": { "l": 148.32, "t": 687.36, "r": 463.92, "b": 672.24 }, "text": "Summary for Subcatchment 175S: DA P2 (Impervious)", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p30.3", "order": 3, "type": "text", "bbox": { "l": 53.04, "t": 660, "r": 464.16, "b": 634.08 }, "text": "Runoff = 1.38 cfs @ 1.11 hrs, Volume= 2,023 cf, Depth= 1.03\"\nRouted to Pond 177P : WQ Infiltration Basin #2", "reading_order": 2 }, { "id": "p30.4", "order": 4, "type": "text", "bbox": { "l": 52.08, "t": 623.76, "r": 611.04, "b": 598.08 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious, Time Span= 0.00-72.00 hrs, dt= NJ DEP 2-hr NJDEP Rainfall=1.25\"", "reading_order": 3 }, { "id": "p30.5", "order": 5, "type": "table", "bbox": { "l": 52.56, "t": 589.2, "r": 559.44, "b": 387.497874 }, "text": "", "attrs": { "block_label": "table", "n_rows": 11, "n_cols": 4, "integrity": { "cells_checked": 35, "cells_flagged": 0 } }, "children": [ { "id": "p30.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 86.520001, "t": 587.142469, "r": 127.590159, "b": 575.177889 }, "text": "Area (sf)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p30.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 144.389888, "t": 587.142469, "r": 159.742288, "b": 575.177889 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p30.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 286.601768, "t": 475.302451, "r": 340.102911, "b": 463.337871 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p30.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 432.72, "t": 589.2, "r": 559.44, "b": 572.8 }, "text": "", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 3 }, { "id": "p30.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 95.280001, "t": 573.222448, "r": 127.805562, "b": 561.257868 }, "text": "23,470", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p30.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 148.003832, "t": 573.222448, "r": 159.753993, "b": 561.257868 }, "text": "98", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p30.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 174.16295, "t": 573.222448, "r": 281.259838, "b": 561.257868 }, "text": "Paved parking, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p30.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 432.72, "t": 572.8, "r": 559.44, "b": 556.4 }, "text": "", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 7 }, { "id": "p30.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 121.799996, "t": 549.222448, "r": 127.760844, "b": 537.257868 }, "text": "0", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p30.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 147.959114, "t": 549.222448, "r": 159.816484, "b": 537.257868 }, "text": "98", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p30.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 174.118232, "t": 549.222448, "r": 325.501647, "b": 537.257868 }, "text": "Unconnected pavement, HSG A", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p30.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 432.72, "t": 556.4, "r": 559.44, "b": 540 }, "text": "", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 11 }, { "id": "p30.5.13", "order": 18, "type": "table_cell", "bbox": { "l": 121.799996, "t": 537.222448, "r": 127.760844, "b": 525.2578679999999 }, "text": "0", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 12 }, { "id": "p30.5.14", "order": 19, "type": "table_cell", "bbox": { "l": 147.959114, "t": 537.222448, "r": 159.816484, "b": 525.2578679999999 }, "text": "98", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p30.5.15", "order": 20, "type": "table_cell", "bbox": { "l": 174.118232, "t": 525.222448, "r": 325.501647, "b": 513.2578679999999 }, "text": "Unconnected pavement, HSG A", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p30.5.16", "order": 21, "type": "table_cell", "bbox": { "l": 432.72, "t": 540, "r": 559.44, "b": 523.6 }, "text": "", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 15 }, { "id": "p30.5.17", "order": 22, "type": "table_cell", "bbox": { "l": 121.799996, "t": 525.222448, "r": 127.760844, "b": 513.2578679999999 }, "text": "0", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p30.5.18", "order": 23, "type": "table_cell", "bbox": { "l": 147.959114, "t": 525.222448, "r": 159.816484, "b": 513.2578679999999 }, "text": "98", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p30.5.19", "order": 24, "type": "table_cell", "bbox": { "l": 174.118232, "t": 537.222448, "r": 281.247366, "b": 525.2578679999999 }, "text": "Paved parking, HSG A", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p30.5.20", "order": 25, "type": "table_cell", "bbox": { "l": 432.72, "t": 523.6, "r": 559.44, "b": 507.2 }, "text": "", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 19 }, { "id": "p30.5.21", "order": 26, "type": "table_cell", "bbox": { "l": 121.799996, "t": 561.222448, "r": 127.760844, "b": 549.257868 }, "text": "0", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p30.5.22", "order": 27, "type": "table_cell", "bbox": { "l": 148.003832, "t": 499.302451, "r": 159.753993, "b": 487.337871 }, "text": "98", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p30.5.23", "order": 28, "type": "table_cell", "bbox": { "l": 174.118232, "t": 561.222448, "r": 325.501647, "b": 549.257868 }, "text": "Unconnected pavement, HSG A", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 22 }, { "id": "p30.5.24", "order": 29, "type": "table_cell", "bbox": { "l": 432.72, "t": 507.2, "r": 559.44, "b": 490.8 }, "text": "", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 23 }, { "id": "p30.5.25", "order": 30, "type": "table_cell", "bbox": { "l": 95.280001, "t": 499.302451, "r": 127.805562, "b": 487.337871 }, "text": "23,470", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 24 }, { "id": "p30.5.26", "order": 31, "type": "table_cell", "bbox": { "l": 148.003832, "t": 511.302451, "r": 159.753993, "b": 499.337871 }, "text": "98", "attrs": { "row": 6, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 25 }, { "id": "p30.5.27", "order": 32, "type": "table_cell", "bbox": { "l": 174.16295, "t": 511.302451, "r": 262.223033, "b": 499.337871 }, "text": "Weighted Average", "attrs": { "row": 6, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 26 }, { "id": "p30.5.28", "order": 33, "type": "table_cell", "bbox": { "l": 432.72, "t": 490.8, "r": 559.44, "b": 474.4 }, "text": "", "attrs": { "row": 6, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 27 }, { "id": "p30.5.29", "order": 34, "type": "table_cell", "bbox": { "l": 95.280001, "t": 511.302451, "r": 127.805562, "b": 499.337871 }, "text": "23,470", "attrs": { "row": 7, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 28 }, { "id": "p30.5.30", "order": 35, "type": "table_cell", "bbox": { "l": 147.959114, "t": 561.222448, "r": 159.816484, "b": 549.257868 }, "text": "98", "attrs": { "row": 7, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 29 }, { "id": "p30.5.31", "order": 36, "type": "table_cell", "bbox": { "l": 174.16295, "t": 499.302451, "r": 296.664294, "b": 487.337871 }, "text": "100.00% Impervious Area", "attrs": { "row": 7, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 30 }, { "id": "p30.5.32", "order": 37, "type": "table_cell", "bbox": { "l": 432.72, "t": 474.4, "r": 559.44, "b": 458 }, "text": "", "attrs": { "row": 7, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 31 }, { "id": "p30.5.33", "order": 38, "type": "table_cell", "bbox": { "l": 65.040001, "t": 475.302451, "r": 89.475992, "b": 437.417872 }, "text": "Tc (min)\n0.8", "attrs": { "row": 8, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 32 }, { "id": "p30.5.34", "order": 39, "type": "table_cell", "bbox": { "l": 100.248415, "t": 475.302451, "r": 132.68142, "b": 437.417872 }, "text": "Length (feet)\n100", "attrs": { "row": 8, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 33 }, { "id": "p30.5.35", "order": 40, "type": "table_cell", "bbox": { "l": 143.445254, "t": 475.302451, "r": 175.895438, "b": 437.417872 }, "text": "Slope (ft/ft)\n0.0500", "attrs": { "row": 8, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 34 }, { "id": "p30.5.36", "order": 41, "type": "table_cell", "bbox": { "l": 186.552062, "t": 475.302451, "r": 223.968178, "b": 437.417872 }, "text": "Velocity (ft/sec)\n2.05", "attrs": { "row": 8, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 35 }, { "id": "p30.5.37", "order": 42, "type": "table_cell", "bbox": { "l": 74.639998, "t": 425.382452, "r": 89.475992, "b": 413.417872 }, "text": "4.1", "attrs": { "row": 9, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 36 }, { "id": "p30.5.38", "order": 43, "type": "table_cell", "bbox": { "l": 114.927527, "t": 425.382452, "r": 132.68142, "b": 413.417872 }, "text": "350", "attrs": { "row": 9, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 37 }, { "id": "p30.5.39", "order": 44, "type": "table_cell", "bbox": { "l": 143.445254, "t": 425.382452, "r": 175.863606, "b": 413.417872 }, "text": "0.0050", "attrs": { "row": 9, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 38 }, { "id": "p30.5.40", "order": 45, "type": "table_cell", "bbox": { "l": 203.137703, "t": 425.382452, "r": 223.870219, "b": 413.417872 }, "text": "1.44", "attrs": { "row": 9, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 39 }, { "id": "p30.5.41", "order": 46, "type": "table_cell", "bbox": { "l": 74.639998, "t": 399.462454, "r": 89.475992, "b": 387.497874 }, "text": "4.9", "attrs": { "row": 10, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 40 }, { "id": "p30.5.42", "order": 47, "type": "table_cell", "bbox": { "l": 114.927527, "t": 399.462454, "r": 132.68142, "b": 387.497874 }, "text": "450", "attrs": { "row": 10, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 41 }, { "id": "p30.5.43", "order": 48, "type": "table_cell", "bbox": { "l": 143.445254, "t": 399.462454, "r": 167.029543, "b": 387.497874 }, "text": "Total", "attrs": { "row": 10, "col": 2, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 42 } ], "reading_order": 4 }, { "id": "p30.6", "order": 49, "type": "caption", "bbox": { "l": 186.96, "t": 374.64, "r": 424.32, "b": 359.76 }, "text": "Subcatchment 175S: DA P2 (Impervious)", "attrs": { "block_label": "figure_title" }, "reading_order": 5 }, { "id": "p30.7", "order": 50, "type": "figure", "bbox": { "l": 62.64, "t": 357.6, "r": 551.52, "b": 88.56 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nRunoff\n1.38 cfs\nNJ DEP 2-hr\nNJDEP Rainfall=1.25\"\nRunoff Area=23,470 sf\n1\nRunoff Volume=2,023 cf\n(cfs) Runoff Depth=1.03\"\nFlow Flow Length=450'\nTc=4.9 min\nCN=0/98\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72\nTime (hours)" }, "reading_order": 6 } ] }, { "document_id": 16592, "page": 31, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 34, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "table": 1, "table_cell": 24, "text": 5, "title": 1 }, "build_ms": 4, "items": [ { "id": "p31.1", "order": 1, "type": "header", "bbox": { "l": 53.28, "t": 738.48, "r": 560.64, "b": 698.64 }, "text": "102 Sams -REV 12-02-25 NJ DEP 2-hr NJDEP Rainfall=1.25\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 7", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p31.2", "order": 2, "type": "title", "bbox": { "l": 155.04, "t": 687.6, "r": 457.2, "b": 672.24 }, "text": "Summary for Subcatchment 176S: DA P3 (Pervious)", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p31.3", "order": 3, "type": "text", "bbox": { "l": 52.56, "t": 659.52, "r": 303.84, "b": 647.04 }, "text": "Runoff = 0.00 cfs @ 0.00 hrs, Volume=0 cf, Depth=0.00\"", "reading_order": 2 }, { "id": "p31.4", "order": 4, "type": "text", "bbox": { "l": 65.52, "t": 647.28, "r": 294.72, "b": 634.56 }, "text": "Routed to Pond 177P : WQ Infiltration Basin #2", "reading_order": 3 }, { "id": "p31.5", "order": 5, "type": "text", "bbox": { "l": 368.16, "t": 659.76, "r": 463.44, "b": 646.8 }, "text": "0 cf. Depth= 0.00\"", "reading_order": 4 }, { "id": "p31.6", "order": 6, "type": "text", "bbox": { "l": 52.08, "t": 623.76, "r": 611.04, "b": 598.08 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious, Time Span= 0.00-72.00 hrs, dt= NJ DEP 2-hr NJDEP Rainfall=1.25\"", "reading_order": 5 }, { "id": "p31.7", "order": 7, "type": "table", "bbox": { "l": 52.32, "t": 588.96, "r": 558.96, "b": 447.497874 }, "text": "", "attrs": { "block_label": "table", "n_rows": 6, "n_cols": 5, "integrity": { "cells_checked": 22, "cells_flagged": 0 } }, "children": [ { "id": "p31.7.1", "order": 8, "type": "table_cell", "bbox": { "l": 86.520001, "t": 587.142469, "r": 127.590159, "b": 575.177889 }, "text": "Area (sf)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p31.7.2", "order": 9, "type": "table_cell", "bbox": { "l": 144.389888, "t": 587.142469, "r": 159.742288, "b": 575.177889 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p31.7.3", "order": 10, "type": "table_cell", "bbox": { "l": 286.601768, "t": 535.302451, "r": 340.102911, "b": 523.337871 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p31.7.4", "order": 11, "type": "table_cell", "bbox": { "l": 95.280001, "t": 559.302451, "r": 127.805562, "b": 547.337871 }, "text": "62,973", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 3 }, { "id": "p31.7.5", "order": 12, "type": "table_cell", "bbox": { "l": 148.003832, "t": 559.302451, "r": 159.753993, "b": 547.337871 }, "text": "39", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p31.7.6", "order": 13, "type": "table_cell", "bbox": { "l": 174.16295, "t": 573.222448, "r": 333.31717, "b": 561.257868 }, "text": ">75% Grass cover, Good, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 5 }, { "id": "p31.7.7", "order": 14, "type": "table_cell", "bbox": { "l": 95.280001, "t": 573.222448, "r": 127.805562, "b": 561.257868 }, "text": "62,973", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p31.7.8", "order": 15, "type": "table_cell", "bbox": { "l": 148.003832, "t": 573.222448, "r": 159.753993, "b": 561.257868 }, "text": "39", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p31.7.9", "order": 16, "type": "table_cell", "bbox": { "l": 174.16295, "t": 559.302451, "r": 286.000299, "b": 547.337871 }, "text": "100.00% Pervious Area", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 8 }, { "id": "p31.7.10", "order": 17, "type": "table_cell", "bbox": { "l": 65.040001, "t": 535.302451, "r": 89.475992, "b": 497.417872 }, "text": "Tc (min)\n9.5", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 9 }, { "id": "p31.7.11", "order": 18, "type": "table_cell", "bbox": { "l": 100.248415, "t": 535.302451, "r": 132.68142, "b": 497.417872 }, "text": "Length (feet)\n100", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 10 }, { "id": "p31.7.12", "order": 19, "type": "table_cell", "bbox": { "l": 143.445254, "t": 535.302451, "r": 175.895438, "b": 497.417872 }, "text": "Slope (ft/ft)\n0.0200", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 11 }, { "id": "p31.7.13", "order": 20, "type": "table_cell", "bbox": { "l": 186.552062, "t": 535.302451, "r": 223.968178, "b": 497.417872 }, "text": "Velocity (ft/sec)\n0.18", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 12 }, { "id": "p31.7.14", "order": 21, "type": "table_cell", "bbox": { "l": 234.581918, "t": 535.302451, "r": 452.820335, "b": 485.417872 }, "text": "Capacity (cfs)\nSheet Flow, Grass: Short n= 0.150 P2= 3.42\"", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 13 }, { "id": "p31.7.15", "order": 22, "type": "table_cell", "bbox": { "l": 74.639998, "t": 485.382452, "r": 89.475992, "b": 473.417872 }, "text": "3.6", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p31.7.16", "order": 23, "type": "table_cell", "bbox": { "l": 114.927527, "t": 485.382452, "r": 132.68142, "b": 473.417872 }, "text": "216", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p31.7.17", "order": 24, "type": "table_cell", "bbox": { "l": 143.445254, "t": 485.382452, "r": 175.863606, "b": 473.417872 }, "text": "0.0200", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p31.7.18", "order": 25, "type": "table_cell", "bbox": { "l": 203.137703, "t": 485.382452, "r": 223.870219, "b": 473.417872 }, "text": "0.99", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p31.7.19", "order": 26, "type": "table_cell", "bbox": { "l": 286.679993, "t": 485.26245, "r": 446.147004, "b": 461.417872 }, "text": "Shallow Concentrated Flow, Short Grass Pasture Kv= 7.0 fps", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p31.7.20", "order": 27, "type": "table_cell", "bbox": { "l": 68.76, "t": 459.462454, "r": 89.492517, "b": 447.497874 }, "text": "13.1", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p31.7.21", "order": 28, "type": "table_cell", "bbox": { "l": 114.944052, "t": 459.462454, "r": 132.697945, "b": 447.497874 }, "text": "316", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p31.7.22", "order": 29, "type": "table_cell", "bbox": { "l": 143.354569, "t": 459.462454, "r": 166.947862, "b": 447.497874 }, "text": "Total", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p31.7.23", "order": 30, "type": "table_cell", "bbox": { "l": 356.304, "t": 470.4686, "r": 457.632, "b": 450.72 }, "text": "", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 22 }, { "id": "p31.7.24", "order": 31, "type": "table_cell", "bbox": { "l": 457.632, "t": 470.4686, "r": 558.96, "b": 450.72 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 23 } ], "reading_order": 6 }, { "id": "p31.8", "order": 32, "type": "caption", "bbox": { "l": 192.96, "t": 435.12, "r": 418.08, "b": 420 }, "text": "Subcatchment 176S: DA P3 (Pervious)", "attrs": { "block_label": "figure_title" }, "reading_order": 7 }, { "id": "p31.9", "order": 33, "type": "figure", "bbox": { "l": 60.72, "t": 419.04, "r": 553.68, "b": 150.24 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n1\nRunoff\nNJ DEP 2-hr\nNJDEP Rainfall=1.25\"\nRunoff Area=62,973 sf\nRunoff Volume=0 cf\n(cfs) Runoff Depth=0.00\"\nFlow Flow Length=316'\nSlope=0.0200 '/'\nTc=13.1 min\nCN=39/0\n0.00 cfs\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72\nTime (hours)" }, "reading_order": 8 }, { "id": "p31.10", "order": 34, "type": "text", "bbox": { "l": 265.44, "t": 156, "r": 312.96, "b": 146.88 }, "text": "Time (hours)", "attrs": { "block_label": "number" }, "reading_order": 9 } ] }, { "document_id": 16592, "page": 32, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 39, "counts_by_type": { "footnote": 2, "header": 2, "heading": 1, "table": 3, "table_cell": 31 }, "build_ms": 8, "items": [ { "id": "p32.1", "order": 1, "type": "header", "bbox": { "l": 373.92, "t": 739.68, "r": 561.6, "b": 699.84 }, "text": "NJ DEP 2-hr NJDEP Rainfall=1.25\"\nPrinted 04/12/2025\nLLC Page 8", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p32.2", "order": 2, "type": "header", "bbox": { "l": 51.84, "t": 739.2, "r": 394.32, "b": 699.36 }, "text": "102 Sams -REV 12-02-25 NJ\nPrepared by Haler Consulting\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p32.3", "order": 3, "type": "heading", "bbox": { "l": 162.24, "t": 687.84, "r": 449.28, "b": 672.48 }, "text": "Summary for Pond 174P: WQ Infiltration Basin #1", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 2 }, { "id": "p32.4", "order": 4, "type": "table", "bbox": { "l": 51.6, "t": 663.36, "r": 549.6, "b": 524.88 }, "text": "", "attrs": { "block_label": "table", "n_rows": 7, "n_cols": 1, "integrity": { "cells_checked": 7, "cells_flagged": 1, "flags": [ { "row": 4, "col": 0, "coverage": 0, "text": "Primary = 0.00 cfs @ 0.00 hrs, Volume= 0 cf" } ] } }, "children": [ { "id": "p32.4.1", "order": 5, "type": "table_cell", "bbox": { "l": 51.6, "t": 663.36, "r": 549.6, "b": 647.9733 }, "text": "Inflow Area = 108,596 sf, 29.12% Impervious, Inflow Depth = 0.30\" for NJDEP event", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 0 }, { "id": "p32.4.2", "order": 6, "type": "table_cell", "bbox": { "l": 51.6, "t": 647.9733, "r": 549.6, "b": 632.5867 }, "text": "Inflow = 2.10 cfs @ 1.09 hrs, Volume= 2,727 cf", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 1 }, { "id": "p32.4.3", "order": 7, "type": "table_cell", "bbox": { "l": 51.6, "t": 632.5867, "r": 549.6, "b": 617.2 }, "text": "Outflow = 0.00 cfs @ 0.00 hrs, Volume= 0 cf, Atten= 100%, Lag= 0.0 min", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 2 }, { "id": "p32.4.4", "order": 8, "type": "table_cell", "bbox": { "l": 51.6, "t": 617.2, "r": 549.6, "b": 601.8133 }, "text": "Discarded = 0.00 cfs @ 0.00 hrs, Volume= 0 cf", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 3 }, { "id": "p32.4.5", "order": 9, "type": "table_cell", "bbox": { "l": 51.6, "t": 601.8133, "r": 549.6, "b": 586.4267 }, "text": "Primary = 0.00 cfs @ 0.00 hrs, Volume= 0 cf", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 4 }, { "id": "p32.4.6", "order": 10, "type": "table_cell", "bbox": { "l": 54, "t": 587.142469, "r": 389.625077, "b": 563.177889 }, "text": "Routing by Stor-Ind method, Time Span= 0.00-72.00 hrs, dt= 0.01 hrs\nPeak Elev= 95.61' @ 2.34 hrs Surf.Area= 4,754 sf Storage= 2,726 cf", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p32.4.7", "order": 11, "type": "table_cell", "bbox": { "l": 54, "t": 551.142469, "r": 401.237248, "b": 527.177889 }, "text": "Plug-Flow detention time= (not calculated: initial storage exceeds outflow)\nCenter-of-Mass det. time= (not calculated: no outflow)", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 } ], "reading_order": 3 }, { "id": "p32.5", "order": 12, "type": "table", "bbox": { "l": 52.32, "t": 515.52, "r": 558.96, "b": 400.32 }, "text": "", "attrs": { "block_label": "table", "n_rows": 2, "n_cols": 5, "integrity": { "cells_checked": 8, "cells_flagged": 0 } }, "children": [ { "id": "p32.5.1", "order": 13, "type": "table_cell", "bbox": { "l": 54, "t": 515.142469, "r": 90.142207, "b": 489.257868 }, "text": "Volume\n#1", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p32.5.2", "order": 14, "type": "table_cell", "bbox": { "l": 120.355217, "t": 515.142469, "r": 148.95691, "b": 489.257868 }, "text": "Invert\n95.00'", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p32.5.3", "order": 15, "type": "table_cell", "bbox": { "l": 170.997811, "t": 515.142469, "r": 234.422951, "b": 489.257868 }, "text": "Avail.Storage\n16,706 cf", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p32.5.4", "order": 16, "type": "table_cell", "bbox": { "l": 246.044461, "t": 515.142469, "r": 502.944852, "b": 489.137889 }, "text": "Storage Description\nCustom Stage Data (Prismatic) Listed below (Recalc)", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p32.5.5", "order": 17, "type": "table_cell", "bbox": { "l": 57.360002, "t": 477.222448, "r": 101.273013, "b": 403.337871 }, "text": "Elevation\\n(feet)\n95.00\n96.00\n97.00\n98.00", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p32.5.6", "order": 18, "type": "table_cell", "bbox": { "l": 140.447365, "t": 477.222448, "r": 185.72688, "b": 403.337871 }, "text": "Surf.Area\\n(sq-ft)\n4,231\n5,092\n6,008\n6,981", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p32.5.7", "order": 19, "type": "table_cell", "bbox": { "l": 227.371027, "t": 477.222448, "r": 354.642567, "b": 403.337871 }, "text": "Inc.Store\\n(cubic-feet)\n0\n4,662\n5,550\n6,495", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p32.5.8", "order": 20, "type": "table_cell", "bbox": { "l": 216.402998, "t": 477.222448, "r": 354.689052, "b": 403.337871 }, "text": "Cum.Store\\n(cubic-feet)\n0\n4,662\n10,212\n16,706", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 7 } ], "reading_order": 4 }, { "id": "p32.6", "order": 21, "type": "table", "bbox": { "l": 52.32, "t": 391.68, "r": 556.56, "b": 290.4 }, "text": "", "attrs": { "block_label": "table", "n_rows": 4, "n_cols": 4, "integrity": { "cells_checked": 16, "cells_flagged": 0 } }, "children": [ { "id": "p32.6.1", "order": 22, "type": "table_cell", "bbox": { "l": 54, "t": 391.302451, "r": 86.679256, "b": 379.337871 }, "text": "Device", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p32.6.2", "order": 23, "type": "table_cell", "bbox": { "l": 98.407976, "t": 391.302451, "r": 135.030741, "b": 379.337871 }, "text": "Routing", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p32.6.3", "order": 24, "type": "table_cell", "bbox": { "l": 182.045624, "t": 391.302451, "r": 208.824841, "b": 379.337871 }, "text": "Invert", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p32.6.4", "order": 25, "type": "table_cell", "bbox": { "l": 220.650048, "t": 391.302451, "r": 290.014595, "b": 379.337871 }, "text": "Outlet Devices", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 3 }, { "id": "p32.6.5", "order": 26, "type": "table_cell", "bbox": { "l": 70.320002, "t": 377.382452, "r": 82.177372, "b": 365.417872 }, "text": "#1", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p32.6.6", "order": 27, "type": "table_cell", "bbox": { "l": 98.408891, "t": 377.382452, "r": 135.204992, "b": 365.417872 }, "text": "Primary", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p32.6.7", "order": 28, "type": "table_cell", "bbox": { "l": 354.69794, "t": 353.382452, "r": 383.299634, "b": 341.417872 }, "text": "97.60'", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p32.6.8", "order": 29, "type": "table_cell", "bbox": { "l": 220.679993, "t": 377.262472, "r": 512.979659, "b": 329.417872 }, "text": "15.0\" Round Culvert to Subsurface Basin X 0.00\\nL= 35.0' RCP, square edge headwall, Ke= 0.500\\nInlet / Outlet Invert= 95.00' / 97.60' S= -0.0743'' Cc= 0.900\\nn= 0.012 Corrugated PP, smooth interior, Flow Area= 1.23 sf", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p32.6.9", "order": 30, "type": "table_cell", "bbox": { "l": 70.320002, "t": 329.382452, "r": 82.177372, "b": 317.417872 }, "text": "#2", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p32.6.10", "order": 31, "type": "table_cell", "bbox": { "l": 98.408891, "t": 329.382452, "r": 139.963293, "b": 317.417872 }, "text": "Device 1", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p32.6.11", "order": 32, "type": "table_cell", "bbox": { "l": 180.316949, "t": 329.382452, "r": 208.918642, "b": 317.417872 }, "text": "97.00'", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p32.6.12", "order": 33, "type": "table_cell", "bbox": { "l": 220.679993, "t": 329.262472, "r": 458.575821, "b": 305.417872 }, "text": "4.0' long Sharp-Crested Rectangular Weir X 0.00\\n2 End Contraction(s)", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 }, { "id": "p32.6.13", "order": 34, "type": "table_cell", "bbox": { "l": 70.320002, "t": 305.382452, "r": 82.177372, "b": 293.417872 }, "text": "#3", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 12 }, { "id": "p32.6.14", "order": 35, "type": "table_cell", "bbox": { "l": 98.408891, "t": 305.382452, "r": 146.474595, "b": 293.417872 }, "text": "Discarded", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p32.6.15", "order": 36, "type": "table_cell", "bbox": { "l": 180.288471, "t": 305.382452, "r": 208.890165, "b": 293.417872 }, "text": "95.00'", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p32.6.16", "order": 37, "type": "table_cell", "bbox": { "l": 220.679993, "t": 305.262472, "r": 452.522253, "b": 293.297892 }, "text": "3.100 in/hr Exfiltration X 0.00 over Surface area", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 } ], "reading_order": 5 }, { "id": "p32.7", "order": 38, "type": "footnote", "bbox": { "l": 51.84, "t": 282.24, "r": 423.84, "b": 256.08 }, "text": "Discarded OutFlow Max=0.00 cfs @ 0.00 hrs HW=95.00' (Free Discharge)\n3=Exfiltration (Controls 0.00 cfs)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 6 }, { "id": "p32.8", "order": 39, "type": "footnote", "bbox": { "l": 51.6, "t": 246.24, "r": 412.08, "b": 207.84 }, "text": "Primary OutFlow Max=0.00 cfs @ 0.00 hrs HW=95.00' (Free Discharge)\n1=Culvert to Subsurface Basin (Controls 0.00 cfs)\n2=Sharp-Crested Rectangular Weir (Controls 0.00 cfs)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 7 } ] }, { "document_id": 16592, "page": 33, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 6, "counts_by_type": { "caption": 1, "figure": 1, "footnote": 1, "header": 2, "text": 1 }, "build_ms": 0, "items": [ { "id": "p33.1", "order": 1, "type": "header", "bbox": { "l": 374.16, "t": 738.96, "r": 560.4, "b": 711.6 }, "text": "NJ DEP 2-hr NJDEP Rainfall=1.25\"\nPrinted 04/12/2025", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p33.2", "order": 2, "type": "header", "bbox": { "l": 52.8, "t": 738, "r": 396, "b": 699.6 }, "text": "102 Sams -REV 12-02-25 NJ\nPrepared by Haler Consulting\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p33.3", "order": 3, "type": "text", "bbox": { "l": 522.72, "t": 711.12, "r": 559.68, "b": 699.12 }, "text": "Page 9", "attrs": { "block_label": "number" }, "reading_order": 2 }, { "id": "p33.4", "order": 4, "type": "caption", "bbox": { "l": 201.12, "t": 687.6, "r": 409.2, "b": 672.96 }, "text": "Pond 174P: WQ Infiltration Basin #1", "attrs": { "block_label": "figure_title" }, "reading_order": 3 }, { "id": "p33.5", "order": 5, "type": "figure", "bbox": { "l": 62.4, "t": 667.92, "r": 550.56, "b": 414 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nInflow\n2.10 cfs Outflow\nInflow Area=108,596 sf Primary\nDiscarded\nPeak Elev=95.61'\nStorage=2,726 cf\n2\n(cfs)\nFlow 1\n0.00 cfs\n0.00 cfs\n0.00 cfs\n0" }, "reading_order": 4 }, { "id": "p33.6", "order": 6, "type": "footnote", "bbox": { "l": 83.28, "t": 420.24, "r": 449.52, "b": 400.8 }, "text": "0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72 Time (hours)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 5 } ] }, { "document_id": 16592, "page": 34, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 11, "counts_by_type": { "caption": 1, "header": 1, "table": 1, "table_cell": 8 }, "build_ms": 30, "items": [ { "id": "p34.1", "order": 1, "type": "header", "bbox": { "l": 53.04, "t": 738.48, "r": 561.12, "b": 698.64 }, "text": "102 Sams -REV 12-02-25 NJ DEP 2-hr NJDEP Rainfall=1.25\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 10", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p34.2", "order": 2, "type": "caption", "bbox": { "l": 153.6, "t": 687.84, "r": 457.44, "b": 672.96 }, "text": "Stage-Discharge for Pond 174P: WQ Infiltration Basin #1", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p34.3", "order": 3, "type": "table", "bbox": { "l": 55.2, "t": 663.12, "r": 508.08, "b": 58.32 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 8, "integrity": { "cells_checked": 8, "cells_flagged": 0 } }, "children": [ { "id": "p34.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 57.479999, "t": 661.126246, "r": 98.137287, "b": 64.158859 }, "text": "Elevation (feet)\n95.00\n95.05\n95.10\n95.15\n95.20\n95.25\n95.30\n95.35\n95.40\n95.45\n95.50\n95.55\n95.60\n95.65\n95.70\n95.75\n95.80\n95.85\n95.90\n95.95\n96.00\n96.05\n96.10\n96.15\n96.20\n96.25\n96.30\n96.35\n96.40\n96.45\n96.50\n96.55\n96.60\n96.65\n96.70\n96.75\n96.80\n96.85\n96.90\n96.95\n97.00\n97.05\n97.10\n97.15\n97.20\n97.25\n97.30\n97.35\n97.40\n97.45\n97.50\n97.55", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p34.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 109.680004, "t": 661.126246, "r": 154.780724, "b": 64.158859 }, "text": "Discharge (cfs)\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p34.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 166.080002, "t": 661.126246, "r": 211.198514, "b": 64.158859 }, "text": "Discarded (cfs)\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p34.3.4", "order": 7, "type": "table_cell", "bbox": { "l": 233.160004, "t": 661.126246, "r": 267.536512, "b": 64.158859 }, "text": "Primary (cfs)\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p34.3.5", "order": 8, "type": "table_cell", "bbox": { "l": 291, "t": 661.126246, "r": 331.657282, "b": 351.198838 }, "text": "Elevation (feet)\n97.60\n97.65\n97.70\n97.75\n97.80\n97.85\n97.90\n97.95\n98.00\n98.05\n98.10\n98.15\n98.20\n98.25\n98.30\n98.35\n98.40\n98.45\n98.50\n98.55\n98.60\n98.65\n98.70\n98.75\n98.80\n98.85", "attrs": { "row": 0, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p34.3.6", "order": 9, "type": "table_cell", "bbox": { "l": 343.200005, "t": 661.126246, "r": 388.053689, "b": 351.198838 }, "text": "Discharge (cfs)\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00", "attrs": { "row": 0, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p34.3.7", "order": 10, "type": "table_cell", "bbox": { "l": 399.599991, "t": 661.126246, "r": 444.395578, "b": 351.198838 }, "text": "Discarded (cfs)\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00", "attrs": { "row": 0, "col": 6, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p34.3.8", "order": 11, "type": "table_cell", "bbox": { "l": 466.679993, "t": 661.126246, "r": 501.056501, "b": 351.198838 }, "text": "Primary (cfs)\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00", "attrs": { "row": 0, "col": 7, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 7 } ], "reading_order": 2 } ] }, { "document_id": 16592, "page": 35, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 11, "counts_by_type": { "caption": 1, "header": 2, "table": 1, "table_cell": 6, "text": 1 }, "build_ms": 11, "items": [ { "id": "p35.1", "order": 1, "type": "header", "bbox": { "l": 374.4, "t": 739.2, "r": 561.12, "b": 712.8 }, "text": "NJ DEP 2-hr NJDEP Rainfall=1.25\"\nPrinted 04/12/2025", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p35.2", "order": 2, "type": "header", "bbox": { "l": 51.84, "t": 738.24, "r": 396.96, "b": 698.88 }, "text": "102 Sams -REV 12-02-25 NJ L\nPrepared by Haler Consulting\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p35.3", "order": 3, "type": "text", "bbox": { "l": 516.72, "t": 711.12, "r": 558.96, "b": 698.88 }, "text": "Page 11", "attrs": { "block_label": "number" }, "reading_order": 2 }, { "id": "p35.4", "order": 4, "type": "caption", "bbox": { "l": 144.96, "t": 687.84, "r": 465.6, "b": 672.72 }, "text": "Stage-Area-Storage for Pond 174P: WQ Infiltration Basin #1", "attrs": { "block_label": "figure_title" }, "reading_order": 3 }, { "id": "p35.5", "order": 5, "type": "table", "bbox": { "l": 54.96, "t": 667.44, "r": 465.6, "b": 54.72 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 6, "integrity": { "cells_checked": 6, "cells_flagged": 0 } }, "children": [ { "id": "p35.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 57.479999, "t": 661.126246, "r": 98.137287, "b": 64.158859 }, "text": "Elevation (feet)\n95.00\n95.05\n95.10\n95.15\n95.20\n95.25\n95.30\n95.35\n95.40\n95.45\n95.50\n95.55\n95.60\n95.65\n95.70\n95.75\n95.80\n95.85\n95.90\n95.95\n96.00\n96.05\n96.10\n96.15\n96.20\n96.25\n96.30\n96.35\n96.40\n96.45\n96.50\n96.55\n96.60\n96.65\n96.70\n96.75\n96.80\n96.85\n96.90\n96.95\n97.00\n97.05\n97.10\n97.15\n97.20\n97.25\n97.30\n97.35\n97.40\n97.45\n97.50\n97.55", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p35.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 139.439999, "t": 661.126246, "r": 173.816353, "b": 64.158859 }, "text": "Surface (sq-ft)\n4,231\n4,274\n4,317\n4,360\n4,403\n4,446\n4,489\n4,532\n4,575\n4,618\n4,662\n4,705\n4,748\n4,791\n4,834\n4,877\n4,920\n4,963\n5,006\n5,049\n5,092\n5,138\n5,184\n5,229\n5,275\n5,321\n5,367\n5,413\n5,458\n5,504\n5,550\n5,596\n5,642\n5,687\n5,733\n5,779\n5,825\n5,871\n5,916\n5,962\n6,008\n6,057\n6,105\n6,154\n6,203\n6,251\n6,300\n6,349\n6,397\n6,446\n6,495\n6,543", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p35.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 199.55999, "t": 661.126246, "r": 249.524304, "b": 64.158859 }, "text": "Storage (cubic-feet)\n0\n213\n427\n644\n863\n1,085\n1,308\n1,534\n1,761\n1,991\n2,223\n2,457\n2,694\n2,932\n3,173\n3,415\n3,660\n3,907\n4,157\n4,408\n4,662\n4,917\n5,175\n5,436\n5,698\n5,963\n6,230\n6,500\n6,772\n7,046\n7,322\n7,601\n7,882\n8,165\n8,450\n8,738\n9,028\n9,321\n9,615\n9,912\n10,212\n10,513\n10,817\n11,124\n11,433\n11,744\n12,058\n12,374\n12,693\n13,014\n13,337\n13,663", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p35.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 273.240005, "t": 661.126246, "r": 313.897287, "b": 351.198838 }, "text": "Elevation (feet)\n97.60\n97.65\n97.70\n97.75\n97.80\n97.85\n97.90\n97.95\n98.00\n98.05\n98.10\n98.15\n98.20\n98.25\n98.30\n98.35\n98.40\n98.45\n98.50\n98.55\n98.60\n98.65\n98.70\n98.75\n98.80\n98.85", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p35.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 355.200005, "t": 661.126246, "r": 389.808242, "b": 351.198838 }, "text": "Surface (sq-ft)\n6,592\n6,640\n6,689\n6,738\n6,786\n6,835\n6,884\n6,932\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981", "attrs": { "row": 0, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p35.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 415.320008, "t": 661.126246, "r": 465.558002, "b": 351.198838 }, "text": "Storage (cubic-feet)\n13,991\n14,322\n14,655\n14,991\n15,329\n15,670\n16,013\n16,358\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706", "attrs": { "row": 0, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 } ], "reading_order": 4 } ] }, { "document_id": 16592, "page": 36, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 39, "counts_by_type": { "footnote": 2, "header": 2, "heading": 1, "table": 3, "table_cell": 31 }, "build_ms": 8, "items": [ { "id": "p36.1", "order": 1, "type": "header", "bbox": { "l": 374.16, "t": 739.68, "r": 561.6, "b": 701.04 }, "text": "NJ DEP 2-hr NJDEP Rainfall=1.25\"\nPrinted 04/12/2025\nLLC Page 12", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p36.2", "order": 2, "type": "header", "bbox": { "l": 52.08, "t": 738, "r": 394.08, "b": 699.12 }, "text": "102 Sams -REV 12-02-25 NJ\nPrepared by Haler Consulting\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p36.3", "order": 3, "type": "heading", "bbox": { "l": 162, "t": 687.84, "r": 450.24, "b": 672.48 }, "text": "Summary for Pond 177P: WQ Infiltration Basin #2", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 2 }, { "id": "p36.4", "order": 4, "type": "table", "bbox": { "l": 52.08, "t": 663.36, "r": 549.36, "b": 524.88 }, "text": "", "attrs": { "block_label": "table", "n_rows": 7, "n_cols": 1, "integrity": { "cells_checked": 7, "cells_flagged": 1, "flags": [ { "row": 4, "col": 0, "coverage": 0, "text": "Primary = 0.00 cfs @ 0.00 hrs, Volume= 0 cf" } ] } }, "children": [ { "id": "p36.4.1", "order": 5, "type": "table_cell", "bbox": { "l": 52.08, "t": 663.36, "r": 549.36, "b": 647.9733 }, "text": "Inflow Area = 86,443 sf, 27.15% Impervious, Inflow Depth = 0.28\" for NJDEP event", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 0 }, { "id": "p36.4.2", "order": 6, "type": "table_cell", "bbox": { "l": 52.08, "t": 647.9733, "r": 549.36, "b": 632.5867 }, "text": "Inflow = 1.38 cfs @ 1.11 hrs, Volume= 2,023 cf", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 1 }, { "id": "p36.4.3", "order": 7, "type": "table_cell", "bbox": { "l": 52.08, "t": 632.5867, "r": 549.36, "b": 617.2 }, "text": "Outflow = 0.00 cfs @ 0.00 hrs, Volume= 0 cf, Atten= 100%, Lag= 0.0 min", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 2 }, { "id": "p36.4.4", "order": 8, "type": "table_cell", "bbox": { "l": 52.08, "t": 617.2, "r": 549.36, "b": 601.8133 }, "text": "Discarded = 0.00 cfs @ 0.00 hrs, Volume= 0 cf", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 3 }, { "id": "p36.4.5", "order": 9, "type": "table_cell", "bbox": { "l": 52.08, "t": 601.8133, "r": 549.36, "b": 586.4267 }, "text": "Primary = 0.00 cfs @ 0.00 hrs, Volume= 0 cf", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 4 }, { "id": "p36.4.6", "order": 10, "type": "table_cell", "bbox": { "l": 54, "t": 587.142469, "r": 389.625077, "b": 563.177889 }, "text": "Routing by Stor-Ind method, Time Span= 0.00-72.00 hrs, dt= 0.01 hrs\nPeak Elev= 91.70' @ 2.55 hrs Surf.Area= 3,116 sf Storage= 2,023 cf", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p36.4.7", "order": 11, "type": "table_cell", "bbox": { "l": 54, "t": 551.142469, "r": 401.237248, "b": 527.177889 }, "text": "Plug-Flow detention time= (not calculated: initial storage exceeds outflow)\nCenter-of-Mass det. time= (not calculated: no outflow)", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 } ], "reading_order": 3 }, { "id": "p36.5", "order": 12, "type": "table", "bbox": { "l": 52.56, "t": 515.28, "r": 558.96, "b": 388.56 }, "text": "", "attrs": { "block_label": "table", "n_rows": 2, "n_cols": 5, "integrity": { "cells_checked": 8, "cells_flagged": 0 } }, "children": [ { "id": "p36.5.1", "order": 13, "type": "table_cell", "bbox": { "l": 54, "t": 515.142469, "r": 90.142207, "b": 489.257868 }, "text": "Volume\n#1", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p36.5.2", "order": 14, "type": "table_cell", "bbox": { "l": 120.355217, "t": 515.142469, "r": 148.95691, "b": 489.257868 }, "text": "Invert\n91.00'", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p36.5.3", "order": 15, "type": "table_cell", "bbox": { "l": 170.997811, "t": 515.142469, "r": 234.422951, "b": 489.257868 }, "text": "Avail.Storage\n13,818 cf", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p36.5.4", "order": 16, "type": "table_cell", "bbox": { "l": 246.044461, "t": 515.142469, "r": 502.944852, "b": 489.137889 }, "text": "Storage Description\nCustom Stage Data (Prismatic) Listed below (Recalc)", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p36.5.5", "order": 17, "type": "table_cell", "bbox": { "l": 57.360002, "t": 477.222448, "r": 101.273013, "b": 391.337871 }, "text": "Elevation\\n(feet)\n91.00\n92.00\n93.00\n94.00\n94.50", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p36.5.6", "order": 18, "type": "table_cell", "bbox": { "l": 140.447365, "t": 477.222448, "r": 185.72688, "b": 391.337871 }, "text": "Surf.Area\\n(sq-ft)\n2,628\n3,320\n4,067\n5,010\n5,438", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p36.5.7", "order": 19, "type": "table_cell", "bbox": { "l": 227.371027, "t": 477.222448, "r": 354.642567, "b": 391.337871 }, "text": "Inc.Store\\n(cubic-feet)\n0\n2,974\n3,694\n4,539\n2,612", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p36.5.8", "order": 20, "type": "table_cell", "bbox": { "l": 216.402998, "t": 477.222448, "r": 354.689052, "b": 391.337871 }, "text": "Cum.Store\\n(cubic-feet)\n0\n2,974\n6,668\n11,206\n13,818", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 7 } ], "reading_order": 4 }, { "id": "p36.6", "order": 21, "type": "table", "bbox": { "l": 52.32, "t": 379.68, "r": 556.32, "b": 277.2 }, "text": "", "attrs": { "block_label": "table", "n_rows": 4, "n_cols": 4, "integrity": { "cells_checked": 16, "cells_flagged": 0 } }, "children": [ { "id": "p36.6.1", "order": 22, "type": "table_cell", "bbox": { "l": 54, "t": 379.302451, "r": 86.679256, "b": 367.337871 }, "text": "Device", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p36.6.2", "order": 23, "type": "table_cell", "bbox": { "l": 98.407976, "t": 379.302451, "r": 135.030741, "b": 367.337871 }, "text": "Routing", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p36.6.3", "order": 24, "type": "table_cell", "bbox": { "l": 182.045624, "t": 379.302451, "r": 208.824841, "b": 367.337871 }, "text": "Invert", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p36.6.4", "order": 25, "type": "table_cell", "bbox": { "l": 220.650048, "t": 379.302451, "r": 290.014595, "b": 367.337871 }, "text": "Outlet Devices", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 3 }, { "id": "p36.6.5", "order": 26, "type": "table_cell", "bbox": { "l": 70.320002, "t": 365.382452, "r": 82.177372, "b": 353.417872 }, "text": "#1", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p36.6.6", "order": 27, "type": "table_cell", "bbox": { "l": 98.408891, "t": 365.382452, "r": 135.204992, "b": 353.417872 }, "text": "Primary", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p36.6.7", "order": 28, "type": "table_cell", "bbox": { "l": 354.69794, "t": 341.382452, "r": 383.299634, "b": 329.417872 }, "text": "93.80'", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p36.6.8", "order": 29, "type": "table_cell", "bbox": { "l": 220.679993, "t": 365.262472, "r": 512.979659, "b": 317.417872 }, "text": "6.0\" Round Culvert to Subsurface Basin X 0.00\\nL = 35.0' RCP, square edge headwall, Ke= 0.500\\nInlet / Outlet Invert= 92.00' / 93.80' S= -0.0514'' Cc= 0.900\\nn= 0.012 Corrugated PP, smooth interior, Flow Area= 0.20 sf", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p36.6.9", "order": 30, "type": "table_cell", "bbox": { "l": 70.320002, "t": 317.382452, "r": 82.177372, "b": 305.417872 }, "text": "#2", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p36.6.10", "order": 31, "type": "table_cell", "bbox": { "l": 98.408891, "t": 317.382452, "r": 139.963293, "b": 305.417872 }, "text": "Device 1", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p36.6.11", "order": 32, "type": "table_cell", "bbox": { "l": 180.316949, "t": 317.382452, "r": 208.918642, "b": 305.417872 }, "text": "93.00'", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p36.6.12", "order": 33, "type": "table_cell", "bbox": { "l": 220.679993, "t": 317.262472, "r": 458.575821, "b": 293.417872 }, "text": "4.0' long Sharp-Crested Rectangular Weir X 0.00\\n2 End Contraction(s)", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 }, { "id": "p36.6.13", "order": 34, "type": "table_cell", "bbox": { "l": 70.320002, "t": 293.382452, "r": 82.177372, "b": 281.417872 }, "text": "#3", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 12 }, { "id": "p36.6.14", "order": 35, "type": "table_cell", "bbox": { "l": 98.408891, "t": 293.382452, "r": 146.474595, "b": 281.417872 }, "text": "Discarded", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p36.6.15", "order": 36, "type": "table_cell", "bbox": { "l": 180.288471, "t": 293.382452, "r": 208.890165, "b": 281.417872 }, "text": "91.00'", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p36.6.16", "order": 37, "type": "table_cell", "bbox": { "l": 220.679993, "t": 293.262472, "r": 452.522253, "b": 281.297892 }, "text": "1.050 in/hr Exfiltration X 0.00 over Surface area", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 } ], "reading_order": 5 }, { "id": "p36.7", "order": 38, "type": "footnote", "bbox": { "l": 51.84, "t": 270.24, "r": 423.36, "b": 243.84 }, "text": "Discarded OutFlow Max=0.00 cfs @ 0.00 hrs HW=91.00' (Free Discharge)\n3=Exfiltration (Controls 0.00 cfs)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 6 }, { "id": "p36.8", "order": 39, "type": "footnote", "bbox": { "l": 51.84, "t": 234.24, "r": 412.56, "b": 196.32 }, "text": "Primary OutFlow Max=0.00 cfs @ 0.00 hrs HW=91.00' (Free Discharge)\n1=Culvert to Subsurface Basin (Controls 0.00 cfs)\n2=Sharp-Crested Rectangular Weir (Controls 0.00 cfs)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 7 } ] }, { "document_id": 16592, "page": 37, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 7, "counts_by_type": { "caption": 1, "figure": 1, "footnote": 2, "header": 2, "text": 1 }, "build_ms": 0, "items": [ { "id": "p37.1", "order": 1, "type": "header", "bbox": { "l": 374.4, "t": 738.96, "r": 560.4, "b": 710.64 }, "text": "NJ DEP 2-hr NJDEP Rainfall=1.25\"\nPrinted 04/12/2025", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p37.2", "order": 2, "type": "header", "bbox": { "l": 52.32, "t": 738, "r": 395.28, "b": 699.12 }, "text": "102 Sams -REV 12-02-25 NJ\nPrepared by Haler Consulting\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p37.3", "order": 3, "type": "text", "bbox": { "l": 517.2, "t": 711.12, "r": 559.2, "b": 699.12 }, "text": "Page 13", "attrs": { "block_label": "number" }, "reading_order": 2 }, { "id": "p37.4", "order": 4, "type": "caption", "bbox": { "l": 200.88, "t": 687.84, "r": 410.64, "b": 672.96 }, "text": "Pond 177P: WQ Infiltration Basin #2", "attrs": { "block_label": "figure_title" }, "reading_order": 3 }, { "id": "p37.5", "order": 5, "type": "figure", "bbox": { "l": 63.36, "t": 667.92, "r": 512.64, "b": 417.36 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n1.38 cfs\nInflow Area=86,443 sf\nPeak Elev=91.70'\nStorage=2,023 cf\n1\n(cfs)\nFlow\n0.00 cfs\n0.00 cfs\n0.00 cfs\n0" }, "reading_order": 4 }, { "id": "p37.6", "order": 6, "type": "footnote", "bbox": { "l": 496.8, "t": 645.12, "r": 547.44, "b": 609.84 }, "text": "Inflow Outflow Discarded Primary", "attrs": { "block_label": "vision_footnote" }, "reading_order": 5 }, { "id": "p37.7", "order": 7, "type": "footnote", "bbox": { "l": 83.04, "t": 420.48, "r": 449.52, "b": 400.8 }, "text": "0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72 Time (hours)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 6 } ] }, { "document_id": 16592, "page": 38, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 11, "counts_by_type": { "caption": 1, "header": 1, "table": 1, "table_cell": 8 }, "build_ms": 26, "items": [ { "id": "p38.1", "order": 1, "type": "header", "bbox": { "l": 53.04, "t": 738.48, "r": 562.08, "b": 698.64 }, "text": "102 Sams -REV 12-02-25 NJ DEP 2-hr NJDEP Rainfall=1.25\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 14", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p38.2", "order": 2, "type": "caption", "bbox": { "l": 153.6, "t": 687.84, "r": 458.16, "b": 672.96 }, "text": "Stage-Discharge for Pond 177P: WQ Infiltration Basin #2", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p38.3", "order": 3, "type": "table", "bbox": { "l": 54.96, "t": 663.36, "r": 507.6, "b": 58.08 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 8, "integrity": { "cells_checked": 8, "cells_flagged": 0 } }, "children": [ { "id": "p38.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 57.479999, "t": 661.126246, "r": 98.137287, "b": 64.158859 }, "text": "Elevation (feet)\n91.00\n91.05\n91.10\n91.15\n91.20\n91.25\n91.30\n91.35\n91.40\n91.45\n91.50\n91.55\n91.60\n91.65\n91.70\n91.75\n91.80\n91.85\n91.90\n91.95\n92.00\n92.05\n92.10\n92.15\n92.20\n92.25\n92.30\n92.35\n92.40\n92.45\n92.50\n92.55\n92.60\n92.65\n92.70\n92.75\n92.80\n92.85\n92.90\n92.95\n93.00\n93.05\n93.10\n93.15\n93.20\n93.25\n93.30\n93.35\n93.40\n93.45\n93.50\n93.55", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p38.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 109.680004, "t": 661.126246, "r": 154.780724, "b": 64.158859 }, "text": "Discharge (cfs)\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p38.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 166.080002, "t": 661.126246, "r": 211.198514, "b": 64.158859 }, "text": "Discarded (cfs)\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p38.3.4", "order": 7, "type": "table_cell", "bbox": { "l": 233.160004, "t": 661.126246, "r": 267.536512, "b": 64.158859 }, "text": "Primary (cfs)\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p38.3.5", "order": 8, "type": "table_cell", "bbox": { "l": 291, "t": 661.126246, "r": 331.657282, "b": 428.478844 }, "text": "Elevation (feet)\n93.60\n93.65\n93.70\n93.75\n93.80\n93.85\n93.90\n93.95\n94.00\n94.05\n94.10\n94.15\n94.20\n94.25\n94.30\n94.35\n94.40\n94.45\n94.50", "attrs": { "row": 0, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p38.3.6", "order": 9, "type": "table_cell", "bbox": { "l": 343.200005, "t": 661.126246, "r": 388.053689, "b": 428.478844 }, "text": "Discharge (cfs)\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00", "attrs": { "row": 0, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p38.3.7", "order": 10, "type": "table_cell", "bbox": { "l": 399.599991, "t": 661.126246, "r": 444.395578, "b": 428.478844 }, "text": "Discarded (cfs)\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00", "attrs": { "row": 0, "col": 6, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p38.3.8", "order": 11, "type": "table_cell", "bbox": { "l": 466.679993, "t": 661.126246, "r": 501.056501, "b": 428.478844 }, "text": "Primary (cfs)\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00", "attrs": { "row": 0, "col": 7, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 7 } ], "reading_order": 2 } ] }, { "document_id": 16592, "page": 39, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 47, "counts_by_type": { "caption": 1, "header": 2, "table": 1, "table_cell": 42, "text": 1 }, "build_ms": 12, "items": [ { "id": "p39.1", "order": 1, "type": "header", "bbox": { "l": 374.4, "t": 739.44, "r": 561.6, "b": 712.32 }, "text": "NJ DEP 2-hr NJDEP Rainfall=1.25\"\nPrinted 04/12/2025", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p39.2", "order": 2, "type": "header", "bbox": { "l": 51.36, "t": 738.24, "r": 396.72, "b": 699.12 }, "text": "102 Sams -REV 12-02-25 NJ L\nPrepared by Haler Consulting\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p39.3", "order": 3, "type": "text", "bbox": { "l": 516.72, "t": 711.12, "r": 559.44, "b": 699.12 }, "text": "Page 15", "attrs": { "block_label": "number" }, "reading_order": 2 }, { "id": "p39.4", "order": 4, "type": "caption", "bbox": { "l": 145.92, "t": 687.84, "r": 466.08, "b": 672.96 }, "text": "Stage-Area-Storage for Pond 177P: WQ Infiltration Basin #2", "attrs": { "block_label": "figure_title" }, "reading_order": 3 }, { "id": "p39.5", "order": 5, "type": "table", "bbox": { "l": 54.96, "t": 665.76, "r": 465.558002, "b": 51.84 }, "text": "", "attrs": { "block_label": "table", "n_rows": 7, "n_cols": 6, "integrity": { "cells_checked": 42, "cells_flagged": 3, "flags": [ { "row": 1, "col": 5, "coverage": 0, "text": "10,463" }, { "row": 3, "col": 5, "coverage": 0, "text": "11,717" }, { "row": 5, "col": 5, "coverage": 0, "text": "12,488" } ] } }, "children": [ { "id": "p39.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 57.479999, "t": 661.126246, "r": 98.137287, "b": 583.038857 }, "text": "Elevation (feet)\n91.00\n91.05\n91.10\n91.15\n91.20", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p39.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 139.439999, "t": 661.126246, "r": 173.816353, "b": 583.038857 }, "text": "Surface (sq-ft)\n2,628\n2,663\n2,697\n2,732\n2,766", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p39.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 199.55999, "t": 661.126246, "r": 249.522956, "b": 583.038857 }, "text": "Storage (cubic-feet)\n0\n132\n266\n402\n539", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p39.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 273.240005, "t": 661.126246, "r": 313.897287, "b": 583.038857 }, "text": "Elevation (feet)\n93.60\n93.65\n93.70\n93.75\n93.80", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p39.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 355.200005, "t": 661.126246, "r": 389.576359, "b": 583.038857 }, "text": "Surface (sq-ft)\n4,633\n4,680\n4,727\n4,774\n4,821", "attrs": { "row": 0, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p39.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 415.320008, "t": 661.126246, "r": 465.284304, "b": 583.038857 }, "text": "Storage (cubic-feet)\n9,277\n9,510\n9,745\n9,983\n10,223", "attrs": { "row": 0, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p39.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 73.320002, "t": 583.006243, "r": 98.137287, "b": 571.9988559999999 }, "text": "91.25", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p39.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 148.972477, "t": 583.006243, "r": 173.773196, "b": 571.9988559999999 }, "text": "2,801", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p39.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 232.992149, "t": 583.006243, "r": 249.447055, "b": 571.9988559999999 }, "text": "679", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p39.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 289.080002, "t": 583.006243, "r": 313.897287, "b": 571.9988559999999 }, "text": "93.85", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p39.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 364.732477, "t": 583.006243, "r": 389.533196, "b": 571.9988559999999 }, "text": "4,869", "attrs": { "row": 1, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p39.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 394.36, "t": 596.2596, "r": 462.24, "b": 584.6762 }, "text": "10,463", "attrs": { "row": 1, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 11 }, { "id": "p39.5.13", "order": 18, "type": "table_cell", "bbox": { "l": 73.320002, "t": 571.966242, "r": 98.137287, "b": 527.838853 }, "text": "91.30\n91.35\n91.40\n91.45", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 12 }, { "id": "p39.5.14", "order": 19, "type": "table_cell", "bbox": { "l": 148.972477, "t": 571.966242, "r": 173.773196, "b": 527.838853 }, "text": "2,836\n2,870\n2,905\n2,939", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 13 }, { "id": "p39.5.15", "order": 20, "type": "table_cell", "bbox": { "l": 224.707019, "t": 571.966242, "r": 249.524304, "b": 527.838853 }, "text": "820\n962\n1,107\n1,253", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 14 }, { "id": "p39.5.16", "order": 21, "type": "table_cell", "bbox": { "l": 289.080002, "t": 571.966242, "r": 313.897287, "b": 527.838853 }, "text": "93.90\n93.95\n94.00\n94.05", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 15 }, { "id": "p39.5.17", "order": 22, "type": "table_cell", "bbox": { "l": 364.732477, "t": 571.966242, "r": 389.533196, "b": 527.838853 }, "text": "4,916\n4,963\n5,010\n5,053", "attrs": { "row": 2, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 16 }, { "id": "p39.5.18", "order": 23, "type": "table_cell", "bbox": { "l": 434.943599, "t": 571.966242, "r": 465.246354, "b": 527.838853 }, "text": "10,710\n10,957\n11,206\n11,458", "attrs": { "row": 2, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 17 }, { "id": "p39.5.19", "order": 24, "type": "table_cell", "bbox": { "l": 73.320002, "t": 527.806238, "r": 98.137287, "b": 516.798851 }, "text": "91.50", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p39.5.20", "order": 25, "type": "table_cell", "bbox": { "l": 148.972477, "t": 527.806238, "r": 173.773196, "b": 516.798851 }, "text": "2,974", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p39.5.21", "order": 26, "type": "table_cell", "bbox": { "l": 224.707019, "t": 527.806238, "r": 249.524304, "b": 516.798851 }, "text": "1,401", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p39.5.22", "order": 27, "type": "table_cell", "bbox": { "l": 289.080002, "t": 527.806238, "r": 313.897287, "b": 516.798851 }, "text": "94.10", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p39.5.23", "order": 28, "type": "table_cell", "bbox": { "l": 364.732477, "t": 527.806238, "r": 389.533196, "b": 516.798851 }, "text": "5,096", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 22 }, { "id": "p39.5.24", "order": 29, "type": "table_cell", "bbox": { "l": 394.36, "t": 538.3426, "r": 462.24, "b": 526.7592 }, "text": "11,717", "attrs": { "row": 3, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 23 }, { "id": "p39.5.25", "order": 30, "type": "table_cell", "bbox": { "l": 73.320002, "t": 516.766237, "r": 98.137287, "b": 494.71885 }, "text": "91.55\n91.60", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 24 }, { "id": "p39.5.26", "order": 31, "type": "table_cell", "bbox": { "l": 148.972477, "t": 516.766237, "r": 173.773196, "b": 494.71885 }, "text": "3,009\n3,043", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 25 }, { "id": "p39.5.27", "order": 32, "type": "table_cell", "bbox": { "l": 224.707019, "t": 516.766237, "r": 249.524304, "b": 494.71885 }, "text": "1,550\n1,701", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 26 }, { "id": "p39.5.28", "order": 33, "type": "table_cell", "bbox": { "l": 289.080002, "t": 516.766237, "r": 313.897287, "b": 494.71885 }, "text": "94.15\n94.20", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 27 }, { "id": "p39.5.29", "order": 34, "type": "table_cell", "bbox": { "l": 364.732477, "t": 516.766237, "r": 389.533196, "b": 494.71885 }, "text": "5,138\n5,181", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 28 }, { "id": "p39.5.30", "order": 35, "type": "table_cell", "bbox": { "l": 434.943599, "t": 516.766237, "r": 465.246354, "b": 494.71885 }, "text": "11,967\n12,225", "attrs": { "row": 4, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 29 }, { "id": "p39.5.31", "order": 36, "type": "table_cell", "bbox": { "l": 73.320002, "t": 494.686236, "r": 98.137287, "b": 483.678849 }, "text": "91.65", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 30 }, { "id": "p39.5.32", "order": 37, "type": "table_cell", "bbox": { "l": 148.972477, "t": 494.686236, "r": 173.773196, "b": 483.678849 }, "text": "3,078", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 31 }, { "id": "p39.5.33", "order": 38, "type": "table_cell", "bbox": { "l": 224.707019, "t": 494.686236, "r": 249.524304, "b": 483.678849 }, "text": "1,854", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 32 }, { "id": "p39.5.34", "order": 39, "type": "table_cell", "bbox": { "l": 289.080002, "t": 494.686236, "r": 313.897287, "b": 483.678849 }, "text": "94.25", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 33 }, { "id": "p39.5.35", "order": 40, "type": "table_cell", "bbox": { "l": 364.732477, "t": 494.686236, "r": 389.533196, "b": 483.678849 }, "text": "5,224", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 34 }, { "id": "p39.5.36", "order": 41, "type": "table_cell", "bbox": { "l": 394.36, "t": 503.5925, "r": 462.24, "b": 492.0091 }, "text": "12,488", "attrs": { "row": 5, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 35 }, { "id": "p39.5.37", "order": 42, "type": "table_cell", "bbox": { "l": 73.320002, "t": 483.646234, "r": 98.137287, "b": 64.158859 }, "text": "91.70\n91.75\n91.80\n91.85\n91.90\n91.95\n92.00\n92.05\n92.10\n92.15\n92.20\n92.25\n92.30\n92.35\n92.40\n92.45\n92.50\n92.55\n92.60\n92.65\n92.70\n92.75\n92.80\n92.85\n92.90\n92.95\n93.00\n93.05\n93.10\n93.15\n93.20\n93.25\n93.30\n93.35\n93.40\n93.45\n93.50\n93.55", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 36 }, { "id": "p39.5.38", "order": 43, "type": "table_cell", "bbox": { "l": 148.972477, "t": 483.646234, "r": 173.773196, "b": 64.158859 }, "text": "3,112\n3,147\n3,182\n3,216\n3,251\n3,285\n3,320\n3,357\n3,395\n3,432\n3,469\n3,507\n3,544\n3,581\n3,619\n3,656\n3,694\n3,731\n3,768\n3,806\n3,843\n3,880\n3,918\n3,955\n3,992\n4,030\n4,067\n4,114\n4,161\n4,208\n4,256\n4,303\n4,350\n4,397\n4,444\n4,491\n4,539\n4,586", "attrs": { "row": 6, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 37 }, { "id": "p39.5.39", "order": 44, "type": "table_cell", "bbox": { "l": 224.707019, "t": 483.646234, "r": 249.524304, "b": 64.158859 }, "text": "2,009\n2,166\n2,324\n2,484\n2,645\n2,809\n2,974\n3,141\n3,310\n3,480\n3,653\n3,827\n4,004\n4,182\n4,362\n4,544\n4,727\n4,913\n5,100\n5,290\n5,481\n5,674\n5,869\n6,066\n6,265\n6,465\n6,668\n6,872\n7,079\n7,288\n7,500\n7,714\n7,930\n8,149\n8,370\n8,593\n8,819\n9,047", "attrs": { "row": 6, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 38 }, { "id": "p39.5.40", "order": 45, "type": "table_cell", "bbox": { "l": 289.080002, "t": 483.646234, "r": 313.897287, "b": 428.478844 }, "text": "94.30\n94.35\n94.40\n94.45\n94.50", "attrs": { "row": 6, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 39 }, { "id": "p39.5.41", "order": 46, "type": "table_cell", "bbox": { "l": 364.732477, "t": 483.646234, "r": 389.808242, "b": 428.478844 }, "text": "5,267\n5,310\n5,352\n5,395\n5,438", "attrs": { "row": 6, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 40 }, { "id": "p39.5.42", "order": 47, "type": "table_cell", "bbox": { "l": 434.943599, "t": 483.646234, "r": 465.558002, "b": 428.478844 }, "text": "12,748\n13,012\n13,278\n13,547\n13,818", "attrs": { "row": 6, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 41 } ], "reading_order": 4 } ] }, { "document_id": 16592, "page": 40, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 1, "counts_by_type": { "heading": 1 }, "build_ms": 0, "items": [ { "id": "p40.1", "order": 1, "type": "heading", "bbox": { "l": 252.48, "t": 717.6, "r": 359.04, "b": 696.96 }, "text": "APPENDIX C", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 0 } ] }, { "document_id": 16592, "page": 41, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 5, "counts_by_type": { "caption": 1, "figure": 1, "footer": 3 }, "build_ms": 0, "items": [ { "id": "p41.1", "order": 1, "type": "figure", "bbox": { "l": 55.68, "t": 733.92, "r": 557.52, "b": 58.56 }, "text": "", "attrs": { "block_label": "image" }, "reading_order": 0 }, { "id": "p41.2", "order": 2, "type": "caption", "bbox": { "l": 276.24, "t": 573.12, "r": 335.76, "b": 557.76 }, "text": "PROPOSED", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p41.3", "order": 3, "type": "footer", "bbox": { "l": 71.28, "t": 97.92, "r": 113.52, "b": 68.88 }, "text": "", "attrs": { "block_label": "footer_image" }, "reading_order": 2 }, { "id": "p41.4", "order": 4, "type": "footer", "bbox": { "l": 126.96, "t": 86.64, "r": 157.68, "b": 72.24 }, "text": "Reach", "attrs": { "block_label": "footer" }, "reading_order": 3 }, { "id": "p41.5", "order": 5, "type": "footer", "bbox": { "l": 289.2, "t": 86.4, "r": 548.4, "b": 56.4 }, "text": "Routing Diagram for 102 Sams -REV 12-02-25\nPrepared by Haler Consulting, Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "footer" }, "reading_order": 4 } ] }, { "document_id": 16592, "page": 42, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 10, "counts_by_type": { "header": 2, "heading": 1, "table": 1, "table_cell": 6 }, "build_ms": 1, "items": [ { "id": "p42.1", "order": 1, "type": "header", "bbox": { "l": 52.08, "t": 737.52, "r": 394.8, "b": 698.88 }, "text": "102 Sams -REV 12-02-25\nPrepared by Haler Consulting\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p42.2", "order": 2, "type": "header", "bbox": { "l": 463.2, "t": 724.56, "r": 560.16, "b": 698.88 }, "text": "Printed 04/12/2025\nPage 2", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p42.3", "order": 3, "type": "heading", "bbox": { "l": 226.32, "t": 687.36, "r": 386.16, "b": 672.96 }, "text": "Area Listing (selected nodes)", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 2 }, { "id": "p42.4", "order": 4, "type": "table", "bbox": { "l": 52.08, "t": 663.36, "r": 444.48, "b": 562.08 }, "text": "", "attrs": { "block_label": "table", "n_rows": 2, "n_cols": 3, "integrity": { "cells_checked": 6, "cells_flagged": 0 } }, "children": [ { "id": "p42.4.1", "order": 5, "type": "table_cell", "bbox": { "l": 116.879997, "t": 661.126246, "r": 143.086498, "b": 636.318852 }, "text": "Area (sq-ft)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 0 }, { "id": "p42.4.2", "order": 6, "type": "table_cell", "bbox": { "l": 165.479999, "t": 661.126246, "r": 179.801438, "b": 650.1188589999999 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 1 }, { "id": "p42.4.3", "order": 7, "type": "table_cell", "bbox": { "l": 200.001374, "t": 661.126246, "r": 311.238628, "b": 636.318852 }, "text": "Description (subcatchment-numbers)", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 2 }, { "id": "p42.4.4", "order": 8, "type": "table_cell", "bbox": { "l": 107.279995, "t": 629.926241, "r": 143.321918, "b": 563.71885 }, "text": "239,315\n60,345\n4,000\n236,879\n540,539", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p42.4.5", "order": 9, "type": "table_cell", "bbox": { "l": 168.786654, "t": 629.926241, "r": 180.111841, "b": 563.71885 }, "text": "39\n98\n98\n30\n42", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p42.4.6", "order": 10, "type": "table_cell", "bbox": { "l": 200.002058, "t": 629.926241, "r": 441.06925, "b": 563.71885 }, "text": ">75% Grass cover, Good, HSG A (148S, 149S, 150S)\nPaved parking, HSG A (141S, 143S, 172S)\nUnconnected roofs, HSG A (145S)\nWoods, Good, HSG A (149S)\nTOTAL AREA", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 } ], "reading_order": 3 } ] }, { "document_id": 16592, "page": 43, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 2, "counts_by_type": { "text": 2 }, "build_ms": 1, "items": [ { "id": "p43.1", "order": 1, "type": "text", "bbox": { "l": 50.88, "t": 739.2, "r": 561.12, "b": 699.36 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 2-Year Rainfall=3.42\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 3", "reading_order": 0 }, { "id": "p43.2", "order": 2, "type": "text", "bbox": { "l": 50.16, "t": 688.8, "r": 561.6, "b": 216.72 }, "text": "Time span=0.00-72.00 hrs, dt=0.01 hrs, 7201 points\nRunoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious\nReach routing by Stor-Ind+Trans method - Pond routing by Stor-Ind method\nSubcatchment 141S: DA P1 (Impervious) Runoff Area=31,625 sf 100.00% Impervious Runoff Depth=3.19\"\nFlow Length=450' Tc=3.0 min CN=0/98 Runoff=2.34 cfs 8,398 cf\nSubcatchment 143S: DA P2 (Impervious) Runoff Area=23,470 sf 100.00% Impervious Runoff Depth=3.19\"\nFlow Length=450' Tc=4.9 min CN=0/98 Runoff=1.53 cfs 6,233 cf\nSubcatchment 145S: DA P5 (4000 SF Roof) Runoff Area=4,000 sf 0.00% Impervious Runoff Depth=3.19\"\nTc=6.0 min CN=98/0 Runoff=0.24 cfs 1,062 cf\nSubcatchment 148S: DA P3 (Pervious) Runoff Area=62,973 sf 0.00% Impervious Runoff Depth=0.01\"\nFlow Length=316' Slope=0.0200'/' Tc=13.1 min CN=39/0 Runoff=0.00 cfs 28 cf\nSubcatchment 149S: DA P0 Pervious Runoff Area=336,250 sf 0.00% Impervious Runoff Depth=0.00\"\nFlow Length=679' Tc=49.8 min CN=33/0 Runoff=0.00 cfs 0 cf\nSubcatchment 150S: DA P4 (Pervious) Runoff Area=76,971 sf 0.00% Impervious Runoff Depth=0.01\"\nFlow Length=196' Slope=0.0100'/' Tc=14.8 min CN=39/0 Runoff=0.00 cfs 34 cf\nSubcatchment 172S: DA P6 (Impervious) Runoff Area=5,250 sf 100.00% Impervious Runoff Depth=3.19\"\nFlow Length=150' Tc=1.4 min CN=0/98 Runoff=0.43 cfs 1,394 cf\nPond 130P: SUBSURFACE Peak Elev=1.35' Storage=277 cf Inflow=0.24 cfs 1,062 cf\nOutflow=0.04 cfs 1,062 cf\nPond 144P: WQ Infiltration Basin #1 Peak Elev=95.51' Storage=2,258 cf Inflow=2.34 cfs 8,433 cf\nDiscarded=0.33 cfs 8,433 cf Primary=0.00 cfs 0 cf Outflow=0.33 cfs 8,433 cf\nPond 149P: WQ Infiltration Basin #2 Peak Elev=92.02' Storage=3,026 cf Inflow=1.53 cfs 6,261 cf\nDiscarded=0.08 cfs 6,261 cf Primary=0.00 cfs 0 cf Outflow=0.08 cfs 6,261 cf\nLink 147L: POA Inflow=0.43 cfs 1,394 cf Primary=0.43 cfs 1,394 cf\nTotal Runoff Area = 540,539 sf Runoff Volume = 17,150 cf Average Runoff Depth = 0.38\"\n88.84% Pervious = 480,194 sf 11.16% Impervious = 60,345 sf", "attrs": { "block_label": "algorithm" }, "reading_order": 1 } ] }, { "document_id": 16592, "page": 44, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 34, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "table": 1, "table_cell": 24, "text": 5, "title": 1 }, "build_ms": 3, "items": [ { "id": "p44.1", "order": 1, "type": "header", "bbox": { "l": 53.28, "t": 738.24, "r": 560.64, "b": 698.64 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 2-Year Rainfall=3.42\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 4", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p44.2", "order": 2, "type": "title", "bbox": { "l": 148.08, "t": 687.36, "r": 463.92, "b": 672.24 }, "text": "Summary for Subcatchment 141S: DA P1 (Impervious)", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p44.3", "order": 3, "type": "text", "bbox": { "l": 52.32, "t": 659.76, "r": 303.84, "b": 647.04 }, "text": "Runoff = 2.34 cfs @ 12.11 hrs, Volume=8,398 cf, Depth=3.19\"", "reading_order": 2 }, { "id": "p44.4", "order": 4, "type": "text", "bbox": { "l": 66.24, "t": 647.28, "r": 294.48, "b": 634.56 }, "text": "Routed to Pond 144P : WQ Infiltration Basin #1", "reading_order": 3 }, { "id": "p44.5", "order": 5, "type": "text", "bbox": { "l": 347.04, "t": 660, "r": 463.44, "b": 646.56 }, "text": "8,398 cf, Depth= 3.19\"", "reading_order": 4 }, { "id": "p44.6", "order": 6, "type": "text", "bbox": { "l": 52.32, "t": 623.76, "r": 610.8, "b": 598.32 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious, Time Span= 0.00-72.00 hrs, dt= NOAA 24-hr D 2-Year Rainfall=3.42\"", "reading_order": 5 }, { "id": "p44.7", "order": 7, "type": "table", "bbox": { "l": 52.56, "t": 588.72, "r": 559.2, "b": 447.497874 }, "text": "", "attrs": { "block_label": "table", "n_rows": 6, "n_cols": 5, "integrity": { "cells_checked": 22, "cells_flagged": 0 } }, "children": [ { "id": "p44.7.1", "order": 8, "type": "table_cell", "bbox": { "l": 86.520001, "t": 587.142469, "r": 127.590159, "b": 575.177889 }, "text": "Area (sf)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p44.7.2", "order": 9, "type": "table_cell", "bbox": { "l": 144.389888, "t": 587.142469, "r": 159.742288, "b": 575.177889 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p44.7.3", "order": 10, "type": "table_cell", "bbox": { "l": 286.601768, "t": 535.302451, "r": 340.102911, "b": 523.337871 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p44.7.4", "order": 11, "type": "table_cell", "bbox": { "l": 95.280001, "t": 559.302451, "r": 127.805562, "b": 547.337871 }, "text": "31,625", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 3 }, { "id": "p44.7.5", "order": 12, "type": "table_cell", "bbox": { "l": 148.003832, "t": 559.302451, "r": 159.753993, "b": 547.337871 }, "text": "98", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p44.7.6", "order": 13, "type": "table_cell", "bbox": { "l": 174.16295, "t": 573.222448, "r": 281.259838, "b": 561.257868 }, "text": "Paved parking, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 5 }, { "id": "p44.7.7", "order": 14, "type": "table_cell", "bbox": { "l": 95.280001, "t": 573.222448, "r": 127.805562, "b": 561.257868 }, "text": "31,625", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p44.7.8", "order": 15, "type": "table_cell", "bbox": { "l": 148.003832, "t": 573.222448, "r": 159.753993, "b": 561.257868 }, "text": "98", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p44.7.9", "order": 16, "type": "table_cell", "bbox": { "l": 174.16295, "t": 559.302451, "r": 296.664294, "b": 547.337871 }, "text": "100.00% Impervious Area", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 8 }, { "id": "p44.7.10", "order": 17, "type": "table_cell", "bbox": { "l": 65.040001, "t": 535.302451, "r": 89.475992, "b": 497.417872 }, "text": "Tc (min)\n1.2", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 9 }, { "id": "p44.7.11", "order": 18, "type": "table_cell", "bbox": { "l": 100.248415, "t": 535.302451, "r": 132.68142, "b": 497.417872 }, "text": "Length (feet)\n100", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 10 }, { "id": "p44.7.12", "order": 19, "type": "table_cell", "bbox": { "l": 143.445254, "t": 535.302451, "r": 175.895438, "b": 497.417872 }, "text": "Slope (ft/ft)\n0.0200", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 11 }, { "id": "p44.7.13", "order": 20, "type": "table_cell", "bbox": { "l": 186.552062, "t": 535.302451, "r": 223.968178, "b": 497.417872 }, "text": "Velocity (ft/sec)\n1.42", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 12 }, { "id": "p44.7.14", "order": 21, "type": "table_cell", "bbox": { "l": 234.581918, "t": 535.302451, "r": 473.002733, "b": 485.417872 }, "text": "Capacity (cfs)\nSheet Flow, Smooth surfaces n= 0.011 P2= 3.42\"", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 13 }, { "id": "p44.7.15", "order": 22, "type": "table_cell", "bbox": { "l": 74.639998, "t": 485.382452, "r": 89.475992, "b": 473.417872 }, "text": "1.8", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p44.7.16", "order": 23, "type": "table_cell", "bbox": { "l": 114.927527, "t": 485.382452, "r": 132.68142, "b": 473.417872 }, "text": "350", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p44.7.17", "order": 24, "type": "table_cell", "bbox": { "l": 143.445254, "t": 485.382452, "r": 175.863606, "b": 473.417872 }, "text": "0.0250", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p44.7.18", "order": 25, "type": "table_cell", "bbox": { "l": 203.137703, "t": 485.382452, "r": 223.870219, "b": 473.417872 }, "text": "3.21", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p44.7.19", "order": 26, "type": "table_cell", "bbox": { "l": 286.679993, "t": 485.26245, "r": 425.623588, "b": 461.417872 }, "text": "Shallow Concentrated Flow, Paved Kv= 20.3 fps", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p44.7.20", "order": 27, "type": "table_cell", "bbox": { "l": 74.639998, "t": 459.462454, "r": 89.475992, "b": 447.497874 }, "text": "3.0", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p44.7.21", "order": 28, "type": "table_cell", "bbox": { "l": 114.927527, "t": 459.462454, "r": 132.68142, "b": 447.497874 }, "text": "450", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p44.7.22", "order": 29, "type": "table_cell", "bbox": { "l": 143.445254, "t": 459.462454, "r": 167.029543, "b": 447.497874 }, "text": "Total", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p44.7.23", "order": 30, "type": "table_cell", "bbox": { "l": 356.544, "t": 470.64, "r": 457.872, "b": 450.96 }, "text": "", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 22 }, { "id": "p44.7.24", "order": 31, "type": "table_cell", "bbox": { "l": 457.872, "t": 470.64, "r": 559.2, "b": 450.96 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 23 } ], "reading_order": 6 }, { "id": "p44.8", "order": 32, "type": "caption", "bbox": { "l": 186.96, "t": 435.12, "r": 424.56, "b": 420 }, "text": "Subcatchment 141S: DA P1 (Impervious)", "attrs": { "block_label": "figure_title" }, "reading_order": 7 }, { "id": "p44.9", "order": 33, "type": "figure", "bbox": { "l": 60.72, "t": 416.88, "r": 552.24, "b": 150 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nRunoff\n2.34 cfs\nNOAA 24-hr D\n2 2-Year Rainfall=3.42\"\nRunoff Area=31,625 sf\nRunoff Volume=8,398 cf\n(cfs) Runoff Depth=3.19\"\nFlow Flow Length=450'\nTc=3.0 min\n1\nCN=0/98\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72\nTime (hours)" }, "reading_order": 8 }, { "id": "p44.10", "order": 34, "type": "text", "bbox": { "l": 265.44, "t": 155.76, "r": 312.96, "b": 147.12 }, "text": "Time (hours)", "attrs": { "block_label": "number" }, "reading_order": 9 } ] }, { "document_id": 16592, "page": 45, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 34, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "table": 1, "table_cell": 24, "text": 5, "title": 1 }, "build_ms": 3, "items": [ { "id": "p45.1", "order": 1, "type": "header", "bbox": { "l": 53.28, "t": 738.24, "r": 560.64, "b": 698.64 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 2-Year Rainfall=3.42\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 5", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p45.2", "order": 2, "type": "title", "bbox": { "l": 148.08, "t": 687.36, "r": 463.92, "b": 672.24 }, "text": "Summary for Subcatchment 143S: DA P2 (Impervious)", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p45.3", "order": 3, "type": "text", "bbox": { "l": 52.08, "t": 659.52, "r": 303.84, "b": 647.04 }, "text": "Runoff = 1.53 cfs @ 12.13 hrs, Volume=6,233 cf, Depth= 3.19\"", "reading_order": 2 }, { "id": "p45.4", "order": 4, "type": "text", "bbox": { "l": 66.24, "t": 647.28, "r": 294.96, "b": 634.56 }, "text": "Routed to Pond 149P : WQ Infiltration Basin #2", "reading_order": 3 }, { "id": "p45.5", "order": 5, "type": "text", "bbox": { "l": 347.04, "t": 660, "r": 463.44, "b": 646.8 }, "text": "6,233 cf, Depth= 3.19\"", "reading_order": 4 }, { "id": "p45.6", "order": 6, "type": "text", "bbox": { "l": 52.32, "t": 623.76, "r": 611.04, "b": 598.32 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious, Time Span= 0.00-72.00 hrs, dt= NOAA 24-hr D 2-Year Rainfall=3.42\"", "reading_order": 5 }, { "id": "p45.7", "order": 7, "type": "table", "bbox": { "l": 52.56, "t": 588.48, "r": 558.96, "b": 447.497874 }, "text": "", "attrs": { "block_label": "table", "n_rows": 6, "n_cols": 5, "integrity": { "cells_checked": 22, "cells_flagged": 0 } }, "children": [ { "id": "p45.7.1", "order": 8, "type": "table_cell", "bbox": { "l": 86.520001, "t": 587.142469, "r": 127.590159, "b": 575.177889 }, "text": "Area (sf)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p45.7.2", "order": 9, "type": "table_cell", "bbox": { "l": 144.389888, "t": 587.142469, "r": 159.742288, "b": 575.177889 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p45.7.3", "order": 10, "type": "table_cell", "bbox": { "l": 286.601768, "t": 535.302451, "r": 340.102911, "b": 523.337871 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p45.7.4", "order": 11, "type": "table_cell", "bbox": { "l": 95.280001, "t": 559.302451, "r": 127.805562, "b": 547.337871 }, "text": "23,470", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 3 }, { "id": "p45.7.5", "order": 12, "type": "table_cell", "bbox": { "l": 148.003832, "t": 559.302451, "r": 159.753993, "b": 547.337871 }, "text": "98", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p45.7.6", "order": 13, "type": "table_cell", "bbox": { "l": 174.16295, "t": 573.222448, "r": 281.259838, "b": 561.257868 }, "text": "Paved parking, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 5 }, { "id": "p45.7.7", "order": 14, "type": "table_cell", "bbox": { "l": 95.280001, "t": 573.222448, "r": 127.805562, "b": 561.257868 }, "text": "23,470", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p45.7.8", "order": 15, "type": "table_cell", "bbox": { "l": 148.003832, "t": 573.222448, "r": 159.753993, "b": 561.257868 }, "text": "98", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p45.7.9", "order": 16, "type": "table_cell", "bbox": { "l": 174.16295, "t": 559.302451, "r": 296.664294, "b": 547.337871 }, "text": "100.00% Impervious Area", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 8 }, { "id": "p45.7.10", "order": 17, "type": "table_cell", "bbox": { "l": 65.040001, "t": 535.302451, "r": 89.475992, "b": 497.417872 }, "text": "Tc (min)\n0.8", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 9 }, { "id": "p45.7.11", "order": 18, "type": "table_cell", "bbox": { "l": 100.248415, "t": 535.302451, "r": 132.68142, "b": 497.417872 }, "text": "Length (feet)\n100", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 10 }, { "id": "p45.7.12", "order": 19, "type": "table_cell", "bbox": { "l": 143.445254, "t": 535.302451, "r": 175.895438, "b": 497.417872 }, "text": "Slope (ft/ft)\n0.0500", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 11 }, { "id": "p45.7.13", "order": 20, "type": "table_cell", "bbox": { "l": 186.552062, "t": 535.302451, "r": 223.968178, "b": 497.417872 }, "text": "Velocity (ft/sec)\n2.05", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 12 }, { "id": "p45.7.14", "order": 21, "type": "table_cell", "bbox": { "l": 234.581918, "t": 535.302451, "r": 473.002733, "b": 485.417872 }, "text": "Capacity (cfs)\nSheet Flow, Smooth surfaces n= 0.011 P2= 3.42\"", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 13 }, { "id": "p45.7.15", "order": 22, "type": "table_cell", "bbox": { "l": 74.639998, "t": 485.382452, "r": 89.475992, "b": 473.417872 }, "text": "4.1", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p45.7.16", "order": 23, "type": "table_cell", "bbox": { "l": 114.927527, "t": 485.382452, "r": 132.68142, "b": 473.417872 }, "text": "350", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p45.7.17", "order": 24, "type": "table_cell", "bbox": { "l": 143.445254, "t": 485.382452, "r": 175.863606, "b": 473.417872 }, "text": "0.0050", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p45.7.18", "order": 25, "type": "table_cell", "bbox": { "l": 203.137703, "t": 485.382452, "r": 223.870219, "b": 473.417872 }, "text": "1.44", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p45.7.19", "order": 26, "type": "table_cell", "bbox": { "l": 286.679993, "t": 485.26245, "r": 425.623588, "b": 461.417872 }, "text": "Shallow Concentrated Flow, Paved Kv= 20.3 fps", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p45.7.20", "order": 27, "type": "table_cell", "bbox": { "l": 74.639998, "t": 459.462454, "r": 89.475992, "b": 447.497874 }, "text": "4.9", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p45.7.21", "order": 28, "type": "table_cell", "bbox": { "l": 114.927527, "t": 459.462454, "r": 132.68142, "b": 447.497874 }, "text": "450", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p45.7.22", "order": 29, "type": "table_cell", "bbox": { "l": 143.445254, "t": 459.462454, "r": 167.029543, "b": 447.497874 }, "text": "Total", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p45.7.23", "order": 30, "type": "table_cell", "bbox": { "l": 356.4, "t": 471.0171, "r": 457.68, "b": 451.44 }, "text": "", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 22 }, { "id": "p45.7.24", "order": 31, "type": "table_cell", "bbox": { "l": 457.68, "t": 471.0171, "r": 558.96, "b": 451.44 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 23 } ], "reading_order": 6 }, { "id": "p45.8", "order": 32, "type": "caption", "bbox": { "l": 186.96, "t": 435.12, "r": 424.56, "b": 419.76 }, "text": "Subcatchment 143S: DA P2 (Impervious)", "attrs": { "block_label": "figure_title" }, "reading_order": 7 }, { "id": "p45.9", "order": 33, "type": "figure", "bbox": { "l": 60.24, "t": 415.92, "r": 553.2, "b": 149.76 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nRunoff\n1.53 cfs\nNOAA 24-hr D\n2-Year Rainfall=3.42\"\nRunoff Area=23,470 sf\nRunoff Volume=6,233 cf\n1\n(cfs) Runoff Depth=3.19\"\nFlow Flow Length=450'\nTc=4.9 min\nCN=0/98\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72\nTime (hours)" }, "reading_order": 8 }, { "id": "p45.10", "order": 34, "type": "text", "bbox": { "l": 265.44, "t": 155.76, "r": 312.96, "b": 147.12 }, "text": "Time (hours)", "attrs": { "block_label": "number" }, "reading_order": 9 } ] }, { "document_id": 16592, "page": 46, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 21, "counts_by_type": { "caption": 1, "figure": 1, "footer": 1, "footnote": 1, "header": 1, "table": 1, "table_cell": 12, "text": 2, "title": 1 }, "build_ms": 2, "items": [ { "id": "p46.1", "order": 1, "type": "header", "bbox": { "l": 53.76, "t": 738.48, "r": 559.92, "b": 698.4 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 2-Year Rainfall=3.42\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 6", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p46.2", "order": 2, "type": "title", "bbox": { "l": 142.08, "t": 687.6, "r": 470.4, "b": 672.24 }, "text": "Summary for Subcatchment 145S: DA P5 (4000 SF Roof)", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p46.3", "order": 3, "type": "text", "bbox": { "l": 54, "t": 660.48, "r": 463.68, "b": 634.08 }, "text": "Runoff = 0.24 cfs @ 12.14 hrs, Volume= 1,062 cf, Depth= 3.19\"\nRouted to Pond 130P : SUBSURFACE", "reading_order": 2 }, { "id": "p46.4", "order": 4, "type": "text", "bbox": { "l": 51.84, "t": 623.76, "r": 611.52, "b": 598.32 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious, Time Span= 0.00-72.00 hrs, dt= NOAA 24-hr D 2-Year Rainfall=3.42\"", "reading_order": 3 }, { "id": "p46.5", "order": 5, "type": "table", "bbox": { "l": 53.04, "t": 587.142469, "r": 559.92, "b": 497.29787 }, "text": "", "attrs": { "block_label": "table", "n_rows": 4, "n_cols": 3, "integrity": { "cells_checked": 12, "cells_flagged": 0 } }, "children": [ { "id": "p46.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 86.520001, "t": 587.142469, "r": 127.590159, "b": 575.177889 }, "text": "Area (sf)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p46.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 144.389888, "t": 587.142469, "r": 159.742288, "b": 575.177889 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p46.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 286.601768, "t": 535.302451, "r": 340.102911, "b": 523.337871 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p46.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 101.160004, "t": 559.302451, "r": 127.789043, "b": 547.337871 }, "text": "4,000", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 3 }, { "id": "p46.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 147.987313, "t": 559.302451, "r": 159.844683, "b": 547.337871 }, "text": "98", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p46.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 174.146431, "t": 573.222448, "r": 302.745943, "b": 561.257868 }, "text": "Unconnected roofs, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p46.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 101.160004, "t": 573.222448, "r": 127.789043, "b": 561.257868 }, "text": "4,000", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p46.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 147.987313, "t": 573.222448, "r": 159.844683, "b": 561.257868 }, "text": "98", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p46.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 174.146431, "t": 559.302451, "r": 286.007022, "b": 547.337871 }, "text": "100.00% Pervious Area", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p46.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 65.040001, "t": 535.302451, "r": 89.475992, "b": 497.417872 }, "text": "Tc (min)\n6.0", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 9 }, { "id": "p46.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 100.248415, "t": 535.302451, "r": 348.647167, "b": 497.29787 }, "text": "Length (feet)\nDirect Entry,", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 10 }, { "id": "p46.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 148.683866, "t": 535.302451, "r": 275.988028, "b": 511.337871 }, "text": "Slope (ft/ft) Velocity (ft/sec) Capacity (cfs)", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 } ], "reading_order": 4 }, { "id": "p46.6", "order": 18, "type": "caption", "bbox": { "l": 180.96, "t": 485.04, "r": 430.56, "b": 469.92 }, "text": "Subcatchment 145S: DA P5 (4000 SF Roof)", "attrs": { "block_label": "figure_title" }, "reading_order": 5 }, { "id": "p46.7", "order": 19, "type": "figure", "bbox": { "l": 63.36, "t": 463.44, "r": 498.48, "b": 201.6 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n0.26\n0.24 cfs\nNOAA 24-hr D\n0.24\n2-Year Rainfall=3.42\"\n0.22\n0.2\nRunoff Area=4,000 sf\n0.18\n0.16 Runoff Volume=1,062 cf\n(cfs) 0.14 Runoff Depth=3.19\"\nFlow 0.12 Tc=6.0 min\nCN=98/0\n0.1\n0.08\n0.06\n0.04\n0.02\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72" }, "reading_order": 6 }, { "id": "p46.8", "order": 20, "type": "footnote", "bbox": { "l": 89.76, "t": 216.72, "r": 492.48, "b": 197.52 }, "text": "6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72 Time (hours)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 7 }, { "id": "p46.9", "order": 21, "type": "footer", "bbox": { "l": 509.76, "t": 443.28, "r": 547.68, "b": 430.8 }, "text": "", "attrs": { "block_label": "footer_image" }, "reading_order": 8 } ] }, { "document_id": 16592, "page": 47, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 32, "counts_by_type": { "caption": 1, "figure": 2, "table": 1, "table_cell": 24, "text": 3, "title": 1 }, "build_ms": 4, "items": [ { "id": "p47.1", "order": 1, "type": "figure", "bbox": { "l": 53.28, "t": 738.48, "r": 560.64, "b": 698.64 }, "text": "", "attrs": { "role": "page_header", "block_label": "header_image", "embedded_text": "102 Sams -REV 12-02-25 NOAA 24-hr D 2-Year Rainfall=3.42\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 7" }, "reading_order": 0 }, { "id": "p47.2", "order": 2, "type": "title", "bbox": { "l": 154.8, "t": 687.36, "r": 457.2, "b": 672.24 }, "text": "Summary for Subcatchment 148S: DA P3 (Pervious)", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p47.3", "order": 3, "type": "text", "bbox": { "l": 53.76, "t": 660.24, "r": 463.2, "b": 634.08 }, "text": "Runoff = 0.00 cfs @ 24.01 hrs, Volume= 28 cf, Depth= 0.01\"\nRouted to Pond 149P : WQ Infiltration Basin #2", "reading_order": 2 }, { "id": "p47.4", "order": 4, "type": "text", "bbox": { "l": 52.32, "t": 623.52, "r": 611.04, "b": 598.32 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious, Time Span= 0.00-72.00 hrs, dt= NOAA 24-hr D 2-Year Rainfall=3.42\"", "reading_order": 3 }, { "id": "p47.5", "order": 5, "type": "table", "bbox": { "l": 52.56, "t": 588.72, "r": 558.96, "b": 447.497874 }, "text": "", "attrs": { "block_label": "table", "n_rows": 6, "n_cols": 5, "integrity": { "cells_checked": 22, "cells_flagged": 0 } }, "children": [ { "id": "p47.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 86.520001, "t": 587.142469, "r": 127.590159, "b": 575.177889 }, "text": "Area (sf)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p47.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 144.389888, "t": 587.142469, "r": 159.742288, "b": 575.177889 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p47.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 286.601768, "t": 535.302451, "r": 340.102911, "b": 523.337871 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p47.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 95.280001, "t": 559.302451, "r": 127.805562, "b": 547.337871 }, "text": "62,973", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 3 }, { "id": "p47.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 148.003832, "t": 559.302451, "r": 159.753993, "b": 547.337871 }, "text": "39", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p47.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 174.16295, "t": 573.222448, "r": 333.31717, "b": 561.257868 }, "text": ">75% Grass cover, Good, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 5 }, { "id": "p47.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 95.280001, "t": 573.222448, "r": 127.805562, "b": 561.257868 }, "text": "62,973", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p47.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 148.003832, "t": 573.222448, "r": 159.753993, "b": 561.257868 }, "text": "39", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p47.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 174.16295, "t": 559.302451, "r": 286.000299, "b": 547.337871 }, "text": "100.00% Pervious Area", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 8 }, { "id": "p47.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 65.040001, "t": 535.302451, "r": 89.475992, "b": 497.417872 }, "text": "Tc (min)\n9.5", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 9 }, { "id": "p47.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 100.248415, "t": 535.302451, "r": 132.68142, "b": 497.417872 }, "text": "Length (feet)\n100", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 10 }, { "id": "p47.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 143.445254, "t": 535.302451, "r": 175.895438, "b": 497.417872 }, "text": "Slope (ft/ft)\n0.0200", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 11 }, { "id": "p47.5.13", "order": 18, "type": "table_cell", "bbox": { "l": 186.552062, "t": 535.302451, "r": 223.968178, "b": 497.417872 }, "text": "Velocity (ft/sec)\n0.18", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 12 }, { "id": "p47.5.14", "order": 19, "type": "table_cell", "bbox": { "l": 234.581918, "t": 535.302451, "r": 452.820335, "b": 485.417872 }, "text": "Capacity (cfs)\nSheet Flow, Grass: Short n= 0.150 P2= 3.42\"", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 13 }, { "id": "p47.5.15", "order": 20, "type": "table_cell", "bbox": { "l": 74.639998, "t": 485.382452, "r": 89.475992, "b": 473.417872 }, "text": "3.6", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p47.5.16", "order": 21, "type": "table_cell", "bbox": { "l": 114.927527, "t": 485.382452, "r": 132.68142, "b": 473.417872 }, "text": "216", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p47.5.17", "order": 22, "type": "table_cell", "bbox": { "l": 143.445254, "t": 485.382452, "r": 175.863606, "b": 473.417872 }, "text": "0.0200", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p47.5.18", "order": 23, "type": "table_cell", "bbox": { "l": 203.137703, "t": 485.382452, "r": 223.870219, "b": 473.417872 }, "text": "0.99", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p47.5.19", "order": 24, "type": "table_cell", "bbox": { "l": 286.679993, "t": 485.26245, "r": 446.147004, "b": 461.417872 }, "text": "Shallow Concentrated Flow, Short Grass Pasture Kv= 7.0 fps", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p47.5.20", "order": 25, "type": "table_cell", "bbox": { "l": 68.76, "t": 459.462454, "r": 89.492517, "b": 447.497874 }, "text": "13.1", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p47.5.21", "order": 26, "type": "table_cell", "bbox": { "l": 114.944052, "t": 459.462454, "r": 132.697945, "b": 447.497874 }, "text": "316", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p47.5.22", "order": 27, "type": "table_cell", "bbox": { "l": 143.354569, "t": 459.462454, "r": 166.947862, "b": 447.497874 }, "text": "Total", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p47.5.23", "order": 28, "type": "table_cell", "bbox": { "l": 356.4, "t": 470.8457, "r": 457.68, "b": 451.2 }, "text": "", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 22 }, { "id": "p47.5.24", "order": 29, "type": "table_cell", "bbox": { "l": 457.68, "t": 470.8457, "r": 558.96, "b": 451.2 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 23 } ], "reading_order": 4 }, { "id": "p47.6", "order": 30, "type": "caption", "bbox": { "l": 193.2, "t": 434.88, "r": 417.84, "b": 420 }, "text": "Subcatchment 148S: DA P3 (Pervious)", "attrs": { "block_label": "figure_title" }, "reading_order": 5 }, { "id": "p47.7", "order": 31, "type": "figure", "bbox": { "l": 62.88, "t": 413.52, "r": 549.84, "b": 149.04 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nRunoff\n0.002\n0.00 cfs\n0.002\n0.002 NOAA 24-hr D\n0.002\n0.002 2-Year Rainfall=3.42\"\n0.002\n0.002 Runoff Area=62,973 sf\n0.001 Runoff Volume=28 cf\n0.001\n(cfs) 0.001 Runoff Depth=0.01\"\n0.001\nFlow Flow Length=316'\n0.001\n0.001\nSlope=0.0200 '/'\n0.001\n0.001\n0.001 Tc=13.1 min\n0.000\n0.000 CN=39/0\n0.000\n0.000\n0\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72\nTime (hours)" }, "reading_order": 6 }, { "id": "p47.8", "order": 32, "type": "text", "bbox": { "l": 269.76, "t": 155.76, "r": 317.52, "b": 147.12 }, "text": "Time (hours)", "attrs": { "block_label": "number" }, "reading_order": 7 } ] }, { "document_id": 16592, "page": 48, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 33, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "table": 1, "table_cell": 26, "text": 2, "title": 1 }, "build_ms": 4, "items": [ { "id": "p48.1", "order": 1, "type": "header", "bbox": { "l": 54.48, "t": 737.76, "r": 560.4, "b": 698.64 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 2-Year Rainfall=3.42\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 8", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p48.2", "order": 2, "type": "title", "bbox": { "l": 159.36, "t": 687.6, "r": 453.36, "b": 672.48 }, "text": "Summary for Subcatchment 149S: DA P0 Pervious", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p48.3", "order": 3, "type": "text", "bbox": { "l": 53.04, "t": 660.24, "r": 463.2, "b": 634.56 }, "text": "Runoff = 0.00 cfs @ 0.00 hrs, Volume= 0 cf, Depth= 0.00\"\nRouted to Link 147L : POA", "reading_order": 2 }, { "id": "p48.4", "order": 4, "type": "text", "bbox": { "l": 52.08, "t": 623.76, "r": 611.28, "b": 598.32 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious, Time Span= 0.00-72.00 hrs, dt= NOAA 24-hr D 2-Year Rainfall=3.42\"", "reading_order": 3 }, { "id": "p48.5", "order": 5, "type": "table", "bbox": { "l": 53.52, "t": 588, "r": 558.96, "b": 423.497874 }, "text": "", "attrs": { "block_label": "table", "n_rows": 7, "n_cols": 5, "integrity": { "cells_checked": 24, "cells_flagged": 0 } }, "children": [ { "id": "p48.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 86.520001, "t": 587.142469, "r": 127.590159, "b": 575.177889 }, "text": "Area (sf)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p48.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 144.389888, "t": 587.142469, "r": 159.742288, "b": 575.177889 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p48.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 286.601768, "t": 511.302451, "r": 340.102911, "b": 499.337871 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p48.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 89.399998, "t": 573.222448, "r": 127.805562, "b": 549.257868 }, "text": "236,879\n99,371", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p48.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 147.913142, "t": 573.222448, "r": 159.770513, "b": 549.257868 }, "text": "30\n39", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p48.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 174.07226, "t": 573.222448, "r": 333.31717, "b": 549.257868 }, "text": "Woods, Good, HSG A\n>75% Grass cover, Good, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p48.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 89.399998, "t": 535.302451, "r": 127.714872, "b": 523.337871 }, "text": "336,250", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p48.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 147.913142, "t": 535.302451, "r": 159.770513, "b": 523.337871 }, "text": "33", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p48.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 174.07226, "t": 547.302451, "r": 262.271799, "b": 535.337871 }, "text": "Weighted Average", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 8 }, { "id": "p48.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 89.399998, "t": 547.302451, "r": 127.714872, "b": 535.337871 }, "text": "336,250", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p48.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 147.913142, "t": 547.302451, "r": 159.770513, "b": 535.337871 }, "text": "33", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p48.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 174.07226, "t": 535.302451, "r": 286.016818, "b": 523.337871 }, "text": "100.00% Pervious Area", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 11 }, { "id": "p48.5.13", "order": 18, "type": "table_cell", "bbox": { "l": 65.040001, "t": 511.302451, "r": 89.492517, "b": 473.417872 }, "text": "Tc (min)\n36.2", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 12 }, { "id": "p48.5.14", "order": 19, "type": "table_cell", "bbox": { "l": 100.248415, "t": 511.302451, "r": 132.697945, "b": 473.417872 }, "text": "Length (feet)\n100", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 13 }, { "id": "p48.5.15", "order": 20, "type": "table_cell", "bbox": { "l": 143.354569, "t": 511.302451, "r": 175.895438, "b": 473.417872 }, "text": "Slope (ft/ft)\n0.0050", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 14 }, { "id": "p48.5.16", "order": 21, "type": "table_cell", "bbox": { "l": 186.552062, "t": 511.302451, "r": 223.968178, "b": 473.417872 }, "text": "Velocity (ft/sec)\n0.05", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 15 }, { "id": "p48.5.17", "order": 22, "type": "table_cell", "bbox": { "l": 234.581918, "t": 511.302451, "r": 512.409343, "b": 437.417872 }, "text": "Capacity (cfs)\nSheet Flow, Woods: Light underbrush n= 0.400 P2= 3.42\" Shallow Concentrated Flow, Woodland Kv= 5.0 fps", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 16 }, { "id": "p48.5.18", "order": 23, "type": "table_cell", "bbox": { "l": 68.76, "t": 461.382452, "r": 89.492517, "b": 449.417872 }, "text": "13.6", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p48.5.19", "order": 24, "type": "table_cell", "bbox": { "l": 114.944052, "t": 461.382452, "r": 132.697945, "b": 449.417872 }, "text": "579", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p48.5.20", "order": 25, "type": "table_cell", "bbox": { "l": 143.354569, "t": 461.382452, "r": 175.880131, "b": 449.417872 }, "text": "0.0200", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p48.5.21", "order": 26, "type": "table_cell", "bbox": { "l": 203.154228, "t": 461.382452, "r": 223.886744, "b": 449.417872 }, "text": "0.71", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p48.5.22", "order": 27, "type": "table_cell", "bbox": { "l": 68.76, "t": 435.462454, "r": 89.492517, "b": 423.497874 }, "text": "49.8", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p48.5.23", "order": 28, "type": "table_cell", "bbox": { "l": 114.944052, "t": 435.462454, "r": 132.697945, "b": 423.497874 }, "text": "679", "attrs": { "row": 6, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 22 }, { "id": "p48.5.24", "order": 29, "type": "table_cell", "bbox": { "l": 143.354569, "t": 435.462454, "r": 166.947862, "b": 423.497874 }, "text": "Total", "attrs": { "row": 6, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 23 }, { "id": "p48.5.25", "order": 30, "type": "table_cell", "bbox": { "l": 356.784, "t": 445.4933, "r": 457.872, "b": 427.68 }, "text": "", "attrs": { "row": 6, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 24 }, { "id": "p48.5.26", "order": 31, "type": "table_cell", "bbox": { "l": 457.872, "t": 445.4933, "r": 558.96, "b": 427.68 }, "text": "", "attrs": { "row": 6, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 25 } ], "reading_order": 4 }, { "id": "p48.6", "order": 32, "type": "caption", "bbox": { "l": 197.52, "t": 410.64, "r": 414.24, "b": 396 }, "text": "Subcatchment 149S: DA P0 Pervious", "attrs": { "block_label": "figure_title" }, "reading_order": 5 }, { "id": "p48.7", "order": 33, "type": "figure", "bbox": { "l": 60.48, "t": 394.56, "r": 550.8, "b": 125.52 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n1\nRunoff\nNOAA 24-hr D\n2-Year Rainfall=3.42\"\nRunoff Area=336,250 sf\nRunoff Volume=0 cf\n(cfs)\nRunoff Depth=0.00\"\nFlow\nFlow Length=679'\nTc=49.8 min\nCN=33/0\n0.00 cfs\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72\nTime (hours)" }, "reading_order": 6 } ] }, { "document_id": 16592, "page": 49, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 41, "counts_by_type": { "caption": 1, "figure": 2, "table": 1, "table_cell": 33, "text": 3, "title": 1 }, "build_ms": 4, "items": [ { "id": "p49.1", "order": 1, "type": "figure", "bbox": { "l": 53.28, "t": 738.24, "r": 560.88, "b": 698.88 }, "text": "", "attrs": { "role": "page_header", "block_label": "header_image", "embedded_text": "102 Sams -REV 12-02-25 NOAA 24-hr D 2-Year Rainfall=3.42\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 9" }, "reading_order": 0 }, { "id": "p49.2", "order": 2, "type": "title", "bbox": { "l": 154.8, "t": 687.36, "r": 457.2, "b": 672.24 }, "text": "Summary for Subcatchment 150S: DA P4 (Pervious)", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p49.3", "order": 3, "type": "text", "bbox": { "l": 53.76, "t": 660.24, "r": 463.44, "b": 634.08 }, "text": "Runoff = 0.00 cfs @ 24.01 hrs, Volume= 34 cf, Depth= 0.01\"\nRouted to Pond 144P : WQ Infiltration Basin #1", "reading_order": 2 }, { "id": "p49.4", "order": 4, "type": "text", "bbox": { "l": 52.56, "t": 623.52, "r": 610.8, "b": 598.32 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious, Time Span= 0.00-72.00 hrs, dt= NOAA 24-hr D 2-Year Rainfall=3.42\"", "reading_order": 3 }, { "id": "p49.5", "order": 5, "type": "table", "bbox": { "l": 52.32, "t": 588.48, "r": 559.2, "b": 447.497874 }, "text": "", "attrs": { "block_label": "table", "n_rows": 7, "n_cols": 6, "integrity": { "cells_checked": 28, "cells_flagged": 0 } }, "children": [ { "id": "p49.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 86.520001, "t": 587.142469, "r": 127.590159, "b": 575.177889 }, "text": "Area (sf)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p49.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 144.389888, "t": 587.142469, "r": 159.742288, "b": 575.177889 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p49.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 286.601768, "t": 535.302451, "r": 340.102911, "b": 523.337871 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p49.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 95.280001, "t": 559.302451, "r": 127.805562, "b": 547.337871 }, "text": "76,971", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 3 }, { "id": "p49.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 148.003832, "t": 559.302451, "r": 159.753993, "b": 547.337871 }, "text": "39", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p49.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 174.16295, "t": 573.222448, "r": 333.31717, "b": 561.257868 }, "text": ">75% Grass cover, Good, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 5 }, { "id": "p49.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 95.280001, "t": 573.222448, "r": 127.805562, "b": 561.257868 }, "text": "76,971", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 6 }, { "id": "p49.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 148.003832, "t": 573.222448, "r": 159.753993, "b": 561.257868 }, "text": "39", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p49.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 174.16295, "t": 559.302451, "r": 286.000299, "b": 547.337871 }, "text": "100.00% Pervious Area", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 8 }, { "id": "p49.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 65.040001, "t": 535.302451, "r": 89.40872, "b": 511.337871 }, "text": "Tc (min)", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p49.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 100.248415, "t": 535.302451, "r": 132.666767, "b": 511.337871 }, "text": "Length (feet)", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p49.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 148.683866, "t": 535.302451, "r": 175.895438, "b": 511.337871 }, "text": "Slope (ft/ft)", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 }, { "id": "p49.5.13", "order": 18, "type": "table_cell", "bbox": { "l": 186.552062, "t": 535.302451, "r": 223.968178, "b": 511.337871 }, "text": "Velocity (ft/sec)", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 12 }, { "id": "p49.5.14", "order": 19, "type": "table_cell", "bbox": { "l": 234.581918, "t": 535.302451, "r": 275.988028, "b": 511.337871 }, "text": "Capacity (cfs)", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p49.5.15", "order": 20, "type": "table_cell", "bbox": { "l": 174.08692, "t": 587.142469, "r": 227.564819, "b": 575.177889 }, "text": "Description", "attrs": { "row": 3, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p49.5.16", "order": 21, "type": "table_cell", "bbox": { "l": 68.76, "t": 509.382452, "r": 89.492517, "b": 497.417872 }, "text": "12.5", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p49.5.17", "order": 22, "type": "table_cell", "bbox": { "l": 114.944052, "t": 509.382452, "r": 132.697945, "b": 497.417872 }, "text": "100", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p49.5.18", "order": 23, "type": "table_cell", "bbox": { "l": 143.354569, "t": 509.382452, "r": 175.880131, "b": 497.417872 }, "text": "0.0100", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p49.5.19", "order": 24, "type": "table_cell", "bbox": { "l": 203.154228, "t": 509.382452, "r": 223.886744, "b": 497.417872 }, "text": "0.13", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p49.5.20", "order": 25, "type": "table_cell", "bbox": { "l": 390.24, "t": 509.8971, "r": 474.72, "b": 490.2514 }, "text": "", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 19 }, { "id": "p49.5.21", "order": 26, "type": "table_cell", "bbox": { "l": 286.679993, "t": 509.26245, "r": 452.820335, "b": 485.417872 }, "text": "Sheet Flow, Grass: Short n= 0.150 P2= 3.42\"", "attrs": { "row": 4, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p49.5.22", "order": 27, "type": "table_cell", "bbox": { "l": 74.639998, "t": 485.382452, "r": 89.475992, "b": 473.417872 }, "text": "2.3", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p49.5.23", "order": 28, "type": "table_cell", "bbox": { "l": 120.82405, "t": 485.382452, "r": 132.68142, "b": 473.417872 }, "text": "96", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 22 }, { "id": "p49.5.24", "order": 29, "type": "table_cell", "bbox": { "l": 143.445254, "t": 485.382452, "r": 175.863606, "b": 473.417872 }, "text": "0.0100", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 23 }, { "id": "p49.5.25", "order": 30, "type": "table_cell", "bbox": { "l": 203.137703, "t": 485.382452, "r": 223.870219, "b": 473.417872 }, "text": "0.70", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 24 }, { "id": "p49.5.26", "order": 31, "type": "table_cell", "bbox": { "l": 390.24, "t": 490.2514, "r": 474.72, "b": 470.6057 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 25 }, { "id": "p49.5.27", "order": 32, "type": "table_cell", "bbox": { "l": 286.679993, "t": 485.26245, "r": 446.147004, "b": 461.417872 }, "text": "Shallow Concentrated Flow, Short Grass Pasture Kv= 7.0 fps", "attrs": { "row": 5, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 26 }, { "id": "p49.5.28", "order": 33, "type": "table_cell", "bbox": { "l": 68.76, "t": 459.462454, "r": 89.492517, "b": 447.497874 }, "text": "14.8", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 27 }, { "id": "p49.5.29", "order": 34, "type": "table_cell", "bbox": { "l": 114.944052, "t": 459.462454, "r": 132.697945, "b": 447.497874 }, "text": "196", "attrs": { "row": 6, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 28 }, { "id": "p49.5.30", "order": 35, "type": "table_cell", "bbox": { "l": 143.354569, "t": 459.462454, "r": 166.947862, "b": 447.497874 }, "text": "Total", "attrs": { "row": 6, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 29 }, { "id": "p49.5.31", "order": 36, "type": "table_cell", "bbox": { "l": 305.76, "t": 470.6057, "r": 390.24, "b": 450.96 }, "text": "", "attrs": { "row": 6, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 30 }, { "id": "p49.5.32", "order": 37, "type": "table_cell", "bbox": { "l": 390.24, "t": 470.6057, "r": 474.72, "b": 450.96 }, "text": "", "attrs": { "row": 6, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 31 }, { "id": "p49.5.33", "order": 38, "type": "table_cell", "bbox": { "l": 474.72, "t": 470.6057, "r": 559.2, "b": 450.96 }, "text": "", "attrs": { "row": 6, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 32 } ], "reading_order": 4 }, { "id": "p49.6", "order": 39, "type": "caption", "bbox": { "l": 193.2, "t": 435.12, "r": 417.84, "b": 420 }, "text": "Subcatchment 150S: DA P4 (Pervious)", "attrs": { "block_label": "figure_title" }, "reading_order": 5 }, { "id": "p49.7", "order": 40, "type": "figure", "bbox": { "l": 61.68, "t": 421.44, "r": 551.04, "b": 148.56 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n0.003 Runoff\n0.00 cfs\n0.002\nNOAA 24-hr D\n0.002\n2-Year Rainfall=3.42\"\n0.002\n0.002 Runoff Area=76,971 sf\n0.002 Runoff Volume=34 cf\n(cfs) 0.001 Runoff Depth=0.01\"\nFlow Flow Length=196'\n0.001\nSlope=0.0100 '/'\n0.001\nTc=14.8 min\n0.001\n0.001\nCN=39/0\n0.000\n0.000\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72\nTime (hours)" }, "reading_order": 6 }, { "id": "p49.8", "order": 41, "type": "text", "bbox": { "l": 270, "t": 155.76, "r": 317.76, "b": 146.88 }, "text": "Time (hours)", "attrs": { "block_label": "number" }, "reading_order": 7 } ] }, { "document_id": 16592, "page": 50, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 34, "counts_by_type": { "caption": 2, "figure": 1, "footer": 1, "header": 1, "table": 1, "table_cell": 24, "text": 3, "title": 1 }, "build_ms": 4, "items": [ { "id": "p50.1", "order": 1, "type": "header", "bbox": { "l": 53.28, "t": 738.48, "r": 560.64, "b": 698.64 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 2-Year Rainfall=3.42\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 10", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p50.2", "order": 2, "type": "title", "bbox": { "l": 148.32, "t": 687.6, "r": 463.92, "b": 672.24 }, "text": "Summary for Subcatchment 172S: DA P6 (Impervious)", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p50.3", "order": 3, "type": "text", "bbox": { "l": 54, "t": 660.24, "r": 463.44, "b": 634.56 }, "text": "Runoff = 0.43 cfs @ 12.10 hrs, Volume= 1,394 cf, Depth= 3.19\"\nRouted to Link 147L : POA", "reading_order": 2 }, { "id": "p50.4", "order": 4, "type": "text", "bbox": { "l": 52.08, "t": 623.76, "r": 611.28, "b": 598.32 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious, Time Span= 0.00-72.00 hrs, dt= NOAA 24-hr D 2-Year Rainfall=3.42\"", "reading_order": 3 }, { "id": "p50.5", "order": 5, "type": "table", "bbox": { "l": 52.56, "t": 588.48, "r": 559.2, "b": 447.497874 }, "text": "", "attrs": { "block_label": "table", "n_rows": 6, "n_cols": 5, "integrity": { "cells_checked": 22, "cells_flagged": 0 } }, "children": [ { "id": "p50.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 86.520001, "t": 587.142469, "r": 127.590159, "b": 575.177889 }, "text": "Area (sf)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p50.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 144.389888, "t": 587.142469, "r": 159.742288, "b": 575.177889 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p50.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 286.601768, "t": 535.302451, "r": 340.102911, "b": 523.337871 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p50.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 101.160004, "t": 559.302451, "r": 127.789043, "b": 547.337871 }, "text": "5,250", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 3 }, { "id": "p50.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 147.987313, "t": 559.302451, "r": 159.844683, "b": 547.337871 }, "text": "98", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p50.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 174.146431, "t": 573.222448, "r": 281.243319, "b": 561.257868 }, "text": "Paved parking, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 5 }, { "id": "p50.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 101.160004, "t": 573.222448, "r": 127.789043, "b": 561.257868 }, "text": "5,250", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p50.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 147.987313, "t": 573.222448, "r": 159.844683, "b": 561.257868 }, "text": "98", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p50.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 174.146431, "t": 559.302451, "r": 296.653009, "b": 547.337871 }, "text": "100.00% Impervious Area", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 8 }, { "id": "p50.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 65.040001, "t": 535.302451, "r": 89.475992, "b": 497.417872 }, "text": "Tc (min)\n0.8", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 9 }, { "id": "p50.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 100.248415, "t": 535.302451, "r": 132.68142, "b": 497.417872 }, "text": "Length (feet)\n100", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 10 }, { "id": "p50.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 143.445254, "t": 535.302451, "r": 175.895438, "b": 497.417872 }, "text": "Slope (ft/ft)\n0.0500", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 11 }, { "id": "p50.5.13", "order": 18, "type": "table_cell", "bbox": { "l": 186.552062, "t": 535.302451, "r": 223.968178, "b": 497.417872 }, "text": "Velocity (ft/sec)\n2.05", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 12 }, { "id": "p50.5.14", "order": 19, "type": "table_cell", "bbox": { "l": 234.581918, "t": 535.302451, "r": 473.002733, "b": 485.417872 }, "text": "Capacity (cfs)\nSheet Flow, Smooth surfaces n= 0.011 P2= 3.42\"", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 13 }, { "id": "p50.5.15", "order": 20, "type": "table_cell", "bbox": { "l": 74.639998, "t": 485.382452, "r": 89.475992, "b": 473.417872 }, "text": "0.6", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p50.5.16", "order": 21, "type": "table_cell", "bbox": { "l": 120.82405, "t": 485.382452, "r": 132.68142, "b": 473.417872 }, "text": "50", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p50.5.17", "order": 22, "type": "table_cell", "bbox": { "l": 143.445254, "t": 485.382452, "r": 175.863606, "b": 473.417872 }, "text": "0.0050", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p50.5.18", "order": 23, "type": "table_cell", "bbox": { "l": 203.137703, "t": 485.382452, "r": 223.870219, "b": 473.417872 }, "text": "1.44", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p50.5.19", "order": 24, "type": "table_cell", "bbox": { "l": 286.679993, "t": 485.26245, "r": 425.623588, "b": 461.417872 }, "text": "Shallow Concentrated Flow, Paved Kv= 20.3 fps", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p50.5.20", "order": 25, "type": "table_cell", "bbox": { "l": 74.639998, "t": 459.462454, "r": 89.475992, "b": 447.497874 }, "text": "1.4", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p50.5.21", "order": 26, "type": "table_cell", "bbox": { "l": 114.927527, "t": 459.462454, "r": 132.68142, "b": 447.497874 }, "text": "150", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p50.5.22", "order": 27, "type": "table_cell", "bbox": { "l": 143.445254, "t": 459.462454, "r": 167.029543, "b": 447.497874 }, "text": "Total", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p50.5.23", "order": 28, "type": "table_cell", "bbox": { "l": 356.544, "t": 471.2229, "r": 457.872, "b": 451.68 }, "text": "", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 22 }, { "id": "p50.5.24", "order": 29, "type": "table_cell", "bbox": { "l": 457.872, "t": 471.2229, "r": 559.2, "b": 451.68 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 23 } ], "reading_order": 4 }, { "id": "p50.6", "order": 30, "type": "caption", "bbox": { "l": 186.72, "t": 435.12, "r": 424.56, "b": 419.76 }, "text": "Subcatchment 172S: DA P6 (Impervious)", "attrs": { "block_label": "figure_title" }, "reading_order": 5 }, { "id": "p50.7", "order": 31, "type": "caption", "bbox": { "l": 254.64, "t": 414.48, "r": 306.24, "b": 403.92 }, "text": "Hydrograph", "attrs": { "block_label": "figure_title" }, "reading_order": 6 }, { "id": "p50.8", "order": 32, "type": "figure", "bbox": { "l": 62.64, "t": 412.8, "r": 519.36, "b": 150.24 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n0.46\n0.44 0.43 cfs\nNOAA 24-hr D\n0.42\n0.4\n2-Year Rainfall=3.42\"\n0.38\n0.36\nRunoff Area=5,250 sf\n0.34\n0.32\nRunoff Volume=1,394 cf\n0.3\n0.28\n(cfs) Runoff Depth=3.19\"\n0.26\n0.24\nFlow 0.2 Flow Length=150'\n0.22\n0.16 Tc=1.4 min\n0.18\n0.12 CN=0/98\n0.14\n0.1\n0.08\n0.06\n0.04\n0.02\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72\nTime (hours)" }, "reading_order": 7 }, { "id": "p50.9", "order": 33, "type": "text", "bbox": { "l": 267.36, "t": 155.76, "r": 315.36, "b": 147.12 }, "text": "Time (hours)", "attrs": { "block_label": "number" }, "reading_order": 8 }, { "id": "p50.10", "order": 34, "type": "footer", "bbox": { "l": 511.68, "t": 392.64, "r": 546.24, "b": 381.36 }, "text": "", "attrs": { "block_label": "footer_image" }, "reading_order": 9 } ] }, { "document_id": 16592, "page": 51, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 22, "counts_by_type": { "footnote": 1, "header": 2, "heading": 2, "table": 2, "table_cell": 12, "text": 3 }, "build_ms": 3, "items": [ { "id": "p51.1", "order": 1, "type": "header", "bbox": { "l": 367.68, "t": 738.96, "r": 561.12, "b": 713.04 }, "text": "NOAA 24-hr D 2-Year Rainfall=3.42\"\nPrinted 04/12/2025", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p51.2", "order": 2, "type": "header", "bbox": { "l": 52.56, "t": 738, "r": 395.52, "b": 698.88 }, "text": "102 Sams -REV 12-02-25\nPrepared by Haler Consulting\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p51.3", "order": 3, "type": "text", "bbox": { "l": 516.96, "t": 710.88, "r": 558.72, "b": 699.12 }, "text": "Page 11", "attrs": { "block_label": "number" }, "reading_order": 2 }, { "id": "p51.4", "order": 4, "type": "heading", "bbox": { "l": 188.88, "t": 687.84, "r": 423.84, "b": 672.72 }, "text": "Summary for Pond 130P: SUBSURFACE", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 3 }, { "id": "p51.5", "order": 5, "type": "text", "bbox": { "l": 52.08, "t": 662.64, "r": 528.48, "b": 536.88 }, "text": "Inflow Area = 4,000 sf, 0.00% Impervious, Inflow Depth = 3.19\" for 2-Year event\nInflow = 0.24 cfs @ 12.14 hrs, Volume= 1,062 cf\nOutflow = 0.04 cfs @ 11.60 hrs, Volume= 1,062 cf, Atten= 83%, Lag= 0.0 min\nDiscarded = 0.04 cfs @ 11.60 hrs, Volume= 1,062 cf\n\nRouting by Stor-Ind method, Time Span= 0.00-72.00 hrs, dt= 0.01 hrs\nPeak Elev= 1.35' @ 12.81 hrs Surf.Area= 533 sf Storage= 277 cf\n\nPlug-Flow detention time= 41.5 min calculated for 1,062 cf (100% of inflow)\nCenter-of-Mass det. time= 41.5 min (802.1 - 760.5)", "attrs": { "block_label": "algorithm" }, "reading_order": 4 }, { "id": "p51.6", "order": 6, "type": "table", "bbox": { "l": 51.84, "t": 529.44, "r": 558.24, "b": 436.56 }, "text": "", "attrs": { "block_label": "table", "n_rows": 2, "n_cols": 4, "integrity": { "cells_checked": 8, "cells_flagged": 0 } }, "children": [ { "id": "p51.6.1", "order": 7, "type": "table_cell", "bbox": { "l": 54, "t": 527.142469, "r": 538.219405, "b": 489.257868 }, "text": "Volume\n#1A\n2,664 cf Overall - 751 cf Embedded = 1,914 cf x 40.0% Voids", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p51.6.2", "order": 8, "type": "table_cell", "bbox": { "l": 122.133522, "t": 527.142469, "r": 148.95691, "b": 501.257868 }, "text": "Invert\n0.00'", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p51.6.3", "order": 9, "type": "table_cell", "bbox": { "l": 170.997811, "t": 527.142469, "r": 234.422951, "b": 501.257868 }, "text": "Avail.Storage\n765 cf", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p51.6.4", "order": 10, "type": "table_cell", "bbox": { "l": 246.044461, "t": 527.142469, "r": 410.255528, "b": 501.137889 }, "text": "Storage Description\n13.00'W x 41.00'L x 5.00'H Field A", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p51.6.5", "order": 11, "type": "table_cell", "bbox": { "l": 66, "t": 489.222448, "r": 84.933198, "b": 477.257868 }, "text": "#2A", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p51.6.6", "order": 12, "type": "table_cell", "bbox": { "l": 126.251739, "t": 489.222448, "r": 148.95691, "b": 477.257868 }, "text": "1.00'", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p51.6.7", "order": 13, "type": "table_cell", "bbox": { "l": 205.241898, "t": 489.222448, "r": 234.240267, "b": 477.257868 }, "text": "573 cf", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p51.6.8", "order": 14, "type": "table_cell", "bbox": { "l": 246.120003, "t": 489.222448, "r": 517.204542, "b": 441.257868 }, "text": "ADS N-12 30\" x 6 Inside #1\\nInside= 30.0\"W x 30.0\"H => 4.90 sf x 20.00'L = 98.0 cf\\nOutside= 36.0\"W x 36.0\"H => 6.42 sf x 20.00'L = 128.3 cf\\nRow Length Adjustment= -1.00' x 4.90 sf x 3 rows", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 } ], "reading_order": 5 }, { "id": "p51.7", "order": 15, "type": "heading", "bbox": { "l": 195.6, "t": 439.68, "r": 358.8, "b": 426.48 }, "text": "1,339 cf Total Available Storage", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 6 }, { "id": "p51.8", "order": 16, "type": "text", "bbox": { "l": 66.96, "t": 415.92, "r": 294.48, "b": 402 }, "text": "Storage Group A created with Chamber Wizard", "reading_order": 7 }, { "id": "p51.9", "order": 17, "type": "table", "bbox": { "l": 52.32, "t": 391.92, "r": 420.72, "b": 363.6 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 4, "integrity": { "cells_checked": 4, "cells_flagged": 0 } }, "children": [ { "id": "p51.9.1", "order": 18, "type": "table_cell", "bbox": { "l": 54, "t": 391.302451, "r": 86.679256, "b": 365.417872 }, "text": "Device\n#1", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p51.9.2", "order": 19, "type": "table_cell", "bbox": { "l": 98.407976, "t": 391.302451, "r": 146.474595, "b": 365.417872 }, "text": "Routing\nDiscarded", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p51.9.3", "order": 20, "type": "table_cell", "bbox": { "l": 182.045624, "t": 391.302451, "r": 208.890165, "b": 365.417872 }, "text": "Invert\n0.00'", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p51.9.4", "order": 21, "type": "table_cell", "bbox": { "l": 220.650048, "t": 391.302451, "r": 419.617941, "b": 365.297892 }, "text": "Outlet Devices\n3.250 in/hr Exfiltration over Surface area", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 } ], "reading_order": 8 }, { "id": "p51.10", "order": 22, "type": "footnote", "bbox": { "l": 51.6, "t": 354.48, "r": 423.6, "b": 328.08 }, "text": "Discarded OutFlow Max=0.04 cfs @ 11.60 hrs HW=0.05' (Free Discharge)\n1=Exfiltration (Exfiltration Controls 0.04 cfs)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 9 } ] }, { "document_id": 16592, "page": 52, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 6, "counts_by_type": { "caption": 1, "figure": 1, "header": 2, "text": 2 }, "build_ms": 0, "items": [ { "id": "p52.1", "order": 1, "type": "header", "bbox": { "l": 367.44, "t": 739.2, "r": 560.88, "b": 711.36 }, "text": "NOAA 24-hr D 2-Year Rainfall=3.42\"\nPrinted 04/12/2025", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p52.2", "order": 2, "type": "header", "bbox": { "l": 53.52, "t": 738, "r": 396.96, "b": 699.12 }, "text": "102 Sams -REV 12-02-25\nPrepared by Haler Consulting\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p52.3", "order": 3, "type": "text", "bbox": { "l": 517.2, "t": 711.12, "r": 559.2, "b": 699.12 }, "text": "Page 12", "attrs": { "block_label": "number" }, "reading_order": 2 }, { "id": "p52.4", "order": 4, "type": "caption", "bbox": { "l": 227.76, "t": 687.6, "r": 384.24, "b": 673.2 }, "text": "Pond 130P: SUBSURFACE", "attrs": { "block_label": "figure_title" }, "reading_order": 3 }, { "id": "p52.5", "order": 5, "type": "figure", "bbox": { "l": 62.16, "t": 668.88, "r": 490.08, "b": 402.72 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n0.24 cfs\n0.26\n0.24 Inflow Area=4,000 sf\n0.22 Peak Elev=1.35'\nStorage=277 cf\n0.2\n0.18\n0.16\n(cfs) 0.14\nFlow 0.12\n0.1\n0.08\n0.06\n0.04 cfs\n0.04\n0.02\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72" }, "reading_order": 4 }, { "id": "p52.6", "order": 6, "type": "text", "bbox": { "l": 497.52, "t": 644.64, "r": 546.48, "b": 625.92 }, "text": "Inflow\nDiscarded", "attrs": { "block_label": "aside_text" }, "reading_order": 5 } ] }, { "document_id": 16592, "page": 53, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 9, "counts_by_type": { "caption": 1, "header": 2, "table": 1, "table_cell": 4, "text": 1 }, "build_ms": 21, "items": [ { "id": "p53.1", "order": 1, "type": "header", "bbox": { "l": 367.2, "t": 739.2, "r": 561.12, "b": 712.32 }, "text": "NOAA 24-hr D 2-Year Rainfall=3.42\"\nPrinted 04/12/2025", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p53.2", "order": 2, "type": "header", "bbox": { "l": 51.84, "t": 737.76, "r": 390.48, "b": 699.12 }, "text": "102 Sams -REV 12-02-25\nPrepared by Haler Consulting\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p53.3", "order": 3, "type": "text", "bbox": { "l": 516.96, "t": 711.12, "r": 559.2, "b": 698.88 }, "text": "Page 13", "attrs": { "block_label": "number" }, "reading_order": 2 }, { "id": "p53.4", "order": 4, "type": "caption", "bbox": { "l": 178.56, "t": 687.84, "r": 433.68, "b": 672.96 }, "text": "Stage-Discharge for Pond 130P: SUBSURFACE", "attrs": { "block_label": "figure_title" }, "reading_order": 3 }, { "id": "p53.5", "order": 5, "type": "table", "bbox": { "l": 56.4, "t": 663.36, "r": 279.6, "b": 58.32 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 4, "integrity": { "cells_checked": 4, "cells_flagged": 0 } }, "children": [ { "id": "p53.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 57.479999, "t": 661.126246, "r": 98.089591, "b": 64.158859 }, "text": "Elevation (feet)\n0.00\n0.05\n0.10\n0.15\n0.20\n0.25\n0.30\n0.35\n0.40\n0.45\n0.50\n0.55\n0.60\n0.65\n0.70\n0.75\n0.80\n0.85\n0.90\n0.95\n1.00\n1.05\n1.10\n1.15\n1.20\n1.25\n1.30\n1.35\n1.40\n1.45\n1.50\n1.55\n1.60\n1.65\n1.70\n1.75\n1.80\n1.85\n1.90\n1.95\n2.00\n2.05\n2.10\n2.15\n2.20\n2.25\n2.30\n2.35\n2.40\n2.45\n2.50\n2.55", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p53.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 109.680004, "t": 661.126246, "r": 154.780724, "b": 64.158859 }, "text": "Discarded (cfs)\n0.00\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p53.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 178.200005, "t": 661.126246, "r": 218.809603, "b": 97.27883899999995 }, "text": "Elevation (feet)\n2.60\n2.65\n2.70\n2.75\n2.80\n2.85\n2.90\n2.95\n3.00\n3.05\n3.10\n3.15\n3.20\n3.25\n3.30\n3.35\n3.40\n3.45\n3.50\n3.55\n3.60\n3.65\n3.70\n3.75\n3.80\n3.85\n3.90\n3.95\n4.00\n4.05\n4.10\n4.15\n4.20\n4.25\n4.30\n4.35\n4.40\n4.45\n4.50\n4.55\n4.60\n4.65\n4.70\n4.75\n4.80\n4.85\n4.90\n4.95\n5.00", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p53.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 230.400009, "t": 661.126246, "r": 275.174362, "b": 97.27883899999995 }, "text": "Discarded (cfs)\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 } ], "reading_order": 4 } ] }, { "document_id": 16592, "page": 54, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 11, "counts_by_type": { "caption": 1, "header": 2, "table": 1, "table_cell": 6, "text": 1 }, "build_ms": 18, "items": [ { "id": "p54.1", "order": 1, "type": "header", "bbox": { "l": 367.2, "t": 739.2, "r": 561.36, "b": 713.04 }, "text": "NOAA 24-hr D 2-Year Rainfall=3.42\"\nPrinted 04/12/2025", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p54.2", "order": 2, "type": "header", "bbox": { "l": 50.64, "t": 737.76, "r": 394.8, "b": 699.12 }, "text": "102 Sams -REV 12-02-25\nPrepared by Haler Consulting\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p54.3", "order": 3, "type": "text", "bbox": { "l": 516.72, "t": 710.88, "r": 558.96, "b": 699.12 }, "text": "Page 14", "attrs": { "block_label": "number" }, "reading_order": 2 }, { "id": "p54.4", "order": 4, "type": "caption", "bbox": { "l": 170.64, "t": 688.08, "r": 441.84, "b": 672.96 }, "text": "Stage-Area-Storage for Pond 130P: SUBSURFACE", "attrs": { "block_label": "figure_title" }, "reading_order": 3 }, { "id": "p54.5", "order": 5, "type": "table", "bbox": { "l": 54.72, "t": 665.04, "r": 468.72, "b": 61.44 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 6, "integrity": { "cells_checked": 6, "cells_flagged": 0 } }, "children": [ { "id": "p54.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 57.479999, "t": 661.126246, "r": 98.089591, "b": 64.158859 }, "text": "Elevation\\n(feet)\n0.00\n0.05\n0.10\n0.15\n0.20\n0.25\n0.30\n0.35\n0.40\n0.45\n0.50\n0.55\n0.60\n0.65\n0.70\n0.75\n0.80\n0.85\n0.90\n0.95\n1.00\n1.05\n1.10\n1.15\n1.20\n1.25\n1.30\n1.35\n1.40\n1.45\n1.50\n1.55\n1.60\n1.65\n1.70\n1.75\n1.80\n1.85\n1.90\n1.95\n2.00\n2.05\n2.10\n2.15\n2.20\n2.25\n2.30\n2.35\n2.40\n2.45\n2.50\n2.55", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p54.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 139.439999, "t": 661.126246, "r": 174.077645, "b": 64.158859 }, "text": "Surface\\n(sq-ft)\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p54.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 199.55999, "t": 661.126246, "r": 249.563969, "b": 64.158859 }, "text": "Storage\\n(cubic-feet)\n0\n11\n21\n32\n43\n53\n64\n75\n85\n96\n107\n117\n128\n139\n149\n160\n171\n181\n192\n203\n213\n223\n231\n240\n247\n255\n264\n276\n289\n302\n317\n332\n347\n363\n379\n396\n413\n430\n448\n465\n483\n501\n520\n538\n557\n575\n594\n613\n632\n651\n669\n688", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p54.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 273.240005, "t": 661.126246, "r": 313.84958, "b": 97.27883899999995 }, "text": "Elevation\\n(feet)\n2.60\n2.65\n2.70\n2.75\n2.80\n2.85\n2.90\n2.95\n3.00\n3.05\n3.10\n3.15\n3.20\n3.25\n3.30\n3.35\n3.40\n3.45\n3.50\n3.55\n3.60\n3.65\n3.70\n3.75\n3.80\n3.85\n3.90\n3.95\n4.00\n4.05\n4.10\n4.15\n4.20\n4.25\n4.30\n4.35\n4.40\n4.45\n4.50\n4.55\n4.60\n4.65\n4.70\n4.75\n4.80\n4.85\n4.90\n4.95\n5.00", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p54.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 355.200005, "t": 661.126246, "r": 389.605666, "b": 97.27883899999995 }, "text": "Surface\\n(sq-ft)\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533", "attrs": { "row": 0, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p54.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 415.320008, "t": 661.126246, "r": 465.528236, "b": 97.27883899999995 }, "text": "Storage\\n(cubic-feet)\n707\n726\n745\n764\n782\n801\n819\n838\n856\n874\n891\n909\n926\n943\n960\n976\n992\n1,007\n1,022\n1,037\n1,050\n1,063\n1,075\n1,084\n1,092\n1,099\n1,107\n1,116\n1,126\n1,136\n1,147\n1,158\n1,168\n1,179\n1,190\n1,200\n1,211\n1,222\n1,232\n1,243\n1,254\n1,264\n1,275\n1,286\n1,296\n1,307\n1,318\n1,328\n1,339", "attrs": { "row": 0, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 } ], "reading_order": 4 } ] }, { "document_id": 16592, "page": 55, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 37, "counts_by_type": { "footnote": 2, "header": 2, "heading": 1, "table": 3, "table_cell": 28, "text": 1 }, "build_ms": 8, "items": [ { "id": "p55.1", "order": 1, "type": "header", "bbox": { "l": 367.2, "t": 739.2, "r": 561.12, "b": 703.2 }, "text": "NOAA 24-hr D 2-Year Rainfall=3.42\"\nPrinted 04/12/2025\ns LLC Page 15", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p55.2", "order": 2, "type": "header", "bbox": { "l": 52.56, "t": 738, "r": 393.36, "b": 698.64 }, "text": "102 Sams -REV 12-02-25\nPrepared by Haler Consulting\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p55.3", "order": 3, "type": "text", "bbox": { "l": 516.96, "t": 711.36, "r": 559.44, "b": 699.12 }, "text": "Page 15", "attrs": { "block_label": "number" }, "reading_order": 2 }, { "id": "p55.4", "order": 4, "type": "heading", "bbox": { "l": 162, "t": 687.84, "r": 449.04, "b": 672.48 }, "text": "Summary for Pond 144P: WQ Infiltration Basin #1", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 3 }, { "id": "p55.5", "order": 5, "type": "table", "bbox": { "l": 51.84, "t": 665.28, "r": 546.24, "b": 515.177889 }, "text": "", "attrs": { "block_label": "table", "n_rows": 8, "n_cols": 2, "integrity": { "cells_checked": 8, "cells_flagged": 0 } }, "children": [ { "id": "p55.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 51.84, "t": 665.28, "r": 546.24, "b": 650.328 }, "text": "Inflow Area = 108,596 sf, 29.12% Impervious, Inflow Depth = 0.93\" for 2-Year event", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 2 }, "reading_order": 0 }, { "id": "p55.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 51.84, "t": 650.328, "r": 546.24, "b": 635.376 }, "text": "Inflow = 2.34 cfs @ 12.11 hrs, Volume= 8,433 cf", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 2 }, "reading_order": 1 }, { "id": "p55.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 51.84, "t": 635.376, "r": 546.24, "b": 620.424 }, "text": "Outflow = 0.33 cfs @ 12.65 hrs, Volume= 8,433 cf, Atten= 86%, Lag= 32.5 min", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 2 }, "reading_order": 2 }, { "id": "p55.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 51.84, "t": 620.424, "r": 546.24, "b": 605.472 }, "text": "Discarded = 0.33 cfs @ 12.65 hrs, Volume= 8,433 cf", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 2 }, "reading_order": 3 }, { "id": "p55.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 51.84, "t": 605.472, "r": 546.24, "b": 590.52 }, "text": "Primary = 0.00 cfs @ 0.00 hrs, Volume= 0 cf", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 2 }, "reading_order": 4 }, { "id": "p55.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 69.023569, "t": 599.142469, "r": 195.539615, "b": 587.177889 }, "text": "Routed to Link 147L : POA", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 5 }, { "id": "p55.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 54, "t": 575.142469, "r": 395.5216, "b": 551.177889 }, "text": "Routing by Stor-Ind method, Time Span= 0.00-72.00 hrs, dt= 0.01 hrs\nPeak Elev= 95.51' @ 12.65 hrs Surf.Area= 4,668 sf Storage= 2,258 cf", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p55.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 54, "t": 539.142469, "r": 407.986212, "b": 515.177889 }, "text": "Plug-Flow detention time= 43.9 min calculated for 8,433 cf (100% of inflow)\nCenter-of-Mass det. time= 43.9 min ( 802.2 - 758.2 )", "attrs": { "row": 7, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 7 } ], "reading_order": 4 }, { "id": "p55.6", "order": 14, "type": "table", "bbox": { "l": 53.04, "t": 505.44, "r": 557.28, "b": 389.04 }, "text": "", "attrs": { "block_label": "table", "n_rows": 2, "n_cols": 5, "integrity": { "cells_checked": 8, "cells_flagged": 0 } }, "children": [ { "id": "p55.6.1", "order": 15, "type": "table_cell", "bbox": { "l": 54, "t": 503.142469, "r": 90.142207, "b": 477.257868 }, "text": "Volume\n#1", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p55.6.2", "order": 16, "type": "table_cell", "bbox": { "l": 120.355217, "t": 503.142469, "r": 148.95691, "b": 477.257868 }, "text": "Invert\n95.00'", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p55.6.3", "order": 17, "type": "table_cell", "bbox": { "l": 170.997811, "t": 503.142469, "r": 234.422951, "b": 477.257868 }, "text": "Avail.Storage\n16,706 cf", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p55.6.4", "order": 18, "type": "table_cell", "bbox": { "l": 246.044461, "t": 503.142469, "r": 502.944852, "b": 477.137889 }, "text": "Storage Description\nCustom Stage Data (Prismatic) Listed below (Recalc)", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p55.6.5", "order": 19, "type": "table_cell", "bbox": { "l": 57.360002, "t": 465.222448, "r": 101.273013, "b": 391.337871 }, "text": "Elevation\\n(feet)\n95.00\n96.00\n97.00\n98.00", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p55.6.6", "order": 20, "type": "table_cell", "bbox": { "l": 140.447365, "t": 465.222448, "r": 185.72688, "b": 391.337871 }, "text": "Surf.Area\\n(sq-ft)\n4,231\n5,092\n6,008\n6,981", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p55.6.7", "order": 21, "type": "table_cell", "bbox": { "l": 227.371027, "t": 465.222448, "r": 354.642567, "b": 391.337871 }, "text": "Inc.Store\\n(cubic-feet)\n0\n4,662\n5,550\n6,495", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p55.6.8", "order": 22, "type": "table_cell", "bbox": { "l": 216.402998, "t": 465.222448, "r": 354.689052, "b": 391.337871 }, "text": "Cum.Store\\n(cubic-feet)\n0\n4,662\n10,212\n16,706", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 7 } ], "reading_order": 5 }, { "id": "p55.7", "order": 23, "type": "table", "bbox": { "l": 52.08, "t": 379.68, "r": 556.32, "b": 291.84 }, "text": "", "attrs": { "block_label": "table", "n_rows": 3, "n_cols": 4, "integrity": { "cells_checked": 12, "cells_flagged": 0 } }, "children": [ { "id": "p55.7.1", "order": 24, "type": "table_cell", "bbox": { "l": 54, "t": 379.302451, "r": 86.679256, "b": 367.337871 }, "text": "Device", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p55.7.2", "order": 25, "type": "table_cell", "bbox": { "l": 98.407976, "t": 379.302451, "r": 135.030741, "b": 367.337871 }, "text": "Routing", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p55.7.3", "order": 26, "type": "table_cell", "bbox": { "l": 182.045624, "t": 379.302451, "r": 208.824841, "b": 367.337871 }, "text": "Invert", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p55.7.4", "order": 27, "type": "table_cell", "bbox": { "l": 220.650048, "t": 379.302451, "r": 290.014595, "b": 367.337871 }, "text": "Outlet Devices", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 3 }, { "id": "p55.7.5", "order": 28, "type": "table_cell", "bbox": { "l": 70.320002, "t": 365.382452, "r": 82.177372, "b": 353.417872 }, "text": "#1", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p55.7.6", "order": 29, "type": "table_cell", "bbox": { "l": 98.408891, "t": 365.382452, "r": 135.204992, "b": 353.417872 }, "text": "Primary", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p55.7.7", "order": 30, "type": "table_cell", "bbox": { "l": 354.69794, "t": 341.382452, "r": 383.299634, "b": 329.417872 }, "text": "97.60'", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p55.7.8", "order": 31, "type": "table_cell", "bbox": { "l": 220.679993, "t": 365.262472, "r": 512.979659, "b": 317.417872 }, "text": "15.0\" Round Culvert to Subsurface Basin\\nL= 35.0' RCP, square edge headwall, Ke= 0.500\\nInlet / Outlet Invert= 95.00' / 97.60' S= -0.0743'' Cc= 0.900\\nn= 0.012 Corrugated PP, smooth interior, Flow Area= 1.23 sf", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p55.7.9", "order": 32, "type": "table_cell", "bbox": { "l": 70.320002, "t": 317.382452, "r": 82.177372, "b": 293.417872 }, "text": "#2\n#3", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 8 }, { "id": "p55.7.10", "order": 33, "type": "table_cell", "bbox": { "l": 98.408891, "t": 317.382452, "r": 146.474595, "b": 293.417872 }, "text": "Device 1\nDiscarded", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 9 }, { "id": "p55.7.11", "order": 34, "type": "table_cell", "bbox": { "l": 180.288471, "t": 317.382452, "r": 208.918642, "b": 293.417872 }, "text": "97.00'\n95.00'", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 10 }, { "id": "p55.7.12", "order": 35, "type": "table_cell", "bbox": { "l": 220.679993, "t": 317.382452, "r": 531.965762, "b": 293.297892 }, "text": "4.0' long Sharp-Crested Rectangular Weir 2 End Contraction(s)\n3.100 in/hr Exfiltration over Surface area", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 11 } ], "reading_order": 6 }, { "id": "p55.8", "order": 36, "type": "footnote", "bbox": { "l": 51.84, "t": 282, "r": 430.08, "b": 255.6 }, "text": "Discarded OutFlow Max=0.33 cfs @ 12.65 hrs HW=95.51' (Free Discharge)\n3=Exfiltration (Exfiltration Controls 0.33 cfs)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 7 }, { "id": "p55.9", "order": 37, "type": "footnote", "bbox": { "l": 51.84, "t": 246, "r": 411.84, "b": 207.6 }, "text": "Primary OutFlow Max=0.00 cfs @ 0.00 hrs HW=95.00' (Free Discharge)\n1=Culvert to Subsurface Basin (Controls 0.00 cfs)\n2=Sharp-Crested Rectangular Weir (Controls 0.00 cfs)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 8 } ] }, { "document_id": 16592, "page": 56, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 8, "counts_by_type": { "caption": 1, "figure": 2, "footnote": 2, "header": 2, "text": 1 }, "build_ms": 0, "items": [ { "id": "p56.1", "order": 1, "type": "header", "bbox": { "l": 367.44, "t": 738.96, "r": 560.64, "b": 711.6 }, "text": "NOAA 24-hr D 2-Year Rainfall=3.42\"\nPrinted 04/12/2025", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p56.2", "order": 2, "type": "header", "bbox": { "l": 52.32, "t": 737.76, "r": 393.84, "b": 699.36 }, "text": "102 Sams -REV 12-02-25\nPrepared by Haler Consulting\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p56.3", "order": 3, "type": "text", "bbox": { "l": 517.2, "t": 711.12, "r": 559.44, "b": 699.12 }, "text": "Page 16", "attrs": { "block_label": "number" }, "reading_order": 2 }, { "id": "p56.4", "order": 4, "type": "caption", "bbox": { "l": 201.12, "t": 687.6, "r": 409.2, "b": 672.96 }, "text": "Pond 144P: WQ Infiltration Basin #1", "attrs": { "block_label": "figure_title" }, "reading_order": 3 }, { "id": "p56.5", "order": 5, "type": "figure", "bbox": { "l": 64.08, "t": 666.72, "r": 487.44, "b": 414.24 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n2.34 cfs\nInflow Area=108,596 sf\nPeak Elev=95.51'\nStorage=2,258 cf\n2\n(cfs)\nFlow\n1\n0.33 cfs\n0.33 cfs\n0.00 cfs\n0" }, "reading_order": 4 }, { "id": "p56.6", "order": 6, "type": "figure", "bbox": { "l": 70.08, "t": 666, "r": 551.28, "b": 404.16 }, "text": "", "attrs": { "block_label": "image", "embedded_text": "Hydrograph\nInflow\n2.34 cfs Outflow\nInflow Area=108,596 sf Primary\nDiscarded\nPeak Elev=95.51'\nStorage=2,258 cf\n2\n1\n0.33 cfs\n0.33 cfs\n0.00 cfs\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72" }, "reading_order": 5 }, { "id": "p56.7", "order": 7, "type": "footnote", "bbox": { "l": 497.04, "t": 645.12, "r": 547.44, "b": 610.08 }, "text": "Inflow Outflow Discarded Primary", "attrs": { "block_label": "vision_footnote" }, "reading_order": 6 }, { "id": "p56.8", "order": 8, "type": "footnote", "bbox": { "l": 83.04, "t": 420, "r": 449.52, "b": 400.8 }, "text": "0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72 Time (hours)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 7 } ] }, { "document_id": 16592, "page": 57, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 29, "counts_by_type": { "caption": 1, "header": 2, "table": 1, "table_cell": 24, "text": 1 }, "build_ms": 19, "items": [ { "id": "p57.1", "order": 1, "type": "header", "bbox": { "l": 366.96, "t": 738.72, "r": 560.88, "b": 713.76 }, "text": "NOAA 24-hr D 2-Year Rainfall=3.42\"\nPrinted 04/12/2025", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p57.2", "order": 2, "type": "header", "bbox": { "l": 50.4, "t": 737.52, "r": 396, "b": 699.12 }, "text": "102 Sams -REV 12-02-25\nPrepared by Haler Consulting\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p57.3", "order": 3, "type": "text", "bbox": { "l": 516.48, "t": 711.12, "r": 559.44, "b": 699.12 }, "text": "Page 17", "attrs": { "block_label": "number" }, "reading_order": 2 }, { "id": "p57.4", "order": 4, "type": "caption", "bbox": { "l": 153.6, "t": 687.84, "r": 457.44, "b": 672.96 }, "text": "Stage-Discharge for Pond 144P: WQ Infiltration Basin #1", "attrs": { "block_label": "figure_title" }, "reading_order": 3 }, { "id": "p57.5", "order": 5, "type": "table", "bbox": { "l": 54.72, "t": 662.88, "r": 506.4, "b": 57.84 }, "text": "", "attrs": { "block_label": "table", "n_rows": 3, "n_cols": 8, "integrity": { "cells_checked": 16, "cells_flagged": 0 } }, "children": [ { "id": "p57.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 57.479999, "t": 661.126246, "r": 98.137287, "b": 86.23886200000004 }, "text": "Elevation (feet)\n95.00\n95.05\n95.10\n95.15\n95.20\n95.25\n95.30\n95.35\n95.40\n95.45\n95.50\n95.55\n95.60\n95.65\n95.70\n95.75\n95.80\n95.85\n95.90\n95.95\n96.00\n96.05\n96.10\n96.15\n96.20\n96.25\n96.30\n96.35\n96.40\n96.45\n96.50\n96.55\n96.60\n96.65\n96.70\n96.75\n96.80\n96.85\n96.90\n96.95\n97.00\n97.05\n97.10\n97.15\n97.20\n97.25\n97.30\n97.35\n97.40\n97.45", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p57.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 109.680004, "t": 661.126246, "r": 154.533694, "b": 86.23886200000004 }, "text": "Discharge (cfs)\n0.00\n0.31\n0.31\n0.31\n0.32\n0.32\n0.32\n0.33\n0.33\n0.33\n0.33\n0.34\n0.34\n0.34\n0.35\n0.35\n0.35\n0.36\n0.36\n0.36\n0.37\n0.37\n0.37\n0.38\n0.38\n0.38\n0.39\n0.39\n0.39\n0.39\n0.40\n0.40\n0.40\n0.41\n0.41\n0.41\n0.42\n0.42\n0.42\n0.43\n0.43\n0.43\n0.44\n0.44\n0.45\n0.45\n0.45\n0.46\n0.46\n0.46", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p57.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 166.080002, "t": 661.126246, "r": 210.875583, "b": 86.23886200000004 }, "text": "Discarded (cfs)\n0.00\n0.31\n0.31\n0.31\n0.32\n0.32\n0.32\n0.33\n0.33\n0.33\n0.33\n0.34\n0.34\n0.34\n0.35\n0.35\n0.35\n0.36\n0.36\n0.36\n0.37\n0.37\n0.37\n0.38\n0.38\n0.38\n0.39\n0.39\n0.39\n0.39\n0.40\n0.40\n0.40\n0.41\n0.41\n0.41\n0.42\n0.42\n0.42\n0.43\n0.43\n0.43\n0.44\n0.44\n0.45\n0.45\n0.45\n0.46\n0.46\n0.46", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p57.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 233.160004, "t": 661.126246, "r": 267.536512, "b": 86.23886200000004 }, "text": "Primary (cfs)\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p57.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 291, "t": 661.126246, "r": 331.657282, "b": 351.198838 }, "text": "Elevation (feet)\n97.60\n97.65\n97.70\n97.75\n97.80\n97.85\n97.90\n97.95\n98.00\n98.05\n98.10\n98.15\n98.20\n98.25\n98.30\n98.35\n98.40\n98.45\n98.50\n98.55\n98.60\n98.65\n98.70\n98.75\n98.80\n98.85", "attrs": { "row": 0, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p57.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 343.200005, "t": 661.126246, "r": 388.300713, "b": 351.198838 }, "text": "Discharge (cfs)\n0.47\n0.49\n0.53\n0.59\n0.68\n0.79\n0.92\n1.06\n1.23\n1.41\n1.60\n1.81\n2.04\n2.27\n2.52\n2.77\n3.03\n3.29\n3.56\n3.82\n4.08\n4.34\n4.59\n4.81\n5.02\n5.17", "attrs": { "row": 0, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p57.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 399.599991, "t": 661.126246, "r": 444.700722, "b": 351.198838 }, "text": "Discarded (cfs)\n0.47\n0.48\n0.48\n0.48\n0.49\n0.49\n0.49\n0.50\n0.50\n0.50\n0.50\n0.50\n0.50\n0.50\n0.50\n0.50\n0.50\n0.50\n0.50\n0.50\n0.50\n0.50\n0.50\n0.50\n0.50\n0.50", "attrs": { "row": 0, "col": 6, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p57.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 466.679993, "t": 661.126246, "r": 501.100731, "b": 351.198838 }, "text": "Primary (cfs)\n0.00\n0.01\n0.05\n0.11\n0.19\n0.30\n0.42\n0.57\n0.73\n0.91\n1.10\n1.31\n1.54\n1.77\n2.01\n2.27\n2.53\n2.79\n3.06\n3.32\n3.58\n3.84\n4.08\n4.31\n4.52\n4.67", "attrs": { "row": 0, "col": 7, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 7 }, { "id": "p57.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 73.320002, "t": 86.20622500000002, "r": 98.137287, "b": 75.19883800000002 }, "text": "97.50", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p57.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 135.26256, "t": 75.166246, "r": 154.533694, "b": 64.158859 }, "text": "0.47", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p57.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 191.560334, "t": 75.166246, "r": 210.875583, "b": 64.158859 }, "text": "0.47", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p57.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 248.000856, "t": 75.166246, "r": 267.196089, "b": 64.158859 }, "text": "0.00", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 }, { "id": "p57.5.13", "order": 18, "type": "table_cell", "bbox": { "l": 280.56, "t": 80.6717, "r": 337.02, "b": 69.2558 }, "text": "", "attrs": { "row": 1, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 12 }, { "id": "p57.5.14", "order": 19, "type": "table_cell", "bbox": { "l": 337.02, "t": 80.6717, "r": 393.48, "b": 69.2558 }, "text": "", "attrs": { "row": 1, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 13 }, { "id": "p57.5.15", "order": 20, "type": "table_cell", "bbox": { "l": 393.48, "t": 80.6717, "r": 449.94, "b": 69.2558 }, "text": "", "attrs": { "row": 1, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 14 }, { "id": "p57.5.16", "order": 21, "type": "table_cell", "bbox": { "l": 449.94, "t": 80.6717, "r": 506.4, "b": 69.2558 }, "text": "", "attrs": { "row": 1, "col": 7, "rowspan": 1, "colspan": 1 }, "reading_order": 15 }, { "id": "p57.5.17", "order": 22, "type": "table_cell", "bbox": { "l": 73.320002, "t": 75.166246, "r": 98.137287, "b": 64.158859 }, "text": "97.55", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p57.5.18", "order": 23, "type": "table_cell", "bbox": { "l": 135.26256, "t": 86.20622500000002, "r": 154.533694, "b": 75.19883800000002 }, "text": "0.47", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p57.5.19", "order": 24, "type": "table_cell", "bbox": { "l": 191.560334, "t": 86.20622500000002, "r": 210.875583, "b": 75.19883800000002 }, "text": "0.47", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p57.5.20", "order": 25, "type": "table_cell", "bbox": { "l": 248.000856, "t": 86.20622500000002, "r": 267.196089, "b": 75.19883800000002 }, "text": "0.00", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p57.5.21", "order": 26, "type": "table_cell", "bbox": { "l": 280.56, "t": 69.2558, "r": 337.02, "b": 57.84 }, "text": "", "attrs": { "row": 2, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 20 }, { "id": "p57.5.22", "order": 27, "type": "table_cell", "bbox": { "l": 337.02, "t": 69.2558, "r": 393.48, "b": 57.84 }, "text": "", "attrs": { "row": 2, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 21 }, { "id": "p57.5.23", "order": 28, "type": "table_cell", "bbox": { "l": 393.48, "t": 69.2558, "r": 449.94, "b": 57.84 }, "text": "", "attrs": { "row": 2, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 22 }, { "id": "p57.5.24", "order": 29, "type": "table_cell", "bbox": { "l": 449.94, "t": 69.2558, "r": 506.4, "b": 57.84 }, "text": "", "attrs": { "row": 2, "col": 7, "rowspan": 1, "colspan": 1 }, "reading_order": 23 } ], "reading_order": 4 } ] }, { "document_id": 16592, "page": 58, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 11, "counts_by_type": { "caption": 1, "header": 2, "table": 1, "table_cell": 6, "text": 1 }, "build_ms": 11, "items": [ { "id": "p58.1", "order": 1, "type": "header", "bbox": { "l": 367.44, "t": 739.2, "r": 561.6, "b": 713.04 }, "text": "NOAA 24-hr D 2-Year Rainfall=3.42\"\nPrinted 04/12/2025", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p58.2", "order": 2, "type": "header", "bbox": { "l": 51.6, "t": 738, "r": 396.24, "b": 698.88 }, "text": "102 Sams -REV 12-02-25\nPrepared by Haler Consulting\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p58.3", "order": 3, "type": "text", "bbox": { "l": 516.72, "t": 710.88, "r": 559.2, "b": 699.12 }, "text": "Page 18", "attrs": { "block_label": "number" }, "reading_order": 2 }, { "id": "p58.4", "order": 4, "type": "caption", "bbox": { "l": 144.96, "t": 687.84, "r": 465.36, "b": 672.96 }, "text": "Stage-Area-Storage for Pond 144P: WQ Infiltration Basin #1", "attrs": { "block_label": "figure_title" }, "reading_order": 3 }, { "id": "p58.5", "order": 5, "type": "table", "bbox": { "l": 55.44, "t": 661.2, "r": 466.32, "b": 54 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 6, "integrity": { "cells_checked": 6, "cells_flagged": 0 } }, "children": [ { "id": "p58.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 57.479999, "t": 661.126246, "r": 98.137287, "b": 64.158859 }, "text": "Elevation (feet)\n95.00\n95.05\n95.10\n95.15\n95.20\n95.25\n95.30\n95.35\n95.40\n95.45\n95.50\n95.55\n95.60\n95.65\n95.70\n95.75\n95.80\n95.85\n95.90\n95.95\n96.00\n96.05\n96.10\n96.15\n96.20\n96.25\n96.30\n96.35\n96.40\n96.45\n96.50\n96.55\n96.60\n96.65\n96.70\n96.75\n96.80\n96.85\n96.90\n96.95\n97.00\n97.05\n97.10\n97.15\n97.20\n97.25\n97.30\n97.35\n97.40\n97.45\n97.50\n97.55", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p58.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 139.439999, "t": 661.126246, "r": 173.816353, "b": 64.158859 }, "text": "Surface (sq-ft)\n4,231\n4,274\n4,317\n4,360\n4,403\n4,446\n4,489\n4,532\n4,575\n4,618\n4,662\n4,705\n4,748\n4,791\n4,834\n4,877\n4,920\n4,963\n5,006\n5,049\n5,092\n5,138\n5,184\n5,229\n5,275\n5,321\n5,367\n5,413\n5,458\n5,504\n5,550\n5,596\n5,642\n5,687\n5,733\n5,779\n5,825\n5,871\n5,916\n5,962\n6,008\n6,057\n6,105\n6,154\n6,203\n6,251\n6,300\n6,349\n6,397\n6,446\n6,495\n6,543", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p58.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 199.55999, "t": 661.126246, "r": 249.524304, "b": 64.158859 }, "text": "Storage (cubic-feet)\n0\n213\n427\n644\n863\n1,085\n1,308\n1,534\n1,761\n1,991\n2,223\n2,457\n2,694\n2,932\n3,173\n3,415\n3,660\n3,907\n4,157\n4,408\n4,662\n4,917\n5,175\n5,436\n5,698\n5,963\n6,230\n6,500\n6,772\n7,046\n7,322\n7,601\n7,882\n8,165\n8,450\n8,738\n9,028\n9,321\n9,615\n9,912\n10,212\n10,513\n10,817\n11,124\n11,433\n11,744\n12,058\n12,374\n12,693\n13,014\n13,337\n13,663", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p58.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 273.240005, "t": 661.126246, "r": 313.897287, "b": 351.198838 }, "text": "Elevation (feet)\n97.60\n97.65\n97.70\n97.75\n97.80\n97.85\n97.90\n97.95\n98.00\n98.05\n98.10\n98.15\n98.20\n98.25\n98.30\n98.35\n98.40\n98.45\n98.50\n98.55\n98.60\n98.65\n98.70\n98.75\n98.80\n98.85", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p58.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 355.200005, "t": 661.126246, "r": 389.808242, "b": 351.198838 }, "text": "Surface (sq-ft)\n6,592\n6,640\n6,689\n6,738\n6,786\n6,835\n6,884\n6,932\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981", "attrs": { "row": 0, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p58.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 415.320008, "t": 661.126246, "r": 465.558002, "b": 351.198838 }, "text": "Storage (cubic-feet)\n13,991\n14,322\n14,655\n14,991\n15,329\n15,670\n16,013\n16,358\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706", "attrs": { "row": 0, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 } ], "reading_order": 4 } ] }, { "document_id": 16592, "page": 59, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 35, "counts_by_type": { "footnote": 2, "header": 1, "heading": 1, "table": 3, "table_cell": 28 }, "build_ms": 8, "items": [ { "id": "p59.1", "order": 1, "type": "header", "bbox": { "l": 53.52, "t": 738.72, "r": 560.88, "b": 698.16 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 2-Year Rainfall=3.42\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 19", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p59.2", "order": 2, "type": "heading", "bbox": { "l": 162, "t": 687.6, "r": 450, "b": 672.72 }, "text": "Summary for Pond 149P: WQ Infiltration Basin #2", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p59.3", "order": 3, "type": "table", "bbox": { "l": 51.6, "t": 664.56, "r": 550.8, "b": 515.177889 }, "text": "", "attrs": { "block_label": "table", "n_rows": 8, "n_cols": 1, "integrity": { "cells_checked": 8, "cells_flagged": 0 } }, "children": [ { "id": "p59.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 51.6, "t": 664.56, "r": 550.8, "b": 649.8 }, "text": "Inflow Area = 86,443 sf, 27.15% Impervious, Inflow Depth = 0.87\" for 2-Year event", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 0 }, { "id": "p59.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 51.6, "t": 649.8, "r": 550.8, "b": 635.04 }, "text": "Inflow = 1.53 cfs @ 12.13 hrs, Volume= 6,261 cf", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 1 }, { "id": "p59.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 51.6, "t": 635.04, "r": 550.8, "b": 620.28 }, "text": "Outflow = 0.08 cfs @ 14.36 hrs, Volume= 6,261 cf, Atten= 95%, Lag= 133.9 min", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 2 }, { "id": "p59.3.4", "order": 7, "type": "table_cell", "bbox": { "l": 51.6, "t": 620.28, "r": 550.8, "b": 605.52 }, "text": "Discarded = 0.08 cfs @ 14.36 hrs, Volume= 6,261 cf", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 3 }, { "id": "p59.3.5", "order": 8, "type": "table_cell", "bbox": { "l": 51.6, "t": 605.52, "r": 550.8, "b": 590.76 }, "text": "Primary = 0.00 cfs @ 0.00 hrs, Volume= 0 cf", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 4 }, { "id": "p59.3.6", "order": 9, "type": "table_cell", "bbox": { "l": 69.023569, "t": 599.142469, "r": 195.539615, "b": 587.177889 }, "text": "Routed to Link 147L : POA", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p59.3.7", "order": 10, "type": "table_cell", "bbox": { "l": 54, "t": 575.142469, "r": 395.5216, "b": 551.177889 }, "text": "Routing by Stor-Ind method, Time Span= 0.00-72.00 hrs, dt= 0.01 hrs\nPeak Elev= 92.02' @ 14.36 hrs Surf.Area= 3,332 sf Storage= 3,026 cf", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p59.3.8", "order": 11, "type": "table_cell", "bbox": { "l": 54, "t": 539.142469, "r": 413.896973, "b": 515.177889 }, "text": "Plug-Flow detention time= 342.1 min calculated for 6,260 cf (100% of inflow)\nCenter-of-Mass det. time= 342.1 min ( 1,103.5 - 761.4 )", "attrs": { "row": 7, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 7 } ], "reading_order": 2 }, { "id": "p59.4", "order": 12, "type": "table", "bbox": { "l": 52.8, "t": 505.2, "r": 557.28, "b": 376.32 }, "text": "", "attrs": { "block_label": "table", "n_rows": 2, "n_cols": 5, "integrity": { "cells_checked": 8, "cells_flagged": 0 } }, "children": [ { "id": "p59.4.1", "order": 13, "type": "table_cell", "bbox": { "l": 54, "t": 503.142469, "r": 90.142207, "b": 477.257868 }, "text": "Volume\n#1", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p59.4.2", "order": 14, "type": "table_cell", "bbox": { "l": 120.355217, "t": 503.142469, "r": 148.95691, "b": 477.257868 }, "text": "Invert\n91.00'", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p59.4.3", "order": 15, "type": "table_cell", "bbox": { "l": 170.997811, "t": 503.142469, "r": 234.422951, "b": 477.257868 }, "text": "Avail.Storage\n13,818 cf", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p59.4.4", "order": 16, "type": "table_cell", "bbox": { "l": 246.044461, "t": 503.142469, "r": 502.944852, "b": 477.137889 }, "text": "Storage Description\nCustom Stage Data (Prismatic) Listed below (Recalc)", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p59.4.5", "order": 17, "type": "table_cell", "bbox": { "l": 57.360002, "t": 465.222448, "r": 101.273013, "b": 379.337871 }, "text": "Elevation\\n(feet)\n91.00\n92.00\n93.00\n94.00\n94.50", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p59.4.6", "order": 18, "type": "table_cell", "bbox": { "l": 140.447365, "t": 465.222448, "r": 185.72688, "b": 379.337871 }, "text": "Surf.Area\\n(sq-ft)\n2,628\n3,320\n4,067\n5,010\n5,438", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p59.4.7", "order": 19, "type": "table_cell", "bbox": { "l": 227.371027, "t": 465.222448, "r": 354.642567, "b": 379.337871 }, "text": "Inc.Store\\n(cubic-feet)\n0\n2,974\n3,694\n4,539\n2,612", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p59.4.8", "order": 20, "type": "table_cell", "bbox": { "l": 216.402998, "t": 465.222448, "r": 354.689052, "b": 379.337871 }, "text": "Cum.Store\\n(cubic-feet)\n0\n2,974\n6,668\n11,206\n13,818", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 7 } ], "reading_order": 3 }, { "id": "p59.5", "order": 21, "type": "table", "bbox": { "l": 52.08, "t": 367.92, "r": 556.32, "b": 278.88 }, "text": "", "attrs": { "block_label": "table", "n_rows": 3, "n_cols": 4, "integrity": { "cells_checked": 12, "cells_flagged": 0 } }, "children": [ { "id": "p59.5.1", "order": 22, "type": "table_cell", "bbox": { "l": 54, "t": 367.302451, "r": 86.679256, "b": 355.337871 }, "text": "Device", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p59.5.2", "order": 23, "type": "table_cell", "bbox": { "l": 98.407976, "t": 367.302451, "r": 135.030741, "b": 355.337871 }, "text": "Routing", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p59.5.3", "order": 24, "type": "table_cell", "bbox": { "l": 182.045624, "t": 367.302451, "r": 208.824841, "b": 355.337871 }, "text": "Invert", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p59.5.4", "order": 25, "type": "table_cell", "bbox": { "l": 220.650048, "t": 367.302451, "r": 290.014595, "b": 355.337871 }, "text": "Outlet Devices", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 3 }, { "id": "p59.5.5", "order": 26, "type": "table_cell", "bbox": { "l": 70.320002, "t": 353.382452, "r": 82.177372, "b": 341.417872 }, "text": "#1", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p59.5.6", "order": 27, "type": "table_cell", "bbox": { "l": 98.408891, "t": 353.382452, "r": 135.204992, "b": 341.417872 }, "text": "Primary", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p59.5.7", "order": 28, "type": "table_cell", "bbox": { "l": 354.69794, "t": 329.382452, "r": 383.299634, "b": 317.417872 }, "text": "93.80'", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p59.5.8", "order": 29, "type": "table_cell", "bbox": { "l": 220.679993, "t": 353.262472, "r": 512.979659, "b": 305.417872 }, "text": "6.0\" Round Culvert to Subsurface Basin\\nL= 35.0' RCP, square edge headwall, Ke= 0.500\\nInlet / Outlet Invert= 92.00' / 93.80' S= -0.0514'' Cc= 0.900\\nn= 0.012 Corrugated PP, smooth interior, Flow Area= 0.20 sf", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p59.5.9", "order": 30, "type": "table_cell", "bbox": { "l": 70.320002, "t": 305.382452, "r": 82.177372, "b": 281.417872 }, "text": "#2\n#3", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 8 }, { "id": "p59.5.10", "order": 31, "type": "table_cell", "bbox": { "l": 98.408891, "t": 305.382452, "r": 146.474595, "b": 281.417872 }, "text": "Device 1\nDiscarded", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 9 }, { "id": "p59.5.11", "order": 32, "type": "table_cell", "bbox": { "l": 180.288471, "t": 305.382452, "r": 208.918642, "b": 281.417872 }, "text": "93.00'\n91.00'", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 10 }, { "id": "p59.5.12", "order": 33, "type": "table_cell", "bbox": { "l": 220.679993, "t": 305.382452, "r": 531.965762, "b": 281.297892 }, "text": "4.0' long Sharp-Crested Rectangular Weir 2 End Contraction(s)\n1.050 in/hr Exfiltration over Surface area", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 11 } ], "reading_order": 4 }, { "id": "p59.6", "order": 34, "type": "footnote", "bbox": { "l": 51.12, "t": 270, "r": 429.6, "b": 244.32 }, "text": "Discarded OutFlow Max=0.08 cfs @ 14.36 hrs HW=92.02' (Free Discharge)\n3=Exfiltration (Exfiltration Controls 0.08 cfs)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 5 }, { "id": "p59.7", "order": 35, "type": "footnote", "bbox": { "l": 52.08, "t": 234, "r": 412.8, "b": 196.32 }, "text": "Primary OutFlow Max=0.00 cfs @ 0.00 hrs HW=91.00' (Free Discharge)\n1=Culvert to Subsurface Basin (Controls 0.00 cfs)\n2=Sharp-Crested Rectangular Weir (Controls 0.00 cfs)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 6 } ] }, { "document_id": 16592, "page": 60, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 7, "counts_by_type": { "caption": 1, "figure": 1, "footnote": 2, "header": 3 }, "build_ms": 0, "items": [ { "id": "p60.1", "order": 1, "type": "header", "bbox": { "l": 367.44, "t": 738.72, "r": 560.64, "b": 710.16 }, "text": "NOAA 24-hr D 2-Year Rainfall=3.42\"\nPrinted 04/12/2025", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p60.2", "order": 2, "type": "header", "bbox": { "l": 52.08, "t": 738, "r": 392.88, "b": 699.12 }, "text": "102 Sams -REV 12-02-25\nPrepared by Haler Consulting\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p60.3", "order": 3, "type": "header", "bbox": { "l": 517.2, "t": 711.36, "r": 559.44, "b": 699.12 }, "text": "Page 20", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 2 }, { "id": "p60.4", "order": 4, "type": "caption", "bbox": { "l": 201.12, "t": 687.6, "r": 410.64, "b": 672.96 }, "text": "Pond 149P: WQ Infiltration Basin #2", "attrs": { "block_label": "figure_title" }, "reading_order": 3 }, { "id": "p60.5", "order": 5, "type": "figure", "bbox": { "l": 63.36, "t": 669.12, "r": 489.36, "b": 416.64 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n1.53 cfs\nInflow Area=86,443 sf\nPeak Elev=92.02'\nStorage=3,026 cf\n1\n(cfs)\nFlow\n0.08 cfs\n0.08 cfs\n0.00 cfs\n0" }, "reading_order": 4 }, { "id": "p60.6", "order": 6, "type": "footnote", "bbox": { "l": 83.04, "t": 420, "r": 449.52, "b": 400.8 }, "text": "0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72 Time (hours)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 5 }, { "id": "p60.7", "order": 7, "type": "footnote", "bbox": { "l": 497.04, "t": 645.12, "r": 547.44, "b": 609.84 }, "text": "Inflow Outflow Discarded Primary", "attrs": { "block_label": "vision_footnote" }, "reading_order": 6 } ] }, { "document_id": 16592, "page": 61, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 27, "counts_by_type": { "caption": 1, "header": 1, "table": 1, "table_cell": 24 }, "build_ms": 17, "items": [ { "id": "p61.1", "order": 1, "type": "header", "bbox": { "l": 53.04, "t": 738.72, "r": 562.08, "b": 698.64 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 2-Year Rainfall=3.42\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 21", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p61.2", "order": 2, "type": "caption", "bbox": { "l": 153.6, "t": 687.84, "r": 458.16, "b": 672.96 }, "text": "Stage-Discharge for Pond 149P: WQ Infiltration Basin #2", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p61.3", "order": 3, "type": "table", "bbox": { "l": 55.2, "t": 664.56, "r": 506.4, "b": 56.88 }, "text": "", "attrs": { "block_label": "table", "n_rows": 3, "n_cols": 8, "integrity": { "cells_checked": 16, "cells_flagged": 0 } }, "children": [ { "id": "p61.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 57.479999, "t": 661.126246, "r": 98.137287, "b": 108.31886299999996 }, "text": "Elevation (feet)\n91.00\n91.05\n91.10\n91.15\n91.20\n91.25\n91.30\n91.35\n91.40\n91.45\n91.50\n91.55\n91.60\n91.65\n91.70\n91.75\n91.80\n91.85\n91.90\n91.95\n92.00\n92.05\n92.10\n92.15\n92.20\n92.25\n92.30\n92.35\n92.40\n92.45\n92.50\n92.55\n92.60\n92.65\n92.70\n92.75\n92.80\n92.85\n92.90\n92.95\n93.00\n93.05\n93.10\n93.15\n93.20\n93.25\n93.30\n93.35", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p61.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 109.680004, "t": 661.126246, "r": 154.533694, "b": 108.31886299999996 }, "text": "Discharge (cfs)\n0.00\n0.06\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.08\n0.08\n0.08\n0.08\n0.08\n0.08\n0.08\n0.08\n0.08\n0.08\n0.08\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.11\n0.11", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p61.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 166.080002, "t": 661.126246, "r": 210.875583, "b": 108.31886299999996 }, "text": "Discarded (cfs)\n0.00\n0.06\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.08\n0.08\n0.08\n0.08\n0.08\n0.08\n0.08\n0.08\n0.08\n0.08\n0.08\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.11\n0.11", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p61.3.4", "order": 7, "type": "table_cell", "bbox": { "l": 233.160004, "t": 661.126246, "r": 267.536512, "b": 108.31886299999996 }, "text": "Primary (cfs)\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p61.3.5", "order": 8, "type": "table_cell", "bbox": { "l": 291, "t": 661.126246, "r": 331.657282, "b": 428.478844 }, "text": "Elevation (feet)\n93.60\n93.65\n93.70\n93.75\n93.80\n93.85\n93.90\n93.95\n94.00\n94.05\n94.10\n94.15\n94.20\n94.25\n94.30\n94.35\n94.40\n94.45\n94.50", "attrs": { "row": 0, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p61.3.6", "order": 9, "type": "table_cell", "bbox": { "l": 343.200005, "t": 661.126246, "r": 388.300713, "b": 428.478844 }, "text": "Discharge (cfs)\n0.11\n0.11\n0.11\n0.12\n0.12\n0.13\n0.15\n0.19\n0.23\n0.29\n0.35\n0.42\n0.49\n0.55\n0.60\n0.65\n0.69\n0.73\n0.77", "attrs": { "row": 0, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p61.3.7", "order": 10, "type": "table_cell", "bbox": { "l": 399.599991, "t": 661.126246, "r": 444.718503, "b": 428.478844 }, "text": "Discarded (cfs)\n0.11\n0.11\n0.11\n0.12\n0.12\n0.12\n0.12\n0.12\n0.12\n0.12\n0.12\n0.12\n0.13\n0.13\n0.13\n0.13\n0.13\n0.13\n0.13", "attrs": { "row": 0, "col": 6, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p61.3.8", "order": 11, "type": "table_cell", "bbox": { "l": 466.679993, "t": 661.126246, "r": 501.056501, "b": 428.478844 }, "text": "Primary (cfs)\n0.00\n0.00\n0.00\n0.00\n0.00\n0.01\n0.03\n0.07\n0.11\n0.17\n0.23\n0.30\n0.36\n0.43\n0.47\n0.52\n0.56\n0.60\n0.63", "attrs": { "row": 0, "col": 7, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 7 }, { "id": "p61.3.9", "order": 12, "type": "table_cell", "bbox": { "l": 73.320002, "t": 108.28622600000006, "r": 98.137287, "b": 75.19883800000002 }, "text": "93.40\n93.45\n93.50", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 8 }, { "id": "p61.3.10", "order": 13, "type": "table_cell", "bbox": { "l": 135.26256, "t": 97.24624900000003, "r": 154.533694, "b": 64.158859 }, "text": "0.11\n0.11\n0.11", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 9 }, { "id": "p61.3.11", "order": 14, "type": "table_cell", "bbox": { "l": 191.560334, "t": 97.24624900000003, "r": 210.875583, "b": 64.158859 }, "text": "0.11\n0.11\n0.11", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 10 }, { "id": "p61.3.12", "order": 15, "type": "table_cell", "bbox": { "l": 248.000856, "t": 97.24624900000003, "r": 267.196089, "b": 64.158859 }, "text": "0.00\n0.00\n0.00", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 11 }, { "id": "p61.3.13", "order": 16, "type": "table_cell", "bbox": { "l": 280.8, "t": 102.7426, "r": 337.2, "b": 91.277 }, "text": "", "attrs": { "row": 1, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 12 }, { "id": "p61.3.14", "order": 17, "type": "table_cell", "bbox": { "l": 337.2, "t": 102.7426, "r": 393.6, "b": 91.277 }, "text": "", "attrs": { "row": 1, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 13 }, { "id": "p61.3.15", "order": 18, "type": "table_cell", "bbox": { "l": 393.6, "t": 102.7426, "r": 450, "b": 91.277 }, "text": "", "attrs": { "row": 1, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 14 }, { "id": "p61.3.16", "order": 19, "type": "table_cell", "bbox": { "l": 450, "t": 102.7426, "r": 506.4, "b": 91.277 }, "text": "", "attrs": { "row": 1, "col": 7, "rowspan": 1, "colspan": 1 }, "reading_order": 15 }, { "id": "p61.3.17", "order": 20, "type": "table_cell", "bbox": { "l": 73.320002, "t": 75.166246, "r": 98.137287, "b": 64.158859 }, "text": "93.55", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p61.3.18", "order": 21, "type": "table_cell", "bbox": { "l": 135.26256, "t": 108.28622600000006, "r": 154.533694, "b": 97.27883899999995 }, "text": "0.11", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p61.3.19", "order": 22, "type": "table_cell", "bbox": { "l": 191.560334, "t": 108.28622600000006, "r": 210.875583, "b": 97.27883899999995 }, "text": "0.11", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p61.3.20", "order": 23, "type": "table_cell", "bbox": { "l": 248.000856, "t": 108.28622600000006, "r": 267.196089, "b": 97.27883899999995 }, "text": "0.00", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p61.3.21", "order": 24, "type": "table_cell", "bbox": { "l": 280.8, "t": 68.3457, "r": 337.2, "b": 56.88 }, "text": "", "attrs": { "row": 2, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 20 }, { "id": "p61.3.22", "order": 25, "type": "table_cell", "bbox": { "l": 337.2, "t": 68.3457, "r": 393.6, "b": 56.88 }, "text": "", "attrs": { "row": 2, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 21 }, { "id": "p61.3.23", "order": 26, "type": "table_cell", "bbox": { "l": 393.6, "t": 68.3457, "r": 450, "b": 56.88 }, "text": "", "attrs": { "row": 2, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 22 }, { "id": "p61.3.24", "order": 27, "type": "table_cell", "bbox": { "l": 450, "t": 68.3457, "r": 506.4, "b": 56.88 }, "text": "", "attrs": { "row": 2, "col": 7, "rowspan": 1, "colspan": 1 }, "reading_order": 23 } ], "reading_order": 2 } ] }, { "document_id": 16592, "page": 62, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 47, "counts_by_type": { "caption": 1, "header": 3, "table": 1, "table_cell": 42 }, "build_ms": 12, "items": [ { "id": "p62.1", "order": 1, "type": "header", "bbox": { "l": 510.96, "t": 738.96, "r": 561.36, "b": 699.12 }, "text": "fall=3.42\"\n4/12/2025\nPage 22", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p62.2", "order": 2, "type": "header", "bbox": { "l": 367.44, "t": 738.48, "r": 560.88, "b": 714.96 }, "text": "NOAA 24-hr D 2-Year Rainfall=3.42\" Printed 04/12/2025", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p62.3", "order": 3, "type": "header", "bbox": { "l": 52.08, "t": 738.24, "r": 396.96, "b": 699.12 }, "text": "102 Sams -REV 12-02-25\nPrepared by Haler Consulting\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 2 }, { "id": "p62.4", "order": 4, "type": "caption", "bbox": { "l": 145.92, "t": 687.84, "r": 466.08, "b": 672.96 }, "text": "Stage-Area-Storage for Pond 149P: WQ Infiltration Basin #2", "attrs": { "block_label": "figure_title" }, "reading_order": 3 }, { "id": "p62.5", "order": 5, "type": "table", "bbox": { "l": 54.96, "t": 665.76, "r": 465.558002, "b": 51.84 }, "text": "", "attrs": { "block_label": "table", "n_rows": 7, "n_cols": 6, "integrity": { "cells_checked": 42, "cells_flagged": 3, "flags": [ { "row": 1, "col": 5, "coverage": 0, "text": "10,463" }, { "row": 3, "col": 5, "coverage": 0, "text": "11,717" }, { "row": 5, "col": 5, "coverage": 0, "text": "12,488" } ] } }, "children": [ { "id": "p62.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 57.479999, "t": 661.126246, "r": 98.137287, "b": 583.038857 }, "text": "Elevation (feet)\n91.00\n91.05\n91.10\n91.15\n91.20", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p62.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 139.439999, "t": 661.126246, "r": 173.816353, "b": 583.038857 }, "text": "Surface (sq-ft)\n2,628\n2,663\n2,697\n2,732\n2,766", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p62.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 199.55999, "t": 661.126246, "r": 249.522956, "b": 583.038857 }, "text": "Storage (cubic-feet)\n0\n132\n266\n402\n539", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p62.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 273.240005, "t": 661.126246, "r": 313.897287, "b": 583.038857 }, "text": "Elevation (feet)\n93.60\n93.65\n93.70\n93.75\n93.80", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p62.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 355.200005, "t": 661.126246, "r": 389.576359, "b": 583.038857 }, "text": "Surface (sq-ft)\n4,633\n4,680\n4,727\n4,774\n4,821", "attrs": { "row": 0, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p62.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 415.320008, "t": 661.126246, "r": 465.284304, "b": 583.038857 }, "text": "Storage (cubic-feet)\n9,277\n9,510\n9,745\n9,983\n10,223", "attrs": { "row": 0, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p62.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 73.320002, "t": 583.006243, "r": 98.137287, "b": 571.9988559999999 }, "text": "91.25", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p62.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 148.972477, "t": 583.006243, "r": 173.773196, "b": 571.9988559999999 }, "text": "2,801", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p62.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 232.992149, "t": 583.006243, "r": 249.447055, "b": 571.9988559999999 }, "text": "679", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p62.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 289.080002, "t": 583.006243, "r": 313.897287, "b": 571.9988559999999 }, "text": "93.85", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p62.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 364.732477, "t": 583.006243, "r": 389.533196, "b": 571.9988559999999 }, "text": "4,869", "attrs": { "row": 1, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p62.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 394.36, "t": 596.2596, "r": 462.24, "b": 584.6762 }, "text": "10,463", "attrs": { "row": 1, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 11 }, { "id": "p62.5.13", "order": 18, "type": "table_cell", "bbox": { "l": 73.320002, "t": 571.966242, "r": 98.137287, "b": 527.838853 }, "text": "91.30\n91.35\n91.40\n91.45", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 12 }, { "id": "p62.5.14", "order": 19, "type": "table_cell", "bbox": { "l": 148.972477, "t": 571.966242, "r": 173.773196, "b": 527.838853 }, "text": "2,836\n2,870\n2,905\n2,939", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 13 }, { "id": "p62.5.15", "order": 20, "type": "table_cell", "bbox": { "l": 224.707019, "t": 571.966242, "r": 249.524304, "b": 527.838853 }, "text": "820\n962\n1,107\n1,253", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 14 }, { "id": "p62.5.16", "order": 21, "type": "table_cell", "bbox": { "l": 289.080002, "t": 571.966242, "r": 313.897287, "b": 527.838853 }, "text": "93.90\n93.95\n94.00\n94.05", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 15 }, { "id": "p62.5.17", "order": 22, "type": "table_cell", "bbox": { "l": 364.732477, "t": 571.966242, "r": 389.533196, "b": 527.838853 }, "text": "4,916\n4,963\n5,010\n5,053", "attrs": { "row": 2, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 16 }, { "id": "p62.5.18", "order": 23, "type": "table_cell", "bbox": { "l": 434.943599, "t": 571.966242, "r": 465.246354, "b": 527.838853 }, "text": "10,710\n10,957\n11,206\n11,458", "attrs": { "row": 2, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 17 }, { "id": "p62.5.19", "order": 24, "type": "table_cell", "bbox": { "l": 73.320002, "t": 527.806238, "r": 98.137287, "b": 516.798851 }, "text": "91.50", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p62.5.20", "order": 25, "type": "table_cell", "bbox": { "l": 148.972477, "t": 527.806238, "r": 173.773196, "b": 516.798851 }, "text": "2,974", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p62.5.21", "order": 26, "type": "table_cell", "bbox": { "l": 224.707019, "t": 527.806238, "r": 249.524304, "b": 516.798851 }, "text": "1,401", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p62.5.22", "order": 27, "type": "table_cell", "bbox": { "l": 289.080002, "t": 527.806238, "r": 313.897287, "b": 516.798851 }, "text": "94.10", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p62.5.23", "order": 28, "type": "table_cell", "bbox": { "l": 364.732477, "t": 527.806238, "r": 389.533196, "b": 516.798851 }, "text": "5,096", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 22 }, { "id": "p62.5.24", "order": 29, "type": "table_cell", "bbox": { "l": 394.36, "t": 538.3426, "r": 462.24, "b": 526.7592 }, "text": "11,717", "attrs": { "row": 3, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 23 }, { "id": "p62.5.25", "order": 30, "type": "table_cell", "bbox": { "l": 73.320002, "t": 516.766237, "r": 98.137287, "b": 494.71885 }, "text": "91.55\n91.60", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 24 }, { "id": "p62.5.26", "order": 31, "type": "table_cell", "bbox": { "l": 148.972477, "t": 516.766237, "r": 173.773196, "b": 494.71885 }, "text": "3,009\n3,043", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 25 }, { "id": "p62.5.27", "order": 32, "type": "table_cell", "bbox": { "l": 224.707019, "t": 516.766237, "r": 249.524304, "b": 494.71885 }, "text": "1,550\n1,701", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 26 }, { "id": "p62.5.28", "order": 33, "type": "table_cell", "bbox": { "l": 289.080002, "t": 516.766237, "r": 313.897287, "b": 494.71885 }, "text": "94.15\n94.20", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 27 }, { "id": "p62.5.29", "order": 34, "type": "table_cell", "bbox": { "l": 364.732477, "t": 516.766237, "r": 389.533196, "b": 494.71885 }, "text": "5,138\n5,181", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 28 }, { "id": "p62.5.30", "order": 35, "type": "table_cell", "bbox": { "l": 434.943599, "t": 516.766237, "r": 465.246354, "b": 494.71885 }, "text": "11,967\n12,225", "attrs": { "row": 4, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 29 }, { "id": "p62.5.31", "order": 36, "type": "table_cell", "bbox": { "l": 73.320002, "t": 494.686236, "r": 98.137287, "b": 483.678849 }, "text": "91.65", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 30 }, { "id": "p62.5.32", "order": 37, "type": "table_cell", "bbox": { "l": 148.972477, "t": 494.686236, "r": 173.773196, "b": 483.678849 }, "text": "3,078", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 31 }, { "id": "p62.5.33", "order": 38, "type": "table_cell", "bbox": { "l": 224.707019, "t": 494.686236, "r": 249.524304, "b": 483.678849 }, "text": "1,854", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 32 }, { "id": "p62.5.34", "order": 39, "type": "table_cell", "bbox": { "l": 289.080002, "t": 494.686236, "r": 313.897287, "b": 483.678849 }, "text": "94.25", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 33 }, { "id": "p62.5.35", "order": 40, "type": "table_cell", "bbox": { "l": 364.732477, "t": 494.686236, "r": 389.533196, "b": 483.678849 }, "text": "5,224", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 34 }, { "id": "p62.5.36", "order": 41, "type": "table_cell", "bbox": { "l": 394.36, "t": 503.5925, "r": 462.24, "b": 492.0091 }, "text": "12,488", "attrs": { "row": 5, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 35 }, { "id": "p62.5.37", "order": 42, "type": "table_cell", "bbox": { "l": 73.320002, "t": 483.646234, "r": 98.137287, "b": 64.158859 }, "text": "91.70\n91.75\n91.80\n91.85\n91.90\n91.95\n92.00\n92.05\n92.10\n92.15\n92.20\n92.25\n92.30\n92.35\n92.40\n92.45\n92.50\n92.55\n92.60\n92.65\n92.70\n92.75\n92.80\n92.85\n92.90\n92.95\n93.00\n93.05\n93.10\n93.15\n93.20\n93.25\n93.30\n93.35\n93.40\n93.45\n93.50\n93.55", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 36 }, { "id": "p62.5.38", "order": 43, "type": "table_cell", "bbox": { "l": 148.972477, "t": 483.646234, "r": 173.773196, "b": 64.158859 }, "text": "3,112\n3,147\n3,182\n3,216\n3,251\n3,285\n3,320\n3,357\n3,395\n3,432\n3,469\n3,507\n3,544\n3,581\n3,619\n3,656\n3,694\n3,731\n3,768\n3,806\n3,843\n3,880\n3,918\n3,955\n3,992\n4,030\n4,067\n4,114\n4,161\n4,208\n4,256\n4,303\n4,350\n4,397\n4,444\n4,491\n4,539\n4,586", "attrs": { "row": 6, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 37 }, { "id": "p62.5.39", "order": 44, "type": "table_cell", "bbox": { "l": 224.707019, "t": 483.646234, "r": 249.524304, "b": 64.158859 }, "text": "2,009\n2,166\n2,324\n2,484\n2,645\n2,809\n2,974\n3,141\n3,310\n3,480\n3,653\n3,827\n4,004\n4,182\n4,362\n4,544\n4,727\n4,913\n5,100\n5,290\n5,481\n5,674\n5,869\n6,066\n6,265\n6,465\n6,668\n6,872\n7,079\n7,288\n7,500\n7,714\n7,930\n8,149\n8,370\n8,593\n8,819\n9,047", "attrs": { "row": 6, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 38 }, { "id": "p62.5.40", "order": 45, "type": "table_cell", "bbox": { "l": 289.080002, "t": 483.646234, "r": 313.897287, "b": 428.478844 }, "text": "94.30\n94.35\n94.40\n94.45\n94.50", "attrs": { "row": 6, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 39 }, { "id": "p62.5.41", "order": 46, "type": "table_cell", "bbox": { "l": 364.732477, "t": 483.646234, "r": 389.808242, "b": 428.478844 }, "text": "5,267\n5,310\n5,352\n5,395\n5,438", "attrs": { "row": 6, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 40 }, { "id": "p62.5.42", "order": 47, "type": "table_cell", "bbox": { "l": 434.943599, "t": 483.646234, "r": 465.558002, "b": 428.478844 }, "text": "12,748\n13,012\n13,278\n13,547\n13,818", "attrs": { "row": 6, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 41 } ], "reading_order": 4 } ] }, { "document_id": 16592, "page": 63, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 11, "counts_by_type": { "caption": 2, "figure": 1, "footer": 1, "footnote": 1, "header": 2, "heading": 1, "text": 3 }, "build_ms": 1, "items": [ { "id": "p63.1", "order": 1, "type": "header", "bbox": { "l": 367.44, "t": 738.96, "r": 560.64, "b": 712.8 }, "text": "NOAA 24-hr D 2-Year Rainfall=3.42\"\nPrinted 04/12/2025", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p63.2", "order": 2, "type": "header", "bbox": { "l": 52.08, "t": 737.76, "r": 396.24, "b": 699.36 }, "text": "102 Sams -REV 12-02-25\nPrepared by Haler Consulting\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p63.3", "order": 3, "type": "text", "bbox": { "l": 517.2, "t": 710.88, "r": 558.96, "b": 699.36 }, "text": "Page 23", "attrs": { "block_label": "number" }, "reading_order": 2 }, { "id": "p63.4", "order": 4, "type": "heading", "bbox": { "l": 221.04, "t": 687.36, "r": 391.92, "b": 672.48 }, "text": "Summary for Link 147L: POA", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 3 }, { "id": "p63.5", "order": 5, "type": "text", "bbox": { "l": 52.32, "t": 659.76, "r": 515.28, "b": 622.32 }, "text": "Inflow Area = 536,539 sf, 11.25% Impervious, Inflow Depth = 0.03\" for 2-Year event\nInflow = 0.43 cfs @ 12.10 hrs, Volume= 1,394 cf\nPrimary = 0.43 cfs @ 12.10 hrs, Volume= 1,394 cf, Atten= 0%, Lag= 0.0 min", "reading_order": 4 }, { "id": "p63.6", "order": 6, "type": "text", "bbox": { "l": 52.08, "t": 611.28, "r": 366.96, "b": 597.84 }, "text": "Primary outflow = Inflow, Time Span = 0.00-72.00 hrs, dt = 0.01 hrs", "reading_order": 5 }, { "id": "p63.7", "order": 7, "type": "caption", "bbox": { "l": 259.44, "t": 586.32, "r": 352.56, "b": 572.64 }, "text": "Link 147L: POA", "attrs": { "block_label": "figure_title" }, "reading_order": 6 }, { "id": "p63.8", "order": 8, "type": "caption", "bbox": { "l": 252.96, "t": 566.4, "r": 303.6, "b": 555.84 }, "text": "Hydrograph", "attrs": { "block_label": "figure_title" }, "reading_order": 7 }, { "id": "p63.9", "order": 9, "type": "figure", "bbox": { "l": 65.04, "t": 561.36, "r": 494.16, "b": 307.44 }, "text": "", "attrs": { "block_label": "image", "embedded_text": "0.46 0.43 cfs\nInflow Area=536,539 sf\n0.44 0.43 cfs\n0.42\n0.4\n0.38\n0.36\n0.34\n0.32\n0.3\n0.28\n(cfs) 0.26\n0.24\nFlow\n0.22\n0.2\n0.18\n0.16\n0.14\n0.12\n0.1\n0.08\n0.06\n0.04\n0.02\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72" }, "reading_order": 8 }, { "id": "p63.10", "order": 10, "type": "footnote", "bbox": { "l": 91.2, "t": 317.28, "r": 478.8, "b": 300 }, "text": "0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72 Time (hours)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 9 }, { "id": "p63.11", "order": 11, "type": "footer", "bbox": { "l": 506.16, "t": 544.8, "r": 546.96, "b": 525.36 }, "text": "", "attrs": { "block_label": "footer_image" }, "reading_order": 10 } ] }, { "document_id": 16592, "page": 64, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 2, "counts_by_type": { "footer": 1, "text": 1 }, "build_ms": 2, "items": [ { "id": "p64.1", "order": 1, "type": "text", "bbox": { "l": 49.68, "t": 680.88, "r": 560.64, "b": 222.24 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious\nReach routing by Stor-Ind+Trans method - Pond routing by Stor-Ind method\n\nSubcatchment 141S: DA P1 (Impervious) Runoff Area=31,625 sf 100.00% Impervious Runoff Depth=5.14\"\nFlow Length=450' Tc=3.0 min CN=0/98 Runoff=3.70 cfs 13,553 cf\n\nSubcatchment 143S: DA P2 (Impervious) Runoff Area=23,470 sf 100.00% Impervious Runoff Depth=5.14\"\nFlow Length=450' Tc=4.9 min CN=0/98 Runoff=2.42 cfs 10,058 cf\n\nSubcatchment 145S: DA P5 (4000 SF Roof) Runoff Area=4,000 sf 0.00% Impervious Runoff Depth=5.14\"\nTc=6.0 min CN=98/0 Runoff=0.38 cfs 1,714 cf\n\nSubcatchment 148S: DA P3 (Pervious) Runoff Area=62,973 sf 0.00% Impervious Runoff Depth=0.28\"\nFlow Length=316' Slope=0.0200'/' Tc=13.1 min CN=39/0 Runoff=0.07 cfs 1,487 cf\n\nSubcatchment 149S: DA P0 Pervious Runoff Area=336,250 sf 0.00% Impervious Runoff Depth=0.08\"\nFlow Length=679' Tc=49.8 min CN=33/0 Runoff=0.06 cfs 2,256 cf\n\nSubcatchment 150S: DA P4 (Pervious) Runoff Area=76,971 sf 0.00% Impervious Runoff Depth=0.28\"\nFlow Length=196' Slope=0.0100'/' Tc=14.8 min CN=39/0 Runoff=0.09 cfs 1,818 cf\n\nSubcatchment 172S: DA P6 (Impervious) Runoff Area=5,250 sf 100.00% Impervious Runoff Depth=5.14\"\nFlow Length=150' Tc=1.4 min CN=0/98 Runoff=0.67 cfs 2,250 cf\n\nPond 130P: SUBSURFACE Peak Elevation=2.25' Storage=576 cfs Runoff=0.38 cfs 1,714 cf\nOutflow=0.04 cfs 1,714 cf\n\nPond 144P: WQ Infiltration Basin #1 Peak Elevation=96.01' Storage=4,717 cfs Runoff=3.70 cfs 15,371 cf\nDiscarded=0.37 cfs Runoff=0.37 cfs 15,371 cf Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff=0.37 cfs Runoff", "attrs": { "block_label": "algorithm" }, "reading_order": 0 }, { "id": "p64.2", "order": 2, "type": "footer", "bbox": { "l": 50.4, "t": 739.44, "r": 559.68, "b": 699.6 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 10-Year Rainfall=5.38\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 24", "attrs": { "block_label": "footer" }, "reading_order": 1 } ] }, { "document_id": 16592, "page": 65, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 32, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "table": 1, "table_cell": 24, "text": 3, "title": 1 }, "build_ms": 3, "items": [ { "id": "p65.1", "order": 1, "type": "header", "bbox": { "l": 53.28, "t": 738.48, "r": 560.64, "b": 698.64 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 10-Year Rainfall=5.38\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 25", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p65.2", "order": 2, "type": "title", "bbox": { "l": 148.08, "t": 687.6, "r": 463.92, "b": 672.24 }, "text": "Summary for Subcatchment 141S: DA P1 (Impervious)", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p65.3", "order": 3, "type": "text", "bbox": { "l": 53.76, "t": 660.48, "r": 463.68, "b": 634.08 }, "text": "Runoff = 3.70 cfs @ 12.11 hrs, Volume= 13,553 cf, Depth= 5.14\"\nRouted to Pond 144P : WQ Infiltration Basin #1", "reading_order": 2 }, { "id": "p65.4", "order": 4, "type": "text", "bbox": { "l": 52.08, "t": 623.76, "r": 611.28, "b": 598.32 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious, Time Span= 0.00-72.00 hrs, dt= NOAA 24-hr D 10-Year Rainfall=5.38\"", "reading_order": 3 }, { "id": "p65.5", "order": 5, "type": "table", "bbox": { "l": 52.56, "t": 588.48, "r": 559.2, "b": 447.497874 }, "text": "", "attrs": { "block_label": "table", "n_rows": 6, "n_cols": 5, "integrity": { "cells_checked": 22, "cells_flagged": 0 } }, "children": [ { "id": "p65.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 86.520001, "t": 587.142469, "r": 127.590159, "b": 575.177889 }, "text": "Area (sf)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p65.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 144.389888, "t": 587.142469, "r": 159.742288, "b": 575.177889 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p65.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 286.601768, "t": 535.302451, "r": 340.102911, "b": 523.337871 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p65.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 95.280001, "t": 559.302451, "r": 127.805562, "b": 547.337871 }, "text": "31,625", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 3 }, { "id": "p65.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 148.003832, "t": 559.302451, "r": 159.753993, "b": 547.337871 }, "text": "98", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p65.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 174.16295, "t": 573.222448, "r": 281.259838, "b": 561.257868 }, "text": "Paved parking, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 5 }, { "id": "p65.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 95.280001, "t": 573.222448, "r": 127.805562, "b": 561.257868 }, "text": "31,625", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p65.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 148.003832, "t": 573.222448, "r": 159.753993, "b": 561.257868 }, "text": "98", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p65.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 174.16295, "t": 559.302451, "r": 296.664294, "b": 547.337871 }, "text": "100.00% Impervious Area", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 8 }, { "id": "p65.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 65.040001, "t": 535.302451, "r": 89.475992, "b": 497.417872 }, "text": "Tc (min)\n1.2", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 9 }, { "id": "p65.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 100.248415, "t": 535.302451, "r": 132.68142, "b": 497.417872 }, "text": "Length (feet)\n100", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 10 }, { "id": "p65.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 143.445254, "t": 535.302451, "r": 175.895438, "b": 497.417872 }, "text": "Slope (ft/ft)\n0.0200", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 11 }, { "id": "p65.5.13", "order": 18, "type": "table_cell", "bbox": { "l": 186.552062, "t": 535.302451, "r": 223.968178, "b": 497.417872 }, "text": "Velocity (ft/sec)\n1.42", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 12 }, { "id": "p65.5.14", "order": 19, "type": "table_cell", "bbox": { "l": 234.581918, "t": 535.302451, "r": 473.002733, "b": 485.417872 }, "text": "Capacity (cfs)\nSheet Flow, Smooth surfaces n= 0.011 P2= 3.42\"", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 13 }, { "id": "p65.5.15", "order": 20, "type": "table_cell", "bbox": { "l": 74.639998, "t": 485.382452, "r": 89.475992, "b": 473.417872 }, "text": "1.8", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p65.5.16", "order": 21, "type": "table_cell", "bbox": { "l": 114.927527, "t": 485.382452, "r": 132.68142, "b": 473.417872 }, "text": "350", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p65.5.17", "order": 22, "type": "table_cell", "bbox": { "l": 143.445254, "t": 485.382452, "r": 175.863606, "b": 473.417872 }, "text": "0.0250", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p65.5.18", "order": 23, "type": "table_cell", "bbox": { "l": 203.137703, "t": 485.382452, "r": 223.870219, "b": 473.417872 }, "text": "3.21", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p65.5.19", "order": 24, "type": "table_cell", "bbox": { "l": 286.679993, "t": 485.26245, "r": 425.623588, "b": 461.417872 }, "text": "Shallow Concentrated Flow, Paved Kv= 20.3 fps", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p65.5.20", "order": 25, "type": "table_cell", "bbox": { "l": 74.639998, "t": 459.462454, "r": 89.475992, "b": 447.497874 }, "text": "3.0", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p65.5.21", "order": 26, "type": "table_cell", "bbox": { "l": 114.927527, "t": 459.462454, "r": 132.68142, "b": 447.497874 }, "text": "450", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p65.5.22", "order": 27, "type": "table_cell", "bbox": { "l": 143.445254, "t": 459.462454, "r": 167.029543, "b": 447.497874 }, "text": "Total", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p65.5.23", "order": 28, "type": "table_cell", "bbox": { "l": 356.544, "t": 470.4, "r": 457.872, "b": 450.72 }, "text": "", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 22 }, { "id": "p65.5.24", "order": 29, "type": "table_cell", "bbox": { "l": 457.872, "t": 470.4, "r": 559.2, "b": 450.72 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 23 } ], "reading_order": 4 }, { "id": "p65.6", "order": 30, "type": "caption", "bbox": { "l": 186.96, "t": 435.12, "r": 424.56, "b": 420 }, "text": "Subcatchment 141S: DA P1 (Impervious)", "attrs": { "block_label": "figure_title" }, "reading_order": 5 }, { "id": "p65.7", "order": 31, "type": "figure", "bbox": { "l": 60.96, "t": 415.68, "r": 552.48, "b": 149.76 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n4 Runoff\n3.70 cfs\nNOAA 24-hr D\n10-Year Rainfall=5.38\"\nRunoff Area=31,625 sf\n3\nRunoff Volume=13,553 cf\n(cfs) Runoff Depth=5.14\"\nFlow Flow Length=450'\n2\nTc=3.0 min\nCN=0/98\n1\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72\nTime (hours)" }, "reading_order": 6 }, { "id": "p65.8", "order": 32, "type": "text", "bbox": { "l": 265.44, "t": 155.76, "r": 312.96, "b": 147.12 }, "text": "Time (hours)", "attrs": { "block_label": "number" }, "reading_order": 7 } ] }, { "document_id": 16592, "page": 66, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 34, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "table": 1, "table_cell": 24, "text": 5, "title": 1 }, "build_ms": 4, "items": [ { "id": "p66.1", "order": 1, "type": "header", "bbox": { "l": 53.28, "t": 738.48, "r": 560.64, "b": 698.64 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 10-Year Rainfall=5.38\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 26", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p66.2", "order": 2, "type": "title", "bbox": { "l": 148.32, "t": 687.6, "r": 463.92, "b": 672.24 }, "text": "Summary for Subcatchment 143S: DA P2 (Impervious)", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p66.3", "order": 3, "type": "text", "bbox": { "l": 52.32, "t": 659.76, "r": 303.84, "b": 647.04 }, "text": "Runoff = 2.42 cfs @ 12.13 hrs, Volume=10,058 cf, Depth= 5.14\"", "reading_order": 2 }, { "id": "p66.4", "order": 4, "type": "text", "bbox": { "l": 66.24, "t": 647.28, "r": 294.96, "b": 634.32 }, "text": "Routed to Pond 149P : WQ Infiltration Basin #2", "reading_order": 3 }, { "id": "p66.5", "order": 5, "type": "text", "bbox": { "l": 342.48, "t": 660, "r": 463.2, "b": 646.56 }, "text": "10,058 cf, Depth= 5.14\"", "reading_order": 4 }, { "id": "p66.6", "order": 6, "type": "text", "bbox": { "l": 52.08, "t": 623.76, "r": 611.28, "b": 598.32 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious, Time Span= 0.00-72.00 hrs, dt= NOAA 24-hr D 10-Year Rainfall=5.38\"", "reading_order": 5 }, { "id": "p66.7", "order": 7, "type": "table", "bbox": { "l": 52.56, "t": 588.48, "r": 558.96, "b": 447.497874 }, "text": "", "attrs": { "block_label": "table", "n_rows": 6, "n_cols": 5, "integrity": { "cells_checked": 22, "cells_flagged": 0 } }, "children": [ { "id": "p66.7.1", "order": 8, "type": "table_cell", "bbox": { "l": 86.520001, "t": 587.142469, "r": 127.590159, "b": 575.177889 }, "text": "Area (sf)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p66.7.2", "order": 9, "type": "table_cell", "bbox": { "l": 144.389888, "t": 587.142469, "r": 159.742288, "b": 575.177889 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p66.7.3", "order": 10, "type": "table_cell", "bbox": { "l": 286.601768, "t": 535.302451, "r": 340.102911, "b": 523.337871 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p66.7.4", "order": 11, "type": "table_cell", "bbox": { "l": 95.280001, "t": 559.302451, "r": 127.805562, "b": 547.337871 }, "text": "23,470", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 3 }, { "id": "p66.7.5", "order": 12, "type": "table_cell", "bbox": { "l": 148.003832, "t": 559.302451, "r": 159.753993, "b": 547.337871 }, "text": "98", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p66.7.6", "order": 13, "type": "table_cell", "bbox": { "l": 174.16295, "t": 573.222448, "r": 281.259838, "b": 561.257868 }, "text": "Paved parking, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 5 }, { "id": "p66.7.7", "order": 14, "type": "table_cell", "bbox": { "l": 95.280001, "t": 573.222448, "r": 127.805562, "b": 561.257868 }, "text": "23,470", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p66.7.8", "order": 15, "type": "table_cell", "bbox": { "l": 148.003832, "t": 573.222448, "r": 159.753993, "b": 561.257868 }, "text": "98", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p66.7.9", "order": 16, "type": "table_cell", "bbox": { "l": 174.16295, "t": 559.302451, "r": 296.664294, "b": 547.337871 }, "text": "100.00% Impervious Area", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 8 }, { "id": "p66.7.10", "order": 17, "type": "table_cell", "bbox": { "l": 65.040001, "t": 535.302451, "r": 89.475992, "b": 497.417872 }, "text": "Tc (min)\n0.8", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 9 }, { "id": "p66.7.11", "order": 18, "type": "table_cell", "bbox": { "l": 100.248415, "t": 535.302451, "r": 132.68142, "b": 497.417872 }, "text": "Length (feet)\n100", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 10 }, { "id": "p66.7.12", "order": 19, "type": "table_cell", "bbox": { "l": 143.445254, "t": 535.302451, "r": 175.895438, "b": 497.417872 }, "text": "Slope (ft/ft)\n0.0500", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 11 }, { "id": "p66.7.13", "order": 20, "type": "table_cell", "bbox": { "l": 186.552062, "t": 535.302451, "r": 223.968178, "b": 497.417872 }, "text": "Velocity (ft/sec)\n2.05", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 12 }, { "id": "p66.7.14", "order": 21, "type": "table_cell", "bbox": { "l": 234.581918, "t": 535.302451, "r": 473.002733, "b": 485.417872 }, "text": "Capacity (cfs)\nSheet Flow, Smooth surfaces n= 0.011 P2= 3.42\"", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 13 }, { "id": "p66.7.15", "order": 22, "type": "table_cell", "bbox": { "l": 74.639998, "t": 485.382452, "r": 89.475992, "b": 473.417872 }, "text": "4.1", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p66.7.16", "order": 23, "type": "table_cell", "bbox": { "l": 114.927527, "t": 485.382452, "r": 132.68142, "b": 473.417872 }, "text": "350", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p66.7.17", "order": 24, "type": "table_cell", "bbox": { "l": 143.445254, "t": 485.382452, "r": 175.863606, "b": 473.417872 }, "text": "0.0050", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p66.7.18", "order": 25, "type": "table_cell", "bbox": { "l": 203.137703, "t": 485.382452, "r": 223.870219, "b": 473.417872 }, "text": "1.44", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p66.7.19", "order": 26, "type": "table_cell", "bbox": { "l": 286.679993, "t": 485.26245, "r": 425.623588, "b": 461.417872 }, "text": "Shallow Concentrated Flow, Paved Kv= 20.3 fps", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p66.7.20", "order": 27, "type": "table_cell", "bbox": { "l": 74.639998, "t": 459.462454, "r": 89.475992, "b": 447.497874 }, "text": "4.9", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p66.7.21", "order": 28, "type": "table_cell", "bbox": { "l": 114.927527, "t": 459.462454, "r": 132.68142, "b": 447.497874 }, "text": "450", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p66.7.22", "order": 29, "type": "table_cell", "bbox": { "l": 143.445254, "t": 459.462454, "r": 167.029543, "b": 447.497874 }, "text": "Total", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p66.7.23", "order": 30, "type": "table_cell", "bbox": { "l": 356.4, "t": 471.0171, "r": 457.68, "b": 451.44 }, "text": "", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 22 }, { "id": "p66.7.24", "order": 31, "type": "table_cell", "bbox": { "l": 457.68, "t": 471.0171, "r": 558.96, "b": 451.44 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 23 } ], "reading_order": 6 }, { "id": "p66.8", "order": 32, "type": "caption", "bbox": { "l": 186.96, "t": 435.12, "r": 424.56, "b": 419.76 }, "text": "Subcatchment 143S: DA P2 (Impervious)", "attrs": { "block_label": "figure_title" }, "reading_order": 7 }, { "id": "p66.9", "order": 33, "type": "figure", "bbox": { "l": 60.96, "t": 413.76, "r": 552, "b": 149.52 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nRunoff\n2.42 cfs\nNOAA 24-hr D\n10-Year Rainfall=5.38\"\n2\nRunoff Area=23,470 sf\nRunoff Volume=10,058 cf\n(cfs) Runoff Depth=5.14\"\nFlow Flow Length=450'\n1 Tc=4.9 min\nCN=0/98\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72\nTime (hours)" }, "reading_order": 8 }, { "id": "p66.10", "order": 34, "type": "text", "bbox": { "l": 265.44, "t": 155.76, "r": 312.72, "b": 147.12 }, "text": "Time (hours)", "attrs": { "block_label": "number" }, "reading_order": 9 } ] }, { "document_id": 16592, "page": 67, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 18, "counts_by_type": { "caption": 1, "figure": 1, "footer": 1, "footnote": 1, "header": 1, "table": 1, "table_cell": 9, "text": 2, "title": 1 }, "build_ms": 2, "items": [ { "id": "p67.1", "order": 1, "type": "header", "bbox": { "l": 53.76, "t": 738, "r": 560.16, "b": 698.4 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 10-Year Rainfall=5.38\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 27", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p67.2", "order": 2, "type": "title", "bbox": { "l": 142.08, "t": 687.6, "r": 470.4, "b": 672.24 }, "text": "Summary for Subcatchment 145S: DA P5 (4000 SF Roof)", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p67.3", "order": 3, "type": "text", "bbox": { "l": 54, "t": 660.48, "r": 463.44, "b": 634.08 }, "text": "Runoff = 0.38 cfs @ 12.14 hrs, Volume= 1,714 cf, Depth= 5.14\"\nRouted to Pond 130P : SUBSURFACE", "reading_order": 2 }, { "id": "p67.4", "order": 4, "type": "text", "bbox": { "l": 51.84, "t": 623.76, "r": 611.52, "b": 598.32 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious, Time Span= 0.00-72.00 hrs, dt= NOAA 24-hr D 10-Year Rainfall=5.38\"", "reading_order": 3 }, { "id": "p67.5", "order": 5, "type": "table", "bbox": { "l": 53.52, "t": 587.52, "r": 559.92, "b": 497.04 }, "text": "", "attrs": { "block_label": "table", "n_rows": 3, "n_cols": 3, "integrity": { "cells_checked": 9, "cells_flagged": 0 } }, "children": [ { "id": "p67.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 86.520001, "t": 587.142469, "r": 127.590159, "b": 575.177889 }, "text": "Area (sf)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p67.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 144.389888, "t": 587.142469, "r": 159.742288, "b": 575.177889 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p67.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 286.601768, "t": 535.302451, "r": 340.102911, "b": 523.337871 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p67.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 101.160004, "t": 573.222448, "r": 127.789043, "b": 547.337871 }, "text": "4,000\n4,000", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p67.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 147.987313, "t": 573.222448, "r": 159.844683, "b": 547.337871 }, "text": "98\n98", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p67.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 174.146431, "t": 573.222448, "r": 302.745943, "b": 547.337871 }, "text": "Unconnected roofs, HSG A\n100.00% Pervious Area", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p67.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 65.040001, "t": 535.302451, "r": 89.475992, "b": 497.417872 }, "text": "Tc (min)\n6.0", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p67.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 100.248415, "t": 535.302451, "r": 348.647167, "b": 497.29787 }, "text": "Length (feet)\nDirect Entry,", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 7 }, { "id": "p67.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 148.683866, "t": 535.302451, "r": 275.988028, "b": 511.337871 }, "text": "Slope (ft/ft) Velocity (ft/sec) Capacity (cfs)", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 } ], "reading_order": 4 }, { "id": "p67.6", "order": 15, "type": "caption", "bbox": { "l": 180.96, "t": 485.04, "r": 430.32, "b": 469.68 }, "text": "Subcatchment 145S: DA P5 (4000 SF Roof)", "attrs": { "block_label": "figure_title" }, "reading_order": 5 }, { "id": "p67.7", "order": 16, "type": "figure", "bbox": { "l": 64.8, "t": 463.44, "r": 496.8, "b": 202.32 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n0.42\n0.4 0.38 cfs\nNOAA 24-hr D\n0.38\n0.36\n10-Year Rainfall=5.38\"\n0.34\n0.32\n0.3 Runoff Area=4,000 sf\n0.28\n0.26 Runoff Volume=1,714 cf\n(cfs) 0.22 Runoff Depth=5.14\"\n0.24\nFlow 0.18 Tc=6.0 min\n0.2\nCN=98/0\n0.16\n0.14\n0.12\n0.1\n0.08\n0.06\n0.04\n0.02\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72" }, "reading_order": 6 }, { "id": "p67.8", "order": 17, "type": "footnote", "bbox": { "l": 91.44, "t": 216.72, "r": 492.24, "b": 197.52 }, "text": "4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72 Time (hours)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 7 }, { "id": "p67.9", "order": 18, "type": "footer", "bbox": { "l": 509.76, "t": 443.28, "r": 547.68, "b": 430.8 }, "text": "", "attrs": { "block_label": "footer_image" }, "reading_order": 8 } ] }, { "document_id": 16592, "page": 68, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 41, "counts_by_type": { "caption": 1, "figure": 2, "table": 1, "table_cell": 33, "text": 3, "title": 1 }, "build_ms": 4, "items": [ { "id": "p68.1", "order": 1, "type": "figure", "bbox": { "l": 53.04, "t": 738.48, "r": 560.64, "b": 698.88 }, "text": "", "attrs": { "role": "page_header", "block_label": "header_image", "embedded_text": "102 Sams -REV 12-02-25 NOAA 24-hr D 10-Year Rainfall=5.38\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 28" }, "reading_order": 0 }, { "id": "p68.2", "order": 2, "type": "title", "bbox": { "l": 154.8, "t": 687.6, "r": 457.2, "b": 672.48 }, "text": "Summary for Subcatchment 148S: DA P3 (Pervious)", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p68.3", "order": 3, "type": "text", "bbox": { "l": 53.52, "t": 660.24, "r": 463.92, "b": 634.08 }, "text": "Runoff = 0.07 cfs @ 13.04 hrs, Volume= 1,487 cf, Depth= 0.28\"\nRouted to Pond 149P : WQ Infiltration Basin #2", "reading_order": 2 }, { "id": "p68.4", "order": 4, "type": "text", "bbox": { "l": 52.32, "t": 623.52, "r": 611.04, "b": 598.32 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious, Time Span= 0.00-72.00 hrs, dt= NOAA 24-hr D 10-Year Rainfall=5.38\"", "reading_order": 3 }, { "id": "p68.5", "order": 5, "type": "table", "bbox": { "l": 52.32, "t": 588.72, "r": 558.96, "b": 447.497874 }, "text": "", "attrs": { "block_label": "table", "n_rows": 7, "n_cols": 6, "integrity": { "cells_checked": 28, "cells_flagged": 0 } }, "children": [ { "id": "p68.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 86.520001, "t": 587.142469, "r": 127.590159, "b": 575.177889 }, "text": "Area (sf)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p68.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 144.389888, "t": 587.142469, "r": 159.742288, "b": 575.177889 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p68.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 286.601768, "t": 535.302451, "r": 340.102911, "b": 523.337871 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p68.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 95.280001, "t": 559.302451, "r": 127.805562, "b": 547.337871 }, "text": "62,973", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 3 }, { "id": "p68.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 148.003832, "t": 559.302451, "r": 159.753993, "b": 547.337871 }, "text": "39", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p68.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 174.16295, "t": 573.222448, "r": 333.31717, "b": 561.257868 }, "text": ">75% Grass cover, Good, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 5 }, { "id": "p68.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 95.280001, "t": 573.222448, "r": 127.805562, "b": 561.257868 }, "text": "62,973", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 6 }, { "id": "p68.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 148.003832, "t": 573.222448, "r": 159.753993, "b": 561.257868 }, "text": "39", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p68.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 174.16295, "t": 559.302451, "r": 286.000299, "b": 547.337871 }, "text": "100.00% Pervious Area", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 8 }, { "id": "p68.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 65.040001, "t": 535.302451, "r": 89.40872, "b": 511.337871 }, "text": "Tc (min)", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p68.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 100.248415, "t": 535.302451, "r": 132.666767, "b": 511.337871 }, "text": "Length (feet)", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p68.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 148.683866, "t": 535.302451, "r": 175.895438, "b": 511.337871 }, "text": "Slope (ft/ft)", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 }, { "id": "p68.5.13", "order": 18, "type": "table_cell", "bbox": { "l": 186.552062, "t": 535.302451, "r": 223.968178, "b": 511.337871 }, "text": "Velocity (ft/sec)", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 12 }, { "id": "p68.5.14", "order": 19, "type": "table_cell", "bbox": { "l": 234.581918, "t": 535.302451, "r": 275.988028, "b": 511.337871 }, "text": "Capacity (cfs)", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p68.5.15", "order": 20, "type": "table_cell", "bbox": { "l": 174.08692, "t": 587.142469, "r": 227.564819, "b": 575.177889 }, "text": "Description", "attrs": { "row": 3, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p68.5.16", "order": 21, "type": "table_cell", "bbox": { "l": 74.639998, "t": 509.382452, "r": 89.475992, "b": 497.417872 }, "text": "9.5", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p68.5.17", "order": 22, "type": "table_cell", "bbox": { "l": 114.927527, "t": 509.382452, "r": 132.68142, "b": 497.417872 }, "text": "100", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p68.5.18", "order": 23, "type": "table_cell", "bbox": { "l": 143.445254, "t": 509.382452, "r": 175.863606, "b": 497.417872 }, "text": "0.0200", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p68.5.19", "order": 24, "type": "table_cell", "bbox": { "l": 203.137703, "t": 509.382452, "r": 223.870219, "b": 497.417872 }, "text": "0.18", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p68.5.20", "order": 25, "type": "table_cell", "bbox": { "l": 390.08, "t": 510.1371, "r": 474.52, "b": 490.4914 }, "text": "", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 19 }, { "id": "p68.5.21", "order": 26, "type": "table_cell", "bbox": { "l": 286.679993, "t": 509.26245, "r": 452.820335, "b": 485.417872 }, "text": "Sheet Flow, Grass: Short n= 0.150 P2= 3.42\"", "attrs": { "row": 4, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p68.5.22", "order": 27, "type": "table_cell", "bbox": { "l": 74.639998, "t": 485.382452, "r": 89.475992, "b": 473.417872 }, "text": "3.6", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p68.5.23", "order": 28, "type": "table_cell", "bbox": { "l": 114.927527, "t": 485.382452, "r": 132.68142, "b": 473.417872 }, "text": "216", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 22 }, { "id": "p68.5.24", "order": 29, "type": "table_cell", "bbox": { "l": 143.445254, "t": 485.382452, "r": 175.863606, "b": 473.417872 }, "text": "0.0200", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 23 }, { "id": "p68.5.25", "order": 30, "type": "table_cell", "bbox": { "l": 203.137703, "t": 485.382452, "r": 223.870219, "b": 473.417872 }, "text": "0.99", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 24 }, { "id": "p68.5.26", "order": 31, "type": "table_cell", "bbox": { "l": 390.08, "t": 490.4914, "r": 474.52, "b": 470.8457 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 25 }, { "id": "p68.5.27", "order": 32, "type": "table_cell", "bbox": { "l": 286.679993, "t": 485.26245, "r": 446.147004, "b": 461.417872 }, "text": "Shallow Concentrated Flow, Short Grass Pasture Kv= 7.0 fps", "attrs": { "row": 5, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 26 }, { "id": "p68.5.28", "order": 33, "type": "table_cell", "bbox": { "l": 68.76, "t": 459.462454, "r": 89.492517, "b": 447.497874 }, "text": "13.1", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 27 }, { "id": "p68.5.29", "order": 34, "type": "table_cell", "bbox": { "l": 114.944052, "t": 459.462454, "r": 132.697945, "b": 447.497874 }, "text": "316", "attrs": { "row": 6, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 28 }, { "id": "p68.5.30", "order": 35, "type": "table_cell", "bbox": { "l": 143.354569, "t": 459.462454, "r": 166.947862, "b": 447.497874 }, "text": "Total", "attrs": { "row": 6, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 29 }, { "id": "p68.5.31", "order": 36, "type": "table_cell", "bbox": { "l": 305.64, "t": 470.8457, "r": 390.08, "b": 451.2 }, "text": "", "attrs": { "row": 6, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 30 }, { "id": "p68.5.32", "order": 37, "type": "table_cell", "bbox": { "l": 390.08, "t": 470.8457, "r": 474.52, "b": 451.2 }, "text": "", "attrs": { "row": 6, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 31 }, { "id": "p68.5.33", "order": 38, "type": "table_cell", "bbox": { "l": 474.52, "t": 470.8457, "r": 558.96, "b": 451.2 }, "text": "", "attrs": { "row": 6, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 32 } ], "reading_order": 4 }, { "id": "p68.6", "order": 39, "type": "caption", "bbox": { "l": 192.96, "t": 435.12, "r": 417.84, "b": 420 }, "text": "Subcatchment 148S: DA P3 (Pervious)", "attrs": { "block_label": "figure_title" }, "reading_order": 5 }, { "id": "p68.7", "order": 40, "type": "figure", "bbox": { "l": 61.92, "t": 420.96, "r": 551.76, "b": 148.32 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n0.08 Runoff\n0.07 cfs\n0.075\n0.07 NOAA 24-hr D\n10-Year Rainfall=5.38\"\n0.065\n0.06\nRunoff Area=62,973 sf\n0.055\n0.05 Runoff Volume=1,487 cf\n(cfs) Runoff Depth=0.28\"\n0.045\n0.04\nFlow 0.035 Flow Length=316'\nSlope=0.0200 '/'\n0.03\n0.025\nTc=13.1 min\n0.02\n0.015 CN=39/0\n0.01\n0.005\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72\nTime (hours)" }, "reading_order": 6 }, { "id": "p68.8", "order": 41, "type": "text", "bbox": { "l": 270, "t": 155.76, "r": 317.76, "b": 146.88 }, "text": "Time (hours)", "attrs": { "block_label": "number" }, "reading_order": 7 } ] }, { "document_id": 16592, "page": 69, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 39, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "table": 1, "table_cell": 31, "text": 3, "title": 1 }, "build_ms": 6, "items": [ { "id": "p69.1", "order": 1, "type": "header", "bbox": { "l": 54, "t": 738, "r": 560.4, "b": 698.88 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 10-Year Rainfall=5.38\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 29", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p69.2", "order": 2, "type": "title", "bbox": { "l": 159.36, "t": 687.36, "r": 453.36, "b": 672.72 }, "text": "Summary for Subcatchment 149S: DA P0 Pervious", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p69.3", "order": 3, "type": "text", "bbox": { "l": 53.76, "t": 660.24, "r": 304.08, "b": 634.08 }, "text": "Runoff = 0.06 cfs @ 17.81 hrs, Volume=\nRouted to Link 147L : POA\n2,256 cf, Depth= 0.08\"", "reading_order": 2 }, { "id": "p69.4", "order": 4, "type": "text", "bbox": { "l": 347.04, "t": 660, "r": 463.44, "b": 646.56 }, "text": "2,256 cf, Depth= 0.08\"", "reading_order": 3 }, { "id": "p69.5", "order": 5, "type": "text", "bbox": { "l": 52.08, "t": 623.76, "r": 611.28, "b": 598.08 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious, Time Span= 0.00-72.00 hrs, dt= NOAA 24-hr D 10-Year Rainfall=5.38\"", "reading_order": 4 }, { "id": "p69.6", "order": 6, "type": "table", "bbox": { "l": 53.52, "t": 587.52, "r": 558.96, "b": 423.497874 }, "text": "", "attrs": { "block_label": "table", "n_rows": 8, "n_cols": 5, "integrity": { "cells_checked": 29, "cells_flagged": 1, "flags": [ { "row": 5, "col": 4, "coverage": 0, "text": "Sheet Flow, Woods: Light underbrush n=0.400 P2=3.42\" Shallo…" } ] } }, "children": [ { "id": "p69.6.1", "order": 7, "type": "table_cell", "bbox": { "l": 86.520001, "t": 587.142469, "r": 127.590159, "b": 575.177889 }, "text": "Area (sf)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p69.6.2", "order": 8, "type": "table_cell", "bbox": { "l": 144.389888, "t": 587.142469, "r": 159.742288, "b": 575.177889 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p69.6.3", "order": 9, "type": "table_cell", "bbox": { "l": 286.601768, "t": 511.302451, "r": 340.102911, "b": 499.337871 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p69.6.4", "order": 10, "type": "table_cell", "bbox": { "l": 89.399998, "t": 573.222448, "r": 127.805562, "b": 549.257868 }, "text": "236,879\n99,371", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p69.6.5", "order": 11, "type": "table_cell", "bbox": { "l": 147.913142, "t": 573.222448, "r": 159.770513, "b": 549.257868 }, "text": "30\n39", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p69.6.6", "order": 12, "type": "table_cell", "bbox": { "l": 174.07226, "t": 573.222448, "r": 333.31717, "b": 549.257868 }, "text": "Woods, Good, HSG A\n>75% Grass cover, Good, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p69.6.7", "order": 13, "type": "table_cell", "bbox": { "l": 89.399998, "t": 535.302451, "r": 127.714872, "b": 523.337871 }, "text": "336,250", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p69.6.8", "order": 14, "type": "table_cell", "bbox": { "l": 147.913142, "t": 535.302451, "r": 159.770513, "b": 523.337871 }, "text": "33", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p69.6.9", "order": 15, "type": "table_cell", "bbox": { "l": 174.07226, "t": 547.302451, "r": 262.271799, "b": 535.337871 }, "text": "Weighted Average", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 8 }, { "id": "p69.6.10", "order": 16, "type": "table_cell", "bbox": { "l": 89.399998, "t": 547.302451, "r": 127.714872, "b": 535.337871 }, "text": "336,250", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p69.6.11", "order": 17, "type": "table_cell", "bbox": { "l": 147.913142, "t": 547.302451, "r": 159.770513, "b": 535.337871 }, "text": "33", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p69.6.12", "order": 18, "type": "table_cell", "bbox": { "l": 174.07226, "t": 535.302451, "r": 286.016818, "b": 523.337871 }, "text": "100.00% Pervious Area", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 11 }, { "id": "p69.6.13", "order": 19, "type": "table_cell", "bbox": { "l": 65.040001, "t": 511.302451, "r": 89.40872, "b": 487.337871 }, "text": "Tc (min)", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 12 }, { "id": "p69.6.14", "order": 20, "type": "table_cell", "bbox": { "l": 100.248415, "t": 511.302451, "r": 132.666767, "b": 487.337871 }, "text": "Length (feet)", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p69.6.15", "order": 21, "type": "table_cell", "bbox": { "l": 148.683866, "t": 511.302451, "r": 175.895438, "b": 487.337871 }, "text": "Slope (ft/ft)", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p69.6.16", "order": 22, "type": "table_cell", "bbox": { "l": 186.552062, "t": 511.302451, "r": 223.968178, "b": 487.337871 }, "text": "Velocity (ft/sec)", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p69.6.17", "order": 23, "type": "table_cell", "bbox": { "l": 234.581918, "t": 511.302451, "r": 275.988028, "b": 487.337871 }, "text": "Capacity (cfs)", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p69.6.18", "order": 24, "type": "table_cell", "bbox": { "l": 68.76, "t": 485.382452, "r": 89.492517, "b": 473.417872 }, "text": "36.2", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p69.6.19", "order": 25, "type": "table_cell", "bbox": { "l": 114.944052, "t": 485.382452, "r": 132.697945, "b": 473.417872 }, "text": "100", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p69.6.20", "order": 26, "type": "table_cell", "bbox": { "l": 143.354569, "t": 485.382452, "r": 175.880131, "b": 473.417872 }, "text": "0.0050", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p69.6.21", "order": 27, "type": "table_cell", "bbox": { "l": 203.154228, "t": 485.382452, "r": 223.886744, "b": 473.417872 }, "text": "0.05", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p69.6.22", "order": 28, "type": "table_cell", "bbox": { "l": 457.872, "t": 481.6, "r": 558.96, "b": 446.2933 }, "text": "Sheet Flow, Woods: Light underbrush n=0.400 P2=3.42\" Shallow Concentrated Flow, Woodland Kv=5.0 fps", "attrs": { "row": 5, "col": 4, "rowspan": 2, "colspan": 1 }, "reading_order": 21 }, { "id": "p69.6.23", "order": 29, "type": "table_cell", "bbox": { "l": 68.76, "t": 461.382452, "r": 89.492517, "b": 449.417872 }, "text": "13.6", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 22 }, { "id": "p69.6.24", "order": 30, "type": "table_cell", "bbox": { "l": 114.944052, "t": 461.382452, "r": 132.697945, "b": 449.417872 }, "text": "579", "attrs": { "row": 6, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 23 }, { "id": "p69.6.25", "order": 31, "type": "table_cell", "bbox": { "l": 143.354569, "t": 461.382452, "r": 175.880131, "b": 449.417872 }, "text": "0.0200", "attrs": { "row": 6, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 24 }, { "id": "p69.6.26", "order": 32, "type": "table_cell", "bbox": { "l": 203.154228, "t": 461.382452, "r": 223.886744, "b": 449.417872 }, "text": "0.71", "attrs": { "row": 6, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 25 }, { "id": "p69.6.27", "order": 33, "type": "table_cell", "bbox": { "l": 68.76, "t": 435.462454, "r": 89.492517, "b": 423.497874 }, "text": "49.8", "attrs": { "row": 7, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 26 }, { "id": "p69.6.28", "order": 34, "type": "table_cell", "bbox": { "l": 114.944052, "t": 435.462454, "r": 132.697945, "b": 423.497874 }, "text": "679", "attrs": { "row": 7, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 27 }, { "id": "p69.6.29", "order": 35, "type": "table_cell", "bbox": { "l": 143.354569, "t": 435.462454, "r": 166.947862, "b": 423.497874 }, "text": "Total", "attrs": { "row": 7, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 28 }, { "id": "p69.6.30", "order": 36, "type": "table_cell", "bbox": { "l": 356.784, "t": 446.2933, "r": 457.872, "b": 428.64 }, "text": "", "attrs": { "row": 7, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 29 }, { "id": "p69.6.31", "order": 37, "type": "table_cell", "bbox": { "l": 457.872, "t": 446.2933, "r": 558.96, "b": 428.64 }, "text": "", "attrs": { "row": 7, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 30 } ], "reading_order": 5 }, { "id": "p69.7", "order": 38, "type": "caption", "bbox": { "l": 197.52, "t": 410.64, "r": 414.24, "b": 396 }, "text": "Subcatchment 149S: DA P0 Pervious", "attrs": { "block_label": "figure_title" }, "reading_order": 6 }, { "id": "p69.8", "order": 39, "type": "figure", "bbox": { "l": 62.88, "t": 393.36, "r": 549.12, "b": 124.32 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n0.07 Runoff\n0.06 cfs\n0.065\nNOAA 24-hr D\n0.06\n0.055 10-Year Rainfall=5.38\"\n0.05 Runoff Area=336,250 sf\nRunoff Volume=2,256 cf\n0.045\n(cfs) Runoff Depth=0.08\"\n0.04\n0.035\nFlow 0.03 Flow Length=679'\n0.025 Tc=49.8 min\nCN=33/0\n0.02\n0.015\n0.01\n0.005\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72\nTime (hours)" }, "reading_order": 7 } ] }, { "document_id": 16592, "page": 70, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 41, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "table": 1, "table_cell": 33, "text": 3, "title": 1 }, "build_ms": 4, "items": [ { "id": "p70.1", "order": 1, "type": "header", "bbox": { "l": 52.8, "t": 738.48, "r": 562.32, "b": 698.64 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 10-Year Rainfall=5.38\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 30", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p70.2", "order": 2, "type": "title", "bbox": { "l": 154.8, "t": 687.36, "r": 457.44, "b": 672.48 }, "text": "Summary for Subcatchment 150S: DA P4 (Pervious)", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p70.3", "order": 3, "type": "text", "bbox": { "l": 53.28, "t": 660.24, "r": 463.92, "b": 634.32 }, "text": "Runoff = 0.09 cfs @ 13.09 hrs, Volume= 1,818 cf, Depth= 0.28\"\nRouted to Pond 144P : WQ Infiltration Basin #1", "reading_order": 2 }, { "id": "p70.4", "order": 4, "type": "text", "bbox": { "l": 52.32, "t": 623.52, "r": 611.04, "b": 598.32 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious, Time Span= 0.00-72.00 hrs, dt= NOAA 24-hr D 10-Year Rainfall=5.38\"", "reading_order": 3 }, { "id": "p70.5", "order": 5, "type": "table", "bbox": { "l": 52.32, "t": 588.48, "r": 559.2, "b": 447.497874 }, "text": "", "attrs": { "block_label": "table", "n_rows": 7, "n_cols": 6, "integrity": { "cells_checked": 28, "cells_flagged": 0 } }, "children": [ { "id": "p70.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 86.520001, "t": 587.142469, "r": 127.590159, "b": 575.177889 }, "text": "Area (sf)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p70.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 144.389888, "t": 587.142469, "r": 159.742288, "b": 575.177889 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p70.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 286.601768, "t": 535.302451, "r": 340.102911, "b": 523.337871 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p70.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 95.280001, "t": 559.302451, "r": 127.805562, "b": 547.337871 }, "text": "76,971", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 3 }, { "id": "p70.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 148.003832, "t": 559.302451, "r": 159.753993, "b": 547.337871 }, "text": "39", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p70.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 174.16295, "t": 573.222448, "r": 333.31717, "b": 561.257868 }, "text": ">75% Grass cover, Good, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 5 }, { "id": "p70.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 95.280001, "t": 573.222448, "r": 127.805562, "b": 561.257868 }, "text": "76,971", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 6 }, { "id": "p70.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 148.003832, "t": 573.222448, "r": 159.753993, "b": 561.257868 }, "text": "39", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p70.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 174.16295, "t": 559.302451, "r": 286.000299, "b": 547.337871 }, "text": "100.00% Pervious Area", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 8 }, { "id": "p70.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 65.040001, "t": 535.302451, "r": 89.40872, "b": 511.337871 }, "text": "Tc (min)", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p70.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 100.248415, "t": 535.302451, "r": 132.666767, "b": 511.337871 }, "text": "Length (feet)", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p70.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 148.683866, "t": 535.302451, "r": 175.895438, "b": 511.337871 }, "text": "Slope (ft/ft)", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 }, { "id": "p70.5.13", "order": 18, "type": "table_cell", "bbox": { "l": 186.552062, "t": 535.302451, "r": 223.968178, "b": 511.337871 }, "text": "Velocity (ft/sec)", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 12 }, { "id": "p70.5.14", "order": 19, "type": "table_cell", "bbox": { "l": 234.581918, "t": 535.302451, "r": 275.988028, "b": 511.337871 }, "text": "Capacity (cfs)", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p70.5.15", "order": 20, "type": "table_cell", "bbox": { "l": 174.08692, "t": 587.142469, "r": 227.564819, "b": 575.177889 }, "text": "Description", "attrs": { "row": 3, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p70.5.16", "order": 21, "type": "table_cell", "bbox": { "l": 68.76, "t": 509.382452, "r": 89.492517, "b": 497.417872 }, "text": "12.5", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p70.5.17", "order": 22, "type": "table_cell", "bbox": { "l": 114.944052, "t": 509.382452, "r": 132.697945, "b": 497.417872 }, "text": "100", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p70.5.18", "order": 23, "type": "table_cell", "bbox": { "l": 143.354569, "t": 509.382452, "r": 175.880131, "b": 497.417872 }, "text": "0.0100", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p70.5.19", "order": 24, "type": "table_cell", "bbox": { "l": 203.154228, "t": 509.382452, "r": 223.886744, "b": 497.417872 }, "text": "0.13", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p70.5.20", "order": 25, "type": "table_cell", "bbox": { "l": 390.24, "t": 509.76, "r": 474.72, "b": 490.08 }, "text": "", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 19 }, { "id": "p70.5.21", "order": 26, "type": "table_cell", "bbox": { "l": 286.679993, "t": 509.26245, "r": 452.820335, "b": 485.417872 }, "text": "Sheet Flow, Grass: Short n= 0.150 P2= 3.42\"", "attrs": { "row": 4, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p70.5.22", "order": 27, "type": "table_cell", "bbox": { "l": 74.639998, "t": 485.382452, "r": 89.475992, "b": 473.417872 }, "text": "2.3", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p70.5.23", "order": 28, "type": "table_cell", "bbox": { "l": 120.82405, "t": 485.382452, "r": 132.68142, "b": 473.417872 }, "text": "96", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 22 }, { "id": "p70.5.24", "order": 29, "type": "table_cell", "bbox": { "l": 143.445254, "t": 485.382452, "r": 175.863606, "b": 473.417872 }, "text": "0.0100", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 23 }, { "id": "p70.5.25", "order": 30, "type": "table_cell", "bbox": { "l": 203.137703, "t": 485.382452, "r": 223.870219, "b": 473.417872 }, "text": "0.70", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 24 }, { "id": "p70.5.26", "order": 31, "type": "table_cell", "bbox": { "l": 390.24, "t": 490.08, "r": 474.72, "b": 470.4 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 25 }, { "id": "p70.5.27", "order": 32, "type": "table_cell", "bbox": { "l": 286.679993, "t": 485.26245, "r": 446.147004, "b": 461.417872 }, "text": "Shallow Concentrated Flow, Short Grass Pasture Kv= 7.0 fps", "attrs": { "row": 5, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 26 }, { "id": "p70.5.28", "order": 33, "type": "table_cell", "bbox": { "l": 68.76, "t": 459.462454, "r": 89.492517, "b": 447.497874 }, "text": "14.8", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 27 }, { "id": "p70.5.29", "order": 34, "type": "table_cell", "bbox": { "l": 114.944052, "t": 459.462454, "r": 132.697945, "b": 447.497874 }, "text": "196", "attrs": { "row": 6, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 28 }, { "id": "p70.5.30", "order": 35, "type": "table_cell", "bbox": { "l": 143.354569, "t": 459.462454, "r": 166.947862, "b": 447.497874 }, "text": "Total", "attrs": { "row": 6, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 29 }, { "id": "p70.5.31", "order": 36, "type": "table_cell", "bbox": { "l": 305.76, "t": 470.4, "r": 390.24, "b": 450.72 }, "text": "", "attrs": { "row": 6, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 30 }, { "id": "p70.5.32", "order": 37, "type": "table_cell", "bbox": { "l": 390.24, "t": 470.4, "r": 474.72, "b": 450.72 }, "text": "", "attrs": { "row": 6, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 31 }, { "id": "p70.5.33", "order": 38, "type": "table_cell", "bbox": { "l": 474.72, "t": 470.4, "r": 559.2, "b": 450.72 }, "text": "", "attrs": { "row": 6, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 32 } ], "reading_order": 4 }, { "id": "p70.6", "order": 39, "type": "caption", "bbox": { "l": 193.2, "t": 435.12, "r": 417.84, "b": 419.76 }, "text": "Subcatchment 150S: DA P4 (Pervious)", "attrs": { "block_label": "figure_title" }, "reading_order": 5 }, { "id": "p70.7", "order": 40, "type": "figure", "bbox": { "l": 61.2, "t": 414.24, "r": 549.12, "b": 149.04 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n0.095 Runoff\n0.09 cfs\n0.09\n0.085 NOAA 24-hr D\n0.075 10-Year Rainfall=5.38\"\n0.08\nRunoff Area=76,971 sf\n0.07\n0.065\n0.06 Runoff Volume=1,818 cf\n(cfs) 0.05 Runoff Depth=0.28\"\n0.055\nFlow Flow Length=196'\n0.045\n0.04\n0.035 Slope=0.0100 '/'\n0.03\n0.025 Tc=14.8 min\nCN=39/0\n0.02\n0.015\n0.01\n0.005\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72\nTime (hours)" }, "reading_order": 6 }, { "id": "p70.8", "order": 41, "type": "text", "bbox": { "l": 270, "t": 155.76, "r": 317.52, "b": 146.88 }, "text": "Time (hours)", "attrs": { "block_label": "number" }, "reading_order": 7 } ] }, { "document_id": 16592, "page": 71, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 34, "counts_by_type": { "caption": 2, "figure": 1, "footer": 1, "header": 1, "table": 1, "table_cell": 24, "text": 3, "title": 1 }, "build_ms": 4, "items": [ { "id": "p71.1", "order": 1, "type": "header", "bbox": { "l": 53.28, "t": 738.48, "r": 560.4, "b": 698.64 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 10-Year Rainfall=5.38\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 31", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p71.2", "order": 2, "type": "title", "bbox": { "l": 148.32, "t": 687.6, "r": 463.92, "b": 672.24 }, "text": "Summary for Subcatchment 172S: DA P6 (Impervious)", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p71.3", "order": 3, "type": "text", "bbox": { "l": 53.76, "t": 660.24, "r": 462.96, "b": 634.8 }, "text": "Runoff = 0.67 cfs @ 12.10 hrs, Volume= 2,250 cf, Depth= 5.14\"\nRouted to Link 147L : POA", "reading_order": 2 }, { "id": "p71.4", "order": 4, "type": "text", "bbox": { "l": 52.08, "t": 623.76, "r": 611.28, "b": 598.56 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious, Time Span= 0.00-72.00 hrs, dt= NOAA 24-hr D 10-Year Rainfall=5.38\"", "reading_order": 3 }, { "id": "p71.5", "order": 5, "type": "table", "bbox": { "l": 52.56, "t": 588.48, "r": 559.2, "b": 447.497874 }, "text": "", "attrs": { "block_label": "table", "n_rows": 6, "n_cols": 5, "integrity": { "cells_checked": 22, "cells_flagged": 0 } }, "children": [ { "id": "p71.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 86.520001, "t": 587.142469, "r": 127.590159, "b": 575.177889 }, "text": "Area (sf)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p71.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 144.389888, "t": 587.142469, "r": 159.742288, "b": 575.177889 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p71.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 286.601768, "t": 535.302451, "r": 340.102911, "b": 523.337871 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p71.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 101.160004, "t": 559.302451, "r": 127.789043, "b": 547.337871 }, "text": "5,250", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 3 }, { "id": "p71.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 147.987313, "t": 559.302451, "r": 159.844683, "b": 547.337871 }, "text": "98", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p71.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 174.146431, "t": 573.222448, "r": 281.243319, "b": 561.257868 }, "text": "Paved parking, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 5 }, { "id": "p71.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 101.160004, "t": 573.222448, "r": 127.789043, "b": 561.257868 }, "text": "5,250", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p71.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 147.987313, "t": 573.222448, "r": 159.844683, "b": 561.257868 }, "text": "98", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p71.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 174.146431, "t": 559.302451, "r": 296.653009, "b": 547.337871 }, "text": "100.00% Impervious Area", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 8 }, { "id": "p71.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 65.040001, "t": 535.302451, "r": 89.475992, "b": 497.417872 }, "text": "Tc (min)\n0.8", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 9 }, { "id": "p71.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 100.248415, "t": 535.302451, "r": 132.68142, "b": 497.417872 }, "text": "Length (feet)\n100", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 10 }, { "id": "p71.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 143.445254, "t": 535.302451, "r": 175.895438, "b": 497.417872 }, "text": "Slope (ft/ft)\n0.0500", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 11 }, { "id": "p71.5.13", "order": 18, "type": "table_cell", "bbox": { "l": 186.552062, "t": 535.302451, "r": 223.968178, "b": 497.417872 }, "text": "Velocity (ft/sec)\n2.05", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 12 }, { "id": "p71.5.14", "order": 19, "type": "table_cell", "bbox": { "l": 234.581918, "t": 535.302451, "r": 473.002733, "b": 485.417872 }, "text": "Capacity (cfs)\nSheet Flow, Smooth surfaces n= 0.011 P2= 3.42\"", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 13 }, { "id": "p71.5.15", "order": 20, "type": "table_cell", "bbox": { "l": 74.639998, "t": 485.382452, "r": 89.475992, "b": 473.417872 }, "text": "0.6", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p71.5.16", "order": 21, "type": "table_cell", "bbox": { "l": 120.82405, "t": 485.382452, "r": 132.68142, "b": 473.417872 }, "text": "50", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p71.5.17", "order": 22, "type": "table_cell", "bbox": { "l": 143.445254, "t": 485.382452, "r": 175.863606, "b": 473.417872 }, "text": "0.0050", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p71.5.18", "order": 23, "type": "table_cell", "bbox": { "l": 203.137703, "t": 485.382452, "r": 223.870219, "b": 473.417872 }, "text": "1.44", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p71.5.19", "order": 24, "type": "table_cell", "bbox": { "l": 286.679993, "t": 485.26245, "r": 425.623588, "b": 461.417872 }, "text": "Shallow Concentrated Flow, Paved Kv= 20.3 fps", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p71.5.20", "order": 25, "type": "table_cell", "bbox": { "l": 74.639998, "t": 459.462454, "r": 89.475992, "b": 447.497874 }, "text": "1.4", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p71.5.21", "order": 26, "type": "table_cell", "bbox": { "l": 114.927527, "t": 459.462454, "r": 132.68142, "b": 447.497874 }, "text": "150", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p71.5.22", "order": 27, "type": "table_cell", "bbox": { "l": 143.445254, "t": 459.462454, "r": 167.029543, "b": 447.497874 }, "text": "Total", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p71.5.23", "order": 28, "type": "table_cell", "bbox": { "l": 356.544, "t": 471.4286, "r": 457.872, "b": 451.92 }, "text": "", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 22 }, { "id": "p71.5.24", "order": 29, "type": "table_cell", "bbox": { "l": 457.872, "t": 471.4286, "r": 559.2, "b": 451.92 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 23 } ], "reading_order": 4 }, { "id": "p71.6", "order": 30, "type": "caption", "bbox": { "l": 186.72, "t": 435.12, "r": 424.56, "b": 419.76 }, "text": "Subcatchment 172S: DA P6 (Impervious)", "attrs": { "block_label": "figure_title" }, "reading_order": 5 }, { "id": "p71.7", "order": 31, "type": "caption", "bbox": { "l": 254.64, "t": 414.48, "r": 306, "b": 403.92 }, "text": "Hydrograph", "attrs": { "block_label": "figure_title" }, "reading_order": 6 }, { "id": "p71.8", "order": 32, "type": "figure", "bbox": { "l": 63.36, "t": 412.56, "r": 497.28, "b": 149.04 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n0.75\n0.7 0.67 cfs\n0.65 NOAA 24-hr D\n10-Year Rainfall=5.38\"\n0.6\nRunoff Area=5,250 sf\n0.55\n0.5\n0.45 Runoff Volume=2,250 cf\n(cfs) 0.4 Runoff Depth=5.14\"\nFlow Flow Length=150'\n0.35\n0.3\nTc=1.4 min\n0.25\n0.2 CN=0/98\n0.15\n0.1\n0.05\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72\nTime (hours)" }, "reading_order": 7 }, { "id": "p71.9", "order": 33, "type": "text", "bbox": { "l": 267.6, "t": 155.76, "r": 315.36, "b": 147.12 }, "text": "Time (hours)", "attrs": { "block_label": "number" }, "reading_order": 8 }, { "id": "p71.10", "order": 34, "type": "footer", "bbox": { "l": 511.44, "t": 392.64, "r": 546.24, "b": 381.6 }, "text": "", "attrs": { "block_label": "footer_image" }, "reading_order": 9 } ] }, { "document_id": 16592, "page": 72, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 22, "counts_by_type": { "footnote": 1, "header": 2, "heading": 2, "table": 2, "table_cell": 12, "text": 3 }, "build_ms": 3, "items": [ { "id": "p72.1", "order": 1, "type": "header", "bbox": { "l": 361.2, "t": 738.96, "r": 560.88, "b": 713.04 }, "text": "NOAA 24-hr D 10-Year Rainfall=5.38\"\nPrinted 04/12/2025", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p72.2", "order": 2, "type": "header", "bbox": { "l": 52.32, "t": 738.24, "r": 396.48, "b": 698.88 }, "text": "102 Sams -REV 12-02-25 NOAA\nPrepared by Haler Consulting\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p72.3", "order": 3, "type": "text", "bbox": { "l": 517.2, "t": 711.36, "r": 559.2, "b": 699.12 }, "text": "Page 32", "attrs": { "block_label": "number" }, "reading_order": 2 }, { "id": "p72.4", "order": 4, "type": "heading", "bbox": { "l": 188.88, "t": 687.84, "r": 423.84, "b": 672.72 }, "text": "Summary for Pond 130P: SUBSURFACE", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 3 }, { "id": "p72.5", "order": 5, "type": "text", "bbox": { "l": 52.8, "t": 663.84, "r": 529.2, "b": 536.4 }, "text": "Inflow Area = 4,000 sf, 0.00% Impervious, Inflow Depth = 5.14\" for 10-Year event\nInflow = 0.38 cfs @ 12.14 hrs, Volume= 1,714 cf\nOutflow = 0.04 cfs @ 11.14 hrs, Volume= 1,714 cf, Atten= 90%, Lag= 0.0 min\nDiscarded = 0.04 cfs @ 11.14 hrs, Volume= 1,714 cf\n\nRouting by Stor-Ind method, Time Span= 0.00-72.00 hrs, dt= 0.01 hrs\nPeak Elev= 2.25' @ 13.27 hrs Surf.Area= 533 sf Storage= 576 cf\n\nPlug-Flow detention time= 97.6 min calculated for 1,714 cf (100% of inflow)\nCenter-of-Mass det. time= 97.6 min (849.3 - 751.7)", "attrs": { "block_label": "algorithm" }, "reading_order": 4 }, { "id": "p72.6", "order": 6, "type": "table", "bbox": { "l": 51.84, "t": 529.44, "r": 558.24, "b": 436.56 }, "text": "", "attrs": { "block_label": "table", "n_rows": 2, "n_cols": 4, "integrity": { "cells_checked": 8, "cells_flagged": 0 } }, "children": [ { "id": "p72.6.1", "order": 7, "type": "table_cell", "bbox": { "l": 54, "t": 527.142469, "r": 538.219405, "b": 489.257868 }, "text": "Volume\n#1A\n2,664 cf Overall - 751 cf Embedded = 1,914 cf x 40.0% Voids", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p72.6.2", "order": 8, "type": "table_cell", "bbox": { "l": 122.133522, "t": 527.142469, "r": 148.95691, "b": 501.257868 }, "text": "Invert\n0.00'", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p72.6.3", "order": 9, "type": "table_cell", "bbox": { "l": 170.997811, "t": 527.142469, "r": 234.422951, "b": 501.257868 }, "text": "Avail.Storage\n765 cf", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p72.6.4", "order": 10, "type": "table_cell", "bbox": { "l": 246.044461, "t": 527.142469, "r": 410.255528, "b": 501.137889 }, "text": "Storage Description\n13.00'W x 41.00'L x 5.00'H Field A", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p72.6.5", "order": 11, "type": "table_cell", "bbox": { "l": 66, "t": 489.222448, "r": 84.933198, "b": 477.257868 }, "text": "#2A", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p72.6.6", "order": 12, "type": "table_cell", "bbox": { "l": 126.251739, "t": 489.222448, "r": 148.95691, "b": 477.257868 }, "text": "1.00'", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p72.6.7", "order": 13, "type": "table_cell", "bbox": { "l": 205.241898, "t": 489.222448, "r": 234.240267, "b": 477.257868 }, "text": "573 cf", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p72.6.8", "order": 14, "type": "table_cell", "bbox": { "l": 246.120003, "t": 489.222448, "r": 517.204542, "b": 441.257868 }, "text": "ADS N-12 30\" x 6 Inside #1\\nInside= 30.0\"W x 30.0\"H => 4.90 sf x 20.00'L = 98.0 cf\\nOutside= 36.0\"W x 36.0\"H => 6.42 sf x 20.00'L = 128.3 cf\\nRow Length Adjustment= -1.00' x 4.90 sf x 3 rows", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 } ], "reading_order": 5 }, { "id": "p72.7", "order": 15, "type": "heading", "bbox": { "l": 195.6, "t": 439.68, "r": 358.8, "b": 426.48 }, "text": "1,339 cf Total Available Storage", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 6 }, { "id": "p72.8", "order": 16, "type": "text", "bbox": { "l": 67.2, "t": 415.92, "r": 294.24, "b": 402 }, "text": "Storage Group A created with Chamber Wizard", "reading_order": 7 }, { "id": "p72.9", "order": 17, "type": "table", "bbox": { "l": 52.32, "t": 391.92, "r": 420.72, "b": 363.6 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 4, "integrity": { "cells_checked": 4, "cells_flagged": 0 } }, "children": [ { "id": "p72.9.1", "order": 18, "type": "table_cell", "bbox": { "l": 54, "t": 391.302451, "r": 86.679256, "b": 365.417872 }, "text": "Device\n#1", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p72.9.2", "order": 19, "type": "table_cell", "bbox": { "l": 98.407976, "t": 391.302451, "r": 146.474595, "b": 365.417872 }, "text": "Routing\nDiscarded", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p72.9.3", "order": 20, "type": "table_cell", "bbox": { "l": 182.045624, "t": 391.302451, "r": 208.890165, "b": 365.417872 }, "text": "Invert\n0.00'", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p72.9.4", "order": 21, "type": "table_cell", "bbox": { "l": 220.650048, "t": 391.302451, "r": 419.617941, "b": 365.297892 }, "text": "Outlet Devices\n3.250 in/hr Exfiltration over Surface area", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 } ], "reading_order": 8 }, { "id": "p72.10", "order": 22, "type": "footnote", "bbox": { "l": 51.6, "t": 354.48, "r": 423.6, "b": 328.08 }, "text": "Discarded OutFlow Max=0.04 cfs @ 11.14 hrs HW=0.05' (Free Discharge)\n1=Exfiltration (Exfiltration Controls 0.04 cfs)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 9 } ] }, { "document_id": 16592, "page": 73, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 5, "counts_by_type": { "caption": 1, "figure": 1, "footnote": 1, "header": 1, "text": 1 }, "build_ms": 0, "items": [ { "id": "p73.1", "order": 1, "type": "header", "bbox": { "l": 53.04, "t": 738.72, "r": 563.28, "b": 698.4 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 10-Year Rainfall=5.38\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 33", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p73.2", "order": 2, "type": "caption", "bbox": { "l": 227.76, "t": 687.6, "r": 384.24, "b": 673.2 }, "text": "Pond 130P: SUBSURFACE", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p73.3", "order": 3, "type": "figure", "bbox": { "l": 64.08, "t": 666.72, "r": 486.48, "b": 407.04 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n0.42 0.38 cfs\n0.38 Inflow Area=4,000 sf\n0.4\n0.34 Peak Elev=2.25'\n0.36\n0.3 Storage=576 cf\n0.32\n0.28\n0.26\n(cfs)\n0.24\n0.22\nFlow\n0.2\n0.18\n0.16\n0.14\n0.12\n0.1\n0.08\n0.06 0.04 cfs\n0.04\n0.02\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72" }, "reading_order": 2 }, { "id": "p73.4", "order": 4, "type": "text", "bbox": { "l": 497.28, "t": 644.64, "r": 546.24, "b": 625.92 }, "text": "Inflow\nDiscarded", "attrs": { "block_label": "aside_text" }, "reading_order": 3 }, { "id": "p73.5", "order": 5, "type": "footnote", "bbox": { "l": 89.76, "t": 421.44, "r": 470.88, "b": 401.04 }, "text": "0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72 Time (hours)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 4 } ] }, { "document_id": 16592, "page": 74, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 9, "counts_by_type": { "caption": 1, "header": 2, "table": 1, "table_cell": 4, "text": 1 }, "build_ms": 10, "items": [ { "id": "p74.1", "order": 1, "type": "header", "bbox": { "l": 360.72, "t": 739.2, "r": 561.12, "b": 711.84 }, "text": "NOAA 24-hr D 10-Year Rainfall=5.38\"\nPrinted 04/12/2025", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p74.2", "order": 2, "type": "header", "bbox": { "l": 51.12, "t": 738, "r": 408.48, "b": 699.12 }, "text": "102 Sams -REV 12-02-25 NOAA 24\nPrepared by Haler Consulting\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p74.3", "order": 3, "type": "text", "bbox": { "l": 516.96, "t": 711.36, "r": 558.96, "b": 699.12 }, "text": "Page 34", "attrs": { "block_label": "number" }, "reading_order": 2 }, { "id": "p74.4", "order": 4, "type": "caption", "bbox": { "l": 178.56, "t": 687.84, "r": 433.68, "b": 672.96 }, "text": "Stage-Discharge for Pond 130P: SUBSURFACE", "attrs": { "block_label": "figure_title" }, "reading_order": 3 }, { "id": "p74.5", "order": 5, "type": "table", "bbox": { "l": 56.4, "t": 663.36, "r": 279.6, "b": 58.56 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 4, "integrity": { "cells_checked": 4, "cells_flagged": 0 } }, "children": [ { "id": "p74.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 57.479999, "t": 661.126246, "r": 98.089591, "b": 64.158859 }, "text": "Elevation (feet)\n0.00\n0.05\n0.10\n0.15\n0.20\n0.25\n0.30\n0.35\n0.40\n0.45\n0.50\n0.55\n0.60\n0.65\n0.70\n0.75\n0.80\n0.85\n0.90\n0.95\n1.00\n1.05\n1.10\n1.15\n1.20\n1.25\n1.30\n1.35\n1.40\n1.45\n1.50\n1.55\n1.60\n1.65\n1.70\n1.75\n1.80\n1.85\n1.90\n1.95\n2.00\n2.05\n2.10\n2.15\n2.20\n2.25\n2.30\n2.35\n2.40\n2.45\n2.50\n2.55", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p74.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 109.680004, "t": 661.126246, "r": 154.780724, "b": 64.158859 }, "text": "Discarded (cfs)\n0.00\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p74.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 178.200005, "t": 661.126246, "r": 218.809603, "b": 97.27883899999995 }, "text": "Elevation (feet)\n2.60\n2.65\n2.70\n2.75\n2.80\n2.85\n2.90\n2.95\n3.00\n3.05\n3.10\n3.15\n3.20\n3.25\n3.30\n3.35\n3.40\n3.45\n3.50\n3.55\n3.60\n3.65\n3.70\n3.75\n3.80\n3.85\n3.90\n3.95\n4.00\n4.05\n4.10\n4.15\n4.20\n4.25\n4.30\n4.35\n4.40\n4.45\n4.50\n4.55\n4.60\n4.65\n4.70\n4.75\n4.80\n4.85\n4.90\n4.95\n5.00", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p74.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 230.400009, "t": 661.126246, "r": 275.174362, "b": 97.27883899999995 }, "text": "Discarded (cfs)\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 } ], "reading_order": 4 } ] }, { "document_id": 16592, "page": 75, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 11, "counts_by_type": { "caption": 1, "header": 2, "table": 1, "table_cell": 6, "text": 1 }, "build_ms": 18, "items": [ { "id": "p75.1", "order": 1, "type": "header", "bbox": { "l": 361.44, "t": 738.96, "r": 561.36, "b": 713.04 }, "text": "NOAA 24-hr D 10-Year Rainfall=5.38\"\nPrinted 04/12/2025", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p75.2", "order": 2, "type": "header", "bbox": { "l": 49.44, "t": 737.76, "r": 393.36, "b": 699.12 }, "text": "102 Sams -REV 12-02-25\nPrepared by Haler Consulting\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p75.3", "order": 3, "type": "text", "bbox": { "l": 516.96, "t": 711.12, "r": 559.2, "b": 698.88 }, "text": "Page 35", "attrs": { "block_label": "number" }, "reading_order": 2 }, { "id": "p75.4", "order": 4, "type": "caption", "bbox": { "l": 170.64, "t": 688.08, "r": 441.84, "b": 672.96 }, "text": "Stage-Area-Storage for Pond 130P: SUBSURFACE", "attrs": { "block_label": "figure_title" }, "reading_order": 3 }, { "id": "p75.5", "order": 5, "type": "table", "bbox": { "l": 54.72, "t": 664.8, "r": 468.72, "b": 61.68 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 6, "integrity": { "cells_checked": 6, "cells_flagged": 0 } }, "children": [ { "id": "p75.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 57.479999, "t": 661.126246, "r": 98.089591, "b": 64.158859 }, "text": "Elevation\\n(feet)\n0.00\n0.05\n0.10\n0.15\n0.20\n0.25\n0.30\n0.35\n0.40\n0.45\n0.50\n0.55\n0.60\n0.65\n0.70\n0.75\n0.80\n0.85\n0.90\n0.95\n1.00\n1.05\n1.10\n1.15\n1.20\n1.25\n1.30\n1.35\n1.40\n1.45\n1.50\n1.55\n1.60\n1.65\n1.70\n1.75\n1.80\n1.85\n1.90\n1.95\n2.00\n2.05\n2.10\n2.15\n2.20\n2.25\n2.30\n2.35\n2.40\n2.45\n2.50\n2.55", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p75.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 139.439999, "t": 661.126246, "r": 174.077645, "b": 64.158859 }, "text": "Surface\\n(sq-ft)\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p75.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 199.55999, "t": 661.126246, "r": 249.563969, "b": 64.158859 }, "text": "Storage\\n(cubic-feet)\n0\n11\n21\n32\n43\n53\n64\n75\n85\n96\n107\n117\n128\n139\n149\n160\n171\n181\n192\n203\n213\n223\n231\n240\n247\n255\n264\n276\n289\n302\n317\n332\n347\n363\n379\n396\n413\n430\n448\n465\n483\n501\n520\n538\n557\n575\n594\n613\n632\n651\n669\n688", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p75.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 273.240005, "t": 661.126246, "r": 313.84958, "b": 97.27883899999995 }, "text": "Elevation\\n(feet)\n2.60\n2.65\n2.70\n2.75\n2.80\n2.85\n2.90\n2.95\n3.00\n3.05\n3.10\n3.15\n3.20\n3.25\n3.30\n3.35\n3.40\n3.45\n3.50\n3.55\n3.60\n3.65\n3.70\n3.75\n3.80\n3.85\n3.90\n3.95\n4.00\n4.05\n4.10\n4.15\n4.20\n4.25\n4.30\n4.35\n4.40\n4.45\n4.50\n4.55\n4.60\n4.65\n4.70\n4.75\n4.80\n4.85\n4.90\n4.95\n5.00", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p75.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 355.200005, "t": 661.126246, "r": 389.605666, "b": 97.27883899999995 }, "text": "Surface\\n(sq-ft)\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533", "attrs": { "row": 0, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p75.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 415.320008, "t": 661.126246, "r": 465.528236, "b": 97.27883899999995 }, "text": "Storage\\n(cubic-feet)\n707\n726\n745\n764\n782\n801\n819\n838\n856\n874\n891\n909\n926\n943\n960\n976\n992\n1,007\n1,022\n1,037\n1,050\n1,063\n1,075\n1,084\n1,092\n1,099\n1,107\n1,116\n1,126\n1,136\n1,147\n1,158\n1,168\n1,179\n1,190\n1,200\n1,211\n1,222\n1,232\n1,243\n1,254\n1,264\n1,275\n1,286\n1,296\n1,307\n1,318\n1,328\n1,339", "attrs": { "row": 0, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 } ], "reading_order": 4 } ] }, { "document_id": 16592, "page": 76, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 36, "counts_by_type": { "footnote": 3, "header": 1, "heading": 1, "table": 3, "table_cell": 28 }, "build_ms": 8, "items": [ { "id": "p76.1", "order": 1, "type": "header", "bbox": { "l": 53.52, "t": 738.96, "r": 561.12, "b": 698.16 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 10-Year Rainfall=5.38\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 36", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p76.2", "order": 2, "type": "heading", "bbox": { "l": 162.24, "t": 687.84, "r": 449.04, "b": 672.48 }, "text": "Summary for Pond 144P: WQ Infiltration Basin #1", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p76.3", "order": 3, "type": "table", "bbox": { "l": 52.56, "t": 661.92, "r": 530.88, "b": 587.177889 }, "text": "", "attrs": { "block_label": "table", "n_rows": 2, "n_cols": 4, "integrity": { "cells_checked": 8, "cells_flagged": 2, "flags": [ { "row": 0, "col": 2, "coverage": 0, "text": "29.12% Impervious," }, { "row": 0, "col": 3, "coverage": 0.5, "text": "Inflow Depth = 1.70\" for 10-Year event" } ] } }, "children": [ { "id": "p76.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 54, "t": 659.142458, "r": 107.356451, "b": 647.177878 }, "text": "Inflow Area =", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 0 }, { "id": "p76.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 151.868035, "t": 659.142458, "r": 204.64367, "b": 647.177878 }, "text": "108,596 sf,", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 1 }, { "id": "p76.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 291.72, "t": 661.92, "r": 411.3, "b": 649.6 }, "text": "29.12% Impervious,", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 2 }, { "id": "p76.3.4", "order": 7, "type": "table_cell", "bbox": { "l": 411.3, "t": 661.92, "r": 530.88, "b": 649.6 }, "text": "Inflow Depth = 1.70\" for 10-Year event", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 3 }, { "id": "p76.3.5", "order": 8, "type": "table_cell", "bbox": { "l": 54, "t": 647.142458, "r": 195.539615, "b": 587.177889 }, "text": "Inflow =\nOutflow =\nDiscarded =\nPrimary =\nRouted to Link 147L : POA", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p76.3.6", "order": 9, "type": "table_cell", "bbox": { "l": 146.255659, "t": 647.142458, "r": 183.784219, "b": 599.177878 }, "text": "3.70 cfs @\n0.37 cfs @\n0.37 cfs @\n0.00 cfs @", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p76.3.7", "order": 10, "type": "table_cell", "bbox": { "l": 206.460913, "t": 647.142458, "r": 253.806345, "b": 599.177878 }, "text": "12.11 hrs,\n13.34 hrs,\n13.34 hrs,\n0.00 hrs,", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p76.3.8", "order": 11, "type": "table_cell", "bbox": { "l": 343.335198, "t": 647.142458, "r": 528.248175, "b": 599.177878 }, "text": "15,371 cf\n15,371 cf, Atten= 90%, Lag= 73.5 min\n15,371 cf\n0 cf", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 7 } ], "reading_order": 2 }, { "id": "p76.4", "order": 12, "type": "table", "bbox": { "l": 52.8, "t": 505.44, "r": 557.52, "b": 389.04 }, "text": "", "attrs": { "block_label": "table", "n_rows": 2, "n_cols": 5, "integrity": { "cells_checked": 8, "cells_flagged": 0 } }, "children": [ { "id": "p76.4.1", "order": 13, "type": "table_cell", "bbox": { "l": 54, "t": 503.142469, "r": 90.142207, "b": 477.257868 }, "text": "Volume\n#1", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p76.4.2", "order": 14, "type": "table_cell", "bbox": { "l": 120.355217, "t": 503.142469, "r": 148.95691, "b": 477.257868 }, "text": "Invert\n95.00'", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p76.4.3", "order": 15, "type": "table_cell", "bbox": { "l": 170.997811, "t": 503.142469, "r": 234.422951, "b": 477.257868 }, "text": "Avail.Storage\n16,706 cf", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p76.4.4", "order": 16, "type": "table_cell", "bbox": { "l": 246.044461, "t": 503.142469, "r": 502.944852, "b": 477.137889 }, "text": "Storage Description\nCustom Stage Data (Prismatic) Listed below (Recalc)", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p76.4.5", "order": 17, "type": "table_cell", "bbox": { "l": 57.360002, "t": 465.222448, "r": 101.273013, "b": 391.337871 }, "text": "Elevation\\n(feet)\n95.00\n96.00\n97.00\n98.00", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p76.4.6", "order": 18, "type": "table_cell", "bbox": { "l": 140.447365, "t": 465.222448, "r": 185.72688, "b": 391.337871 }, "text": "Surf.Area\\n(sq-ft)\n4,231\n5,092\n6,008\n6,981", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p76.4.7", "order": 19, "type": "table_cell", "bbox": { "l": 227.371027, "t": 465.222448, "r": 354.642567, "b": 391.337871 }, "text": "Inc.Store\\n(cubic-feet)\n0\n4,662\n5,550\n6,495", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p76.4.8", "order": 20, "type": "table_cell", "bbox": { "l": 216.402998, "t": 465.222448, "r": 354.689052, "b": 391.337871 }, "text": "Cum.Store\\n(cubic-feet)\n0\n4,662\n10,212\n16,706", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 7 } ], "reading_order": 3 }, { "id": "p76.5", "order": 21, "type": "table", "bbox": { "l": 52.08, "t": 379.68, "r": 556.08, "b": 291.84 }, "text": "", "attrs": { "block_label": "table", "n_rows": 3, "n_cols": 4, "integrity": { "cells_checked": 12, "cells_flagged": 0 } }, "children": [ { "id": "p76.5.1", "order": 22, "type": "table_cell", "bbox": { "l": 54, "t": 379.302451, "r": 86.679256, "b": 367.337871 }, "text": "Device", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p76.5.2", "order": 23, "type": "table_cell", "bbox": { "l": 98.407976, "t": 379.302451, "r": 135.030741, "b": 367.337871 }, "text": "Routing", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p76.5.3", "order": 24, "type": "table_cell", "bbox": { "l": 182.045624, "t": 379.302451, "r": 208.824841, "b": 367.337871 }, "text": "Invert", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p76.5.4", "order": 25, "type": "table_cell", "bbox": { "l": 220.650048, "t": 379.302451, "r": 290.014595, "b": 367.337871 }, "text": "Outlet Devices", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 3 }, { "id": "p76.5.5", "order": 26, "type": "table_cell", "bbox": { "l": 70.320002, "t": 365.382452, "r": 82.177372, "b": 353.417872 }, "text": "#1", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p76.5.6", "order": 27, "type": "table_cell", "bbox": { "l": 98.408891, "t": 365.382452, "r": 135.204992, "b": 353.417872 }, "text": "Primary", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p76.5.7", "order": 28, "type": "table_cell", "bbox": { "l": 354.69794, "t": 341.382452, "r": 383.299634, "b": 329.417872 }, "text": "97.60'", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p76.5.8", "order": 29, "type": "table_cell", "bbox": { "l": 220.679993, "t": 365.262472, "r": 512.979659, "b": 317.417872 }, "text": "15.0\" Round Culvert to Subsurface Basin\\nL= 35.0' RCP, square edge headwall, Ke= 0.500\\nInlet / Outlet Invert= 95.00' / 97.60' S= -0.0743'' Cc= 0.900\\nn= 0.012 Corrugated PP, smooth interior, Flow Area= 1.23 sf", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p76.5.9", "order": 30, "type": "table_cell", "bbox": { "l": 70.320002, "t": 317.382452, "r": 82.177372, "b": 293.417872 }, "text": "#2\n#3", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 8 }, { "id": "p76.5.10", "order": 31, "type": "table_cell", "bbox": { "l": 98.408891, "t": 317.382452, "r": 146.474595, "b": 293.417872 }, "text": "Device 1\nDiscarded", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 9 }, { "id": "p76.5.11", "order": 32, "type": "table_cell", "bbox": { "l": 180.288471, "t": 317.382452, "r": 208.918642, "b": 293.417872 }, "text": "97.00'\n95.00'", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 10 }, { "id": "p76.5.12", "order": 33, "type": "table_cell", "bbox": { "l": 220.679993, "t": 317.382452, "r": 531.965762, "b": 293.297892 }, "text": "4.0' long Sharp-Crested Rectangular Weir 2 End Contraction(s)\n3.100 in/hr Exfiltration over Surface area", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 11 } ], "reading_order": 4 }, { "id": "p76.6", "order": 34, "type": "footnote", "bbox": { "l": 52.56, "t": 576.96, "r": 412.8, "b": 512.64 }, "text": "Routing by Stor-Ind method, Time Span= 0.00-72.00 hrs, dt= 0.01 hrs\nPeak Elev= 96.01' @ 13.34 hrs Surf.Area= 5,102 sf Storage= 4,717 cf\nPlug-Flow detention time= 98.2 min calculated for 15,369 cf (100% of inflow)\nCenter-of-Mass det. time= 98.2 min ( 878.4 - 780.2 )", "attrs": { "block_label": "vision_footnote" }, "reading_order": 5 }, { "id": "p76.7", "order": 35, "type": "footnote", "bbox": { "l": 51.84, "t": 282.48, "r": 429.84, "b": 255.36 }, "text": "Discarded OutFlow Max=0.37 cfs @ 13.34 hrs HW=96.01' (Free Discharge)\n3=Exfiltration (Exfiltration Controls 0.37 cfs)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 6 }, { "id": "p76.8", "order": 36, "type": "footnote", "bbox": { "l": 51.84, "t": 246, "r": 412.08, "b": 207.6 }, "text": "Primary OutFlow Max=0.00 cfs @ 0.00 hrs HW=95.00' (Free Discharge)\n1=Culvert to Subsurface Basin (Controls 0.00 cfs)\n2=Sharp-Crested Rectangular Weir (Controls 0.00 cfs)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 7 } ] }, { "document_id": 16592, "page": 77, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 8, "counts_by_type": { "caption": 1, "figure": 2, "footnote": 2, "header": 3 }, "build_ms": 0, "items": [ { "id": "p77.1", "order": 1, "type": "header", "bbox": { "l": 361.44, "t": 738.96, "r": 560.64, "b": 711.36 }, "text": "NOAA 24-hr D 10-Year Rainfall=5.38\"\nPrinted 04/12/2025", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p77.2", "order": 2, "type": "header", "bbox": { "l": 52.32, "t": 738, "r": 400.08, "b": 699.36 }, "text": "102 Sams -REV 12-02-25\nPrepared by Haler Consulting\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p77.3", "order": 3, "type": "header", "bbox": { "l": 517.2, "t": 711.36, "r": 559.2, "b": 699.12 }, "text": "Page 37", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 2 }, { "id": "p77.4", "order": 4, "type": "caption", "bbox": { "l": 201.12, "t": 687.6, "r": 409.44, "b": 672.96 }, "text": "Pond 144P: WQ Infiltration Basin #1", "attrs": { "block_label": "figure_title" }, "reading_order": 3 }, { "id": "p77.5", "order": 5, "type": "figure", "bbox": { "l": 65.28, "t": 679.44, "r": 551.52, "b": 408 }, "text": "", "attrs": { "block_label": "image", "embedded_text": "Hydrograph\nInflow\n3.70 cfs Outflow\nInflow Area=108,596 sf Primary\nDiscarded\n4\nPeak Elev=96.01'\nStorage=4,717 cf\n3\n(cfs)\n2\nFlow\n1 0.37 cfs\n0.37 cfs\n0.00 cfs\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72" }, "reading_order": 4 }, { "id": "p77.6", "order": 6, "type": "figure", "bbox": { "l": 64.32, "t": 666, "r": 490.8, "b": 416.4 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n3.70 cfs\nInflow Area=108,596 sf\n4\nPeak Elev=96.01'\nStorage=4,717 cf\n3\n(cfs)\n2\nFlow\n1 0.37 cfs\n0.37 cfs\n0.00 cfs\n0" }, "reading_order": 5 }, { "id": "p77.7", "order": 7, "type": "footnote", "bbox": { "l": 497.04, "t": 645.12, "r": 547.44, "b": 609.84 }, "text": "Inflow Outflow Discarded Primary", "attrs": { "block_label": "vision_footnote" }, "reading_order": 6 }, { "id": "p77.8", "order": 8, "type": "footnote", "bbox": { "l": 83.76, "t": 420, "r": 449.28, "b": 401.04 }, "text": "0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72 Time (hours)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 7 } ] }, { "document_id": 16592, "page": 78, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 29, "counts_by_type": { "caption": 1, "header": 2, "table": 1, "table_cell": 24, "text": 1 }, "build_ms": 19, "items": [ { "id": "p78.1", "order": 1, "type": "header", "bbox": { "l": 360.96, "t": 739.2, "r": 561.12, "b": 713.04 }, "text": "NOAA 24-hr D 10-Year Rainfall=5.38\"\nPrinted 04/12/2025", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p78.2", "order": 2, "type": "header", "bbox": { "l": 50.64, "t": 738.24, "r": 396.48, "b": 699.12 }, "text": "102 Sams -REV 12-02-25 NOAA\nPrepared by Haler Consulting\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p78.3", "order": 3, "type": "text", "bbox": { "l": 516.72, "t": 711.12, "r": 558.96, "b": 699.12 }, "text": "Page 38", "attrs": { "block_label": "number" }, "reading_order": 2 }, { "id": "p78.4", "order": 4, "type": "caption", "bbox": { "l": 153.6, "t": 687.84, "r": 457.44, "b": 672.96 }, "text": "Stage-Discharge for Pond 144P: WQ Infiltration Basin #1", "attrs": { "block_label": "figure_title" }, "reading_order": 3 }, { "id": "p78.5", "order": 5, "type": "table", "bbox": { "l": 54.72, "t": 662.88, "r": 506.88, "b": 57.84 }, "text": "", "attrs": { "block_label": "table", "n_rows": 3, "n_cols": 8, "integrity": { "cells_checked": 16, "cells_flagged": 0 } }, "children": [ { "id": "p78.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 57.479999, "t": 661.126246, "r": 98.137287, "b": 86.23886200000004 }, "text": "Elevation (feet)\n95.00\n95.05\n95.10\n95.15\n95.20\n95.25\n95.30\n95.35\n95.40\n95.45\n95.50\n95.55\n95.60\n95.65\n95.70\n95.75\n95.80\n95.85\n95.90\n95.95\n96.00\n96.05\n96.10\n96.15\n96.20\n96.25\n96.30\n96.35\n96.40\n96.45\n96.50\n96.55\n96.60\n96.65\n96.70\n96.75\n96.80\n96.85\n96.90\n96.95\n97.00\n97.05\n97.10\n97.15\n97.20\n97.25\n97.30\n97.35\n97.40\n97.45", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p78.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 109.680004, "t": 661.126246, "r": 154.533694, "b": 86.23886200000004 }, "text": "Discharge (cfs)\n0.00\n0.31\n0.31\n0.31\n0.32\n0.32\n0.32\n0.33\n0.33\n0.33\n0.33\n0.34\n0.34\n0.34\n0.35\n0.35\n0.35\n0.36\n0.36\n0.36\n0.37\n0.37\n0.37\n0.38\n0.38\n0.38\n0.39\n0.39\n0.39\n0.39\n0.40\n0.40\n0.40\n0.41\n0.41\n0.41\n0.42\n0.42\n0.42\n0.43\n0.43\n0.43\n0.44\n0.44\n0.45\n0.45\n0.45\n0.46\n0.46\n0.46", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p78.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 166.080002, "t": 661.126246, "r": 210.875583, "b": 86.23886200000004 }, "text": "Discarded (cfs)\n0.00\n0.31\n0.31\n0.31\n0.32\n0.32\n0.32\n0.33\n0.33\n0.33\n0.33\n0.34\n0.34\n0.34\n0.35\n0.35\n0.35\n0.36\n0.36\n0.36\n0.37\n0.37\n0.37\n0.38\n0.38\n0.38\n0.39\n0.39\n0.39\n0.39\n0.40\n0.40\n0.40\n0.41\n0.41\n0.41\n0.42\n0.42\n0.42\n0.43\n0.43\n0.43\n0.44\n0.44\n0.45\n0.45\n0.45\n0.46\n0.46\n0.46", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p78.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 233.160004, "t": 661.126246, "r": 267.536512, "b": 86.23886200000004 }, "text": "Primary (cfs)\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p78.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 291, "t": 661.126246, "r": 331.657282, "b": 351.198838 }, "text": "Elevation (feet)\n97.60\n97.65\n97.70\n97.75\n97.80\n97.85\n97.90\n97.95\n98.00\n98.05\n98.10\n98.15\n98.20\n98.25\n98.30\n98.35\n98.40\n98.45\n98.50\n98.55\n98.60\n98.65\n98.70\n98.75\n98.80\n98.85", "attrs": { "row": 0, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p78.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 343.200005, "t": 661.126246, "r": 388.300713, "b": 351.198838 }, "text": "Discharge (cfs)\n0.47\n0.49\n0.53\n0.59\n0.68\n0.79\n0.92\n1.06\n1.23\n1.41\n1.60\n1.81\n2.04\n2.27\n2.52\n2.77\n3.03\n3.29\n3.56\n3.82\n4.08\n4.34\n4.59\n4.81\n5.02\n5.17", "attrs": { "row": 0, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p78.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 399.599991, "t": 661.126246, "r": 444.700722, "b": 351.198838 }, "text": "Discarded (cfs)\n0.47\n0.48\n0.48\n0.48\n0.49\n0.49\n0.49\n0.50\n0.50\n0.50\n0.50\n0.50\n0.50\n0.50\n0.50\n0.50\n0.50\n0.50\n0.50\n0.50\n0.50\n0.50\n0.50\n0.50\n0.50\n0.50", "attrs": { "row": 0, "col": 6, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p78.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 466.679993, "t": 661.126246, "r": 501.100731, "b": 351.198838 }, "text": "Primary (cfs)\n0.00\n0.01\n0.05\n0.11\n0.19\n0.30\n0.42\n0.57\n0.73\n0.91\n1.10\n1.31\n1.54\n1.77\n2.01\n2.27\n2.53\n2.79\n3.06\n3.32\n3.58\n3.84\n4.08\n4.31\n4.52\n4.67", "attrs": { "row": 0, "col": 7, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 7 }, { "id": "p78.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 73.320002, "t": 86.20622500000002, "r": 98.137287, "b": 75.19883800000002 }, "text": "97.50", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p78.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 135.26256, "t": 75.166246, "r": 154.533694, "b": 64.158859 }, "text": "0.47", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p78.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 191.560334, "t": 75.166246, "r": 210.875583, "b": 64.158859 }, "text": "0.47", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p78.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 248.000856, "t": 75.166246, "r": 267.196089, "b": 64.158859 }, "text": "0.00", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 }, { "id": "p78.5.13", "order": 18, "type": "table_cell", "bbox": { "l": 280.8, "t": 80.6717, "r": 337.32, "b": 69.2558 }, "text": "", "attrs": { "row": 1, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 12 }, { "id": "p78.5.14", "order": 19, "type": "table_cell", "bbox": { "l": 337.32, "t": 80.6717, "r": 393.84, "b": 69.2558 }, "text": "", "attrs": { "row": 1, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 13 }, { "id": "p78.5.15", "order": 20, "type": "table_cell", "bbox": { "l": 393.84, "t": 80.6717, "r": 450.36, "b": 69.2558 }, "text": "", "attrs": { "row": 1, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 14 }, { "id": "p78.5.16", "order": 21, "type": "table_cell", "bbox": { "l": 450.36, "t": 80.6717, "r": 506.88, "b": 69.2558 }, "text": "", "attrs": { "row": 1, "col": 7, "rowspan": 1, "colspan": 1 }, "reading_order": 15 }, { "id": "p78.5.17", "order": 22, "type": "table_cell", "bbox": { "l": 73.320002, "t": 75.166246, "r": 98.137287, "b": 64.158859 }, "text": "97.55", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p78.5.18", "order": 23, "type": "table_cell", "bbox": { "l": 135.26256, "t": 86.20622500000002, "r": 154.533694, "b": 75.19883800000002 }, "text": "0.47", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p78.5.19", "order": 24, "type": "table_cell", "bbox": { "l": 191.560334, "t": 86.20622500000002, "r": 210.875583, "b": 75.19883800000002 }, "text": "0.47", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p78.5.20", "order": 25, "type": "table_cell", "bbox": { "l": 248.000856, "t": 86.20622500000002, "r": 267.196089, "b": 75.19883800000002 }, "text": "0.00", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p78.5.21", "order": 26, "type": "table_cell", "bbox": { "l": 280.8, "t": 69.2558, "r": 337.32, "b": 57.84 }, "text": "", "attrs": { "row": 2, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 20 }, { "id": "p78.5.22", "order": 27, "type": "table_cell", "bbox": { "l": 337.32, "t": 69.2558, "r": 393.84, "b": 57.84 }, "text": "", "attrs": { "row": 2, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 21 }, { "id": "p78.5.23", "order": 28, "type": "table_cell", "bbox": { "l": 393.84, "t": 69.2558, "r": 450.36, "b": 57.84 }, "text": "", "attrs": { "row": 2, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 22 }, { "id": "p78.5.24", "order": 29, "type": "table_cell", "bbox": { "l": 450.36, "t": 69.2558, "r": 506.88, "b": 57.84 }, "text": "", "attrs": { "row": 2, "col": 7, "rowspan": 1, "colspan": 1 }, "reading_order": 23 } ], "reading_order": 4 } ] }, { "document_id": 16592, "page": 79, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 11, "counts_by_type": { "caption": 1, "header": 2, "table": 1, "table_cell": 6, "text": 1 }, "build_ms": 11, "items": [ { "id": "p79.1", "order": 1, "type": "header", "bbox": { "l": 361.44, "t": 738.96, "r": 561.12, "b": 702.96 }, "text": "NOAA 24-hr D 10-Year Rainfall=5.38\"\nPrinted 04/12/2025\nPage 39", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p79.2", "order": 2, "type": "header", "bbox": { "l": 51.6, "t": 738.48, "r": 395.76, "b": 698.88 }, "text": "102 Sams -REV 12-02-25 NOAA\nPrepared by Haler Consulting\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p79.3", "order": 3, "type": "text", "bbox": { "l": 516.72, "t": 711.12, "r": 559.2, "b": 699.12 }, "text": "Page 39", "attrs": { "block_label": "number" }, "reading_order": 2 }, { "id": "p79.4", "order": 4, "type": "caption", "bbox": { "l": 144.96, "t": 687.84, "r": 465.36, "b": 672.96 }, "text": "Stage-Area-Storage for Pond 144P: WQ Infiltration Basin #1", "attrs": { "block_label": "figure_title" }, "reading_order": 3 }, { "id": "p79.5", "order": 5, "type": "table", "bbox": { "l": 55.2, "t": 666.72, "r": 465.558002, "b": 54.72 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 6, "integrity": { "cells_checked": 6, "cells_flagged": 0 } }, "children": [ { "id": "p79.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 57.479999, "t": 661.126246, "r": 98.137287, "b": 64.158859 }, "text": "Elevation (feet)\n95.00\n95.05\n95.10\n95.15\n95.20\n95.25\n95.30\n95.35\n95.40\n95.45\n95.50\n95.55\n95.60\n95.65\n95.70\n95.75\n95.80\n95.85\n95.90\n95.95\n96.00\n96.05\n96.10\n96.15\n96.20\n96.25\n96.30\n96.35\n96.40\n96.45\n96.50\n96.55\n96.60\n96.65\n96.70\n96.75\n96.80\n96.85\n96.90\n96.95\n97.00\n97.05\n97.10\n97.15\n97.20\n97.25\n97.30\n97.35\n97.40\n97.45\n97.50\n97.55", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p79.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 139.439999, "t": 661.126246, "r": 173.816353, "b": 64.158859 }, "text": "Surface (sq-ft)\n4,231\n4,274\n4,317\n4,360\n4,403\n4,446\n4,489\n4,532\n4,575\n4,618\n4,662\n4,705\n4,748\n4,791\n4,834\n4,877\n4,920\n4,963\n5,006\n5,049\n5,092\n5,138\n5,184\n5,229\n5,275\n5,321\n5,367\n5,413\n5,458\n5,504\n5,550\n5,596\n5,642\n5,687\n5,733\n5,779\n5,825\n5,871\n5,916\n5,962\n6,008\n6,057\n6,105\n6,154\n6,203\n6,251\n6,300\n6,349\n6,397\n6,446\n6,495\n6,543", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p79.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 199.55999, "t": 661.126246, "r": 249.524304, "b": 64.158859 }, "text": "Storage (cubic-feet)\n0\n213\n427\n644\n863\n1,085\n1,308\n1,534\n1,761\n1,991\n2,223\n2,457\n2,694\n2,932\n3,173\n3,415\n3,660\n3,907\n4,157\n4,408\n4,662\n4,917\n5,175\n5,436\n5,698\n5,963\n6,230\n6,500\n6,772\n7,046\n7,322\n7,601\n7,882\n8,165\n8,450\n8,738\n9,028\n9,321\n9,615\n9,912\n10,212\n10,513\n10,817\n11,124\n11,433\n11,744\n12,058\n12,374\n12,693\n13,014\n13,337\n13,663", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p79.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 273.240005, "t": 661.126246, "r": 313.897287, "b": 351.198838 }, "text": "Elevation (feet)\n97.60\n97.65\n97.70\n97.75\n97.80\n97.85\n97.90\n97.95\n98.00\n98.05\n98.10\n98.15\n98.20\n98.25\n98.30\n98.35\n98.40\n98.45\n98.50\n98.55\n98.60\n98.65\n98.70\n98.75\n98.80\n98.85", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p79.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 355.200005, "t": 661.126246, "r": 389.808242, "b": 351.198838 }, "text": "Surface (sq-ft)\n6,592\n6,640\n6,689\n6,738\n6,786\n6,835\n6,884\n6,932\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981", "attrs": { "row": 0, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p79.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 415.320008, "t": 661.126246, "r": 465.558002, "b": 351.198838 }, "text": "Storage (cubic-feet)\n13,991\n14,322\n14,655\n14,991\n15,329\n15,670\n16,013\n16,358\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706", "attrs": { "row": 0, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 } ], "reading_order": 4 } ] }, { "document_id": 16592, "page": 80, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 27, "counts_by_type": { "footnote": 2, "header": 1, "heading": 1, "table": 2, "table_cell": 20, "text": 1 }, "build_ms": 6, "items": [ { "id": "p80.1", "order": 1, "type": "header", "bbox": { "l": 53.52, "t": 738.72, "r": 561.12, "b": 698.4 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 10-Year Rainfall=5.38\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 40", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p80.2", "order": 2, "type": "heading", "bbox": { "l": 162, "t": 687.6, "r": 450, "b": 672.72 }, "text": "Summary for Pond 149P: WQ Infiltration Basin #2", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p80.3", "order": 3, "type": "text", "bbox": { "l": 51.36, "t": 664.08, "r": 551.28, "b": 517.2 }, "text": "Inflow Area = 86,443 sf, 27.15% Impervious, Inflow Depth = 1.60\" for 10-Year event\nInflow = 2.42 cfs @ 12.13 hrs, Volume= 11,545 cf\nOutflow = 0.10 cfs @ 17.18 hrs, Volume= 11,545 cf, Atten= 96%, Lag= 303.1 min\nDiscarded = 0.10 cfs @ 17.18 hrs, Volume= 11,545 cf\nPrimary = 0.00 cfs @ 0.00 hrs, Volume= 0 cf\nRouted to Link 147L : POA\n\nRouting by Stor-Ind method, Time Span= 0.00-72.00 hrs, dt= 0.01 hrs\nPeak Elev= 92.89' @ 17.18 hrs Surf.Area= 3,987 sf Storage= 6,236 cf\n\nPlug-Flow detention time= 647.4 min calculated for 11,545 cf (100% of inflow)\nCenter-of-Mass det. time= 647.4 min (1,432.8 - 785.4 )", "attrs": { "block_label": "algorithm" }, "reading_order": 2 }, { "id": "p80.4", "order": 4, "type": "table", "bbox": { "l": 53.04, "t": 505.2, "r": 557.04, "b": 376.32 }, "text": "", "attrs": { "block_label": "table", "n_rows": 2, "n_cols": 5, "integrity": { "cells_checked": 8, "cells_flagged": 0 } }, "children": [ { "id": "p80.4.1", "order": 5, "type": "table_cell", "bbox": { "l": 54, "t": 503.142469, "r": 90.142207, "b": 477.257868 }, "text": "Volume\n#1", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p80.4.2", "order": 6, "type": "table_cell", "bbox": { "l": 120.355217, "t": 503.142469, "r": 148.95691, "b": 477.257868 }, "text": "Invert\n91.00'", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p80.4.3", "order": 7, "type": "table_cell", "bbox": { "l": 170.997811, "t": 503.142469, "r": 234.422951, "b": 477.257868 }, "text": "Avail.Storage\n13,818 cf", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p80.4.4", "order": 8, "type": "table_cell", "bbox": { "l": 246.044461, "t": 503.142469, "r": 502.944852, "b": 477.137889 }, "text": "Storage Description\nCustom Stage Data (Prismatic) Listed below (Recalc)", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p80.4.5", "order": 9, "type": "table_cell", "bbox": { "l": 57.360002, "t": 465.222448, "r": 101.273013, "b": 379.337871 }, "text": "Elevation\\n(feet)\n91.00\n92.00\n93.00\n94.00\n94.50", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p80.4.6", "order": 10, "type": "table_cell", "bbox": { "l": 140.447365, "t": 465.222448, "r": 185.72688, "b": 379.337871 }, "text": "Surf.Area\\n(sq-ft)\n2,628\n3,320\n4,067\n5,010\n5,438", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p80.4.7", "order": 11, "type": "table_cell", "bbox": { "l": 227.371027, "t": 465.222448, "r": 354.642567, "b": 379.337871 }, "text": "Inc.Store\\n(cubic-feet)\n0\n2,974\n3,694\n4,539\n2,612", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p80.4.8", "order": 12, "type": "table_cell", "bbox": { "l": 216.402998, "t": 465.222448, "r": 354.689052, "b": 379.337871 }, "text": "Cum.Store\\n(cubic-feet)\n0\n2,974\n6,668\n11,206\n13,818", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 7 } ], "reading_order": 3 }, { "id": "p80.5", "order": 13, "type": "table", "bbox": { "l": 52.08, "t": 367.92, "r": 556.32, "b": 278.88 }, "text": "", "attrs": { "block_label": "table", "n_rows": 3, "n_cols": 4, "integrity": { "cells_checked": 12, "cells_flagged": 0 } }, "children": [ { "id": "p80.5.1", "order": 14, "type": "table_cell", "bbox": { "l": 54, "t": 367.302451, "r": 86.679256, "b": 355.337871 }, "text": "Device", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p80.5.2", "order": 15, "type": "table_cell", "bbox": { "l": 98.407976, "t": 367.302451, "r": 135.030741, "b": 355.337871 }, "text": "Routing", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p80.5.3", "order": 16, "type": "table_cell", "bbox": { "l": 182.045624, "t": 367.302451, "r": 208.824841, "b": 355.337871 }, "text": "Invert", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p80.5.4", "order": 17, "type": "table_cell", "bbox": { "l": 220.650048, "t": 367.302451, "r": 290.014595, "b": 355.337871 }, "text": "Outlet Devices", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 3 }, { "id": "p80.5.5", "order": 18, "type": "table_cell", "bbox": { "l": 70.320002, "t": 353.382452, "r": 82.177372, "b": 341.417872 }, "text": "#1", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p80.5.6", "order": 19, "type": "table_cell", "bbox": { "l": 98.408891, "t": 353.382452, "r": 135.204992, "b": 341.417872 }, "text": "Primary", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p80.5.7", "order": 20, "type": "table_cell", "bbox": { "l": 354.69794, "t": 329.382452, "r": 383.299634, "b": 317.417872 }, "text": "93.80'", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p80.5.8", "order": 21, "type": "table_cell", "bbox": { "l": 220.679993, "t": 353.262472, "r": 512.979659, "b": 305.417872 }, "text": "6.0\" Round Culvert to Subsurface Basin\\nL= 35.0' RCP, square edge headwall, Ke= 0.500\\nInlet / Outlet Invert= 92.00' / 93.80' S= -0.0514'' Cc= 0.900\\nn= 0.012 Corrugated PP, smooth interior, Flow Area= 0.20 sf", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p80.5.9", "order": 22, "type": "table_cell", "bbox": { "l": 70.320002, "t": 305.382452, "r": 82.177372, "b": 281.417872 }, "text": "#2\n#3", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 8 }, { "id": "p80.5.10", "order": 23, "type": "table_cell", "bbox": { "l": 98.408891, "t": 305.382452, "r": 146.474595, "b": 281.417872 }, "text": "Device 1\nDiscarded", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 9 }, { "id": "p80.5.11", "order": 24, "type": "table_cell", "bbox": { "l": 180.288471, "t": 305.382452, "r": 208.918642, "b": 281.417872 }, "text": "93.00'\n91.00'", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 10 }, { "id": "p80.5.12", "order": 25, "type": "table_cell", "bbox": { "l": 220.679993, "t": 305.382452, "r": 531.965762, "b": 281.297892 }, "text": "4.0' long Sharp-Crested Rectangular Weir 2 End Contraction(s)\n1.050 in/hr Exfiltration over Surface area", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 11 } ], "reading_order": 4 }, { "id": "p80.6", "order": 26, "type": "footnote", "bbox": { "l": 51.12, "t": 269.76, "r": 429.12, "b": 244.32 }, "text": "Discarded OutFlow Max=0.10 cfs @ 17.18 hrs HW=92.89' (Free Discharge)\n3=Exfiltration (Exfiltration Controls 0.10 cfs)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 5 }, { "id": "p80.7", "order": 27, "type": "footnote", "bbox": { "l": 52.08, "t": 234, "r": 412.8, "b": 196.32 }, "text": "Primary OutFlow Max=0.00 cfs @ 0.00 hrs HW=91.00' (Free Discharge)\n1=Culvert to Subsurface Basin (Controls 0.00 cfs)\n2=Sharp-Crested Rectangular Weir (Controls 0.00 cfs)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 6 } ] }, { "document_id": 16592, "page": 81, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 7, "counts_by_type": { "caption": 1, "figure": 1, "footnote": 2, "header": 2, "text": 1 }, "build_ms": 0, "items": [ { "id": "p81.1", "order": 1, "type": "header", "bbox": { "l": 361.44, "t": 738.72, "r": 560.64, "b": 712.08 }, "text": "NOAA 24-hr D 10-Year Rainfall=5.38\"\nPrinted 04/12/2025", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p81.2", "order": 2, "type": "header", "bbox": { "l": 52.32, "t": 738, "r": 403.92, "b": 699.12 }, "text": "102 Sams -REV 12-02-25 NOAA 2\nPrepared by Haler Consulting\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p81.3", "order": 3, "type": "text", "bbox": { "l": 517.2, "t": 710.88, "r": 558.72, "b": 699.36 }, "text": "Page 41", "attrs": { "block_label": "number" }, "reading_order": 2 }, { "id": "p81.4", "order": 4, "type": "caption", "bbox": { "l": 201.12, "t": 687.6, "r": 410.64, "b": 672.96 }, "text": "Pond 149P: WQ Infiltration Basin #2", "attrs": { "block_label": "figure_title" }, "reading_order": 3 }, { "id": "p81.5", "order": 5, "type": "figure", "bbox": { "l": 65.28, "t": 668.16, "r": 486.48, "b": 417.6 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n2.42 cfs\nInflow Area=86,443 sf\nPeak Elev=92.89'\nStorage=6,236 cf\n2\n(cfs)\nFlow\n1\n0.10 cfs\n0.10 cfs\n0.00 cfs\n0" }, "reading_order": 4 }, { "id": "p81.6", "order": 6, "type": "footnote", "bbox": { "l": 83.04, "t": 420, "r": 449.52, "b": 400.8 }, "text": "0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72 Time (hours)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 5 }, { "id": "p81.7", "order": 7, "type": "footnote", "bbox": { "l": 497.04, "t": 644.88, "r": 547.2, "b": 610.08 }, "text": "Inflow Outflow Discarded Primary", "attrs": { "block_label": "vision_footnote" }, "reading_order": 6 } ] }, { "document_id": 16592, "page": 82, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 27, "counts_by_type": { "caption": 1, "header": 1, "table": 1, "table_cell": 24 }, "build_ms": 18, "items": [ { "id": "p82.1", "order": 1, "type": "header", "bbox": { "l": 52.8, "t": 738.48, "r": 561.6, "b": 698.64 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 10-Year Rainfall=5.38\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 42", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p82.2", "order": 2, "type": "caption", "bbox": { "l": 153.6, "t": 687.84, "r": 458.16, "b": 672.96 }, "text": "Stage-Discharge for Pond 149P: WQ Infiltration Basin #2", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p82.3", "order": 3, "type": "table", "bbox": { "l": 55.2, "t": 664.56, "r": 506.16, "b": 57.12 }, "text": "", "attrs": { "block_label": "table", "n_rows": 3, "n_cols": 8, "integrity": { "cells_checked": 16, "cells_flagged": 0 } }, "children": [ { "id": "p82.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 57.479999, "t": 661.126246, "r": 98.137287, "b": 108.31886299999996 }, "text": "Elevation (feet)\n91.00\n91.05\n91.10\n91.15\n91.20\n91.25\n91.30\n91.35\n91.40\n91.45\n91.50\n91.55\n91.60\n91.65\n91.70\n91.75\n91.80\n91.85\n91.90\n91.95\n92.00\n92.05\n92.10\n92.15\n92.20\n92.25\n92.30\n92.35\n92.40\n92.45\n92.50\n92.55\n92.60\n92.65\n92.70\n92.75\n92.80\n92.85\n92.90\n92.95\n93.00\n93.05\n93.10\n93.15\n93.20\n93.25\n93.30\n93.35", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p82.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 109.680004, "t": 661.126246, "r": 154.533694, "b": 108.31886299999996 }, "text": "Discharge (cfs)\n0.00\n0.06\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.08\n0.08\n0.08\n0.08\n0.08\n0.08\n0.08\n0.08\n0.08\n0.08\n0.08\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.11\n0.11", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p82.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 166.080002, "t": 661.126246, "r": 210.875583, "b": 108.31886299999996 }, "text": "Discarded (cfs)\n0.00\n0.06\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.08\n0.08\n0.08\n0.08\n0.08\n0.08\n0.08\n0.08\n0.08\n0.08\n0.08\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.11\n0.11", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p82.3.4", "order": 7, "type": "table_cell", "bbox": { "l": 233.160004, "t": 661.126246, "r": 267.536512, "b": 108.31886299999996 }, "text": "Primary (cfs)\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p82.3.5", "order": 8, "type": "table_cell", "bbox": { "l": 291, "t": 661.126246, "r": 331.657282, "b": 428.478844 }, "text": "Elevation (feet)\n93.60\n93.65\n93.70\n93.75\n93.80\n93.85\n93.90\n93.95\n94.00\n94.05\n94.10\n94.15\n94.20\n94.25\n94.30\n94.35\n94.40\n94.45\n94.50", "attrs": { "row": 0, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p82.3.6", "order": 9, "type": "table_cell", "bbox": { "l": 343.200005, "t": 661.126246, "r": 388.300713, "b": 428.478844 }, "text": "Discharge (cfs)\n0.11\n0.11\n0.11\n0.12\n0.12\n0.13\n0.15\n0.19\n0.23\n0.29\n0.35\n0.42\n0.49\n0.55\n0.60\n0.65\n0.69\n0.73\n0.77", "attrs": { "row": 0, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p82.3.7", "order": 10, "type": "table_cell", "bbox": { "l": 399.599991, "t": 661.126246, "r": 444.718503, "b": 428.478844 }, "text": "Discarded (cfs)\n0.11\n0.11\n0.11\n0.12\n0.12\n0.12\n0.12\n0.12\n0.12\n0.12\n0.12\n0.12\n0.13\n0.13\n0.13\n0.13\n0.13\n0.13\n0.13", "attrs": { "row": 0, "col": 6, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p82.3.8", "order": 11, "type": "table_cell", "bbox": { "l": 466.679993, "t": 661.126246, "r": 501.056501, "b": 428.478844 }, "text": "Primary (cfs)\n0.00\n0.00\n0.00\n0.00\n0.00\n0.01\n0.03\n0.07\n0.11\n0.17\n0.23\n0.30\n0.36\n0.43\n0.47\n0.52\n0.56\n0.60\n0.63", "attrs": { "row": 0, "col": 7, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 7 }, { "id": "p82.3.9", "order": 12, "type": "table_cell", "bbox": { "l": 73.320002, "t": 108.28622600000006, "r": 98.137287, "b": 75.19883800000002 }, "text": "93.40\n93.45\n93.50", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 8 }, { "id": "p82.3.10", "order": 13, "type": "table_cell", "bbox": { "l": 135.26256, "t": 97.24624900000003, "r": 154.533694, "b": 64.158859 }, "text": "0.11\n0.11\n0.11", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 9 }, { "id": "p82.3.11", "order": 14, "type": "table_cell", "bbox": { "l": 191.560334, "t": 97.24624900000003, "r": 210.875583, "b": 64.158859 }, "text": "0.11\n0.11\n0.11", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 10 }, { "id": "p82.3.12", "order": 15, "type": "table_cell", "bbox": { "l": 248.000856, "t": 97.24624900000003, "r": 267.196089, "b": 64.158859 }, "text": "0.00\n0.00\n0.00", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 11 }, { "id": "p82.3.13", "order": 16, "type": "table_cell", "bbox": { "l": 280.68, "t": 102.9645, "r": 337.05, "b": 91.5034 }, "text": "", "attrs": { "row": 1, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 12 }, { "id": "p82.3.14", "order": 17, "type": "table_cell", "bbox": { "l": 337.05, "t": 102.9645, "r": 393.42, "b": 91.5034 }, "text": "", "attrs": { "row": 1, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 13 }, { "id": "p82.3.15", "order": 18, "type": "table_cell", "bbox": { "l": 393.42, "t": 102.9645, "r": 449.79, "b": 91.5034 }, "text": "", "attrs": { "row": 1, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 14 }, { "id": "p82.3.16", "order": 19, "type": "table_cell", "bbox": { "l": 449.79, "t": 102.9645, "r": 506.16, "b": 91.5034 }, "text": "", "attrs": { "row": 1, "col": 7, "rowspan": 1, "colspan": 1 }, "reading_order": 15 }, { "id": "p82.3.17", "order": 20, "type": "table_cell", "bbox": { "l": 73.320002, "t": 75.166246, "r": 98.137287, "b": 64.158859 }, "text": "93.55", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p82.3.18", "order": 21, "type": "table_cell", "bbox": { "l": 135.26256, "t": 108.28622600000006, "r": 154.533694, "b": 97.27883899999995 }, "text": "0.11", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p82.3.19", "order": 22, "type": "table_cell", "bbox": { "l": 191.560334, "t": 108.28622600000006, "r": 210.875583, "b": 97.27883899999995 }, "text": "0.11", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p82.3.20", "order": 23, "type": "table_cell", "bbox": { "l": 248.000856, "t": 108.28622600000006, "r": 267.196089, "b": 97.27883899999995 }, "text": "0.00", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p82.3.21", "order": 24, "type": "table_cell", "bbox": { "l": 280.68, "t": 68.5811, "r": 337.05, "b": 57.12 }, "text": "", "attrs": { "row": 2, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 20 }, { "id": "p82.3.22", "order": 25, "type": "table_cell", "bbox": { "l": 337.05, "t": 68.5811, "r": 393.42, "b": 57.12 }, "text": "", "attrs": { "row": 2, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 21 }, { "id": "p82.3.23", "order": 26, "type": "table_cell", "bbox": { "l": 393.42, "t": 68.5811, "r": 449.79, "b": 57.12 }, "text": "", "attrs": { "row": 2, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 22 }, { "id": "p82.3.24", "order": 27, "type": "table_cell", "bbox": { "l": 449.79, "t": 68.5811, "r": 506.16, "b": 57.12 }, "text": "", "attrs": { "row": 2, "col": 7, "rowspan": 1, "colspan": 1 }, "reading_order": 23 } ], "reading_order": 2 } ] }, { "document_id": 16592, "page": 83, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 83, "counts_by_type": { "caption": 1, "header": 2, "table": 1, "table_cell": 78, "text": 1 }, "build_ms": 15, "items": [ { "id": "p83.1", "order": 1, "type": "header", "bbox": { "l": 361.44, "t": 739.2, "r": 561.6, "b": 713.04 }, "text": "NOAA 24-hr D 10-Year Rainfall=5.38\"\nPrinted 04/12/2025", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p83.2", "order": 2, "type": "header", "bbox": { "l": 51.84, "t": 738.48, "r": 396.48, "b": 698.88 }, "text": "102 Sams -REV 12-02-25\nPrepared by Haler Consulting\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p83.3", "order": 3, "type": "text", "bbox": { "l": 516.96, "t": 710.88, "r": 558.96, "b": 699.12 }, "text": "Page 43", "attrs": { "block_label": "number" }, "reading_order": 2 }, { "id": "p83.4", "order": 4, "type": "caption", "bbox": { "l": 145.92, "t": 687.84, "r": 466.08, "b": 672.96 }, "text": "Stage-Area-Storage for Pond 149P: WQ Infiltration Basin #2", "attrs": { "block_label": "figure_title" }, "reading_order": 3 }, { "id": "p83.5", "order": 5, "type": "table", "bbox": { "l": 54.48, "t": 665.28, "r": 465.558002, "b": 52.08 }, "text": "", "attrs": { "block_label": "table", "n_rows": 13, "n_cols": 6, "integrity": { "cells_checked": 78, "cells_flagged": 7, "flags": [ { "row": 1, "col": 5, "coverage": 0, "text": "9,271" }, { "row": 3, "col": 5, "coverage": 0, "text": "10,468" }, { "row": 5, "col": 5, "coverage": 0, "text": "10,953" }, { "row": 6, "col": 5, "coverage": 0, "text": "11,200" }, { "row": 8, "col": 5, "coverage": 0, "text": "11,717" }, { "row": 10, "col": 5, "coverage": 0, "text": "12,223" }, { "row": 11, "col": 5, "coverage": 0, "text": "12,488" } ] } }, "children": [ { "id": "p83.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 57.479999, "t": 661.126246, "r": 98.089591, "b": 639.078858 }, "text": "Elevation (feet)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p83.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 139.439999, "t": 661.126246, "r": 173.816353, "b": 639.078858 }, "text": "Surface (sq-ft)", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p83.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 199.55999, "t": 661.126246, "r": 249.511546, "b": 639.078858 }, "text": "Storage (cubic-feet)", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p83.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 273.240005, "t": 661.126246, "r": 313.84958, "b": 639.078858 }, "text": "Elevation (feet)", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 3 }, { "id": "p83.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 355.200005, "t": 661.126246, "r": 389.576359, "b": 639.078858 }, "text": "Surface (sq-ft)", "attrs": { "row": 0, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 4 }, { "id": "p83.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 415.320008, "t": 661.126246, "r": 465.271564, "b": 639.078858 }, "text": "Storage (cubic-feet)", "attrs": { "row": 0, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 5 }, { "id": "p83.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 73.320002, "t": 638.206236, "r": 98.137287, "b": 627.198849 }, "text": "91.00", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p83.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 148.972477, "t": 638.206236, "r": 173.773196, "b": 627.198849 }, "text": "2,628", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p83.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 244.038989, "t": 638.206236, "r": 249.522956, "b": 627.198849 }, "text": "0", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p83.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 289.080002, "t": 638.206236, "r": 313.897287, "b": 627.198849 }, "text": "93.60", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p83.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 364.732477, "t": 638.206236, "r": 389.533196, "b": 627.198849 }, "text": "4,633", "attrs": { "row": 1, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p83.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 393.68, "t": 653.7102, "r": 461.52, "b": 642.1404 }, "text": "9,271", "attrs": { "row": 1, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 11 }, { "id": "p83.5.13", "order": 18, "type": "table_cell", "bbox": { "l": 73.320002, "t": 627.166246, "r": 98.137287, "b": 583.038857 }, "text": "91.05\n91.10\n91.15\n91.20", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 12 }, { "id": "p83.5.14", "order": 19, "type": "table_cell", "bbox": { "l": 148.972477, "t": 627.166246, "r": 173.773196, "b": 583.038857 }, "text": "2,663\n2,697\n2,732\n2,766", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 13 }, { "id": "p83.5.15", "order": 20, "type": "table_cell", "bbox": { "l": 232.992149, "t": 627.166246, "r": 249.447055, "b": 583.038857 }, "text": "132\n266\n402\n539", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 14 }, { "id": "p83.5.16", "order": 21, "type": "table_cell", "bbox": { "l": 289.080002, "t": 627.166246, "r": 313.897287, "b": 583.038857 }, "text": "93.65\n93.70\n93.75\n93.80", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 15 }, { "id": "p83.5.17", "order": 22, "type": "table_cell", "bbox": { "l": 364.732477, "t": 627.166246, "r": 389.533196, "b": 583.038857 }, "text": "4,680\n4,727\n4,774\n4,821", "attrs": { "row": 2, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 16 }, { "id": "p83.5.18", "order": 23, "type": "table_cell", "bbox": { "l": 434.943599, "t": 627.166246, "r": 465.284304, "b": 583.038857 }, "text": "9,510\n9,745\n9,983\n10,223", "attrs": { "row": 2, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 17 }, { "id": "p83.5.19", "order": 24, "type": "table_cell", "bbox": { "l": 73.320002, "t": 583.006243, "r": 98.137287, "b": 571.9988559999999 }, "text": "91.25", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p83.5.20", "order": 25, "type": "table_cell", "bbox": { "l": 148.972477, "t": 583.006243, "r": 173.773196, "b": 571.9988559999999 }, "text": "2,801", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p83.5.21", "order": 26, "type": "table_cell", "bbox": { "l": 232.992149, "t": 583.006243, "r": 249.447055, "b": 571.9988559999999 }, "text": "679", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p83.5.22", "order": 27, "type": "table_cell", "bbox": { "l": 289.080002, "t": 583.006243, "r": 313.897287, "b": 571.9988559999999 }, "text": "93.85", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p83.5.23", "order": 28, "type": "table_cell", "bbox": { "l": 364.732477, "t": 583.006243, "r": 389.533196, "b": 571.9988559999999 }, "text": "4,869", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 22 }, { "id": "p83.5.24", "order": 29, "type": "table_cell", "bbox": { "l": 393.68, "t": 595.8611, "r": 461.52, "b": 584.2913 }, "text": "10,468", "attrs": { "row": 3, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 23 }, { "id": "p83.5.25", "order": 30, "type": "table_cell", "bbox": { "l": 73.320002, "t": 571.966242, "r": 98.137287, "b": 560.958855 }, "text": "91.30", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 24 }, { "id": "p83.5.26", "order": 31, "type": "table_cell", "bbox": { "l": 148.972477, "t": 571.966242, "r": 173.773196, "b": 560.958855 }, "text": "2,836", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 25 }, { "id": "p83.5.27", "order": 32, "type": "table_cell", "bbox": { "l": 232.992149, "t": 571.966242, "r": 249.447055, "b": 560.958855 }, "text": "820", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 26 }, { "id": "p83.5.28", "order": 33, "type": "table_cell", "bbox": { "l": 289.080002, "t": 571.966242, "r": 313.897287, "b": 560.958855 }, "text": "93.90", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 27 }, { "id": "p83.5.29", "order": 34, "type": "table_cell", "bbox": { "l": 364.732477, "t": 571.966242, "r": 389.533196, "b": 560.958855 }, "text": "4,916", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 28 }, { "id": "p83.5.30", "order": 35, "type": "table_cell", "bbox": { "l": 434.943599, "t": 571.966242, "r": 465.246354, "b": 560.958855 }, "text": "10,710", "attrs": { "row": 4, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 29 }, { "id": "p83.5.31", "order": 36, "type": "table_cell", "bbox": { "l": 73.320002, "t": 560.926241, "r": 98.137287, "b": 549.918854 }, "text": "91.35", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 30 }, { "id": "p83.5.32", "order": 37, "type": "table_cell", "bbox": { "l": 148.972477, "t": 560.926241, "r": 173.773196, "b": 549.918854 }, "text": "2,870", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 31 }, { "id": "p83.5.33", "order": 38, "type": "table_cell", "bbox": { "l": 232.992149, "t": 560.926241, "r": 249.447055, "b": 549.918854 }, "text": "962", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 32 }, { "id": "p83.5.34", "order": 39, "type": "table_cell", "bbox": { "l": 289.080002, "t": 560.926241, "r": 313.897287, "b": 549.918854 }, "text": "93.95", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 33 }, { "id": "p83.5.35", "order": 40, "type": "table_cell", "bbox": { "l": 364.732477, "t": 560.926241, "r": 389.533196, "b": 549.918854 }, "text": "4,963", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 34 }, { "id": "p83.5.36", "order": 41, "type": "table_cell", "bbox": { "l": 393.68, "t": 572.7215, "r": 461.52, "b": 561.1517 }, "text": "10,953", "attrs": { "row": 5, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 35 }, { "id": "p83.5.37", "order": 42, "type": "table_cell", "bbox": { "l": 73.320002, "t": 549.88624, "r": 98.137287, "b": 538.8788529999999 }, "text": "91.40", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 36 }, { "id": "p83.5.38", "order": 43, "type": "table_cell", "bbox": { "l": 148.972477, "t": 549.88624, "r": 173.773196, "b": 538.8788529999999 }, "text": "2,905", "attrs": { "row": 6, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 37 }, { "id": "p83.5.39", "order": 44, "type": "table_cell", "bbox": { "l": 224.707019, "t": 549.88624, "r": 249.524304, "b": 538.8788529999999 }, "text": "1,107", "attrs": { "row": 6, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 38 }, { "id": "p83.5.40", "order": 45, "type": "table_cell", "bbox": { "l": 289.080002, "t": 549.88624, "r": 313.897287, "b": 538.8788529999999 }, "text": "94.00", "attrs": { "row": 6, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 39 }, { "id": "p83.5.41", "order": 46, "type": "table_cell", "bbox": { "l": 364.732477, "t": 549.88624, "r": 389.533196, "b": 538.8788529999999 }, "text": "5,010", "attrs": { "row": 6, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 40 }, { "id": "p83.5.42", "order": 47, "type": "table_cell", "bbox": { "l": 393.68, "t": 561.1517, "r": 461.52, "b": 549.5819 }, "text": "11,200", "attrs": { "row": 6, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 41 }, { "id": "p83.5.43", "order": 48, "type": "table_cell", "bbox": { "l": 73.320002, "t": 538.84624, "r": 98.137287, "b": 527.838853 }, "text": "91.45", "attrs": { "row": 7, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 42 }, { "id": "p83.5.44", "order": 49, "type": "table_cell", "bbox": { "l": 148.972477, "t": 538.84624, "r": 173.773196, "b": 527.838853 }, "text": "2,939", "attrs": { "row": 7, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 43 }, { "id": "p83.5.45", "order": 50, "type": "table_cell", "bbox": { "l": 224.707019, "t": 538.84624, "r": 249.524304, "b": 527.838853 }, "text": "1,253", "attrs": { "row": 7, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 44 }, { "id": "p83.5.46", "order": 51, "type": "table_cell", "bbox": { "l": 289.080002, "t": 538.84624, "r": 313.897287, "b": 527.838853 }, "text": "94.05", "attrs": { "row": 7, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 45 }, { "id": "p83.5.47", "order": 52, "type": "table_cell", "bbox": { "l": 364.732477, "t": 538.84624, "r": 389.533196, "b": 527.838853 }, "text": "5,053", "attrs": { "row": 7, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 46 }, { "id": "p83.5.48", "order": 53, "type": "table_cell", "bbox": { "l": 434.943599, "t": 538.84624, "r": 465.246354, "b": 527.838853 }, "text": "11,458", "attrs": { "row": 7, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 47 }, { "id": "p83.5.49", "order": 54, "type": "table_cell", "bbox": { "l": 73.320002, "t": 527.806238, "r": 98.137287, "b": 516.798851 }, "text": "91.50", "attrs": { "row": 8, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 48 }, { "id": "p83.5.50", "order": 55, "type": "table_cell", "bbox": { "l": 148.972477, "t": 527.806238, "r": 173.773196, "b": 516.798851 }, "text": "2,974", "attrs": { "row": 8, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 49 }, { "id": "p83.5.51", "order": 56, "type": "table_cell", "bbox": { "l": 224.707019, "t": 527.806238, "r": 249.524304, "b": 516.798851 }, "text": "1,401", "attrs": { "row": 8, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 50 }, { "id": "p83.5.52", "order": 57, "type": "table_cell", "bbox": { "l": 289.080002, "t": 527.806238, "r": 313.897287, "b": 516.798851 }, "text": "94.10", "attrs": { "row": 8, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 51 }, { "id": "p83.5.53", "order": 58, "type": "table_cell", "bbox": { "l": 364.732477, "t": 527.806238, "r": 389.533196, "b": 516.798851 }, "text": "5,096", "attrs": { "row": 8, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 52 }, { "id": "p83.5.54", "order": 59, "type": "table_cell", "bbox": { "l": 393.68, "t": 538.0121, "r": 461.52, "b": 526.4423 }, "text": "11,717", "attrs": { "row": 8, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 53 }, { "id": "p83.5.55", "order": 60, "type": "table_cell", "bbox": { "l": 73.320002, "t": 516.766237, "r": 98.137287, "b": 505.75885 }, "text": "91.55", "attrs": { "row": 9, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 54 }, { "id": "p83.5.56", "order": 61, "type": "table_cell", "bbox": { "l": 148.972477, "t": 516.766237, "r": 173.773196, "b": 505.75885 }, "text": "3,009", "attrs": { "row": 9, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 55 }, { "id": "p83.5.57", "order": 62, "type": "table_cell", "bbox": { "l": 224.707019, "t": 516.766237, "r": 249.524304, "b": 505.75885 }, "text": "1,550", "attrs": { "row": 9, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 56 }, { "id": "p83.5.58", "order": 63, "type": "table_cell", "bbox": { "l": 289.080002, "t": 516.766237, "r": 313.897287, "b": 505.75885 }, "text": "94.15", "attrs": { "row": 9, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 57 }, { "id": "p83.5.59", "order": 64, "type": "table_cell", "bbox": { "l": 364.732477, "t": 516.766237, "r": 389.533196, "b": 505.75885 }, "text": "5,138", "attrs": { "row": 9, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 58 }, { "id": "p83.5.60", "order": 65, "type": "table_cell", "bbox": { "l": 434.943599, "t": 516.766237, "r": 465.246354, "b": 505.75885 }, "text": "11,967", "attrs": { "row": 9, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 59 }, { "id": "p83.5.61", "order": 66, "type": "table_cell", "bbox": { "l": 73.320002, "t": 505.726237, "r": 98.137287, "b": 494.71885 }, "text": "91.60", "attrs": { "row": 10, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 60 }, { "id": "p83.5.62", "order": 67, "type": "table_cell", "bbox": { "l": 148.972477, "t": 505.726237, "r": 173.773196, "b": 494.71885 }, "text": "3,043", "attrs": { "row": 10, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 61 }, { "id": "p83.5.63", "order": 68, "type": "table_cell", "bbox": { "l": 224.707019, "t": 505.726237, "r": 249.524304, "b": 494.71885 }, "text": "1,701", "attrs": { "row": 10, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 62 }, { "id": "p83.5.64", "order": 69, "type": "table_cell", "bbox": { "l": 289.080002, "t": 505.726237, "r": 313.897287, "b": 494.71885 }, "text": "94.20", "attrs": { "row": 10, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 63 }, { "id": "p83.5.65", "order": 70, "type": "table_cell", "bbox": { "l": 364.732477, "t": 505.726237, "r": 389.533196, "b": 494.71885 }, "text": "5,181", "attrs": { "row": 10, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 64 }, { "id": "p83.5.66", "order": 71, "type": "table_cell", "bbox": { "l": 393.68, "t": 514.8725, "r": 461.52, "b": 503.3026 }, "text": "12,223", "attrs": { "row": 10, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 65 }, { "id": "p83.5.67", "order": 72, "type": "table_cell", "bbox": { "l": 73.320002, "t": 494.686236, "r": 98.137287, "b": 483.678849 }, "text": "91.65", "attrs": { "row": 11, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 66 }, { "id": "p83.5.68", "order": 73, "type": "table_cell", "bbox": { "l": 148.972477, "t": 494.686236, "r": 173.773196, "b": 483.678849 }, "text": "3,078", "attrs": { "row": 11, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 67 }, { "id": "p83.5.69", "order": 74, "type": "table_cell", "bbox": { "l": 224.707019, "t": 494.686236, "r": 249.524304, "b": 483.678849 }, "text": "1,854", "attrs": { "row": 11, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 68 }, { "id": "p83.5.70", "order": 75, "type": "table_cell", "bbox": { "l": 289.080002, "t": 494.686236, "r": 313.897287, "b": 483.678849 }, "text": "94.25", "attrs": { "row": 11, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 69 }, { "id": "p83.5.71", "order": 76, "type": "table_cell", "bbox": { "l": 364.732477, "t": 494.686236, "r": 389.533196, "b": 483.678849 }, "text": "5,224", "attrs": { "row": 11, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 70 }, { "id": "p83.5.72", "order": 77, "type": "table_cell", "bbox": { "l": 393.68, "t": 503.3026, "r": 461.52, "b": 491.7328 }, "text": "12,488", "attrs": { "row": 11, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 71 }, { "id": "p83.5.73", "order": 78, "type": "table_cell", "bbox": { "l": 73.320002, "t": 483.646234, "r": 98.137287, "b": 64.158859 }, "text": "91.70\n91.75\n91.80\n91.85\n91.90\n91.95\n92.00\n92.05\n92.10\n92.15\n92.20\n92.25\n92.30\n92.35\n92.40\n92.45\n92.50\n92.55\n92.60\n92.65\n92.70\n92.75\n92.80\n92.85\n92.90\n92.95\n93.00\n93.05\n93.10\n93.15\n93.20\n93.25\n93.30\n93.35\n93.40\n93.45\n93.50\n93.55", "attrs": { "row": 12, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 72 }, { "id": "p83.5.74", "order": 79, "type": "table_cell", "bbox": { "l": 148.972477, "t": 483.646234, "r": 173.773196, "b": 64.158859 }, "text": "3,112\n3,147\n3,182\n3,216\n3,251\n3,285\n3,320\n3,357\n3,395\n3,432\n3,469\n3,507\n3,544\n3,581\n3,619\n3,656\n3,694\n3,731\n3,768\n3,806\n3,843\n3,880\n3,918\n3,955\n3,992\n4,030\n4,067\n4,114\n4,161\n4,208\n4,256\n4,303\n4,350\n4,397\n4,444\n4,491\n4,539\n4,586", "attrs": { "row": 12, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 73 }, { "id": "p83.5.75", "order": 80, "type": "table_cell", "bbox": { "l": 224.707019, "t": 483.646234, "r": 249.524304, "b": 64.158859 }, "text": "2,009\n2,166\n2,324\n2,484\n2,645\n2,809\n2,974\n3,141\n3,310\n3,480\n3,653\n3,827\n4,004\n4,182\n4,362\n4,544\n4,727\n4,913\n5,100\n5,290\n5,481\n5,674\n5,869\n6,066\n6,265\n6,465\n6,668\n6,872\n7,079\n7,288\n7,500\n7,714\n7,930\n8,149\n8,370\n8,593\n8,819\n9,047", "attrs": { "row": 12, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 74 }, { "id": "p83.5.76", "order": 81, "type": "table_cell", "bbox": { "l": 289.080002, "t": 483.646234, "r": 313.897287, "b": 428.478844 }, "text": "94.30\n94.35\n94.40\n94.45\n94.50", "attrs": { "row": 12, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 75 }, { "id": "p83.5.77", "order": 82, "type": "table_cell", "bbox": { "l": 364.732477, "t": 483.646234, "r": 389.808242, "b": 428.478844 }, "text": "5,267\n5,310\n5,352\n5,395\n5,438", "attrs": { "row": 12, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 76 }, { "id": "p83.5.78", "order": 83, "type": "table_cell", "bbox": { "l": 434.943599, "t": 483.646234, "r": 465.558002, "b": 428.478844 }, "text": "12,748\n13,012\n13,278\n13,547\n13,818", "attrs": { "row": 12, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 77 } ], "reading_order": 4 } ] }, { "document_id": 16592, "page": 84, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 10, "counts_by_type": { "caption": 2, "figure": 1, "footer": 1, "header": 2, "heading": 1, "text": 3 }, "build_ms": 1, "items": [ { "id": "p84.1", "order": 1, "type": "header", "bbox": { "l": 360.96, "t": 738.96, "r": 560.88, "b": 712.08 }, "text": "NOAA 24-hr D 10-Year Rainfall=5.38\"\nPrinted 04/12/2025", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p84.2", "order": 2, "type": "header", "bbox": { "l": 52.8, "t": 738, "r": 393.36, "b": 699.6 }, "text": "102 Sams -REV 12-02-25 NOAA\nPrepared by Haler Consulting\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p84.3", "order": 3, "type": "text", "bbox": { "l": 517.2, "t": 710.88, "r": 558.72, "b": 699.36 }, "text": "Page 44", "attrs": { "block_label": "number" }, "reading_order": 2 }, { "id": "p84.4", "order": 4, "type": "heading", "bbox": { "l": 221.04, "t": 687.6, "r": 392.16, "b": 672.48 }, "text": "Summary for Link 147L: POA", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 3 }, { "id": "p84.5", "order": 5, "type": "text", "bbox": { "l": 52.32, "t": 659.76, "r": 516, "b": 622.08 }, "text": "Inflow Area = 536,539 sf, 11.25% Impervious, Inflow Depth = 0.10\" for 10-Year event\nInflow = 0.67 cfs @ 12.10 hrs, Volume= 4,506 cf\nPrimary = 0.67 cfs @ 12.10 hrs, Volume= 4,506 cf, Atten=0%, Lag=0.0 min", "reading_order": 4 }, { "id": "p84.6", "order": 6, "type": "text", "bbox": { "l": 52.08, "t": 611.52, "r": 367.2, "b": 597.84 }, "text": "Primary outflow = Inflow, Time Span = 0.00-72.00 hrs, dt = 0.01 hrs", "reading_order": 5 }, { "id": "p84.7", "order": 7, "type": "caption", "bbox": { "l": 259.44, "t": 586.32, "r": 352.56, "b": 572.64 }, "text": "Link 147L: POA", "attrs": { "block_label": "figure_title" }, "reading_order": 6 }, { "id": "p84.8", "order": 8, "type": "caption", "bbox": { "l": 252.72, "t": 566.64, "r": 303.6, "b": 555.6 }, "text": "Hydrograph", "attrs": { "block_label": "figure_title" }, "reading_order": 7 }, { "id": "p84.9", "order": 9, "type": "figure", "bbox": { "l": 64.56, "t": 563.52, "r": 499.92, "b": 301.2 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n0.75 0.67 cfs\nInflow Area=536,539 sf\n0.7 0.67 cfs\n0.65\n0.6\n0.55\n0.5\n0.45\n(cfs) 0.4\nFlow\n0.35\n0.3\n0.25\n0.2\n0.15\n0.1\n0.05\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72\nTime (hours)" }, "reading_order": 8 }, { "id": "p84.10", "order": 10, "type": "footer", "bbox": { "l": 505.92, "t": 545.04, "r": 546.96, "b": 525.36 }, "text": "", "attrs": { "block_label": "footer_image" }, "reading_order": 9 } ] }, { "document_id": 16592, "page": 85, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 2, "counts_by_type": { "text": 2 }, "build_ms": 1, "items": [ { "id": "p85.1", "order": 1, "type": "text", "bbox": { "l": 51.12, "t": 739.2, "r": 561.12, "b": 699.12 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 100-Year Rainfall=9.48\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 45", "reading_order": 0 }, { "id": "p85.2", "order": 2, "type": "text", "bbox": { "l": 50.16, "t": 688.8, "r": 561.12, "b": 216.96 }, "text": "Time span=0.00-72.00 hrs, dt=0.01 hrs, 7201 points\nRunoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious\nReach routing by Stor-Ind+Trans method - Pond routing by Stor-Ind method\n\nSubcatchment 141S: DA P1 (Impervious) Runoff Area=31,625 sf 100.00% Impervious Runoff Depth=9.24\"\nFlow Length=450' Tc=3.0 min CN=0/98 Runoff=6.54 cfs 24,350 cf\n\nSubcatchment 143S: DA P2 (Impervious) Runoff Area=23,470 sf 100.00% Impervious Runoff Depth=9.24\"\nFlow Length=450' Tc=4.9 min CN=0/98 Runoff=4.27 cfs 18,071 cf\n\nSubcatchment 145S: DA P5 (4000 SF Roof) Runoff Area=4,000 sf 0.00% Impervious Runoff Depth=9.24\"\nTc=6.0 min CN=98/0 Runoff=0.68 cfs 3,080 cf\n\nSubcatchment 148S: DA P3 (Pervious) Runoff Area=62,973 sf 0.00% Impervious Runoff Depth=1.83\"\nFlow Length=316' Slope=0.0200 /' Tc=13.1 min CN=39/0 Runoff=1.31 cfs 9,627 cf\n\nSubcatchment 149S: DA P0 Pervious Runoff Area=336,250 sf 0.00% Impervious Runoff Depth=1.14\"\nFlow Length=679' Tc=49.8 min CN=33/0 Runoff=1.65 cfs 31,994 cf\n\nSubcatchment 150S: DA P4 (Pervious) Runoff Area=76,971 sf 0.00% Impervious Runoff Depth=1.83\"\nFlow Length=196' Slope=0.0100 /' Tc=14.8 min CN=39/0 Runoff=1.50 cfs 11,767 cf\n\nSubcatchment 172S: DA P6 (Impervious) Runoff Area=5,250 sf 100.00% Impervious Runoff Depth=9.24\"\nFlow Length=150' Tc=1.4 min CN=0/98 Runoff=1.19 cfs 4,042 cf\n\nPond 130P: SUBSURFACE Peak Elevation=4.98' Storage=1,335 cfs Runoff=0.68 cfs 3,080 cf\nOutflow=0.04 cfs 3,080 cf\n\nPond 144P: WQ Infiltration Basin #1 Peak Elevation=97.79' Storage=15,241 cfs Runoff=7.21 cfs 36,117 cf\nDiscarded=0.49 cfs 34,901 cf Primary=0.17 cfs 1,215 cfs Outflow=0.66 cfs 36,117 cf\n\nPond 149P: WQ Infiltration Basin #2 Peak Elevation=94.41' Storage=13,337 cfs Runoff=5.06 cfs 27,698 cf\nDiscarded=0.13 cfs 18,586 cfs Primary=0.57 cfs 9,111 cfs Outflow=0.70 cfs 27,698 cf\n\nLink 147L: POA Runoff Volume = 102,930 cfs Average Runoff Depth = 2.29\"\n88.84% Pervious = 480,194 cfs Runoff Depth = 11.16% Impervious = 60,345 cfs", "attrs": { "block_label": "algorithm" }, "reading_order": 1 } ] }, { "document_id": 16592, "page": 86, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 32, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "table": 1, "table_cell": 24, "text": 3, "title": 1 }, "build_ms": 3, "items": [ { "id": "p86.1", "order": 1, "type": "header", "bbox": { "l": 53.28, "t": 738.48, "r": 560.64, "b": 698.64 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 100-Year Rainfall=9.48\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 46", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p86.2", "order": 2, "type": "title", "bbox": { "l": 148.08, "t": 687.36, "r": 463.92, "b": 672.24 }, "text": "Summary for Subcatchment 141S: DA P1 (Impervious)", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p86.3", "order": 3, "type": "text", "bbox": { "l": 53.76, "t": 660.48, "r": 463.68, "b": 634.32 }, "text": "Runoff = 6.54 cfs @ 12.11 hrs, Volume= 24,350 cf, Depth= 9.24\"\nRouted to Pond 144P : WQ Infiltration Basin #1", "reading_order": 2 }, { "id": "p86.4", "order": 4, "type": "text", "bbox": { "l": 52.08, "t": 623.76, "r": 611.04, "b": 598.08 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious, Time Span= 0.00-72.00 hrs, dt= NOAA 24-hr D 100-Year Rainfall=9.48\"", "reading_order": 3 }, { "id": "p86.5", "order": 5, "type": "table", "bbox": { "l": 52.56, "t": 588.48, "r": 559.2, "b": 447.497874 }, "text": "", "attrs": { "block_label": "table", "n_rows": 6, "n_cols": 5, "integrity": { "cells_checked": 22, "cells_flagged": 0 } }, "children": [ { "id": "p86.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 86.520001, "t": 587.142469, "r": 127.590159, "b": 575.177889 }, "text": "Area (sf)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p86.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 144.389888, "t": 587.142469, "r": 159.742288, "b": 575.177889 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p86.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 286.601768, "t": 535.302451, "r": 340.102911, "b": 523.337871 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p86.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 95.280001, "t": 559.302451, "r": 127.805562, "b": 547.337871 }, "text": "31,625", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 3 }, { "id": "p86.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 148.003832, "t": 559.302451, "r": 159.753993, "b": 547.337871 }, "text": "98", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p86.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 174.16295, "t": 573.222448, "r": 281.259838, "b": 561.257868 }, "text": "Paved parking, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 5 }, { "id": "p86.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 95.280001, "t": 573.222448, "r": 127.805562, "b": 561.257868 }, "text": "31,625", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p86.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 148.003832, "t": 573.222448, "r": 159.753993, "b": 561.257868 }, "text": "98", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p86.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 174.16295, "t": 559.302451, "r": 296.664294, "b": 547.337871 }, "text": "100.00% Impervious Area", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 8 }, { "id": "p86.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 65.040001, "t": 535.302451, "r": 89.475992, "b": 497.417872 }, "text": "Tc (min)\n1.2", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 9 }, { "id": "p86.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 100.248415, "t": 535.302451, "r": 132.68142, "b": 497.417872 }, "text": "Length (feet)\n100", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 10 }, { "id": "p86.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 143.445254, "t": 535.302451, "r": 175.895438, "b": 497.417872 }, "text": "Slope (ft/ft)\n0.0200", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 11 }, { "id": "p86.5.13", "order": 18, "type": "table_cell", "bbox": { "l": 186.552062, "t": 535.302451, "r": 223.968178, "b": 497.417872 }, "text": "Velocity (ft/sec)\n1.42", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 12 }, { "id": "p86.5.14", "order": 19, "type": "table_cell", "bbox": { "l": 234.581918, "t": 535.302451, "r": 473.002733, "b": 485.417872 }, "text": "Capacity (cfs)\nSheet Flow, Smooth surfaces n= 0.011 P2= 3.42\"", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 13 }, { "id": "p86.5.15", "order": 20, "type": "table_cell", "bbox": { "l": 74.639998, "t": 485.382452, "r": 89.475992, "b": 473.417872 }, "text": "1.8", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p86.5.16", "order": 21, "type": "table_cell", "bbox": { "l": 114.927527, "t": 485.382452, "r": 132.68142, "b": 473.417872 }, "text": "350", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p86.5.17", "order": 22, "type": "table_cell", "bbox": { "l": 143.445254, "t": 485.382452, "r": 175.863606, "b": 473.417872 }, "text": "0.0250", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p86.5.18", "order": 23, "type": "table_cell", "bbox": { "l": 203.137703, "t": 485.382452, "r": 223.870219, "b": 473.417872 }, "text": "3.21", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p86.5.19", "order": 24, "type": "table_cell", "bbox": { "l": 286.679993, "t": 485.26245, "r": 425.623588, "b": 461.417872 }, "text": "Shallow Concentrated Flow, Paved Kv= 20.3 fps", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p86.5.20", "order": 25, "type": "table_cell", "bbox": { "l": 74.639998, "t": 459.462454, "r": 89.475992, "b": 447.497874 }, "text": "3.0", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p86.5.21", "order": 26, "type": "table_cell", "bbox": { "l": 114.927527, "t": 459.462454, "r": 132.68142, "b": 447.497874 }, "text": "450", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p86.5.22", "order": 27, "type": "table_cell", "bbox": { "l": 143.445254, "t": 459.462454, "r": 167.029543, "b": 447.497874 }, "text": "Total", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p86.5.23", "order": 28, "type": "table_cell", "bbox": { "l": 356.544, "t": 470.6057, "r": 457.872, "b": 450.96 }, "text": "", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 22 }, { "id": "p86.5.24", "order": 29, "type": "table_cell", "bbox": { "l": 457.872, "t": 470.6057, "r": 559.2, "b": 450.96 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 23 } ], "reading_order": 4 }, { "id": "p86.6", "order": 30, "type": "caption", "bbox": { "l": 186.72, "t": 435.12, "r": 424.8, "b": 420 }, "text": "Subcatchment 141S: DA P1 (Impervious)", "attrs": { "block_label": "figure_title" }, "reading_order": 5 }, { "id": "p86.7", "order": 31, "type": "figure", "bbox": { "l": 60.96, "t": 415.92, "r": 552.48, "b": 149.76 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nRunoff\n7\n6.54 cfs\nNOAA 24-hr D\n6\n100-Year Rainfall=9.48\"\n5 Runoff Area=31,625 sf\nRunoff Volume=24,350 cf\n(cfs) 4 Runoff Depth=9.24\"\nFlow Flow Length=450'\n3\nTc=3.0 min\n2 CN=0/98\n1\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72\nTime (hours)" }, "reading_order": 6 }, { "id": "p86.8", "order": 32, "type": "text", "bbox": { "l": 265.44, "t": 155.76, "r": 312.96, "b": 147.12 }, "text": "Time (hours)", "attrs": { "block_label": "number" }, "reading_order": 7 } ] }, { "document_id": 16592, "page": 87, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 34, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "table": 1, "table_cell": 24, "text": 5, "title": 1 }, "build_ms": 4, "items": [ { "id": "p87.1", "order": 1, "type": "header", "bbox": { "l": 53.04, "t": 738.48, "r": 560.64, "b": 698.64 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 100-Year Rainfall=9.48\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 47", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p87.2", "order": 2, "type": "title", "bbox": { "l": 148.08, "t": 687.6, "r": 463.92, "b": 672.24 }, "text": "Summary for Subcatchment 143S: DA P2 (Impervious)", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p87.3", "order": 3, "type": "text", "bbox": { "l": 52.08, "t": 659.76, "r": 303.84, "b": 647.04 }, "text": "Runoff = 4.27 cfs @ 12.13 hrs, Volume=18,071 cf, Depth= 9.24\"", "reading_order": 2 }, { "id": "p87.4", "order": 4, "type": "text", "bbox": { "l": 66.24, "t": 647.28, "r": 294.96, "b": 634.32 }, "text": "Routed to Pond 149P : WQ Infiltration Basin #2", "reading_order": 3 }, { "id": "p87.5", "order": 5, "type": "text", "bbox": { "l": 342.24, "t": 660, "r": 463.2, "b": 646.56 }, "text": "18,071 cf, Depth= 9.24\"", "reading_order": 4 }, { "id": "p87.6", "order": 6, "type": "text", "bbox": { "l": 52.08, "t": 623.76, "r": 611.04, "b": 598.32 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious, Time Span= 0.00-72.00 hrs, dt= NOAA 24-hr D 100-Year Rainfall=9.48\"", "reading_order": 5 }, { "id": "p87.7", "order": 7, "type": "table", "bbox": { "l": 52.56, "t": 588.48, "r": 558.96, "b": 447.497874 }, "text": "", "attrs": { "block_label": "table", "n_rows": 6, "n_cols": 5, "integrity": { "cells_checked": 22, "cells_flagged": 0 } }, "children": [ { "id": "p87.7.1", "order": 8, "type": "table_cell", "bbox": { "l": 86.520001, "t": 587.142469, "r": 127.590159, "b": 575.177889 }, "text": "Area (sf)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p87.7.2", "order": 9, "type": "table_cell", "bbox": { "l": 144.389888, "t": 587.142469, "r": 159.742288, "b": 575.177889 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p87.7.3", "order": 10, "type": "table_cell", "bbox": { "l": 286.601768, "t": 535.302451, "r": 340.102911, "b": 523.337871 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p87.7.4", "order": 11, "type": "table_cell", "bbox": { "l": 95.280001, "t": 559.302451, "r": 127.805562, "b": 547.337871 }, "text": "23,470", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 3 }, { "id": "p87.7.5", "order": 12, "type": "table_cell", "bbox": { "l": 148.003832, "t": 559.302451, "r": 159.753993, "b": 547.337871 }, "text": "98", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p87.7.6", "order": 13, "type": "table_cell", "bbox": { "l": 174.16295, "t": 573.222448, "r": 281.259838, "b": 561.257868 }, "text": "Paved parking, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 5 }, { "id": "p87.7.7", "order": 14, "type": "table_cell", "bbox": { "l": 95.280001, "t": 573.222448, "r": 127.805562, "b": 561.257868 }, "text": "23,470", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p87.7.8", "order": 15, "type": "table_cell", "bbox": { "l": 148.003832, "t": 573.222448, "r": 159.753993, "b": 561.257868 }, "text": "98", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p87.7.9", "order": 16, "type": "table_cell", "bbox": { "l": 174.16295, "t": 559.302451, "r": 296.664294, "b": 547.337871 }, "text": "100.00% Impervious Area", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 8 }, { "id": "p87.7.10", "order": 17, "type": "table_cell", "bbox": { "l": 65.040001, "t": 535.302451, "r": 89.475992, "b": 497.417872 }, "text": "Tc (min)\n0.8", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 9 }, { "id": "p87.7.11", "order": 18, "type": "table_cell", "bbox": { "l": 100.248415, "t": 535.302451, "r": 132.68142, "b": 497.417872 }, "text": "Length (feet)\n100", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 10 }, { "id": "p87.7.12", "order": 19, "type": "table_cell", "bbox": { "l": 143.445254, "t": 535.302451, "r": 175.895438, "b": 497.417872 }, "text": "Slope (ft/ft)\n0.0500", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 11 }, { "id": "p87.7.13", "order": 20, "type": "table_cell", "bbox": { "l": 186.552062, "t": 535.302451, "r": 223.968178, "b": 497.417872 }, "text": "Velocity (ft/sec)\n2.05", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 12 }, { "id": "p87.7.14", "order": 21, "type": "table_cell", "bbox": { "l": 234.581918, "t": 535.302451, "r": 473.002733, "b": 485.417872 }, "text": "Capacity (cfs)\nSheet Flow, Smooth surfaces n= 0.011 P2= 3.42\"", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 13 }, { "id": "p87.7.15", "order": 22, "type": "table_cell", "bbox": { "l": 74.639998, "t": 485.382452, "r": 89.475992, "b": 473.417872 }, "text": "4.1", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p87.7.16", "order": 23, "type": "table_cell", "bbox": { "l": 114.927527, "t": 485.382452, "r": 132.68142, "b": 473.417872 }, "text": "350", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p87.7.17", "order": 24, "type": "table_cell", "bbox": { "l": 143.445254, "t": 485.382452, "r": 175.863606, "b": 473.417872 }, "text": "0.0050", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p87.7.18", "order": 25, "type": "table_cell", "bbox": { "l": 203.137703, "t": 485.382452, "r": 223.870219, "b": 473.417872 }, "text": "1.44", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p87.7.19", "order": 26, "type": "table_cell", "bbox": { "l": 286.679993, "t": 485.26245, "r": 425.623588, "b": 461.417872 }, "text": "Shallow Concentrated Flow, Paved Kv= 20.3 fps", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p87.7.20", "order": 27, "type": "table_cell", "bbox": { "l": 74.639998, "t": 459.462454, "r": 89.475992, "b": 447.497874 }, "text": "4.9", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p87.7.21", "order": 28, "type": "table_cell", "bbox": { "l": 114.927527, "t": 459.462454, "r": 132.68142, "b": 447.497874 }, "text": "450", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p87.7.22", "order": 29, "type": "table_cell", "bbox": { "l": 143.445254, "t": 459.462454, "r": 167.029543, "b": 447.497874 }, "text": "Total", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p87.7.23", "order": 30, "type": "table_cell", "bbox": { "l": 356.4, "t": 470.8114, "r": 457.68, "b": 451.2 }, "text": "", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 22 }, { "id": "p87.7.24", "order": 31, "type": "table_cell", "bbox": { "l": 457.68, "t": 470.8114, "r": 558.96, "b": 451.2 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 23 } ], "reading_order": 6 }, { "id": "p87.8", "order": 32, "type": "caption", "bbox": { "l": 186.72, "t": 435.12, "r": 424.56, "b": 419.76 }, "text": "Subcatchment 143S: DA P2 (Impervious)", "attrs": { "block_label": "figure_title" }, "reading_order": 7 }, { "id": "p87.9", "order": 33, "type": "figure", "bbox": { "l": 61.2, "t": 418.32, "r": 552.72, "b": 148.8 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nRunoff\n4.27 cfs\nNOAA 24-hr D\n4\n100-Year Rainfall=9.48\"\nRunoff Area=23,470 sf\n3 Runoff Volume=18,071 cf\n(cfs) Runoff Depth=9.24\"\nFlow Flow Length=450'\n2\nTc=4.9 min\nCN=0/98\n1\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72\nTime (hours)" }, "reading_order": 8 }, { "id": "p87.10", "order": 34, "type": "text", "bbox": { "l": 265.68, "t": 156, "r": 312.96, "b": 147.12 }, "text": "Time (hours)", "attrs": { "block_label": "number" }, "reading_order": 9 } ] }, { "document_id": 16592, "page": 88, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 18, "counts_by_type": { "caption": 1, "figure": 1, "footer": 1, "footnote": 1, "header": 1, "table": 1, "table_cell": 9, "text": 2, "title": 1 }, "build_ms": 2, "items": [ { "id": "p88.1", "order": 1, "type": "header", "bbox": { "l": 53.04, "t": 738.24, "r": 560.4, "b": 698.88 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 100-Year Rainfall=9.48\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 48", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p88.2", "order": 2, "type": "title", "bbox": { "l": 142.08, "t": 687.6, "r": 470.4, "b": 672.24 }, "text": "Summary for Subcatchment 145S: DA P5 (4000 SF Roof)", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p88.3", "order": 3, "type": "text", "bbox": { "l": 54, "t": 660.24, "r": 463.2, "b": 634.08 }, "text": "Runoff = 0.68 cfs @ 12.14 hrs, Volume= 3,080 cf, Depth= 9.24\"\nRouted to Pond 130P : SUBSURFACE", "reading_order": 2 }, { "id": "p88.4", "order": 4, "type": "text", "bbox": { "l": 51.84, "t": 623.76, "r": 611.52, "b": 598.32 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious, Time Span= 0.00-72.00 hrs, dt= NOAA 24-hr D 100-Year Rainfall=9.48\"", "reading_order": 3 }, { "id": "p88.5", "order": 5, "type": "table", "bbox": { "l": 53.52, "t": 587.52, "r": 559.92, "b": 497.29787 }, "text": "", "attrs": { "block_label": "table", "n_rows": 3, "n_cols": 3, "integrity": { "cells_checked": 9, "cells_flagged": 0 } }, "children": [ { "id": "p88.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 86.520001, "t": 587.142469, "r": 127.590159, "b": 575.177889 }, "text": "Area (sf)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p88.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 144.389888, "t": 587.142469, "r": 159.742288, "b": 575.177889 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p88.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 286.601768, "t": 535.302451, "r": 340.102911, "b": 523.337871 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p88.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 101.160004, "t": 573.222448, "r": 127.789043, "b": 547.337871 }, "text": "4,000\n4,000", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p88.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 147.987313, "t": 573.222448, "r": 159.844683, "b": 547.337871 }, "text": "98\n98", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p88.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 174.146431, "t": 573.222448, "r": 302.745943, "b": 547.337871 }, "text": "Unconnected roofs, HSG A\n100.00% Pervious Area", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p88.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 65.040001, "t": 535.302451, "r": 89.475992, "b": 497.417872 }, "text": "Tc (min)\n6.0", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p88.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 100.248415, "t": 535.302451, "r": 348.647167, "b": 497.29787 }, "text": "Length (feet)\nDirect Entry,", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 7 }, { "id": "p88.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 148.683866, "t": 535.302451, "r": 275.988028, "b": 511.337871 }, "text": "Slope (ft/ft) Velocity (ft/sec) Capacity (cfs)", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 } ], "reading_order": 4 }, { "id": "p88.6", "order": 15, "type": "caption", "bbox": { "l": 180.96, "t": 485.04, "r": 430.56, "b": 469.92 }, "text": "Subcatchment 145S: DA P5 (4000 SF Roof)", "attrs": { "block_label": "figure_title" }, "reading_order": 5 }, { "id": "p88.7", "order": 16, "type": "figure", "bbox": { "l": 62.4, "t": 465.36, "r": 498.24, "b": 201.12 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n0.75\n0.7 0.68 cfs\n0.65 NOAA 24-hr D\n0.6 100-Year Rainfall=9.48\"\nRunoff Area=4,000 sf\n0.55\n0.5\n0.45 Runoff Volume=3,080 cf\n(cfs) 0.4 Runoff Depth=9.24\"\nFlow Tc=6.0 min\n0.35\n0.3\nCN=98/0\n0.25\n0.2\n0.15\n0.1\n0.05\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72" }, "reading_order": 6 }, { "id": "p88.8", "order": 17, "type": "footnote", "bbox": { "l": 90.24, "t": 216.48, "r": 492.24, "b": 197.52 }, "text": "6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72 Time (hours)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 7 }, { "id": "p88.9", "order": 18, "type": "footer", "bbox": { "l": 509.76, "t": 443.28, "r": 547.68, "b": 431.04 }, "text": "", "attrs": { "block_label": "footer_image" }, "reading_order": 8 } ] }, { "document_id": 16592, "page": 89, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 36, "counts_by_type": { "caption": 1, "figure": 1, "header": 2, "table": 1, "table_cell": 24, "text": 6, "title": 1 }, "build_ms": 4, "items": [ { "id": "p89.1", "order": 1, "type": "header", "bbox": { "l": 355.2, "t": 738.96, "r": 560.64, "b": 712.8 }, "text": "NOAA 24-hr D 100-Year Rainfall=9.48\"\nPrinted 04/12/2025", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p89.2", "order": 2, "type": "header", "bbox": { "l": 51.6, "t": 737.76, "r": 395.76, "b": 699.12 }, "text": "102 Sams -REV 12-02-25 NOAA 2\nPrepared by Haler Consulting\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p89.3", "order": 3, "type": "text", "bbox": { "l": 517.2, "t": 710.88, "r": 558.96, "b": 699.36 }, "text": "Page 49", "attrs": { "block_label": "number" }, "reading_order": 2 }, { "id": "p89.4", "order": 4, "type": "title", "bbox": { "l": 154.8, "t": 687.6, "r": 457.2, "b": 672.48 }, "text": "Summary for Subcatchment 148S: DA P3 (Pervious)", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 3 }, { "id": "p89.5", "order": 5, "type": "text", "bbox": { "l": 52.08, "t": 659.52, "r": 304.08, "b": 647.04 }, "text": "Runoff = 1.31 cfs @ 12.26 hrs, Volume=9,627 cf, Depth= 1.83\"", "reading_order": 4 }, { "id": "p89.6", "order": 6, "type": "text", "bbox": { "l": 66.48, "t": 647.28, "r": 294.96, "b": 634.56 }, "text": "Routed to Pond 149P : WQ Infiltration Basin #2", "reading_order": 5 }, { "id": "p89.7", "order": 7, "type": "text", "bbox": { "l": 347.04, "t": 660, "r": 463.44, "b": 646.8 }, "text": "9,627 cf, Depth= 1.83\"", "reading_order": 6 }, { "id": "p89.8", "order": 8, "type": "text", "bbox": { "l": 52.32, "t": 623.76, "r": 611.04, "b": 598.32 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious, Time Span= 0.00-72.00 hrs, dt= NOAA 24-hr D 100-Year Rainfall=9.48\"", "reading_order": 7 }, { "id": "p89.9", "order": 9, "type": "table", "bbox": { "l": 52.56, "t": 589.2, "r": 558.96, "b": 447.497874 }, "text": "", "attrs": { "block_label": "table", "n_rows": 6, "n_cols": 5, "integrity": { "cells_checked": 22, "cells_flagged": 0 } }, "children": [ { "id": "p89.9.1", "order": 10, "type": "table_cell", "bbox": { "l": 86.520001, "t": 587.142469, "r": 127.590159, "b": 575.177889 }, "text": "Area (sf)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p89.9.2", "order": 11, "type": "table_cell", "bbox": { "l": 144.389888, "t": 587.142469, "r": 159.742288, "b": 575.177889 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p89.9.3", "order": 12, "type": "table_cell", "bbox": { "l": 286.601768, "t": 535.302451, "r": 340.102911, "b": 523.337871 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p89.9.4", "order": 13, "type": "table_cell", "bbox": { "l": 95.280001, "t": 559.302451, "r": 127.805562, "b": 547.337871 }, "text": "62,973", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 3 }, { "id": "p89.9.5", "order": 14, "type": "table_cell", "bbox": { "l": 148.003832, "t": 559.302451, "r": 159.753993, "b": 547.337871 }, "text": "39", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p89.9.6", "order": 15, "type": "table_cell", "bbox": { "l": 174.16295, "t": 573.222448, "r": 333.31717, "b": 561.257868 }, "text": ">75% Grass cover, Good, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 5 }, { "id": "p89.9.7", "order": 16, "type": "table_cell", "bbox": { "l": 95.280001, "t": 573.222448, "r": 127.805562, "b": 561.257868 }, "text": "62,973", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p89.9.8", "order": 17, "type": "table_cell", "bbox": { "l": 148.003832, "t": 573.222448, "r": 159.753993, "b": 561.257868 }, "text": "39", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p89.9.9", "order": 18, "type": "table_cell", "bbox": { "l": 174.16295, "t": 559.302451, "r": 286.000299, "b": 547.337871 }, "text": "100.00% Pervious Area", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 8 }, { "id": "p89.9.10", "order": 19, "type": "table_cell", "bbox": { "l": 65.040001, "t": 535.302451, "r": 89.475992, "b": 497.417872 }, "text": "Tc (min)\n9.5", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 9 }, { "id": "p89.9.11", "order": 20, "type": "table_cell", "bbox": { "l": 100.248415, "t": 535.302451, "r": 132.68142, "b": 497.417872 }, "text": "Length (feet)\n100", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 10 }, { "id": "p89.9.12", "order": 21, "type": "table_cell", "bbox": { "l": 143.445254, "t": 535.302451, "r": 175.895438, "b": 497.417872 }, "text": "Slope (ft/ft)\n0.0200", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 11 }, { "id": "p89.9.13", "order": 22, "type": "table_cell", "bbox": { "l": 186.552062, "t": 535.302451, "r": 223.968178, "b": 497.417872 }, "text": "Velocity (ft/sec)\n0.18", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 12 }, { "id": "p89.9.14", "order": 23, "type": "table_cell", "bbox": { "l": 234.581918, "t": 535.302451, "r": 452.820335, "b": 485.417872 }, "text": "Capacity (cfs)\nSheet Flow, Grass: Short n= 0.150 P2= 3.42\"", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 13 }, { "id": "p89.9.15", "order": 24, "type": "table_cell", "bbox": { "l": 74.639998, "t": 485.382452, "r": 89.475992, "b": 473.417872 }, "text": "3.6", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p89.9.16", "order": 25, "type": "table_cell", "bbox": { "l": 114.927527, "t": 485.382452, "r": 132.68142, "b": 473.417872 }, "text": "216", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p89.9.17", "order": 26, "type": "table_cell", "bbox": { "l": 143.445254, "t": 485.382452, "r": 175.863606, "b": 473.417872 }, "text": "0.0200", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p89.9.18", "order": 27, "type": "table_cell", "bbox": { "l": 203.137703, "t": 485.382452, "r": 223.870219, "b": 473.417872 }, "text": "0.99", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p89.9.19", "order": 28, "type": "table_cell", "bbox": { "l": 286.679993, "t": 485.26245, "r": 446.147004, "b": 461.417872 }, "text": "Shallow Concentrated Flow, Short Grass Pasture Kv= 7.0 fps", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p89.9.20", "order": 29, "type": "table_cell", "bbox": { "l": 68.76, "t": 459.462454, "r": 89.492517, "b": 447.497874 }, "text": "13.1", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p89.9.21", "order": 30, "type": "table_cell", "bbox": { "l": 114.944052, "t": 459.462454, "r": 132.697945, "b": 447.497874 }, "text": "316", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p89.9.22", "order": 31, "type": "table_cell", "bbox": { "l": 143.354569, "t": 459.462454, "r": 166.947862, "b": 447.497874 }, "text": "Total", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p89.9.23", "order": 32, "type": "table_cell", "bbox": { "l": 356.4, "t": 469.8857, "r": 457.68, "b": 450 }, "text": "", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 22 }, { "id": "p89.9.24", "order": 33, "type": "table_cell", "bbox": { "l": 457.68, "t": 469.8857, "r": 558.96, "b": 450 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 23 } ], "reading_order": 8 }, { "id": "p89.10", "order": 34, "type": "caption", "bbox": { "l": 193.2, "t": 435.12, "r": 418.08, "b": 420 }, "text": "Subcatchment 148S: DA P3 (Pervious)", "attrs": { "block_label": "figure_title" }, "reading_order": 9 }, { "id": "p89.11", "order": 35, "type": "figure", "bbox": { "l": 62.64, "t": 418.56, "r": 552, "b": 150.24 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nRunoff\n1.31 cfs\nNOAA 24-hr D\n100-Year Rainfall=9.48\"\n1 Runoff Area=62,973 sf\nRunoff Volume=9,627 cf\n(cfs) Runoff Depth=1.83\"\nFlow Flow Length=316'\nSlope=0.0200 '/'\nTc=13.1 min\nCN=39/0\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72\nTime (hours)" }, "reading_order": 10 }, { "id": "p89.12", "order": 36, "type": "text", "bbox": { "l": 265.44, "t": 156, "r": 312.96, "b": 146.88 }, "text": "Time (hours)", "attrs": { "block_label": "number" }, "reading_order": 11 } ] }, { "document_id": 16592, "page": 90, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 39, "counts_by_type": { "caption": 1, "figure": 1, "footnote": 1, "header": 1, "table": 1, "table_cell": 31, "text": 2, "title": 1 }, "build_ms": 4, "items": [ { "id": "p90.1", "order": 1, "type": "header", "bbox": { "l": 53.52, "t": 738.48, "r": 560.64, "b": 698.64 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 100-Year Rainfall=9.48\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 50", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p90.2", "order": 2, "type": "title", "bbox": { "l": 159.36, "t": 687.6, "r": 453.36, "b": 672.48 }, "text": "Summary for Subcatchment 149S: DA P0 Pervious", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p90.3", "order": 3, "type": "text", "bbox": { "l": 53.04, "t": 660.48, "r": 463.68, "b": 634.56 }, "text": "Runoff = 1.65 cfs @ 13.28 hrs, Volume= 31,994 cf, Depth= 1.14\"\nRouted to Link 147L : POA", "reading_order": 2 }, { "id": "p90.4", "order": 4, "type": "text", "bbox": { "l": 52.08, "t": 623.76, "r": 611.28, "b": 598.08 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious, Time Span= 0.00-72.00 hrs, dt= NOAA 24-hr D 100-Year Rainfall=9.48\"", "reading_order": 3 }, { "id": "p90.5", "order": 5, "type": "table", "bbox": { "l": 53.76, "t": 587.76, "r": 558.96, "b": 423.497874 }, "text": "", "attrs": { "block_label": "table", "n_rows": 8, "n_cols": 5, "integrity": { "cells_checked": 29, "cells_flagged": 1, "flags": [ { "row": 5, "col": 4, "coverage": 0, "text": "Sheet Flow, Woods: Light underbrush n=0.400 P2=3.42\" Shallo…" } ] } }, "children": [ { "id": "p90.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 86.520001, "t": 587.142469, "r": 127.590159, "b": 575.177889 }, "text": "Area (sf)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p90.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 144.389888, "t": 587.142469, "r": 159.742288, "b": 575.177889 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p90.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 286.601768, "t": 511.302451, "r": 340.102911, "b": 499.337871 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p90.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 89.399998, "t": 573.222448, "r": 127.805562, "b": 549.257868 }, "text": "236,879\n99,371", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p90.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 147.913142, "t": 573.222448, "r": 159.770513, "b": 549.257868 }, "text": "30\n39", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p90.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 174.07226, "t": 573.222448, "r": 333.31717, "b": 549.257868 }, "text": "Woods, Good, HSG A\n>75% Grass cover, Good, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p90.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 89.399998, "t": 535.302451, "r": 127.714872, "b": 523.337871 }, "text": "336,250", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p90.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 147.913142, "t": 535.302451, "r": 159.770513, "b": 523.337871 }, "text": "33", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p90.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 174.07226, "t": 547.302451, "r": 262.271799, "b": 535.337871 }, "text": "Weighted Average", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 8 }, { "id": "p90.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 89.399998, "t": 547.302451, "r": 127.714872, "b": 535.337871 }, "text": "336,250", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p90.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 147.913142, "t": 547.302451, "r": 159.770513, "b": 535.337871 }, "text": "33", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p90.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 174.07226, "t": 535.302451, "r": 286.016818, "b": 523.337871 }, "text": "100.00% Pervious Area", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 11 }, { "id": "p90.5.13", "order": 18, "type": "table_cell", "bbox": { "l": 65.040001, "t": 511.302451, "r": 89.40872, "b": 487.337871 }, "text": "Tc (min)", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 12 }, { "id": "p90.5.14", "order": 19, "type": "table_cell", "bbox": { "l": 100.248415, "t": 511.302451, "r": 132.666767, "b": 487.337871 }, "text": "Length (feet)", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p90.5.15", "order": 20, "type": "table_cell", "bbox": { "l": 148.683866, "t": 511.302451, "r": 175.895438, "b": 487.337871 }, "text": "Slope (ft/ft)", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p90.5.16", "order": 21, "type": "table_cell", "bbox": { "l": 186.552062, "t": 511.302451, "r": 223.968178, "b": 487.337871 }, "text": "Velocity (ft/sec)", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p90.5.17", "order": 22, "type": "table_cell", "bbox": { "l": 234.581918, "t": 511.302451, "r": 275.988028, "b": 487.337871 }, "text": "Capacity (cfs)", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p90.5.18", "order": 23, "type": "table_cell", "bbox": { "l": 68.76, "t": 485.382452, "r": 89.492517, "b": 473.417872 }, "text": "36.2", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p90.5.19", "order": 24, "type": "table_cell", "bbox": { "l": 114.944052, "t": 485.382452, "r": 132.697945, "b": 473.417872 }, "text": "100", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p90.5.20", "order": 25, "type": "table_cell", "bbox": { "l": 143.354569, "t": 485.382452, "r": 175.880131, "b": 473.417872 }, "text": "0.0050", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p90.5.21", "order": 26, "type": "table_cell", "bbox": { "l": 203.154228, "t": 485.382452, "r": 223.886744, "b": 473.417872 }, "text": "0.05", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p90.5.22", "order": 27, "type": "table_cell", "bbox": { "l": 457.92, "t": 481.2, "r": 558.96, "b": 445.68 }, "text": "Sheet Flow, Woods: Light underbrush n=0.400 P2=3.42\" Shallow Concentrated Flow, Woodland Kv=5.0 fps", "attrs": { "row": 5, "col": 4, "rowspan": 2, "colspan": 1 }, "reading_order": 21 }, { "id": "p90.5.23", "order": 28, "type": "table_cell", "bbox": { "l": 68.76, "t": 461.382452, "r": 89.492517, "b": 449.417872 }, "text": "13.6", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 22 }, { "id": "p90.5.24", "order": 29, "type": "table_cell", "bbox": { "l": 114.944052, "t": 461.382452, "r": 132.697945, "b": 449.417872 }, "text": "579", "attrs": { "row": 6, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 23 }, { "id": "p90.5.25", "order": 30, "type": "table_cell", "bbox": { "l": 143.354569, "t": 461.382452, "r": 175.880131, "b": 449.417872 }, "text": "0.0200", "attrs": { "row": 6, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 24 }, { "id": "p90.5.26", "order": 31, "type": "table_cell", "bbox": { "l": 203.154228, "t": 461.382452, "r": 223.886744, "b": 449.417872 }, "text": "0.71", "attrs": { "row": 6, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 25 }, { "id": "p90.5.27", "order": 32, "type": "table_cell", "bbox": { "l": 68.76, "t": 435.462454, "r": 89.492517, "b": 423.497874 }, "text": "49.8", "attrs": { "row": 7, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 26 }, { "id": "p90.5.28", "order": 33, "type": "table_cell", "bbox": { "l": 114.944052, "t": 435.462454, "r": 132.697945, "b": 423.497874 }, "text": "679", "attrs": { "row": 7, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 27 }, { "id": "p90.5.29", "order": 34, "type": "table_cell", "bbox": { "l": 143.354569, "t": 435.462454, "r": 166.947862, "b": 423.497874 }, "text": "Total", "attrs": { "row": 7, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 28 }, { "id": "p90.5.30", "order": 35, "type": "table_cell", "bbox": { "l": 356.88, "t": 445.68, "r": 457.92, "b": 427.92 }, "text": "", "attrs": { "row": 7, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 29 }, { "id": "p90.5.31", "order": 36, "type": "table_cell", "bbox": { "l": 457.92, "t": 445.68, "r": 558.96, "b": 427.92 }, "text": "", "attrs": { "row": 7, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 30 } ], "reading_order": 4 }, { "id": "p90.6", "order": 37, "type": "caption", "bbox": { "l": 197.76, "t": 410.64, "r": 414.24, "b": 396 }, "text": "Subcatchment 149S: DA P0 Pervious", "attrs": { "block_label": "figure_title" }, "reading_order": 5 }, { "id": "p90.7", "order": 38, "type": "figure", "bbox": { "l": 61.2, "t": 391.68, "r": 550.8, "b": 125.76 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nRunoff\n1.65 cfs\nNOAA 24-hr D\n100-Year Rainfall=9.48\"\nRunoff Area=336,250 sf\nRunoff Volume=31,994 cf\n(cfs) 1 Runoff Depth=1.14\"\nFlow Flow Length=679'\nTc=49.8 min\nCN=33/0\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72\nTime (hours)" }, "reading_order": 6 }, { "id": "p90.8", "order": 39, "type": "footnote", "bbox": { "l": 85.2, "t": 142.08, "r": 493.2, "b": 123.6 }, "text": "0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72 Time (hours)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 7 } ] }, { "document_id": 16592, "page": 91, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 43, "counts_by_type": { "caption": 1, "figure": 1, "footnote": 1, "header": 2, "table": 1, "table_cell": 33, "text": 3, "title": 1 }, "build_ms": 4, "items": [ { "id": "p91.1", "order": 1, "type": "header", "bbox": { "l": 355.2, "t": 738.96, "r": 560.64, "b": 712.8 }, "text": "NOAA 24-hr D 100-Year Rainfall=9.48\"\nPrinted 04/12/2025", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p91.2", "order": 2, "type": "header", "bbox": { "l": 51.6, "t": 737.76, "r": 396.24, "b": 699.12 }, "text": "102 Sams -REV 12-02-25 NOAA 2\nPrepared by Haler Consulting\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p91.3", "order": 3, "type": "text", "bbox": { "l": 517.2, "t": 710.88, "r": 558.48, "b": 699.12 }, "text": "Page 51", "attrs": { "block_label": "number" }, "reading_order": 2 }, { "id": "p91.4", "order": 4, "type": "title", "bbox": { "l": 154.8, "t": 687.6, "r": 457.2, "b": 672.48 }, "text": "Summary for Subcatchment 150S: DA P4 (Pervious)", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 3 }, { "id": "p91.5", "order": 5, "type": "text", "bbox": { "l": 53.52, "t": 660.48, "r": 463.92, "b": 634.08 }, "text": "Runoff = 1.50 cfs @ 12.30 hrs, Volume= 11,767 cf, Depth= 1.83\"\nRouted to Pond 144P : WQ Infiltration Basin #1", "reading_order": 4 }, { "id": "p91.6", "order": 6, "type": "text", "bbox": { "l": 52.32, "t": 623.76, "r": 611.04, "b": 598.32 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious, Time Span= 0.00-72.00 hrs, dt= NOAA 24-hr D 100-Year Rainfall=9.48\"", "reading_order": 5 }, { "id": "p91.7", "order": 7, "type": "table", "bbox": { "l": 52.32, "t": 588.96, "r": 558.96, "b": 447.497874 }, "text": "", "attrs": { "block_label": "table", "n_rows": 7, "n_cols": 6, "integrity": { "cells_checked": 28, "cells_flagged": 0 } }, "children": [ { "id": "p91.7.1", "order": 8, "type": "table_cell", "bbox": { "l": 86.520001, "t": 587.142469, "r": 127.590159, "b": 575.177889 }, "text": "Area (sf)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p91.7.2", "order": 9, "type": "table_cell", "bbox": { "l": 144.389888, "t": 587.142469, "r": 159.742288, "b": 575.177889 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p91.7.3", "order": 10, "type": "table_cell", "bbox": { "l": 286.601768, "t": 535.302451, "r": 340.102911, "b": 523.337871 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p91.7.4", "order": 11, "type": "table_cell", "bbox": { "l": 95.280001, "t": 559.302451, "r": 127.805562, "b": 547.337871 }, "text": "76,971", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 3 }, { "id": "p91.7.5", "order": 12, "type": "table_cell", "bbox": { "l": 148.003832, "t": 559.302451, "r": 159.753993, "b": 547.337871 }, "text": "39", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p91.7.6", "order": 13, "type": "table_cell", "bbox": { "l": 174.16295, "t": 573.222448, "r": 333.31717, "b": 561.257868 }, "text": ">75% Grass cover, Good, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 5 }, { "id": "p91.7.7", "order": 14, "type": "table_cell", "bbox": { "l": 95.280001, "t": 573.222448, "r": 127.805562, "b": 561.257868 }, "text": "76,971", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 6 }, { "id": "p91.7.8", "order": 15, "type": "table_cell", "bbox": { "l": 148.003832, "t": 573.222448, "r": 159.753993, "b": 561.257868 }, "text": "39", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p91.7.9", "order": 16, "type": "table_cell", "bbox": { "l": 174.16295, "t": 559.302451, "r": 286.000299, "b": 547.337871 }, "text": "100.00% Pervious Area", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 8 }, { "id": "p91.7.10", "order": 17, "type": "table_cell", "bbox": { "l": 65.040001, "t": 535.302451, "r": 89.40872, "b": 511.337871 }, "text": "Tc (min)", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p91.7.11", "order": 18, "type": "table_cell", "bbox": { "l": 100.248415, "t": 535.302451, "r": 132.666767, "b": 511.337871 }, "text": "Length (feet)", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p91.7.12", "order": 19, "type": "table_cell", "bbox": { "l": 148.683866, "t": 535.302451, "r": 175.895438, "b": 511.337871 }, "text": "Slope (ft/ft)", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 }, { "id": "p91.7.13", "order": 20, "type": "table_cell", "bbox": { "l": 186.552062, "t": 535.302451, "r": 223.968178, "b": 511.337871 }, "text": "Velocity (ft/sec)", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 12 }, { "id": "p91.7.14", "order": 21, "type": "table_cell", "bbox": { "l": 234.581918, "t": 535.302451, "r": 275.988028, "b": 511.337871 }, "text": "Capacity (cfs)", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p91.7.15", "order": 22, "type": "table_cell", "bbox": { "l": 174.08692, "t": 587.142469, "r": 227.564819, "b": 575.177889 }, "text": "Description", "attrs": { "row": 3, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p91.7.16", "order": 23, "type": "table_cell", "bbox": { "l": 68.76, "t": 509.382452, "r": 89.492517, "b": 497.417872 }, "text": "12.5", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p91.7.17", "order": 24, "type": "table_cell", "bbox": { "l": 114.944052, "t": 509.382452, "r": 132.697945, "b": 497.417872 }, "text": "100", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p91.7.18", "order": 25, "type": "table_cell", "bbox": { "l": 143.354569, "t": 509.382452, "r": 175.880131, "b": 497.417872 }, "text": "0.0100", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p91.7.19", "order": 26, "type": "table_cell", "bbox": { "l": 203.154228, "t": 509.382452, "r": 223.886744, "b": 497.417872 }, "text": "0.13", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p91.7.20", "order": 27, "type": "table_cell", "bbox": { "l": 390.08, "t": 509.28, "r": 474.52, "b": 489.36 }, "text": "", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 19 }, { "id": "p91.7.21", "order": 28, "type": "table_cell", "bbox": { "l": 286.679993, "t": 509.26245, "r": 452.820335, "b": 485.417872 }, "text": "Sheet Flow, Grass: Short n= 0.150 P2= 3.42\"", "attrs": { "row": 4, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p91.7.22", "order": 29, "type": "table_cell", "bbox": { "l": 74.639998, "t": 485.382452, "r": 89.475992, "b": 473.417872 }, "text": "2.3", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p91.7.23", "order": 30, "type": "table_cell", "bbox": { "l": 120.82405, "t": 485.382452, "r": 132.68142, "b": 473.417872 }, "text": "96", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 22 }, { "id": "p91.7.24", "order": 31, "type": "table_cell", "bbox": { "l": 143.445254, "t": 485.382452, "r": 175.863606, "b": 473.417872 }, "text": "0.0100", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 23 }, { "id": "p91.7.25", "order": 32, "type": "table_cell", "bbox": { "l": 203.137703, "t": 485.382452, "r": 223.870219, "b": 473.417872 }, "text": "0.70", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 24 }, { "id": "p91.7.26", "order": 33, "type": "table_cell", "bbox": { "l": 390.08, "t": 489.36, "r": 474.52, "b": 469.44 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 25 }, { "id": "p91.7.27", "order": 34, "type": "table_cell", "bbox": { "l": 286.679993, "t": 485.26245, "r": 446.147004, "b": 461.417872 }, "text": "Shallow Concentrated Flow, Short Grass Pasture Kv= 7.0 fps", "attrs": { "row": 5, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 26 }, { "id": "p91.7.28", "order": 35, "type": "table_cell", "bbox": { "l": 68.76, "t": 459.462454, "r": 89.492517, "b": 447.497874 }, "text": "14.8", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 27 }, { "id": "p91.7.29", "order": 36, "type": "table_cell", "bbox": { "l": 114.944052, "t": 459.462454, "r": 132.697945, "b": 447.497874 }, "text": "196", "attrs": { "row": 6, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 28 }, { "id": "p91.7.30", "order": 37, "type": "table_cell", "bbox": { "l": 143.354569, "t": 459.462454, "r": 166.947862, "b": 447.497874 }, "text": "Total", "attrs": { "row": 6, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 29 }, { "id": "p91.7.31", "order": 38, "type": "table_cell", "bbox": { "l": 305.64, "t": 469.44, "r": 390.08, "b": 449.52 }, "text": "", "attrs": { "row": 6, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 30 }, { "id": "p91.7.32", "order": 39, "type": "table_cell", "bbox": { "l": 390.08, "t": 469.44, "r": 474.52, "b": 449.52 }, "text": "", "attrs": { "row": 6, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 31 }, { "id": "p91.7.33", "order": 40, "type": "table_cell", "bbox": { "l": 474.52, "t": 469.44, "r": 558.96, "b": 449.52 }, "text": "", "attrs": { "row": 6, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 32 } ], "reading_order": 6 }, { "id": "p91.8", "order": 41, "type": "caption", "bbox": { "l": 193.2, "t": 435.12, "r": 417.84, "b": 420 }, "text": "Subcatchment 150S: DA P4 (Pervious)", "attrs": { "block_label": "figure_title" }, "reading_order": 7 }, { "id": "p91.9", "order": 42, "type": "figure", "bbox": { "l": 60.72, "t": 415.68, "r": 552.48, "b": 150.48 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nRunoff\n1.50 cfs\nNOAA 24-hr D\n100-Year Rainfall=9.48\"\nRunoff Area=76,971 sf\nRunoff Volume=11,767 cf\n1\n(cfs) Runoff Depth=1.83\"\nFlow Flow Length=196'\nSlope=0.0100 '/'\nTc=14.8 min\nCN=39/0\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72" }, "reading_order": 8 }, { "id": "p91.10", "order": 43, "type": "footnote", "bbox": { "l": 84.48, "t": 168.24, "r": 493.44, "b": 148.08 }, "text": "0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72 Time (hours)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 9 } ] }, { "document_id": 16592, "page": 92, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 41, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "table": 1, "table_cell": 31, "text": 5, "title": 1 }, "build_ms": 4, "items": [ { "id": "p92.1", "order": 1, "type": "header", "bbox": { "l": 53.28, "t": 738.48, "r": 560.64, "b": 698.64 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 100-Year Rainfall=9.48\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 52", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p92.2", "order": 2, "type": "title", "bbox": { "l": 148.32, "t": 687.36, "r": 463.92, "b": 672.24 }, "text": "Summary for Subcatchment 172S: DA P6 (Impervious)", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p92.3", "order": 3, "type": "text", "bbox": { "l": 52.32, "t": 659.52, "r": 304.08, "b": 647.04 }, "text": "Runoff = 1.19 cfs @ 12.10 hrs, Volume=4,042 cf, Depth= 9.24\"", "reading_order": 2 }, { "id": "p92.4", "order": 4, "type": "text", "bbox": { "l": 66.72, "t": 647.28, "r": 198, "b": 634.8 }, "text": "Routed to Link 147L : POA", "reading_order": 3 }, { "id": "p92.5", "order": 5, "type": "text", "bbox": { "l": 347.04, "t": 660, "r": 463.2, "b": 646.56 }, "text": ".∠4\"", "reading_order": 4 }, { "id": "p92.6", "order": 6, "type": "text", "bbox": { "l": 52.08, "t": 623.76, "r": 611.28, "b": 598.32 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious, Time Span= 0.00-72.00 hrs, dt= NOAA 24-hr D 100-Year Rainfall=9.48\"", "reading_order": 5 }, { "id": "p92.7", "order": 7, "type": "table", "bbox": { "l": 52.56, "t": 588.72, "r": 559.2, "b": 447.497874 }, "text": "", "attrs": { "block_label": "table", "n_rows": 6, "n_cols": 6, "integrity": { "cells_checked": 25, "cells_flagged": 0 } }, "children": [ { "id": "p92.7.1", "order": 8, "type": "table_cell", "bbox": { "l": 86.520001, "t": 587.142469, "r": 127.590159, "b": 575.177889 }, "text": "Area (sf)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p92.7.2", "order": 9, "type": "table_cell", "bbox": { "l": 144.389888, "t": 587.142469, "r": 159.742288, "b": 575.177889 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p92.7.3", "order": 10, "type": "table_cell", "bbox": { "l": 286.601768, "t": 535.302451, "r": 340.102911, "b": 523.337871 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p92.7.4", "order": 11, "type": "table_cell", "bbox": { "l": 52.56, "t": 573.4133, "r": 137, "b": 558.1067 }, "text": "", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 3 }, { "id": "p92.7.5", "order": 12, "type": "table_cell", "bbox": { "l": 101.160004, "t": 573.222448, "r": 127.789043, "b": 547.337871 }, "text": "5,250\n5,250", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p92.7.6", "order": 13, "type": "table_cell", "bbox": { "l": 147.987313, "t": 573.222448, "r": 159.844683, "b": 547.337871 }, "text": "98\n98", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p92.7.7", "order": 14, "type": "table_cell", "bbox": { "l": 174.146431, "t": 573.222448, "r": 296.653009, "b": 547.337871 }, "text": "Paved parking, HSG A\n100.00% Impervious Area", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 3, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p92.7.8", "order": 15, "type": "table_cell", "bbox": { "l": 65.040001, "t": 535.302451, "r": 89.40872, "b": 511.337871 }, "text": "Tc (min)", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p92.7.9", "order": 16, "type": "table_cell", "bbox": { "l": 100.248415, "t": 535.302451, "r": 132.666767, "b": 511.337871 }, "text": "Length (feet)", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p92.7.10", "order": 17, "type": "table_cell", "bbox": { "l": 148.683866, "t": 535.302451, "r": 175.895438, "b": 511.337871 }, "text": "Slope (ft/ft)", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p92.7.11", "order": 18, "type": "table_cell", "bbox": { "l": 186.552062, "t": 535.302451, "r": 223.968178, "b": 511.337871 }, "text": "Velocity (ft/sec)", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p92.7.12", "order": 19, "type": "table_cell", "bbox": { "l": 234.581918, "t": 535.302451, "r": 275.988028, "b": 511.337871 }, "text": "Capacity (cfs)", "attrs": { "row": 2, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 }, { "id": "p92.7.13", "order": 20, "type": "table_cell", "bbox": { "l": 174.08692, "t": 587.142469, "r": 227.564819, "b": 575.177889 }, "text": "Description", "attrs": { "row": 2, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 12 }, { "id": "p92.7.14", "order": 21, "type": "table_cell", "bbox": { "l": 74.639998, "t": 509.382452, "r": 89.475992, "b": 497.417872 }, "text": "0.8", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p92.7.15", "order": 22, "type": "table_cell", "bbox": { "l": 114.927527, "t": 509.382452, "r": 132.68142, "b": 497.417872 }, "text": "100", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p92.7.16", "order": 23, "type": "table_cell", "bbox": { "l": 143.445254, "t": 509.382452, "r": 175.863606, "b": 497.417872 }, "text": "0.0500", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p92.7.17", "order": 24, "type": "table_cell", "bbox": { "l": 203.137703, "t": 509.382452, "r": 223.870219, "b": 497.417872 }, "text": "2.05", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p92.7.18", "order": 25, "type": "table_cell", "bbox": { "l": 390.32, "t": 527.4933, "r": 474.76, "b": 512.1867 }, "text": "", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 17 }, { "id": "p92.7.19", "order": 26, "type": "table_cell", "bbox": { "l": 286.679993, "t": 509.26245, "r": 344.648169, "b": 497.29787 }, "text": "Sheet Flow,", "attrs": { "row": 3, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p92.7.20", "order": 27, "type": "table_cell", "bbox": { "l": 74.639998, "t": 485.382452, "r": 89.475992, "b": 473.417872 }, "text": "0.6", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p92.7.21", "order": 28, "type": "table_cell", "bbox": { "l": 120.82405, "t": 485.382452, "r": 132.68142, "b": 473.417872 }, "text": "50", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p92.7.22", "order": 29, "type": "table_cell", "bbox": { "l": 143.445254, "t": 485.382452, "r": 175.863606, "b": 473.417872 }, "text": "0.0050", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p92.7.23", "order": 30, "type": "table_cell", "bbox": { "l": 203.137703, "t": 485.382452, "r": 223.870219, "b": 473.417872 }, "text": "1.44", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 22 }, { "id": "p92.7.24", "order": 31, "type": "table_cell", "bbox": { "l": 390.32, "t": 512.1867, "r": 474.76, "b": 496.88 }, "text": "", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 23 }, { "id": "p92.7.25", "order": 32, "type": "table_cell", "bbox": { "l": 286.679993, "t": 497.382452, "r": 473.002733, "b": 461.417872 }, "text": "Smooth surfaces n= 0.011 P2= 3.42\"\nShallow Concentrated Flow,\nPaved Kv= 20.3 fps", "attrs": { "row": 4, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 24 }, { "id": "p92.7.26", "order": 33, "type": "table_cell", "bbox": { "l": 74.639998, "t": 459.462454, "r": 89.475992, "b": 447.497874 }, "text": "1.4", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 25 }, { "id": "p92.7.27", "order": 34, "type": "table_cell", "bbox": { "l": 114.927527, "t": 459.462454, "r": 132.68142, "b": 447.497874 }, "text": "150", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 26 }, { "id": "p92.7.28", "order": 35, "type": "table_cell", "bbox": { "l": 143.445254, "t": 459.462454, "r": 167.029543, "b": 447.497874 }, "text": "Total", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 27 }, { "id": "p92.7.29", "order": 36, "type": "table_cell", "bbox": { "l": 305.88, "t": 466.2667, "r": 390.32, "b": 450.96 }, "text": "", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 28 }, { "id": "p92.7.30", "order": 37, "type": "table_cell", "bbox": { "l": 390.32, "t": 466.2667, "r": 474.76, "b": 450.96 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 29 }, { "id": "p92.7.31", "order": 38, "type": "table_cell", "bbox": { "l": 474.76, "t": 466.2667, "r": 559.2, "b": 450.96 }, "text": "", "attrs": { "row": 5, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 30 } ], "reading_order": 6 }, { "id": "p92.8", "order": 39, "type": "caption", "bbox": { "l": 186.72, "t": 435.12, "r": 424.56, "b": 419.76 }, "text": "Subcatchment 172S: DA P6 (Impervious)", "attrs": { "block_label": "figure_title" }, "reading_order": 7 }, { "id": "p92.9", "order": 40, "type": "figure", "bbox": { "l": 61.2, "t": 417.36, "r": 552.72, "b": 149.76 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nRunoff\n1.19 cfs\nNOAA 24-hr D\n100-Year Rainfall=9.48\"\n1\nRunoff Area=5,250 sf\nRunoff Volume=4,042 cf\n(cfs) Runoff Depth=9.24\"\nFlow Flow Length=150'\nTc=1.4 min\nCN=0/98\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72\nTime (hours)" }, "reading_order": 8 }, { "id": "p92.10", "order": 41, "type": "text", "bbox": { "l": 265.44, "t": 156, "r": 312.96, "b": 147.12 }, "text": "Time (hours)", "attrs": { "block_label": "number" }, "reading_order": 9 } ] }, { "document_id": 16592, "page": 93, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 19, "counts_by_type": { "footnote": 1, "header": 2, "table": 1, "table_cell": 15 }, "build_ms": 3, "items": [ { "id": "p93.1", "order": 1, "type": "header", "bbox": { "l": 340.56, "t": 739.92, "r": 567.84, "b": 700.08 }, "text": "NOAA 24-hr D 100-Year Rainfall=9.48\"\nPrinted 04/12/2025\n'C\nPage 53", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p93.2", "order": 2, "type": "header", "bbox": { "l": 52.08, "t": 738.24, "r": 397.2, "b": 699.12 }, "text": "102 Sams -REV 12-02-25 NOAA 2\nPrepared by Haler Consulting\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p93.3", "order": 3, "type": "table", "bbox": { "l": 49.68, "t": 698.64, "r": 558.48, "b": 349.92 }, "text": "", "attrs": { "block_label": "table", "n_rows": 15, "n_cols": 4, "integrity": { "cells_checked": 15, "cells_flagged": 6, "flags": [ { "row": 1, "col": 0, "coverage": 0.08, "text": "Inflow Area = 4,000 sf, 0.00% Impervious, Inflow Depth = 9.…" }, { "row": 2, "col": 0, "coverage": 0.13, "text": "Inflow = 0.68 cfs @ 12.14 hrs, Volume= 3,080 cf" }, { "row": 7, "col": 0, "coverage": 0, "text": "Volume Invert Avail.Storage Storage Description" }, { "row": 11, "col": 0, "coverage": 0.2, "text": "1,339 cf Total Available Storage" }, { "row": 13, "col": 0, "coverage": 0, "text": "Device Routing Invert Outlet Devices" }, { "row": 14, "col": 0, "coverage": 0, "text": "#1 Discarded 0.00' 3.250 in/hr Exfiltration over Surface ar…" } ] } }, "children": [ { "id": "p93.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 190.560002, "t": 687.071827, "r": 422.475947, "b": 673.073337 }, "text": "Summary for Pond 130P: SUBSURFACE", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 4, "bbox_refit": true }, "reading_order": 0 }, { "id": "p93.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 49.68, "t": 681.204, "r": 558.48, "b": 663.768 }, "text": "Inflow Area = 4,000 sf, 0.00% Impervious, Inflow Depth = 9.24\" for 100-Year event", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 4 }, "reading_order": 1 }, { "id": "p93.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 49.68, "t": 663.768, "r": 558.48, "b": 646.332 }, "text": "Inflow = 0.68 cfs @ 12.14 hrs, Volume= 3,080 cf", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 4 }, "reading_order": 2 }, { "id": "p93.3.4", "order": 7, "type": "table_cell", "bbox": { "l": 49.68, "t": 646.332, "r": 558.48, "b": 628.896 }, "text": "Outflow = 0.04 cfs @ 10.15 hrs, Volume= 3,080 cf, Atten= 94%, Lag= 0.0 min", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 4 }, "reading_order": 3 }, { "id": "p93.3.5", "order": 8, "type": "table_cell", "bbox": { "l": 49.68, "t": 628.896, "r": 558.48, "b": 611.46 }, "text": "Discarded = 0.04 cfs @ 10.15 hrs, Volume= 3,080 cf", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 4 }, "reading_order": 4 }, { "id": "p93.3.6", "order": 9, "type": "table_cell", "bbox": { "l": 54, "t": 599.142469, "r": 381.619459, "b": 575.177889 }, "text": "Routing by Stor-Ind method, Time Span= 0.00-72.00 hrs, dt= 0.01 hrs\nPeak Elev= 4.98' @ 14.27 hrs Surf.Area= 533 sf Storage= 1,335 cf", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 4, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p93.3.7", "order": 10, "type": "table_cell", "bbox": { "l": 54, "t": 563.142469, "r": 413.896973, "b": 539.177889 }, "text": "Plug-Flow detention time= 265.3 min calculated for 3,079 cf (100% of inflow)\nCenter-of-Mass det. time= 265.3 min ( 1,008.8 - 743.6 )", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 4, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p93.3.8", "order": 11, "type": "table_cell", "bbox": { "l": 49.68, "t": 541.716, "r": 558.48, "b": 524.28 }, "text": "Volume Invert Avail.Storage Storage Description", "attrs": { "row": 7, "col": 0, "rowspan": 1, "colspan": 4 }, "reading_order": 7 }, { "id": "p93.3.9", "order": 12, "type": "table_cell", "bbox": { "l": 49.68, "t": 524.28, "r": 558.48, "b": 506.844 }, "text": "#1A 0.00' 765 cf 13.00'W x 41.00'L x 5.00'H Field A", "attrs": { "row": 8, "col": 0, "rowspan": 1, "colspan": 4 }, "reading_order": 8 }, { "id": "p93.3.10", "order": 13, "type": "table_cell", "bbox": { "l": 49.68, "t": 506.844, "r": 558.48, "b": 489.408 }, "text": "#2A 1.00' 573 cf 2,664 cf Overall - 751 cf Embedded = 1,914 cf x 40.0% Voids", "attrs": { "row": 9, "col": 0, "rowspan": 1, "colspan": 4 }, "reading_order": 9 }, { "id": "p93.3.11", "order": 14, "type": "table_cell", "bbox": { "l": 246.120003, "t": 489.222448, "r": 517.204542, "b": 441.257868 }, "text": "ADS N-12 30\" x 6 Inside #1\nInside= 30.0\"W x 30.0\"H => 4.90 sf x 20.00'L = 98.0 cf\nOutside= 36.0\"W x 36.0\"H => 6.42 sf x 20.00'L = 128.3 cf\nRow Length Adjustment= -1.00' x 4.90 sf x 3 rows", "attrs": { "row": 10, "col": 0, "rowspan": 1, "colspan": 4, "bbox_refit": true, "merged_continuation": true }, "reading_order": 10 }, { "id": "p93.3.12", "order": 15, "type": "table_cell", "bbox": { "l": 49.68, "t": 419.664, "r": 558.48, "b": 402.228 }, "text": "1,339 cf Total Available Storage", "attrs": { "row": 11, "col": 0, "rowspan": 1, "colspan": 4 }, "reading_order": 11 }, { "id": "p93.3.13", "order": 16, "type": "table_cell", "bbox": { "l": 69.023569, "t": 415.302451, "r": 292.371571, "b": 403.337871 }, "text": "Storage Group A created with Chamber Wizard", "attrs": { "row": 12, "col": 0, "rowspan": 1, "colspan": 4, "bbox_refit": true }, "reading_order": 12 }, { "id": "p93.3.14", "order": 17, "type": "table_cell", "bbox": { "l": 49.68, "t": 384.792, "r": 558.48, "b": 367.356 }, "text": "Device Routing Invert Outlet Devices", "attrs": { "row": 13, "col": 0, "rowspan": 1, "colspan": 4 }, "reading_order": 13 }, { "id": "p93.3.15", "order": 18, "type": "table_cell", "bbox": { "l": 49.68, "t": 367.356, "r": 558.48, "b": 349.92 }, "text": "#1 Discarded 0.00' 3.250 in/hr Exfiltration over Surface area", "attrs": { "row": 14, "col": 0, "rowspan": 1, "colspan": 4 }, "reading_order": 14 } ], "reading_order": 2 }, { "id": "p93.4", "order": 19, "type": "footnote", "bbox": { "l": 51.6, "t": 354.48, "r": 423.6, "b": 328.08 }, "text": "Discarded OutFlow Max=0.04 cfs @ 10.15 hrs HW=0.05' (Free Discharge)\n1=Exfiltration (Exfiltration Controls 0.04 cfs)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 3 } ] }, { "document_id": 16592, "page": 94, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 5, "counts_by_type": { "caption": 1, "figure": 2, "footnote": 1, "header": 1 }, "build_ms": 0, "items": [ { "id": "p94.1", "order": 1, "type": "header", "bbox": { "l": 53.04, "t": 738.72, "r": 562.8, "b": 698.16 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 100-Year Rainfall=9.48\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 54", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p94.2", "order": 2, "type": "figure", "bbox": { "l": 497.28, "t": 644.64, "r": 546.24, "b": 625.92 }, "text": "", "attrs": { "role": "page_header", "block_label": "header_image", "embedded_text": "Inflow\nDiscarded" }, "reading_order": 1 }, { "id": "p94.3", "order": 3, "type": "caption", "bbox": { "l": 227.76, "t": 687.6, "r": 384.24, "b": 673.2 }, "text": "Pond 130P: SUBSURFACE", "attrs": { "block_label": "figure_title" }, "reading_order": 2 }, { "id": "p94.4", "order": 4, "type": "figure", "bbox": { "l": 64.8, "t": 667.2, "r": 484.32, "b": 408.48 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n0.75 0.68 cfs\nInflow Area=4,000 sf\n0.7\n0.65\n0.6 Peak Elev=4.98'\nStorage=1,335 cf\n0.55\n0.5\n0.45\n(cfs) 0.4\nFlow\n0.35\n0.3\n0.25\n0.2\n0.15\n0.1\n0.04 cfs\n0.05\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72" }, "reading_order": 3 }, { "id": "p94.5", "order": 5, "type": "footnote", "bbox": { "l": 89.04, "t": 421.44, "r": 470.88, "b": 401.04 }, "text": "0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72 Time (hours)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 4 } ] }, { "document_id": 16592, "page": 95, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 9, "counts_by_type": { "caption": 1, "header": 2, "table": 1, "table_cell": 4, "text": 1 }, "build_ms": 11, "items": [ { "id": "p95.1", "order": 1, "type": "header", "bbox": { "l": 354.72, "t": 739.2, "r": 561.36, "b": 711.84 }, "text": "NOAA 24-hr D 100-Year Rainfall=9.48\"\nPrinted 04/12/2025", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p95.2", "order": 2, "type": "header", "bbox": { "l": 52.08, "t": 738, "r": 397.2, "b": 699.36 }, "text": "102 Sams -REV 12-02-25 NOAA 2\nPrepared by Haler Consulting\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p95.3", "order": 3, "type": "text", "bbox": { "l": 516.96, "t": 711.36, "r": 559.44, "b": 698.88 }, "text": "Page 55", "attrs": { "block_label": "number" }, "reading_order": 2 }, { "id": "p95.4", "order": 4, "type": "caption", "bbox": { "l": 178.56, "t": 687.84, "r": 433.68, "b": 672.96 }, "text": "Stage-Discharge for Pond 130P: SUBSURFACE", "attrs": { "block_label": "figure_title" }, "reading_order": 3 }, { "id": "p95.5", "order": 5, "type": "table", "bbox": { "l": 56.4, "t": 663.12, "r": 279.6, "b": 58.32 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 4, "integrity": { "cells_checked": 4, "cells_flagged": 0 } }, "children": [ { "id": "p95.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 57.479999, "t": 661.126246, "r": 98.089591, "b": 64.158859 }, "text": "Elevation (feet)\n0.00\n0.05\n0.10\n0.15\n0.20\n0.25\n0.30\n0.35\n0.40\n0.45\n0.50\n0.55\n0.60\n0.65\n0.70\n0.75\n0.80\n0.85\n0.90\n0.95\n1.00\n1.05\n1.10\n1.15\n1.20\n1.25\n1.30\n1.35\n1.40\n1.45\n1.50\n1.55\n1.60\n1.65\n1.70\n1.75\n1.80\n1.85\n1.90\n1.95\n2.00\n2.05\n2.10\n2.15\n2.20\n2.25\n2.30\n2.35\n2.40\n2.45\n2.50\n2.55", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p95.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 109.680004, "t": 661.126246, "r": 154.780724, "b": 64.158859 }, "text": "Discarded (cfs)\n0.00\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p95.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 178.200005, "t": 661.126246, "r": 218.809603, "b": 97.27883899999995 }, "text": "Elevation (feet)\n2.60\n2.65\n2.70\n2.75\n2.80\n2.85\n2.90\n2.95\n3.00\n3.05\n3.10\n3.15\n3.20\n3.25\n3.30\n3.35\n3.40\n3.45\n3.50\n3.55\n3.60\n3.65\n3.70\n3.75\n3.80\n3.85\n3.90\n3.95\n4.00\n4.05\n4.10\n4.15\n4.20\n4.25\n4.30\n4.35\n4.40\n4.45\n4.50\n4.55\n4.60\n4.65\n4.70\n4.75\n4.80\n4.85\n4.90\n4.95\n5.00", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p95.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 230.400009, "t": 661.126246, "r": 275.174362, "b": 97.27883899999995 }, "text": "Discarded (cfs)\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04\n0.04", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 } ], "reading_order": 4 } ] }, { "document_id": 16592, "page": 96, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 11, "counts_by_type": { "caption": 1, "header": 2, "table": 1, "table_cell": 6, "text": 1 }, "build_ms": 17, "items": [ { "id": "p96.1", "order": 1, "type": "header", "bbox": { "l": 355.44, "t": 738.96, "r": 561.36, "b": 712.8 }, "text": "NOAA 24-hr D 100-Year Rainfall=9.48\"\nPrinted 04/12/2025", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p96.2", "order": 2, "type": "header", "bbox": { "l": 52.32, "t": 738, "r": 396.96, "b": 699.36 }, "text": "102 Sams -REV 12-02-25 NOAA 2\nPrepared by Haler Consulting\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p96.3", "order": 3, "type": "text", "bbox": { "l": 516.96, "t": 711.12, "r": 559.2, "b": 698.88 }, "text": "Page 56", "attrs": { "block_label": "number" }, "reading_order": 2 }, { "id": "p96.4", "order": 4, "type": "caption", "bbox": { "l": 170.64, "t": 688.08, "r": 441.84, "b": 672.96 }, "text": "Stage-Area-Storage for Pond 130P: SUBSURFACE", "attrs": { "block_label": "figure_title" }, "reading_order": 3 }, { "id": "p96.5", "order": 5, "type": "table", "bbox": { "l": 54.72, "t": 665.04, "r": 468.72, "b": 61.68 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 6, "integrity": { "cells_checked": 6, "cells_flagged": 0 } }, "children": [ { "id": "p96.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 57.479999, "t": 661.126246, "r": 98.089591, "b": 64.158859 }, "text": "Elevation\\n(feet)\n0.00\n0.05\n0.10\n0.15\n0.20\n0.25\n0.30\n0.35\n0.40\n0.45\n0.50\n0.55\n0.60\n0.65\n0.70\n0.75\n0.80\n0.85\n0.90\n0.95\n1.00\n1.05\n1.10\n1.15\n1.20\n1.25\n1.30\n1.35\n1.40\n1.45\n1.50\n1.55\n1.60\n1.65\n1.70\n1.75\n1.80\n1.85\n1.90\n1.95\n2.00\n2.05\n2.10\n2.15\n2.20\n2.25\n2.30\n2.35\n2.40\n2.45\n2.50\n2.55", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p96.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 139.439999, "t": 661.126246, "r": 174.077645, "b": 64.158859 }, "text": "Surface\\n(sq-ft)\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p96.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 199.55999, "t": 661.126246, "r": 249.563969, "b": 64.158859 }, "text": "Storage\\n(cubic-feet)\n0\n11\n21\n32\n43\n53\n64\n75\n85\n96\n107\n117\n128\n139\n149\n160\n171\n181\n192\n203\n213\n223\n231\n240\n247\n255\n264\n276\n289\n302\n317\n332\n347\n363\n379\n396\n413\n430\n448\n465\n483\n501\n520\n538\n557\n575\n594\n613\n632\n651\n669\n688", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p96.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 273.240005, "t": 661.126246, "r": 313.84958, "b": 97.27883899999995 }, "text": "Elevation\\n(feet)\n2.60\n2.65\n2.70\n2.75\n2.80\n2.85\n2.90\n2.95\n3.00\n3.05\n3.10\n3.15\n3.20\n3.25\n3.30\n3.35\n3.40\n3.45\n3.50\n3.55\n3.60\n3.65\n3.70\n3.75\n3.80\n3.85\n3.90\n3.95\n4.00\n4.05\n4.10\n4.15\n4.20\n4.25\n4.30\n4.35\n4.40\n4.45\n4.50\n4.55\n4.60\n4.65\n4.70\n4.75\n4.80\n4.85\n4.90\n4.95\n5.00", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p96.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 355.200005, "t": 661.126246, "r": 389.605666, "b": 97.27883899999995 }, "text": "Surface\\n(sq-ft)\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533\n533", "attrs": { "row": 0, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p96.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 415.320008, "t": 661.126246, "r": 465.528236, "b": 97.27883899999995 }, "text": "Storage\\n(cubic-feet)\n707\n726\n745\n764\n782\n801\n819\n838\n856\n874\n891\n909\n926\n943\n960\n976\n992\n1,007\n1,022\n1,037\n1,050\n1,063\n1,075\n1,084\n1,092\n1,099\n1,107\n1,116\n1,126\n1,136\n1,147\n1,158\n1,168\n1,179\n1,190\n1,200\n1,211\n1,222\n1,232\n1,243\n1,254\n1,264\n1,275\n1,286\n1,296\n1,307\n1,318\n1,328\n1,339", "attrs": { "row": 0, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 } ], "reading_order": 4 } ] }, { "document_id": 16592, "page": 97, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 36, "counts_by_type": { "footnote": 3, "header": 1, "heading": 1, "table": 3, "table_cell": 28 }, "build_ms": 8, "items": [ { "id": "p97.1", "order": 1, "type": "header", "bbox": { "l": 54.72, "t": 738.96, "r": 560.64, "b": 698.16 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 100-Year Rainfall=9.48\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 57", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p97.2", "order": 2, "type": "heading", "bbox": { "l": 162.24, "t": 687.6, "r": 449.04, "b": 672.72 }, "text": "Summary for Pond 144P: WQ Infiltration Basin #1", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p97.3", "order": 3, "type": "table", "bbox": { "l": 52.08, "t": 666, "r": 549.6, "b": 523.68 }, "text": "", "attrs": { "block_label": "table", "n_rows": 8, "n_cols": 1, "integrity": { "cells_checked": 8, "cells_flagged": 1, "flags": [ { "row": 4, "col": 0, "coverage": 0, "text": "Primary = 0.17 cfs @ 14.19 hrs, Volume= 1,215 cf" } ] } }, "children": [ { "id": "p97.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 52.08, "t": 666, "r": 549.6, "b": 650.1867 }, "text": "Inflow Area = 108,596 sf, 29.12% Impervious, Inflow Depth = 3.99\" for 100-Year event", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 0 }, { "id": "p97.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 52.08, "t": 650.1867, "r": 549.6, "b": 634.3733 }, "text": "Inflow = 7.21 cfs @ 12.11 hrs, Volume= 36,117 cf", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 1 }, { "id": "p97.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 52.08, "t": 634.3733, "r": 549.6, "b": 618.56 }, "text": "Outflow = 0.66 cfs @ 14.19 hrs, Volume= 36,117 cf, Atten= 91%, Lag= 124.7 min", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 2 }, { "id": "p97.3.4", "order": 7, "type": "table_cell", "bbox": { "l": 52.08, "t": 618.56, "r": 549.6, "b": 602.7467 }, "text": "Discarded = 0.49 cfs @ 14.19 hrs, Volume= 34,901 cf", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 3 }, { "id": "p97.3.5", "order": 8, "type": "table_cell", "bbox": { "l": 52.08, "t": 602.7467, "r": 549.6, "b": 586.9333 }, "text": "Primary = 0.17 cfs @ 14.19 hrs, Volume= 1,215 cf", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 4 }, { "id": "p97.3.6", "order": 9, "type": "table_cell", "bbox": { "l": 69.023569, "t": 599.142469, "r": 195.539615, "b": 587.177889 }, "text": "Routed to Link 147L : POA", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p97.3.7", "order": 10, "type": "table_cell", "bbox": { "l": 54, "t": 575.142469, "r": 401.418122, "b": 551.177889 }, "text": "Routing by Stor-Ind method, Time Span= 0.00-72.00 hrs, dt= 0.01 hrs\nPeak Elev= 97.79' @ 14.19 hrs Surf.Area= 6,774 sf Storage= 15,241 cf", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p97.3.8", "order": 11, "type": "table_cell", "bbox": { "l": 54, "t": 539.142469, "r": 419.686286, "b": 527.177889 }, "text": "Plug-Flow detention time= 300.5 min calculated for 36,111 cf (100% of inflow)", "attrs": { "row": 7, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 } ], "reading_order": 2 }, { "id": "p97.4", "order": 12, "type": "table", "bbox": { "l": 53.04, "t": 505.2, "r": 557.28, "b": 389.04 }, "text": "", "attrs": { "block_label": "table", "n_rows": 2, "n_cols": 5, "integrity": { "cells_checked": 8, "cells_flagged": 0 } }, "children": [ { "id": "p97.4.1", "order": 13, "type": "table_cell", "bbox": { "l": 54, "t": 503.142469, "r": 90.142207, "b": 477.257868 }, "text": "Volume\n#1", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p97.4.2", "order": 14, "type": "table_cell", "bbox": { "l": 120.355217, "t": 503.142469, "r": 148.95691, "b": 477.257868 }, "text": "Invert\n95.00'", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p97.4.3", "order": 15, "type": "table_cell", "bbox": { "l": 170.997811, "t": 503.142469, "r": 234.422951, "b": 477.257868 }, "text": "Avail.Storage\n16,706 cf", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p97.4.4", "order": 16, "type": "table_cell", "bbox": { "l": 246.044461, "t": 503.142469, "r": 502.944852, "b": 477.137889 }, "text": "Storage Description\nCustom Stage Data (Prismatic) Listed below (Recalc)", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p97.4.5", "order": 17, "type": "table_cell", "bbox": { "l": 57.360002, "t": 465.222448, "r": 101.273013, "b": 391.337871 }, "text": "Elevation\\n(feet)\n95.00\n96.00\n97.00\n98.00", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p97.4.6", "order": 18, "type": "table_cell", "bbox": { "l": 140.447365, "t": 465.222448, "r": 185.72688, "b": 391.337871 }, "text": "Surf.Area\\n(sq-ft)\n4,231\n5,092\n6,008\n6,981", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p97.4.7", "order": 19, "type": "table_cell", "bbox": { "l": 227.371027, "t": 465.222448, "r": 354.642567, "b": 391.337871 }, "text": "Inc.Store\\n(cubic-feet)\n0\n4,662\n5,550\n6,495", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p97.4.8", "order": 20, "type": "table_cell", "bbox": { "l": 216.402998, "t": 465.222448, "r": 354.689052, "b": 391.337871 }, "text": "Cum.Store\\n(cubic-feet)\n0\n4,662\n10,212\n16,706", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 7 } ], "reading_order": 3 }, { "id": "p97.5", "order": 21, "type": "table", "bbox": { "l": 52.08, "t": 379.92, "r": 556.08, "b": 291.84 }, "text": "", "attrs": { "block_label": "table", "n_rows": 3, "n_cols": 4, "integrity": { "cells_checked": 12, "cells_flagged": 0 } }, "children": [ { "id": "p97.5.1", "order": 22, "type": "table_cell", "bbox": { "l": 54, "t": 379.302451, "r": 86.679256, "b": 367.337871 }, "text": "Device", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p97.5.2", "order": 23, "type": "table_cell", "bbox": { "l": 98.407976, "t": 379.302451, "r": 135.030741, "b": 367.337871 }, "text": "Routing", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p97.5.3", "order": 24, "type": "table_cell", "bbox": { "l": 182.045624, "t": 379.302451, "r": 208.824841, "b": 367.337871 }, "text": "Invert", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p97.5.4", "order": 25, "type": "table_cell", "bbox": { "l": 220.650048, "t": 379.302451, "r": 290.014595, "b": 367.337871 }, "text": "Outlet Devices", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 3 }, { "id": "p97.5.5", "order": 26, "type": "table_cell", "bbox": { "l": 70.320002, "t": 365.382452, "r": 82.177372, "b": 353.417872 }, "text": "#1", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p97.5.6", "order": 27, "type": "table_cell", "bbox": { "l": 98.408891, "t": 365.382452, "r": 135.204992, "b": 353.417872 }, "text": "Primary", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p97.5.7", "order": 28, "type": "table_cell", "bbox": { "l": 354.69794, "t": 341.382452, "r": 383.299634, "b": 329.417872 }, "text": "97.60'", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p97.5.8", "order": 29, "type": "table_cell", "bbox": { "l": 220.679993, "t": 365.262472, "r": 512.979659, "b": 317.417872 }, "text": "15.0\" Round Culvert to Subsurface Basin\\nL= 35.0' RCP, square edge headwall, Ke= 0.500\\nInlet / Outlet Invert= 95.00' / 97.60' S= -0.0743'' Cc= 0.900\\nn= 0.012 Corrugated PP, smooth interior, Flow Area= 1.23 sf", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p97.5.9", "order": 30, "type": "table_cell", "bbox": { "l": 70.320002, "t": 317.382452, "r": 82.177372, "b": 293.417872 }, "text": "#2\n#3", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 8 }, { "id": "p97.5.10", "order": 31, "type": "table_cell", "bbox": { "l": 98.408891, "t": 317.382452, "r": 146.474595, "b": 293.417872 }, "text": "Device 1\nDiscarded", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 9 }, { "id": "p97.5.11", "order": 32, "type": "table_cell", "bbox": { "l": 180.288471, "t": 317.382452, "r": 208.918642, "b": 293.417872 }, "text": "97.00'\n95.00'", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 10 }, { "id": "p97.5.12", "order": 33, "type": "table_cell", "bbox": { "l": 220.679993, "t": 317.382452, "r": 531.965762, "b": 293.297892 }, "text": "4.0' long Sharp-Crested Rectangular Weir 2 End Contraction(s)\n3.100 in/hr Exfiltration over Surface area", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 11 } ], "reading_order": 4 }, { "id": "p97.6", "order": 34, "type": "footnote", "bbox": { "l": 51.84, "t": 540.48, "r": 421.68, "b": 513.84 }, "text": "Plug-Flow detention time = 300.5 min calculated for 36,111 cf (100% of inflow)\nCenter-of-Mass det. time = 300.5 min (1,100.6 - 800.1)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 5 }, { "id": "p97.7", "order": 35, "type": "footnote", "bbox": { "l": 51.84, "t": 282, "r": 430.32, "b": 256.08 }, "text": "Discarded OutFlow Max=0.49 cfs @ 14.19 hrs HW=97.79' (Free Discharge)\n3=Exfiltration (Exfiltration Controls 0.49 cfs)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 6 }, { "id": "p97.8", "order": 36, "type": "footnote", "bbox": { "l": 51.36, "t": 246.24, "r": 462.96, "b": 207.6 }, "text": "Primary OutFlow Max=0.17 cfs @ 14.19 hrs HW=97.79' (Free Discharge)\n1=Culvert to Subsurface Basin (Inlet Controls 0.17 cfs @ 1.47 fps)\n2=Sharp-Crested Rectangular Weir (Passes 0.17 cfs of 5.75 cfs potential flow)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 7 } ] }, { "document_id": 16592, "page": 98, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 7, "counts_by_type": { "caption": 1, "figure": 1, "footnote": 1, "header": 3, "text": 1 }, "build_ms": 0, "items": [ { "id": "p98.1", "order": 1, "type": "header", "bbox": { "l": 355.44, "t": 738.72, "r": 560.64, "b": 711.6 }, "text": "NOAA 24-hr D 100-Year Rainfall=9.48\"\nPrinted 04/12/2025", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p98.2", "order": 2, "type": "header", "bbox": { "l": 53.04, "t": 738, "r": 394.08, "b": 699.36 }, "text": "102 Sams -REV 12-02-25 NOAA\nPrepared by Haler Consulting\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p98.3", "order": 3, "type": "header", "bbox": { "l": 517.2, "t": 711.12, "r": 559.2, "b": 699.36 }, "text": "Page 58", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 2 }, { "id": "p98.4", "order": 4, "type": "caption", "bbox": { "l": 201.12, "t": 687.6, "r": 409.44, "b": 672.96 }, "text": "Pond 144P: WQ Infiltration Basin #1", "attrs": { "block_label": "figure_title" }, "reading_order": 3 }, { "id": "p98.5", "order": 5, "type": "figure", "bbox": { "l": 65.52, "t": 667.44, "r": 487.44, "b": 413.52 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n7.21 cfs\n8 Inflow Area=108,596 sf\nPeak Elev=97.79'\n7\nStorage=15,241 cf\n6\n5\n(cfs)\n4\nFlow\n3\n2\n0.66 cfs\n0.49 cfs\n1\n0.17 cfs\n0" }, "reading_order": 4 }, { "id": "p98.6", "order": 6, "type": "text", "bbox": { "l": 497.28, "t": 644.88, "r": 546.96, "b": 610.32 }, "text": "Inflow Outflow Discarded Primary", "attrs": { "block_label": "aside_text" }, "reading_order": 5 }, { "id": "p98.7", "order": 7, "type": "footnote", "bbox": { "l": 85.68, "t": 419.28, "r": 449.52, "b": 401.04 }, "text": "0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72 Time (hours)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 6 } ] }, { "document_id": 16592, "page": 99, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 13, "counts_by_type": { "caption": 1, "header": 2, "table": 1, "table_cell": 8, "text": 1 }, "build_ms": 20, "items": [ { "id": "p99.1", "order": 1, "type": "header", "bbox": { "l": 354.72, "t": 738.96, "r": 561.12, "b": 713.04 }, "text": "NOAA 24-hr D 100-Year Rainfall=9.48\"\nPrinted 04/12/2025", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p99.2", "order": 2, "type": "header", "bbox": { "l": 50.88, "t": 738.48, "r": 396.72, "b": 698.88 }, "text": "102 Sams -REV 12-02-25 NOAA 2\nPrepared by Haler Consulting\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p99.3", "order": 3, "type": "text", "bbox": { "l": 516.72, "t": 710.88, "r": 559.2, "b": 699.12 }, "text": "Page 59", "attrs": { "block_label": "number" }, "reading_order": 2 }, { "id": "p99.4", "order": 4, "type": "caption", "bbox": { "l": 153.6, "t": 687.84, "r": 457.44, "b": 672.96 }, "text": "Stage-Discharge for Pond 144P: WQ Infiltration Basin #1", "attrs": { "block_label": "figure_title" }, "reading_order": 3 }, { "id": "p99.5", "order": 5, "type": "table", "bbox": { "l": 54.72, "t": 663.36, "r": 506.64, "b": 58.08 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 8, "integrity": { "cells_checked": 8, "cells_flagged": 0 } }, "children": [ { "id": "p99.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 57.479999, "t": 661.126246, "r": 98.137287, "b": 64.158859 }, "text": "Elevation (feet)\n95.00\n95.05\n95.10\n95.15\n95.20\n95.25\n95.30\n95.35\n95.40\n95.45\n95.50\n95.55\n95.60\n95.65\n95.70\n95.75\n95.80\n95.85\n95.90\n95.95\n96.00\n96.05\n96.10\n96.15\n96.20\n96.25\n96.30\n96.35\n96.40\n96.45\n96.50\n96.55\n96.60\n96.65\n96.70\n96.75\n96.80\n96.85\n96.90\n96.95\n97.00\n97.05\n97.10\n97.15\n97.20\n97.25\n97.30\n97.35\n97.40\n97.45\n97.50\n97.55", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p99.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 109.680004, "t": 661.126246, "r": 154.533694, "b": 64.158859 }, "text": "Discharge (cfs)\n0.00\n0.31\n0.31\n0.31\n0.32\n0.32\n0.32\n0.33\n0.33\n0.33\n0.33\n0.34\n0.34\n0.34\n0.35\n0.35\n0.35\n0.36\n0.36\n0.36\n0.37\n0.37\n0.37\n0.38\n0.38\n0.38\n0.39\n0.39\n0.39\n0.39\n0.40\n0.40\n0.40\n0.41\n0.41\n0.41\n0.42\n0.42\n0.42\n0.43\n0.43\n0.43\n0.44\n0.44\n0.45\n0.45\n0.45\n0.46\n0.46\n0.46\n0.47\n0.47", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p99.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 166.080002, "t": 661.126246, "r": 210.875583, "b": 64.158859 }, "text": "Discarded (cfs)\n0.00\n0.31\n0.31\n0.31\n0.32\n0.32\n0.32\n0.33\n0.33\n0.33\n0.33\n0.34\n0.34\n0.34\n0.35\n0.35\n0.35\n0.36\n0.36\n0.36\n0.37\n0.37\n0.37\n0.38\n0.38\n0.38\n0.39\n0.39\n0.39\n0.39\n0.40\n0.40\n0.40\n0.41\n0.41\n0.41\n0.42\n0.42\n0.42\n0.43\n0.43\n0.43\n0.44\n0.44\n0.45\n0.45\n0.45\n0.46\n0.46\n0.46\n0.47\n0.47", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p99.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 233.160004, "t": 661.126246, "r": 267.536512, "b": 64.158859 }, "text": "Primary (cfs)\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p99.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 291, "t": 661.126246, "r": 331.657282, "b": 351.198838 }, "text": "Elevation (feet)\n97.60\n97.65\n97.70\n97.75\n97.80\n97.85\n97.90\n97.95\n98.00\n98.05\n98.10\n98.15\n98.20\n98.25\n98.30\n98.35\n98.40\n98.45\n98.50\n98.55\n98.60\n98.65\n98.70\n98.75\n98.80\n98.85", "attrs": { "row": 0, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p99.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 343.200005, "t": 661.126246, "r": 388.300713, "b": 351.198838 }, "text": "Discharge (cfs)\n0.47\n0.49\n0.53\n0.59\n0.68\n0.79\n0.92\n1.06\n1.23\n1.41\n1.60\n1.81\n2.04\n2.27\n2.52\n2.77\n3.03\n3.29\n3.56\n3.82\n4.08\n4.34\n4.59\n4.81\n5.02\n5.17", "attrs": { "row": 0, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p99.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 399.599991, "t": 661.126246, "r": 444.700722, "b": 351.198838 }, "text": "Discarded (cfs)\n0.47\n0.48\n0.48\n0.48\n0.49\n0.49\n0.49\n0.50\n0.50\n0.50\n0.50\n0.50\n0.50\n0.50\n0.50\n0.50\n0.50\n0.50\n0.50\n0.50\n0.50\n0.50\n0.50\n0.50\n0.50\n0.50", "attrs": { "row": 0, "col": 6, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p99.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 466.679993, "t": 661.126246, "r": 501.100731, "b": 351.198838 }, "text": "Primary (cfs)\n0.00\n0.01\n0.05\n0.11\n0.19\n0.30\n0.42\n0.57\n0.73\n0.91\n1.10\n1.31\n1.54\n1.77\n2.01\n2.27\n2.53\n2.79\n3.06\n3.32\n3.58\n3.84\n4.08\n4.31\n4.52\n4.67", "attrs": { "row": 0, "col": 7, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 7 } ], "reading_order": 4 } ] }, { "document_id": 16592, "page": 100, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 11, "counts_by_type": { "caption": 1, "header": 2, "table": 1, "table_cell": 6, "text": 1 }, "build_ms": 12, "items": [ { "id": "p100.1", "order": 1, "type": "header", "bbox": { "l": 355.2, "t": 738.96, "r": 561.12, "b": 703.44 }, "text": "NOAA 24-hr D 100-Year Rainfall=9.48\"\nPrinted 04/12/2025\nions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p100.2", "order": 2, "type": "header", "bbox": { "l": 51.6, "t": 738.24, "r": 395.76, "b": 699.12 }, "text": "102 Sams -REV 12-02-25 NOAA 2\nPrepared by Haler Consulting\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p100.3", "order": 3, "type": "text", "bbox": { "l": 516.72, "t": 711.12, "r": 559.44, "b": 698.88 }, "text": "Page 60", "attrs": { "block_label": "number" }, "reading_order": 2 }, { "id": "p100.4", "order": 4, "type": "caption", "bbox": { "l": 144.96, "t": 687.84, "r": 465.36, "b": 672.72 }, "text": "Stage-Area-Storage for Pond 144P: WQ Infiltration Basin #1", "attrs": { "block_label": "figure_title" }, "reading_order": 3 }, { "id": "p100.5", "order": 5, "type": "table", "bbox": { "l": 55.44, "t": 667.2, "r": 465.84, "b": 54.96 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 6, "integrity": { "cells_checked": 6, "cells_flagged": 0 } }, "children": [ { "id": "p100.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 57.479999, "t": 661.126246, "r": 98.137287, "b": 64.158859 }, "text": "Elevation (feet)\n95.00\n95.05\n95.10\n95.15\n95.20\n95.25\n95.30\n95.35\n95.40\n95.45\n95.50\n95.55\n95.60\n95.65\n95.70\n95.75\n95.80\n95.85\n95.90\n95.95\n96.00\n96.05\n96.10\n96.15\n96.20\n96.25\n96.30\n96.35\n96.40\n96.45\n96.50\n96.55\n96.60\n96.65\n96.70\n96.75\n96.80\n96.85\n96.90\n96.95\n97.00\n97.05\n97.10\n97.15\n97.20\n97.25\n97.30\n97.35\n97.40\n97.45\n97.50\n97.55", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p100.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 139.439999, "t": 661.126246, "r": 173.816353, "b": 64.158859 }, "text": "Surface (sq-ft)\n4,231\n4,274\n4,317\n4,360\n4,403\n4,446\n4,489\n4,532\n4,575\n4,618\n4,662\n4,705\n4,748\n4,791\n4,834\n4,877\n4,920\n4,963\n5,006\n5,049\n5,092\n5,138\n5,184\n5,229\n5,275\n5,321\n5,367\n5,413\n5,458\n5,504\n5,550\n5,596\n5,642\n5,687\n5,733\n5,779\n5,825\n5,871\n5,916\n5,962\n6,008\n6,057\n6,105\n6,154\n6,203\n6,251\n6,300\n6,349\n6,397\n6,446\n6,495\n6,543", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p100.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 199.55999, "t": 661.126246, "r": 249.524304, "b": 64.158859 }, "text": "Storage (cubic-feet)\n0\n213\n427\n644\n863\n1,085\n1,308\n1,534\n1,761\n1,991\n2,223\n2,457\n2,694\n2,932\n3,173\n3,415\n3,660\n3,907\n4,157\n4,408\n4,662\n4,917\n5,175\n5,436\n5,698\n5,963\n6,230\n6,500\n6,772\n7,046\n7,322\n7,601\n7,882\n8,165\n8,450\n8,738\n9,028\n9,321\n9,615\n9,912\n10,212\n10,513\n10,817\n11,124\n11,433\n11,744\n12,058\n12,374\n12,693\n13,014\n13,337\n13,663", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p100.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 273.240005, "t": 661.126246, "r": 313.897287, "b": 351.198838 }, "text": "Elevation (feet)\n97.60\n97.65\n97.70\n97.75\n97.80\n97.85\n97.90\n97.95\n98.00\n98.05\n98.10\n98.15\n98.20\n98.25\n98.30\n98.35\n98.40\n98.45\n98.50\n98.55\n98.60\n98.65\n98.70\n98.75\n98.80\n98.85", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p100.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 355.200005, "t": 661.126246, "r": 389.808242, "b": 351.198838 }, "text": "Surface (sq-ft)\n6,592\n6,640\n6,689\n6,738\n6,786\n6,835\n6,884\n6,932\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981", "attrs": { "row": 0, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p100.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 415.320008, "t": 661.126246, "r": 465.558002, "b": 351.198838 }, "text": "Storage (cubic-feet)\n13,991\n14,322\n14,655\n14,991\n15,329\n15,670\n16,013\n16,358\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706", "attrs": { "row": 0, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 } ], "reading_order": 4 } ] }, { "document_id": 16592, "page": 101, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 36, "counts_by_type": { "footnote": 3, "header": 1, "heading": 1, "table": 3, "table_cell": 28 }, "build_ms": 8, "items": [ { "id": "p101.1", "order": 1, "type": "header", "bbox": { "l": 53.28, "t": 738.72, "r": 560.88, "b": 698.4 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 100-Year Rainfall=9.48\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 61", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p101.2", "order": 2, "type": "heading", "bbox": { "l": 162.24, "t": 687.6, "r": 450, "b": 672.72 }, "text": "Summary for Pond 149P: WQ Infiltration Basin #2", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p101.3", "order": 3, "type": "table", "bbox": { "l": 50.16, "t": 664.08, "r": 549.12, "b": 515.177889 }, "text": "", "attrs": { "block_label": "table", "n_rows": 8, "n_cols": 1, "integrity": { "cells_checked": 8, "cells_flagged": 1, "flags": [ { "row": 4, "col": 0, "coverage": 0, "text": "Primary = 0.57 cfs @ 13.56 hrs, Volume= 9,111 cf" } ] } }, "children": [ { "id": "p101.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 50.16, "t": 664.08, "r": 549.12, "b": 649.344 }, "text": "Inflow Area = 86,443 sf, 27.15% Impervious, Inflow Depth = 3.84\" for 100-Year event", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 0 }, { "id": "p101.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 50.16, "t": 649.344, "r": 549.12, "b": 634.608 }, "text": "Inflow = 5.06 cfs @ 12.14 hrs, Volume= 27,698 cf", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 1 }, { "id": "p101.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 50.16, "t": 634.608, "r": 549.12, "b": 619.872 }, "text": "Outflow = 0.70 cfs @ 13.56 hrs, Volume= 27,698 cf, Atten= 86%, Lag= 85.4 min", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 2 }, { "id": "p101.3.4", "order": 7, "type": "table_cell", "bbox": { "l": 50.16, "t": 619.872, "r": 549.12, "b": 605.136 }, "text": "Discarded = 0.13 cfs @ 13.56 hrs, Volume= 18,586 cf", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 3 }, { "id": "p101.3.5", "order": 8, "type": "table_cell", "bbox": { "l": 50.16, "t": 605.136, "r": 549.12, "b": 590.4 }, "text": "Primary = 0.57 cfs @ 13.56 hrs, Volume= 9,111 cf", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 4 }, { "id": "p101.3.6", "order": 9, "type": "table_cell", "bbox": { "l": 69.023569, "t": 599.142469, "r": 195.539615, "b": 587.177889 }, "text": "Routed to Link 147L : POA", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p101.3.7", "order": 10, "type": "table_cell", "bbox": { "l": 54, "t": 575.142469, "r": 401.418122, "b": 551.177889 }, "text": "Routing by Stor-Ind method, Time Span= 0.00-72.00 hrs, dt= 0.01 hrs\nPeak Elev= 94.41' @ 13.56 hrs Surf.Area= 5,362 sf Storage= 13,337 cf", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p101.3.8", "order": 11, "type": "table_cell", "bbox": { "l": 54, "t": 539.142469, "r": 419.686286, "b": 515.177889 }, "text": "Plug-Flow detention time= 665.1 min calculated for 27,698 cf (100% of inflow)\nCenter-of-Mass det. time= 665.1 min ( 1,470.3 - 805.2 )", "attrs": { "row": 7, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 7 } ], "reading_order": 2 }, { "id": "p101.4", "order": 12, "type": "table", "bbox": { "l": 53.04, "t": 504.96, "r": 557.28, "b": 376.32 }, "text": "", "attrs": { "block_label": "table", "n_rows": 2, "n_cols": 5, "integrity": { "cells_checked": 8, "cells_flagged": 0 } }, "children": [ { "id": "p101.4.1", "order": 13, "type": "table_cell", "bbox": { "l": 54, "t": 503.142469, "r": 90.142207, "b": 477.257868 }, "text": "Volume\n#1", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p101.4.2", "order": 14, "type": "table_cell", "bbox": { "l": 120.355217, "t": 503.142469, "r": 148.95691, "b": 477.257868 }, "text": "Invert\n91.00'", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p101.4.3", "order": 15, "type": "table_cell", "bbox": { "l": 170.997811, "t": 503.142469, "r": 234.422951, "b": 477.257868 }, "text": "Avail.Storage\n13,818 cf", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p101.4.4", "order": 16, "type": "table_cell", "bbox": { "l": 246.044461, "t": 503.142469, "r": 502.944852, "b": 477.137889 }, "text": "Storage Description\nCustom Stage Data (Prismatic) Listed below (Recalc)", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p101.4.5", "order": 17, "type": "table_cell", "bbox": { "l": 57.360002, "t": 465.222448, "r": 101.273013, "b": 379.337871 }, "text": "Elevation\\n(feet)\n91.00\n92.00\n93.00\n94.00\n94.50", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p101.4.6", "order": 18, "type": "table_cell", "bbox": { "l": 140.447365, "t": 465.222448, "r": 185.72688, "b": 379.337871 }, "text": "Surf.Area\\n(sq-ft)\n2,628\n3,320\n4,067\n5,010\n5,438", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p101.4.7", "order": 19, "type": "table_cell", "bbox": { "l": 227.371027, "t": 465.222448, "r": 354.642567, "b": 379.337871 }, "text": "Inc.Store\\n(cubic-feet)\n0\n2,974\n3,694\n4,539\n2,612", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p101.4.8", "order": 20, "type": "table_cell", "bbox": { "l": 216.402998, "t": 465.222448, "r": 354.689052, "b": 379.337871 }, "text": "Cum.Store\\n(cubic-feet)\n0\n2,974\n6,668\n11,206\n13,818", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 7 } ], "reading_order": 3 }, { "id": "p101.5", "order": 21, "type": "table", "bbox": { "l": 52.08, "t": 367.92, "r": 556.08, "b": 279.12 }, "text": "", "attrs": { "block_label": "table", "n_rows": 3, "n_cols": 4, "integrity": { "cells_checked": 12, "cells_flagged": 0 } }, "children": [ { "id": "p101.5.1", "order": 22, "type": "table_cell", "bbox": { "l": 54, "t": 367.302451, "r": 86.679256, "b": 355.337871 }, "text": "Device", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p101.5.2", "order": 23, "type": "table_cell", "bbox": { "l": 98.407976, "t": 367.302451, "r": 135.030741, "b": 355.337871 }, "text": "Routing", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p101.5.3", "order": 24, "type": "table_cell", "bbox": { "l": 182.045624, "t": 367.302451, "r": 208.824841, "b": 355.337871 }, "text": "Invert", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p101.5.4", "order": 25, "type": "table_cell", "bbox": { "l": 220.650048, "t": 367.302451, "r": 290.014595, "b": 355.337871 }, "text": "Outlet Devices", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 3 }, { "id": "p101.5.5", "order": 26, "type": "table_cell", "bbox": { "l": 70.320002, "t": 353.382452, "r": 82.177372, "b": 341.417872 }, "text": "#1", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p101.5.6", "order": 27, "type": "table_cell", "bbox": { "l": 98.408891, "t": 353.382452, "r": 135.204992, "b": 341.417872 }, "text": "Primary", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p101.5.7", "order": 28, "type": "table_cell", "bbox": { "l": 354.69794, "t": 329.382452, "r": 383.299634, "b": 317.417872 }, "text": "93.80'", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p101.5.8", "order": 29, "type": "table_cell", "bbox": { "l": 220.679993, "t": 353.262472, "r": 512.979659, "b": 305.417872 }, "text": "6.0\" Round Culvert to Subsurface Basin\\nL= 35.0' RCP, square edge headwall, Ke= 0.500\\nInlet / Outlet Invert= 92.00' / 93.80' S= -0.0514'' Cc= 0.900\\nn= 0.012 Corrugated PP, smooth interior, Flow Area= 0.20 sf", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p101.5.9", "order": 30, "type": "table_cell", "bbox": { "l": 70.320002, "t": 305.382452, "r": 82.177372, "b": 281.417872 }, "text": "#2\n#3", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 8 }, { "id": "p101.5.10", "order": 31, "type": "table_cell", "bbox": { "l": 98.408891, "t": 305.382452, "r": 146.474595, "b": 281.417872 }, "text": "Device 1\nDiscarded", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 9 }, { "id": "p101.5.11", "order": 32, "type": "table_cell", "bbox": { "l": 180.288471, "t": 305.382452, "r": 208.918642, "b": 281.417872 }, "text": "93.00'\n91.00'", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 10 }, { "id": "p101.5.12", "order": 33, "type": "table_cell", "bbox": { "l": 220.679993, "t": 305.382452, "r": 531.965762, "b": 281.297892 }, "text": "4.0' long Sharp-Crested Rectangular Weir 2 End Contraction(s)\n1.050 in/hr Exfiltration over Surface area", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 11 } ], "reading_order": 4 }, { "id": "p101.6", "order": 34, "type": "footnote", "bbox": { "l": 51.12, "t": 270, "r": 429.36, "b": 244.08 }, "text": "Discarded OutFlow Max=0.13 cfs @ 13.56 hrs HW=94.41' (Free Discharge)\n3=Exfiltration (Exfiltration Controls 0.13 cfs)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 5 }, { "id": "p101.7", "order": 35, "type": "footnote", "bbox": { "l": 51.84, "t": 234.72, "r": 418.32, "b": 220.56 }, "text": "Primary OutFlow Max=0.57 cfs @ 13.56 hrs HW=94.41' (Free Discharge)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 6 }, { "id": "p101.8", "order": 36, "type": "footnote", "bbox": { "l": 53.04, "t": 226.32, "r": 468.96, "b": 195.6 }, "text": "1=Culvert to Subsurface Basin (Inlet Controls 0.57 cfs @ 2.89 fps)\n2=Sharp-Crested Rectangular Weir (Passes 0.57 cfs of 16.44 cfs potential flow)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 7 } ] }, { "document_id": 16592, "page": 102, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 7, "counts_by_type": { "caption": 1, "figure": 1, "footnote": 1, "header": 3, "text": 1 }, "build_ms": 0, "items": [ { "id": "p102.1", "order": 1, "type": "header", "bbox": { "l": 355.2, "t": 738.72, "r": 560.64, "b": 708.24 }, "text": "NOAA 24-hr D 100-Year Rainfall=9.48\"\nPrinted 04/12/2025", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p102.2", "order": 2, "type": "header", "bbox": { "l": 52.8, "t": 738, "r": 393.36, "b": 699.36 }, "text": "102 Sams -REV 12-02-25 NOAA\nPrepared by Haler Consulting\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p102.3", "order": 3, "type": "header", "bbox": { "l": 517.2, "t": 711.36, "r": 559.44, "b": 699.12 }, "text": "Page 62", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 2 }, { "id": "p102.4", "order": 4, "type": "caption", "bbox": { "l": 200.64, "t": 687.6, "r": 410.88, "b": 672.96 }, "text": "Pond 149P: WQ Infiltration Basin #2", "attrs": { "block_label": "figure_title" }, "reading_order": 3 }, { "id": "p102.5", "order": 5, "type": "figure", "bbox": { "l": 65.04, "t": 669.6, "r": 484.08, "b": 408.96 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n5.06 cfs\nInflow Area=86,443 sf\n5 Peak Elev=94.41'\nStorage=13,337 cf\n4\n(cfs) 3\nFlow\n2\n0.70 cfs\n1\n0.57 cfs\n0.13 cfs\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72" }, "reading_order": 4 }, { "id": "p102.6", "order": 6, "type": "text", "bbox": { "l": 497.04, "t": 644.88, "r": 546.96, "b": 610.08 }, "text": "Inflow Outflow Discarded Primary", "attrs": { "block_label": "aside_text" }, "reading_order": 5 }, { "id": "p102.7", "order": 7, "type": "footnote", "bbox": { "l": 85.68, "t": 419.52, "r": 449.52, "b": 401.04 }, "text": "0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72 Time (hours)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 6 } ] }, { "document_id": 16592, "page": 103, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 27, "counts_by_type": { "caption": 1, "header": 1, "table": 1, "table_cell": 24 }, "build_ms": 17, "items": [ { "id": "p103.1", "order": 1, "type": "header", "bbox": { "l": 52.8, "t": 738.48, "r": 561.36, "b": 698.64 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 100-Year Rainfall=9.48\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 63", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p103.2", "order": 2, "type": "caption", "bbox": { "l": 153.6, "t": 687.84, "r": 458.16, "b": 672.96 }, "text": "Stage-Discharge for Pond 149P: WQ Infiltration Basin #2", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p103.3", "order": 3, "type": "table", "bbox": { "l": 55.2, "t": 664.56, "r": 506.16, "b": 57.12 }, "text": "", "attrs": { "block_label": "table", "n_rows": 3, "n_cols": 8, "integrity": { "cells_checked": 16, "cells_flagged": 0 } }, "children": [ { "id": "p103.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 57.479999, "t": 661.126246, "r": 98.137287, "b": 108.31886299999996 }, "text": "Elevation (feet)\n91.00\n91.05\n91.10\n91.15\n91.20\n91.25\n91.30\n91.35\n91.40\n91.45\n91.50\n91.55\n91.60\n91.65\n91.70\n91.75\n91.80\n91.85\n91.90\n91.95\n92.00\n92.05\n92.10\n92.15\n92.20\n92.25\n92.30\n92.35\n92.40\n92.45\n92.50\n92.55\n92.60\n92.65\n92.70\n92.75\n92.80\n92.85\n92.90\n92.95\n93.00\n93.05\n93.10\n93.15\n93.20\n93.25\n93.30\n93.35", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p103.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 109.680004, "t": 661.126246, "r": 154.533694, "b": 108.31886299999996 }, "text": "Discharge (cfs)\n0.00\n0.06\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.08\n0.08\n0.08\n0.08\n0.08\n0.08\n0.08\n0.08\n0.08\n0.08\n0.08\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.11\n0.11", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p103.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 166.080002, "t": 661.126246, "r": 210.875583, "b": 108.31886299999996 }, "text": "Discarded (cfs)\n0.00\n0.06\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.08\n0.08\n0.08\n0.08\n0.08\n0.08\n0.08\n0.08\n0.08\n0.08\n0.08\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.11\n0.11", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p103.3.4", "order": 7, "type": "table_cell", "bbox": { "l": 233.160004, "t": 661.126246, "r": 267.536512, "b": 108.31886299999996 }, "text": "Primary (cfs)\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p103.3.5", "order": 8, "type": "table_cell", "bbox": { "l": 291, "t": 661.126246, "r": 331.657282, "b": 428.478844 }, "text": "Elevation (feet)\n93.60\n93.65\n93.70\n93.75\n93.80\n93.85\n93.90\n93.95\n94.00\n94.05\n94.10\n94.15\n94.20\n94.25\n94.30\n94.35\n94.40\n94.45\n94.50", "attrs": { "row": 0, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p103.3.6", "order": 9, "type": "table_cell", "bbox": { "l": 343.200005, "t": 661.126246, "r": 388.300713, "b": 428.478844 }, "text": "Discharge (cfs)\n0.11\n0.11\n0.11\n0.12\n0.12\n0.13\n0.15\n0.19\n0.23\n0.29\n0.35\n0.42\n0.49\n0.55\n0.60\n0.65\n0.69\n0.73\n0.77", "attrs": { "row": 0, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p103.3.7", "order": 10, "type": "table_cell", "bbox": { "l": 399.599991, "t": 661.126246, "r": 444.718503, "b": 428.478844 }, "text": "Discarded (cfs)\n0.11\n0.11\n0.11\n0.12\n0.12\n0.12\n0.12\n0.12\n0.12\n0.12\n0.12\n0.12\n0.13\n0.13\n0.13\n0.13\n0.13\n0.13\n0.13", "attrs": { "row": 0, "col": 6, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p103.3.8", "order": 11, "type": "table_cell", "bbox": { "l": 466.679993, "t": 661.126246, "r": 501.056501, "b": 428.478844 }, "text": "Primary (cfs)\n0.00\n0.00\n0.00\n0.00\n0.00\n0.01\n0.03\n0.07\n0.11\n0.17\n0.23\n0.30\n0.36\n0.43\n0.47\n0.52\n0.56\n0.60\n0.63", "attrs": { "row": 0, "col": 7, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 7 }, { "id": "p103.3.9", "order": 12, "type": "table_cell", "bbox": { "l": 73.320002, "t": 108.28622600000006, "r": 98.137287, "b": 75.19883800000002 }, "text": "93.40\n93.45\n93.50", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 8 }, { "id": "p103.3.10", "order": 13, "type": "table_cell", "bbox": { "l": 135.26256, "t": 97.24624900000003, "r": 154.533694, "b": 64.158859 }, "text": "0.11\n0.11\n0.11", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 9 }, { "id": "p103.3.11", "order": 14, "type": "table_cell", "bbox": { "l": 191.560334, "t": 97.24624900000003, "r": 210.875583, "b": 64.158859 }, "text": "0.11\n0.11\n0.11", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 10 }, { "id": "p103.3.12", "order": 15, "type": "table_cell", "bbox": { "l": 248.000856, "t": 97.24624900000003, "r": 267.196089, "b": 64.158859 }, "text": "0.00\n0.00\n0.00", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 11 }, { "id": "p103.3.13", "order": 16, "type": "table_cell", "bbox": { "l": 280.68, "t": 102.9645, "r": 337.05, "b": 91.5034 }, "text": "", "attrs": { "row": 1, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 12 }, { "id": "p103.3.14", "order": 17, "type": "table_cell", "bbox": { "l": 337.05, "t": 102.9645, "r": 393.42, "b": 91.5034 }, "text": "", "attrs": { "row": 1, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 13 }, { "id": "p103.3.15", "order": 18, "type": "table_cell", "bbox": { "l": 393.42, "t": 102.9645, "r": 449.79, "b": 91.5034 }, "text": "", "attrs": { "row": 1, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 14 }, { "id": "p103.3.16", "order": 19, "type": "table_cell", "bbox": { "l": 449.79, "t": 102.9645, "r": 506.16, "b": 91.5034 }, "text": "", "attrs": { "row": 1, "col": 7, "rowspan": 1, "colspan": 1 }, "reading_order": 15 }, { "id": "p103.3.17", "order": 20, "type": "table_cell", "bbox": { "l": 73.320002, "t": 75.166246, "r": 98.137287, "b": 64.158859 }, "text": "93.55", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p103.3.18", "order": 21, "type": "table_cell", "bbox": { "l": 135.26256, "t": 108.28622600000006, "r": 154.533694, "b": 97.27883899999995 }, "text": "0.11", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p103.3.19", "order": 22, "type": "table_cell", "bbox": { "l": 191.560334, "t": 108.28622600000006, "r": 210.875583, "b": 97.27883899999995 }, "text": "0.11", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p103.3.20", "order": 23, "type": "table_cell", "bbox": { "l": 248.000856, "t": 108.28622600000006, "r": 267.196089, "b": 97.27883899999995 }, "text": "0.00", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p103.3.21", "order": 24, "type": "table_cell", "bbox": { "l": 280.68, "t": 68.5811, "r": 337.05, "b": 57.12 }, "text": "", "attrs": { "row": 2, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 20 }, { "id": "p103.3.22", "order": 25, "type": "table_cell", "bbox": { "l": 337.05, "t": 68.5811, "r": 393.42, "b": 57.12 }, "text": "", "attrs": { "row": 2, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 21 }, { "id": "p103.3.23", "order": 26, "type": "table_cell", "bbox": { "l": 393.42, "t": 68.5811, "r": 449.79, "b": 57.12 }, "text": "", "attrs": { "row": 2, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 22 }, { "id": "p103.3.24", "order": 27, "type": "table_cell", "bbox": { "l": 449.79, "t": 68.5811, "r": 506.16, "b": 57.12 }, "text": "", "attrs": { "row": 2, "col": 7, "rowspan": 1, "colspan": 1 }, "reading_order": 23 } ], "reading_order": 2 } ] }, { "document_id": 16592, "page": 104, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 52, "counts_by_type": { "caption": 1, "header": 2, "table": 1, "table_cell": 48 }, "build_ms": 11, "items": [ { "id": "p104.1", "order": 1, "type": "header", "bbox": { "l": 355.2, "t": 738.96, "r": 560.88, "b": 701.76 }, "text": "NOAA 24-hr D 100-Year Rainfall=9.48\"\nPrinted 04/12/2025\nions LLC Page 64", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p104.2", "order": 2, "type": "header", "bbox": { "l": 51.6, "t": 738.24, "r": 396.96, "b": 699.36 }, "text": "102 Sams -REV 12-02-25\nPrepared by Haler Consulting\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p104.3", "order": 3, "type": "caption", "bbox": { "l": 145.92, "t": 687.84, "r": 466.08, "b": 672.96 }, "text": "Stage-Area-Storage for Pond 149P: WQ Infiltration Basin #2", "attrs": { "block_label": "figure_title" }, "reading_order": 2 }, { "id": "p104.4", "order": 4, "type": "table", "bbox": { "l": 54.96, "t": 665.52, "r": 465.558002, "b": 51.84 }, "text": "", "attrs": { "block_label": "table", "n_rows": 8, "n_cols": 6, "integrity": { "cells_checked": 48, "cells_flagged": 4, "flags": [ { "row": 1, "col": 5, "coverage": 0, "text": "10,222" }, { "row": 2, "col": 5, "coverage": 0, "text": "10,468" }, { "row": 4, "col": 5, "coverage": 0, "text": "11,717" }, { "row": 6, "col": 5, "coverage": 0, "text": "12,488" } ] } }, "children": [ { "id": "p104.4.1", "order": 5, "type": "table_cell", "bbox": { "l": 57.479999, "t": 661.126246, "r": 98.137287, "b": 594.078858 }, "text": "Elevation (feet)\n91.00\n91.05\n91.10\n91.15", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p104.4.2", "order": 6, "type": "table_cell", "bbox": { "l": 139.439999, "t": 661.126246, "r": 173.816353, "b": 594.078858 }, "text": "Surface (sq-ft)\n2,628\n2,663\n2,697\n2,732", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p104.4.3", "order": 7, "type": "table_cell", "bbox": { "l": 199.55999, "t": 661.126246, "r": 249.522956, "b": 594.078858 }, "text": "Storage (cubic-feet)\n0\n132\n266\n402", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p104.4.4", "order": 8, "type": "table_cell", "bbox": { "l": 273.240005, "t": 661.126246, "r": 313.897287, "b": 594.078858 }, "text": "Elevation (feet)\n93.60\n93.65\n93.70\n93.75", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p104.4.5", "order": 9, "type": "table_cell", "bbox": { "l": 355.200005, "t": 661.126246, "r": 389.576359, "b": 594.078858 }, "text": "Surface (sq-ft)\n4,633\n4,680\n4,727\n4,774", "attrs": { "row": 0, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p104.4.6", "order": 10, "type": "table_cell", "bbox": { "l": 415.320008, "t": 661.126246, "r": 465.284304, "b": 594.078858 }, "text": "Storage (cubic-feet)\n9,277\n9,510\n9,745\n9,983", "attrs": { "row": 0, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p104.4.7", "order": 11, "type": "table_cell", "bbox": { "l": 73.320002, "t": 594.046244, "r": 98.137287, "b": 583.038857 }, "text": "91.20", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p104.4.8", "order": 12, "type": "table_cell", "bbox": { "l": 148.972477, "t": 594.046244, "r": 173.773196, "b": 583.038857 }, "text": "2,766", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p104.4.9", "order": 13, "type": "table_cell", "bbox": { "l": 232.992149, "t": 594.046244, "r": 249.447055, "b": 583.038857 }, "text": "539", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p104.4.10", "order": 14, "type": "table_cell", "bbox": { "l": 289.080002, "t": 594.046244, "r": 313.897287, "b": 583.038857 }, "text": "93.80", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p104.4.11", "order": 15, "type": "table_cell", "bbox": { "l": 364.732477, "t": 594.046244, "r": 389.533196, "b": 583.038857 }, "text": "4,821", "attrs": { "row": 1, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p104.4.12", "order": 16, "type": "table_cell", "bbox": { "l": 394.36, "t": 607.6257, "r": 462.24, "b": 596.0468 }, "text": "10,222", "attrs": { "row": 1, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 11 }, { "id": "p104.4.13", "order": 17, "type": "table_cell", "bbox": { "l": 73.320002, "t": 583.006243, "r": 98.137287, "b": 571.9988559999999 }, "text": "91.25", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 12 }, { "id": "p104.4.14", "order": 18, "type": "table_cell", "bbox": { "l": 148.972477, "t": 583.006243, "r": 173.773196, "b": 571.9988559999999 }, "text": "2,801", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p104.4.15", "order": 19, "type": "table_cell", "bbox": { "l": 232.992149, "t": 583.006243, "r": 249.447055, "b": 571.9988559999999 }, "text": "679", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p104.4.16", "order": 20, "type": "table_cell", "bbox": { "l": 289.080002, "t": 583.006243, "r": 313.897287, "b": 571.9988559999999 }, "text": "93.85", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p104.4.17", "order": 21, "type": "table_cell", "bbox": { "l": 364.732477, "t": 583.006243, "r": 389.533196, "b": 571.9988559999999 }, "text": "4,869", "attrs": { "row": 2, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p104.4.18", "order": 22, "type": "table_cell", "bbox": { "l": 394.36, "t": 596.0468, "r": 462.24, "b": 584.4679 }, "text": "10,468", "attrs": { "row": 2, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 17 }, { "id": "p104.4.19", "order": 23, "type": "table_cell", "bbox": { "l": 73.320002, "t": 571.966242, "r": 98.137287, "b": 527.838853 }, "text": "91.30\n91.35\n91.40\n91.45", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 18 }, { "id": "p104.4.20", "order": 24, "type": "table_cell", "bbox": { "l": 148.972477, "t": 571.966242, "r": 173.773196, "b": 527.838853 }, "text": "2,836\n2,870\n2,905\n2,939", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 19 }, { "id": "p104.4.21", "order": 25, "type": "table_cell", "bbox": { "l": 224.707019, "t": 571.966242, "r": 249.524304, "b": 527.838853 }, "text": "820\n962\n1,107\n1,253", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 20 }, { "id": "p104.4.22", "order": 26, "type": "table_cell", "bbox": { "l": 289.080002, "t": 571.966242, "r": 313.897287, "b": 527.838853 }, "text": "93.90\n93.95\n94.00\n94.05", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 21 }, { "id": "p104.4.23", "order": 27, "type": "table_cell", "bbox": { "l": 364.732477, "t": 571.966242, "r": 389.533196, "b": 527.838853 }, "text": "4,916\n4,963\n5,010\n5,053", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 22 }, { "id": "p104.4.24", "order": 28, "type": "table_cell", "bbox": { "l": 434.943599, "t": 571.966242, "r": 465.246354, "b": 527.838853 }, "text": "10,710\n10,957\n11,206\n11,458", "attrs": { "row": 3, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 23 }, { "id": "p104.4.25", "order": 29, "type": "table_cell", "bbox": { "l": 73.320002, "t": 527.806238, "r": 98.137287, "b": 516.798851 }, "text": "91.50", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 24 }, { "id": "p104.4.26", "order": 30, "type": "table_cell", "bbox": { "l": 148.972477, "t": 527.806238, "r": 173.773196, "b": 516.798851 }, "text": "2,974", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 25 }, { "id": "p104.4.27", "order": 31, "type": "table_cell", "bbox": { "l": 224.707019, "t": 527.806238, "r": 249.524304, "b": 516.798851 }, "text": "1,401", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 26 }, { "id": "p104.4.28", "order": 32, "type": "table_cell", "bbox": { "l": 289.080002, "t": 527.806238, "r": 313.897287, "b": 516.798851 }, "text": "94.10", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 27 }, { "id": "p104.4.29", "order": 33, "type": "table_cell", "bbox": { "l": 364.732477, "t": 527.806238, "r": 389.533196, "b": 516.798851 }, "text": "5,096", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 28 }, { "id": "p104.4.30", "order": 34, "type": "table_cell", "bbox": { "l": 394.36, "t": 538.1525, "r": 462.24, "b": 526.5736 }, "text": "11,717", "attrs": { "row": 4, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 29 }, { "id": "p104.4.31", "order": 35, "type": "table_cell", "bbox": { "l": 73.320002, "t": 516.766237, "r": 98.137287, "b": 494.71885 }, "text": "91.55\n91.60", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 30 }, { "id": "p104.4.32", "order": 36, "type": "table_cell", "bbox": { "l": 148.972477, "t": 516.766237, "r": 173.773196, "b": 494.71885 }, "text": "3,009\n3,043", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 31 }, { "id": "p104.4.33", "order": 37, "type": "table_cell", "bbox": { "l": 224.707019, "t": 516.766237, "r": 249.524304, "b": 494.71885 }, "text": "1,550\n1,701", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 32 }, { "id": "p104.4.34", "order": 38, "type": "table_cell", "bbox": { "l": 289.080002, "t": 516.766237, "r": 313.897287, "b": 494.71885 }, "text": "94.15\n94.20", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 33 }, { "id": "p104.4.35", "order": 39, "type": "table_cell", "bbox": { "l": 364.732477, "t": 516.766237, "r": 389.533196, "b": 494.71885 }, "text": "5,138\n5,181", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 34 }, { "id": "p104.4.36", "order": 40, "type": "table_cell", "bbox": { "l": 434.943599, "t": 516.766237, "r": 465.246354, "b": 494.71885 }, "text": "11,967\n12,225", "attrs": { "row": 5, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 35 }, { "id": "p104.4.37", "order": 41, "type": "table_cell", "bbox": { "l": 73.320002, "t": 494.686236, "r": 98.137287, "b": 483.678849 }, "text": "91.65", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 36 }, { "id": "p104.4.38", "order": 42, "type": "table_cell", "bbox": { "l": 148.972477, "t": 494.686236, "r": 173.773196, "b": 483.678849 }, "text": "3,078", "attrs": { "row": 6, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 37 }, { "id": "p104.4.39", "order": 43, "type": "table_cell", "bbox": { "l": 224.707019, "t": 494.686236, "r": 249.524304, "b": 483.678849 }, "text": "1,854", "attrs": { "row": 6, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 38 }, { "id": "p104.4.40", "order": 44, "type": "table_cell", "bbox": { "l": 289.080002, "t": 494.686236, "r": 313.897287, "b": 483.678849 }, "text": "94.25", "attrs": { "row": 6, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 39 }, { "id": "p104.4.41", "order": 45, "type": "table_cell", "bbox": { "l": 364.732477, "t": 494.686236, "r": 389.533196, "b": 483.678849 }, "text": "5,224", "attrs": { "row": 6, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 40 }, { "id": "p104.4.42", "order": 46, "type": "table_cell", "bbox": { "l": 394.36, "t": 503.4158, "r": 462.24, "b": 491.837 }, "text": "12,488", "attrs": { "row": 6, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 41 }, { "id": "p104.4.43", "order": 47, "type": "table_cell", "bbox": { "l": 73.320002, "t": 483.646234, "r": 98.137287, "b": 64.158859 }, "text": "91.70\n91.75\n91.80\n91.85\n91.90\n91.95\n92.00\n92.05\n92.10\n92.15\n92.20\n92.25\n92.30\n92.35\n92.40\n92.45\n92.50\n92.55\n92.60\n92.65\n92.70\n92.75\n92.80\n92.85\n92.90\n92.95\n93.00\n93.05\n93.10\n93.15\n93.20\n93.25\n93.30\n93.35\n93.40\n93.45\n93.50\n93.55", "attrs": { "row": 7, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 42 }, { "id": "p104.4.44", "order": 48, "type": "table_cell", "bbox": { "l": 148.972477, "t": 483.646234, "r": 173.773196, "b": 64.158859 }, "text": "3,112\n3,147\n3,182\n3,216\n3,251\n3,285\n3,320\n3,357\n3,395\n3,432\n3,469\n3,507\n3,544\n3,581\n3,619\n3,656\n3,694\n3,731\n3,768\n3,806\n3,843\n3,880\n3,918\n3,955\n3,992\n4,030\n4,067\n4,114\n4,161\n4,208\n4,256\n4,303\n4,350\n4,397\n4,444\n4,491\n4,539\n4,586", "attrs": { "row": 7, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 43 }, { "id": "p104.4.45", "order": 49, "type": "table_cell", "bbox": { "l": 224.707019, "t": 483.646234, "r": 249.524304, "b": 64.158859 }, "text": "2,009\n2,166\n2,324\n2,484\n2,645\n2,809\n2,974\n3,141\n3,310\n3,480\n3,653\n3,827\n4,004\n4,182\n4,362\n4,544\n4,727\n4,913\n5,100\n5,290\n5,481\n5,674\n5,869\n6,066\n6,265\n6,465\n6,668\n6,872\n7,079\n7,288\n7,500\n7,714\n7,930\n8,149\n8,370\n8,593\n8,819\n9,047", "attrs": { "row": 7, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 44 }, { "id": "p104.4.46", "order": 50, "type": "table_cell", "bbox": { "l": 289.080002, "t": 483.646234, "r": 313.897287, "b": 428.478844 }, "text": "94.30\n94.35\n94.40\n94.45\n94.50", "attrs": { "row": 7, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 45 }, { "id": "p104.4.47", "order": 51, "type": "table_cell", "bbox": { "l": 364.732477, "t": 483.646234, "r": 389.808242, "b": 428.478844 }, "text": "5,267\n5,310\n5,352\n5,395\n5,438", "attrs": { "row": 7, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 46 }, { "id": "p104.4.48", "order": 52, "type": "table_cell", "bbox": { "l": 434.943599, "t": 483.646234, "r": 465.558002, "b": 428.478844 }, "text": "12,748\n13,012\n13,278\n13,547\n13,818", "attrs": { "row": 7, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 47 } ], "reading_order": 3 } ] }, { "document_id": 16592, "page": 105, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 11, "counts_by_type": { "caption": 2, "figure": 1, "form_field": 1, "header": 2, "heading": 1, "text": 4 }, "build_ms": 22, "items": [ { "id": "p105.1", "order": 1, "type": "header", "bbox": { "l": 354.96, "t": 738.96, "r": 560.88, "b": 712.56 }, "text": "NOAA 24-hr D 100-Year Rainfall=9.48\"\nPrinted 04/12/2025", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p105.2", "order": 2, "type": "header", "bbox": { "l": 53.52, "t": 737.76, "r": 393.36, "b": 699.36 }, "text": "102 Sams -REV 12-02-25 NOAA\nPrepared by Haler Consulting\nHydroCAD[p105.2.2] 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "children": [ { "id": "p105.2.1", "order": 3, "type": "form_field", "bbox": { "l": 96, "t": 712.16, "r": 108, "b": 700.16 }, "text": "", "attrs": { "field_kind": "radio", "label": "ledR 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions …", "source": "glyph_estimate", "bbox_estimated": true }, "reading_order": 0 }, { "id": "p105.2.2", "order": 4, "type": "text", "bbox": { "l": 53.52, "t": 737.76, "r": 393.36, "b": 699.36 }, "text": "^{\\circledR}", "attrs": { "inline": true, "text_offset": 65, "text_span": 10, "bbox_estimated": true }, "reading_order": 1 } ], "level": 2, "reading_order": 1 }, { "id": "p105.3", "order": 5, "type": "text", "bbox": { "l": 517.2, "t": 711.12, "r": 559.44, "b": 699.12 }, "text": "Page 65", "attrs": { "block_label": "number" }, "reading_order": 2 }, { "id": "p105.4", "order": 6, "type": "heading", "bbox": { "l": 220.8, "t": 687.6, "r": 392.16, "b": 672.48 }, "text": "Summary for Link 147L: POA", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 3 }, { "id": "p105.5", "order": 7, "type": "text", "bbox": { "l": 52.32, "t": 660, "r": 517.92, "b": 622.32 }, "text": "Inflow Area = 536,539 sf, 11.25% Impervious, Inflow Depth = 1.04\" for 100-Year event\nInflow = 2.36 cfs @ 13.51 hrs, Volume = 46,363 cf\nPrimary = 2.36 cfs @ 13.51 hrs, Volume = 46,363 cf, Atten = 0%, Lag = 0.0 min", "reading_order": 4 }, { "id": "p105.6", "order": 8, "type": "text", "bbox": { "l": 52.08, "t": 611.52, "r": 367.2, "b": 597.84 }, "text": "Primary outflow = Inflow, Time Span = 0.00-72.00 hrs, dt = 0.01 hrs", "reading_order": 5 }, { "id": "p105.7", "order": 9, "type": "caption", "bbox": { "l": 258.96, "t": 586.56, "r": 352.56, "b": 572.4 }, "text": "Link 147L: POA", "attrs": { "block_label": "figure_title" }, "reading_order": 6 }, { "id": "p105.8", "order": 10, "type": "caption", "bbox": { "l": 252.96, "t": 566.64, "r": 303.84, "b": 555.6 }, "text": "Hydrograph", "attrs": { "block_label": "figure_title" }, "reading_order": 7 }, { "id": "p105.9", "order": 11, "type": "figure", "bbox": { "l": 60.48, "t": 563.76, "r": 553.68, "b": 299.76 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nInflow\n2.36 cfs Primary\nInflow Area=536,539 sf\n2.36 cfs\n2\n(cfs)\nFlow\n1\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72\nTime (hours)" }, "reading_order": 8 } ] }, { "document_id": 16592, "page": 106, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 1, "counts_by_type": { "heading": 1 }, "build_ms": 0, "items": [ { "id": "p106.1", "order": 1, "type": "heading", "bbox": { "l": 251.76, "t": 717.12, "r": 359.28, "b": 697.44 }, "text": "APPENDIX D", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 0 } ] }, { "document_id": 16592, "page": 107, "width": 792, "height": 612, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 792, "height_pt": 612, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 105, "counts_by_type": { "table": 1, "table_cell": 101, "text": 2, "title": 1 }, "build_ms": 5, "items": [ { "id": "p107.1", "order": 1, "type": "title", "bbox": { "l": 278.16, "t": 514.56, "r": 517.44, "b": 478.32 }, "text": "HALER CONSULTING, LLC\n102 Sams Road Pipe Calculations", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 0 }, { "id": "p107.2", "order": 2, "type": "text", "bbox": { "l": 95.28, "t": 465.12, "r": 183.36, "b": 426.48 }, "text": "102 Sams Road\nJackson\nBlock 20101, Lot 29&30\nOcean County", "reading_order": 1 }, { "id": "p107.3", "order": 3, "type": "text", "bbox": { "l": 596.4, "t": 465.36, "r": 647.28, "b": 446.88 }, "text": "23-092\nOctober 2025", "reading_order": 2 }, { "id": "p107.4", "order": 4, "type": "table", "bbox": { "l": 94.8, "t": 390.72, "r": 698.88, "b": 196.56 }, "text": "", "attrs": { "block_label": "table", "n_rows": 7, "n_cols": 15, "integrity": { "cells_checked": 49, "cells_flagged": 1, "flags": [ { "row": 1, "col": 5, "coverage": 0.33, "text": "Runoff Coefficient C" } ] } }, "children": [ { "id": "p107.4.1", "order": 5, "type": "table_cell", "bbox": { "l": 126.359997, "t": 388.31237699999997, "r": 150.537598, "b": 379.591088 }, "text": "Station", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "column_header": true, "header_source": "pdf" }, "reading_order": 0 }, { "id": "p107.4.2", "order": 6, "type": "table_cell", "bbox": { "l": 175.344, "t": 390.72, "r": 215.616, "b": 369.1467 }, "text": "", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "column_header": true, "header_source": "pdf" }, "reading_order": 1 }, { "id": "p107.4.3", "order": 7, "type": "table_cell", "bbox": { "l": 220.667389, "t": 388.31237699999997, "r": 293.916344, "b": 379.591088 }, "text": "Drainage Area A (ac)", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 2, "bbox_refit": true, "column_header": true, "header_source": "pdf" }, "reading_order": 2 }, { "id": "p107.4.4", "order": 8, "type": "table_cell", "bbox": { "l": 296.16, "t": 390.72, "r": 336.432, "b": 369.1467 }, "text": "", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "column_header": true, "header_source": "pdf" }, "reading_order": 3 }, { "id": "p107.4.5", "order": 9, "type": "table_cell", "bbox": { "l": 375.088411, "t": 388.31237699999997, "r": 393.998854, "b": 379.591088 }, "text": "A x C", "attrs": { "row": 0, "col": 4, "rowspan": 1, "colspan": 2, "bbox_refit": true, "column_header": true, "header_source": "pdf" }, "reading_order": 4 }, { "id": "p107.4.6", "order": 10, "type": "table_cell", "bbox": { "l": 416.976, "t": 390.72, "r": 457.248, "b": 369.1467 }, "text": "", "attrs": { "row": 0, "col": 5, "rowspan": 1, "colspan": 1, "column_header": true, "header_source": "pdf" }, "reading_order": 5 }, { "id": "p107.4.7", "order": 11, "type": "table_cell", "bbox": { "l": 457.248, "t": 390.72, "r": 497.52, "b": 369.1467 }, "text": "", "attrs": { "row": 0, "col": 6, "rowspan": 1, "colspan": 1, "column_header": true, "header_source": "pdf" }, "reading_order": 6 }, { "id": "p107.4.8", "order": 12, "type": "table_cell", "bbox": { "l": 497.52, "t": 390.72, "r": 537.792, "b": 369.1467 }, "text": "", "attrs": { "row": 0, "col": 7, "rowspan": 1, "colspan": 1, "column_header": true, "header_source": "pdf" }, "reading_order": 7 }, { "id": "p107.4.9", "order": 13, "type": "table_cell", "bbox": { "l": 537.792, "t": 390.72, "r": 578.064, "b": 369.1467 }, "text": "", "attrs": { "row": 0, "col": 8, "rowspan": 1, "colspan": 1, "column_header": true, "header_source": "pdf" }, "reading_order": 8 }, { "id": "p107.4.10", "order": 14, "type": "table_cell", "bbox": { "l": 601.621797, "t": 388.31237699999997, "r": 640.655285, "b": 379.591088 }, "text": "Invert Elev.", "attrs": { "row": 0, "col": 9, "rowspan": 1, "colspan": 2, "bbox_refit": true, "column_header": true, "header_source": "pdf" }, "reading_order": 9 }, { "id": "p107.4.11", "order": 15, "type": "table_cell", "bbox": { "l": 658.608, "t": 390.72, "r": 698.88, "b": 369.1467 }, "text": "", "attrs": { "row": 0, "col": 10, "rowspan": 1, "colspan": 1, "column_header": true, "header_source": "pdf" }, "reading_order": 10 }, { "id": "p107.4.12", "order": 16, "type": "table_cell", "bbox": { "l": 112.819301, "t": 344.389403, "r": 121.524024, "b": 326.15719 }, "text": "From", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 }, { "id": "p107.4.13", "order": 17, "type": "table_cell", "bbox": { "l": 154.458282, "t": 339.82937, "r": 163.163005, "b": 330.717171 }, "text": "To", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 12 }, { "id": "p107.4.14", "order": 18, "type": "table_cell", "bbox": { "l": 193.697876, "t": 353.019802, "r": 202.402598, "b": 317.516611 }, "text": "Length (ft)", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p107.4.15", "order": 19, "type": "table_cell", "bbox": { "l": 230.77801, "t": 355.607868, "r": 239.482733, "b": 314.876494 }, "text": "Incremental", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p107.4.16", "order": 20, "type": "table_cell", "bbox": { "l": 270.858827, "t": 344.00133, "r": 279.56355, "b": 326.636574 }, "text": "Total", "attrs": { "row": 1, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p107.4.17", "order": 21, "type": "table_cell", "bbox": { "l": 296.16, "t": 369.1467, "r": 336.432, "b": 347.5733 }, "text": "Runoff Coefficient C", "attrs": { "row": 1, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 16 }, { "id": "p107.4.18", "order": 22, "type": "table_cell", "bbox": { "l": 360.976507, "t": 355.607868, "r": 369.68123, "b": 314.876494 }, "text": "Incremental", "attrs": { "row": 1, "col": 6, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p107.4.19", "order": 23, "type": "table_cell", "bbox": { "l": 398.057571, "t": 344.00133, "r": 406.762294, "b": 326.636574 }, "text": "Total", "attrs": { "row": 1, "col": 7, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p107.4.20", "order": 24, "type": "table_cell", "bbox": { "l": 435.138682, "t": 368.25658, "r": 443.843405, "b": 302.634679 }, "text": "Rainfall Intensity I", "attrs": { "row": 1, "col": 8, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p107.4.21", "order": 25, "type": "table_cell", "bbox": { "l": 472.217376, "t": 369.389584, "r": 480.922098, "b": 301.196574 }, "text": "Total Runoff Q=CIA", "attrs": { "row": 1, "col": 9, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p107.4.22", "order": 26, "type": "table_cell", "bbox": { "l": 509.298486, "t": 366.576907, "r": 518.003209, "b": 303.955937 }, "text": "Pipe Diameter (in)", "attrs": { "row": 1, "col": 10, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p107.4.23", "order": 27, "type": "table_cell", "bbox": { "l": 553.694385, "t": 352.568801, "r": 562.399108, "b": 298.434836 }, "text": "Capacity Full (ft ³/sec)", "attrs": { "row": 1, "col": 11, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 22 }, { "id": "p107.4.24", "order": 28, "type": "table_cell", "bbox": { "l": 597.497614, "t": 353.920656, "r": 606.202336, "b": 316.674737 }, "text": "Upper End", "attrs": { "row": 1, "col": 12, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 23 }, { "id": "p107.4.25", "order": 29, "type": "table_cell", "bbox": { "l": 635.776013, "t": 353.920656, "r": 644.480735, "b": 316.674737 }, "text": "Lower End", "attrs": { "row": 1, "col": 13, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 24 }, { "id": "p107.4.26", "order": 30, "type": "table_cell", "bbox": { "l": 672.857077, "t": 354.318589, "r": 681.5618, "b": 316.314623 }, "text": "Slope (ft/ft)", "attrs": { "row": 1, "col": 14, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 25 }, { "id": "p107.4.27", "order": 31, "type": "table_cell", "bbox": { "l": 94.8, "t": 347.5733, "r": 135.072, "b": 326 }, "text": "", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 26 }, { "id": "p107.4.28", "order": 32, "type": "table_cell", "bbox": { "l": 135.072, "t": 347.5733, "r": 175.344, "b": 326 }, "text": "", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1 }, "reading_order": 27 }, { "id": "p107.4.29", "order": 33, "type": "table_cell", "bbox": { "l": 175.344, "t": 347.5733, "r": 215.616, "b": 326 }, "text": "", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 28 }, { "id": "p107.4.30", "order": 34, "type": "table_cell", "bbox": { "l": 215.616, "t": 347.5733, "r": 255.888, "b": 326 }, "text": "", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 29 }, { "id": "p107.4.31", "order": 35, "type": "table_cell", "bbox": { "l": 255.888, "t": 347.5733, "r": 296.16, "b": 326 }, "text": "", "attrs": { "row": 2, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 30 }, { "id": "p107.4.32", "order": 36, "type": "table_cell", "bbox": { "l": 296.16, "t": 347.5733, "r": 336.432, "b": 326 }, "text": "", "attrs": { "row": 2, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 31 }, { "id": "p107.4.33", "order": 37, "type": "table_cell", "bbox": { "l": 336.432, "t": 347.5733, "r": 376.704, "b": 326 }, "text": "", "attrs": { "row": 2, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 32 }, { "id": "p107.4.34", "order": 38, "type": "table_cell", "bbox": { "l": 376.704, "t": 347.5733, "r": 416.976, "b": 326 }, "text": "", "attrs": { "row": 2, "col": 7, "rowspan": 1, "colspan": 1 }, "reading_order": 33 }, { "id": "p107.4.35", "order": 39, "type": "table_cell", "bbox": { "l": 416.976, "t": 347.5733, "r": 457.248, "b": 326 }, "text": "", "attrs": { "row": 2, "col": 8, "rowspan": 1, "colspan": 1 }, "reading_order": 34 }, { "id": "p107.4.36", "order": 40, "type": "table_cell", "bbox": { "l": 457.248, "t": 347.5733, "r": 497.52, "b": 326 }, "text": "", "attrs": { "row": 2, "col": 9, "rowspan": 1, "colspan": 1 }, "reading_order": 35 }, { "id": "p107.4.37", "order": 41, "type": "table_cell", "bbox": { "l": 497.52, "t": 347.5733, "r": 537.792, "b": 326 }, "text": "", "attrs": { "row": 2, "col": 10, "rowspan": 1, "colspan": 1 }, "reading_order": 36 }, { "id": "p107.4.38", "order": 42, "type": "table_cell", "bbox": { "l": 537.792, "t": 347.5733, "r": 578.064, "b": 326 }, "text": "", "attrs": { "row": 2, "col": 11, "rowspan": 1, "colspan": 1 }, "reading_order": 37 }, { "id": "p107.4.39", "order": 43, "type": "table_cell", "bbox": { "l": 578.064, "t": 347.5733, "r": 618.336, "b": 326 }, "text": "", "attrs": { "row": 2, "col": 12, "rowspan": 1, "colspan": 1 }, "reading_order": 38 }, { "id": "p107.4.40", "order": 44, "type": "table_cell", "bbox": { "l": 618.336, "t": 347.5733, "r": 658.608, "b": 326 }, "text": "", "attrs": { "row": 2, "col": 13, "rowspan": 1, "colspan": 1 }, "reading_order": 39 }, { "id": "p107.4.41", "order": 45, "type": "table_cell", "bbox": { "l": 658.608, "t": 347.5733, "r": 698.88, "b": 326 }, "text": "", "attrs": { "row": 2, "col": 14, "rowspan": 1, "colspan": 1 }, "reading_order": 40 }, { "id": "p107.4.42", "order": 46, "type": "table_cell", "bbox": { "l": 103.319996, "t": 276.352378, "r": 131.890814, "b": 254.071076 }, "text": "INLET 2\nINLET 1", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 41 }, { "id": "p107.4.43", "order": 47, "type": "table_cell", "bbox": { "l": 143.800531, "t": 276.352378, "r": 174.580365, "b": 254.071076 }, "text": "INLET 1\nOUTLET", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 42 }, { "id": "p107.4.44", "order": 48, "type": "table_cell", "bbox": { "l": 190.923624, "t": 276.352378, "r": 206.103855, "b": 254.071076 }, "text": "38.0\n54.0", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 43 }, { "id": "p107.4.45", "order": 49, "type": "table_cell", "bbox": { "l": 225.886805, "t": 276.352378, "r": 245.345473, "b": 254.071076 }, "text": "2.976\n2.976", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 44 }, { "id": "p107.4.46", "order": 50, "type": "table_cell", "bbox": { "l": 265.979348, "t": 276.352378, "r": 285.453279, "b": 254.071076 }, "text": "2.976\n2.976", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 45 }, { "id": "p107.4.47", "order": 51, "type": "table_cell", "bbox": { "l": 314.696534, "t": 276.352378, "r": 329.824259, "b": 254.071076 }, "text": "0.98\n0.98", "attrs": { "row": 3, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 46 }, { "id": "p107.4.48", "order": 52, "type": "table_cell", "bbox": { "l": 356.097899, "t": 276.352378, "r": 375.57183, "b": 254.071076 }, "text": "2.916\n2.916", "attrs": { "row": 3, "col": 6, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 47 }, { "id": "p107.4.49", "order": 53, "type": "table_cell", "bbox": { "l": 395.359206, "t": 276.352378, "r": 410.486932, "b": 254.071076 }, "text": "2.92\n2.92", "attrs": { "row": 3, "col": 7, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 48 }, { "id": "p107.4.50", "order": 54, "type": "table_cell", "bbox": { "l": 434.572435, "t": 276.352378, "r": 445.450113, "b": 254.071076 }, "text": "6.7\n6.7", "attrs": { "row": 3, "col": 8, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 49 }, { "id": "p107.4.51", "order": 55, "type": "table_cell", "bbox": { "l": 467.347479, "t": 276.352378, "r": 486.82141, "b": 254.071076 }, "text": "19.54\n19.54", "attrs": { "row": 3, "col": 9, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 50 }, { "id": "p107.4.52", "order": 56, "type": "table_cell", "bbox": { "l": 509.890992, "t": 276.352378, "r": 518.549396, "b": 254.071076 }, "text": "24\n24", "attrs": { "row": 3, "col": 10, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 51 }, { "id": "p107.4.53", "order": 57, "type": "table_cell", "bbox": { "l": 548.027094, "t": 276.352378, "r": 567.501025, "b": 254.071076 }, "text": "22.51\n24.38", "attrs": { "row": 3, "col": 11, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 52 }, { "id": "p107.4.54", "order": 58, "type": "table_cell", "bbox": { "l": 592.680596, "t": 276.352378, "r": 612.154527, "b": 254.071076 }, "text": "95.40\n95.25", "attrs": { "row": 3, "col": 12, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 53 }, { "id": "p107.4.55", "order": 59, "type": "table_cell", "bbox": { "l": 630.925983, "t": 276.352378, "r": 650.447993, "b": 254.071076 }, "text": "95.25\n95.00", "attrs": { "row": 3, "col": 13, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 54 }, { "id": "p107.4.56", "order": 60, "type": "table_cell", "bbox": { "l": 665.937243, "t": 276.352378, "r": 689.696174, "b": 254.071076 }, "text": "0.0039\n0.0046", "attrs": { "row": 3, "col": 14, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 55 }, { "id": "p107.4.57", "order": 61, "type": "table_cell", "bbox": { "l": 94.8, "t": 282.8533, "r": 135.072, "b": 261.28 }, "text": "", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 56 }, { "id": "p107.4.58", "order": 62, "type": "table_cell", "bbox": { "l": 135.072, "t": 282.8533, "r": 175.344, "b": 261.28 }, "text": "", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1 }, "reading_order": 57 }, { "id": "p107.4.59", "order": 63, "type": "table_cell", "bbox": { "l": 175.344, "t": 282.8533, "r": 215.616, "b": 261.28 }, "text": "", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 58 }, { "id": "p107.4.60", "order": 64, "type": "table_cell", "bbox": { "l": 215.616, "t": 282.8533, "r": 255.888, "b": 261.28 }, "text": "", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 59 }, { "id": "p107.4.61", "order": 65, "type": "table_cell", "bbox": { "l": 255.888, "t": 282.8533, "r": 296.16, "b": 261.28 }, "text": "", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 60 }, { "id": "p107.4.62", "order": 66, "type": "table_cell", "bbox": { "l": 296.16, "t": 282.8533, "r": 336.432, "b": 261.28 }, "text": "", "attrs": { "row": 4, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 61 }, { "id": "p107.4.63", "order": 67, "type": "table_cell", "bbox": { "l": 336.432, "t": 282.8533, "r": 376.704, "b": 261.28 }, "text": "", "attrs": { "row": 4, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 62 }, { "id": "p107.4.64", "order": 68, "type": "table_cell", "bbox": { "l": 376.704, "t": 282.8533, "r": 416.976, "b": 261.28 }, "text": "", "attrs": { "row": 4, "col": 7, "rowspan": 1, "colspan": 1 }, "reading_order": 63 }, { "id": "p107.4.65", "order": 69, "type": "table_cell", "bbox": { "l": 416.976, "t": 282.8533, "r": 457.248, "b": 261.28 }, "text": "", "attrs": { "row": 4, "col": 8, "rowspan": 1, "colspan": 1 }, "reading_order": 64 }, { "id": "p107.4.66", "order": 70, "type": "table_cell", "bbox": { "l": 457.248, "t": 282.8533, "r": 497.52, "b": 261.28 }, "text": "", "attrs": { "row": 4, "col": 9, "rowspan": 1, "colspan": 1 }, "reading_order": 65 }, { "id": "p107.4.67", "order": 71, "type": "table_cell", "bbox": { "l": 497.52, "t": 282.8533, "r": 537.792, "b": 261.28 }, "text": "", "attrs": { "row": 4, "col": 10, "rowspan": 1, "colspan": 1 }, "reading_order": 66 }, { "id": "p107.4.68", "order": 72, "type": "table_cell", "bbox": { "l": 537.792, "t": 282.8533, "r": 578.064, "b": 261.28 }, "text": "", "attrs": { "row": 4, "col": 11, "rowspan": 1, "colspan": 1 }, "reading_order": 67 }, { "id": "p107.4.69", "order": 73, "type": "table_cell", "bbox": { "l": 578.064, "t": 282.8533, "r": 618.336, "b": 261.28 }, "text": "", "attrs": { "row": 4, "col": 12, "rowspan": 1, "colspan": 1 }, "reading_order": 68 }, { "id": "p107.4.70", "order": 74, "type": "table_cell", "bbox": { "l": 618.336, "t": 282.8533, "r": 658.608, "b": 261.28 }, "text": "", "attrs": { "row": 4, "col": 13, "rowspan": 1, "colspan": 1 }, "reading_order": 69 }, { "id": "p107.4.71", "order": 75, "type": "table_cell", "bbox": { "l": 658.608, "t": 282.8533, "r": 698.88, "b": 261.28 }, "text": "", "attrs": { "row": 4, "col": 14, "rowspan": 1, "colspan": 1 }, "reading_order": 70 }, { "id": "p107.4.72", "order": 76, "type": "table_cell", "bbox": { "l": 103.319996, "t": 235.67236200000002, "r": 131.890814, "b": 213.39106099999998 }, "text": "INLET 3\nINLET 4", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 71 }, { "id": "p107.4.73", "order": 77, "type": "table_cell", "bbox": { "l": 143.800531, "t": 235.67236200000002, "r": 174.580365, "b": 213.39106099999998 }, "text": "INLET 4\nOUTLET", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 72 }, { "id": "p107.4.74", "order": 78, "type": "table_cell", "bbox": { "l": 188.803256, "t": 235.67236200000002, "r": 208.261923, "b": 213.39106099999998 }, "text": "39.0\n106.0", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 73 }, { "id": "p107.4.75", "order": 79, "type": "table_cell", "bbox": { "l": 225.876426, "t": 235.67236200000002, "r": 245.345473, "b": 213.39106099999998 }, "text": "3.928\n3.928", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 74 }, { "id": "p107.4.76", "order": 80, "type": "table_cell", "bbox": { "l": 265.997359, "t": 235.67236200000002, "r": 285.456027, "b": 213.39106099999998 }, "text": "3.928\n3.928", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 75 }, { "id": "p107.4.77", "order": 81, "type": "table_cell", "bbox": { "l": 314.711797, "t": 235.67236200000002, "r": 329.827006, "b": 213.39106099999998 }, "text": "0.98\n0.98", "attrs": { "row": 5, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 76 }, { "id": "p107.4.78", "order": 82, "type": "table_cell", "bbox": { "l": 356.113162, "t": 235.67236200000002, "r": 375.574577, "b": 213.39106099999998 }, "text": "3.849\n3.849", "attrs": { "row": 5, "col": 6, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 77 }, { "id": "p107.4.79", "order": 83, "type": "table_cell", "bbox": { "l": 395.37447, "t": 235.67236200000002, "r": 410.489679, "b": 213.39106099999998 }, "text": "3.85\n3.85", "attrs": { "row": 5, "col": 7, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 78 }, { "id": "p107.4.80", "order": 84, "type": "table_cell", "bbox": { "l": 434.587698, "t": 235.67236200000002, "r": 445.45286, "b": 213.39106099999998 }, "text": "6.7\n6.7", "attrs": { "row": 5, "col": 8, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 79 }, { "id": "p107.4.81", "order": 85, "type": "table_cell", "bbox": { "l": 467.362742, "t": 235.67236200000002, "r": 486.824157, "b": 213.39106099999998 }, "text": "25.79\n25.79", "attrs": { "row": 5, "col": 9, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 80 }, { "id": "p107.4.82", "order": 86, "type": "table_cell", "bbox": { "l": 509.906255, "t": 235.67236200000002, "r": 518.552144, "b": 213.39106099999998 }, "text": "24\n24", "attrs": { "row": 5, "col": 10, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 81 }, { "id": "p107.4.83", "order": 87, "type": "table_cell", "bbox": { "l": 548.042357, "t": 235.67236200000002, "r": 567.503772, "b": 213.39106099999998 }, "text": "28.69\n31.13", "attrs": { "row": 5, "col": 11, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 82 }, { "id": "p107.4.84", "order": 88, "type": "table_cell", "bbox": { "l": 592.695859, "t": 235.67236200000002, "r": 612.157274, "b": 213.39106099999998 }, "text": "92.05\n91.80", "attrs": { "row": 5, "col": 12, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 83 }, { "id": "p107.4.85", "order": 89, "type": "table_cell", "bbox": { "l": 630.941246, "t": 235.67236200000002, "r": 650.45074, "b": 213.39106099999998 }, "text": "91.80\n91.00", "attrs": { "row": 5, "col": 13, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 84 }, { "id": "p107.4.86", "order": 90, "type": "table_cell", "bbox": { "l": 665.952507, "t": 235.67236200000002, "r": 689.698922, "b": 213.39106099999998 }, "text": "0.0064\n0.0075", "attrs": { "row": 5, "col": 14, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 85 }, { "id": "p107.4.87", "order": 91, "type": "table_cell", "bbox": { "l": 94.8, "t": 218.1333, "r": 135.072, "b": 196.56 }, "text": "", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 86 }, { "id": "p107.4.88", "order": 92, "type": "table_cell", "bbox": { "l": 135.072, "t": 218.1333, "r": 175.344, "b": 196.56 }, "text": "", "attrs": { "row": 6, "col": 1, "rowspan": 1, "colspan": 1 }, "reading_order": 87 }, { "id": "p107.4.89", "order": 93, "type": "table_cell", "bbox": { "l": 175.344, "t": 218.1333, "r": 215.616, "b": 196.56 }, "text": "", "attrs": { "row": 6, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 88 }, { "id": "p107.4.90", "order": 94, "type": "table_cell", "bbox": { "l": 215.616, "t": 218.1333, "r": 255.888, "b": 196.56 }, "text": "", "attrs": { "row": 6, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 89 }, { "id": "p107.4.91", "order": 95, "type": "table_cell", "bbox": { "l": 255.888, "t": 218.1333, "r": 296.16, "b": 196.56 }, "text": "", "attrs": { "row": 6, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 90 }, { "id": "p107.4.92", "order": 96, "type": "table_cell", "bbox": { "l": 296.16, "t": 218.1333, "r": 336.432, "b": 196.56 }, "text": "", "attrs": { "row": 6, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 91 }, { "id": "p107.4.93", "order": 97, "type": "table_cell", "bbox": { "l": 336.432, "t": 218.1333, "r": 376.704, "b": 196.56 }, "text": "", "attrs": { "row": 6, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 92 }, { "id": "p107.4.94", "order": 98, "type": "table_cell", "bbox": { "l": 376.704, "t": 218.1333, "r": 416.976, "b": 196.56 }, "text": "", "attrs": { "row": 6, "col": 7, "rowspan": 1, "colspan": 1 }, "reading_order": 93 }, { "id": "p107.4.95", "order": 99, "type": "table_cell", "bbox": { "l": 416.976, "t": 218.1333, "r": 457.248, "b": 196.56 }, "text": "", "attrs": { "row": 6, "col": 8, "rowspan": 1, "colspan": 1 }, "reading_order": 94 }, { "id": "p107.4.96", "order": 100, "type": "table_cell", "bbox": { "l": 457.248, "t": 218.1333, "r": 497.52, "b": 196.56 }, "text": "", "attrs": { "row": 6, "col": 9, "rowspan": 1, "colspan": 1 }, "reading_order": 95 }, { "id": "p107.4.97", "order": 101, "type": "table_cell", "bbox": { "l": 497.52, "t": 218.1333, "r": 537.792, "b": 196.56 }, "text": "", "attrs": { "row": 6, "col": 10, "rowspan": 1, "colspan": 1 }, "reading_order": 96 }, { "id": "p107.4.98", "order": 102, "type": "table_cell", "bbox": { "l": 537.792, "t": 218.1333, "r": 578.064, "b": 196.56 }, "text": "", "attrs": { "row": 6, "col": 11, "rowspan": 1, "colspan": 1 }, "reading_order": 97 }, { "id": "p107.4.99", "order": 103, "type": "table_cell", "bbox": { "l": 578.064, "t": 218.1333, "r": 618.336, "b": 196.56 }, "text": "", "attrs": { "row": 6, "col": 12, "rowspan": 1, "colspan": 1 }, "reading_order": 98 }, { "id": "p107.4.100", "order": 104, "type": "table_cell", "bbox": { "l": 618.336, "t": 218.1333, "r": 658.608, "b": 196.56 }, "text": "", "attrs": { "row": 6, "col": 13, "rowspan": 1, "colspan": 1 }, "reading_order": 99 }, { "id": "p107.4.101", "order": 105, "type": "table_cell", "bbox": { "l": 658.608, "t": 218.1333, "r": 698.88, "b": 196.56 }, "text": "", "attrs": { "row": 6, "col": 14, "rowspan": 1, "colspan": 1 }, "reading_order": 100 } ], "reading_order": 3 } ] }, { "document_id": 16592, "page": 108, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 1, "counts_by_type": { "heading": 1 }, "build_ms": 0, "items": [ { "id": "p108.1", "order": 1, "type": "heading", "bbox": { "l": 253.2, "t": 717.6, "r": 358.08, "b": 696.96 }, "text": "APPENDIX E", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 0 } ] }, { "document_id": 16592, "page": 109, "width": 792, "height": 612, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 792, "height_pt": 612, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 13, "counts_by_type": { "caption": 5, "figure": 2, "formula": 2, "heading": 1, "text": 3 }, "build_ms": 1, "items": [ { "id": "p109.1", "order": 1, "type": "figure", "bbox": { "l": 46.08, "t": 548.4, "r": 241.92, "b": 327.6 }, "text": "", "attrs": { "block_label": "image" }, "children": [ { "id": "p109.1.1", "order": 2, "type": "text", "bbox": { "l": 83.28, "t": 546, "r": 232.32, "b": 473.28 }, "text": "Scour Hole:\nWo 2.00 ft\nDo 2.00 ft\nQ100 6.36 cfs\nq 3.18\nD 1.00 (Do or 0.5*Do)\nTw 0.21 ft", "reading_order": 0 }, { "id": "p109.1.2", "order": 3, "type": "text", "bbox": { "l": 51.84, "t": 461.52, "r": 190.32, "b": 410.88 }, "text": "Dimensions:\nW1 4 ft\nW2 10 ft\nL1 6 ft\nL2 12 ft", "reading_order": 1 }, { "id": "p109.1.3", "order": 4, "type": "text", "bbox": { "l": 48, "t": 401.52, "r": 242.4, "b": 326.64 }, "text": "Riprap where[p109.1.3.1] [p109.1.3.2]\nwhere Y=D_{0} d_{50}=\\frac{0.0082}{Tw}q^{1.33}\nY=0.5Do d50 0.28 ft Use 6\"\nY=Do d50 0.18 ft Use 6\"", "children": [ { "id": "p109.1.3.1", "order": 5, "type": "formula", "bbox": { "l": 48, "t": 401.52, "r": 242.4, "b": 326.64 }, "text": "\\text{Riprap}\\quad \\text{where } Y = \\tfrac{1}{2} D_{o}\\quad d_{50}=\\frac{0.0125}{Tw}q^{1.33}\\qquad \\text{where } Y = D_{o}\\quad d_{50}=\\frac{0.0082}{Tw}q^{1.33}\\\\ Y=0.5Do\\quad d50\\quad 0.28\\ \\text{ft}\\quad \\text{Use 6\"}\\\\ Y=Do\\quad d50\\quad 0.18\\ \\text{ft}\\quad \\text{Use 6\"}", "attrs": { "latex": "\\text{Riprap}\\quad \\text{where } Y = \\tfrac{1}{2} D_{o}\\quad d_{50}=\\frac{0.0125}{Tw}q^{1.33}\\qquad \\text{where } Y = D_{o}\\quad d_{50}=\\frac{0.0082}{Tw}q^{1.33}\\\\ Y=0.5Do\\quad d50\\quad 0.28\\ \\text{ft}\\quad \\text{Use 6\"}\\\\ Y=Do\\quad d50\\quad 0.18\\ \\text{ft}\\quad \\text{Use 6\"}", "inline": true, "text_offset": 12, "text_span": 12, "bbox_estimated": true, "alt": "Riprap where Y equals tfrac 1 2 D sub o d sub 50 equals 0.0125 over Tw q to the power of 1.33 where Y equals D sub o d sub 50 equals 0.0082 over Tw q to the power of 1.33 Y equals 0.5 Do d50 0.28 ft Use 6\" Y equals Do d50 0.18 ft Use 6\"", "notation": "latex", "mathml": "Riprapwhere Y=12Dod50=0.0125Twq1.33where Y=Dod50=0.0082Twq1.33Y=0.5Dod500.28 ftUse 6\"Y=Dod500.18 ftUse 6\"" }, "reading_order": 0 }, { "id": "p109.1.3.2", "order": 6, "type": "formula", "bbox": { "l": 48, "t": 401.52, "r": 242.4, "b": 326.64 }, "text": "\\begin{aligned} &\\text{Riprap} \\\\ &\\text{where } Y = \\tfrac{1}{2} D_o \\qquad d_{50}=\\frac{0.0125}{Tw}q^{1.33} \\\\ &\\text{where } Y = D_o \\qquad d_{50}=\\frac{0.0082}{Tw}q^{1.33} \\\\ &Y=0.5Do \\quad d50 \\quad 0.28\\ \\text{ft} \\quad \\text{Use 6\"} \\\\ &Y=Do \\quad d50 \\quad 0.18\\ \\text{ft} \\quad \\text{Use 6\"} \\end{aligned}", "attrs": { "latex": "\\begin{aligned} &\\text{Riprap} \\\\ &\\text{where } Y = \\tfrac{1}{2} D_o \\qquad d_{50}=\\frac{0.0125}{Tw}q^{1.33} \\\\ &\\text{where } Y = D_o \\qquad d_{50}=\\frac{0.0082}{Tw}q^{1.33} \\\\ &Y=0.5Do \\quad d50 \\quad 0.28\\ \\text{ft} \\quad \\text{Use 6\"} \\\\ &Y=Do \\quad d50 \\quad 0.18\\ \\text{ft} \\quad \\text{Use 6\"} \\end{aligned}", "inline": true, "text_offset": 25, "text_span": 12, "bbox_estimated": true, "notation": "latex", "alt": "begin aligned & Riprap & where Y equals tfrac 1 2 D sub o d sub 50 equals 0.0125 over Tw q to the power of 1.33 & where Y equals D sub o d sub 50 equals 0.0082 over Tw q to the power of 1.33 &Y equals 0.5 Do d50 0.28 ft Use 6\" &Y equals Do d50 0.18 ft Use 6\" end aligned", "mathml": "&Riprap&where Y=12Dod50=0.0125Twq1.33&where Y=Dod50=0.0082Twq1.33&Y=0.5Dod500.28 ftUse 6\"&Y=Dod500.18 ftUse 6\"" }, "reading_order": 1 } ], "reading_order": 2 } ], "reading_order": 0 }, { "id": "p109.2", "order": 7, "type": "figure", "bbox": { "l": 265.92, "t": 535.2, "r": 696, "b": 295.44 }, "text": "", "attrs": { "block_label": "image", "embedded_text": "W1 W2\nL1\nL2" }, "children": [ { "id": "p109.2.1", "order": 8, "type": "caption", "bbox": { "l": 562.32, "t": 532.32, "r": 641.52, "b": 521.52 }, "text": "Preferred Scour Hole", "attrs": { "block_label": "figure_title" }, "reading_order": 0 }, { "id": "p109.2.2", "order": 9, "type": "heading", "bbox": { "l": 337.92, "t": 530.88, "r": 429.36, "b": 519.36 }, "text": "Preferred Scour Hole", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p109.2.3", "order": 10, "type": "caption", "bbox": { "l": 600, "t": 421.44, "r": 623.52, "b": 410.64 }, "text": "PLAN", "attrs": { "block_label": "figure_title" }, "reading_order": 2 }, { "id": "p109.2.4", "order": 11, "type": "caption", "bbox": { "l": 382.08, "t": 418.8, "r": 408.48, "b": 407.52 }, "text": "PLAN", "attrs": { "block_label": "figure_title" }, "reading_order": 3 }, { "id": "p109.2.5", "order": 12, "type": "caption", "bbox": { "l": 585.6, "t": 312, "r": 633.36, "b": 301.2 }, "text": "Section A - A", "attrs": { "block_label": "figure_title" }, "reading_order": 4 }, { "id": "p109.2.6", "order": 13, "type": "caption", "bbox": { "l": 365.28, "t": 307.92, "r": 420.48, "b": 297.12 }, "text": "Section A - A", "attrs": { "block_label": "figure_title" }, "reading_order": 5 } ], "reading_order": 1 } ] }, { "document_id": 16592, "page": 110, "width": 792, "height": 612, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 792, "height_pt": 612, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 15, "counts_by_type": { "caption": 5, "figure": 2, "formula": 4, "heading": 1, "text": 3 }, "build_ms": 1, "items": [ { "id": "p110.1", "order": 1, "type": "figure", "bbox": { "l": 45.84, "t": 548.88, "r": 242.64, "b": 327.12 }, "text": "", "attrs": { "block_label": "image" }, "children": [ { "id": "p110.1.1", "order": 2, "type": "text", "bbox": { "l": 83.04, "t": 546, "r": 232.32, "b": 473.28 }, "text": "Scour Hole:\nWo 2.00 ft\nDo 2.00 ft\nQ100 6.40 cfs\nq 3.20\nD 1.00 (Do or 0.5*Do)\nTw 0.31 ft", "reading_order": 0 }, { "id": "p110.1.2", "order": 3, "type": "text", "bbox": { "l": 51.6, "t": 462, "r": 190.32, "b": 410.88 }, "text": "Dimensions:\nW1 4 ft\nW2 10 ft\nL1 6 ft\nL2 12 ft", "reading_order": 1 }, { "id": "p110.1.3", "order": 4, "type": "text", "bbox": { "l": 48.24, "t": 401.52, "r": 242.88, "b": 326.88 }, "text": "Riprap where[p110.1.3.1] [p110.1.3.2]\nwhere[p110.1.3.3] [p110.1.3.4]\nY=0.5Do d50 0.19 ft Use 6\"\nY=Do d50 0.12 ft Use 6\"", "children": [ { "id": "p110.1.3.1", "order": 5, "type": "formula", "bbox": { "l": 48.24, "t": 401.52, "r": 242.88, "b": 326.88 }, "text": "\\text{Riprap} \\text{where } Y = \\tfrac{1}{2} D_{o} \\qquad d_{50} = \\frac{0.0125}{Tw} q^{1.33} \\text{where } Y = D_{o} \\qquad d_{50} = \\frac{0.0082}{Tw} q^{1.33} Y=0.5Do \\quad d50 \\quad 0.19\\ \\text{ft} \\quad \\text{Use 6\"} Y=Do \\quad d50 \\quad 0.12\\ \\text{ft} \\quad \\text{Use 6\"}", "attrs": { "latex": "\\text{Riprap} \\text{where } Y = \\tfrac{1}{2} D_{o} \\qquad d_{50} = \\frac{0.0125}{Tw} q^{1.33} \\text{where } Y = D_{o} \\qquad d_{50} = \\frac{0.0082}{Tw} q^{1.33} Y=0.5Do \\quad d50 \\quad 0.19\\ \\text{ft} \\quad \\text{Use 6\"} Y=Do \\quad d50 \\quad 0.12\\ \\text{ft} \\quad \\text{Use 6\"}", "inline": true, "text_offset": 12, "text_span": 12, "bbox_estimated": true, "alt": "Riprap where Y equals tfrac 1 2 D sub o d sub 50 equals 0.0125 over Tw q to the power of 1.33 where Y equals D sub o d sub 50 equals 0.0082 over Tw q to the power of 1.33 Y equals 0.5 Do d50 0.19 ft Use 6\" Y equals Do d50 0.12 ft Use 6\"", "notation": "latex", "mathml": "Riprapwhere Y=12Dod50=0.0125Twq1.33where Y=Dod50=0.0082Twq1.33Y=0.5Dod500.19 ftUse 6\"Y=Dod500.12 ftUse 6\"" }, "reading_order": 0 }, { "id": "p110.1.3.2", "order": 6, "type": "formula", "bbox": { "l": 48.24, "t": 401.52, "r": 242.88, "b": 326.88 }, "text": "\\text{Riprap} \\text{where } Y = \\tfrac{1}{2} D_o \\qquad d_{50}=\\frac{0.0125}{Tw}q^{1.33} \\text{where } Y = D_o \\qquad d_{50}=\\frac{0.0082}{Tw}q^{1.33} \\text{Y=0.5Do}\\quad d50 \\quad 0.19\\text{ ft} \\quad \\text{Use 6\"} \\text{Y=Do}\\quad d50 \\quad 0.12\\text{ ft} \\quad \\text{Use 6\"}", "attrs": { "latex": "\\text{Riprap} \\text{where } Y = \\tfrac{1}{2} D_o \\qquad d_{50}=\\frac{0.0125}{Tw}q^{1.33} \\text{where } Y = D_o \\qquad d_{50}=\\frac{0.0082}{Tw}q^{1.33} \\text{Y=0.5Do}\\quad d50 \\quad 0.19\\text{ ft} \\quad \\text{Use 6\"} \\text{Y=Do}\\quad d50 \\quad 0.12\\text{ ft} \\quad \\text{Use 6\"}", "inline": true, "text_offset": 25, "text_span": 12, "bbox_estimated": true, "notation": "latex", "alt": "Riprap where Y equals tfrac 1 2 D sub o d sub 50 equals 0.0125 over Tw q to the power of 1.33 where Y equals D sub o d sub 50 equals 0.0082 over Tw q to the power of 1.33 Y equals 0.5 Do d50 0.19 ft Use 6\" Y equals Do d50 0.12 ft Use 6\"", "mathml": "Riprapwhere Y=12Dod50=0.0125Twq1.33where Y=Dod50=0.0082Twq1.33Y=0.5Dod500.19 ftUse 6\"Y=Dod500.12 ftUse 6\"" }, "reading_order": 1 }, { "id": "p110.1.3.3", "order": 7, "type": "formula", "bbox": { "l": 48.24, "t": 401.52, "r": 242.88, "b": 326.88 }, "text": "\\begin{aligned} &\\text{Riprap} \\\\ &\\text{where } Y = \\tfrac{1}{2} D_{o} \\qquad d_{50} = \\frac{0.0125}{Tw} q^{1.33} \\\\ &\\text{where } Y = D_{o} \\qquad d_{50} = \\frac{0.0082}{Tw} q^{1.33} \\\\ &Y=0.5Do \\quad d50 \\quad 0.19\\ \\text{ft} \\quad \\text{Use 6\"} \\\\ &Y=Do \\quad d50 \\quad 0.12\\ \\text{ft} \\quad \\text{Use 6\"} \\end{aligned}", "attrs": { "latex": "\\begin{aligned} &\\text{Riprap} \\\\ &\\text{where } Y = \\tfrac{1}{2} D_{o} \\qquad d_{50} = \\frac{0.0125}{Tw} q^{1.33} \\\\ &\\text{where } Y = D_{o} \\qquad d_{50} = \\frac{0.0082}{Tw} q^{1.33} \\\\ &Y=0.5Do \\quad d50 \\quad 0.19\\ \\text{ft} \\quad \\text{Use 6\"} \\\\ &Y=Do \\quad d50 \\quad 0.12\\ \\text{ft} \\quad \\text{Use 6\"} \\end{aligned}", "inline": true, "text_offset": 43, "text_span": 12, "bbox_estimated": true, "alt": "begin aligned & Riprap & where Y equals tfrac 1 2 D sub o d sub 50 equals 0.0125 over Tw q to the power of 1.33 & where Y equals D sub o d sub 50 equals 0.0082 over Tw q to the power of 1.33 &Y equals 0.5 Do d50 0.19 ft Use 6\" &Y equals Do d50 0.12 ft Use 6\" end aligned", "notation": "latex", "mathml": "&Riprap&where Y=12Dod50=0.0125Twq1.33&where Y=Dod50=0.0082Twq1.33&Y=0.5Dod500.19 ftUse 6\"&Y=Dod500.12 ftUse 6\"" }, "reading_order": 2 }, { "id": "p110.1.3.4", "order": 8, "type": "formula", "bbox": { "l": 48.24, "t": 401.52, "r": 242.88, "b": 326.88 }, "text": "\\text{Riprap} \\text{where } Y = \\tfrac{1}{2} D_o \\qquad d_{50} = \\frac{0.0125}{Tw} q^{1.33} \\text{where } Y = D_o \\qquad d_{50} = \\frac{0.0082}{Tw} q^{1.33} \\begin{aligned} Y&=0.5Do \\quad d50 \\quad 0.19 \\text{ ft} \\quad \\text{Use 6\"} \\\\ Y&=Do \\quad d50 \\quad 0.12 \\text{ ft} \\quad \\text{Use 6\"} \\end{aligned}", "attrs": { "latex": "\\text{Riprap} \\text{where } Y = \\tfrac{1}{2} D_o \\qquad d_{50} = \\frac{0.0125}{Tw} q^{1.33} \\text{where } Y = D_o \\qquad d_{50} = \\frac{0.0082}{Tw} q^{1.33} \\begin{aligned} Y&=0.5Do \\quad d50 \\quad 0.19 \\text{ ft} \\quad \\text{Use 6\"} \\\\ Y&=Do \\quad d50 \\quad 0.12 \\text{ ft} \\quad \\text{Use 6\"} \\end{aligned}", "inline": true, "text_offset": 56, "text_span": 12, "bbox_estimated": true, "notation": "latex", "alt": "Riprap where Y equals tfrac 1 2 D sub o d sub 50 equals 0.0125 over Tw q to the power of 1.33 where Y equals D sub o d sub 50 equals 0.0082 over Tw q to the power of 1.33 begin aligned Y& equals 0.5 Do d50 0.19 ft Use 6\" Y& equals Do d50 0.12 ft Use 6\" end aligned", "mathml": "Riprapwhere Y=12Dod50=0.0125Twq1.33where Y=Dod50=0.0082Twq1.33Y&=0.5Dod500.19 ftUse 6\"Y&=Dod500.12 ftUse 6\"" }, "reading_order": 3 } ], "reading_order": 2 } ], "reading_order": 0 }, { "id": "p110.2", "order": 9, "type": "figure", "bbox": { "l": 265.92, "t": 535.2, "r": 695.76, "b": 295.68 }, "text": "", "attrs": { "block_label": "image", "embedded_text": "W1 W2\nL1\nL2" }, "children": [ { "id": "p110.2.1", "order": 10, "type": "caption", "bbox": { "l": 562.32, "t": 532.32, "r": 641.52, "b": 521.52 }, "text": "Preferred Scour Hole", "attrs": { "block_label": "figure_title" }, "reading_order": 0 }, { "id": "p110.2.2", "order": 11, "type": "heading", "bbox": { "l": 337.92, "t": 530.88, "r": 429.36, "b": 519.36 }, "text": "Preferred Scour Hole", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p110.2.3", "order": 12, "type": "caption", "bbox": { "l": 600, "t": 421.44, "r": 623.52, "b": 410.64 }, "text": "PLAN", "attrs": { "block_label": "figure_title" }, "reading_order": 2 }, { "id": "p110.2.4", "order": 13, "type": "caption", "bbox": { "l": 382.08, "t": 418.8, "r": 408.48, "b": 407.52 }, "text": "PLAN", "attrs": { "block_label": "figure_title" }, "reading_order": 3 }, { "id": "p110.2.5", "order": 14, "type": "caption", "bbox": { "l": 585.84, "t": 312, "r": 633.36, "b": 301.2 }, "text": "Section A - A", "attrs": { "block_label": "figure_title" }, "reading_order": 4 }, { "id": "p110.2.6", "order": 15, "type": "caption", "bbox": { "l": 365.28, "t": 307.92, "r": 420.48, "b": 297.12 }, "text": "Section A - A", "attrs": { "block_label": "figure_title" }, "reading_order": 5 } ], "reading_order": 1 } ] }, { "document_id": 16592, "page": 111, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 32, "counts_by_type": { "form_field": 1, "heading": 4, "list": 3, "list_item": 11, "text": 12, "title": 1 }, "build_ms": 2, "items": [ { "id": "p111.1", "order": 1, "type": "title", "bbox": { "l": 153.12, "t": 756.24, "r": 458.88, "b": 713.28 }, "text": "New Jersey Department of Agriculture\nHydrologic Modeling Database – Data Entry Form", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 0 }, { "id": "p111.2", "order": 2, "type": "heading", "bbox": { "l": 69.84, "t": 690.96, "r": 160.08, "b": 677.76 }, "text": "Project Site Details", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p111.3", "order": 3, "type": "heading", "bbox": { "l": 106.08, "t": 667.92, "r": 247.68, "b": 654.48 }, "text": "Chpt. 251 Application Number:", "level": 3, "reading_order": 2 }, { "id": "p111.4", "order": 4, "type": "list", "bbox": { "l": 105.36, "t": 644.930158, "r": 540, "b": 586.08 }, "text": "", "attrs": { "item_count": 3 }, "children": [ { "id": "p111.4.1", "order": 5, "type": "list_item", "bbox": { "l": 108, "t": 644.930158, "r": 203.579586, "b": 631.486886 }, "text": "Start Date (if known): ___", "reading_order": 0 }, { "id": "p111.4.2", "order": 6, "type": "list_item", "bbox": { "l": 105.36, "t": 622.56, "r": 540, "b": 607.2 }, "text": ". Cuzan County", "attrs": { "bbox_estimated": true }, "reading_order": 1 }, { "id": "p111.4.3", "order": 7, "type": "list_item", "bbox": { "l": 105.36, "t": 601.92, "r": 288.24, "b": 586.08 }, "text": "Street Address: 102 SAMS ROAD", "attrs": { "bbox_estimated": true }, "reading_order": 2 } ], "reading_order": 3 }, { "id": "p111.5", "order": 8, "type": "text", "bbox": { "l": 104.64, "t": 600.96, "r": 539.28, "b": 585.36 }, "text": "JAMS ROAD", "children": [ { "id": "p111.5.1", "order": 9, "type": "form_field", "bbox": { "l": 107.88, "t": 600.7627, "r": 437.2155, "b": 585.7252 }, "text": "", "attrs": { "field_kind": "text", "label": "Street Address: 225 Brewers Bridge Road", "source": "blank_line" }, "reading_order": 0 } ], "reading_order": 4 }, { "id": "p111.6", "order": 10, "type": "text", "bbox": { "l": 105.36, "t": 578.16, "r": 537.84, "b": 562.8 }, "text": "Municipality: Jackson", "reading_order": 5 }, { "id": "p111.7", "order": 11, "type": "text", "bbox": { "l": 105.84, "t": 553.68, "r": 254.4, "b": 537.12 }, "text": "Block: 20101", "reading_order": 6 }, { "id": "p111.8", "order": 12, "type": "text", "bbox": { "l": 105.84, "t": 532.32, "r": 251.28, "b": 515.52 }, "text": "Lot: 29&30", "reading_order": 7 }, { "id": "p111.9", "order": 13, "type": "text", "bbox": { "l": 105.6, "t": 504.72, "r": 291.84, "b": 491.28 }, "text": "NJDEP Anderson Landuse Code (4 digits):", "reading_order": 8 }, { "id": "p111.10", "order": 14, "type": "text", "bbox": { "l": 105.36, "t": 483.36, "r": 539.28, "b": 468 }, "text": "Landuse description: 1810", "reading_order": 9 }, { "id": "p111.11", "order": 15, "type": "text", "bbox": { "l": 105.12, "t": 444, "r": 312.24, "b": 430.32 }, "text": "Site Centroid Location (NJ State Plane Feet): [p111.11.1]", "children": [ { "id": "p111.11.1", "order": 16, "type": "text", "bbox": { "l": 105.12, "t": 444, "r": 312.24, "b": 430.32 }, "text": "¹", "attrs": { "inline": true, "text_offset": 46, "text_span": 11, "bbox_estimated": true }, "reading_order": 0 } ], "reading_order": 10 }, { "id": "p111.12", "order": 17, "type": "text", "bbox": { "l": 142.08, "t": 426.24, "r": 551.52, "b": 404.88 }, "text": "Northing: 457298 Easting: 553535", "reading_order": 11 }, { "id": "p111.13", "order": 18, "type": "heading", "bbox": { "l": 69.84, "t": 359.52, "r": 177.84, "b": 346.32 }, "text": "Project Contact Details", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 12 }, { "id": "p111.14", "order": 19, "type": "list", "bbox": { "l": 104.88, "t": 337.2, "r": 551.04, "b": 279.12 }, "text": "", "attrs": { "item_count": 3 }, "children": [ { "id": "p111.14.1", "order": 20, "type": "list_item", "bbox": { "l": 105.12, "t": 337.2, "r": 540.24, "b": 323.04 }, "text": "Applicant:_____", "reading_order": 0 }, { "id": "p111.14.2", "order": 21, "type": "list_item", "bbox": { "l": 104.88, "t": 315.6, "r": 540.24, "b": 300.24 }, "text": "Address:___", "reading_order": 1 }, { "id": "p111.14.3", "order": 22, "type": "list_item", "bbox": { "l": 105.36, "t": 292.08, "r": 551.04, "b": 279.12 }, "text": "Phone:_____", "reading_order": 2 } ], "reading_order": 13 }, { "id": "p111.15", "order": 23, "type": "text", "bbox": { "l": 74.16, "t": 269.76, "r": 553.44, "b": 244.08 }, "text": "Email: ___", "reading_order": 14 }, { "id": "p111.16", "order": 24, "type": "heading", "bbox": { "l": 69.6, "t": 222.48, "r": 282.96, "b": 208.8 }, "text": "Post Construction Operation & Maintenance: [p111.16.1]", "attrs": { "block_label": "paragraph_title" }, "children": [ { "id": "p111.16.1", "order": 25, "type": "text", "bbox": { "l": 69.6, "t": 222.48, "r": 282.96, "b": 208.8 }, "text": "²", "attrs": { "inline": true, "text_offset": 43, "text_span": 11, "bbox_estimated": true }, "reading_order": 0 } ], "level": 3, "reading_order": 15 }, { "id": "p111.17", "order": 26, "type": "list", "bbox": { "l": 104.88, "t": 199.2, "r": 540, "b": 90.72 }, "text": "", "attrs": { "item_count": 5 }, "children": [ { "id": "p111.17.1", "order": 27, "type": "list_item", "bbox": { "l": 105.36, "t": 199.2, "r": 474.96, "b": 185.04 }, "text": "Party Name: ___", "reading_order": 0 }, { "id": "p111.17.2", "order": 28, "type": "list_item", "bbox": { "l": 104.88, "t": 175.92, "r": 540, "b": 161.28 }, "text": "Address: ___", "reading_order": 1 }, { "id": "p111.17.3", "order": 29, "type": "list_item", "bbox": { "l": 105.36, "t": 152.16, "r": 292.08, "b": 137.52 }, "text": "Phone: _____", "reading_order": 2 }, { "id": "p111.17.4", "order": 30, "type": "list_item", "bbox": { "l": 105.36, "t": 129.36, "r": 468.48, "b": 114.72 }, "text": "Email: ___", "reading_order": 3 }, { "id": "p111.17.5", "order": 31, "type": "list_item", "bbox": { "l": 105.84, "t": 105.36, "r": 348, "b": 90.72 }, "text": "Party type: ___", "reading_order": 4 } ], "reading_order": 16 }, { "id": "p111.18", "order": 32, "type": "text", "bbox": { "l": 38.16, "t": 57.84, "r": 539.28, "b": 24.24 }, "text": "SSCC 251 HDF1", "reading_order": 17 } ] }, { "document_id": 16592, "page": 112, "width": 792, "height": 612, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 792, "height_pt": 612, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 111, "counts_by_type": { "caption": 1, "heading": 1, "table": 1, "table_cell": 108 }, "build_ms": 8, "items": [ { "id": "p112.1", "order": 1, "type": "heading", "bbox": { "l": 217.44, "t": 583.92, "r": 557.76, "b": 539.76 }, "text": "New Jersey Department of Agriculture\nHydrologic Modeling Database – Data Entry Short Form", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 0 }, { "id": "p112.2", "order": 2, "type": "caption", "bbox": { "l": 61.2, "t": 511.2, "r": 705.36, "b": 469.68 }, "text": "Note: Provide an electronic copy (pdf) of the drainage report which contains basin design data, flow rates etc. to the soil conservation district as part of the application package. Make additional copies of this page for additional basin information as needed. If no electronic drainage report can be provided, then the Data Entry Long Form must be used.", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p112.3", "order": 3, "type": "table", "bbox": { "l": 62.64, "t": 454.08, "r": 705.36, "b": 47.76 }, "text": "", "attrs": { "block_label": "table", "n_rows": 12, "n_cols": 9, "integrity": { "cells_checked": 57, "cells_flagged": 0 } }, "children": [ { "id": "p112.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 71.16, "t": 453.16704, "r": 107.096304, "b": 438.39552000000003 }, "text": "Basin ID", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "pdf" }, "reading_order": 0 }, { "id": "p112.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 128.64048, "t": 453.16704, "r": 171.115776, "b": 384.63552000000004 }, "text": "Basin\\nCentroid\\nNorthing, Easting (SPF)", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "pdf" }, "reading_order": 1 }, { "id": "p112.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 191.52384, "t": 453.16704, "r": 261.201696, "b": 398.08416 }, "text": "Basin Type\\n(ex., detention, infiltration, wet pond etc)", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "pdf" }, "reading_order": 2 }, { "id": "p112.3.4", "order": 7, "type": "table_cell", "bbox": { "l": 280.56, "t": 453.16704, "r": 346.559328, "b": 398.08416 }, "text": "Construction (embankment, excavated, subsurface?)", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "pdf" }, "reading_order": 3 }, { "id": "p112.3.5", "order": 8, "type": "table_cell", "bbox": { "l": 371.16528, "t": 453.16704, "r": 412.601712, "b": 398.08416 }, "text": "Dam Height (ft)Width (ft)", "attrs": { "row": 0, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "pdf" }, "reading_order": 4 }, { "id": "p112.3.6", "order": 9, "type": "table_cell", "bbox": { "l": 430.8, "t": 453.16704, "r": 478.048992, "b": 424.95552 }, "text": "Dam Class (I-V or NA)", "attrs": { "row": 0, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "pdf" }, "reading_order": 5 }, { "id": "p112.3.7", "order": 10, "type": "table_cell", "bbox": { "l": 496.8, "t": 453.16704, "r": 537.309072, "b": 407.43744000000004 }, "text": "Outlet ID (HW# or FES#)", "attrs": { "row": 0, "col": 6, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "pdf" }, "reading_order": 6 }, { "id": "p112.3.8", "order": 11, "type": "table_cell", "bbox": { "l": 554.04, "t": 453.16704, "r": 623.19456, "b": 392.07552 }, "text": "Outlet Location\\nNorthing, Easting (SPF)", "attrs": { "row": 0, "col": 7, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "pdf" }, "reading_order": 7 }, { "id": "p112.3.9", "order": 12, "type": "table_cell", "bbox": { "l": 642.36, "t": 453.16704, "r": 690.956976, "b": 438.39552000000003 }, "text": "Comments", "attrs": { "row": 0, "col": 8, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "pdf" }, "reading_order": 8 }, { "id": "p112.3.10", "order": 13, "type": "table_cell", "bbox": { "l": 68.9212, "t": 379.291, "r": 108.9412, "b": 354.391 }, "text": "WQ\\nBasin 1", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p112.3.11", "order": 14, "type": "table_cell", "bbox": { "l": 128.4587, "t": 380.932, "r": 169.28, "b": 354.5732 }, "text": "457185\\n553442", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p112.3.12", "order": 15, "type": "table_cell", "bbox": { "l": 194.3796, "t": 379.2113, "r": 245.7276, "b": 354.3113 }, "text": "detention + infiltration", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 }, { "id": "p112.3.13", "order": 16, "type": "table_cell", "bbox": { "l": 283.6889, "t": 374.245, "r": 325.0409, "b": 363.145 }, "text": "Surface", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 12 }, { "id": "p112.3.14", "order": 17, "type": "table_cell", "bbox": { "l": 348.2933, "t": 420.22, "r": 419.7067, "b": 386.36 }, "text": "", "attrs": { "row": 1, "col": 4, "rowspan": 1, "colspan": 1, "column_header": true, "header_source": "pdf" }, "reading_order": 13 }, { "id": "p112.3.15", "order": 18, "type": "table_cell", "bbox": { "l": 419.7067, "t": 420.22, "r": 491.12, "b": 386.36 }, "text": "", "attrs": { "row": 1, "col": 5, "rowspan": 1, "colspan": 1, "column_header": true, "header_source": "pdf" }, "reading_order": 14 }, { "id": "p112.3.16", "order": 19, "type": "table_cell", "bbox": { "l": 498.4986, "t": 372.49940000000004, "r": 535.1706, "b": 361.3994 }, "text": "OCS-1", "attrs": { "row": 1, "col": 6, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p112.3.17", "order": 20, "type": "table_cell", "bbox": { "l": 562.178, "t": 379.6927, "r": 604.1574, "b": 355.854 }, "text": "457260\\n553511", "attrs": { "row": 1, "col": 7, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p112.3.18", "order": 21, "type": "table_cell", "bbox": { "l": 633.9467, "t": 420.22, "r": 705.36, "b": 386.36 }, "text": "", "attrs": { "row": 1, "col": 8, "rowspan": 1, "colspan": 1, "column_header": true, "header_source": "pdf" }, "reading_order": 17 }, { "id": "p112.3.19", "order": 22, "type": "table_cell", "bbox": { "l": 67.31683, "t": 350.0179, "r": 107.33683, "b": 325.1179 }, "text": "WQ\\nBasin 2", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p112.3.20", "order": 23, "type": "table_cell", "bbox": { "l": 129.0131, "t": 350.7167, "r": 169.8344, "b": 324.3579 }, "text": "457265\\n553750", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p112.3.21", "order": 24, "type": "table_cell", "bbox": { "l": 195.5014, "t": 348.1825, "r": 246.8494, "b": 323.2825 }, "text": "detention + infiltration", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p112.3.22", "order": 25, "type": "table_cell", "bbox": { "l": 283.5263, "t": 344.7924, "r": 324.8783, "b": 333.6924 }, "text": "Surface", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p112.3.23", "order": 26, "type": "table_cell", "bbox": { "l": 348.2933, "t": 386.36, "r": 419.7067, "b": 352.5 }, "text": "", "attrs": { "row": 2, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 22 }, { "id": "p112.3.24", "order": 27, "type": "table_cell", "bbox": { "l": 419.7067, "t": 386.36, "r": 491.12, "b": 352.5 }, "text": "", "attrs": { "row": 2, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 23 }, { "id": "p112.3.25", "order": 28, "type": "table_cell", "bbox": { "l": 499.6695, "t": 342.4171, "r": 536.3415, "b": 331.3171 }, "text": "OCS-2", "attrs": { "row": 2, "col": 6, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 24 }, { "id": "p112.3.26", "order": 29, "type": "table_cell", "bbox": { "l": 562.8604, "t": 350.4666, "r": 603.1764, "b": 326.3253 }, "text": "457263\\n553768", "attrs": { "row": 2, "col": 7, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 25 }, { "id": "p112.3.27", "order": 30, "type": "table_cell", "bbox": { "l": 633.9467, "t": 386.36, "r": 705.36, "b": 352.5 }, "text": "", "attrs": { "row": 2, "col": 8, "rowspan": 1, "colspan": 1 }, "reading_order": 26 }, { "id": "p112.3.28", "order": 31, "type": "table_cell", "bbox": { "l": 65.17009, "t": 316.3855, "r": 113.22109, "b": 296.673 }, "text": "Subsurface\\nLot 30.01", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 27 }, { "id": "p112.3.29", "order": 32, "type": "table_cell", "bbox": { "l": 126.8077, "t": 319.0457, "r": 167.629, "b": 292.6869 }, "text": "457585\\n553803", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 28 }, { "id": "p112.3.30", "order": 33, "type": "table_cell", "bbox": { "l": 195.7434, "t": 318.8393, "r": 247.0914, "b": 293.9393 }, "text": "detention + infiltration", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 29 }, { "id": "p112.3.31", "order": 34, "type": "table_cell", "bbox": { "l": 280.8912, "t": 311.5204, "r": 341.5872, "b": 300.4204 }, "text": "Subsurface", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 30 }, { "id": "p112.3.32", "order": 35, "type": "table_cell", "bbox": { "l": 348.2933, "t": 352.5, "r": 419.7067, "b": 318.64 }, "text": "", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 31 }, { "id": "p112.3.33", "order": 36, "type": "table_cell", "bbox": { "l": 419.7067, "t": 352.5, "r": 491.12, "b": 318.64 }, "text": "", "attrs": { "row": 3, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 32 }, { "id": "p112.3.34", "order": 37, "type": "table_cell", "bbox": { "l": 491.12, "t": 352.5, "r": 562.5333, "b": 318.64 }, "text": "", "attrs": { "row": 3, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 33 }, { "id": "p112.3.35", "order": 38, "type": "table_cell", "bbox": { "l": 562.5333, "t": 352.5, "r": 633.9467, "b": 318.64 }, "text": "", "attrs": { "row": 3, "col": 7, "rowspan": 1, "colspan": 1 }, "reading_order": 34 }, { "id": "p112.3.36", "order": 39, "type": "table_cell", "bbox": { "l": 633.9467, "t": 352.5, "r": 705.36, "b": 318.64 }, "text": "", "attrs": { "row": 3, "col": 8, "rowspan": 1, "colspan": 1 }, "reading_order": 35 }, { "id": "p112.3.37", "order": 40, "type": "table_cell", "bbox": { "l": 65.29681, "t": 285.6815, "r": 113.34781, "b": 265.969 }, "text": "Subsurface\\nLot 30.02", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 36 }, { "id": "p112.3.38", "order": 41, "type": "table_cell", "bbox": { "l": 128.6943, "t": 288.8611, "r": 169.5156, "b": 262.5024 }, "text": "457640\\n553622", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 37 }, { "id": "p112.3.39", "order": 42, "type": "table_cell", "bbox": { "l": 195.1032, "t": 290.0299, "r": 246.4512, "b": 265.1299 }, "text": "detention + infiltration", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 38 }, { "id": "p112.3.40", "order": 43, "type": "table_cell", "bbox": { "l": 280.251, "t": 282.7111, "r": 340.947, "b": 271.6111 }, "text": "Subsurface", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 39 }, { "id": "p112.3.41", "order": 44, "type": "table_cell", "bbox": { "l": 348.2933, "t": 318.64, "r": 419.7067, "b": 284.78 }, "text": "", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 40 }, { "id": "p112.3.42", "order": 45, "type": "table_cell", "bbox": { "l": 419.7067, "t": 318.64, "r": 491.12, "b": 284.78 }, "text": "", "attrs": { "row": 4, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 41 }, { "id": "p112.3.43", "order": 46, "type": "table_cell", "bbox": { "l": 491.12, "t": 318.64, "r": 562.5333, "b": 284.78 }, "text": "", "attrs": { "row": 4, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 42 }, { "id": "p112.3.44", "order": 47, "type": "table_cell", "bbox": { "l": 562.5333, "t": 318.64, "r": 633.9467, "b": 284.78 }, "text": "", "attrs": { "row": 4, "col": 7, "rowspan": 1, "colspan": 1 }, "reading_order": 43 }, { "id": "p112.3.45", "order": 48, "type": "table_cell", "bbox": { "l": 633.9467, "t": 318.64, "r": 705.36, "b": 284.78 }, "text": "", "attrs": { "row": 4, "col": 8, "rowspan": 1, "colspan": 1 }, "reading_order": 44 }, { "id": "p112.3.46", "order": 49, "type": "table_cell", "bbox": { "l": 65.5211, "t": 254.49689999999998, "r": 113.5721, "b": 234.7844 }, "text": "Subsurface\\nLot 30.03", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 45 }, { "id": "p112.3.47", "order": 50, "type": "table_cell", "bbox": { "l": 129.5028, "t": 257.5987, "r": 170.3241, "b": 231.23989999999998 }, "text": "457328\\n553534", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 46 }, { "id": "p112.3.48", "order": 51, "type": "table_cell", "bbox": { "l": 196.8104, "t": 258.6597, "r": 248.1584, "b": 233.7597 }, "text": "detention + infiltration", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 47 }, { "id": "p112.3.49", "order": 52, "type": "table_cell", "bbox": { "l": 279.8242, "t": 251.76760000000002, "r": 340.5202, "b": 240.6676 }, "text": "Subsurface", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 48 }, { "id": "p112.3.50", "order": 53, "type": "table_cell", "bbox": { "l": 348.2933, "t": 284.78, "r": 419.7067, "b": 250.92 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 49 }, { "id": "p112.3.51", "order": 54, "type": "table_cell", "bbox": { "l": 419.7067, "t": 284.78, "r": 491.12, "b": 250.92 }, "text": "", "attrs": { "row": 5, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 50 }, { "id": "p112.3.52", "order": 55, "type": "table_cell", "bbox": { "l": 491.12, "t": 284.78, "r": 562.5333, "b": 250.92 }, "text": "", "attrs": { "row": 5, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 51 }, { "id": "p112.3.53", "order": 56, "type": "table_cell", "bbox": { "l": 562.5333, "t": 284.78, "r": 633.9467, "b": 250.92 }, "text": "", "attrs": { "row": 5, "col": 7, "rowspan": 1, "colspan": 1 }, "reading_order": 52 }, { "id": "p112.3.54", "order": 57, "type": "table_cell", "bbox": { "l": 633.9467, "t": 284.78, "r": 705.36, "b": 250.92 }, "text": "", "attrs": { "row": 5, "col": 8, "rowspan": 1, "colspan": 1 }, "reading_order": 53 }, { "id": "p112.3.55", "order": 58, "type": "table_cell", "bbox": { "l": 65.5211, "t": 224.7391, "r": 113.5721, "b": 205.02659999999997 }, "text": "Subsurface\\nLot 30.04", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 54 }, { "id": "p112.3.56", "order": 59, "type": "table_cell", "bbox": { "l": 131.0568, "t": 227.8279, "r": 171.8781, "b": 201.4692 }, "text": "457643\\n553392", "attrs": { "row": 6, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 55 }, { "id": "p112.3.57", "order": 60, "type": "table_cell", "bbox": { "l": 194.6764, "t": 230.4905, "r": 246.0244, "b": 205.59050000000002 }, "text": "detention + infiltration", "attrs": { "row": 6, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 56 }, { "id": "p112.3.58", "order": 61, "type": "table_cell", "bbox": { "l": 281.5314, "t": 221.6778, "r": 342.2274, "b": 210.57780000000002 }, "text": "Subsurface", "attrs": { "row": 6, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 57 }, { "id": "p112.3.59", "order": 62, "type": "table_cell", "bbox": { "l": 348.2933, "t": 250.92, "r": 419.7067, "b": 217.06 }, "text": "", "attrs": { "row": 6, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 58 }, { "id": "p112.3.60", "order": 63, "type": "table_cell", "bbox": { "l": 419.7067, "t": 250.92, "r": 491.12, "b": 217.06 }, "text": "", "attrs": { "row": 6, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 59 }, { "id": "p112.3.61", "order": 64, "type": "table_cell", "bbox": { "l": 491.12, "t": 250.92, "r": 562.5333, "b": 217.06 }, "text": "", "attrs": { "row": 6, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 60 }, { "id": "p112.3.62", "order": 65, "type": "table_cell", "bbox": { "l": 562.5333, "t": 250.92, "r": 633.9467, "b": 217.06 }, "text": "", "attrs": { "row": 6, "col": 7, "rowspan": 1, "colspan": 1 }, "reading_order": 61 }, { "id": "p112.3.63", "order": 66, "type": "table_cell", "bbox": { "l": 633.9467, "t": 250.92, "r": 705.36, "b": 217.06 }, "text": "", "attrs": { "row": 6, "col": 8, "rowspan": 1, "colspan": 1 }, "reading_order": 62 }, { "id": "p112.3.64", "order": 67, "type": "table_cell", "bbox": { "l": 65.1468, "t": 193.85829999999999, "r": 113.1978, "b": 174.1458 }, "text": "Subsurface\\nLot 30.05", "attrs": { "row": 7, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 63 }, { "id": "p112.3.65", "order": 68, "type": "table_cell", "bbox": { "l": 130.6887, "t": 197.27530000000002, "r": 171.51, "b": 170.91660000000002 }, "text": "457417\\n553272", "attrs": { "row": 7, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 64 }, { "id": "p112.3.66", "order": 69, "type": "table_cell", "bbox": { "l": 195.0199, "t": 196.5865, "r": 246.3679, "b": 171.68650000000002 }, "text": "detention + infiltration", "attrs": { "row": 7, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 65 }, { "id": "p112.3.67", "order": 70, "type": "table_cell", "bbox": { "l": 281.8749, "t": 187.7738, "r": 342.5709, "b": 176.67380000000003 }, "text": "Subsurface", "attrs": { "row": 7, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 66 }, { "id": "p112.3.68", "order": 71, "type": "table_cell", "bbox": { "l": 348.2933, "t": 217.06, "r": 419.7067, "b": 183.2 }, "text": "", "attrs": { "row": 7, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 67 }, { "id": "p112.3.69", "order": 72, "type": "table_cell", "bbox": { "l": 419.7067, "t": 217.06, "r": 491.12, "b": 183.2 }, "text": "", "attrs": { "row": 7, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 68 }, { "id": "p112.3.70", "order": 73, "type": "table_cell", "bbox": { "l": 491.12, "t": 217.06, "r": 562.5333, "b": 183.2 }, "text": "", "attrs": { "row": 7, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 69 }, { "id": "p112.3.71", "order": 74, "type": "table_cell", "bbox": { "l": 562.5333, "t": 217.06, "r": 633.9467, "b": 183.2 }, "text": "", "attrs": { "row": 7, "col": 7, "rowspan": 1, "colspan": 1 }, "reading_order": 70 }, { "id": "p112.3.72", "order": 75, "type": "table_cell", "bbox": { "l": 633.9467, "t": 217.06, "r": 705.36, "b": 183.2 }, "text": "", "attrs": { "row": 7, "col": 8, "rowspan": 1, "colspan": 1 }, "reading_order": 71 }, { "id": "p112.3.73", "order": 76, "type": "table_cell", "bbox": { "l": 65.1468, "t": 162.6033, "r": 113.1978, "b": 142.8908 }, "text": "Subsurface\\nLot 30.06", "attrs": { "row": 8, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 72 }, { "id": "p112.3.74", "order": 77, "type": "table_cell", "bbox": { "l": 130.9458, "t": 168.5381, "r": 171.7671, "b": 142.1794 }, "text": "457208\\n553208", "attrs": { "row": 8, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 73 }, { "id": "p112.3.75", "order": 78, "type": "table_cell", "bbox": { "l": 194.6318, "t": 167.48000000000002, "r": 245.9798, "b": 142.57999999999998 }, "text": "detention + infiltration", "attrs": { "row": 8, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 74 }, { "id": "p112.3.76", "order": 79, "type": "table_cell", "bbox": { "l": 281.4868, "t": 158.6673, "r": 342.1828, "b": 147.5673 }, "text": "Subsurface", "attrs": { "row": 8, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 75 }, { "id": "p112.3.77", "order": 80, "type": "table_cell", "bbox": { "l": 348.2933, "t": 183.2, "r": 419.7067, "b": 149.34 }, "text": "", "attrs": { "row": 8, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 76 }, { "id": "p112.3.78", "order": 81, "type": "table_cell", "bbox": { "l": 419.7067, "t": 183.2, "r": 491.12, "b": 149.34 }, "text": "", "attrs": { "row": 8, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 77 }, { "id": "p112.3.79", "order": 82, "type": "table_cell", "bbox": { "l": 491.12, "t": 183.2, "r": 562.5333, "b": 149.34 }, "text": "", "attrs": { "row": 8, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 78 }, { "id": "p112.3.80", "order": 83, "type": "table_cell", "bbox": { "l": 562.5333, "t": 183.2, "r": 633.9467, "b": 149.34 }, "text": "", "attrs": { "row": 8, "col": 7, "rowspan": 1, "colspan": 1 }, "reading_order": 79 }, { "id": "p112.3.81", "order": 84, "type": "table_cell", "bbox": { "l": 633.9467, "t": 183.2, "r": 705.36, "b": 149.34 }, "text": "", "attrs": { "row": 8, "col": 8, "rowspan": 1, "colspan": 1 }, "reading_order": 80 }, { "id": "p112.3.82", "order": 85, "type": "table_cell", "bbox": { "l": 65.33395, "t": 131.53539999999998, "r": 113.38495, "b": 111.8229 }, "text": "Subsurface\\nLot 30.07", "attrs": { "row": 9, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 81 }, { "id": "p112.3.83", "order": 86, "type": "table_cell", "bbox": { "l": 130.9395, "t": 138.24380000000002, "r": 171.7608, "b": 111.88510000000002 }, "text": "456993\\n553380", "attrs": { "row": 9, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 82 }, { "id": "p112.3.84", "order": 87, "type": "table_cell", "bbox": { "l": 198.1246, "t": 136.82119999999998, "r": 249.4726, "b": 111.9212 }, "text": "detention + infiltration", "attrs": { "row": 9, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 83 }, { "id": "p112.3.85", "order": 88, "type": "table_cell", "bbox": { "l": 284.9796, "t": 128.00850000000003, "r": 345.6756, "b": 116.9085 }, "text": "Subsurface", "attrs": { "row": 9, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 84 }, { "id": "p112.3.86", "order": 89, "type": "table_cell", "bbox": { "l": 348.2933, "t": 149.34, "r": 419.7067, "b": 115.48 }, "text": "", "attrs": { "row": 9, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 85 }, { "id": "p112.3.87", "order": 90, "type": "table_cell", "bbox": { "l": 419.7067, "t": 149.34, "r": 491.12, "b": 115.48 }, "text": "", "attrs": { "row": 9, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 86 }, { "id": "p112.3.88", "order": 91, "type": "table_cell", "bbox": { "l": 491.12, "t": 149.34, "r": 562.5333, "b": 115.48 }, "text": "", "attrs": { "row": 9, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 87 }, { "id": "p112.3.89", "order": 92, "type": "table_cell", "bbox": { "l": 562.5333, "t": 149.34, "r": 633.9467, "b": 115.48 }, "text": "", "attrs": { "row": 9, "col": 7, "rowspan": 1, "colspan": 1 }, "reading_order": 88 }, { "id": "p112.3.90", "order": 93, "type": "table_cell", "bbox": { "l": 633.9467, "t": 149.34, "r": 705.36, "b": 115.48 }, "text": "", "attrs": { "row": 9, "col": 8, "rowspan": 1, "colspan": 1 }, "reading_order": 89 }, { "id": "p112.3.91", "order": 94, "type": "table_cell", "bbox": { "l": 65.86423, "t": 101.21614, "r": 113.91523, "b": 81.50364000000002 }, "text": "Subsurface\\nLot 30.08", "attrs": { "row": 10, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 90 }, { "id": "p112.3.92", "order": 95, "type": "table_cell", "bbox": { "l": 131.7001, "t": 107.06661000000003, "r": 172.5214, "b": 80.70790999999997 }, "text": "456967\\n553485", "attrs": { "row": 10, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 91 }, { "id": "p112.3.93", "order": 96, "type": "table_cell", "bbox": { "l": 195.7961, "t": 105.38612999999998, "r": 247.1441, "b": 80.48612000000003 }, "text": "detention + infiltration", "attrs": { "row": 10, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 92 }, { "id": "p112.3.94", "order": 97, "type": "table_cell", "bbox": { "l": 282.6511, "t": 96.57343000000003, "r": 343.3471, "b": 85.47343000000001 }, "text": "Subsurface", "attrs": { "row": 10, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 93 }, { "id": "p112.3.95", "order": 98, "type": "table_cell", "bbox": { "l": 348.2933, "t": 115.48, "r": 419.7067, "b": 81.62 }, "text": "", "attrs": { "row": 10, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 94 }, { "id": "p112.3.96", "order": 99, "type": "table_cell", "bbox": { "l": 419.7067, "t": 115.48, "r": 491.12, "b": 81.62 }, "text": "", "attrs": { "row": 10, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 95 }, { "id": "p112.3.97", "order": 100, "type": "table_cell", "bbox": { "l": 491.12, "t": 115.48, "r": 562.5333, "b": 81.62 }, "text": "", "attrs": { "row": 10, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 96 }, { "id": "p112.3.98", "order": 101, "type": "table_cell", "bbox": { "l": 562.5333, "t": 115.48, "r": 633.9467, "b": 81.62 }, "text": "", "attrs": { "row": 10, "col": 7, "rowspan": 1, "colspan": 1 }, "reading_order": 97 }, { "id": "p112.3.99", "order": 102, "type": "table_cell", "bbox": { "l": 633.9467, "t": 115.48, "r": 705.36, "b": 81.62 }, "text": "", "attrs": { "row": 10, "col": 8, "rowspan": 1, "colspan": 1 }, "reading_order": 98 }, { "id": "p112.3.100", "order": 103, "type": "table_cell", "bbox": { "l": 65.5653, "t": 71.18025, "r": 113.6163, "b": 51.467750000000024 }, "text": "Subsurface\\nLot 30.09", "attrs": { "row": 11, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 99 }, { "id": "p112.3.101", "order": 104, "type": "table_cell", "bbox": { "l": 131.7001, "t": 76.34307000000001, "r": 172.5214, "b": 49.98436000000004 }, "text": "457180\\n553604", "attrs": { "row": 11, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 100 }, { "id": "p112.3.102", "order": 105, "type": "table_cell", "bbox": { "l": 195.408, "t": 76.27962000000002, "r": 246.756, "b": 51.379620000000045 }, "text": "detention + infiltration", "attrs": { "row": 11, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 101 }, { "id": "p112.3.103", "order": 106, "type": "table_cell", "bbox": { "l": 282.263, "t": 67.46691999999996, "r": 342.959, "b": 56.36692000000005 }, "text": "Subsurface", "attrs": { "row": 11, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 102 }, { "id": "p112.3.104", "order": 107, "type": "table_cell", "bbox": { "l": 348.2933, "t": 81.62, "r": 419.7067, "b": 47.76 }, "text": "", "attrs": { "row": 11, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 103 }, { "id": "p112.3.105", "order": 108, "type": "table_cell", "bbox": { "l": 419.7067, "t": 81.62, "r": 491.12, "b": 47.76 }, "text": "", "attrs": { "row": 11, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 104 }, { "id": "p112.3.106", "order": 109, "type": "table_cell", "bbox": { "l": 491.12, "t": 81.62, "r": 562.5333, "b": 47.76 }, "text": "", "attrs": { "row": 11, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 105 }, { "id": "p112.3.107", "order": 110, "type": "table_cell", "bbox": { "l": 562.5333, "t": 81.62, "r": 633.9467, "b": 47.76 }, "text": "", "attrs": { "row": 11, "col": 7, "rowspan": 1, "colspan": 1 }, "reading_order": 106 }, { "id": "p112.3.108", "order": 111, "type": "table_cell", "bbox": { "l": 633.9467, "t": 81.62, "r": 705.36, "b": 47.76 }, "text": "", "attrs": { "row": 11, "col": 8, "rowspan": 1, "colspan": 1 }, "reading_order": 107 } ], "reading_order": 2 } ] }, { "document_id": 16592, "page": 113, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 1, "counts_by_type": { "heading": 1 }, "build_ms": 0, "items": [ { "id": "p113.1", "order": 1, "type": "heading", "bbox": { "l": 253.2, "t": 717.6, "r": 357.84, "b": 696.96 }, "text": "APPENDIX F", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 0 } ] }, { "document_id": 16592, "page": 114, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 5, "counts_by_type": { "caption": 1, "figure": 1, "footer": 3 }, "build_ms": 0, "items": [ { "id": "p114.1", "order": 1, "type": "figure", "bbox": { "l": 53.28, "t": 729.84, "r": 558.96, "b": 60.48 }, "text": "", "attrs": { "block_label": "image" }, "reading_order": 0 }, { "id": "p114.2", "order": 2, "type": "caption", "bbox": { "l": 292.8, "t": 528.24, "r": 319.44, "b": 513.36 }, "text": "SCD", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p114.3", "order": 3, "type": "footer", "bbox": { "l": 71.76, "t": 98.64, "r": 113.28, "b": 68.4 }, "text": "", "attrs": { "block_label": "footer_image" }, "reading_order": 2 }, { "id": "p114.4", "order": 4, "type": "footer", "bbox": { "l": 126.96, "t": 87.12, "r": 157.68, "b": 72 }, "text": "Reach", "attrs": { "block_label": "footer" }, "reading_order": 3 }, { "id": "p114.5", "order": 5, "type": "footer", "bbox": { "l": 288.96, "t": 86.64, "r": 548.4, "b": 56.16 }, "text": "Routing Diagram for 102 Sams -REV 12-02-25\nPrepared by Haler Consulting, Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "footer" }, "reading_order": 4 } ] }, { "document_id": 16592, "page": 115, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 10, "counts_by_type": { "header": 2, "heading": 1, "table": 1, "table_cell": 6 }, "build_ms": 1, "items": [ { "id": "p115.1", "order": 1, "type": "header", "bbox": { "l": 52.08, "t": 737.52, "r": 395.76, "b": 698.88 }, "text": "102 Sams -REV 12-02-25\nPrepared by Haler Consulting\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p115.2", "order": 2, "type": "header", "bbox": { "l": 463.2, "t": 724.56, "r": 560.16, "b": 698.88 }, "text": "Printed 04/12/2025\nPage 2", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p115.3", "order": 3, "type": "heading", "bbox": { "l": 226.32, "t": 687.36, "r": 386.16, "b": 672.96 }, "text": "Area Listing (selected nodes)", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 2 }, { "id": "p115.4", "order": 4, "type": "table", "bbox": { "l": 52.32, "t": 663.36, "r": 443.04, "b": 575.52 }, "text": "", "attrs": { "block_label": "table", "n_rows": 2, "n_cols": 3, "integrity": { "cells_checked": 6, "cells_flagged": 0 } }, "children": [ { "id": "p115.4.1", "order": 5, "type": "table_cell", "bbox": { "l": 116.879997, "t": 661.126246, "r": 143.086498, "b": 636.318852 }, "text": "Area (sq-ft)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 0 }, { "id": "p115.4.2", "order": 6, "type": "table_cell", "bbox": { "l": 165.479999, "t": 661.126246, "r": 179.801438, "b": 650.1188589999999 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 1 }, { "id": "p115.4.3", "order": 7, "type": "table_cell", "bbox": { "l": 200.001374, "t": 661.126246, "r": 311.238628, "b": 636.318852 }, "text": "Description (subcatchment-numbers)", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 2 }, { "id": "p115.4.4", "order": 8, "type": "table_cell", "bbox": { "l": 107.279995, "t": 629.926241, "r": 143.321918, "b": 577.518845 }, "text": "239,315\n60,345\n236,879\n536,539", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p115.4.5", "order": 9, "type": "table_cell", "bbox": { "l": 168.786654, "t": 629.926241, "r": 180.111841, "b": 577.518845 }, "text": "39\n98\n30\n42", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p115.4.6", "order": 10, "type": "table_cell", "bbox": { "l": 200.002058, "t": 629.926241, "r": 441.06925, "b": 577.518845 }, "text": ">75% Grass cover, Good, HSG A (178S, 179S, 180S)\nPaved parking, HSG A (170S, 174S, 181S)\nWoods, Good, HSG A (179S)\nTOTAL AREA", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 } ], "reading_order": 3 } ] }, { "document_id": 16592, "page": 116, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 2, "counts_by_type": { "footer": 1, "text": 1 }, "build_ms": 1, "items": [ { "id": "p116.1", "order": 1, "type": "text", "bbox": { "l": 50.16, "t": 685.2, "r": 559.68, "b": 294.72 }, "text": "Time span=0.00-72.00 hrs, dt=0.01 hrs, 7201 points\nRunoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious\nReach routing by Stor-Ind+Trans method - Pond routing by Stor-Ind method\n\nSubcatchment 170S: DA P1 (Impervious) Runoff Area=31,625 sf 100.00% Impervious Runoff Depth=3.19\"\nFlow Length=450' Tc=3.0 min CN=0/98 Runoff=2.34 cfs 8,398 cf\n\nSubcatchment 174S: DA P2 (Impervious) Runoff Area=23,470 sf 100.00% Impervious Runoff Depth=3.19\"\nFlow Length=450' Tc=4.9 min CN=0/98 Runoff=1.53 cfs 6,233 cf\n\nSubcatchment 178S: DA P3 (Pervious) Runoff Area=62,973 sf 0.00% Impervious Runoff Depth=0.01\"\nFlow Length=316' Slope=0.0200'/' Tc=13.1 min CN=39/0 Runoff=0.00 cfs 28 cf\n\nSubcatchment 179S: DA P0 Pervious Runoff Area=336,250 sf 0.00% Impervious Runoff Depth=0.00\"\nFlow Length=679' Tc=49.8 min CN=33/0 Runoff=0.00 cfs 0 cf\n\nSubcatchment 180S: DA P4 (Pervious) Runoff Area=76,971 sf 0.00% Impervious Runoff Depth=0.01\"\nFlow Length=196' Slope=0.0100'/' Tc=14.8 min CN=39/0 Runoff=0.00 cfs 34 cf\n\nSubcatchment 181S: DA P6 (Impervious) Runoff Area=5,250 sf 100.00% Impervious Runoff Depth=3.19\"\nFlow Length=150' Tc=1.4 min CN=0/98 Runoff=0.43 cfs 1,394 cf\n\nPond 183P: WQ Infiltration Basin #1 Peak Elevation=97.83' Storage=15,558 cfs Inflow=2.34 cfs 8,433 cf\nDiscarded=0.00 cfs 0 cf Primary=0.26 cfs 4,631 cf Outflow=0.26 cfs 4,631 cf\n\nPond 184P: WQ Infiltration Basin #2 Peak Elevation=93.98' Storage=11,122 cfs Inflow=1.53 cfs 6,261 cf\nDiscarded=0.00 cfs 0 cf Primary=0.10 cfs 2,699 cf Outflow=0.10 cfs 2,699 cf\n\nLink 185L: POA Inflow=0.43 cfs 8,725 cf Primary=0.43 cfs 8,725 cf\nTotal Runoff Area = 536,539 sf Runoff Volume = 16,088 cf Average Runoff Depth = 0.36\"\n88.75% Pervious = 476.194 sf 11.25% Impervious = 60.345 sf", "attrs": { "block_label": "algorithm" }, "reading_order": 0 }, { "id": "p116.2", "order": 2, "type": "footer", "bbox": { "l": 50.4, "t": 739.2, "r": 559.68, "b": 700.08 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 2-Year Rainfall=3.42\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 3", "attrs": { "block_label": "footer" }, "reading_order": 1 } ] }, { "document_id": 16592, "page": 117, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 32, "counts_by_type": { "caption": 1, "figure": 1, "footnote": 1, "header": 1, "table": 1, "table_cell": 24, "text": 2, "title": 1 }, "build_ms": 3, "items": [ { "id": "p117.1", "order": 1, "type": "header", "bbox": { "l": 53.28, "t": 738.24, "r": 560.64, "b": 698.64 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 2-Year Rainfall=3.42\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 4", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p117.2", "order": 2, "type": "title", "bbox": { "l": 148.08, "t": 687.6, "r": 463.92, "b": 672.24 }, "text": "Summary for Subcatchment 170S: DA P1 (Impervious)", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p117.3", "order": 3, "type": "text", "bbox": { "l": 53.76, "t": 660.48, "r": 463.92, "b": 634.08 }, "text": "Runoff = 2.34 cfs @ 12.11 hrs, Volume= 8,398 cf, Depth= 3.19\"\nRouted to Pond 183P : WQ Infiltration Basin #1", "reading_order": 2 }, { "id": "p117.4", "order": 4, "type": "text", "bbox": { "l": 52.32, "t": 623.76, "r": 611.04, "b": 598.32 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious, Time Span= 0.00-72.00 hrs, dt= NOAA 24-hr D 2-Year Rainfall=3.42\"", "reading_order": 3 }, { "id": "p117.5", "order": 5, "type": "table", "bbox": { "l": 52.56, "t": 588.48, "r": 559.2, "b": 447.497874 }, "text": "", "attrs": { "block_label": "table", "n_rows": 6, "n_cols": 5, "integrity": { "cells_checked": 22, "cells_flagged": 0 } }, "children": [ { "id": "p117.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 86.520001, "t": 587.142469, "r": 127.590159, "b": 575.177889 }, "text": "Area (sf)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p117.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 144.389888, "t": 587.142469, "r": 159.742288, "b": 575.177889 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p117.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 286.601768, "t": 535.302451, "r": 340.102911, "b": 523.337871 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p117.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 95.280001, "t": 559.302451, "r": 127.805562, "b": 547.337871 }, "text": "31,625", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 3 }, { "id": "p117.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 148.003832, "t": 559.302451, "r": 159.753993, "b": 547.337871 }, "text": "98", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p117.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 174.16295, "t": 573.222448, "r": 281.259838, "b": 561.257868 }, "text": "Paved parking, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 5 }, { "id": "p117.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 95.280001, "t": 573.222448, "r": 127.805562, "b": 561.257868 }, "text": "31,625", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p117.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 148.003832, "t": 573.222448, "r": 159.753993, "b": 561.257868 }, "text": "98", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p117.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 174.16295, "t": 559.302451, "r": 296.664294, "b": 547.337871 }, "text": "100.00% Impervious Area", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 8 }, { "id": "p117.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 65.040001, "t": 535.302451, "r": 89.475992, "b": 497.417872 }, "text": "Tc (min)\n1.2", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 9 }, { "id": "p117.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 100.248415, "t": 535.302451, "r": 132.68142, "b": 497.417872 }, "text": "Length (feet)\n100", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 10 }, { "id": "p117.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 143.445254, "t": 535.302451, "r": 175.895438, "b": 497.417872 }, "text": "Slope (ft/ft)\n0.0200", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 11 }, { "id": "p117.5.13", "order": 18, "type": "table_cell", "bbox": { "l": 186.552062, "t": 535.302451, "r": 223.968178, "b": 497.417872 }, "text": "Velocity (ft/sec)\n1.42", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 12 }, { "id": "p117.5.14", "order": 19, "type": "table_cell", "bbox": { "l": 234.581918, "t": 535.302451, "r": 473.002733, "b": 485.417872 }, "text": "Capacity (cfs)\nSheet Flow, Smooth surfaces n= 0.011 P2= 3.42\"", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 13 }, { "id": "p117.5.15", "order": 20, "type": "table_cell", "bbox": { "l": 74.639998, "t": 485.382452, "r": 89.475992, "b": 473.417872 }, "text": "1.8", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p117.5.16", "order": 21, "type": "table_cell", "bbox": { "l": 114.927527, "t": 485.382452, "r": 132.68142, "b": 473.417872 }, "text": "350", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p117.5.17", "order": 22, "type": "table_cell", "bbox": { "l": 143.445254, "t": 485.382452, "r": 175.863606, "b": 473.417872 }, "text": "0.0250", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p117.5.18", "order": 23, "type": "table_cell", "bbox": { "l": 203.137703, "t": 485.382452, "r": 223.870219, "b": 473.417872 }, "text": "3.21", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p117.5.19", "order": 24, "type": "table_cell", "bbox": { "l": 286.679993, "t": 485.26245, "r": 425.623588, "b": 461.417872 }, "text": "Shallow Concentrated Flow, Paved Kv= 20.3 fps", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p117.5.20", "order": 25, "type": "table_cell", "bbox": { "l": 74.639998, "t": 459.462454, "r": 89.475992, "b": 447.497874 }, "text": "3.0", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p117.5.21", "order": 26, "type": "table_cell", "bbox": { "l": 114.927527, "t": 459.462454, "r": 132.68142, "b": 447.497874 }, "text": "450", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p117.5.22", "order": 27, "type": "table_cell", "bbox": { "l": 143.445254, "t": 459.462454, "r": 167.029543, "b": 447.497874 }, "text": "Total", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p117.5.23", "order": 28, "type": "table_cell", "bbox": { "l": 356.544, "t": 470.6057, "r": 457.872, "b": 450.96 }, "text": "", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 22 }, { "id": "p117.5.24", "order": 29, "type": "table_cell", "bbox": { "l": 457.872, "t": 470.6057, "r": 559.2, "b": 450.96 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 23 } ], "reading_order": 4 }, { "id": "p117.6", "order": 30, "type": "caption", "bbox": { "l": 186.96, "t": 435.12, "r": 424.56, "b": 419.76 }, "text": "Subcatchment 170S: DA P1 (Impervious)", "attrs": { "block_label": "figure_title" }, "reading_order": 5 }, { "id": "p117.7", "order": 31, "type": "figure", "bbox": { "l": 60.96, "t": 417.12, "r": 552.24, "b": 150 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nRunoff\n2.34 cfs\nNOAA 24-hr D\n2 2-Year Rainfall=3.42\"\nRunoff Area=31,625 sf\nRunoff Volume=8,398 cf\n(cfs) Runoff Depth=3.19\"\nFlow Flow Length=450'\nTc=3.0 min\n1\nCN=0/98\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72\nTime (hours)" }, "reading_order": 6 }, { "id": "p117.8", "order": 32, "type": "footnote", "bbox": { "l": 84.48, "t": 168.48, "r": 493.2, "b": 147.84 }, "text": "0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72 Time (hours)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 7 } ] }, { "document_id": 16592, "page": 118, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 34, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "table": 1, "table_cell": 24, "text": 5, "title": 1 }, "build_ms": 3, "items": [ { "id": "p118.1", "order": 1, "type": "header", "bbox": { "l": 53.28, "t": 738.24, "r": 560.64, "b": 698.64 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 2-Year Rainfall=3.42\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 5", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p118.2", "order": 2, "type": "title", "bbox": { "l": 148.08, "t": 687.36, "r": 463.92, "b": 672.24 }, "text": "Summary for Subcatchment 174S: DA P2 (Impervious)", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p118.3", "order": 3, "type": "text", "bbox": { "l": 52.08, "t": 659.52, "r": 303.84, "b": 647.04 }, "text": "Runoff = 1.53 cfs @ 12.13 hrs, Volume=6,233 cf, Depth= 3.19\"", "reading_order": 2 }, { "id": "p118.4", "order": 4, "type": "text", "bbox": { "l": 66.24, "t": 647.28, "r": 294.96, "b": 634.56 }, "text": "Routed to Pond 184P : WQ Infiltration Basin #2", "reading_order": 3 }, { "id": "p118.5", "order": 5, "type": "text", "bbox": { "l": 347.04, "t": 660, "r": 463.44, "b": 646.56 }, "text": "6,233 cf, Depth= 3.19\"", "reading_order": 4 }, { "id": "p118.6", "order": 6, "type": "text", "bbox": { "l": 52.32, "t": 623.76, "r": 611.04, "b": 598.32 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious, Time Span= 0.00-72.00 hrs, dt= NOAA 24-hr D 2-Year Rainfall=3.42\"", "reading_order": 5 }, { "id": "p118.7", "order": 7, "type": "table", "bbox": { "l": 52.56, "t": 588.48, "r": 559.2, "b": 447.497874 }, "text": "", "attrs": { "block_label": "table", "n_rows": 6, "n_cols": 5, "integrity": { "cells_checked": 22, "cells_flagged": 0 } }, "children": [ { "id": "p118.7.1", "order": 8, "type": "table_cell", "bbox": { "l": 86.520001, "t": 587.142469, "r": 127.590159, "b": 575.177889 }, "text": "Area (sf)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p118.7.2", "order": 9, "type": "table_cell", "bbox": { "l": 144.389888, "t": 587.142469, "r": 159.742288, "b": 575.177889 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p118.7.3", "order": 10, "type": "table_cell", "bbox": { "l": 286.601768, "t": 535.302451, "r": 340.102911, "b": 523.337871 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p118.7.4", "order": 11, "type": "table_cell", "bbox": { "l": 95.280001, "t": 559.302451, "r": 127.805562, "b": 547.337871 }, "text": "23,470", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 3 }, { "id": "p118.7.5", "order": 12, "type": "table_cell", "bbox": { "l": 148.003832, "t": 559.302451, "r": 159.753993, "b": 547.337871 }, "text": "98", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p118.7.6", "order": 13, "type": "table_cell", "bbox": { "l": 174.16295, "t": 573.222448, "r": 281.259838, "b": 561.257868 }, "text": "Paved parking, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 5 }, { "id": "p118.7.7", "order": 14, "type": "table_cell", "bbox": { "l": 95.280001, "t": 573.222448, "r": 127.805562, "b": 561.257868 }, "text": "23,470", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p118.7.8", "order": 15, "type": "table_cell", "bbox": { "l": 148.003832, "t": 573.222448, "r": 159.753993, "b": 561.257868 }, "text": "98", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p118.7.9", "order": 16, "type": "table_cell", "bbox": { "l": 174.16295, "t": 559.302451, "r": 296.664294, "b": 547.337871 }, "text": "100.00% Impervious Area", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 8 }, { "id": "p118.7.10", "order": 17, "type": "table_cell", "bbox": { "l": 65.040001, "t": 535.302451, "r": 89.475992, "b": 497.417872 }, "text": "Tc (min)\n0.8", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 9 }, { "id": "p118.7.11", "order": 18, "type": "table_cell", "bbox": { "l": 100.248415, "t": 535.302451, "r": 132.68142, "b": 497.417872 }, "text": "Length (feet)\n100", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 10 }, { "id": "p118.7.12", "order": 19, "type": "table_cell", "bbox": { "l": 143.445254, "t": 535.302451, "r": 175.895438, "b": 497.417872 }, "text": "Slope (ft/ft)\n0.0500", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 11 }, { "id": "p118.7.13", "order": 20, "type": "table_cell", "bbox": { "l": 186.552062, "t": 535.302451, "r": 223.968178, "b": 497.417872 }, "text": "Velocity (ft/sec)\n2.05", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 12 }, { "id": "p118.7.14", "order": 21, "type": "table_cell", "bbox": { "l": 234.581918, "t": 535.302451, "r": 473.002733, "b": 485.417872 }, "text": "Capacity (cfs)\nSheet Flow, Smooth surfaces n= 0.011 P2= 3.42\"", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 13 }, { "id": "p118.7.15", "order": 22, "type": "table_cell", "bbox": { "l": 74.639998, "t": 485.382452, "r": 89.475992, "b": 473.417872 }, "text": "4.1", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p118.7.16", "order": 23, "type": "table_cell", "bbox": { "l": 114.927527, "t": 485.382452, "r": 132.68142, "b": 473.417872 }, "text": "350", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p118.7.17", "order": 24, "type": "table_cell", "bbox": { "l": 143.445254, "t": 485.382452, "r": 175.863606, "b": 473.417872 }, "text": "0.0050", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p118.7.18", "order": 25, "type": "table_cell", "bbox": { "l": 203.137703, "t": 485.382452, "r": 223.870219, "b": 473.417872 }, "text": "1.44", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p118.7.19", "order": 26, "type": "table_cell", "bbox": { "l": 286.679993, "t": 485.26245, "r": 425.623588, "b": 461.417872 }, "text": "Shallow Concentrated Flow, Paved Kv= 20.3 fps", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p118.7.20", "order": 27, "type": "table_cell", "bbox": { "l": 74.639998, "t": 459.462454, "r": 89.475992, "b": 447.497874 }, "text": "4.9", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p118.7.21", "order": 28, "type": "table_cell", "bbox": { "l": 114.927527, "t": 459.462454, "r": 132.68142, "b": 447.497874 }, "text": "450", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p118.7.22", "order": 29, "type": "table_cell", "bbox": { "l": 143.445254, "t": 459.462454, "r": 167.029543, "b": 447.497874 }, "text": "Total", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p118.7.23", "order": 30, "type": "table_cell", "bbox": { "l": 356.544, "t": 471.0171, "r": 457.872, "b": 451.44 }, "text": "", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 22 }, { "id": "p118.7.24", "order": 31, "type": "table_cell", "bbox": { "l": 457.872, "t": 471.0171, "r": 559.2, "b": 451.44 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 23 } ], "reading_order": 6 }, { "id": "p118.8", "order": 32, "type": "caption", "bbox": { "l": 186.96, "t": 435.12, "r": 424.56, "b": 419.76 }, "text": "Subcatchment 174S: DA P2 (Impervious)", "attrs": { "block_label": "figure_title" }, "reading_order": 7 }, { "id": "p118.9", "order": 33, "type": "figure", "bbox": { "l": 60.24, "t": 416.4, "r": 553.2, "b": 150 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nRunoff\n1.53 cfs\nNOAA 24-hr D\n2-Year Rainfall=3.42\"\nRunoff Area=23,470 sf\nRunoff Volume=6,233 cf\n1\n(cfs) Runoff Depth=3.19\"\nFlow Flow Length=450'\nTc=4.9 min\nCN=0/98\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72\nTime (hours)" }, "reading_order": 8 }, { "id": "p118.10", "order": 34, "type": "text", "bbox": { "l": 265.44, "t": 155.76, "r": 312.96, "b": 147.12 }, "text": "Time (hours)", "attrs": { "block_label": "number" }, "reading_order": 9 } ] }, { "document_id": 16592, "page": 119, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 33, "counts_by_type": { "caption": 2, "figure": 1, "header": 1, "table": 1, "table_cell": 24, "text": 3, "title": 1 }, "build_ms": 4, "items": [ { "id": "p119.1", "order": 1, "type": "header", "bbox": { "l": 53.28, "t": 738.24, "r": 560.64, "b": 698.64 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 2-Year Rainfall=3.42\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 6", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p119.2", "order": 2, "type": "title", "bbox": { "l": 154.8, "t": 687.36, "r": 457.2, "b": 672.24 }, "text": "Summary for Subcatchment 178S: DA P3 (Pervious)", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p119.3", "order": 3, "type": "text", "bbox": { "l": 53.52, "t": 660.24, "r": 463.2, "b": 634.08 }, "text": "Runoff = 0.00 cfs @ 24.01 hrs, Volume= 28 cf, Depth= 0.01\"\nRouted to Pond 184P : WQ Infiltration Basin #2", "reading_order": 2 }, { "id": "p119.4", "order": 4, "type": "text", "bbox": { "l": 52.32, "t": 623.52, "r": 611.04, "b": 598.08 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious, Time Span= 0.00-72.00 hrs, dt= NOAA 24-hr D 2-Year Rainfall=3.42\"", "reading_order": 3 }, { "id": "p119.5", "order": 5, "type": "table", "bbox": { "l": 52.56, "t": 588.72, "r": 558.96, "b": 447.497874 }, "text": "", "attrs": { "block_label": "table", "n_rows": 6, "n_cols": 5, "integrity": { "cells_checked": 22, "cells_flagged": 0 } }, "children": [ { "id": "p119.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 86.520001, "t": 587.142469, "r": 127.590159, "b": 575.177889 }, "text": "Area (sf)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p119.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 144.389888, "t": 587.142469, "r": 159.742288, "b": 575.177889 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p119.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 286.601768, "t": 535.302451, "r": 340.102911, "b": 523.337871 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p119.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 95.280001, "t": 559.302451, "r": 127.805562, "b": 547.337871 }, "text": "62,973", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 3 }, { "id": "p119.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 148.003832, "t": 559.302451, "r": 159.753993, "b": 547.337871 }, "text": "39", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p119.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 174.16295, "t": 573.222448, "r": 333.31717, "b": 561.257868 }, "text": ">75% Grass cover, Good, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 5 }, { "id": "p119.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 95.280001, "t": 573.222448, "r": 127.805562, "b": 561.257868 }, "text": "62,973", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p119.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 148.003832, "t": 573.222448, "r": 159.753993, "b": 561.257868 }, "text": "39", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p119.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 174.16295, "t": 559.302451, "r": 286.000299, "b": 547.337871 }, "text": "100.00% Pervious Area", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 8 }, { "id": "p119.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 65.040001, "t": 535.302451, "r": 89.475992, "b": 497.417872 }, "text": "Tc (min)\n9.5", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 9 }, { "id": "p119.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 100.248415, "t": 535.302451, "r": 132.68142, "b": 497.417872 }, "text": "Length (feet)\n100", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 10 }, { "id": "p119.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 143.445254, "t": 535.302451, "r": 175.895438, "b": 497.417872 }, "text": "Slope (ft/ft)\n0.0200", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 11 }, { "id": "p119.5.13", "order": 18, "type": "table_cell", "bbox": { "l": 186.552062, "t": 535.302451, "r": 223.968178, "b": 497.417872 }, "text": "Velocity (ft/sec)\n0.18", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 12 }, { "id": "p119.5.14", "order": 19, "type": "table_cell", "bbox": { "l": 234.581918, "t": 535.302451, "r": 452.820335, "b": 485.417872 }, "text": "Capacity (cfs)\nSheet Flow, Grass: Short n= 0.150 P2= 3.42\"", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 13 }, { "id": "p119.5.15", "order": 20, "type": "table_cell", "bbox": { "l": 74.639998, "t": 485.382452, "r": 89.475992, "b": 473.417872 }, "text": "3.6", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p119.5.16", "order": 21, "type": "table_cell", "bbox": { "l": 114.927527, "t": 485.382452, "r": 132.68142, "b": 473.417872 }, "text": "216", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p119.5.17", "order": 22, "type": "table_cell", "bbox": { "l": 143.445254, "t": 485.382452, "r": 175.863606, "b": 473.417872 }, "text": "0.0200", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p119.5.18", "order": 23, "type": "table_cell", "bbox": { "l": 203.137703, "t": 485.382452, "r": 223.870219, "b": 473.417872 }, "text": "0.99", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p119.5.19", "order": 24, "type": "table_cell", "bbox": { "l": 286.679993, "t": 485.26245, "r": 446.147004, "b": 461.417872 }, "text": "Shallow Concentrated Flow, Short Grass Pasture Kv= 7.0 fps", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p119.5.20", "order": 25, "type": "table_cell", "bbox": { "l": 68.76, "t": 459.462454, "r": 89.492517, "b": 447.497874 }, "text": "13.1", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p119.5.21", "order": 26, "type": "table_cell", "bbox": { "l": 114.944052, "t": 459.462454, "r": 132.697945, "b": 447.497874 }, "text": "316", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p119.5.22", "order": 27, "type": "table_cell", "bbox": { "l": 143.354569, "t": 459.462454, "r": 166.947862, "b": 447.497874 }, "text": "Total", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p119.5.23", "order": 28, "type": "table_cell", "bbox": { "l": 356.4, "t": 470.8457, "r": 457.68, "b": 451.2 }, "text": "", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 22 }, { "id": "p119.5.24", "order": 29, "type": "table_cell", "bbox": { "l": 457.68, "t": 470.8457, "r": 558.96, "b": 451.2 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 23 } ], "reading_order": 4 }, { "id": "p119.6", "order": 30, "type": "caption", "bbox": { "l": 193.2, "t": 435.12, "r": 417.84, "b": 420 }, "text": "Subcatchment 178S: DA P3 (Pervious)", "attrs": { "block_label": "figure_title" }, "reading_order": 5 }, { "id": "p119.7", "order": 31, "type": "caption", "bbox": { "l": 254.4, "t": 414.48, "r": 306.24, "b": 404.16 }, "text": "Hydrograph", "attrs": { "block_label": "figure_title" }, "reading_order": 6 }, { "id": "p119.8", "order": 32, "type": "figure", "bbox": { "l": 62.88, "t": 413.28, "r": 549.84, "b": 149.04 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nRunoff\n0.002\n0.00 cfs\n0.002\n0.002 NOAA 24-hr D\n0.002\n0.002 2-Year Rainfall=3.42\"\n0.002\n0.002 Runoff Area=62,973 sf\n0.001 Runoff Volume=28 cf\n0.001\n(cfs) 0.001 Runoff Depth=0.01\"\n0.001\nFlow Flow Length=316'\n0.001\n0.001\nSlope=0.0200 '/'\n0.001\n0.001\n0.001 Tc=13.1 min\n0.000\n0.000 CN=39/0\n0.000\n0.000\n0\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72\nTime (hours)" }, "reading_order": 7 }, { "id": "p119.9", "order": 33, "type": "text", "bbox": { "l": 269.76, "t": 155.76, "r": 317.52, "b": 147.12 }, "text": "Time (hours)", "attrs": { "block_label": "number" }, "reading_order": 8 } ] }, { "document_id": 16592, "page": 120, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 38, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "table": 1, "table_cell": 31, "text": 2, "title": 1 }, "build_ms": 4, "items": [ { "id": "p120.1", "order": 1, "type": "header", "bbox": { "l": 53.28, "t": 738.48, "r": 560.64, "b": 698.64 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 2-Year Rainfall=3.42\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 7", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p120.2", "order": 2, "type": "title", "bbox": { "l": 159.36, "t": 687.6, "r": 453.36, "b": 672.48 }, "text": "Summary for Subcatchment 179S: DA P0 Pervious", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p120.3", "order": 3, "type": "text", "bbox": { "l": 53.28, "t": 660.24, "r": 463.2, "b": 634.56 }, "text": "Runoff = 0.00 cfs @ 0.00 hrs, Volume= 0 cf, Depth= 0.00\"\nRouted to Link 185L : POA", "reading_order": 2 }, { "id": "p120.4", "order": 4, "type": "text", "bbox": { "l": 52.08, "t": 623.76, "r": 611.28, "b": 598.32 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious, Time Span= 0.00-72.00 hrs, dt= NOAA 24-hr D 2-Year Rainfall=3.42\"", "reading_order": 3 }, { "id": "p120.5", "order": 5, "type": "table", "bbox": { "l": 53.52, "t": 587.76, "r": 558.96, "b": 423.497874 }, "text": "", "attrs": { "block_label": "table", "n_rows": 8, "n_cols": 5, "integrity": { "cells_checked": 29, "cells_flagged": 1, "flags": [ { "row": 5, "col": 4, "coverage": 0, "text": "Sheet Flow, Woods: Light underbrush n=0.400 P2=3.42\" Shallo…" } ] } }, "children": [ { "id": "p120.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 86.520001, "t": 587.142469, "r": 127.590159, "b": 575.177889 }, "text": "Area (sf)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p120.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 144.389888, "t": 587.142469, "r": 159.742288, "b": 575.177889 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p120.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 286.601768, "t": 511.302451, "r": 340.102911, "b": 499.337871 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p120.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 89.399998, "t": 573.222448, "r": 127.805562, "b": 549.257868 }, "text": "236,879\n99,371", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p120.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 147.913142, "t": 573.222448, "r": 159.770513, "b": 549.257868 }, "text": "30\n39", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p120.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 174.07226, "t": 573.222448, "r": 333.31717, "b": 549.257868 }, "text": "Woods, Good, HSG A\n>75% Grass cover, Good, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p120.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 89.399998, "t": 535.302451, "r": 127.714872, "b": 523.337871 }, "text": "336,250", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p120.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 147.913142, "t": 535.302451, "r": 159.770513, "b": 523.337871 }, "text": "33", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p120.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 174.07226, "t": 547.302451, "r": 262.271799, "b": 535.337871 }, "text": "Weighted Average", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 8 }, { "id": "p120.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 89.399998, "t": 547.302451, "r": 127.714872, "b": 535.337871 }, "text": "336,250", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p120.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 147.913142, "t": 547.302451, "r": 159.770513, "b": 535.337871 }, "text": "33", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p120.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 174.07226, "t": 535.302451, "r": 286.016818, "b": 523.337871 }, "text": "100.00% Pervious Area", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 11 }, { "id": "p120.5.13", "order": 18, "type": "table_cell", "bbox": { "l": 65.040001, "t": 511.302451, "r": 89.40872, "b": 487.337871 }, "text": "Tc (min)", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 12 }, { "id": "p120.5.14", "order": 19, "type": "table_cell", "bbox": { "l": 100.248415, "t": 511.302451, "r": 132.666767, "b": 487.337871 }, "text": "Length (feet)", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p120.5.15", "order": 20, "type": "table_cell", "bbox": { "l": 148.683866, "t": 511.302451, "r": 175.895438, "b": 487.337871 }, "text": "Slope (ft/ft)", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p120.5.16", "order": 21, "type": "table_cell", "bbox": { "l": 186.552062, "t": 511.302451, "r": 223.968178, "b": 487.337871 }, "text": "Velocity (ft/sec)", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p120.5.17", "order": 22, "type": "table_cell", "bbox": { "l": 234.581918, "t": 511.302451, "r": 275.988028, "b": 487.337871 }, "text": "Capacity (cfs)", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p120.5.18", "order": 23, "type": "table_cell", "bbox": { "l": 68.76, "t": 485.382452, "r": 89.492517, "b": 473.417872 }, "text": "36.2", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p120.5.19", "order": 24, "type": "table_cell", "bbox": { "l": 114.944052, "t": 485.382452, "r": 132.697945, "b": 473.417872 }, "text": "100", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p120.5.20", "order": 25, "type": "table_cell", "bbox": { "l": 143.354569, "t": 485.382452, "r": 175.880131, "b": 473.417872 }, "text": "0.0050", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p120.5.21", "order": 26, "type": "table_cell", "bbox": { "l": 203.154228, "t": 485.382452, "r": 223.886744, "b": 473.417872 }, "text": "0.05", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p120.5.22", "order": 27, "type": "table_cell", "bbox": { "l": 457.872, "t": 481.04, "r": 558.96, "b": 445.4667 }, "text": "Sheet Flow, Woods: Light underbrush n=0.400 P2=3.42\" Shallow Concentrated Flow, Woodland Kv=5.0 fps", "attrs": { "row": 5, "col": 4, "rowspan": 2, "colspan": 1 }, "reading_order": 21 }, { "id": "p120.5.23", "order": 28, "type": "table_cell", "bbox": { "l": 68.76, "t": 461.382452, "r": 89.492517, "b": 449.417872 }, "text": "13.6", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 22 }, { "id": "p120.5.24", "order": 29, "type": "table_cell", "bbox": { "l": 114.944052, "t": 461.382452, "r": 132.697945, "b": 449.417872 }, "text": "579", "attrs": { "row": 6, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 23 }, { "id": "p120.5.25", "order": 30, "type": "table_cell", "bbox": { "l": 143.354569, "t": 461.382452, "r": 175.880131, "b": 449.417872 }, "text": "0.0200", "attrs": { "row": 6, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 24 }, { "id": "p120.5.26", "order": 31, "type": "table_cell", "bbox": { "l": 203.154228, "t": 461.382452, "r": 223.886744, "b": 449.417872 }, "text": "0.71", "attrs": { "row": 6, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 25 }, { "id": "p120.5.27", "order": 32, "type": "table_cell", "bbox": { "l": 68.76, "t": 435.462454, "r": 89.492517, "b": 423.497874 }, "text": "49.8", "attrs": { "row": 7, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 26 }, { "id": "p120.5.28", "order": 33, "type": "table_cell", "bbox": { "l": 114.944052, "t": 435.462454, "r": 132.697945, "b": 423.497874 }, "text": "679", "attrs": { "row": 7, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 27 }, { "id": "p120.5.29", "order": 34, "type": "table_cell", "bbox": { "l": 143.354569, "t": 435.462454, "r": 166.947862, "b": 423.497874 }, "text": "Total", "attrs": { "row": 7, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 28 }, { "id": "p120.5.30", "order": 35, "type": "table_cell", "bbox": { "l": 356.784, "t": 445.4667, "r": 457.872, "b": 427.68 }, "text": "", "attrs": { "row": 7, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 29 }, { "id": "p120.5.31", "order": 36, "type": "table_cell", "bbox": { "l": 457.872, "t": 445.4667, "r": 558.96, "b": 427.68 }, "text": "", "attrs": { "row": 7, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 30 } ], "reading_order": 4 }, { "id": "p120.6", "order": 37, "type": "caption", "bbox": { "l": 197.52, "t": 410.64, "r": 414.24, "b": 396 }, "text": "Subcatchment 179S: DA P0 Pervious", "attrs": { "block_label": "figure_title" }, "reading_order": 5 }, { "id": "p120.7", "order": 38, "type": "figure", "bbox": { "l": 60.48, "t": 394.56, "r": 550.56, "b": 125.52 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n1\nRunoff\nNOAA 24-hr D\n2-Year Rainfall=3.42\"\nRunoff Area=336,250 sf\nRunoff Volume=0 cf\n(cfs)\nRunoff Depth=0.00\"\nFlow\nFlow Length=679'\nTc=49.8 min\nCN=33/0\n0.00 cfs\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72\nTime (hours)" }, "reading_order": 6 } ] }, { "document_id": 16592, "page": 121, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 41, "counts_by_type": { "caption": 1, "figure": 2, "table": 1, "table_cell": 33, "text": 3, "title": 1 }, "build_ms": 4, "items": [ { "id": "p121.1", "order": 1, "type": "figure", "bbox": { "l": 53.28, "t": 738.24, "r": 560.64, "b": 698.64 }, "text": "", "attrs": { "role": "page_header", "block_label": "header_image", "embedded_text": "102 Sams -REV 12-02-25 NOAA 24-hr D 2-Year Rainfall=3.42\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 8" }, "reading_order": 0 }, { "id": "p121.2", "order": 2, "type": "title", "bbox": { "l": 154.8, "t": 687.36, "r": 457.2, "b": 672.24 }, "text": "Summary for Subcatchment 180S: DA P4 (Pervious)", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p121.3", "order": 3, "type": "text", "bbox": { "l": 53.76, "t": 660.24, "r": 463.44, "b": 634.08 }, "text": "Runoff = 0.00 cfs @ 24.01 hrs, Volume= 34 cf, Depth= 0.01\"\nRouted to Pond 183P : WQ Infiltration Basin #1", "reading_order": 2 }, { "id": "p121.4", "order": 4, "type": "text", "bbox": { "l": 52.56, "t": 623.52, "r": 610.8, "b": 598.32 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious, Time Span= 0.00-72.00 hrs, dt= NOAA 24-hr D 2-Year Rainfall=3.42\"", "reading_order": 3 }, { "id": "p121.5", "order": 5, "type": "table", "bbox": { "l": 52.32, "t": 588.48, "r": 559.2, "b": 447.497874 }, "text": "", "attrs": { "block_label": "table", "n_rows": 7, "n_cols": 6, "integrity": { "cells_checked": 28, "cells_flagged": 0 } }, "children": [ { "id": "p121.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 86.520001, "t": 587.142469, "r": 127.590159, "b": 575.177889 }, "text": "Area (sf)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p121.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 144.389888, "t": 587.142469, "r": 159.742288, "b": 575.177889 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p121.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 286.601768, "t": 535.302451, "r": 340.102911, "b": 523.337871 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p121.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 95.280001, "t": 559.302451, "r": 127.805562, "b": 547.337871 }, "text": "76,971", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 3 }, { "id": "p121.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 148.003832, "t": 559.302451, "r": 159.753993, "b": 547.337871 }, "text": "39", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p121.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 174.16295, "t": 573.222448, "r": 333.31717, "b": 561.257868 }, "text": ">75% Grass cover, Good, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 5 }, { "id": "p121.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 95.280001, "t": 573.222448, "r": 127.805562, "b": 561.257868 }, "text": "76,971", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 6 }, { "id": "p121.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 148.003832, "t": 573.222448, "r": 159.753993, "b": 561.257868 }, "text": "39", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p121.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 174.16295, "t": 559.302451, "r": 286.000299, "b": 547.337871 }, "text": "100.00% Pervious Area", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 8 }, { "id": "p121.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 65.040001, "t": 535.302451, "r": 89.40872, "b": 511.337871 }, "text": "Tc (min)", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p121.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 100.248415, "t": 535.302451, "r": 132.666767, "b": 511.337871 }, "text": "Length (feet)", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p121.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 148.683866, "t": 535.302451, "r": 175.895438, "b": 511.337871 }, "text": "Slope (ft/ft)", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 }, { "id": "p121.5.13", "order": 18, "type": "table_cell", "bbox": { "l": 186.552062, "t": 535.302451, "r": 223.968178, "b": 511.337871 }, "text": "Velocity (ft/sec)", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 12 }, { "id": "p121.5.14", "order": 19, "type": "table_cell", "bbox": { "l": 234.581918, "t": 535.302451, "r": 275.988028, "b": 511.337871 }, "text": "Capacity (cfs)", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p121.5.15", "order": 20, "type": "table_cell", "bbox": { "l": 174.08692, "t": 587.142469, "r": 227.564819, "b": 575.177889 }, "text": "Description", "attrs": { "row": 3, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p121.5.16", "order": 21, "type": "table_cell", "bbox": { "l": 68.76, "t": 509.382452, "r": 89.492517, "b": 497.417872 }, "text": "12.5", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p121.5.17", "order": 22, "type": "table_cell", "bbox": { "l": 114.944052, "t": 509.382452, "r": 132.697945, "b": 497.417872 }, "text": "100", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p121.5.18", "order": 23, "type": "table_cell", "bbox": { "l": 143.354569, "t": 509.382452, "r": 175.880131, "b": 497.417872 }, "text": "0.0100", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p121.5.19", "order": 24, "type": "table_cell", "bbox": { "l": 203.154228, "t": 509.382452, "r": 223.886744, "b": 497.417872 }, "text": "0.13", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p121.5.20", "order": 25, "type": "table_cell", "bbox": { "l": 390.24, "t": 509.8971, "r": 474.72, "b": 490.2514 }, "text": "", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 19 }, { "id": "p121.5.21", "order": 26, "type": "table_cell", "bbox": { "l": 286.679993, "t": 509.26245, "r": 452.820335, "b": 485.417872 }, "text": "Sheet Flow, Grass: Short n= 0.150 P2= 3.42\"", "attrs": { "row": 4, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p121.5.22", "order": 27, "type": "table_cell", "bbox": { "l": 74.639998, "t": 485.382452, "r": 89.475992, "b": 473.417872 }, "text": "2.3", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p121.5.23", "order": 28, "type": "table_cell", "bbox": { "l": 120.82405, "t": 485.382452, "r": 132.68142, "b": 473.417872 }, "text": "96", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 22 }, { "id": "p121.5.24", "order": 29, "type": "table_cell", "bbox": { "l": 143.445254, "t": 485.382452, "r": 175.863606, "b": 473.417872 }, "text": "0.0100", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 23 }, { "id": "p121.5.25", "order": 30, "type": "table_cell", "bbox": { "l": 203.137703, "t": 485.382452, "r": 223.870219, "b": 473.417872 }, "text": "0.70", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 24 }, { "id": "p121.5.26", "order": 31, "type": "table_cell", "bbox": { "l": 390.24, "t": 490.2514, "r": 474.72, "b": 470.6057 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 25 }, { "id": "p121.5.27", "order": 32, "type": "table_cell", "bbox": { "l": 286.679993, "t": 485.26245, "r": 446.147004, "b": 461.417872 }, "text": "Shallow Concentrated Flow, Short Grass Pasture Kv= 7.0 fps", "attrs": { "row": 5, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 26 }, { "id": "p121.5.28", "order": 33, "type": "table_cell", "bbox": { "l": 68.76, "t": 459.462454, "r": 89.492517, "b": 447.497874 }, "text": "14.8", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 27 }, { "id": "p121.5.29", "order": 34, "type": "table_cell", "bbox": { "l": 114.944052, "t": 459.462454, "r": 132.697945, "b": 447.497874 }, "text": "196", "attrs": { "row": 6, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 28 }, { "id": "p121.5.30", "order": 35, "type": "table_cell", "bbox": { "l": 143.354569, "t": 459.462454, "r": 166.947862, "b": 447.497874 }, "text": "Total", "attrs": { "row": 6, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 29 }, { "id": "p121.5.31", "order": 36, "type": "table_cell", "bbox": { "l": 305.76, "t": 470.6057, "r": 390.24, "b": 450.96 }, "text": "", "attrs": { "row": 6, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 30 }, { "id": "p121.5.32", "order": 37, "type": "table_cell", "bbox": { "l": 390.24, "t": 470.6057, "r": 474.72, "b": 450.96 }, "text": "", "attrs": { "row": 6, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 31 }, { "id": "p121.5.33", "order": 38, "type": "table_cell", "bbox": { "l": 474.72, "t": 470.6057, "r": 559.2, "b": 450.96 }, "text": "", "attrs": { "row": 6, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 32 } ], "reading_order": 4 }, { "id": "p121.6", "order": 39, "type": "caption", "bbox": { "l": 193.2, "t": 435.12, "r": 417.84, "b": 420 }, "text": "Subcatchment 180S: DA P4 (Pervious)", "attrs": { "block_label": "figure_title" }, "reading_order": 5 }, { "id": "p121.7", "order": 40, "type": "figure", "bbox": { "l": 61.68, "t": 420.96, "r": 551.04, "b": 148.56 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n0.003 Runoff\n0.00 cfs\n0.002\nNOAA 24-hr D\n0.002\n2-Year Rainfall=3.42\"\n0.002\n0.002 Runoff Area=76,971 sf\n0.002 Runoff Volume=34 cf\n(cfs) 0.001 Runoff Depth=0.01\"\nFlow Flow Length=196'\n0.001\nSlope=0.0100 '/'\n0.001\nTc=14.8 min\n0.001\n0.001\nCN=39/0\n0.000\n0.000\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72\nTime (hours)" }, "reading_order": 6 }, { "id": "p121.8", "order": 41, "type": "text", "bbox": { "l": 270, "t": 155.76, "r": 317.76, "b": 146.88 }, "text": "Time (hours)", "attrs": { "block_label": "number" }, "reading_order": 7 } ] }, { "document_id": 16592, "page": 122, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 34, "counts_by_type": { "caption": 2, "figure": 1, "footer": 1, "header": 1, "table": 1, "table_cell": 24, "text": 3, "title": 1 }, "build_ms": 5, "items": [ { "id": "p122.1", "order": 1, "type": "header", "bbox": { "l": 53.52, "t": 738.24, "r": 560.16, "b": 698.64 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 2-Year Rainfall=3.42\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 9", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p122.2", "order": 2, "type": "title", "bbox": { "l": 148.32, "t": 687.6, "r": 463.92, "b": 672.24 }, "text": "Summary for Subcatchment 181S: DA P6 (Impervious)", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p122.3", "order": 3, "type": "text", "bbox": { "l": 54, "t": 660.24, "r": 463.44, "b": 634.56 }, "text": "Runoff = 0.43 cfs @ 12.10 hrs, Volume= 1,394 cf, Depth= 3.19\"\nRouted to Link 185L : POA", "reading_order": 2 }, { "id": "p122.4", "order": 4, "type": "text", "bbox": { "l": 51.84, "t": 623.76, "r": 611.52, "b": 598.56 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious, Time Span= 0.00-72.00 hrs, dt= NOAA 24-hr D 2-Year Rainfall=3.42\"", "reading_order": 3 }, { "id": "p122.5", "order": 5, "type": "table", "bbox": { "l": 52.8, "t": 588.48, "r": 559.2, "b": 447.497874 }, "text": "", "attrs": { "block_label": "table", "n_rows": 6, "n_cols": 5, "integrity": { "cells_checked": 22, "cells_flagged": 0 } }, "children": [ { "id": "p122.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 86.520001, "t": 587.142469, "r": 127.590159, "b": 575.177889 }, "text": "Area (sf)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p122.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 144.389888, "t": 587.142469, "r": 159.742288, "b": 575.177889 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p122.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 286.601768, "t": 535.302451, "r": 340.102911, "b": 523.337871 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p122.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 101.160004, "t": 559.302451, "r": 127.789043, "b": 547.337871 }, "text": "5,250", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 3 }, { "id": "p122.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 147.987313, "t": 559.302451, "r": 159.844683, "b": 547.337871 }, "text": "98", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p122.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 174.146431, "t": 573.222448, "r": 281.243319, "b": 561.257868 }, "text": "Paved parking, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 5 }, { "id": "p122.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 101.160004, "t": 573.222448, "r": 127.789043, "b": 561.257868 }, "text": "5,250", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p122.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 147.987313, "t": 573.222448, "r": 159.844683, "b": 561.257868 }, "text": "98", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p122.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 174.146431, "t": 559.302451, "r": 296.653009, "b": 547.337871 }, "text": "100.00% Impervious Area", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 8 }, { "id": "p122.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 65.040001, "t": 535.302451, "r": 89.475992, "b": 497.417872 }, "text": "Tc (min)\n0.8", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 9 }, { "id": "p122.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 100.248415, "t": 535.302451, "r": 132.68142, "b": 497.417872 }, "text": "Length (feet)\n100", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 10 }, { "id": "p122.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 143.445254, "t": 535.302451, "r": 175.895438, "b": 497.417872 }, "text": "Slope (ft/ft)\n0.0500", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 11 }, { "id": "p122.5.13", "order": 18, "type": "table_cell", "bbox": { "l": 186.552062, "t": 535.302451, "r": 223.968178, "b": 497.417872 }, "text": "Velocity (ft/sec)\n2.05", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 12 }, { "id": "p122.5.14", "order": 19, "type": "table_cell", "bbox": { "l": 234.581918, "t": 535.302451, "r": 473.002733, "b": 485.417872 }, "text": "Capacity (cfs)\nSheet Flow, Smooth surfaces n= 0.011 P2= 3.42\"", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 13 }, { "id": "p122.5.15", "order": 20, "type": "table_cell", "bbox": { "l": 74.639998, "t": 485.382452, "r": 89.475992, "b": 473.417872 }, "text": "0.6", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p122.5.16", "order": 21, "type": "table_cell", "bbox": { "l": 120.82405, "t": 485.382452, "r": 132.68142, "b": 473.417872 }, "text": "50", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p122.5.17", "order": 22, "type": "table_cell", "bbox": { "l": 143.445254, "t": 485.382452, "r": 175.863606, "b": 473.417872 }, "text": "0.0050", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p122.5.18", "order": 23, "type": "table_cell", "bbox": { "l": 203.137703, "t": 485.382452, "r": 223.870219, "b": 473.417872 }, "text": "1.44", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p122.5.19", "order": 24, "type": "table_cell", "bbox": { "l": 286.679993, "t": 485.26245, "r": 425.623588, "b": 461.417872 }, "text": "Shallow Concentrated Flow, Paved Kv= 20.3 fps", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p122.5.20", "order": 25, "type": "table_cell", "bbox": { "l": 74.639998, "t": 459.462454, "r": 89.475992, "b": 447.497874 }, "text": "1.4", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p122.5.21", "order": 26, "type": "table_cell", "bbox": { "l": 114.927527, "t": 459.462454, "r": 132.68142, "b": 447.497874 }, "text": "150", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p122.5.22", "order": 27, "type": "table_cell", "bbox": { "l": 143.445254, "t": 459.462454, "r": 167.029543, "b": 447.497874 }, "text": "Total", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p122.5.23", "order": 28, "type": "table_cell", "bbox": { "l": 356.64, "t": 471.0171, "r": 457.92, "b": 451.44 }, "text": "", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 22 }, { "id": "p122.5.24", "order": 29, "type": "table_cell", "bbox": { "l": 457.92, "t": 471.0171, "r": 559.2, "b": 451.44 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 23 } ], "reading_order": 4 }, { "id": "p122.6", "order": 30, "type": "caption", "bbox": { "l": 186.72, "t": 435.12, "r": 424.56, "b": 419.76 }, "text": "Subcatchment 181S: DA P6 (Impervious)", "attrs": { "block_label": "figure_title" }, "reading_order": 5 }, { "id": "p122.7", "order": 31, "type": "caption", "bbox": { "l": 254.64, "t": 414.48, "r": 306.24, "b": 403.92 }, "text": "Hydrograph", "attrs": { "block_label": "figure_title" }, "reading_order": 6 }, { "id": "p122.8", "order": 32, "type": "figure", "bbox": { "l": 62.64, "t": 412.8, "r": 522.96, "b": 150.24 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n0.46\n0.44 0.43 cfs\nNOAA 24-hr D\n0.42\n0.4\n2-Year Rainfall=3.42\"\n0.38\n0.36\nRunoff Area=5,250 sf\n0.34\n0.32\nRunoff Volume=1,394 cf\n0.3\n0.28\n(cfs) Runoff Depth=3.19\"\n0.26\n0.24\nFlow 0.2 Flow Length=150'\n0.22\n0.16 Tc=1.4 min\n0.18\n0.12 CN=0/98\n0.14\n0.1\n0.08\n0.06\n0.04\n0.02\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72\nTime (hours)" }, "reading_order": 7 }, { "id": "p122.9", "order": 33, "type": "text", "bbox": { "l": 267.6, "t": 155.76, "r": 315.36, "b": 147.12 }, "text": "Time (hours)", "attrs": { "block_label": "number" }, "reading_order": 8 }, { "id": "p122.10", "order": 34, "type": "footer", "bbox": { "l": 511.68, "t": 392.64, "r": 546.24, "b": 381.36 }, "text": "", "attrs": { "block_label": "footer_image" }, "reading_order": 9 } ] }, { "document_id": 16592, "page": 123, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 49, "counts_by_type": { "footnote": 4, "header": 1, "heading": 1, "table": 3, "table_cell": 40 }, "build_ms": 9, "items": [ { "id": "p123.1", "order": 1, "type": "header", "bbox": { "l": 52.56, "t": 738.72, "r": 562.56, "b": 698.4 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 2-Year Rainfall=3.42\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 10", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p123.2", "order": 2, "type": "heading", "bbox": { "l": 162, "t": 687.84, "r": 449.04, "b": 672.72 }, "text": "Summary for Pond 183P: WQ Infiltration Basin #1", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p123.3", "order": 3, "type": "table", "bbox": { "l": 52.56, "t": 662.16, "r": 530.64, "b": 587.177889 }, "text": "", "attrs": { "block_label": "table", "n_rows": 5, "n_cols": 4, "integrity": { "cells_checked": 20, "cells_flagged": 6, "flags": [ { "row": 0, "col": 2, "coverage": 0, "text": "29.12% Impervious," }, { "row": 0, "col": 3, "coverage": 0.5, "text": "Inflow Depth = 0.93\" for 2-Year event" }, { "row": 1, "col": 3, "coverage": 0, "text": "Volume= 8,433 cf" }, { "row": 2, "col": 3, "coverage": 0, "text": "Volume= 4,631 cf," }, { "row": 3, "col": 3, "coverage": 0, "text": "Volume= 0 cf" }, { "row": 4, "col": 3, "coverage": 0, "text": "Volume= 4,631 cf" } ] } }, "children": [ { "id": "p123.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 54, "t": 659.142458, "r": 107.356451, "b": 647.177878 }, "text": "Inflow Area =", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p123.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 151.868035, "t": 659.142458, "r": 204.64367, "b": 647.177878 }, "text": "108,596 sf,", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p123.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 291.6, "t": 662.16, "r": 411.12, "b": 649.84 }, "text": "29.12% Impervious,", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p123.3.4", "order": 7, "type": "table_cell", "bbox": { "l": 411.12, "t": 662.16, "r": 530.64, "b": 649.84 }, "text": "Inflow Depth = 0.93\" for 2-Year event", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "column_header": true, "header_source": "heuristic" }, "reading_order": 3 }, { "id": "p123.3.5", "order": 8, "type": "table_cell", "bbox": { "l": 54, "t": 647.142458, "r": 82.003121, "b": 635.177878 }, "text": "Inflow =", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p123.3.6", "order": 9, "type": "table_cell", "bbox": { "l": 146.30738, "t": 647.142458, "r": 183.784219, "b": 635.177878 }, "text": "2.34 cfs @", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p123.3.7", "order": 10, "type": "table_cell", "bbox": { "l": 206.48939, "t": 647.142458, "r": 253.797341, "b": 635.177878 }, "text": "12.11 hrs,", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p123.3.8", "order": 11, "type": "table_cell", "bbox": { "l": 411.12, "t": 649.84, "r": 530.64, "b": 637.52 }, "text": "Volume= 8,433 cf", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 7 }, { "id": "p123.3.9", "order": 12, "type": "table_cell", "bbox": { "l": 54, "t": 635.142458, "r": 90.34222, "b": 623.177878 }, "text": "Outflow =", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p123.3.10", "order": 13, "type": "table_cell", "bbox": { "l": 146.284137, "t": 635.142458, "r": 183.760976, "b": 623.177878 }, "text": "0.26 cfs @", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p123.3.11", "order": 14, "type": "table_cell", "bbox": { "l": 206.466148, "t": 635.142458, "r": 253.806345, "b": 623.177878 }, "text": "12.92 hrs,", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p123.3.12", "order": 15, "type": "table_cell", "bbox": { "l": 411.12, "t": 637.52, "r": 530.64, "b": 625.2 }, "text": "Volume= 4,631 cf,", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 11 }, { "id": "p123.3.13", "order": 16, "type": "table_cell", "bbox": { "l": 54, "t": 623.142458, "r": 102.065704, "b": 611.177878 }, "text": "Discarded =", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 12 }, { "id": "p123.3.14", "order": 17, "type": "table_cell", "bbox": { "l": 146.278902, "t": 623.142458, "r": 183.755742, "b": 611.177878 }, "text": "0.00 cfs @", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p123.3.15", "order": 18, "type": "table_cell", "bbox": { "l": 212.357435, "t": 623.142458, "r": 253.768864, "b": 611.177878 }, "text": "0.00 hrs,", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p123.3.16", "order": 19, "type": "table_cell", "bbox": { "l": 411.12, "t": 625.2, "r": 530.64, "b": 612.88 }, "text": "Volume= 0 cf", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 15 }, { "id": "p123.3.17", "order": 20, "type": "table_cell", "bbox": { "l": 54, "t": 611.142458, "r": 195.539615, "b": 587.177889 }, "text": "Primary =\nRouted to Link 185L : POA", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 16 }, { "id": "p123.3.18", "order": 21, "type": "table_cell", "bbox": { "l": 146.255659, "t": 611.142458, "r": 183.732499, "b": 599.177878 }, "text": "0.26 cfs @", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p123.3.19", "order": 22, "type": "table_cell", "bbox": { "l": 206.43767, "t": 611.142458, "r": 253.777868, "b": 599.177878 }, "text": "12.92 hrs,", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p123.3.20", "order": 23, "type": "table_cell", "bbox": { "l": 411.12, "t": 612.88, "r": 530.64, "b": 600.56 }, "text": "Volume= 4,631 cf", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 19 } ], "reading_order": 2 }, { "id": "p123.4", "order": 24, "type": "table", "bbox": { "l": 52.56, "t": 492.96, "r": 557.04, "b": 376.32 }, "text": "", "attrs": { "block_label": "table", "n_rows": 2, "n_cols": 5, "integrity": { "cells_checked": 8, "cells_flagged": 0 } }, "children": [ { "id": "p123.4.1", "order": 25, "type": "table_cell", "bbox": { "l": 54, "t": 491.142469, "r": 90.142207, "b": 465.257868 }, "text": "Volume\n#1", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p123.4.2", "order": 26, "type": "table_cell", "bbox": { "l": 120.355217, "t": 491.142469, "r": 148.95691, "b": 465.257868 }, "text": "Invert\n95.00'", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p123.4.3", "order": 27, "type": "table_cell", "bbox": { "l": 170.997811, "t": 491.142469, "r": 234.422951, "b": 465.257868 }, "text": "Avail.Storage\n16,706 cf", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p123.4.4", "order": 28, "type": "table_cell", "bbox": { "l": 246.044461, "t": 491.142469, "r": 502.944852, "b": 465.137889 }, "text": "Storage Description\nCustom Stage Data (Prismatic) Listed below (Recalc)", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p123.4.5", "order": 29, "type": "table_cell", "bbox": { "l": 57.360002, "t": 453.222448, "r": 101.273013, "b": 379.337871 }, "text": "Elevation\\n(feet)\n95.00\n96.00\n97.00\n98.00", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p123.4.6", "order": 30, "type": "table_cell", "bbox": { "l": 140.447365, "t": 453.222448, "r": 185.72688, "b": 379.337871 }, "text": "Surf.Area\\n(sq-ft)\n4,231\n5,092\n6,008\n6,981", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p123.4.7", "order": 31, "type": "table_cell", "bbox": { "l": 227.371027, "t": 453.222448, "r": 354.642567, "b": 379.337871 }, "text": "Inc.Store\\n(cubic-feet)\n0\n4,662\n5,550\n6,495", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p123.4.8", "order": 32, "type": "table_cell", "bbox": { "l": 216.402998, "t": 453.222448, "r": 354.689052, "b": 379.337871 }, "text": "Cum.Store\\n(cubic-feet)\n0\n4,662\n10,212\n16,706", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 7 } ], "reading_order": 3 }, { "id": "p123.5", "order": 33, "type": "table", "bbox": { "l": 52.08, "t": 367.68, "r": 556.08, "b": 278.64 }, "text": "", "attrs": { "block_label": "table", "n_rows": 3, "n_cols": 4, "integrity": { "cells_checked": 12, "cells_flagged": 0 } }, "children": [ { "id": "p123.5.1", "order": 34, "type": "table_cell", "bbox": { "l": 54, "t": 367.302451, "r": 86.679256, "b": 355.337871 }, "text": "Device", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p123.5.2", "order": 35, "type": "table_cell", "bbox": { "l": 98.407976, "t": 367.302451, "r": 135.030741, "b": 355.337871 }, "text": "Routing", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p123.5.3", "order": 36, "type": "table_cell", "bbox": { "l": 182.045624, "t": 367.302451, "r": 208.824841, "b": 355.337871 }, "text": "Invert", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p123.5.4", "order": 37, "type": "table_cell", "bbox": { "l": 220.650048, "t": 367.302451, "r": 290.014595, "b": 355.337871 }, "text": "Outlet Devices", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 3 }, { "id": "p123.5.5", "order": 38, "type": "table_cell", "bbox": { "l": 70.320002, "t": 353.382452, "r": 82.177372, "b": 341.417872 }, "text": "#1", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p123.5.6", "order": 39, "type": "table_cell", "bbox": { "l": 98.408891, "t": 353.382452, "r": 135.204992, "b": 341.417872 }, "text": "Primary", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p123.5.7", "order": 40, "type": "table_cell", "bbox": { "l": 354.69794, "t": 329.382452, "r": 383.299634, "b": 317.417872 }, "text": "97.60'", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p123.5.8", "order": 41, "type": "table_cell", "bbox": { "l": 220.679993, "t": 353.262472, "r": 512.979659, "b": 305.417872 }, "text": "15.0\" Round Culvert to Subsurface Basin\\nL= 35.0' RCP, square edge headwall, Ke= 0.500\\nInlet / Outlet Invert= 95.00' / 97.60' S= -0.0743'' Cc= 0.900\\nn= 0.012 Corrugated PP, smooth interior, Flow Area= 1.23 sf", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p123.5.9", "order": 42, "type": "table_cell", "bbox": { "l": 70.320002, "t": 305.382452, "r": 82.177372, "b": 281.417872 }, "text": "#2\n#3", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 8 }, { "id": "p123.5.10", "order": 43, "type": "table_cell", "bbox": { "l": 98.408891, "t": 305.382452, "r": 146.474595, "b": 281.417872 }, "text": "Device 1\nDiscarded", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 9 }, { "id": "p123.5.11", "order": 44, "type": "table_cell", "bbox": { "l": 180.288471, "t": 305.382452, "r": 208.918642, "b": 281.417872 }, "text": "97.00'\n95.00'", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 10 }, { "id": "p123.5.12", "order": 45, "type": "table_cell", "bbox": { "l": 220.679993, "t": 305.382452, "r": 531.965762, "b": 281.297892 }, "text": "4.0' long Sharp-Crested Rectangular Weir 2 End Contraction(s)\n3.100 in/hr Exfiltration X 0.00 over Surface area", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 11 } ], "reading_order": 4 }, { "id": "p123.6", "order": 46, "type": "footnote", "bbox": { "l": 52.08, "t": 575.04, "r": 513.36, "b": 537.84 }, "text": "Routing by Stor-Ind method, Time Span= 0.00-72.00 hrs, dt= 0.01 hrs\nStarting Elev= 97.00' Surf.Area= 6,008 sf Storage= 10,212 cf\nPeak Elev= 97.83' @ 12.92 hrs Surf.Area= 6,819 sf Storage= 15,558 cf (5,346 cf above start)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 5 }, { "id": "p123.7", "order": 47, "type": "footnote", "bbox": { "l": 51.84, "t": 528.48, "r": 402.24, "b": 502.32 }, "text": "Plug-Flow detention time = (not calculated: initial storage exceeds outflow)\nCenter-of-Mass det. time = 311.5 min (1,069.7 - 758.2)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 6 }, { "id": "p123.8", "order": 48, "type": "footnote", "bbox": { "l": 51.6, "t": 270, "r": 423.6, "b": 244.32 }, "text": "Discarded OutFlow Max=0.00 cfs @ 0.00 hrs HW=97.00' (Free Discharge)\n3=Exfiltration (Controls 0.00 cfs)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 7 }, { "id": "p123.9", "order": 49, "type": "footnote", "bbox": { "l": 52.56, "t": 230.88, "r": 462.96, "b": 196.08 }, "text": "Primary OutFlow Max=0.26 cfs @ 12.92 hrs HW=97.83' (Free Discharge)\n1=Culvert to Subsurface Basin (Inlet Controls 0.26 cfs @ 1.65 fps)\n2=Sharp-Crested Rectangular Weir (Passes 0.26 cfs of 6.63 cfs potential flow)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 8 } ] }, { "document_id": 16592, "page": 124, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 7, "counts_by_type": { "caption": 1, "figure": 1, "footnote": 2, "header": 2, "text": 1 }, "build_ms": 0, "items": [ { "id": "p124.1", "order": 1, "type": "header", "bbox": { "l": 367.44, "t": 738.72, "r": 560.64, "b": 712.32 }, "text": "NOAA 24-hr D 2-Year Rainfall=3.42\"\nPrinted 04/12/2025", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p124.2", "order": 2, "type": "header", "bbox": { "l": 50.4, "t": 737.76, "r": 400.32, "b": 699.36 }, "text": "102 Sams -REV 12-02-25\nPrepared by Haler Consulting\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p124.3", "order": 3, "type": "text", "bbox": { "l": 517.2, "t": 710.88, "r": 558.96, "b": 699.12 }, "text": "Page 11", "attrs": { "block_label": "number" }, "reading_order": 2 }, { "id": "p124.4", "order": 4, "type": "caption", "bbox": { "l": 201.12, "t": 687.6, "r": 409.44, "b": 672.96 }, "text": "Pond 183P: WQ Infiltration Basin #1", "attrs": { "block_label": "figure_title" }, "reading_order": 3 }, { "id": "p124.5", "order": 5, "type": "figure", "bbox": { "l": 66, "t": 667.2, "r": 488.64, "b": 413.04 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n2.34 cfs\nInflow Area=108,596 sf\nPeak Elev=97.83'\nStorage=15,558 cf\n2\n(cfs)\nFlow\n1\n0.26 cfs\n0.26 cfs\n0.00 cfs\n0" }, "reading_order": 4 }, { "id": "p124.6", "order": 6, "type": "footnote", "bbox": { "l": 84.24, "t": 420.24, "r": 449.28, "b": 400.8 }, "text": "0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72 Time (hours)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 5 }, { "id": "p124.7", "order": 7, "type": "footnote", "bbox": { "l": 497.04, "t": 644.88, "r": 547.44, "b": 610.08 }, "text": "Inflow Outflow Discarded Primary", "attrs": { "block_label": "vision_footnote" }, "reading_order": 6 } ] }, { "document_id": 16592, "page": 125, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 11, "counts_by_type": { "caption": 1, "header": 1, "table": 1, "table_cell": 8 }, "build_ms": 24, "items": [ { "id": "p125.1", "order": 1, "type": "header", "bbox": { "l": 53.04, "t": 738.48, "r": 561.6, "b": 698.64 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 2-Year Rainfall=3.42\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 12", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p125.2", "order": 2, "type": "caption", "bbox": { "l": 153.6, "t": 687.84, "r": 457.44, "b": 672.96 }, "text": "Stage-Discharge for Pond 183P: WQ Infiltration Basin #1", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p125.3", "order": 3, "type": "table", "bbox": { "l": 55.2, "t": 662.4, "r": 507.36, "b": 58.56 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 8, "integrity": { "cells_checked": 8, "cells_flagged": 0 } }, "children": [ { "id": "p125.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 57.479999, "t": 661.126246, "r": 98.137287, "b": 64.158859 }, "text": "Elevation (feet)\n95.00\n95.05\n95.10\n95.15\n95.20\n95.25\n95.30\n95.35\n95.40\n95.45\n95.50\n95.55\n95.60\n95.65\n95.70\n95.75\n95.80\n95.85\n95.90\n95.95\n96.00\n96.05\n96.10\n96.15\n96.20\n96.25\n96.30\n96.35\n96.40\n96.45\n96.50\n96.55\n96.60\n96.65\n96.70\n96.75\n96.80\n96.85\n96.90\n96.95\n97.00\n97.05\n97.10\n97.15\n97.20\n97.25\n97.30\n97.35\n97.40\n97.45\n97.50\n97.55", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p125.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 109.680004, "t": 661.126246, "r": 154.533694, "b": 64.158859 }, "text": "Discharge (cfs)\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p125.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 166.080002, "t": 661.126246, "r": 211.180733, "b": 64.158859 }, "text": "Discarded (cfs)\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p125.3.4", "order": 7, "type": "table_cell", "bbox": { "l": 233.160004, "t": 661.126246, "r": 267.536512, "b": 64.158859 }, "text": "Primary (cfs)\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p125.3.5", "order": 8, "type": "table_cell", "bbox": { "l": 291, "t": 661.126246, "r": 331.657282, "b": 351.198838 }, "text": "Elevation (feet)\n97.60\n97.65\n97.70\n97.75\n97.80\n97.85\n97.90\n97.95\n98.00\n98.05\n98.10\n98.15\n98.20\n98.25\n98.30\n98.35\n98.40\n98.45\n98.50\n98.55\n98.60\n98.65\n98.70\n98.75\n98.80\n98.85", "attrs": { "row": 0, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p125.3.6", "order": 9, "type": "table_cell", "bbox": { "l": 343.200005, "t": 661.126246, "r": 388.300713, "b": 351.198838 }, "text": "Discharge (cfs)\n0.00\n0.01\n0.05\n0.11\n0.19\n0.30\n0.42\n0.57\n0.73\n0.91\n1.10\n1.31\n1.54\n1.77\n2.01\n2.27\n2.53\n2.79\n3.06\n3.32\n3.58\n3.84\n4.08\n4.31\n4.52\n4.67", "attrs": { "row": 0, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p125.3.7", "order": 10, "type": "table_cell", "bbox": { "l": 399.599991, "t": 661.126246, "r": 444.395578, "b": 351.198838 }, "text": "Discarded (cfs)\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00", "attrs": { "row": 0, "col": 6, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p125.3.8", "order": 11, "type": "table_cell", "bbox": { "l": 466.679993, "t": 661.126246, "r": 501.100731, "b": 351.198838 }, "text": "Primary (cfs)\n0.00\n0.01\n0.05\n0.11\n0.19\n0.30\n0.42\n0.57\n0.73\n0.91\n1.10\n1.31\n1.54\n1.77\n2.01\n2.27\n2.53\n2.79\n3.06\n3.32\n3.58\n3.84\n4.08\n4.31\n4.52\n4.67", "attrs": { "row": 0, "col": 7, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 7 } ], "reading_order": 2 } ] }, { "document_id": 16592, "page": 126, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 11, "counts_by_type": { "caption": 1, "header": 2, "table": 1, "table_cell": 6, "text": 1 }, "build_ms": 11, "items": [ { "id": "p126.1", "order": 1, "type": "header", "bbox": { "l": 367.44, "t": 739.2, "r": 561.6, "b": 713.04 }, "text": "NOAA 24-hr D 2-Year Rainfall=3.42\"\nPrinted 04/12/2025", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p126.2", "order": 2, "type": "header", "bbox": { "l": 51.6, "t": 738, "r": 396.24, "b": 698.88 }, "text": "102 Sams -REV 12-02-25\nPrepared by Haler Consulting\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p126.3", "order": 3, "type": "text", "bbox": { "l": 516.72, "t": 710.88, "r": 559.2, "b": 698.88 }, "text": "Page 13", "attrs": { "block_label": "number" }, "reading_order": 2 }, { "id": "p126.4", "order": 4, "type": "caption", "bbox": { "l": 144.96, "t": 687.84, "r": 465.36, "b": 672.72 }, "text": "Stage-Area-Storage for Pond 183P: WQ Infiltration Basin #1", "attrs": { "block_label": "figure_title" }, "reading_order": 3 }, { "id": "p126.5", "order": 5, "type": "table", "bbox": { "l": 55.44, "t": 661.44, "r": 466.32, "b": 54.24 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 6, "integrity": { "cells_checked": 6, "cells_flagged": 0 } }, "children": [ { "id": "p126.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 57.479999, "t": 661.126246, "r": 98.137287, "b": 64.158859 }, "text": "Elevation (feet)\n95.00\n95.05\n95.10\n95.15\n95.20\n95.25\n95.30\n95.35\n95.40\n95.45\n95.50\n95.55\n95.60\n95.65\n95.70\n95.75\n95.80\n95.85\n95.90\n95.95\n96.00\n96.05\n96.10\n96.15\n96.20\n96.25\n96.30\n96.35\n96.40\n96.45\n96.50\n96.55\n96.60\n96.65\n96.70\n96.75\n96.80\n96.85\n96.90\n96.95\n97.00\n97.05\n97.10\n97.15\n97.20\n97.25\n97.30\n97.35\n97.40\n97.45\n97.50\n97.55", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p126.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 139.439999, "t": 661.126246, "r": 173.816353, "b": 64.158859 }, "text": "Surface (sq-ft)\n4,231\n4,274\n4,317\n4,360\n4,403\n4,446\n4,489\n4,532\n4,575\n4,618\n4,662\n4,705\n4,748\n4,791\n4,834\n4,877\n4,920\n4,963\n5,006\n5,049\n5,092\n5,138\n5,184\n5,229\n5,275\n5,321\n5,367\n5,413\n5,458\n5,504\n5,550\n5,596\n5,642\n5,687\n5,733\n5,779\n5,825\n5,871\n5,916\n5,962\n6,008\n6,057\n6,105\n6,154\n6,203\n6,251\n6,300\n6,349\n6,397\n6,446\n6,495\n6,543", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p126.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 199.55999, "t": 661.126246, "r": 249.524304, "b": 64.158859 }, "text": "Storage (cubic-feet)\n0\n213\n427\n644\n863\n1,085\n1,308\n1,534\n1,761\n1,991\n2,223\n2,457\n2,694\n2,932\n3,173\n3,415\n3,660\n3,907\n4,157\n4,408\n4,662\n4,917\n5,175\n5,436\n5,698\n5,963\n6,230\n6,500\n6,772\n7,046\n7,322\n7,601\n7,882\n8,165\n8,450\n8,738\n9,028\n9,321\n9,615\n9,912\n10,212\n10,513\n10,817\n11,124\n11,433\n11,744\n12,058\n12,374\n12,693\n13,014\n13,337\n13,663", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p126.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 273.240005, "t": 661.126246, "r": 313.897287, "b": 351.198838 }, "text": "Elevation (feet)\n97.60\n97.65\n97.70\n97.75\n97.80\n97.85\n97.90\n97.95\n98.00\n98.05\n98.10\n98.15\n98.20\n98.25\n98.30\n98.35\n98.40\n98.45\n98.50\n98.55\n98.60\n98.65\n98.70\n98.75\n98.80\n98.85", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p126.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 355.200005, "t": 661.126246, "r": 389.808242, "b": 351.198838 }, "text": "Surface (sq-ft)\n6,592\n6,640\n6,689\n6,738\n6,786\n6,835\n6,884\n6,932\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981", "attrs": { "row": 0, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p126.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 415.320008, "t": 661.126246, "r": 465.558002, "b": 351.198838 }, "text": "Storage (cubic-feet)\n13,991\n14,322\n14,655\n14,991\n15,329\n15,670\n16,013\n16,358\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706", "attrs": { "row": 0, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 } ], "reading_order": 4 } ] }, { "document_id": 16592, "page": 127, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 37, "counts_by_type": { "footnote": 4, "header": 1, "heading": 1, "table": 3, "table_cell": 28 }, "build_ms": 8, "items": [ { "id": "p127.1", "order": 1, "type": "header", "bbox": { "l": 53.76, "t": 738.72, "r": 560.88, "b": 698.4 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 2-Year Rainfall=3.42\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 14", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p127.2", "order": 2, "type": "heading", "bbox": { "l": 162.24, "t": 687.6, "r": 450, "b": 672.72 }, "text": "Summary for Pond 184P: WQ Infiltration Basin #2", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p127.3", "order": 3, "type": "table", "bbox": { "l": 52.8, "t": 662.16, "r": 535.44, "b": 587.177889 }, "text": "", "attrs": { "block_label": "table", "n_rows": 2, "n_cols": 4, "integrity": { "cells_checked": 8, "cells_flagged": 2, "flags": [ { "row": 0, "col": 2, "coverage": 0, "text": "27.15% Impervious," }, { "row": 0, "col": 3, "coverage": 0.5, "text": "Inflow Depth = 0.87\" for 2-Year event" } ] } }, "children": [ { "id": "p127.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 54, "t": 659.142458, "r": 107.356451, "b": 647.177878 }, "text": "Inflow Area =", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 0 }, { "id": "p127.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 157.764557, "t": 659.142458, "r": 204.64367, "b": 647.177878 }, "text": "86,443 sf,", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 1 }, { "id": "p127.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 294.12, "t": 662.16, "r": 414.78, "b": 649.84 }, "text": "27.15% Impervious,", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 2 }, { "id": "p127.3.4", "order": 7, "type": "table_cell", "bbox": { "l": 414.78, "t": 662.16, "r": 535.44, "b": 649.84 }, "text": "Inflow Depth = 0.87\" for 2-Year event", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 3 }, { "id": "p127.3.5", "order": 8, "type": "table_cell", "bbox": { "l": 54, "t": 647.142458, "r": 195.539615, "b": 587.177889 }, "text": "Inflow =\nOutflow =\nDiscarded =\nPrimary =\nRouted to Link 185L : POA", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p127.3.6", "order": 9, "type": "table_cell", "bbox": { "l": 146.255659, "t": 647.142458, "r": 183.784219, "b": 599.177878 }, "text": "1.53 cfs @\n0.10 cfs @\n0.00 cfs @\n0.10 cfs @", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p127.3.7", "order": 10, "type": "table_cell", "bbox": { "l": 206.43767, "t": 647.142458, "r": 253.806345, "b": 599.177878 }, "text": "12.13 hrs,\n13.87 hrs,\n0.00 hrs,\n13.87 hrs,", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p127.3.8", "order": 11, "type": "table_cell", "bbox": { "l": 349.176231, "t": 647.142458, "r": 534.144698, "b": 599.177878 }, "text": "6,261 cf\n2,699 cf, Atten= 94%, Lag= 104.6 min\n0 cf\n2,699 cf", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 7 } ], "reading_order": 2 }, { "id": "p127.4", "order": 12, "type": "table", "bbox": { "l": 52.32, "t": 492.48, "r": 557.04, "b": 365.28 }, "text": "", "attrs": { "block_label": "table", "n_rows": 2, "n_cols": 5, "integrity": { "cells_checked": 8, "cells_flagged": 0 } }, "children": [ { "id": "p127.4.1", "order": 13, "type": "table_cell", "bbox": { "l": 54, "t": 491.142469, "r": 90.142207, "b": 465.257868 }, "text": "Volume\n#1", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p127.4.2", "order": 14, "type": "table_cell", "bbox": { "l": 120.355217, "t": 491.142469, "r": 148.95691, "b": 465.257868 }, "text": "Invert\n91.00'", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p127.4.3", "order": 15, "type": "table_cell", "bbox": { "l": 170.997811, "t": 491.142469, "r": 234.422951, "b": 465.257868 }, "text": "Avail.Storage\n13,818 cf", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p127.4.4", "order": 16, "type": "table_cell", "bbox": { "l": 246.044461, "t": 491.142469, "r": 502.944852, "b": 465.137889 }, "text": "Storage Description\nCustom Stage Data (Prismatic) Listed below (Recalc)", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p127.4.5", "order": 17, "type": "table_cell", "bbox": { "l": 57.360002, "t": 453.222448, "r": 101.273013, "b": 367.337871 }, "text": "Elevation\\n(feet)\n91.00\n92.00\n93.00\n94.00\n94.50", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p127.4.6", "order": 18, "type": "table_cell", "bbox": { "l": 140.447365, "t": 453.222448, "r": 185.72688, "b": 367.337871 }, "text": "Surf.Area\\n(sq-ft)\n2,628\n3,320\n4,067\n5,010\n5,438", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p127.4.7", "order": 19, "type": "table_cell", "bbox": { "l": 227.371027, "t": 453.222448, "r": 354.642567, "b": 367.337871 }, "text": "Inc.Store\\n(cubic-feet)\n0\n2,974\n3,694\n4,539\n2,612", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p127.4.8", "order": 20, "type": "table_cell", "bbox": { "l": 216.402998, "t": 453.222448, "r": 354.689052, "b": 367.337871 }, "text": "Cum.Store\\n(cubic-feet)\n0\n2,974\n6,668\n11,206\n13,818", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 7 } ], "reading_order": 3 }, { "id": "p127.5", "order": 21, "type": "table", "bbox": { "l": 51.36, "t": 355.302451, "r": 555.12, "b": 266.88 }, "text": "", "attrs": { "block_label": "table", "n_rows": 3, "n_cols": 4, "integrity": { "cells_checked": 12, "cells_flagged": 0 } }, "children": [ { "id": "p127.5.1", "order": 22, "type": "table_cell", "bbox": { "l": 54, "t": 355.302451, "r": 86.679256, "b": 343.337871 }, "text": "Device", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p127.5.2", "order": 23, "type": "table_cell", "bbox": { "l": 98.407976, "t": 355.302451, "r": 135.030741, "b": 343.337871 }, "text": "Routing", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p127.5.3", "order": 24, "type": "table_cell", "bbox": { "l": 182.045624, "t": 355.302451, "r": 208.824841, "b": 343.337871 }, "text": "Invert", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p127.5.4", "order": 25, "type": "table_cell", "bbox": { "l": 220.650048, "t": 355.302451, "r": 290.014595, "b": 343.337871 }, "text": "Outlet Devices", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 3 }, { "id": "p127.5.5", "order": 26, "type": "table_cell", "bbox": { "l": 70.320002, "t": 341.382452, "r": 82.177372, "b": 329.417872 }, "text": "#1", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p127.5.6", "order": 27, "type": "table_cell", "bbox": { "l": 98.408891, "t": 341.382452, "r": 135.204992, "b": 329.417872 }, "text": "Primary", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p127.5.7", "order": 28, "type": "table_cell", "bbox": { "l": 354.69794, "t": 317.382452, "r": 383.299634, "b": 305.417872 }, "text": "93.80'", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p127.5.8", "order": 29, "type": "table_cell", "bbox": { "l": 220.679993, "t": 341.262472, "r": 512.979659, "b": 293.417872 }, "text": "6.0\" Round Culvert to Subsurface Basin\\nL= 35.0' RCP, square edge headwall, Ke= 0.500\\nInlet / Outlet Invert= 92.00' / 93.80' S= -0.0514'' Cc= 0.900\\nn= 0.012 Corrugated PP, smooth interior, Flow Area= 0.20 sf", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p127.5.9", "order": 30, "type": "table_cell", "bbox": { "l": 70.320002, "t": 293.382452, "r": 82.177372, "b": 269.417872 }, "text": "#2\n#3", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 8 }, { "id": "p127.5.10", "order": 31, "type": "table_cell", "bbox": { "l": 98.408891, "t": 293.382452, "r": 146.474595, "b": 269.417872 }, "text": "Device 1\nDiscarded", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 9 }, { "id": "p127.5.11", "order": 32, "type": "table_cell", "bbox": { "l": 180.288471, "t": 293.382452, "r": 208.918642, "b": 269.417872 }, "text": "93.00'\n91.00'", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 10 }, { "id": "p127.5.12", "order": 33, "type": "table_cell", "bbox": { "l": 220.679993, "t": 293.382452, "r": 531.965762, "b": 269.29789200000005 }, "text": "4.0' long Sharp-Crested Rectangular Weir 2 End Contraction(s)\n1.050 in/hr Exfiltration X 0.00 over Surface area", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 11 } ], "reading_order": 4 }, { "id": "p127.6", "order": 34, "type": "footnote", "bbox": { "l": 52.32, "t": 576, "r": 513.6, "b": 537.84 }, "text": "Routing by Stor-Ind method, Time Span= 0.00-72.00 hrs, dt= 0.01 hrs\nStarting Elev= 93.00' Surf.Area= 4,067 sf Storage= 6,668 cf\nPeak Elev= 93.98' @ 13.87 hrs Surf.Area= 4,994 sf Storage= 11,122 cf (4,455 cf above start)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 5 }, { "id": "p127.7", "order": 35, "type": "footnote", "bbox": { "l": 51.84, "t": 528.48, "r": 402.72, "b": 501.84 }, "text": "Plug-Flow detention time = (not calculated: initial storage exceeds outflow)\nCenter-of-Mass det. time = 416.3 min (1,177.6 - 761.4)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 6 }, { "id": "p127.8", "order": 36, "type": "footnote", "bbox": { "l": 51.84, "t": 258.72, "r": 424.08, "b": 232.32 }, "text": "Discarded OutFlow Max=0.00 cfs @ 0.00 hrs HW=93.00' (Free Discharge)\n3=Exfiltration (Controls 0.00 cfs)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 7 }, { "id": "p127.9", "order": 37, "type": "footnote", "bbox": { "l": 50.64, "t": 222.48, "r": 462.24, "b": 183.12 }, "text": "Primary OutFlow Max=0.10 cfs @ 13.87 hrs HW=93.98' (Free Discharge)\n1=Culvert to Subsurface Basin (Inlet Controls 0.10 cfs @ 1.46 fps)\n2=Sharp-Crested Rectangular Weir (Passes 0.10 cfs of 7.28 cfs potential flow)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 8 } ] }, { "document_id": 16592, "page": 128, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 7, "counts_by_type": { "caption": 1, "figure": 1, "footnote": 2, "header": 2, "text": 1 }, "build_ms": 0, "items": [ { "id": "p128.1", "order": 1, "type": "header", "bbox": { "l": 367.44, "t": 738.72, "r": 560.64, "b": 711.6 }, "text": "NOAA 24-hr D 2-Year Rainfall=3.42\"\nPrinted 04/12/2025", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p128.2", "order": 2, "type": "header", "bbox": { "l": 51.12, "t": 737.76, "r": 402.72, "b": 699.36 }, "text": "102 Sams -REV 12-02-25\nPrepared by Haler Consulting\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p128.3", "order": 3, "type": "text", "bbox": { "l": 517.2, "t": 711.12, "r": 559.44, "b": 699.12 }, "text": "Page 15", "attrs": { "block_label": "number" }, "reading_order": 2 }, { "id": "p128.4", "order": 4, "type": "caption", "bbox": { "l": 200.64, "t": 687.6, "r": 410.64, "b": 672.96 }, "text": "Pond 184P: WQ Infiltration Basin #2", "attrs": { "block_label": "figure_title" }, "reading_order": 3 }, { "id": "p128.5", "order": 5, "type": "figure", "bbox": { "l": 64.8, "t": 669.6, "r": 487.92, "b": 412.32 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n1.53 cfs\nInflow Area=86,443 sf\nPeak Elev=93.98'\nStorage=11,122 cf\n1\n(cfs)\nFlow\n0.10 cfs\n0.00 cfs 0.10 cfs\n0" }, "reading_order": 4 }, { "id": "p128.6", "order": 6, "type": "footnote", "bbox": { "l": 84.24, "t": 420, "r": 449.28, "b": 400.8 }, "text": "0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72 Time (hours)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 5 }, { "id": "p128.7", "order": 7, "type": "footnote", "bbox": { "l": 497.04, "t": 645.12, "r": 547.44, "b": 610.08 }, "text": "Inflow Outflow Discarded Primary", "attrs": { "block_label": "vision_footnote" }, "reading_order": 6 } ] }, { "document_id": 16592, "page": 129, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 11, "counts_by_type": { "caption": 1, "header": 1, "table": 1, "table_cell": 8 }, "build_ms": 22, "items": [ { "id": "p129.1", "order": 1, "type": "header", "bbox": { "l": 53.04, "t": 738.48, "r": 561.36, "b": 698.64 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 2-Year Rainfall=3.42\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 16", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p129.2", "order": 2, "type": "caption", "bbox": { "l": 153.6, "t": 687.84, "r": 457.92, "b": 672.96 }, "text": "Stage-Discharge for Pond 184P: WQ Infiltration Basin #2", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p129.3", "order": 3, "type": "table", "bbox": { "l": 54.96, "t": 664.32, "r": 506.4, "b": 58.8 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 8, "integrity": { "cells_checked": 8, "cells_flagged": 0 } }, "children": [ { "id": "p129.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 57.479999, "t": 661.126246, "r": 98.137287, "b": 64.158859 }, "text": "Elevation (feet)\n91.00\n91.05\n91.10\n91.15\n91.20\n91.25\n91.30\n91.35\n91.40\n91.45\n91.50\n91.55\n91.60\n91.65\n91.70\n91.75\n91.80\n91.85\n91.90\n91.95\n92.00\n92.05\n92.10\n92.15\n92.20\n92.25\n92.30\n92.35\n92.40\n92.45\n92.50\n92.55\n92.60\n92.65\n92.70\n92.75\n92.80\n92.85\n92.90\n92.95\n93.00\n93.05\n93.10\n93.15\n93.20\n93.25\n93.30\n93.35\n93.40\n93.45\n93.50\n93.55", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p129.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 109.680004, "t": 661.126246, "r": 154.533694, "b": 64.158859 }, "text": "Discharge (cfs)\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p129.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 166.080002, "t": 661.126246, "r": 211.180733, "b": 64.158859 }, "text": "Discarded (cfs)\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p129.3.4", "order": 7, "type": "table_cell", "bbox": { "l": 233.160004, "t": 661.126246, "r": 267.536512, "b": 64.158859 }, "text": "Primary (cfs)\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p129.3.5", "order": 8, "type": "table_cell", "bbox": { "l": 291, "t": 661.126246, "r": 331.657282, "b": 428.478844 }, "text": "Elevation (feet)\n93.60\n93.65\n93.70\n93.75\n93.80\n93.85\n93.90\n93.95\n94.00\n94.05\n94.10\n94.15\n94.20\n94.25\n94.30\n94.35\n94.40\n94.45\n94.50", "attrs": { "row": 0, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p129.3.6", "order": 9, "type": "table_cell", "bbox": { "l": 343.200005, "t": 661.126246, "r": 388.300713, "b": 428.478844 }, "text": "Discharge (cfs)\n0.00\n0.00\n0.00\n0.00\n0.00\n0.01\n0.03\n0.07\n0.11\n0.17\n0.23\n0.30\n0.36\n0.43\n0.47\n0.52\n0.56\n0.60\n0.63", "attrs": { "row": 0, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p129.3.7", "order": 10, "type": "table_cell", "bbox": { "l": 399.599991, "t": 661.126246, "r": 444.395578, "b": 428.478844 }, "text": "Discarded (cfs)\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00", "attrs": { "row": 0, "col": 6, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p129.3.8", "order": 11, "type": "table_cell", "bbox": { "l": 466.679993, "t": 661.126246, "r": 501.100731, "b": 428.478844 }, "text": "Primary (cfs)\n0.00\n0.00\n0.00\n0.00\n0.00\n0.01\n0.03\n0.07\n0.11\n0.17\n0.23\n0.30\n0.36\n0.43\n0.47\n0.52\n0.56\n0.60\n0.63", "attrs": { "row": 0, "col": 7, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 7 } ], "reading_order": 2 } ] }, { "document_id": 16592, "page": 130, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 47, "counts_by_type": { "caption": 1, "header": 2, "table": 1, "table_cell": 42, "text": 1 }, "build_ms": 12, "items": [ { "id": "p130.1", "order": 1, "type": "header", "bbox": { "l": 367.44, "t": 739.44, "r": 561.36, "b": 712.8 }, "text": "NOAA 24-hr D 2-Year Rainfall=3.42\"\nPrinted 04/12/2025", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p130.2", "order": 2, "type": "header", "bbox": { "l": 52.08, "t": 738.24, "r": 396.96, "b": 699.12 }, "text": "102 Sams -REV 12-02-25\nPrepared by Haler Consulting\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p130.3", "order": 3, "type": "text", "bbox": { "l": 516.72, "t": 711.12, "r": 559.2, "b": 698.88 }, "text": "Page 17", "attrs": { "block_label": "number" }, "reading_order": 2 }, { "id": "p130.4", "order": 4, "type": "caption", "bbox": { "l": 145.92, "t": 687.84, "r": 466.08, "b": 672.96 }, "text": "Stage-Area-Storage for Pond 184P: WQ Infiltration Basin #2", "attrs": { "block_label": "figure_title" }, "reading_order": 3 }, { "id": "p130.5", "order": 5, "type": "table", "bbox": { "l": 54.72, "t": 665.28, "r": 465.558002, "b": 52.08 }, "text": "", "attrs": { "block_label": "table", "n_rows": 7, "n_cols": 6, "integrity": { "cells_checked": 42, "cells_flagged": 3, "flags": [ { "row": 1, "col": 5, "coverage": 0, "text": "10,468" }, { "row": 3, "col": 5, "coverage": 0, "text": "11,717" }, { "row": 5, "col": 5, "coverage": 0, "text": "12,488" } ] } }, "children": [ { "id": "p130.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 57.479999, "t": 661.126246, "r": 98.137287, "b": 583.038857 }, "text": "Elevation (feet)\n91.00\n91.05\n91.10\n91.15\n91.20", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p130.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 139.439999, "t": 661.126246, "r": 173.816353, "b": 583.038857 }, "text": "Surface (sq-ft)\n2,628\n2,663\n2,697\n2,732\n2,766", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p130.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 199.55999, "t": 661.126246, "r": 249.522956, "b": 583.038857 }, "text": "Storage (cubic-feet)\n0\n132\n266\n402\n539", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p130.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 273.240005, "t": 661.126246, "r": 313.897287, "b": 583.038857 }, "text": "Elevation (feet)\n93.60\n93.65\n93.70\n93.75\n93.80", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p130.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 355.200005, "t": 661.126246, "r": 389.576359, "b": 583.038857 }, "text": "Surface (sq-ft)\n4,633\n4,680\n4,727\n4,774\n4,821", "attrs": { "row": 0, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p130.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 415.320008, "t": 661.126246, "r": 465.284304, "b": 583.038857 }, "text": "Storage (cubic-feet)\n9,277\n9,510\n9,745\n9,983\n10,223", "attrs": { "row": 0, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p130.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 73.320002, "t": 583.006243, "r": 98.137287, "b": 571.9988559999999 }, "text": "91.25", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p130.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 148.972477, "t": 583.006243, "r": 173.773196, "b": 571.9988559999999 }, "text": "2,801", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p130.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 232.992149, "t": 583.006243, "r": 249.447055, "b": 571.9988559999999 }, "text": "679", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p130.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 289.080002, "t": 583.006243, "r": 313.897287, "b": 571.9988559999999 }, "text": "93.85", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p130.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 364.732477, "t": 583.006243, "r": 389.533196, "b": 571.9988559999999 }, "text": "4,869", "attrs": { "row": 1, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p130.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 394.32, "t": 595.8611, "r": 462.24, "b": 584.2913 }, "text": "10,468", "attrs": { "row": 1, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 11 }, { "id": "p130.5.13", "order": 18, "type": "table_cell", "bbox": { "l": 73.320002, "t": 571.966242, "r": 98.137287, "b": 527.838853 }, "text": "91.30\n91.35\n91.40\n91.45", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 12 }, { "id": "p130.5.14", "order": 19, "type": "table_cell", "bbox": { "l": 148.972477, "t": 571.966242, "r": 173.773196, "b": 527.838853 }, "text": "2,836\n2,870\n2,905\n2,939", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 13 }, { "id": "p130.5.15", "order": 20, "type": "table_cell", "bbox": { "l": 224.707019, "t": 571.966242, "r": 249.524304, "b": 527.838853 }, "text": "820\n962\n1,107\n1,253", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 14 }, { "id": "p130.5.16", "order": 21, "type": "table_cell", "bbox": { "l": 289.080002, "t": 571.966242, "r": 313.897287, "b": 527.838853 }, "text": "93.90\n93.95\n94.00\n94.05", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 15 }, { "id": "p130.5.17", "order": 22, "type": "table_cell", "bbox": { "l": 364.732477, "t": 571.966242, "r": 389.533196, "b": 527.838853 }, "text": "4,916\n4,963\n5,010\n5,053", "attrs": { "row": 2, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 16 }, { "id": "p130.5.18", "order": 23, "type": "table_cell", "bbox": { "l": 434.943599, "t": 571.966242, "r": 465.246354, "b": 527.838853 }, "text": "10,710\n10,957\n11,206\n11,458", "attrs": { "row": 2, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 17 }, { "id": "p130.5.19", "order": 24, "type": "table_cell", "bbox": { "l": 73.320002, "t": 527.806238, "r": 98.137287, "b": 516.798851 }, "text": "91.50", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p130.5.20", "order": 25, "type": "table_cell", "bbox": { "l": 148.972477, "t": 527.806238, "r": 173.773196, "b": 516.798851 }, "text": "2,974", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p130.5.21", "order": 26, "type": "table_cell", "bbox": { "l": 224.707019, "t": 527.806238, "r": 249.524304, "b": 516.798851 }, "text": "1,401", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p130.5.22", "order": 27, "type": "table_cell", "bbox": { "l": 289.080002, "t": 527.806238, "r": 313.897287, "b": 516.798851 }, "text": "94.10", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p130.5.23", "order": 28, "type": "table_cell", "bbox": { "l": 364.732477, "t": 527.806238, "r": 389.533196, "b": 516.798851 }, "text": "5,096", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 22 }, { "id": "p130.5.24", "order": 29, "type": "table_cell", "bbox": { "l": 394.32, "t": 538.0121, "r": 462.24, "b": 526.4423 }, "text": "11,717", "attrs": { "row": 3, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 23 }, { "id": "p130.5.25", "order": 30, "type": "table_cell", "bbox": { "l": 73.320002, "t": 516.766237, "r": 98.137287, "b": 494.71885 }, "text": "91.55\n91.60", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 24 }, { "id": "p130.5.26", "order": 31, "type": "table_cell", "bbox": { "l": 148.972477, "t": 516.766237, "r": 173.773196, "b": 494.71885 }, "text": "3,009\n3,043", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 25 }, { "id": "p130.5.27", "order": 32, "type": "table_cell", "bbox": { "l": 224.707019, "t": 516.766237, "r": 249.524304, "b": 494.71885 }, "text": "1,550\n1,701", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 26 }, { "id": "p130.5.28", "order": 33, "type": "table_cell", "bbox": { "l": 289.080002, "t": 516.766237, "r": 313.897287, "b": 494.71885 }, "text": "94.15\n94.20", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 27 }, { "id": "p130.5.29", "order": 34, "type": "table_cell", "bbox": { "l": 364.732477, "t": 516.766237, "r": 389.533196, "b": 494.71885 }, "text": "5,138\n5,181", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 28 }, { "id": "p130.5.30", "order": 35, "type": "table_cell", "bbox": { "l": 434.943599, "t": 516.766237, "r": 465.246354, "b": 494.71885 }, "text": "11,967\n12,225", "attrs": { "row": 4, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 29 }, { "id": "p130.5.31", "order": 36, "type": "table_cell", "bbox": { "l": 73.320002, "t": 494.686236, "r": 98.137287, "b": 483.678849 }, "text": "91.65", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 30 }, { "id": "p130.5.32", "order": 37, "type": "table_cell", "bbox": { "l": 148.972477, "t": 494.686236, "r": 173.773196, "b": 483.678849 }, "text": "3,078", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 31 }, { "id": "p130.5.33", "order": 38, "type": "table_cell", "bbox": { "l": 224.707019, "t": 494.686236, "r": 249.524304, "b": 483.678849 }, "text": "1,854", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 32 }, { "id": "p130.5.34", "order": 39, "type": "table_cell", "bbox": { "l": 289.080002, "t": 494.686236, "r": 313.897287, "b": 483.678849 }, "text": "94.25", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 33 }, { "id": "p130.5.35", "order": 40, "type": "table_cell", "bbox": { "l": 364.732477, "t": 494.686236, "r": 389.533196, "b": 483.678849 }, "text": "5,224", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 34 }, { "id": "p130.5.36", "order": 41, "type": "table_cell", "bbox": { "l": 394.32, "t": 503.3026, "r": 462.24, "b": 491.7328 }, "text": "12,488", "attrs": { "row": 5, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 35 }, { "id": "p130.5.37", "order": 42, "type": "table_cell", "bbox": { "l": 73.320002, "t": 483.646234, "r": 98.137287, "b": 64.158859 }, "text": "91.70\n91.75\n91.80\n91.85\n91.90\n91.95\n92.00\n92.05\n92.10\n92.15\n92.20\n92.25\n92.30\n92.35\n92.40\n92.45\n92.50\n92.55\n92.60\n92.65\n92.70\n92.75\n92.80\n92.85\n92.90\n92.95\n93.00\n93.05\n93.10\n93.15\n93.20\n93.25\n93.30\n93.35\n93.40\n93.45\n93.50\n93.55", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 36 }, { "id": "p130.5.38", "order": 43, "type": "table_cell", "bbox": { "l": 148.972477, "t": 483.646234, "r": 173.773196, "b": 64.158859 }, "text": "3,112\n3,147\n3,182\n3,216\n3,251\n3,285\n3,320\n3,357\n3,395\n3,432\n3,469\n3,507\n3,544\n3,581\n3,619\n3,656\n3,694\n3,731\n3,768\n3,806\n3,843\n3,880\n3,918\n3,955\n3,992\n4,030\n4,067\n4,114\n4,161\n4,208\n4,256\n4,303\n4,350\n4,397\n4,444\n4,491\n4,539\n4,586", "attrs": { "row": 6, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 37 }, { "id": "p130.5.39", "order": 44, "type": "table_cell", "bbox": { "l": 224.707019, "t": 483.646234, "r": 249.524304, "b": 64.158859 }, "text": "2,009\n2,166\n2,324\n2,484\n2,645\n2,809\n2,974\n3,141\n3,310\n3,480\n3,653\n3,827\n4,004\n4,182\n4,362\n4,544\n4,727\n4,913\n5,100\n5,290\n5,481\n5,674\n5,869\n6,066\n6,265\n6,465\n6,668\n6,872\n7,079\n7,288\n7,500\n7,714\n7,930\n8,149\n8,370\n8,593\n8,819\n9,047", "attrs": { "row": 6, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 38 }, { "id": "p130.5.40", "order": 45, "type": "table_cell", "bbox": { "l": 289.080002, "t": 483.646234, "r": 313.897287, "b": 428.478844 }, "text": "94.30\n94.35\n94.40\n94.45\n94.50", "attrs": { "row": 6, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 39 }, { "id": "p130.5.41", "order": 46, "type": "table_cell", "bbox": { "l": 364.732477, "t": 483.646234, "r": 389.808242, "b": 428.478844 }, "text": "5,267\n5,310\n5,352\n5,395\n5,438", "attrs": { "row": 6, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 40 }, { "id": "p130.5.42", "order": 47, "type": "table_cell", "bbox": { "l": 434.943599, "t": 483.646234, "r": 465.558002, "b": 428.478844 }, "text": "12,748\n13,012\n13,278\n13,547\n13,818", "attrs": { "row": 6, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 41 } ], "reading_order": 4 } ] }, { "document_id": 16592, "page": 131, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 11, "counts_by_type": { "caption": 2, "figure": 1, "footer": 1, "footnote": 1, "header": 2, "heading": 1, "text": 3 }, "build_ms": 1, "items": [ { "id": "p131.1", "order": 1, "type": "header", "bbox": { "l": 367.2, "t": 738.96, "r": 560.64, "b": 713.04 }, "text": "NOAA 24-hr D 2-Year Rainfall=3.42\"\nPrinted 04/12/2025", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p131.2", "order": 2, "type": "header", "bbox": { "l": 52.56, "t": 737.76, "r": 395.52, "b": 699.36 }, "text": "102 Sams -REV 12-02-25\nPrepared by Haler Consulting\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p131.3", "order": 3, "type": "text", "bbox": { "l": 517.2, "t": 710.88, "r": 558.96, "b": 699.36 }, "text": "Page 18", "attrs": { "block_label": "number" }, "reading_order": 2 }, { "id": "p131.4", "order": 4, "type": "heading", "bbox": { "l": 221.04, "t": 687.36, "r": 392.16, "b": 672.48 }, "text": "Summary for Link 185L: POA", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 3 }, { "id": "p131.5", "order": 5, "type": "text", "bbox": { "l": 52.08, "t": 660, "r": 515.28, "b": 622.08 }, "text": "Inflow Area = 536,539 sf, 11.25% Impervious, Inflow Depth > 0.20\" for 2-Year event\nInflow = 0.43 cfs @ 12.10 hrs, Volume= 8,725 cf\nPrimary = 0.43 cfs @ 12.10 hrs, Volume= 8,725 cf, Atten= 0%, Lag= 0.0 min", "reading_order": 4 }, { "id": "p131.6", "order": 6, "type": "text", "bbox": { "l": 52.08, "t": 611.28, "r": 366.96, "b": 597.84 }, "text": "Primary outflow = Inflow, Time Span = 0.00-72.00 hrs, dt = 0.01 hrs", "reading_order": 5 }, { "id": "p131.7", "order": 7, "type": "caption", "bbox": { "l": 259.44, "t": 586.32, "r": 352.56, "b": 572.4 }, "text": "Link 185L: POA", "attrs": { "block_label": "figure_title" }, "reading_order": 6 }, { "id": "p131.8", "order": 8, "type": "caption", "bbox": { "l": 252.72, "t": 566.64, "r": 303.36, "b": 555.6 }, "text": "Hydrograph", "attrs": { "block_label": "figure_title" }, "reading_order": 7 }, { "id": "p131.9", "order": 9, "type": "figure", "bbox": { "l": 64.8, "t": 561.36, "r": 495.84, "b": 304.08 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "0.48 0.43 cfs\n0.46 0.43 cfs\n0.44 Inflow Area=536,539 sf\n0.42\n0.4\n0.38\n0.36\n0.34\n0.32\n0.3\n0.28\n(cfs) 0.26\n0.24\nFlow 0.22\n0.2\n0.18\n0.16\n0.14\n0.12\n0.1\n0.08\n0.06\n0.04\n0.02\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72" }, "reading_order": 8 }, { "id": "p131.10", "order": 10, "type": "footnote", "bbox": { "l": 90.96, "t": 317.76, "r": 478.8, "b": 299.76 }, "text": "0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72 Time (hours)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 9 }, { "id": "p131.11", "order": 11, "type": "footer", "bbox": { "l": 505.92, "t": 544.8, "r": 546.96, "b": 525.36 }, "text": "", "attrs": { "block_label": "footer_image" }, "reading_order": 10 } ] }, { "document_id": 16592, "page": 132, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 2, "counts_by_type": { "footer": 1, "text": 1 }, "build_ms": 1, "items": [ { "id": "p132.1", "order": 1, "type": "text", "bbox": { "l": 49.92, "t": 683.76, "r": 560.4, "b": 288.96 }, "text": "Time span=0.00-72.00 hrs, dt=0.01 hrs, 7201 points\nRunoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious\nReach routing by Stor-Ind+Trans method - Pond routing by Stor-Ind method\nSubcatchment 170S: DA P1 (Impervious) Runoff Area=31,625 sf 100.00% Impervious Runoff Depth=5.14\"\nFlow Length=450' Tc=3.0 min CN=0/98 Runoff=3.70 cfs 13,553 cf\nSubcatchment 174S: DA P2 (Impervious) Runoff Area=23,470 sf 100.00% Impervious Runoff Depth=5.14\"\nFlow Length=450' Tc=4.9 min CN=0/98 Runoff=2.42 cfs 10,058 cf\nSubcatchment 178S: DA P3 (Pervious) Runoff Area=62,973 sf 0.00% Impervious Runoff Depth=0.28\"\nFlow Length=316' Slope=0.0200'/' Tc=13.1 min CN=39/0 Runoff=0.07 cfs 1,487 cf\nSubcatchment 179S: DA P0 Pervious Runoff Area=336,250 sf 0.00% Impervious Runoff Depth=0.08\"\nFlow Length=679' Tc=49.8 min CN=33/0 Runoff=0.06 cfs 2,256 cf\nSubcatchment 180S: DA P4 (Pervious) Runoff Area=76,971 sf 0.00% Impervious Runoff Depth=0.28\"\nFlow Length=196' Slope=0.0100'/' Tc=14.8 min CN=39/0 Runoff=0.09 cfs 1,818 cf\nSubcatchment 181S: DA P6 (Impervious) Runoff Area=5,250 sf 100.00% Impervious Runoff Depth=5.14\"\nFlow Length=150' Tc=1.4 min CN=0/98 Runoff=0.67 cfs 2,250 cf\nPond 183P: WQ Infiltration Basin #1 Peak Elevation=98.69' Storage=16,706 cfs Inflow=3.70 cfs 15,371 cf\nDiscarded=0.00 cfs 0 cf Primary=4.03 cfs 11,568 cf Outflow=4.03 cfs 11,568 cf\nPond 184P: WQ Infiltration Basin #2 Peak Elevation=94.29' Storage=12,701 cfs Inflow=2.42 cfs 11,545 cf\nDiscarded=0.00 cfs 0 cf Primary=0.47 cfs 7,983 cf Outflow=0.47 cfs 7,983 cf\nLink 185L: POA Inflow=4.64 cfs 24,056 cf Primary=4.64 cfs 24,056 cf\nTotal Runoff Area = 536,539 sf Runoff Volume = 31,422 cf Average Runoff Depth = 0.70\"\n88.75% Pervious = 476,194 sf 11.25% Impervious = 60,345 sf", "attrs": { "block_label": "algorithm" }, "reading_order": 0 }, { "id": "p132.2", "order": 2, "type": "footer", "bbox": { "l": 50.88, "t": 739.2, "r": 559.92, "b": 699.84 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 10-Year Rainfall=5.38\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 19", "attrs": { "block_label": "footer" }, "reading_order": 1 } ] }, { "document_id": 16592, "page": 133, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 32, "counts_by_type": { "caption": 1, "figure": 1, "footnote": 1, "header": 1, "table": 1, "table_cell": 24, "text": 2, "title": 1 }, "build_ms": 3, "items": [ { "id": "p133.1", "order": 1, "type": "header", "bbox": { "l": 52.8, "t": 738.48, "r": 562.08, "b": 698.64 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 10-Year Rainfall=5.38\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 20", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p133.2", "order": 2, "type": "title", "bbox": { "l": 148.08, "t": 687.6, "r": 463.92, "b": 672.24 }, "text": "Summary for Subcatchment 170S: DA P1 (Impervious)", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p133.3", "order": 3, "type": "text", "bbox": { "l": 53.76, "t": 660.48, "r": 463.68, "b": 634.32 }, "text": "Runoff = 3.70 cfs @ 12.11 hrs, Volume= 13,553 cf, Depth= 5.14\"\nRouted to Pond 183P : WQ Infiltration Basin #1", "reading_order": 2 }, { "id": "p133.4", "order": 4, "type": "text", "bbox": { "l": 52.08, "t": 623.76, "r": 611.28, "b": 598.32 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious, Time Span= 0.00-72.00 hrs, dt= NOAA 24-hr D 10-Year Rainfall=5.38\"", "reading_order": 3 }, { "id": "p133.5", "order": 5, "type": "table", "bbox": { "l": 52.56, "t": 588.48, "r": 559.2, "b": 447.497874 }, "text": "", "attrs": { "block_label": "table", "n_rows": 6, "n_cols": 5, "integrity": { "cells_checked": 22, "cells_flagged": 0 } }, "children": [ { "id": "p133.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 86.520001, "t": 587.142469, "r": 127.590159, "b": 575.177889 }, "text": "Area (sf)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p133.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 144.389888, "t": 587.142469, "r": 159.742288, "b": 575.177889 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p133.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 286.601768, "t": 535.302451, "r": 340.102911, "b": 523.337871 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p133.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 95.280001, "t": 559.302451, "r": 127.805562, "b": 547.337871 }, "text": "31,625", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 3 }, { "id": "p133.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 148.003832, "t": 559.302451, "r": 159.753993, "b": 547.337871 }, "text": "98", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p133.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 174.16295, "t": 573.222448, "r": 281.259838, "b": 561.257868 }, "text": "Paved parking, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 5 }, { "id": "p133.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 95.280001, "t": 573.222448, "r": 127.805562, "b": 561.257868 }, "text": "31,625", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p133.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 148.003832, "t": 573.222448, "r": 159.753993, "b": 561.257868 }, "text": "98", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p133.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 174.16295, "t": 559.302451, "r": 296.664294, "b": 547.337871 }, "text": "100.00% Impervious Area", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 8 }, { "id": "p133.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 65.040001, "t": 535.302451, "r": 89.475992, "b": 497.417872 }, "text": "Tc (min)\n1.2", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 9 }, { "id": "p133.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 100.248415, "t": 535.302451, "r": 132.68142, "b": 497.417872 }, "text": "Length (feet)\n100", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 10 }, { "id": "p133.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 143.445254, "t": 535.302451, "r": 175.895438, "b": 497.417872 }, "text": "Slope (ft/ft)\n0.0200", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 11 }, { "id": "p133.5.13", "order": 18, "type": "table_cell", "bbox": { "l": 186.552062, "t": 535.302451, "r": 223.968178, "b": 497.417872 }, "text": "Velocity (ft/sec)\n1.42", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 12 }, { "id": "p133.5.14", "order": 19, "type": "table_cell", "bbox": { "l": 234.581918, "t": 535.302451, "r": 473.002733, "b": 485.417872 }, "text": "Capacity (cfs)\nSheet Flow, Smooth surfaces n= 0.011 P2= 3.42\"", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 13 }, { "id": "p133.5.15", "order": 20, "type": "table_cell", "bbox": { "l": 74.639998, "t": 485.382452, "r": 89.475992, "b": 473.417872 }, "text": "1.8", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p133.5.16", "order": 21, "type": "table_cell", "bbox": { "l": 114.927527, "t": 485.382452, "r": 132.68142, "b": 473.417872 }, "text": "350", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p133.5.17", "order": 22, "type": "table_cell", "bbox": { "l": 143.445254, "t": 485.382452, "r": 175.863606, "b": 473.417872 }, "text": "0.0250", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p133.5.18", "order": 23, "type": "table_cell", "bbox": { "l": 203.137703, "t": 485.382452, "r": 223.870219, "b": 473.417872 }, "text": "3.21", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p133.5.19", "order": 24, "type": "table_cell", "bbox": { "l": 286.679993, "t": 485.26245, "r": 425.623588, "b": 461.417872 }, "text": "Shallow Concentrated Flow, Paved Kv= 20.3 fps", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p133.5.20", "order": 25, "type": "table_cell", "bbox": { "l": 74.639998, "t": 459.462454, "r": 89.475992, "b": 447.497874 }, "text": "3.0", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p133.5.21", "order": 26, "type": "table_cell", "bbox": { "l": 114.927527, "t": 459.462454, "r": 132.68142, "b": 447.497874 }, "text": "450", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p133.5.22", "order": 27, "type": "table_cell", "bbox": { "l": 143.445254, "t": 459.462454, "r": 167.029543, "b": 447.497874 }, "text": "Total", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p133.5.23", "order": 28, "type": "table_cell", "bbox": { "l": 356.544, "t": 470.6057, "r": 457.872, "b": 450.96 }, "text": "", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 22 }, { "id": "p133.5.24", "order": 29, "type": "table_cell", "bbox": { "l": 457.872, "t": 470.6057, "r": 559.2, "b": 450.96 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 23 } ], "reading_order": 4 }, { "id": "p133.6", "order": 30, "type": "caption", "bbox": { "l": 186.96, "t": 435.12, "r": 424.56, "b": 419.76 }, "text": "Subcatchment 170S: DA P1 (Impervious)", "attrs": { "block_label": "figure_title" }, "reading_order": 5 }, { "id": "p133.7", "order": 31, "type": "figure", "bbox": { "l": 60.96, "t": 415.68, "r": 552.48, "b": 150 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n4 Runoff\n3.70 cfs\nNOAA 24-hr D\n10-Year Rainfall=5.38\"\nRunoff Area=31,625 sf\n3\nRunoff Volume=13,553 cf\n(cfs) Runoff Depth=5.14\"\nFlow Flow Length=450'\n2\nTc=3.0 min\nCN=0/98\n1\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72\nTime (hours)" }, "reading_order": 6 }, { "id": "p133.8", "order": 32, "type": "footnote", "bbox": { "l": 84.96, "t": 168.24, "r": 493.2, "b": 147.84 }, "text": "0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72 Time (hours)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 7 } ] }, { "document_id": 16592, "page": 134, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 34, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "table": 1, "table_cell": 24, "text": 5, "title": 1 }, "build_ms": 4, "items": [ { "id": "p134.1", "order": 1, "type": "header", "bbox": { "l": 53.04, "t": 738.48, "r": 560.64, "b": 698.64 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 10-Year Rainfall=5.38\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 21", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p134.2", "order": 2, "type": "title", "bbox": { "l": 148.32, "t": 687.6, "r": 463.92, "b": 672.24 }, "text": "Summary for Subcatchment 174S: DA P2 (Impervious)", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p134.3", "order": 3, "type": "text", "bbox": { "l": 52.32, "t": 659.76, "r": 303.84, "b": 647.04 }, "text": "Runoff = 2.42 cfs @ 12.13 hrs, Volume=10,058 cf, Depth= 5.14\"", "reading_order": 2 }, { "id": "p134.4", "order": 4, "type": "text", "bbox": { "l": 66.24, "t": 647.28, "r": 294.96, "b": 634.32 }, "text": "Routed to Pond 184P : WQ Infiltration Basin #2", "reading_order": 3 }, { "id": "p134.5", "order": 5, "type": "text", "bbox": { "l": 342.24, "t": 660, "r": 463.2, "b": 646.56 }, "text": "10,058 cf, Depth= 5.14\"", "reading_order": 4 }, { "id": "p134.6", "order": 6, "type": "text", "bbox": { "l": 51.84, "t": 623.76, "r": 611.28, "b": 598.32 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious, Time Span= 0.00-72.00 hrs, dt= NOAA 24-hr D 10-Year Rainfall=5.38\"", "reading_order": 5 }, { "id": "p134.7", "order": 7, "type": "table", "bbox": { "l": 52.56, "t": 588.48, "r": 559.2, "b": 447.497874 }, "text": "", "attrs": { "block_label": "table", "n_rows": 6, "n_cols": 5, "integrity": { "cells_checked": 22, "cells_flagged": 0 } }, "children": [ { "id": "p134.7.1", "order": 8, "type": "table_cell", "bbox": { "l": 86.520001, "t": 587.142469, "r": 127.590159, "b": 575.177889 }, "text": "Area (sf)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p134.7.2", "order": 9, "type": "table_cell", "bbox": { "l": 144.389888, "t": 587.142469, "r": 159.742288, "b": 575.177889 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p134.7.3", "order": 10, "type": "table_cell", "bbox": { "l": 286.601768, "t": 535.302451, "r": 340.102911, "b": 523.337871 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p134.7.4", "order": 11, "type": "table_cell", "bbox": { "l": 95.280001, "t": 559.302451, "r": 127.805562, "b": 547.337871 }, "text": "23,470", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 3 }, { "id": "p134.7.5", "order": 12, "type": "table_cell", "bbox": { "l": 148.003832, "t": 559.302451, "r": 159.753993, "b": 547.337871 }, "text": "98", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p134.7.6", "order": 13, "type": "table_cell", "bbox": { "l": 174.16295, "t": 573.222448, "r": 281.259838, "b": 561.257868 }, "text": "Paved parking, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 5 }, { "id": "p134.7.7", "order": 14, "type": "table_cell", "bbox": { "l": 95.280001, "t": 573.222448, "r": 127.805562, "b": 561.257868 }, "text": "23,470", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p134.7.8", "order": 15, "type": "table_cell", "bbox": { "l": 148.003832, "t": 573.222448, "r": 159.753993, "b": 561.257868 }, "text": "98", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p134.7.9", "order": 16, "type": "table_cell", "bbox": { "l": 174.16295, "t": 559.302451, "r": 296.664294, "b": 547.337871 }, "text": "100.00% Impervious Area", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 8 }, { "id": "p134.7.10", "order": 17, "type": "table_cell", "bbox": { "l": 65.040001, "t": 535.302451, "r": 89.475992, "b": 497.417872 }, "text": "Tc (min)\n0.8", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 9 }, { "id": "p134.7.11", "order": 18, "type": "table_cell", "bbox": { "l": 100.248415, "t": 535.302451, "r": 132.68142, "b": 497.417872 }, "text": "Length (feet)\n100", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 10 }, { "id": "p134.7.12", "order": 19, "type": "table_cell", "bbox": { "l": 143.445254, "t": 535.302451, "r": 175.895438, "b": 497.417872 }, "text": "Slope (ft/ft)\n0.0500", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 11 }, { "id": "p134.7.13", "order": 20, "type": "table_cell", "bbox": { "l": 186.552062, "t": 535.302451, "r": 223.968178, "b": 497.417872 }, "text": "Velocity (ft/sec)\n2.05", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 12 }, { "id": "p134.7.14", "order": 21, "type": "table_cell", "bbox": { "l": 234.581918, "t": 535.302451, "r": 473.002733, "b": 485.417872 }, "text": "Capacity (cfs)\nSheet Flow, Smooth surfaces n= 0.011 P2= 3.42\"", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 13 }, { "id": "p134.7.15", "order": 22, "type": "table_cell", "bbox": { "l": 74.639998, "t": 485.382452, "r": 89.475992, "b": 473.417872 }, "text": "4.1", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p134.7.16", "order": 23, "type": "table_cell", "bbox": { "l": 114.927527, "t": 485.382452, "r": 132.68142, "b": 473.417872 }, "text": "350", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p134.7.17", "order": 24, "type": "table_cell", "bbox": { "l": 143.445254, "t": 485.382452, "r": 175.863606, "b": 473.417872 }, "text": "0.0050", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p134.7.18", "order": 25, "type": "table_cell", "bbox": { "l": 203.137703, "t": 485.382452, "r": 223.870219, "b": 473.417872 }, "text": "1.44", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p134.7.19", "order": 26, "type": "table_cell", "bbox": { "l": 286.679993, "t": 485.26245, "r": 425.623588, "b": 461.417872 }, "text": "Shallow Concentrated Flow, Paved Kv= 20.3 fps", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p134.7.20", "order": 27, "type": "table_cell", "bbox": { "l": 74.639998, "t": 459.462454, "r": 89.475992, "b": 447.497874 }, "text": "4.9", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p134.7.21", "order": 28, "type": "table_cell", "bbox": { "l": 114.927527, "t": 459.462454, "r": 132.68142, "b": 447.497874 }, "text": "450", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p134.7.22", "order": 29, "type": "table_cell", "bbox": { "l": 143.445254, "t": 459.462454, "r": 167.029543, "b": 447.497874 }, "text": "Total", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p134.7.23", "order": 30, "type": "table_cell", "bbox": { "l": 356.544, "t": 470.8114, "r": 457.872, "b": 451.2 }, "text": "", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 22 }, { "id": "p134.7.24", "order": 31, "type": "table_cell", "bbox": { "l": 457.872, "t": 470.8114, "r": 559.2, "b": 451.2 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 23 } ], "reading_order": 6 }, { "id": "p134.8", "order": 32, "type": "caption", "bbox": { "l": 186.96, "t": 435.12, "r": 424.56, "b": 419.76 }, "text": "Subcatchment 174S: DA P2 (Impervious)", "attrs": { "block_label": "figure_title" }, "reading_order": 7 }, { "id": "p134.9", "order": 33, "type": "figure", "bbox": { "l": 60.96, "t": 414.48, "r": 552, "b": 149.52 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nRunoff\n2.42 cfs\nNOAA 24-hr D\n10-Year Rainfall=5.38\"\n2\nRunoff Area=23,470 sf\nRunoff Volume=10,058 cf\n(cfs) Runoff Depth=5.14\"\nFlow Flow Length=450'\n1 Tc=4.9 min\nCN=0/98\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72\nTime (hours)" }, "reading_order": 8 }, { "id": "p134.10", "order": 34, "type": "text", "bbox": { "l": 265.44, "t": 155.76, "r": 312.96, "b": 147.12 }, "text": "Time (hours)", "attrs": { "block_label": "number" }, "reading_order": 9 } ] }, { "document_id": 16592, "page": 135, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 32, "counts_by_type": { "caption": 1, "figure": 2, "table": 1, "table_cell": 24, "text": 3, "title": 1 }, "build_ms": 4, "items": [ { "id": "p135.1", "order": 1, "type": "figure", "bbox": { "l": 53.04, "t": 738.48, "r": 560.64, "b": 698.64 }, "text": "", "attrs": { "role": "page_header", "block_label": "header_image", "embedded_text": "102 Sams -REV 12-02-25 NOAA 24-hr D 10-Year Rainfall=5.38\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 22" }, "reading_order": 0 }, { "id": "p135.2", "order": 2, "type": "title", "bbox": { "l": 154.8, "t": 687.6, "r": 457.2, "b": 672.24 }, "text": "Summary for Subcatchment 178S: DA P3 (Pervious)", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p135.3", "order": 3, "type": "text", "bbox": { "l": 53.52, "t": 660.24, "r": 463.92, "b": 634.08 }, "text": "Runoff = 0.07 cfs @ 13.04 hrs, Volume= 1,487 cf, Depth= 0.28\"\nRouted to Pond 184P : WQ Infiltration Basin #2", "reading_order": 2 }, { "id": "p135.4", "order": 4, "type": "text", "bbox": { "l": 52.32, "t": 623.52, "r": 611.04, "b": 598.32 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious, Time Span= 0.00-72.00 hrs, dt= NOAA 24-hr D 10-Year Rainfall=5.38\"", "reading_order": 3 }, { "id": "p135.5", "order": 5, "type": "table", "bbox": { "l": 52.32, "t": 588.96, "r": 558.96, "b": 447.497874 }, "text": "", "attrs": { "block_label": "table", "n_rows": 6, "n_cols": 5, "integrity": { "cells_checked": 22, "cells_flagged": 0 } }, "children": [ { "id": "p135.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 86.520001, "t": 587.142469, "r": 127.590159, "b": 575.177889 }, "text": "Area (sf)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p135.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 144.389888, "t": 587.142469, "r": 159.742288, "b": 575.177889 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p135.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 286.601768, "t": 535.302451, "r": 340.102911, "b": 523.337871 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p135.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 95.280001, "t": 559.302451, "r": 127.805562, "b": 547.337871 }, "text": "62,973", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 3 }, { "id": "p135.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 148.003832, "t": 559.302451, "r": 159.753993, "b": 547.337871 }, "text": "39", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p135.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 174.16295, "t": 573.222448, "r": 333.31717, "b": 561.257868 }, "text": ">75% Grass cover, Good, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 5 }, { "id": "p135.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 95.280001, "t": 573.222448, "r": 127.805562, "b": 561.257868 }, "text": "62,973", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p135.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 148.003832, "t": 573.222448, "r": 159.753993, "b": 561.257868 }, "text": "39", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p135.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 174.16295, "t": 559.302451, "r": 286.000299, "b": 547.337871 }, "text": "100.00% Pervious Area", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 8 }, { "id": "p135.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 65.040001, "t": 535.302451, "r": 89.475992, "b": 497.417872 }, "text": "Tc (min)\n9.5", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 9 }, { "id": "p135.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 100.248415, "t": 535.302451, "r": 132.68142, "b": 497.417872 }, "text": "Length (feet)\n100", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 10 }, { "id": "p135.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 143.445254, "t": 535.302451, "r": 175.895438, "b": 497.417872 }, "text": "Slope (ft/ft)\n0.0200", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 11 }, { "id": "p135.5.13", "order": 18, "type": "table_cell", "bbox": { "l": 186.552062, "t": 535.302451, "r": 223.968178, "b": 497.417872 }, "text": "Velocity (ft/sec)\n0.18", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 12 }, { "id": "p135.5.14", "order": 19, "type": "table_cell", "bbox": { "l": 234.581918, "t": 535.302451, "r": 452.820335, "b": 485.417872 }, "text": "Capacity (cfs)\nSheet Flow, Grass: Short n= 0.150 P2= 3.42\"", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 13 }, { "id": "p135.5.15", "order": 20, "type": "table_cell", "bbox": { "l": 74.639998, "t": 485.382452, "r": 89.475992, "b": 473.417872 }, "text": "3.6", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p135.5.16", "order": 21, "type": "table_cell", "bbox": { "l": 114.927527, "t": 485.382452, "r": 132.68142, "b": 473.417872 }, "text": "216", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p135.5.17", "order": 22, "type": "table_cell", "bbox": { "l": 143.445254, "t": 485.382452, "r": 175.863606, "b": 473.417872 }, "text": "0.0200", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p135.5.18", "order": 23, "type": "table_cell", "bbox": { "l": 203.137703, "t": 485.382452, "r": 223.870219, "b": 473.417872 }, "text": "0.99", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p135.5.19", "order": 24, "type": "table_cell", "bbox": { "l": 286.679993, "t": 485.26245, "r": 446.147004, "b": 461.417872 }, "text": "Shallow Concentrated Flow, Short Grass Pasture Kv= 7.0 fps", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p135.5.20", "order": 25, "type": "table_cell", "bbox": { "l": 68.76, "t": 459.462454, "r": 89.492517, "b": 447.497874 }, "text": "13.1", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p135.5.21", "order": 26, "type": "table_cell", "bbox": { "l": 114.944052, "t": 459.462454, "r": 132.697945, "b": 447.497874 }, "text": "316", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p135.5.22", "order": 27, "type": "table_cell", "bbox": { "l": 143.354569, "t": 459.462454, "r": 166.947862, "b": 447.497874 }, "text": "Total", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p135.5.23", "order": 28, "type": "table_cell", "bbox": { "l": 356.304, "t": 470.88, "r": 457.632, "b": 451.2 }, "text": "", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 22 }, { "id": "p135.5.24", "order": 29, "type": "table_cell", "bbox": { "l": 457.632, "t": 470.88, "r": 558.96, "b": 451.2 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 23 } ], "reading_order": 4 }, { "id": "p135.6", "order": 30, "type": "caption", "bbox": { "l": 192.96, "t": 435.12, "r": 417.84, "b": 420 }, "text": "Subcatchment 178S: DA P3 (Pervious)", "attrs": { "block_label": "figure_title" }, "reading_order": 5 }, { "id": "p135.7", "order": 31, "type": "figure", "bbox": { "l": 61.92, "t": 420.24, "r": 551.76, "b": 148.32 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n0.08 Runoff\n0.07 cfs\n0.075\n0.07 NOAA 24-hr D\n10-Year Rainfall=5.38\"\n0.065\n0.06\nRunoff Area=62,973 sf\n0.055\n0.05 Runoff Volume=1,487 cf\n(cfs) Runoff Depth=0.28\"\n0.045\n0.04\nFlow 0.035 Flow Length=316'\nSlope=0.0200 '/'\n0.03\n0.025\nTc=13.1 min\n0.02\n0.015 CN=39/0\n0.01\n0.005\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72\nTime (hours)" }, "reading_order": 6 }, { "id": "p135.8", "order": 32, "type": "text", "bbox": { "l": 270, "t": 155.76, "r": 317.76, "b": 146.88 }, "text": "Time (hours)", "attrs": { "block_label": "number" }, "reading_order": 7 } ] }, { "document_id": 16592, "page": 136, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 33, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "table": 1, "table_cell": 26, "text": 2, "title": 1 }, "build_ms": 4, "items": [ { "id": "p136.1", "order": 1, "type": "header", "bbox": { "l": 54.48, "t": 738, "r": 559.92, "b": 698.88 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 10-Year Rainfall=5.38\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 23", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p136.2", "order": 2, "type": "title", "bbox": { "l": 159.36, "t": 687.6, "r": 453.12, "b": 672.48 }, "text": "Summary for Subcatchment 179S: DA P0 Pervious", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p136.3", "order": 3, "type": "text", "bbox": { "l": 53.04, "t": 660.24, "r": 463.92, "b": 634.32 }, "text": "Runoff = 0.06 cfs @ 17.81 hrs, Volume= 2,256 cf, Depth= 0.08\"\nRouted to Link 185L : POA", "reading_order": 2 }, { "id": "p136.4", "order": 4, "type": "text", "bbox": { "l": 52.08, "t": 623.76, "r": 611.28, "b": 598.08 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious, Time Span= 0.00-72.00 hrs, dt= NOAA 24-hr D 10-Year Rainfall=5.38\"", "reading_order": 3 }, { "id": "p136.5", "order": 5, "type": "table", "bbox": { "l": 53.52, "t": 587.52, "r": 558.96, "b": 423.497874 }, "text": "", "attrs": { "block_label": "table", "n_rows": 7, "n_cols": 5, "integrity": { "cells_checked": 24, "cells_flagged": 0 } }, "children": [ { "id": "p136.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 86.520001, "t": 587.142469, "r": 127.590159, "b": 575.177889 }, "text": "Area (sf)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p136.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 144.389888, "t": 587.142469, "r": 159.742288, "b": 575.177889 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p136.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 286.601768, "t": 511.302451, "r": 340.102911, "b": 499.337871 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p136.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 89.399998, "t": 573.222448, "r": 127.805562, "b": 549.257868 }, "text": "236,879\n99,371", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p136.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 147.913142, "t": 573.222448, "r": 159.770513, "b": 549.257868 }, "text": "30\n39", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p136.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 174.07226, "t": 573.222448, "r": 333.31717, "b": 549.257868 }, "text": "Woods, Good, HSG A\n>75% Grass cover, Good, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p136.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 89.399998, "t": 535.302451, "r": 127.714872, "b": 523.337871 }, "text": "336,250", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p136.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 147.913142, "t": 535.302451, "r": 159.770513, "b": 523.337871 }, "text": "33", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p136.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 174.07226, "t": 547.302451, "r": 262.271799, "b": 535.337871 }, "text": "Weighted Average", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 8 }, { "id": "p136.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 89.399998, "t": 547.302451, "r": 127.714872, "b": 535.337871 }, "text": "336,250", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p136.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 147.913142, "t": 547.302451, "r": 159.770513, "b": 535.337871 }, "text": "33", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p136.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 174.07226, "t": 535.302451, "r": 286.016818, "b": 523.337871 }, "text": "100.00% Pervious Area", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 11 }, { "id": "p136.5.13", "order": 18, "type": "table_cell", "bbox": { "l": 65.040001, "t": 511.302451, "r": 89.492517, "b": 473.417872 }, "text": "Tc (min)\n36.2", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 12 }, { "id": "p136.5.14", "order": 19, "type": "table_cell", "bbox": { "l": 100.248415, "t": 511.302451, "r": 132.697945, "b": 473.417872 }, "text": "Length (feet)\n100", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 13 }, { "id": "p136.5.15", "order": 20, "type": "table_cell", "bbox": { "l": 143.354569, "t": 511.302451, "r": 175.895438, "b": 473.417872 }, "text": "Slope (ft/ft)\n0.0050", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 14 }, { "id": "p136.5.16", "order": 21, "type": "table_cell", "bbox": { "l": 186.552062, "t": 511.302451, "r": 223.968178, "b": 473.417872 }, "text": "Velocity (ft/sec)\n0.05", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 15 }, { "id": "p136.5.17", "order": 22, "type": "table_cell", "bbox": { "l": 234.581918, "t": 511.302451, "r": 512.409343, "b": 437.417872 }, "text": "Capacity (cfs)\nSheet Flow, Woods: Light underbrush n= 0.400 P2= 3.42\" Shallow Concentrated Flow, Woodland Kv= 5.0 fps", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 16 }, { "id": "p136.5.18", "order": 23, "type": "table_cell", "bbox": { "l": 68.76, "t": 461.382452, "r": 89.492517, "b": 449.417872 }, "text": "13.6", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p136.5.19", "order": 24, "type": "table_cell", "bbox": { "l": 114.944052, "t": 461.382452, "r": 132.697945, "b": 449.417872 }, "text": "579", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p136.5.20", "order": 25, "type": "table_cell", "bbox": { "l": 143.354569, "t": 461.382452, "r": 175.880131, "b": 449.417872 }, "text": "0.0200", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p136.5.21", "order": 26, "type": "table_cell", "bbox": { "l": 203.154228, "t": 461.382452, "r": 223.886744, "b": 449.417872 }, "text": "0.71", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p136.5.22", "order": 27, "type": "table_cell", "bbox": { "l": 68.76, "t": 435.462454, "r": 89.492517, "b": 423.497874 }, "text": "49.8", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p136.5.23", "order": 28, "type": "table_cell", "bbox": { "l": 114.944052, "t": 435.462454, "r": 132.697945, "b": 423.497874 }, "text": "679", "attrs": { "row": 6, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 22 }, { "id": "p136.5.24", "order": 29, "type": "table_cell", "bbox": { "l": 143.354569, "t": 435.462454, "r": 166.947862, "b": 423.497874 }, "text": "Total", "attrs": { "row": 6, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 23 }, { "id": "p136.5.25", "order": 30, "type": "table_cell", "bbox": { "l": 356.784, "t": 446.2933, "r": 457.872, "b": 428.64 }, "text": "", "attrs": { "row": 6, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 24 }, { "id": "p136.5.26", "order": 31, "type": "table_cell", "bbox": { "l": 457.872, "t": 446.2933, "r": 558.96, "b": 428.64 }, "text": "", "attrs": { "row": 6, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 25 } ], "reading_order": 4 }, { "id": "p136.6", "order": 32, "type": "caption", "bbox": { "l": 197.52, "t": 410.64, "r": 414.24, "b": 396 }, "text": "Subcatchment 179S: DA P0 Pervious", "attrs": { "block_label": "figure_title" }, "reading_order": 5 }, { "id": "p136.7", "order": 33, "type": "figure", "bbox": { "l": 62.88, "t": 393.36, "r": 549.36, "b": 124.32 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n0.07 Runoff\n0.06 cfs\n0.065\nNOAA 24-hr D\n0.06\n0.055 10-Year Rainfall=5.38\"\n0.05 Runoff Area=336,250 sf\nRunoff Volume=2,256 cf\n0.045\n(cfs) Runoff Depth=0.08\"\n0.04\n0.035\nFlow 0.03 Flow Length=679'\n0.025 Tc=49.8 min\nCN=33/0\n0.02\n0.015\n0.01\n0.005\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72\nTime (hours)" }, "reading_order": 6 } ] }, { "document_id": 16592, "page": 137, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 41, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "table": 1, "table_cell": 33, "text": 3, "title": 1 }, "build_ms": 4, "items": [ { "id": "p137.1", "order": 1, "type": "header", "bbox": { "l": 53.04, "t": 738.48, "r": 560.4, "b": 698.88 }, "text": "102 Sams - REV 12-02-25 NOAA 24-hr D 10-Year Rainfall=5.38\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 24", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p137.2", "order": 2, "type": "title", "bbox": { "l": 154.8, "t": 687.36, "r": 457.2, "b": 672.48 }, "text": "Summary for Subcatchment 180S: DA P4 (Pervious)", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p137.3", "order": 3, "type": "text", "bbox": { "l": 53.28, "t": 660.24, "r": 464.16, "b": 634.32 }, "text": "Runoff = 0.09 cfs @ 13.09 hrs, Volume= 1,818 cf, Depth= 0.28\"\nRouted to Pond 183P : WQ Infiltration Basin #1", "reading_order": 2 }, { "id": "p137.4", "order": 4, "type": "text", "bbox": { "l": 52.32, "t": 623.52, "r": 611.04, "b": 598.32 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious, Time Span= 0.00-72.00 hrs, dt= NOAA 24-hr D 10-Year Rainfall=5.38\"", "reading_order": 3 }, { "id": "p137.5", "order": 5, "type": "table", "bbox": { "l": 52.56, "t": 588.48, "r": 558.96, "b": 447.497874 }, "text": "", "attrs": { "block_label": "table", "n_rows": 7, "n_cols": 6, "integrity": { "cells_checked": 28, "cells_flagged": 0 } }, "children": [ { "id": "p137.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 86.520001, "t": 587.142469, "r": 127.590159, "b": 575.177889 }, "text": "Area (sf)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p137.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 144.389888, "t": 587.142469, "r": 159.742288, "b": 575.177889 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p137.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 286.601768, "t": 535.302451, "r": 340.102911, "b": 523.337871 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p137.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 95.280001, "t": 559.302451, "r": 127.805562, "b": 547.337871 }, "text": "76,971", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 3 }, { "id": "p137.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 148.003832, "t": 559.302451, "r": 159.753993, "b": 547.337871 }, "text": "39", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p137.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 174.16295, "t": 573.222448, "r": 333.31717, "b": 561.257868 }, "text": ">75% Grass cover, Good, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 5 }, { "id": "p137.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 95.280001, "t": 573.222448, "r": 127.805562, "b": 561.257868 }, "text": "76,971", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 6 }, { "id": "p137.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 148.003832, "t": 573.222448, "r": 159.753993, "b": 561.257868 }, "text": "39", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p137.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 174.16295, "t": 559.302451, "r": 286.000299, "b": 547.337871 }, "text": "100.00% Pervious Area", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 8 }, { "id": "p137.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 65.040001, "t": 535.302451, "r": 89.40872, "b": 511.337871 }, "text": "Tc (min)", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p137.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 100.248415, "t": 535.302451, "r": 132.666767, "b": 511.337871 }, "text": "Length (feet)", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p137.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 148.683866, "t": 535.302451, "r": 175.895438, "b": 511.337871 }, "text": "Slope (ft/ft)", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 }, { "id": "p137.5.13", "order": 18, "type": "table_cell", "bbox": { "l": 186.552062, "t": 535.302451, "r": 223.968178, "b": 511.337871 }, "text": "Velocity (ft/sec)", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 12 }, { "id": "p137.5.14", "order": 19, "type": "table_cell", "bbox": { "l": 234.581918, "t": 535.302451, "r": 275.988028, "b": 511.337871 }, "text": "Capacity (cfs)", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p137.5.15", "order": 20, "type": "table_cell", "bbox": { "l": 174.08692, "t": 587.142469, "r": 227.564819, "b": 575.177889 }, "text": "Description", "attrs": { "row": 3, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p137.5.16", "order": 21, "type": "table_cell", "bbox": { "l": 68.76, "t": 509.382452, "r": 89.492517, "b": 497.417872 }, "text": "12.5", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p137.5.17", "order": 22, "type": "table_cell", "bbox": { "l": 114.944052, "t": 509.382452, "r": 132.697945, "b": 497.417872 }, "text": "100", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p137.5.18", "order": 23, "type": "table_cell", "bbox": { "l": 143.354569, "t": 509.382452, "r": 175.880131, "b": 497.417872 }, "text": "0.0100", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p137.5.19", "order": 24, "type": "table_cell", "bbox": { "l": 203.154228, "t": 509.382452, "r": 223.886744, "b": 497.417872 }, "text": "0.13", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p137.5.20", "order": 25, "type": "table_cell", "bbox": { "l": 390.16, "t": 509.8971, "r": 474.56, "b": 490.2514 }, "text": "", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 19 }, { "id": "p137.5.21", "order": 26, "type": "table_cell", "bbox": { "l": 286.679993, "t": 509.26245, "r": 452.820335, "b": 485.417872 }, "text": "Sheet Flow, Grass: Short n= 0.150 P2= 3.42\"", "attrs": { "row": 4, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p137.5.22", "order": 27, "type": "table_cell", "bbox": { "l": 74.639998, "t": 485.382452, "r": 89.475992, "b": 473.417872 }, "text": "2.3", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p137.5.23", "order": 28, "type": "table_cell", "bbox": { "l": 120.82405, "t": 485.382452, "r": 132.68142, "b": 473.417872 }, "text": "96", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 22 }, { "id": "p137.5.24", "order": 29, "type": "table_cell", "bbox": { "l": 143.445254, "t": 485.382452, "r": 175.863606, "b": 473.417872 }, "text": "0.0100", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 23 }, { "id": "p137.5.25", "order": 30, "type": "table_cell", "bbox": { "l": 203.137703, "t": 485.382452, "r": 223.870219, "b": 473.417872 }, "text": "0.70", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 24 }, { "id": "p137.5.26", "order": 31, "type": "table_cell", "bbox": { "l": 390.16, "t": 490.2514, "r": 474.56, "b": 470.6057 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 25 }, { "id": "p137.5.27", "order": 32, "type": "table_cell", "bbox": { "l": 286.679993, "t": 485.26245, "r": 446.147004, "b": 461.417872 }, "text": "Shallow Concentrated Flow, Short Grass Pasture Kv= 7.0 fps", "attrs": { "row": 5, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 26 }, { "id": "p137.5.28", "order": 33, "type": "table_cell", "bbox": { "l": 68.76, "t": 459.462454, "r": 89.492517, "b": 447.497874 }, "text": "14.8", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 27 }, { "id": "p137.5.29", "order": 34, "type": "table_cell", "bbox": { "l": 114.944052, "t": 459.462454, "r": 132.697945, "b": 447.497874 }, "text": "196", "attrs": { "row": 6, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 28 }, { "id": "p137.5.30", "order": 35, "type": "table_cell", "bbox": { "l": 143.354569, "t": 459.462454, "r": 166.947862, "b": 447.497874 }, "text": "Total", "attrs": { "row": 6, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 29 }, { "id": "p137.5.31", "order": 36, "type": "table_cell", "bbox": { "l": 305.76, "t": 470.6057, "r": 390.16, "b": 450.96 }, "text": "", "attrs": { "row": 6, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 30 }, { "id": "p137.5.32", "order": 37, "type": "table_cell", "bbox": { "l": 390.16, "t": 470.6057, "r": 474.56, "b": 450.96 }, "text": "", "attrs": { "row": 6, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 31 }, { "id": "p137.5.33", "order": 38, "type": "table_cell", "bbox": { "l": 474.56, "t": 470.6057, "r": 558.96, "b": 450.96 }, "text": "", "attrs": { "row": 6, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 32 } ], "reading_order": 4 }, { "id": "p137.6", "order": 39, "type": "caption", "bbox": { "l": 193.2, "t": 435.12, "r": 417.84, "b": 420 }, "text": "Subcatchment 180S: DA P4 (Pervious)", "attrs": { "block_label": "figure_title" }, "reading_order": 5 }, { "id": "p137.7", "order": 40, "type": "figure", "bbox": { "l": 61.2, "t": 414, "r": 549.12, "b": 149.04 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n0.095 Runoff\n0.09 cfs\n0.09\n0.085 NOAA 24-hr D\n0.075 10-Year Rainfall=5.38\"\n0.08\nRunoff Area=76,971 sf\n0.07\n0.065\n0.06 Runoff Volume=1,818 cf\n(cfs) 0.05 Runoff Depth=0.28\"\n0.055\nFlow Flow Length=196'\n0.045\n0.04\n0.035 Slope=0.0100 '/'\n0.03\n0.025 Tc=14.8 min\nCN=39/0\n0.02\n0.015\n0.01\n0.005\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72\nTime (hours)" }, "reading_order": 6 }, { "id": "p137.8", "order": 41, "type": "text", "bbox": { "l": 270, "t": 155.76, "r": 317.52, "b": 146.88 }, "text": "Time (hours)", "attrs": { "block_label": "number" }, "reading_order": 7 } ] }, { "document_id": 16592, "page": 138, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 34, "counts_by_type": { "caption": 2, "figure": 1, "footer": 1, "header": 1, "table": 1, "table_cell": 24, "text": 3, "title": 1 }, "build_ms": 4, "items": [ { "id": "p138.1", "order": 1, "type": "header", "bbox": { "l": 53.52, "t": 738.48, "r": 560.16, "b": 698.64 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 10-Year Rainfall=5.38\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 25", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p138.2", "order": 2, "type": "title", "bbox": { "l": 148.32, "t": 687.6, "r": 463.92, "b": 672.24 }, "text": "Summary for Subcatchment 181S: DA P6 (Impervious)", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p138.3", "order": 3, "type": "text", "bbox": { "l": 53.52, "t": 660.48, "r": 463.2, "b": 634.8 }, "text": "Runoff = 0.67 cfs @ 12.10 hrs, Volume= 2,250 cf, Depth= 5.14\"\nRouted to Link 185L : POA", "reading_order": 2 }, { "id": "p138.4", "order": 4, "type": "text", "bbox": { "l": 51.84, "t": 623.76, "r": 611.52, "b": 598.56 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious, Time Span= 0.00-72.00 hrs, dt= NOAA 24-hr D 10-Year Rainfall=5.38\"", "reading_order": 3 }, { "id": "p138.5", "order": 5, "type": "table", "bbox": { "l": 52.56, "t": 588.48, "r": 559.2, "b": 447.497874 }, "text": "", "attrs": { "block_label": "table", "n_rows": 6, "n_cols": 5, "integrity": { "cells_checked": 22, "cells_flagged": 0 } }, "children": [ { "id": "p138.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 86.520001, "t": 587.142469, "r": 127.590159, "b": 575.177889 }, "text": "Area (sf)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p138.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 144.389888, "t": 587.142469, "r": 159.742288, "b": 575.177889 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p138.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 286.601768, "t": 535.302451, "r": 340.102911, "b": 523.337871 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p138.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 101.160004, "t": 559.302451, "r": 127.789043, "b": 547.337871 }, "text": "5,250", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 3 }, { "id": "p138.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 147.987313, "t": 559.302451, "r": 159.844683, "b": 547.337871 }, "text": "98", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p138.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 174.146431, "t": 573.222448, "r": 281.243319, "b": 561.257868 }, "text": "Paved parking, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 5 }, { "id": "p138.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 101.160004, "t": 573.222448, "r": 127.789043, "b": 561.257868 }, "text": "5,250", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p138.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 147.987313, "t": 573.222448, "r": 159.844683, "b": 561.257868 }, "text": "98", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p138.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 174.146431, "t": 559.302451, "r": 296.653009, "b": 547.337871 }, "text": "100.00% Impervious Area", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 8 }, { "id": "p138.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 65.040001, "t": 535.302451, "r": 89.475992, "b": 497.417872 }, "text": "Tc (min)\n0.8", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 9 }, { "id": "p138.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 100.248415, "t": 535.302451, "r": 132.68142, "b": 497.417872 }, "text": "Length (feet)\n100", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 10 }, { "id": "p138.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 143.445254, "t": 535.302451, "r": 175.895438, "b": 497.417872 }, "text": "Slope (ft/ft)\n0.0500", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 11 }, { "id": "p138.5.13", "order": 18, "type": "table_cell", "bbox": { "l": 186.552062, "t": 535.302451, "r": 223.968178, "b": 497.417872 }, "text": "Velocity (ft/sec)\n2.05", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 12 }, { "id": "p138.5.14", "order": 19, "type": "table_cell", "bbox": { "l": 234.581918, "t": 535.302451, "r": 473.002733, "b": 485.417872 }, "text": "Capacity (cfs)\nSheet Flow, Smooth surfaces n= 0.011 P2= 3.42\"", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 13 }, { "id": "p138.5.15", "order": 20, "type": "table_cell", "bbox": { "l": 74.639998, "t": 485.382452, "r": 89.475992, "b": 473.417872 }, "text": "0.6", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p138.5.16", "order": 21, "type": "table_cell", "bbox": { "l": 120.82405, "t": 485.382452, "r": 132.68142, "b": 473.417872 }, "text": "50", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p138.5.17", "order": 22, "type": "table_cell", "bbox": { "l": 143.445254, "t": 485.382452, "r": 175.863606, "b": 473.417872 }, "text": "0.0050", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p138.5.18", "order": 23, "type": "table_cell", "bbox": { "l": 203.137703, "t": 485.382452, "r": 223.870219, "b": 473.417872 }, "text": "1.44", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p138.5.19", "order": 24, "type": "table_cell", "bbox": { "l": 286.679993, "t": 485.26245, "r": 425.623588, "b": 461.417872 }, "text": "Shallow Concentrated Flow, Paved Kv= 20.3 fps", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p138.5.20", "order": 25, "type": "table_cell", "bbox": { "l": 74.639998, "t": 459.462454, "r": 89.475992, "b": 447.497874 }, "text": "1.4", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p138.5.21", "order": 26, "type": "table_cell", "bbox": { "l": 114.927527, "t": 459.462454, "r": 132.68142, "b": 447.497874 }, "text": "150", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p138.5.22", "order": 27, "type": "table_cell", "bbox": { "l": 143.445254, "t": 459.462454, "r": 167.029543, "b": 447.497874 }, "text": "Total", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p138.5.23", "order": 28, "type": "table_cell", "bbox": { "l": 356.544, "t": 471.2229, "r": 457.872, "b": 451.68 }, "text": "", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 22 }, { "id": "p138.5.24", "order": 29, "type": "table_cell", "bbox": { "l": 457.872, "t": 471.2229, "r": 559.2, "b": 451.68 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 23 } ], "reading_order": 4 }, { "id": "p138.6", "order": 30, "type": "caption", "bbox": { "l": 186.72, "t": 435.12, "r": 424.56, "b": 419.76 }, "text": "Subcatchment 181S: DA P6 (Impervious)", "attrs": { "block_label": "figure_title" }, "reading_order": 5 }, { "id": "p138.7", "order": 31, "type": "caption", "bbox": { "l": 254.64, "t": 414.48, "r": 306, "b": 403.92 }, "text": "Hydrograph", "attrs": { "block_label": "figure_title" }, "reading_order": 6 }, { "id": "p138.8", "order": 32, "type": "figure", "bbox": { "l": 63.36, "t": 412.8, "r": 497.28, "b": 149.04 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n0.75\n0.7 0.67 cfs\n0.65 NOAA 24-hr D\n10-Year Rainfall=5.38\"\n0.6\nRunoff Area=5,250 sf\n0.55\n0.5\n0.45 Runoff Volume=2,250 cf\n(cfs) 0.4 Runoff Depth=5.14\"\nFlow Flow Length=150'\n0.35\n0.3\nTc=1.4 min\n0.25\n0.2 CN=0/98\n0.15\n0.1\n0.05\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72\nTime (hours)" }, "reading_order": 7 }, { "id": "p138.9", "order": 33, "type": "text", "bbox": { "l": 267.6, "t": 155.76, "r": 315.36, "b": 147.12 }, "text": "Time (hours)", "attrs": { "block_label": "number" }, "reading_order": 8 }, { "id": "p138.10", "order": 34, "type": "footer", "bbox": { "l": 511.44, "t": 392.64, "r": 546.24, "b": 381.6 }, "text": "", "attrs": { "block_label": "footer_image" }, "reading_order": 9 } ] }, { "document_id": 16592, "page": 139, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 54, "counts_by_type": { "footnote": 2, "header": 1, "heading": 1, "table": 3, "table_cell": 47 }, "build_ms": 13, "items": [ { "id": "p139.1", "order": 1, "type": "header", "bbox": { "l": 53.52, "t": 738.72, "r": 560.88, "b": 698.4 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 10-Year Rainfall=5.38\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 26", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p139.2", "order": 2, "type": "heading", "bbox": { "l": 162.24, "t": 687.84, "r": 449.04, "b": 672.72 }, "text": "Summary for Pond 183P: WQ Infiltration Basin #1", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p139.3", "order": 3, "type": "table", "bbox": { "l": 52.56, "t": 666.72, "r": 518.16, "b": 479.177889 }, "text": "", "attrs": { "block_label": "table", "n_rows": 7, "n_cols": 5, "integrity": { "cells_checked": 27, "cells_flagged": 2, "flags": [ { "row": 0, "col": 2, "coverage": 0.5, "text": "29.12% Impervious," }, { "row": 0, "col": 3, "coverage": 0.5, "text": "Inflow Depth =" } ] } }, "children": [ { "id": "p139.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 54, "t": 659.142458, "r": 107.356451, "b": 647.177878 }, "text": "Inflow Area =", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p139.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 151.868035, "t": 659.142458, "r": 204.64367, "b": 647.177878 }, "text": "108,596 sf,", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p139.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 238.8, "t": 666.72, "r": 331.92, "b": 646.26 }, "text": "29.12% Impervious,", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p139.3.4", "order": 7, "type": "table_cell", "bbox": { "l": 331.92, "t": 666.72, "r": 425.04, "b": 646.26 }, "text": "Inflow Depth =", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "column_header": true, "header_source": "heuristic" }, "reading_order": 3 }, { "id": "p139.3.5", "order": 8, "type": "table_cell", "bbox": { "l": 387.866087, "t": 659.142458, "r": 509.621823, "b": 647.177878 }, "text": "1.70\" for 10-Year event", "attrs": { "row": 0, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 4 }, { "id": "p139.3.6", "order": 9, "type": "table_cell", "bbox": { "l": 54, "t": 647.142458, "r": 82.003121, "b": 635.177878 }, "text": "Inflow =", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p139.3.7", "order": 10, "type": "table_cell", "bbox": { "l": 146.30738, "t": 647.142458, "r": 183.784219, "b": 635.177878 }, "text": "3.70 cfs @", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p139.3.8", "order": 11, "type": "table_cell", "bbox": { "l": 206.48939, "t": 647.142458, "r": 253.797341, "b": 635.177878 }, "text": "12.11 hrs,", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p139.3.9", "order": 12, "type": "table_cell", "bbox": { "l": 259.89396, "t": 647.142458, "r": 302.091703, "b": 635.177878 }, "text": "Volume=", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p139.3.10", "order": 13, "type": "table_cell", "bbox": { "l": 343.335198, "t": 647.142458, "r": 387.105235, "b": 635.177878 }, "text": "15,371 cf", "attrs": { "row": 1, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p139.3.11", "order": 14, "type": "table_cell", "bbox": { "l": 54, "t": 635.142458, "r": 90.34222, "b": 623.177878 }, "text": "Outflow =", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p139.3.12", "order": 15, "type": "table_cell", "bbox": { "l": 146.255659, "t": 611.142458, "r": 183.732499, "b": 599.177878 }, "text": "4.03 cfs @", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 }, { "id": "p139.3.13", "order": 16, "type": "table_cell", "bbox": { "l": 206.43767, "t": 611.142458, "r": 253.777868, "b": 599.177878 }, "text": "12.13 hrs,", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 12 }, { "id": "p139.3.14", "order": 17, "type": "table_cell", "bbox": { "l": 259.865483, "t": 623.142458, "r": 302.030979, "b": 611.177878 }, "text": "Volume=", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p139.3.15", "order": 18, "type": "table_cell", "bbox": { "l": 343.386918, "t": 635.142458, "r": 516.478373, "b": 623.177878 }, "text": "11,568 cf, Atten= 0%, Lag= 1.1 min", "attrs": { "row": 2, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p139.3.16", "order": 19, "type": "table_cell", "bbox": { "l": 54, "t": 623.142458, "r": 102.065704, "b": 611.177878 }, "text": "Discarded =", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p139.3.17", "order": 20, "type": "table_cell", "bbox": { "l": 146.278902, "t": 623.142458, "r": 183.755742, "b": 611.177878 }, "text": "0.00 cfs @", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p139.3.18", "order": 21, "type": "table_cell", "bbox": { "l": 212.357435, "t": 623.142458, "r": 253.768864, "b": 611.177878 }, "text": "0.00 hrs,", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p139.3.19", "order": 22, "type": "table_cell", "bbox": { "l": 259.874487, "t": 611.142458, "r": 302.07223, "b": 599.177878 }, "text": "Volume=", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p139.3.20", "order": 23, "type": "table_cell", "bbox": { "l": 369.86243, "t": 623.142458, "r": 387.067754, "b": 611.177878 }, "text": "0 cf", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p139.3.21", "order": 24, "type": "table_cell", "bbox": { "l": 54, "t": 611.142458, "r": 195.539615, "b": 587.177889 }, "text": "Primary =\nRouted to Link 185L : POA", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 20 }, { "id": "p139.3.22", "order": 25, "type": "table_cell", "bbox": { "l": 146.284137, "t": 635.142458, "r": 183.760976, "b": 623.177878 }, "text": "4.03 cfs @", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p139.3.23", "order": 26, "type": "table_cell", "bbox": { "l": 206.466148, "t": 635.142458, "r": 253.806345, "b": 623.177878 }, "text": "12.13 hrs,", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 22 }, { "id": "p139.3.24", "order": 27, "type": "table_cell", "bbox": { "l": 54, "t": 491.142469, "r": 90.142207, "b": 479.177889 }, "text": "Volume=", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 23 }, { "id": "p139.3.25", "order": 28, "type": "table_cell", "bbox": { "l": 343.315724, "t": 611.142458, "r": 387.085761, "b": 599.177878 }, "text": "11,568 cf", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 24 }, { "id": "p139.3.26", "order": 29, "type": "table_cell", "bbox": { "l": 54, "t": 575.142469, "r": 511.516876, "b": 539.177889 }, "text": "Routing by Stor-Ind method, Time Span= 0.00-72.00 hrs, dt= 0.01 hrs\\nStarting Elev= 97.00' Surf.Area= 6,008 sf Storage= 10,212 cf\\nPeak Elev= 98.69' @ 12.13 hrs Surf.Area= 6,981 sf Storage= 16,706 cf (6,495 cf above start)", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 5, "bbox_refit": true }, "reading_order": 25 }, { "id": "p139.3.27", "order": 30, "type": "table_cell", "bbox": { "l": 54, "t": 527.142469, "r": 410.964835, "b": 503.177889 }, "text": "Plug-Flow detention time= 1,319.2 min calculated for 1,356 cf (9% of inflow)\\nCenter-of-Mass det. time= 197.3 min ( 977.5 - 780.2 )", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 5, "bbox_refit": true }, "reading_order": 26 } ], "reading_order": 2 }, { "id": "p139.4", "order": 31, "type": "table", "bbox": { "l": 52.32, "t": 492.96, "r": 557.04, "b": 376.32 }, "text": "", "attrs": { "block_label": "table", "n_rows": 2, "n_cols": 5, "integrity": { "cells_checked": 8, "cells_flagged": 0 } }, "children": [ { "id": "p139.4.1", "order": 32, "type": "table_cell", "bbox": { "l": 54, "t": 491.142469, "r": 90.142207, "b": 465.257868 }, "text": "Volume\n#1", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p139.4.2", "order": 33, "type": "table_cell", "bbox": { "l": 120.355217, "t": 491.142469, "r": 148.95691, "b": 465.257868 }, "text": "Invert\n95.00'", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p139.4.3", "order": 34, "type": "table_cell", "bbox": { "l": 170.997811, "t": 491.142469, "r": 234.422951, "b": 465.257868 }, "text": "Avail.Storage\n16,706 cf", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p139.4.4", "order": 35, "type": "table_cell", "bbox": { "l": 246.044461, "t": 491.142469, "r": 502.944852, "b": 465.137889 }, "text": "Storage Description\nCustom Stage Data (Prismatic) Listed below (Recalc)", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p139.4.5", "order": 36, "type": "table_cell", "bbox": { "l": 57.360002, "t": 453.222448, "r": 101.273013, "b": 379.337871 }, "text": "Elevation\\n(feet)\n95.00\n96.00\n97.00\n98.00", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p139.4.6", "order": 37, "type": "table_cell", "bbox": { "l": 140.447365, "t": 453.222448, "r": 185.72688, "b": 379.337871 }, "text": "Surf.Area\\n(sq-ft)\n4,231\n5,092\n6,008\n6,981", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p139.4.7", "order": 38, "type": "table_cell", "bbox": { "l": 227.371027, "t": 453.222448, "r": 354.642567, "b": 379.337871 }, "text": "Inc.Store\\n(cubic-feet)\n0\n4,662\n5,550\n6,495", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p139.4.8", "order": 39, "type": "table_cell", "bbox": { "l": 216.402998, "t": 453.222448, "r": 354.689052, "b": 379.337871 }, "text": "Cum.Store\\n(cubic-feet)\n0\n4,662\n10,212\n16,706", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 7 } ], "reading_order": 3 }, { "id": "p139.5", "order": 40, "type": "table", "bbox": { "l": 52.08, "t": 367.92, "r": 556.08, "b": 278.64 }, "text": "", "attrs": { "block_label": "table", "n_rows": 3, "n_cols": 4, "integrity": { "cells_checked": 12, "cells_flagged": 0 } }, "children": [ { "id": "p139.5.1", "order": 41, "type": "table_cell", "bbox": { "l": 54, "t": 367.302451, "r": 86.679256, "b": 355.337871 }, "text": "Device", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p139.5.2", "order": 42, "type": "table_cell", "bbox": { "l": 98.407976, "t": 367.302451, "r": 135.030741, "b": 355.337871 }, "text": "Routing", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p139.5.3", "order": 43, "type": "table_cell", "bbox": { "l": 182.045624, "t": 367.302451, "r": 208.824841, "b": 355.337871 }, "text": "Invert", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p139.5.4", "order": 44, "type": "table_cell", "bbox": { "l": 220.650048, "t": 367.302451, "r": 290.014595, "b": 355.337871 }, "text": "Outlet Devices", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 3 }, { "id": "p139.5.5", "order": 45, "type": "table_cell", "bbox": { "l": 70.320002, "t": 353.382452, "r": 82.177372, "b": 341.417872 }, "text": "#1", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p139.5.6", "order": 46, "type": "table_cell", "bbox": { "l": 98.408891, "t": 353.382452, "r": 135.204992, "b": 341.417872 }, "text": "Primary", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p139.5.7", "order": 47, "type": "table_cell", "bbox": { "l": 354.69794, "t": 329.382452, "r": 383.299634, "b": 317.417872 }, "text": "97.60'", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p139.5.8", "order": 48, "type": "table_cell", "bbox": { "l": 220.679993, "t": 353.262472, "r": 512.979659, "b": 305.417872 }, "text": "15.0\" Round Culvert to Subsurface Basin\\nL= 35.0' RCP, square edge headwall, Ke= 0.500\\nInlet / Outlet Invert= 95.00' / 97.60' S= -0.0743'' Cc= 0.900\\nn= 0.012 Corrugated PP, smooth interior, Flow Area= 1.23 sf", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p139.5.9", "order": 49, "type": "table_cell", "bbox": { "l": 70.320002, "t": 305.382452, "r": 82.177372, "b": 281.417872 }, "text": "#2\n#3", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 8 }, { "id": "p139.5.10", "order": 50, "type": "table_cell", "bbox": { "l": 98.408891, "t": 305.382452, "r": 146.474595, "b": 281.417872 }, "text": "Device 1\nDiscarded", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 9 }, { "id": "p139.5.11", "order": 51, "type": "table_cell", "bbox": { "l": 180.288471, "t": 305.382452, "r": 208.918642, "b": 281.417872 }, "text": "97.00'\n95.00'", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 10 }, { "id": "p139.5.12", "order": 52, "type": "table_cell", "bbox": { "l": 220.679993, "t": 305.382452, "r": 531.965762, "b": 281.297892 }, "text": "4.0' long Sharp-Crested Rectangular Weir 2 End Contraction(s)\n3.100 in/hr Exfiltration X 0.00 over Surface area", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 11 } ], "reading_order": 4 }, { "id": "p139.6", "order": 53, "type": "footnote", "bbox": { "l": 51.36, "t": 270, "r": 423.6, "b": 244.32 }, "text": "Discarded OutFlow Max=0.00 cfs @ 0.00 hrs HW=97.00' (Free Discharge)\n3=Exfiltration (Controls 0.00 cfs)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 5 }, { "id": "p139.7", "order": 54, "type": "footnote", "bbox": { "l": 51.6, "t": 233.52, "r": 470.4, "b": 195.36 }, "text": "Primary OutFlow Max=3.92 cfs @ 12.13 hrs HW=98.67' (Free Discharge)\n1=Culvert to Subsurface Basin (Inlet Controls 3.92 cfs @ 3.52 fps)\n2=Sharp-Crested Rectangular Weir (Passes 3.92 cfs of 23.50 cfs potential flow)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 6 } ] }, { "document_id": 16592, "page": 140, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 7, "counts_by_type": { "caption": 1, "figure": 1, "footnote": 1, "header": 3, "text": 1 }, "build_ms": 0, "items": [ { "id": "p140.1", "order": 1, "type": "header", "bbox": { "l": 361.2, "t": 738.96, "r": 560.64, "b": 710.64 }, "text": "NOAA 24-hr D 10-Year Rainfall=5.38\"\nPrinted 04/12/2025", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p140.2", "order": 2, "type": "header", "bbox": { "l": 52.8, "t": 738, "r": 395.52, "b": 699.6 }, "text": "102 Sams -REV 12-02-25 NOAA\nPrepared by Haler Consulting\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p140.3", "order": 3, "type": "header", "bbox": { "l": 517.2, "t": 711.36, "r": 559.2, "b": 699.36 }, "text": "Page 27", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 2 }, { "id": "p140.4", "order": 4, "type": "caption", "bbox": { "l": 200.88, "t": 687.84, "r": 409.44, "b": 672.96 }, "text": "Pond 183P: WQ Infiltration Basin #1", "attrs": { "block_label": "figure_title" }, "reading_order": 3 }, { "id": "p140.5", "order": 5, "type": "figure", "bbox": { "l": 65.52, "t": 667.2, "r": 486.96, "b": 409.44 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n3.70 cfs Inflow Area=108,596 sf\n4.03 cfs\nPeak Elev=98.69'\n4.03 cfs\n4\nStorage=16,706 cf\n3\n(cfs)\nFlow 2\n1\n0.00 cfs\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72" }, "reading_order": 4 }, { "id": "p140.6", "order": 6, "type": "text", "bbox": { "l": 497.04, "t": 644.88, "r": 546.96, "b": 610.32 }, "text": "Inflow Outflow Discarded Primary", "attrs": { "block_label": "aside_text" }, "reading_order": 5 }, { "id": "p140.7", "order": 7, "type": "footnote", "bbox": { "l": 84.24, "t": 420.24, "r": 449.52, "b": 400.8 }, "text": "0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72 Time (hours)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 6 } ] }, { "document_id": 16592, "page": 141, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 11, "counts_by_type": { "caption": 1, "header": 1, "table": 1, "table_cell": 8 }, "build_ms": 25, "items": [ { "id": "p141.1", "order": 1, "type": "header", "bbox": { "l": 53.04, "t": 738.48, "r": 560.4, "b": 698.64 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 10-Year Rainfall=5.38\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 28", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p141.2", "order": 2, "type": "caption", "bbox": { "l": 153.6, "t": 687.84, "r": 457.44, "b": 672.96 }, "text": "Stage-Discharge for Pond 183P: WQ Infiltration Basin #1", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p141.3", "order": 3, "type": "table", "bbox": { "l": 55.2, "t": 662.4, "r": 507.36, "b": 58.56 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 8, "integrity": { "cells_checked": 8, "cells_flagged": 0 } }, "children": [ { "id": "p141.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 57.479999, "t": 661.126246, "r": 98.137287, "b": 64.158859 }, "text": "Elevation (feet)\n95.00\n95.05\n95.10\n95.15\n95.20\n95.25\n95.30\n95.35\n95.40\n95.45\n95.50\n95.55\n95.60\n95.65\n95.70\n95.75\n95.80\n95.85\n95.90\n95.95\n96.00\n96.05\n96.10\n96.15\n96.20\n96.25\n96.30\n96.35\n96.40\n96.45\n96.50\n96.55\n96.60\n96.65\n96.70\n96.75\n96.80\n96.85\n96.90\n96.95\n97.00\n97.05\n97.10\n97.15\n97.20\n97.25\n97.30\n97.35\n97.40\n97.45\n97.50\n97.55", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p141.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 109.680004, "t": 661.126246, "r": 154.533694, "b": 64.158859 }, "text": "Discharge (cfs)\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p141.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 166.080002, "t": 661.126246, "r": 211.180733, "b": 64.158859 }, "text": "Discarded (cfs)\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p141.3.4", "order": 7, "type": "table_cell", "bbox": { "l": 233.160004, "t": 661.126246, "r": 267.536512, "b": 64.158859 }, "text": "Primary (cfs)\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p141.3.5", "order": 8, "type": "table_cell", "bbox": { "l": 291, "t": 661.126246, "r": 331.657282, "b": 351.198838 }, "text": "Elevation (feet)\n97.60\n97.65\n97.70\n97.75\n97.80\n97.85\n97.90\n97.95\n98.00\n98.05\n98.10\n98.15\n98.20\n98.25\n98.30\n98.35\n98.40\n98.45\n98.50\n98.55\n98.60\n98.65\n98.70\n98.75\n98.80\n98.85", "attrs": { "row": 0, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p141.3.6", "order": 9, "type": "table_cell", "bbox": { "l": 343.200005, "t": 661.126246, "r": 388.300713, "b": 351.198838 }, "text": "Discharge (cfs)\n0.00\n0.01\n0.05\n0.11\n0.19\n0.30\n0.42\n0.57\n0.73\n0.91\n1.10\n1.31\n1.54\n1.77\n2.01\n2.27\n2.53\n2.79\n3.06\n3.32\n3.58\n3.84\n4.08\n4.31\n4.52\n4.67", "attrs": { "row": 0, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p141.3.7", "order": 10, "type": "table_cell", "bbox": { "l": 399.599991, "t": 661.126246, "r": 444.395578, "b": 351.198838 }, "text": "Discarded (cfs)\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00", "attrs": { "row": 0, "col": 6, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p141.3.8", "order": 11, "type": "table_cell", "bbox": { "l": 466.679993, "t": 661.126246, "r": 501.100731, "b": 351.198838 }, "text": "Primary (cfs)\n0.00\n0.01\n0.05\n0.11\n0.19\n0.30\n0.42\n0.57\n0.73\n0.91\n1.10\n1.31\n1.54\n1.77\n2.01\n2.27\n2.53\n2.79\n3.06\n3.32\n3.58\n3.84\n4.08\n4.31\n4.52\n4.67", "attrs": { "row": 0, "col": 7, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 7 } ], "reading_order": 2 } ] }, { "document_id": 16592, "page": 142, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 11, "counts_by_type": { "caption": 1, "header": 2, "table": 1, "table_cell": 6, "text": 1 }, "build_ms": 11, "items": [ { "id": "p142.1", "order": 1, "type": "header", "bbox": { "l": 361.2, "t": 739.2, "r": 561.6, "b": 713.04 }, "text": "NOAA 24-hr D 10-Year Rainfall=5.38\"\nPrinted 04/12/2025", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p142.2", "order": 2, "type": "header", "bbox": { "l": 51.84, "t": 738.24, "r": 396, "b": 698.88 }, "text": "102 Sams -REV 12-02-25\nPrepared by Haler Consulting\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p142.3", "order": 3, "type": "text", "bbox": { "l": 516.72, "t": 711.12, "r": 559.2, "b": 699.12 }, "text": "Page 29", "attrs": { "block_label": "number" }, "reading_order": 2 }, { "id": "p142.4", "order": 4, "type": "caption", "bbox": { "l": 144.96, "t": 687.84, "r": 465.36, "b": 672.96 }, "text": "Stage-Area-Storage for Pond 183P: WQ Infiltration Basin #1", "attrs": { "block_label": "figure_title" }, "reading_order": 3 }, { "id": "p142.5", "order": 5, "type": "table", "bbox": { "l": 55.44, "t": 661.126246, "r": 466.56, "b": 54.24 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 6, "integrity": { "cells_checked": 6, "cells_flagged": 0 } }, "children": [ { "id": "p142.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 57.479999, "t": 661.126246, "r": 98.137287, "b": 64.158859 }, "text": "Elevation (feet)\n95.00\n95.05\n95.10\n95.15\n95.20\n95.25\n95.30\n95.35\n95.40\n95.45\n95.50\n95.55\n95.60\n95.65\n95.70\n95.75\n95.80\n95.85\n95.90\n95.95\n96.00\n96.05\n96.10\n96.15\n96.20\n96.25\n96.30\n96.35\n96.40\n96.45\n96.50\n96.55\n96.60\n96.65\n96.70\n96.75\n96.80\n96.85\n96.90\n96.95\n97.00\n97.05\n97.10\n97.15\n97.20\n97.25\n97.30\n97.35\n97.40\n97.45\n97.50\n97.55", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p142.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 139.439999, "t": 661.126246, "r": 173.816353, "b": 64.158859 }, "text": "Surface (sq-ft)\n4,231\n4,274\n4,317\n4,360\n4,403\n4,446\n4,489\n4,532\n4,575\n4,618\n4,662\n4,705\n4,748\n4,791\n4,834\n4,877\n4,920\n4,963\n5,006\n5,049\n5,092\n5,138\n5,184\n5,229\n5,275\n5,321\n5,367\n5,413\n5,458\n5,504\n5,550\n5,596\n5,642\n5,687\n5,733\n5,779\n5,825\n5,871\n5,916\n5,962\n6,008\n6,057\n6,105\n6,154\n6,203\n6,251\n6,300\n6,349\n6,397\n6,446\n6,495\n6,543", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p142.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 199.55999, "t": 661.126246, "r": 249.524304, "b": 64.158859 }, "text": "Storage (cubic-feet)\n0\n213\n427\n644\n863\n1,085\n1,308\n1,534\n1,761\n1,991\n2,223\n2,457\n2,694\n2,932\n3,173\n3,415\n3,660\n3,907\n4,157\n4,408\n4,662\n4,917\n5,175\n5,436\n5,698\n5,963\n6,230\n6,500\n6,772\n7,046\n7,322\n7,601\n7,882\n8,165\n8,450\n8,738\n9,028\n9,321\n9,615\n9,912\n10,212\n10,513\n10,817\n11,124\n11,433\n11,744\n12,058\n12,374\n12,693\n13,014\n13,337\n13,663", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p142.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 273.240005, "t": 661.126246, "r": 313.897287, "b": 351.198838 }, "text": "Elevation (feet)\n97.60\n97.65\n97.70\n97.75\n97.80\n97.85\n97.90\n97.95\n98.00\n98.05\n98.10\n98.15\n98.20\n98.25\n98.30\n98.35\n98.40\n98.45\n98.50\n98.55\n98.60\n98.65\n98.70\n98.75\n98.80\n98.85", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p142.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 355.200005, "t": 661.126246, "r": 389.808242, "b": 351.198838 }, "text": "Surface (sq-ft)\n6,592\n6,640\n6,689\n6,738\n6,786\n6,835\n6,884\n6,932\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981", "attrs": { "row": 0, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p142.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 415.320008, "t": 661.126246, "r": 465.558002, "b": 351.198838 }, "text": "Storage (cubic-feet)\n13,991\n14,322\n14,655\n14,991\n15,329\n15,670\n16,013\n16,358\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706", "attrs": { "row": 0, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 } ], "reading_order": 4 } ] }, { "document_id": 16592, "page": 143, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 49, "counts_by_type": { "footnote": 4, "header": 1, "heading": 1, "table": 3, "table_cell": 40 }, "build_ms": 10, "items": [ { "id": "p143.1", "order": 1, "type": "header", "bbox": { "l": 53.52, "t": 738.72, "r": 561.12, "b": 698.4 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 10-Year Rainfall=5.38\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 30", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p143.2", "order": 2, "type": "heading", "bbox": { "l": 162, "t": 687.84, "r": 450, "b": 672.72 }, "text": "Summary for Pond 184P: WQ Infiltration Basin #2", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p143.3", "order": 3, "type": "table", "bbox": { "l": 52.8, "t": 661.92, "r": 530.64, "b": 587.177889 }, "text": "", "attrs": { "block_label": "table", "n_rows": 4, "n_cols": 5, "integrity": { "cells_checked": 20, "cells_flagged": 3, "flags": [ { "row": 0, "col": 2, "coverage": 0.5, "text": "27.15% Impervious," }, { "row": 0, "col": 3, "coverage": 0.5, "text": "Inflow Depth =" }, { "row": 3, "col": 3, "coverage": 0, "text": "Volume=" } ] } }, "children": [ { "id": "p143.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 54, "t": 659.142458, "r": 107.356451, "b": 647.177878 }, "text": "Inflow Area =", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p143.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 157.764557, "t": 659.142458, "r": 204.64367, "b": 647.177878 }, "text": "86,443 sf,", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p143.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 243.936, "t": 661.92, "r": 339.504, "b": 649.72 }, "text": "27.15% Impervious,", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p143.3.4", "order": 7, "type": "table_cell", "bbox": { "l": 339.504, "t": 661.92, "r": 435.072, "b": 649.72 }, "text": "Inflow Depth =", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "column_header": true, "header_source": "heuristic" }, "reading_order": 3 }, { "id": "p143.3.5", "order": 8, "type": "table_cell", "bbox": { "l": 387.866087, "t": 659.142458, "r": 509.621823, "b": 647.177878 }, "text": "1.60\" for 10-Year event", "attrs": { "row": 0, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 4 }, { "id": "p143.3.6", "order": 9, "type": "table_cell", "bbox": { "l": 54, "t": 647.142458, "r": 82.003121, "b": 635.177878 }, "text": "Inflow =", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p143.3.7", "order": 10, "type": "table_cell", "bbox": { "l": 146.30738, "t": 647.142458, "r": 183.784219, "b": 635.177878 }, "text": "2.42 cfs @", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p143.3.8", "order": 11, "type": "table_cell", "bbox": { "l": 206.48939, "t": 647.142458, "r": 253.797341, "b": 635.177878 }, "text": "12.13 hrs,", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p143.3.9", "order": 12, "type": "table_cell", "bbox": { "l": 259.89396, "t": 647.142458, "r": 302.091703, "b": 635.177878 }, "text": "Volume=", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p143.3.10", "order": 13, "type": "table_cell", "bbox": { "l": 343.335198, "t": 647.142458, "r": 387.105235, "b": 635.177878 }, "text": "11,545 cf", "attrs": { "row": 1, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p143.3.11", "order": 14, "type": "table_cell", "bbox": { "l": 54, "t": 635.142458, "r": 102.065704, "b": 611.177878 }, "text": "Outflow =\nDiscarded =", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 10 }, { "id": "p143.3.12", "order": 15, "type": "table_cell", "bbox": { "l": 146.278902, "t": 635.142458, "r": 183.760976, "b": 611.177878 }, "text": "0.47 cfs @\n0.00 cfs @", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 11 }, { "id": "p143.3.13", "order": 16, "type": "table_cell", "bbox": { "l": 206.466148, "t": 635.142458, "r": 253.806345, "b": 611.177878 }, "text": "12.71 hrs,\n0.00 hrs,", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 12 }, { "id": "p143.3.14", "order": 17, "type": "table_cell", "bbox": { "l": 259.865483, "t": 623.142458, "r": 302.07223, "b": 599.177878 }, "text": "Volume=\nVolume=", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 13 }, { "id": "p143.3.15", "order": 18, "type": "table_cell", "bbox": { "l": 349.176231, "t": 635.142458, "r": 528.248175, "b": 611.177878 }, "text": "7,983 cf, Atten= 81%, Lag= 34.7 min\n0 cf", "attrs": { "row": 2, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 14 }, { "id": "p143.3.16", "order": 19, "type": "table_cell", "bbox": { "l": 54, "t": 611.142458, "r": 195.539615, "b": 587.177889 }, "text": "Primary =\nRouted to Link 185L : POA", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 15 }, { "id": "p143.3.17", "order": 20, "type": "table_cell", "bbox": { "l": 146.255659, "t": 611.142458, "r": 183.732499, "b": 599.177878 }, "text": "0.47 cfs @", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p143.3.18", "order": 21, "type": "table_cell", "bbox": { "l": 206.43767, "t": 611.142458, "r": 253.777868, "b": 599.177878 }, "text": "12.71 hrs,", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p143.3.19", "order": 22, "type": "table_cell", "bbox": { "l": 339.504, "t": 613.12, "r": 435.072, "b": 600.92 }, "text": "Volume=", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 18 }, { "id": "p143.3.20", "order": 23, "type": "table_cell", "bbox": { "l": 349.212247, "t": 611.142458, "r": 387.085761, "b": 599.177878 }, "text": "7,983 cf", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 } ], "reading_order": 2 }, { "id": "p143.4", "order": 24, "type": "table", "bbox": { "l": 52.32, "t": 492.48, "r": 557.04, "b": 365.28 }, "text": "", "attrs": { "block_label": "table", "n_rows": 2, "n_cols": 5, "integrity": { "cells_checked": 8, "cells_flagged": 0 } }, "children": [ { "id": "p143.4.1", "order": 25, "type": "table_cell", "bbox": { "l": 54, "t": 491.142469, "r": 90.142207, "b": 465.257868 }, "text": "Volume\n#1", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p143.4.2", "order": 26, "type": "table_cell", "bbox": { "l": 120.355217, "t": 491.142469, "r": 148.95691, "b": 465.257868 }, "text": "Invert\n91.00'", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p143.4.3", "order": 27, "type": "table_cell", "bbox": { "l": 170.997811, "t": 491.142469, "r": 234.422951, "b": 465.257868 }, "text": "Avail.Storage\n13,818 cf", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p143.4.4", "order": 28, "type": "table_cell", "bbox": { "l": 246.044461, "t": 491.142469, "r": 502.944852, "b": 465.137889 }, "text": "Storage Description\nCustom Stage Data (Prismatic) Listed below (Recalc)", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p143.4.5", "order": 29, "type": "table_cell", "bbox": { "l": 57.360002, "t": 453.222448, "r": 101.273013, "b": 367.337871 }, "text": "Elevation\\n(feet)\n91.00\n92.00\n93.00\n94.00\n94.50", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p143.4.6", "order": 30, "type": "table_cell", "bbox": { "l": 140.447365, "t": 453.222448, "r": 185.72688, "b": 367.337871 }, "text": "Surf.Area\\n(sq-ft)\n2,628\n3,320\n4,067\n5,010\n5,438", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p143.4.7", "order": 31, "type": "table_cell", "bbox": { "l": 227.371027, "t": 453.222448, "r": 354.642567, "b": 367.337871 }, "text": "Inc.Store\\n(cubic-feet)\n0\n2,974\n3,694\n4,539\n2,612", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p143.4.8", "order": 32, "type": "table_cell", "bbox": { "l": 216.402998, "t": 453.222448, "r": 354.689052, "b": 367.337871 }, "text": "Cum.Store\\n(cubic-feet)\n0\n2,974\n6,668\n11,206\n13,818", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 7 } ], "reading_order": 3 }, { "id": "p143.5", "order": 33, "type": "table", "bbox": { "l": 51.6, "t": 355.302451, "r": 555.12, "b": 266.88 }, "text": "", "attrs": { "block_label": "table", "n_rows": 3, "n_cols": 4, "integrity": { "cells_checked": 12, "cells_flagged": 0 } }, "children": [ { "id": "p143.5.1", "order": 34, "type": "table_cell", "bbox": { "l": 54, "t": 355.302451, "r": 86.679256, "b": 343.337871 }, "text": "Device", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p143.5.2", "order": 35, "type": "table_cell", "bbox": { "l": 98.407976, "t": 355.302451, "r": 135.030741, "b": 343.337871 }, "text": "Routing", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p143.5.3", "order": 36, "type": "table_cell", "bbox": { "l": 182.045624, "t": 355.302451, "r": 208.824841, "b": 343.337871 }, "text": "Invert", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p143.5.4", "order": 37, "type": "table_cell", "bbox": { "l": 220.650048, "t": 355.302451, "r": 290.014595, "b": 343.337871 }, "text": "Outlet Devices", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 3 }, { "id": "p143.5.5", "order": 38, "type": "table_cell", "bbox": { "l": 70.320002, "t": 341.382452, "r": 82.177372, "b": 329.417872 }, "text": "#1", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p143.5.6", "order": 39, "type": "table_cell", "bbox": { "l": 98.408891, "t": 341.382452, "r": 135.204992, "b": 329.417872 }, "text": "Primary", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p143.5.7", "order": 40, "type": "table_cell", "bbox": { "l": 354.69794, "t": 317.382452, "r": 383.299634, "b": 305.417872 }, "text": "93.80'", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p143.5.8", "order": 41, "type": "table_cell", "bbox": { "l": 220.679993, "t": 341.262472, "r": 512.979659, "b": 293.417872 }, "text": "6.0\" Round Culvert to Subsurface Basin\\nL= 35.0' RCP, square edge headwall, Ke= 0.500\\nInlet / Outlet Invert= 92.00' / 93.80' S= -0.0514'' Cc= 0.900\\nn= 0.012 Corrugated PP, smooth interior, Flow Area= 0.20 sf", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p143.5.9", "order": 42, "type": "table_cell", "bbox": { "l": 70.320002, "t": 293.382452, "r": 82.177372, "b": 269.417872 }, "text": "#2\n#3", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 8 }, { "id": "p143.5.10", "order": 43, "type": "table_cell", "bbox": { "l": 98.408891, "t": 293.382452, "r": 146.474595, "b": 269.417872 }, "text": "Device 1\nDiscarded", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 9 }, { "id": "p143.5.11", "order": 44, "type": "table_cell", "bbox": { "l": 180.288471, "t": 293.382452, "r": 208.918642, "b": 269.417872 }, "text": "93.00'\n91.00'", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 10 }, { "id": "p143.5.12", "order": 45, "type": "table_cell", "bbox": { "l": 220.679993, "t": 293.382452, "r": 531.965762, "b": 269.29789200000005 }, "text": "4.0' long Sharp-Crested Rectangular Weir 2 End Contraction(s)\n1.050 in/hr Exfiltration X 0.00 over Surface area", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 11 } ], "reading_order": 4 }, { "id": "p143.6", "order": 46, "type": "footnote", "bbox": { "l": 52.08, "t": 574.8, "r": 513.6, "b": 537.6 }, "text": "Routing by Stor-Ind method, Time Span= 0.00-72.00 hrs, dt= 0.01 hrs\nStarting Elev= 93.00' Surf.Area= 4,067 sf Storage= 6,668 cf\nPeak Elev= 94.29' @ 12.71 hrs Surf.Area= 5,259 sf Storage= 12,701 cf (6,033 cf above start)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 5 }, { "id": "p143.7", "order": 47, "type": "footnote", "bbox": { "l": 51.6, "t": 528.72, "r": 418.32, "b": 502.08 }, "text": "Plug-Flow detention time = 1,244.2 min calculated for 1,315 cf (11% of inflow)\nCenter-of-Mass det. time = 244.7 min (1,030.2 - 785.4)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 6 }, { "id": "p143.8", "order": 48, "type": "footnote", "bbox": { "l": 51.84, "t": 258.72, "r": 424.08, "b": 232.32 }, "text": "Discarded OutFlow Max=0.00 cfs @ 0.00 hrs HW=93.00' (Free Discharge)\n3=Exfiltration (Controls 0.00 cfs)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 7 }, { "id": "p143.9", "order": 49, "type": "footnote", "bbox": { "l": 50.64, "t": 222.24, "r": 468.96, "b": 183.36 }, "text": "Primary OutFlow Max=0.47 cfs @ 12.71 hrs HW=94.29' (Free Discharge)\n1=Culvert to Subsurface Basin (Inlet Controls 0.47 cfs @ 2.39 fps)\n2=Sharp-Crested Rectangular Weir (Passes 0.47 cfs of 13.88 cfs potential flow)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 8 } ] }, { "document_id": 16592, "page": 144, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 7, "counts_by_type": { "caption": 1, "figure": 1, "footnote": 1, "header": 2, "text": 2 }, "build_ms": 0, "items": [ { "id": "p144.1", "order": 1, "type": "header", "bbox": { "l": 361.44, "t": 738.96, "r": 560.64, "b": 711.6 }, "text": "NOAA 24-hr D 10-Year Rainfall=5.38\"\nPrinted 04/12/2025", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p144.2", "order": 2, "type": "header", "bbox": { "l": 52.32, "t": 738, "r": 401.76, "b": 699.12 }, "text": "102 Sams -REV 12-02-25 NOAA 2\nPrepared by Haler Consulting\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p144.3", "order": 3, "type": "text", "bbox": { "l": 517.2, "t": 711.12, "r": 558.72, "b": 699.12 }, "text": "Page 31", "attrs": { "block_label": "number" }, "reading_order": 2 }, { "id": "p144.4", "order": 4, "type": "caption", "bbox": { "l": 201.12, "t": 687.6, "r": 410.64, "b": 672.96 }, "text": "Pond 184P: WQ Infiltration Basin #2", "attrs": { "block_label": "figure_title" }, "reading_order": 3 }, { "id": "p144.5", "order": 5, "type": "figure", "bbox": { "l": 65.28, "t": 669.84, "r": 486, "b": 408.48 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n2.42 cfs\nInflow Area=86,443 sf\nPeak Elev=94.29'\nStorage=12,701 cf\n2\n(cfs)\nFlow\n1\n0.47 cfs\n0.47 cfs\n0.00 cfs\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72" }, "reading_order": 4 }, { "id": "p144.6", "order": 6, "type": "text", "bbox": { "l": 497.04, "t": 644.88, "r": 547.2, "b": 610.08 }, "text": "Inflow Outflow Discarded Primary", "attrs": { "block_label": "aside_text" }, "reading_order": 5 }, { "id": "p144.7", "order": 7, "type": "footnote", "bbox": { "l": 84, "t": 420.24, "r": 449.52, "b": 400.8 }, "text": "0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72 Time (hours)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 6 } ] }, { "document_id": 16592, "page": 145, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 11, "counts_by_type": { "caption": 1, "header": 1, "table": 1, "table_cell": 8 }, "build_ms": 25, "items": [ { "id": "p145.1", "order": 1, "type": "header", "bbox": { "l": 52.8, "t": 738.48, "r": 560.88, "b": 698.64 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 10-Year Rainfall=5.38\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 32", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p145.2", "order": 2, "type": "caption", "bbox": { "l": 153.6, "t": 687.84, "r": 458.16, "b": 672.96 }, "text": "Stage-Discharge for Pond 184P: WQ Infiltration Basin #2", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p145.3", "order": 3, "type": "table", "bbox": { "l": 54.96, "t": 664.32, "r": 506.4, "b": 58.8 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 8, "integrity": { "cells_checked": 8, "cells_flagged": 0 } }, "children": [ { "id": "p145.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 57.479999, "t": 661.126246, "r": 98.137287, "b": 64.158859 }, "text": "Elevation (feet)\n91.00\n91.05\n91.10\n91.15\n91.20\n91.25\n91.30\n91.35\n91.40\n91.45\n91.50\n91.55\n91.60\n91.65\n91.70\n91.75\n91.80\n91.85\n91.90\n91.95\n92.00\n92.05\n92.10\n92.15\n92.20\n92.25\n92.30\n92.35\n92.40\n92.45\n92.50\n92.55\n92.60\n92.65\n92.70\n92.75\n92.80\n92.85\n92.90\n92.95\n93.00\n93.05\n93.10\n93.15\n93.20\n93.25\n93.30\n93.35\n93.40\n93.45\n93.50\n93.55", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p145.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 109.680004, "t": 661.126246, "r": 154.533694, "b": 64.158859 }, "text": "Discharge (cfs)\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p145.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 166.080002, "t": 661.126246, "r": 211.180733, "b": 64.158859 }, "text": "Discarded (cfs)\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p145.3.4", "order": 7, "type": "table_cell", "bbox": { "l": 233.160004, "t": 661.126246, "r": 267.536512, "b": 64.158859 }, "text": "Primary (cfs)\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p145.3.5", "order": 8, "type": "table_cell", "bbox": { "l": 291, "t": 661.126246, "r": 331.657282, "b": 428.478844 }, "text": "Elevation (feet)\n93.60\n93.65\n93.70\n93.75\n93.80\n93.85\n93.90\n93.95\n94.00\n94.05\n94.10\n94.15\n94.20\n94.25\n94.30\n94.35\n94.40\n94.45\n94.50", "attrs": { "row": 0, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p145.3.6", "order": 9, "type": "table_cell", "bbox": { "l": 343.200005, "t": 661.126246, "r": 388.300713, "b": 428.478844 }, "text": "Discharge (cfs)\n0.00\n0.00\n0.00\n0.00\n0.00\n0.01\n0.03\n0.07\n0.11\n0.17\n0.23\n0.30\n0.36\n0.43\n0.47\n0.52\n0.56\n0.60\n0.63", "attrs": { "row": 0, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p145.3.7", "order": 10, "type": "table_cell", "bbox": { "l": 399.599991, "t": 661.126246, "r": 444.395578, "b": 428.478844 }, "text": "Discarded (cfs)\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00", "attrs": { "row": 0, "col": 6, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p145.3.8", "order": 11, "type": "table_cell", "bbox": { "l": 466.679993, "t": 661.126246, "r": 501.100731, "b": 428.478844 }, "text": "Primary (cfs)\n0.00\n0.00\n0.00\n0.00\n0.00\n0.01\n0.03\n0.07\n0.11\n0.17\n0.23\n0.30\n0.36\n0.43\n0.47\n0.52\n0.56\n0.60\n0.63", "attrs": { "row": 0, "col": 7, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 7 } ], "reading_order": 2 } ] }, { "document_id": 16592, "page": 146, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 35, "counts_by_type": { "caption": 1, "header": 2, "table": 1, "table_cell": 30, "text": 1 }, "build_ms": 12, "items": [ { "id": "p146.1", "order": 1, "type": "header", "bbox": { "l": 361.68, "t": 739.2, "r": 561.36, "b": 712.8 }, "text": "NOAA 24-hr D 10-Year Rainfall=5.38\"\nPrinted 04/12/2025", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p146.2", "order": 2, "type": "header", "bbox": { "l": 51.84, "t": 738, "r": 396.72, "b": 698.88 }, "text": "102 Sams -REV 12-02-25\nPrepared by Haler Consulting\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p146.3", "order": 3, "type": "text", "bbox": { "l": 516.96, "t": 711.12, "r": 558.96, "b": 699.12 }, "text": "Page 33", "attrs": { "block_label": "number" }, "reading_order": 2 }, { "id": "p146.4", "order": 4, "type": "caption", "bbox": { "l": 145.92, "t": 687.84, "r": 466.08, "b": 672.96 }, "text": "Stage-Area-Storage for Pond 184P: WQ Infiltration Basin #2", "attrs": { "block_label": "figure_title" }, "reading_order": 3 }, { "id": "p146.5", "order": 5, "type": "table", "bbox": { "l": 54.72, "t": 665.76, "r": 465.558002, "b": 52.08 }, "text": "", "attrs": { "block_label": "table", "n_rows": 5, "n_cols": 6, "integrity": { "cells_checked": 30, "cells_flagged": 2, "flags": [ { "row": 1, "col": 5, "coverage": 0, "text": "10,468" }, { "row": 3, "col": 5, "coverage": 0, "text": "12,488" } ] } }, "children": [ { "id": "p146.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 57.479999, "t": 661.126246, "r": 98.137287, "b": 583.038857 }, "text": "Elevation (feet)\n91.00\n91.05\n91.10\n91.15\n91.20", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p146.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 139.439999, "t": 661.126246, "r": 173.816353, "b": 583.038857 }, "text": "Surface (sq-ft)\n2,628\n2,663\n2,697\n2,732\n2,766", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p146.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 199.55999, "t": 661.126246, "r": 249.522956, "b": 583.038857 }, "text": "Storage (cubic-feet)\n0\n132\n266\n402\n539", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p146.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 273.240005, "t": 661.126246, "r": 313.897287, "b": 583.038857 }, "text": "Elevation (feet)\n93.60\n93.65\n93.70\n93.75\n93.80", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p146.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 355.200005, "t": 661.126246, "r": 389.576359, "b": 583.038857 }, "text": "Surface (sq-ft)\n4,633\n4,680\n4,727\n4,774\n4,821", "attrs": { "row": 0, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p146.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 415.320008, "t": 661.126246, "r": 465.284304, "b": 583.038857 }, "text": "Storage (cubic-feet)\n9,277\n9,510\n9,745\n9,983\n10,223", "attrs": { "row": 0, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p146.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 73.320002, "t": 583.006243, "r": 98.137287, "b": 571.9988559999999 }, "text": "91.25", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p146.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 148.972477, "t": 583.006243, "r": 173.773196, "b": 571.9988559999999 }, "text": "2,801", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p146.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 232.992149, "t": 583.006243, "r": 249.447055, "b": 571.9988559999999 }, "text": "679", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p146.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 289.080002, "t": 583.006243, "r": 313.897287, "b": 571.9988559999999 }, "text": "93.85", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p146.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 364.732477, "t": 583.006243, "r": 389.533196, "b": 571.9988559999999 }, "text": "4,869", "attrs": { "row": 1, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p146.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 394.52, "t": 596.2868, "r": 462.48, "b": 584.7079 }, "text": "10,468", "attrs": { "row": 1, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 11 }, { "id": "p146.5.13", "order": 18, "type": "table_cell", "bbox": { "l": 73.320002, "t": 571.966242, "r": 98.137287, "b": 494.71885 }, "text": "91.30\n91.35\n91.40\n91.45\n91.50\n91.55\n91.60", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 12 }, { "id": "p146.5.14", "order": 19, "type": "table_cell", "bbox": { "l": 148.972477, "t": 571.966242, "r": 173.773196, "b": 494.71885 }, "text": "2,836\n2,870\n2,905\n2,939\n2,974\n3,009\n3,043", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 13 }, { "id": "p146.5.15", "order": 20, "type": "table_cell", "bbox": { "l": 224.707019, "t": 571.966242, "r": 249.524304, "b": 494.71885 }, "text": "820\n962\n1,107\n1,253\n1,401\n1,550\n1,701", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 14 }, { "id": "p146.5.16", "order": 21, "type": "table_cell", "bbox": { "l": 289.080002, "t": 571.966242, "r": 313.897287, "b": 494.71885 }, "text": "93.90\n93.95\n94.00\n94.05\n94.10\n94.15\n94.20", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 15 }, { "id": "p146.5.17", "order": 22, "type": "table_cell", "bbox": { "l": 364.732477, "t": 571.966242, "r": 389.533196, "b": 494.71885 }, "text": "4,916\n4,963\n5,010\n5,053\n5,096\n5,138\n5,181", "attrs": { "row": 2, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 16 }, { "id": "p146.5.18", "order": 23, "type": "table_cell", "bbox": { "l": 434.943599, "t": 571.966242, "r": 465.246354, "b": 494.71885 }, "text": "10,710\n10,957\n11,206\n11,458\n11,711\n11,967\n12,225", "attrs": { "row": 2, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 17 }, { "id": "p146.5.19", "order": 24, "type": "table_cell", "bbox": { "l": 73.320002, "t": 494.686236, "r": 98.137287, "b": 483.678849 }, "text": "91.65", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p146.5.20", "order": 25, "type": "table_cell", "bbox": { "l": 148.972477, "t": 494.686236, "r": 173.773196, "b": 483.678849 }, "text": "3,078", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p146.5.21", "order": 26, "type": "table_cell", "bbox": { "l": 224.707019, "t": 494.686236, "r": 249.524304, "b": 483.678849 }, "text": "1,854", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p146.5.22", "order": 27, "type": "table_cell", "bbox": { "l": 289.080002, "t": 494.686236, "r": 313.897287, "b": 483.678849 }, "text": "94.25", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p146.5.23", "order": 28, "type": "table_cell", "bbox": { "l": 364.732477, "t": 494.686236, "r": 389.533196, "b": 483.678849 }, "text": "5,224", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 22 }, { "id": "p146.5.24", "order": 29, "type": "table_cell", "bbox": { "l": 394.52, "t": 503.6558, "r": 462.48, "b": 492.077 }, "text": "12,488", "attrs": { "row": 3, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 23 }, { "id": "p146.5.25", "order": 30, "type": "table_cell", "bbox": { "l": 73.320002, "t": 483.646234, "r": 98.137287, "b": 64.158859 }, "text": "91.70\n91.75\n91.80\n91.85\n91.90\n91.95\n92.00\n92.05\n92.10\n92.15\n92.20\n92.25\n92.30\n92.35\n92.40\n92.45\n92.50\n92.55\n92.60\n92.65\n92.70\n92.75\n92.80\n92.85\n92.90\n92.95\n93.00\n93.05\n93.10\n93.15\n93.20\n93.25\n93.30\n93.35\n93.40\n93.45\n93.50\n93.55", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 24 }, { "id": "p146.5.26", "order": 31, "type": "table_cell", "bbox": { "l": 148.972477, "t": 483.646234, "r": 173.773196, "b": 64.158859 }, "text": "3,112\n3,147\n3,182\n3,216\n3,251\n3,285\n3,320\n3,357\n3,395\n3,432\n3,469\n3,507\n3,544\n3,581\n3,619\n3,656\n3,694\n3,731\n3,768\n3,806\n3,843\n3,880\n3,918\n3,955\n3,992\n4,030\n4,067\n4,114\n4,161\n4,208\n4,256\n4,303\n4,350\n4,397\n4,444\n4,491\n4,539\n4,586", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 25 }, { "id": "p146.5.27", "order": 32, "type": "table_cell", "bbox": { "l": 224.707019, "t": 483.646234, "r": 249.524304, "b": 64.158859 }, "text": "2,009\n2,166\n2,324\n2,484\n2,645\n2,809\n2,974\n3,141\n3,310\n3,480\n3,653\n3,827\n4,004\n4,182\n4,362\n4,544\n4,727\n4,913\n5,100\n5,290\n5,481\n5,674\n5,869\n6,066\n6,265\n6,465\n6,668\n6,872\n7,079\n7,288\n7,500\n7,714\n7,930\n8,149\n8,370\n8,593\n8,819\n9,047", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 26 }, { "id": "p146.5.28", "order": 33, "type": "table_cell", "bbox": { "l": 289.080002, "t": 483.646234, "r": 313.897287, "b": 428.478844 }, "text": "94.30\n94.35\n94.40\n94.45\n94.50", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 27 }, { "id": "p146.5.29", "order": 34, "type": "table_cell", "bbox": { "l": 364.732477, "t": 483.646234, "r": 389.808242, "b": 428.478844 }, "text": "5,267\n5,310\n5,352\n5,395\n5,438", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 28 }, { "id": "p146.5.30", "order": 35, "type": "table_cell", "bbox": { "l": 434.943599, "t": 483.646234, "r": 465.558002, "b": 428.478844 }, "text": "12,748\n13,012\n13,278\n13,547\n13,818", "attrs": { "row": 4, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 29 } ], "reading_order": 4 } ] }, { "document_id": 16592, "page": 147, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 8, "counts_by_type": { "figure": 1, "header": 2, "heading": 2, "text": 3 }, "build_ms": 0, "items": [ { "id": "p147.1", "order": 1, "type": "header", "bbox": { "l": 360.72, "t": 738.96, "r": 560.88, "b": 711.84 }, "text": "NOAA 24-hr D 10-Year Rainfall=5.38\"\nPrinted 04/12/2025", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p147.2", "order": 2, "type": "header", "bbox": { "l": 52.8, "t": 737.76, "r": 395.52, "b": 699.36 }, "text": "102 Sams -REV 12-02-25\nPrepared by Haler Consulting\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p147.3", "order": 3, "type": "text", "bbox": { "l": 516.96, "t": 711.12, "r": 558.96, "b": 699.12 }, "text": "Page 34", "attrs": { "block_label": "number" }, "reading_order": 2 }, { "id": "p147.4", "order": 4, "type": "heading", "bbox": { "l": 220.8, "t": 687.6, "r": 392.4, "b": 672.48 }, "text": "Summary for Link 185L: POA", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 3 }, { "id": "p147.5", "order": 5, "type": "text", "bbox": { "l": 52.08, "t": 660.24, "r": 515.76, "b": 621.84 }, "text": "Inflow Area = 536,539 sf, 11.25% Impervious, Inflow Depth > 0.54\" for 10-Year event\nInflow = 4.64 cfs @ 12.13 hrs, Volume= 24,056 cf\nPrimary = 4.64 cfs @ 12.13 hrs, Volume= 24,056 cf, Atten= 0%, Lag= 0.0 min", "reading_order": 4 }, { "id": "p147.6", "order": 6, "type": "text", "bbox": { "l": 51.84, "t": 611.52, "r": 367.2, "b": 597.84 }, "text": "Primary outflow = Inflow, Time Span = 0.00-72.00 hrs, dt = 0.01 hrs", "reading_order": 5 }, { "id": "p147.7", "order": 7, "type": "heading", "bbox": { "l": 258.96, "t": 586.56, "r": 352.8, "b": 572.4 }, "text": "Link 185L: POA", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 6 }, { "id": "p147.8", "order": 8, "type": "figure", "bbox": { "l": 61.92, "t": 565.44, "r": 552.96, "b": 299.04 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nInflow\n4.64 cfs Primary\n5\nInflow Area=536,539 sf\n4.64 cfs\n4\n3\n(cfs)\nFlow\n2\n1\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72\nTime (hours)" }, "reading_order": 7 } ] }, { "document_id": 16592, "page": 148, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 2, "counts_by_type": { "footer": 1, "text": 1 }, "build_ms": 1, "items": [ { "id": "p148.1", "order": 1, "type": "text", "bbox": { "l": 50.16, "t": 684.48, "r": 559.92, "b": 292.56 }, "text": "Ime span=0.00-/2.00 hrs, dt=0.01 hrs, /201 points\nRunoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious\nReach routing by Stor-Ind+Trans method - Pond routing by Stor-Ind method\n\nSubcatchment 170S: DA P1 (Impervious) Runoff Area=31,625 sf 100.00% Impervious Runoff Depth=6.44\"\nFlow Length=450' Tc=3.0 min CN=0/98 Runoff=4.60 cfs 16,975 cf\n\nSubcatchment 174S: DA P2 (Impervious) Runoff Area=23,470 sf 100.00% Impervious Runoff Depth=6.44\"\nFlow Length=450' Tc=4.9 min CN=0/98 Runoff=3.00 cfs 12,598 cf\n\nSubcatchment 178S: DA P3 (Pervious) Runoff Area=62,973 sf 0.00% Impervious Runoff Depth=0.66\"\nFlow Length=316' Slope=0.0200'/' Tc=13.1 min CN=39/0 Runoff=0.27 cfs 3,449 cf\n\nSubcatchment 179S: DA P0 Pervious Runoff Area=336,250 sf 0.00% Impervious Runoff Depth=0.30\"\nFlow Length=679' Tc=49.8 min CN=33/0 Runoff=0.28 cfs 8,387 cf\n\nSubcatchment 180S: DA P4 (Pervious) Runoff Area=76,971 sf 0.00% Impervious Runoff Depth=0.66\"\nFlow Length=196' Slope=0.0100'/' Tc=14.8 min CN=39/0 Runoff=0.32 cfs 4,216 cf\n\nSubcatchment 181S: DA P6 (Impervious) Runoff Area=5,250 sf 100.00% Impervious Runoff Depth=6.44\"\nFlow Length=150' Tc=1.4 min CN=0/98 Runoff=0.84 cfs 2,818 cf\n\nPond 183P: WQ Infiltration Basin #1 Peak Elevation=99.23' Storage=16,706 cfs Inflow=4.63 cfs 21,191 cf\nDiscarded=0.00 cfs 0 cf Primary=5.91 cfs 17,388 cf Outflow=5.91 cfs 17,388 cf\n\nPond 184P: WQ Infiltration Basin #2 Peak Elevation=99.85' Storage=13,818 cfs Inflow=3.06 cfs 16,047 cf\nDiscarded=0.00 cfs 0 cf Primary=1.97 cfs 12,492 cfs Outflow=1.97 cfs 12,492 cf\n\nLink 185L: POA Inflow=7.07 cfs 41,085 cf Primary=7.07 cfs 41,085 cf\nTotal Runoff Area = 536,539 sf Runoff Volume = 48,444 cf Average Runoff Depth = 1.08\"\n88.75% Pervious = 476,194 sf 11.25% Impervious = 60,345 sf", "attrs": { "block_label": "algorithm" }, "reading_order": 0 }, { "id": "p148.2", "order": 2, "type": "footer", "bbox": { "l": 50.4, "t": 739.2, "r": 559.92, "b": 699.84 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 25-Year Rainfall=6.68\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 35", "attrs": { "block_label": "footer" }, "reading_order": 1 } ] }, { "document_id": 16592, "page": 149, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 32, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "table": 1, "table_cell": 24, "text": 3, "title": 1 }, "build_ms": 3, "items": [ { "id": "p149.1", "order": 1, "type": "header", "bbox": { "l": 53.28, "t": 738.48, "r": 560.64, "b": 698.64 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 25-Year Rainfall=6.68\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 36", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p149.2", "order": 2, "type": "title", "bbox": { "l": 148.08, "t": 687.6, "r": 463.92, "b": 672.24 }, "text": "Summary for Subcatchment 170S: DA P1 (Impervious)", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p149.3", "order": 3, "type": "text", "bbox": { "l": 53.52, "t": 660.24, "r": 463.68, "b": 634.32 }, "text": "Runoff = 4.60 cfs @ 12.11 hrs, Volume= 16,975 cf, Depth= 6.44\"\nRouted to Pond 183P : WQ Infiltration Basin #1", "reading_order": 2 }, { "id": "p149.4", "order": 4, "type": "text", "bbox": { "l": 52.08, "t": 623.76, "r": 611.04, "b": 598.32 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious, Time Span= 0.00-72.00 hrs, dt= NOAA 24-hr D 25-Year Rainfall=6.68\"", "reading_order": 3 }, { "id": "p149.5", "order": 5, "type": "table", "bbox": { "l": 52.56, "t": 588.48, "r": 559.2, "b": 447.497874 }, "text": "", "attrs": { "block_label": "table", "n_rows": 6, "n_cols": 5, "integrity": { "cells_checked": 22, "cells_flagged": 0 } }, "children": [ { "id": "p149.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 86.520001, "t": 587.142469, "r": 127.590159, "b": 575.177889 }, "text": "Area (sf)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p149.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 144.389888, "t": 587.142469, "r": 159.742288, "b": 575.177889 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p149.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 286.601768, "t": 535.302451, "r": 340.102911, "b": 523.337871 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p149.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 95.280001, "t": 559.302451, "r": 127.805562, "b": 547.337871 }, "text": "31,625", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 3 }, { "id": "p149.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 148.003832, "t": 559.302451, "r": 159.753993, "b": 547.337871 }, "text": "98", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p149.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 174.16295, "t": 573.222448, "r": 281.259838, "b": 561.257868 }, "text": "Paved parking, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 5 }, { "id": "p149.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 95.280001, "t": 573.222448, "r": 127.805562, "b": 561.257868 }, "text": "31,625", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p149.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 148.003832, "t": 573.222448, "r": 159.753993, "b": 561.257868 }, "text": "98", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p149.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 174.16295, "t": 559.302451, "r": 296.664294, "b": 547.337871 }, "text": "100.00% Impervious Area", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 8 }, { "id": "p149.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 65.040001, "t": 535.302451, "r": 89.475992, "b": 497.417872 }, "text": "Tc (min)\n1.2", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 9 }, { "id": "p149.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 100.248415, "t": 535.302451, "r": 132.68142, "b": 497.417872 }, "text": "Length (feet)\n100", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 10 }, { "id": "p149.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 143.445254, "t": 535.302451, "r": 175.895438, "b": 497.417872 }, "text": "Slope (ft/ft)\n0.0200", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 11 }, { "id": "p149.5.13", "order": 18, "type": "table_cell", "bbox": { "l": 186.552062, "t": 535.302451, "r": 223.968178, "b": 497.417872 }, "text": "Velocity (ft/sec)\n1.42", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 12 }, { "id": "p149.5.14", "order": 19, "type": "table_cell", "bbox": { "l": 234.581918, "t": 535.302451, "r": 473.002733, "b": 485.417872 }, "text": "Capacity (cfs)\nSheet Flow, Smooth surfaces n= 0.011 P2= 3.42\"", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 13 }, { "id": "p149.5.15", "order": 20, "type": "table_cell", "bbox": { "l": 74.639998, "t": 485.382452, "r": 89.475992, "b": 473.417872 }, "text": "1.8", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p149.5.16", "order": 21, "type": "table_cell", "bbox": { "l": 114.927527, "t": 485.382452, "r": 132.68142, "b": 473.417872 }, "text": "350", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p149.5.17", "order": 22, "type": "table_cell", "bbox": { "l": 143.445254, "t": 485.382452, "r": 175.863606, "b": 473.417872 }, "text": "0.0250", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p149.5.18", "order": 23, "type": "table_cell", "bbox": { "l": 203.137703, "t": 485.382452, "r": 223.870219, "b": 473.417872 }, "text": "3.21", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p149.5.19", "order": 24, "type": "table_cell", "bbox": { "l": 286.679993, "t": 485.26245, "r": 425.623588, "b": 461.417872 }, "text": "Shallow Concentrated Flow, Paved Kv= 20.3 fps", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p149.5.20", "order": 25, "type": "table_cell", "bbox": { "l": 74.639998, "t": 459.462454, "r": 89.475992, "b": 447.497874 }, "text": "3.0", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p149.5.21", "order": 26, "type": "table_cell", "bbox": { "l": 114.927527, "t": 459.462454, "r": 132.68142, "b": 447.497874 }, "text": "450", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p149.5.22", "order": 27, "type": "table_cell", "bbox": { "l": 143.445254, "t": 459.462454, "r": 167.029543, "b": 447.497874 }, "text": "Total", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p149.5.23", "order": 28, "type": "table_cell", "bbox": { "l": 356.544, "t": 470.8114, "r": 457.872, "b": 451.2 }, "text": "", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 22 }, { "id": "p149.5.24", "order": 29, "type": "table_cell", "bbox": { "l": 457.872, "t": 470.8114, "r": 559.2, "b": 451.2 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 23 } ], "reading_order": 4 }, { "id": "p149.6", "order": 30, "type": "caption", "bbox": { "l": 186.72, "t": 435.12, "r": 424.56, "b": 419.76 }, "text": "Subcatchment 170S: DA P1 (Impervious)", "attrs": { "block_label": "figure_title" }, "reading_order": 5 }, { "id": "p149.7", "order": 31, "type": "figure", "bbox": { "l": 61.44, "t": 415.68, "r": 552, "b": 149.76 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n5 Runoff\n4.60 cfs\nNOAA 24-hr D\n4 25-Year Rainfall=6.68\"\nRunoff Area=31,625 sf\nRunoff Volume=16,975 cf\n3\n(cfs) Runoff Depth=6.44\"\nFlow Flow Length=450'\nTc=3.0 min\n2\nCN=0/98\n1\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72\nTime (hours)" }, "reading_order": 6 }, { "id": "p149.8", "order": 32, "type": "text", "bbox": { "l": 265.44, "t": 155.76, "r": 312.96, "b": 147.12 }, "text": "Time (hours)", "attrs": { "block_label": "number" }, "reading_order": 7 } ] }, { "document_id": 16592, "page": 150, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 32, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "table": 1, "table_cell": 24, "text": 3, "title": 1 }, "build_ms": 3, "items": [ { "id": "p150.1", "order": 1, "type": "header", "bbox": { "l": 53.28, "t": 738.48, "r": 560.64, "b": 698.64 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 25-Year Rainfall=6.68\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 37", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p150.2", "order": 2, "type": "title", "bbox": { "l": 148.32, "t": 687.36, "r": 463.92, "b": 672.24 }, "text": "Summary for Subcatchment 174S: DA P2 (Impervious)", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p150.3", "order": 3, "type": "text", "bbox": { "l": 53.52, "t": 660.48, "r": 463.68, "b": 634.32 }, "text": "Runoff = 3.00 cfs @ 12.13 hrs, Volume= 12,598 cf, Depth= 6.44\"\nRouted to Pond 184P : WQ Infiltration Basin #2", "reading_order": 2 }, { "id": "p150.4", "order": 4, "type": "text", "bbox": { "l": 52.08, "t": 623.76, "r": 611.28, "b": 598.32 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious, Time Span= 0.00-72.00 hrs, dt= NOAA 24-hr D 25-Year Rainfall=6.68\"", "reading_order": 3 }, { "id": "p150.5", "order": 5, "type": "table", "bbox": { "l": 52.56, "t": 588.48, "r": 559.2, "b": 447.497874 }, "text": "", "attrs": { "block_label": "table", "n_rows": 6, "n_cols": 5, "integrity": { "cells_checked": 22, "cells_flagged": 0 } }, "children": [ { "id": "p150.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 86.520001, "t": 587.142469, "r": 127.590159, "b": 575.177889 }, "text": "Area (sf)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p150.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 144.389888, "t": 587.142469, "r": 159.742288, "b": 575.177889 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p150.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 286.601768, "t": 535.302451, "r": 340.102911, "b": 523.337871 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p150.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 95.280001, "t": 559.302451, "r": 127.805562, "b": 547.337871 }, "text": "23,470", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 3 }, { "id": "p150.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 148.003832, "t": 559.302451, "r": 159.753993, "b": 547.337871 }, "text": "98", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p150.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 174.16295, "t": 573.222448, "r": 281.259838, "b": 561.257868 }, "text": "Paved parking, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 5 }, { "id": "p150.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 95.280001, "t": 573.222448, "r": 127.805562, "b": 561.257868 }, "text": "23,470", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p150.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 148.003832, "t": 573.222448, "r": 159.753993, "b": 561.257868 }, "text": "98", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p150.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 174.16295, "t": 559.302451, "r": 296.664294, "b": 547.337871 }, "text": "100.00% Impervious Area", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 8 }, { "id": "p150.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 65.040001, "t": 535.302451, "r": 89.475992, "b": 497.417872 }, "text": "Tc (min)\n0.8", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 9 }, { "id": "p150.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 100.248415, "t": 535.302451, "r": 132.68142, "b": 497.417872 }, "text": "Length (feet)\n100", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 10 }, { "id": "p150.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 143.445254, "t": 535.302451, "r": 175.895438, "b": 497.417872 }, "text": "Slope (ft/ft)\n0.0500", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 11 }, { "id": "p150.5.13", "order": 18, "type": "table_cell", "bbox": { "l": 186.552062, "t": 535.302451, "r": 223.968178, "b": 497.417872 }, "text": "Velocity (ft/sec)\n2.05", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 12 }, { "id": "p150.5.14", "order": 19, "type": "table_cell", "bbox": { "l": 234.581918, "t": 535.302451, "r": 473.002733, "b": 485.417872 }, "text": "Capacity (cfs)\nSheet Flow, Smooth surfaces n= 0.011 P2= 3.42\"", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 13 }, { "id": "p150.5.15", "order": 20, "type": "table_cell", "bbox": { "l": 74.639998, "t": 485.382452, "r": 89.475992, "b": 473.417872 }, "text": "4.1", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p150.5.16", "order": 21, "type": "table_cell", "bbox": { "l": 114.927527, "t": 485.382452, "r": 132.68142, "b": 473.417872 }, "text": "350", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p150.5.17", "order": 22, "type": "table_cell", "bbox": { "l": 143.445254, "t": 485.382452, "r": 175.863606, "b": 473.417872 }, "text": "0.0050", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p150.5.18", "order": 23, "type": "table_cell", "bbox": { "l": 203.137703, "t": 485.382452, "r": 223.870219, "b": 473.417872 }, "text": "1.44", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p150.5.19", "order": 24, "type": "table_cell", "bbox": { "l": 286.679993, "t": 485.26245, "r": 425.623588, "b": 461.417872 }, "text": "Shallow Concentrated Flow, Paved Kv= 20.3 fps", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p150.5.20", "order": 25, "type": "table_cell", "bbox": { "l": 74.639998, "t": 459.462454, "r": 89.475992, "b": 447.497874 }, "text": "4.9", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p150.5.21", "order": 26, "type": "table_cell", "bbox": { "l": 114.927527, "t": 459.462454, "r": 132.68142, "b": 447.497874 }, "text": "450", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p150.5.22", "order": 27, "type": "table_cell", "bbox": { "l": 143.445254, "t": 459.462454, "r": 167.029543, "b": 447.497874 }, "text": "Total", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p150.5.23", "order": 28, "type": "table_cell", "bbox": { "l": 356.544, "t": 471.2229, "r": 457.872, "b": 451.68 }, "text": "", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 22 }, { "id": "p150.5.24", "order": 29, "type": "table_cell", "bbox": { "l": 457.872, "t": 471.2229, "r": 559.2, "b": 451.68 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 23 } ], "reading_order": 4 }, { "id": "p150.6", "order": 30, "type": "caption", "bbox": { "l": 186.96, "t": 435.12, "r": 424.56, "b": 419.76 }, "text": "Subcatchment 174S: DA P2 (Impervious)", "attrs": { "block_label": "figure_title" }, "reading_order": 5 }, { "id": "p150.7", "order": 31, "type": "figure", "bbox": { "l": 62.88, "t": 416.4, "r": 551.76, "b": 149.76 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nRunoff\n3.00 cfs\nNOAA 24-hr D\n3\n25-Year Rainfall=6.68\"\nRunoff Area=23,470 sf\nRunoff Volume=12,598 cf\n2\n(cfs) Runoff Depth=6.44\"\nFlow Flow Length=450'\nTc=4.9 min\n1 CN=0/98\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72\nTime (hours)" }, "reading_order": 6 }, { "id": "p150.8", "order": 32, "type": "text", "bbox": { "l": 265.44, "t": 155.76, "r": 312.72, "b": 147.12 }, "text": "Time (hours)", "attrs": { "block_label": "number" }, "reading_order": 7 } ] }, { "document_id": 16592, "page": 151, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 42, "counts_by_type": { "caption": 1, "figure": 2, "footer": 1, "footnote": 1, "table": 1, "table_cell": 33, "text": 2, "title": 1 }, "build_ms": 4, "items": [ { "id": "p151.1", "order": 1, "type": "figure", "bbox": { "l": 53.28, "t": 738.48, "r": 560.64, "b": 698.64 }, "text": "", "attrs": { "role": "page_header", "block_label": "header_image", "embedded_text": "102 Sams -REV 12-02-25 NOAA 24-hr D 25-Year Rainfall=6.68\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 38" }, "reading_order": 0 }, { "id": "p151.2", "order": 2, "type": "title", "bbox": { "l": 154.8, "t": 687.6, "r": 457.2, "b": 672.24 }, "text": "Summary for Subcatchment 178S: DA P3 (Pervious)", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p151.3", "order": 3, "type": "text", "bbox": { "l": 53.28, "t": 660.24, "r": 463.92, "b": 634.08 }, "text": "Runoff = 0.27 cfs @ 12.54 hrs, Volume= 3,449 cf, Depth= 0.66\"\nRouted to Pond 184P : WQ Infiltration Basin #2", "reading_order": 2 }, { "id": "p151.4", "order": 4, "type": "text", "bbox": { "l": 52.32, "t": 623.52, "r": 611.04, "b": 598.32 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious, Time Span= 0.00-72.00 hrs, dt= NOAA 24-hr D 25-Year Rainfall=6.68\"", "reading_order": 3 }, { "id": "p151.5", "order": 5, "type": "table", "bbox": { "l": 52.32, "t": 588.72, "r": 558.96, "b": 447.497874 }, "text": "", "attrs": { "block_label": "table", "n_rows": 7, "n_cols": 6, "integrity": { "cells_checked": 28, "cells_flagged": 0 } }, "children": [ { "id": "p151.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 86.520001, "t": 587.142469, "r": 127.590159, "b": 575.177889 }, "text": "Area (sf)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p151.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 144.389888, "t": 587.142469, "r": 159.742288, "b": 575.177889 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p151.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 286.601768, "t": 535.302451, "r": 340.102911, "b": 523.337871 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p151.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 95.280001, "t": 559.302451, "r": 127.805562, "b": 547.337871 }, "text": "62,973", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 3 }, { "id": "p151.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 148.003832, "t": 559.302451, "r": 159.753993, "b": 547.337871 }, "text": "39", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p151.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 174.16295, "t": 573.222448, "r": 333.31717, "b": 561.257868 }, "text": ">75% Grass cover, Good, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 5 }, { "id": "p151.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 95.280001, "t": 573.222448, "r": 127.805562, "b": 561.257868 }, "text": "62,973", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 6 }, { "id": "p151.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 148.003832, "t": 573.222448, "r": 159.753993, "b": 561.257868 }, "text": "39", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p151.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 174.16295, "t": 559.302451, "r": 286.000299, "b": 547.337871 }, "text": "100.00% Pervious Area", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 8 }, { "id": "p151.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 65.040001, "t": 535.302451, "r": 89.40872, "b": 511.337871 }, "text": "Tc (min)", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p151.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 100.248415, "t": 535.302451, "r": 132.666767, "b": 511.337871 }, "text": "Length (feet)", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p151.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 148.683866, "t": 535.302451, "r": 175.895438, "b": 511.337871 }, "text": "Slope (ft/ft)", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 }, { "id": "p151.5.13", "order": 18, "type": "table_cell", "bbox": { "l": 186.552062, "t": 535.302451, "r": 223.968178, "b": 511.337871 }, "text": "Velocity (ft/sec)", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 12 }, { "id": "p151.5.14", "order": 19, "type": "table_cell", "bbox": { "l": 234.581918, "t": 535.302451, "r": 275.988028, "b": 511.337871 }, "text": "Capacity (cfs)", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p151.5.15", "order": 20, "type": "table_cell", "bbox": { "l": 174.08692, "t": 587.142469, "r": 227.564819, "b": 575.177889 }, "text": "Description", "attrs": { "row": 3, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p151.5.16", "order": 21, "type": "table_cell", "bbox": { "l": 74.639998, "t": 509.382452, "r": 89.475992, "b": 497.417872 }, "text": "9.5", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p151.5.17", "order": 22, "type": "table_cell", "bbox": { "l": 114.927527, "t": 509.382452, "r": 132.68142, "b": 497.417872 }, "text": "100", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p151.5.18", "order": 23, "type": "table_cell", "bbox": { "l": 143.445254, "t": 509.382452, "r": 175.863606, "b": 497.417872 }, "text": "0.0200", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p151.5.19", "order": 24, "type": "table_cell", "bbox": { "l": 203.137703, "t": 509.382452, "r": 223.870219, "b": 497.417872 }, "text": "0.18", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p151.5.20", "order": 25, "type": "table_cell", "bbox": { "l": 390.08, "t": 510, "r": 474.52, "b": 490.32 }, "text": "", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 19 }, { "id": "p151.5.21", "order": 26, "type": "table_cell", "bbox": { "l": 286.679993, "t": 509.26245, "r": 452.820335, "b": 485.417872 }, "text": "Sheet Flow, Grass: Short n= 0.150 P2= 3.42\"", "attrs": { "row": 4, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p151.5.22", "order": 27, "type": "table_cell", "bbox": { "l": 74.639998, "t": 485.382452, "r": 89.475992, "b": 473.417872 }, "text": "3.6", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p151.5.23", "order": 28, "type": "table_cell", "bbox": { "l": 114.927527, "t": 485.382452, "r": 132.68142, "b": 473.417872 }, "text": "216", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 22 }, { "id": "p151.5.24", "order": 29, "type": "table_cell", "bbox": { "l": 143.445254, "t": 485.382452, "r": 175.863606, "b": 473.417872 }, "text": "0.0200", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 23 }, { "id": "p151.5.25", "order": 30, "type": "table_cell", "bbox": { "l": 203.137703, "t": 485.382452, "r": 223.870219, "b": 473.417872 }, "text": "0.99", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 24 }, { "id": "p151.5.26", "order": 31, "type": "table_cell", "bbox": { "l": 390.08, "t": 490.32, "r": 474.52, "b": 470.64 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 25 }, { "id": "p151.5.27", "order": 32, "type": "table_cell", "bbox": { "l": 286.679993, "t": 485.26245, "r": 446.147004, "b": 461.417872 }, "text": "Shallow Concentrated Flow, Short Grass Pasture Kv= 7.0 fps", "attrs": { "row": 5, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 26 }, { "id": "p151.5.28", "order": 33, "type": "table_cell", "bbox": { "l": 68.76, "t": 459.462454, "r": 89.492517, "b": 447.497874 }, "text": "13.1", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 27 }, { "id": "p151.5.29", "order": 34, "type": "table_cell", "bbox": { "l": 114.944052, "t": 459.462454, "r": 132.697945, "b": 447.497874 }, "text": "316", "attrs": { "row": 6, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 28 }, { "id": "p151.5.30", "order": 35, "type": "table_cell", "bbox": { "l": 143.354569, "t": 459.462454, "r": 166.947862, "b": 447.497874 }, "text": "Total", "attrs": { "row": 6, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 29 }, { "id": "p151.5.31", "order": 36, "type": "table_cell", "bbox": { "l": 305.64, "t": 470.64, "r": 390.08, "b": 450.96 }, "text": "", "attrs": { "row": 6, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 30 }, { "id": "p151.5.32", "order": 37, "type": "table_cell", "bbox": { "l": 390.08, "t": 470.64, "r": 474.52, "b": 450.96 }, "text": "", "attrs": { "row": 6, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 31 }, { "id": "p151.5.33", "order": 38, "type": "table_cell", "bbox": { "l": 474.52, "t": 470.64, "r": 558.96, "b": 450.96 }, "text": "", "attrs": { "row": 6, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 32 } ], "reading_order": 4 }, { "id": "p151.6", "order": 39, "type": "caption", "bbox": { "l": 193.2, "t": 435.12, "r": 417.84, "b": 420 }, "text": "Subcatchment 178S: DA P3 (Pervious)", "attrs": { "block_label": "figure_title" }, "reading_order": 5 }, { "id": "p151.7", "order": 40, "type": "figure", "bbox": { "l": 63.12, "t": 416.4, "r": 505.92, "b": 150.48 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n0.3\n0.28 0.27 cfs\n0.26 NOAA 24-hr D\n0.24 25-Year Rainfall=6.68\"\nRunoff Area=62,973 sf\n0.22\n0.2\n0.18 Runoff Volume=3,449 cf\n(cfs) 0.16 Runoff Depth=0.66\"\nFlow Flow Length=316'\n0.14\n0.12\nSlope=0.0200 '/'\n0.1\n0.08 Tc=13.1 min\nCN=39/0\n0.06\n0.04\n0.02\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72" }, "reading_order": 6 }, { "id": "p151.8", "order": 41, "type": "footnote", "bbox": { "l": 89.76, "t": 167.52, "r": 492.96, "b": 148.56 }, "text": "4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72 Time (hours)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 7 }, { "id": "p151.9", "order": 42, "type": "footer", "bbox": { "l": 511.92, "t": 392.64, "r": 546.24, "b": 381.6 }, "text": "", "attrs": { "block_label": "footer_image" }, "reading_order": 8 } ] }, { "document_id": 16592, "page": 152, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 30, "counts_by_type": { "caption": 1, "figure": 1, "footer": 1, "header": 1, "table": 1, "table_cell": 21, "text": 3, "title": 1 }, "build_ms": 4, "items": [ { "id": "p152.1", "order": 1, "type": "header", "bbox": { "l": 53.52, "t": 738.48, "r": 560.4, "b": 698.64 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 25-Year Rainfall=6.68\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 39", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p152.2", "order": 2, "type": "title", "bbox": { "l": 159.36, "t": 687.6, "r": 453.36, "b": 672.48 }, "text": "Summary for Subcatchment 179S: DA P0 Pervious", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p152.3", "order": 3, "type": "text", "bbox": { "l": 54, "t": 660.24, "r": 303.6, "b": 634.08 }, "text": "Runoff = 0.28 cfs @ 14.71 hrs, Volume=\nRouted to Link 185L : POA\n8,387 cf, Depth= 0.30\"", "reading_order": 2 }, { "id": "p152.4", "order": 4, "type": "text", "bbox": { "l": 347.04, "t": 660, "r": 463.68, "b": 646.56 }, "text": "8,387 cf, Depth= 0.30\"", "reading_order": 3 }, { "id": "p152.5", "order": 5, "type": "text", "bbox": { "l": 51.84, "t": 623.76, "r": 611.28, "b": 598.08 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious, Time Span= 0.00-72.00 hrs, dt= NOAA 24-hr D 25-Year Rainfall=6.68\"", "reading_order": 4 }, { "id": "p152.6", "order": 6, "type": "table", "bbox": { "l": 53.52, "t": 589.44, "r": 558.96, "b": 423.497874 }, "text": "", "attrs": { "block_label": "table", "n_rows": 7, "n_cols": 3, "integrity": { "cells_checked": 21, "cells_flagged": 0 } }, "children": [ { "id": "p152.6.1", "order": 7, "type": "table_cell", "bbox": { "l": 86.520001, "t": 587.142469, "r": 127.590159, "b": 575.177889 }, "text": "Area (sf)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p152.6.2", "order": 8, "type": "table_cell", "bbox": { "l": 144.389888, "t": 587.142469, "r": 159.742288, "b": 575.177889 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p152.6.3", "order": 9, "type": "table_cell", "bbox": { "l": 286.601768, "t": 511.302451, "r": 340.102911, "b": 499.337871 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p152.6.4", "order": 10, "type": "table_cell", "bbox": { "l": 89.399998, "t": 573.222448, "r": 127.805562, "b": 549.257868 }, "text": "236,879\n99,371", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p152.6.5", "order": 11, "type": "table_cell", "bbox": { "l": 147.913142, "t": 573.222448, "r": 159.770513, "b": 549.257868 }, "text": "30\n39", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p152.6.6", "order": 12, "type": "table_cell", "bbox": { "l": 174.07226, "t": 573.222448, "r": 333.31717, "b": 549.257868 }, "text": "Woods, Good, HSG A\n>75% Grass cover, Good, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p152.6.7", "order": 13, "type": "table_cell", "bbox": { "l": 89.399998, "t": 535.302451, "r": 127.714872, "b": 523.337871 }, "text": "336,250", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p152.6.8", "order": 14, "type": "table_cell", "bbox": { "l": 147.913142, "t": 535.302451, "r": 159.770513, "b": 523.337871 }, "text": "33", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p152.6.9", "order": 15, "type": "table_cell", "bbox": { "l": 174.07226, "t": 547.302451, "r": 262.271799, "b": 535.337871 }, "text": "Weighted Average", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p152.6.10", "order": 16, "type": "table_cell", "bbox": { "l": 89.399998, "t": 547.302451, "r": 127.714872, "b": 535.337871 }, "text": "336,250", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p152.6.11", "order": 17, "type": "table_cell", "bbox": { "l": 147.913142, "t": 547.302451, "r": 159.770513, "b": 535.337871 }, "text": "33", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p152.6.12", "order": 18, "type": "table_cell", "bbox": { "l": 174.07226, "t": 535.302451, "r": 286.016818, "b": 523.337871 }, "text": "100.00% Pervious Area", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 }, { "id": "p152.6.13", "order": 19, "type": "table_cell", "bbox": { "l": 65.040001, "t": 511.302451, "r": 89.492517, "b": 473.417872 }, "text": "Tc (min)\n36.2", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 12 }, { "id": "p152.6.14", "order": 20, "type": "table_cell", "bbox": { "l": 100.248415, "t": 511.302451, "r": 132.697945, "b": 473.417872 }, "text": "Length (feet)\n100", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 13 }, { "id": "p152.6.15", "order": 21, "type": "table_cell", "bbox": { "l": 143.354569, "t": 511.302451, "r": 275.988028, "b": 473.417872 }, "text": "Slope (ft/ft) Velocity (ft/sec) Capacity (cfs)\n0.0050 0.05", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 14 }, { "id": "p152.6.16", "order": 22, "type": "table_cell", "bbox": { "l": 68.76, "t": 461.382452, "r": 89.492517, "b": 449.417872 }, "text": "13.6", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p152.6.17", "order": 23, "type": "table_cell", "bbox": { "l": 114.944052, "t": 461.382452, "r": 132.697945, "b": 449.417872 }, "text": "579", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p152.6.18", "order": 24, "type": "table_cell", "bbox": { "l": 143.354569, "t": 461.382452, "r": 223.886744, "b": 449.417872 }, "text": "0.0200 0.71", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p152.6.19", "order": 25, "type": "table_cell", "bbox": { "l": 68.76, "t": 435.462454, "r": 89.492517, "b": 423.497874 }, "text": "49.8", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p152.6.20", "order": 26, "type": "table_cell", "bbox": { "l": 114.944052, "t": 435.462454, "r": 132.697945, "b": 423.497874 }, "text": "679", "attrs": { "row": 6, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p152.6.21", "order": 27, "type": "table_cell", "bbox": { "l": 143.354569, "t": 435.462454, "r": 166.947862, "b": 423.497874 }, "text": "Total", "attrs": { "row": 6, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 } ], "reading_order": 5 }, { "id": "p152.7", "order": 28, "type": "caption", "bbox": { "l": 197.52, "t": 410.4, "r": 414.24, "b": 396 }, "text": "Subcatchment 179S: DA P0 Pervious", "attrs": { "block_label": "figure_title" }, "reading_order": 6 }, { "id": "p152.8", "order": 29, "type": "figure", "bbox": { "l": 64.08, "t": 390.24, "r": 497.04, "b": 123.36 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n0.3\n0.28 cfs\nNOAA 24-hr D\n0.28\n0.26\n0.24 25-Year Rainfall=6.68\"\n0.22 Runoff Area=336,250 sf\nRunoff Volume=8,387 cf\n0.2\n0.18\n(cfs) 0.16 Runoff Depth=0.30\"\nFlow 0.14 Flow Length=679'\nTc=49.8 min\n0.12\n0.1\n0.08 CN=33/0\n0.06\n0.04\n0.02\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72\nTime (hours)" }, "reading_order": 7 }, { "id": "p152.9", "order": 30, "type": "footer", "bbox": { "l": 510.24, "t": 369.12, "r": 547.2, "b": 357.12 }, "text": "", "attrs": { "block_label": "footer_image" }, "reading_order": 8 } ] }, { "document_id": 16592, "page": 153, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 43, "counts_by_type": { "caption": 2, "figure": 2, "footer": 1, "footnote": 1, "table": 1, "table_cell": 33, "text": 2, "title": 1 }, "build_ms": 4, "items": [ { "id": "p153.1", "order": 1, "type": "figure", "bbox": { "l": 53.28, "t": 738.24, "r": 560.88, "b": 698.88 }, "text": "", "attrs": { "role": "page_header", "block_label": "header_image", "embedded_text": "102 Sams -REV 12-02-25 NOAA 24-hr D 25-Year Rainfall=6.68\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 40" }, "reading_order": 0 }, { "id": "p153.2", "order": 2, "type": "title", "bbox": { "l": 154.8, "t": 687.36, "r": 457.2, "b": 672.48 }, "text": "Summary for Subcatchment 180S: DA P4 (Pervious)", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p153.3", "order": 3, "type": "text", "bbox": { "l": 53.76, "t": 660.24, "r": 463.92, "b": 634.32 }, "text": "Runoff = 0.32 cfs @ 12.57 hrs, Volume= 4,216 cf, Depth= 0.66\"\nRouted to Pond 183P : WQ Infiltration Basin #1", "reading_order": 2 }, { "id": "p153.4", "order": 4, "type": "text", "bbox": { "l": 52.56, "t": 623.52, "r": 611.04, "b": 598.32 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious, Time Span= 0.00-72.00 hrs, dt= NOAA 24-hr D 25-Year Rainfall=6.68\"", "reading_order": 3 }, { "id": "p153.5", "order": 5, "type": "table", "bbox": { "l": 52.56, "t": 588.48, "r": 559.2, "b": 447.497874 }, "text": "", "attrs": { "block_label": "table", "n_rows": 7, "n_cols": 6, "integrity": { "cells_checked": 28, "cells_flagged": 0 } }, "children": [ { "id": "p153.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 86.520001, "t": 587.142469, "r": 127.590159, "b": 575.177889 }, "text": "Area (sf)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p153.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 144.389888, "t": 587.142469, "r": 159.742288, "b": 575.177889 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p153.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 286.601768, "t": 535.302451, "r": 340.102911, "b": 523.337871 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p153.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 95.280001, "t": 559.302451, "r": 127.805562, "b": 547.337871 }, "text": "76,971", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 3 }, { "id": "p153.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 148.003832, "t": 559.302451, "r": 159.753993, "b": 547.337871 }, "text": "39", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p153.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 174.16295, "t": 573.222448, "r": 333.31717, "b": 561.257868 }, "text": ">75% Grass cover, Good, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 5 }, { "id": "p153.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 95.280001, "t": 573.222448, "r": 127.805562, "b": 561.257868 }, "text": "76,971", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 6 }, { "id": "p153.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 148.003832, "t": 573.222448, "r": 159.753993, "b": 561.257868 }, "text": "39", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p153.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 174.16295, "t": 559.302451, "r": 286.000299, "b": 547.337871 }, "text": "100.00% Pervious Area", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 8 }, { "id": "p153.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 65.040001, "t": 535.302451, "r": 89.40872, "b": 511.337871 }, "text": "Tc (min)", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p153.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 100.248415, "t": 535.302451, "r": 132.666767, "b": 511.337871 }, "text": "Length (feet)", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p153.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 148.683866, "t": 535.302451, "r": 175.895438, "b": 511.337871 }, "text": "Slope (ft/ft)", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 }, { "id": "p153.5.13", "order": 18, "type": "table_cell", "bbox": { "l": 186.552062, "t": 535.302451, "r": 223.968178, "b": 511.337871 }, "text": "Velocity (ft/sec)", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 12 }, { "id": "p153.5.14", "order": 19, "type": "table_cell", "bbox": { "l": 234.581918, "t": 535.302451, "r": 275.988028, "b": 511.337871 }, "text": "Capacity (cfs)", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p153.5.15", "order": 20, "type": "table_cell", "bbox": { "l": 174.08692, "t": 587.142469, "r": 227.564819, "b": 575.177889 }, "text": "Description", "attrs": { "row": 3, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p153.5.16", "order": 21, "type": "table_cell", "bbox": { "l": 68.76, "t": 509.382452, "r": 89.492517, "b": 497.417872 }, "text": "12.5", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p153.5.17", "order": 22, "type": "table_cell", "bbox": { "l": 114.944052, "t": 509.382452, "r": 132.697945, "b": 497.417872 }, "text": "100", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p153.5.18", "order": 23, "type": "table_cell", "bbox": { "l": 143.354569, "t": 509.382452, "r": 175.880131, "b": 497.417872 }, "text": "0.0100", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p153.5.19", "order": 24, "type": "table_cell", "bbox": { "l": 203.154228, "t": 509.382452, "r": 223.886744, "b": 497.417872 }, "text": "0.13", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p153.5.20", "order": 25, "type": "table_cell", "bbox": { "l": 390.32, "t": 509.6229, "r": 474.76, "b": 489.9086 }, "text": "", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 19 }, { "id": "p153.5.21", "order": 26, "type": "table_cell", "bbox": { "l": 286.679993, "t": 509.26245, "r": 452.820335, "b": 485.417872 }, "text": "Sheet Flow, Grass: Short n= 0.150 P2= 3.42\"", "attrs": { "row": 4, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p153.5.22", "order": 27, "type": "table_cell", "bbox": { "l": 74.639998, "t": 485.382452, "r": 89.475992, "b": 473.417872 }, "text": "2.3", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p153.5.23", "order": 28, "type": "table_cell", "bbox": { "l": 120.82405, "t": 485.382452, "r": 132.68142, "b": 473.417872 }, "text": "96", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 22 }, { "id": "p153.5.24", "order": 29, "type": "table_cell", "bbox": { "l": 143.445254, "t": 485.382452, "r": 175.863606, "b": 473.417872 }, "text": "0.0100", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 23 }, { "id": "p153.5.25", "order": 30, "type": "table_cell", "bbox": { "l": 203.137703, "t": 485.382452, "r": 223.870219, "b": 473.417872 }, "text": "0.70", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 24 }, { "id": "p153.5.26", "order": 31, "type": "table_cell", "bbox": { "l": 390.32, "t": 489.9086, "r": 474.76, "b": 470.1943 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 25 }, { "id": "p153.5.27", "order": 32, "type": "table_cell", "bbox": { "l": 286.679993, "t": 485.26245, "r": 446.147004, "b": 461.417872 }, "text": "Shallow Concentrated Flow, Short Grass Pasture Kv= 7.0 fps", "attrs": { "row": 5, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 26 }, { "id": "p153.5.28", "order": 33, "type": "table_cell", "bbox": { "l": 68.76, "t": 459.462454, "r": 89.492517, "b": 447.497874 }, "text": "14.8", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 27 }, { "id": "p153.5.29", "order": 34, "type": "table_cell", "bbox": { "l": 114.944052, "t": 459.462454, "r": 132.697945, "b": 447.497874 }, "text": "196", "attrs": { "row": 6, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 28 }, { "id": "p153.5.30", "order": 35, "type": "table_cell", "bbox": { "l": 143.354569, "t": 459.462454, "r": 166.947862, "b": 447.497874 }, "text": "Total", "attrs": { "row": 6, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 29 }, { "id": "p153.5.31", "order": 36, "type": "table_cell", "bbox": { "l": 305.88, "t": 470.1943, "r": 390.32, "b": 450.48 }, "text": "", "attrs": { "row": 6, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 30 }, { "id": "p153.5.32", "order": 37, "type": "table_cell", "bbox": { "l": 390.32, "t": 470.1943, "r": 474.76, "b": 450.48 }, "text": "", "attrs": { "row": 6, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 31 }, { "id": "p153.5.33", "order": 38, "type": "table_cell", "bbox": { "l": 474.76, "t": 470.1943, "r": 559.2, "b": 450.48 }, "text": "", "attrs": { "row": 6, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 32 } ], "reading_order": 4 }, { "id": "p153.6", "order": 39, "type": "caption", "bbox": { "l": 193.2, "t": 435.12, "r": 417.84, "b": 420 }, "text": "Subcatchment 180S: DA P4 (Pervious)", "attrs": { "block_label": "figure_title" }, "reading_order": 5 }, { "id": "p153.7", "order": 40, "type": "caption", "bbox": { "l": 254.64, "t": 414.48, "r": 306, "b": 404.16 }, "text": "Hydrograph", "attrs": { "block_label": "figure_title" }, "reading_order": 6 }, { "id": "p153.8", "order": 41, "type": "figure", "bbox": { "l": 63.6, "t": 411.12, "r": 496.08, "b": 151.44 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "0.34\n0.32 cfs\nNOAA 24-hr D\n0.32\n0.3\n0.28 25-Year Rainfall=6.68\"\nRunoff Area=76,971 sf\n0.26\n0.24\n0.22 Runoff Volume=4,216 cf\n(cfs) Runoff Depth=0.66\"\n0.2\n0.18\nFlow 0.16 Flow Length=196'\n0.14\n0.12 Slope=0.0100 '/'\n0.1 Tc=14.8 min\n0.08\n0.06 CN=39/0\n0.04\n0.02\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72" }, "reading_order": 7 }, { "id": "p153.9", "order": 42, "type": "footnote", "bbox": { "l": 90.24, "t": 167.52, "r": 493.2, "b": 148.56 }, "text": "0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72 Time (hours)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 8 }, { "id": "p153.10", "order": 43, "type": "footer", "bbox": { "l": 511.92, "t": 392.64, "r": 546, "b": 381.6 }, "text": "", "attrs": { "block_label": "footer_image" }, "reading_order": 9 } ] }, { "document_id": 16592, "page": 154, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 41, "counts_by_type": { "caption": 2, "figure": 1, "footer": 1, "header": 1, "table": 1, "table_cell": 31, "text": 3, "title": 1 }, "build_ms": 4, "items": [ { "id": "p154.1", "order": 1, "type": "header", "bbox": { "l": 53.52, "t": 738.48, "r": 559.92, "b": 698.64 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 25-Year Rainfall=6.68\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 41", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p154.2", "order": 2, "type": "title", "bbox": { "l": 148.32, "t": 687.6, "r": 463.92, "b": 672.24 }, "text": "Summary for Subcatchment 181S: DA P6 (Impervious)", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p154.3", "order": 3, "type": "text", "bbox": { "l": 53.52, "t": 660.24, "r": 462.96, "b": 634.56 }, "text": "Runoff = 0.84 cfs @ 12.10 hrs, Volume= 2,818 cf, Depth= 6.44\"\nRouted to Link 185L : POA", "reading_order": 2 }, { "id": "p154.4", "order": 4, "type": "text", "bbox": { "l": 52.08, "t": 623.76, "r": 611.52, "b": 598.56 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Split Pervious/Imperv. UI as Pervious, Time Span= 0.00-72.00 hrs, dt= NOAA 24-hr D 25-Year Rainfall=6.68\"", "reading_order": 3 }, { "id": "p154.5", "order": 5, "type": "table", "bbox": { "l": 52.56, "t": 588.48, "r": 559.2, "b": 447.497874 }, "text": "", "attrs": { "block_label": "table", "n_rows": 6, "n_cols": 6, "integrity": { "cells_checked": 25, "cells_flagged": 0 } }, "children": [ { "id": "p154.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 86.520001, "t": 587.142469, "r": 127.590159, "b": 575.177889 }, "text": "Area (sf)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p154.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 144.389888, "t": 587.142469, "r": 159.742288, "b": 575.177889 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p154.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 286.601768, "t": 535.302451, "r": 340.102911, "b": 523.337871 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 3, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p154.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 52.56, "t": 573.2533, "r": 137, "b": 558.0267 }, "text": "", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 3 }, { "id": "p154.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 101.160004, "t": 573.222448, "r": 127.789043, "b": 547.337871 }, "text": "5,250\n5,250", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p154.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 147.987313, "t": 573.222448, "r": 159.844683, "b": 547.337871 }, "text": "98\n98", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p154.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 174.146431, "t": 573.222448, "r": 296.653009, "b": 547.337871 }, "text": "Paved parking, HSG A\n100.00% Impervious Area", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 3, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p154.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 65.040001, "t": 535.302451, "r": 89.40872, "b": 511.337871 }, "text": "Tc (min)", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p154.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 100.248415, "t": 535.302451, "r": 132.666767, "b": 511.337871 }, "text": "Length (feet)", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p154.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 148.683866, "t": 535.302451, "r": 175.895438, "b": 511.337871 }, "text": "Slope (ft/ft)", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p154.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 186.552062, "t": 535.302451, "r": 223.968178, "b": 511.337871 }, "text": "Velocity (ft/sec)", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p154.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 234.581918, "t": 535.302451, "r": 275.988028, "b": 511.337871 }, "text": "Capacity (cfs)", "attrs": { "row": 2, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 }, { "id": "p154.5.13", "order": 18, "type": "table_cell", "bbox": { "l": 174.08692, "t": 587.142469, "r": 227.564819, "b": 575.177889 }, "text": "Description", "attrs": { "row": 2, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 12 }, { "id": "p154.5.14", "order": 19, "type": "table_cell", "bbox": { "l": 74.639998, "t": 509.382452, "r": 89.475992, "b": 497.417872 }, "text": "0.8", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p154.5.15", "order": 20, "type": "table_cell", "bbox": { "l": 114.927527, "t": 509.382452, "r": 132.68142, "b": 497.417872 }, "text": "100", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p154.5.16", "order": 21, "type": "table_cell", "bbox": { "l": 143.445254, "t": 509.382452, "r": 175.863606, "b": 497.417872 }, "text": "0.0500", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p154.5.17", "order": 22, "type": "table_cell", "bbox": { "l": 203.137703, "t": 509.382452, "r": 223.870219, "b": 497.417872 }, "text": "2.05", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p154.5.18", "order": 23, "type": "table_cell", "bbox": { "l": 390.32, "t": 527.5733, "r": 474.76, "b": 512.3467 }, "text": "", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 17 }, { "id": "p154.5.19", "order": 24, "type": "table_cell", "bbox": { "l": 286.679993, "t": 509.26245, "r": 344.648169, "b": 497.29787 }, "text": "Sheet Flow,", "attrs": { "row": 3, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p154.5.20", "order": 25, "type": "table_cell", "bbox": { "l": 74.639998, "t": 485.382452, "r": 89.475992, "b": 473.417872 }, "text": "0.6", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p154.5.21", "order": 26, "type": "table_cell", "bbox": { "l": 120.82405, "t": 485.382452, "r": 132.68142, "b": 473.417872 }, "text": "50", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p154.5.22", "order": 27, "type": "table_cell", "bbox": { "l": 143.445254, "t": 485.382452, "r": 175.863606, "b": 473.417872 }, "text": "0.0050", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p154.5.23", "order": 28, "type": "table_cell", "bbox": { "l": 203.137703, "t": 485.382452, "r": 223.870219, "b": 473.417872 }, "text": "1.44", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 22 }, { "id": "p154.5.24", "order": 29, "type": "table_cell", "bbox": { "l": 390.32, "t": 512.3467, "r": 474.76, "b": 497.12 }, "text": "", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 23 }, { "id": "p154.5.25", "order": 30, "type": "table_cell", "bbox": { "l": 286.679993, "t": 497.382452, "r": 473.002733, "b": 461.417872 }, "text": "Smooth surfaces n= 0.011 P2= 3.42\"\nShallow Concentrated Flow,\nPaved Kv= 20.3 fps", "attrs": { "row": 4, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 24 }, { "id": "p154.5.26", "order": 31, "type": "table_cell", "bbox": { "l": 74.639998, "t": 459.462454, "r": 89.475992, "b": 447.497874 }, "text": "1.4", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 25 }, { "id": "p154.5.27", "order": 32, "type": "table_cell", "bbox": { "l": 114.927527, "t": 459.462454, "r": 132.68142, "b": 447.497874 }, "text": "150", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 26 }, { "id": "p154.5.28", "order": 33, "type": "table_cell", "bbox": { "l": 143.445254, "t": 459.462454, "r": 167.029543, "b": 447.497874 }, "text": "Total", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 27 }, { "id": "p154.5.29", "order": 34, "type": "table_cell", "bbox": { "l": 305.88, "t": 466.6667, "r": 390.32, "b": 451.44 }, "text": "", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 28 }, { "id": "p154.5.30", "order": 35, "type": "table_cell", "bbox": { "l": 390.32, "t": 466.6667, "r": 474.76, "b": 451.44 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 29 }, { "id": "p154.5.31", "order": 36, "type": "table_cell", "bbox": { "l": 474.76, "t": 466.6667, "r": 559.2, "b": 451.44 }, "text": "", "attrs": { "row": 5, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 30 } ], "reading_order": 4 }, { "id": "p154.6", "order": 37, "type": "caption", "bbox": { "l": 186.96, "t": 435.12, "r": 424.56, "b": 419.76 }, "text": "Subcatchment 181S: DA P6 (Impervious)", "attrs": { "block_label": "figure_title" }, "reading_order": 5 }, { "id": "p154.7", "order": 38, "type": "caption", "bbox": { "l": 254.64, "t": 414.48, "r": 306, "b": 403.92 }, "text": "Hydrograph", "attrs": { "block_label": "figure_title" }, "reading_order": 6 }, { "id": "p154.8", "order": 39, "type": "figure", "bbox": { "l": 63.6, "t": 412.08, "r": 497.28, "b": 149.28 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n0.9\n0.84 cfs\n0.85\n0.8 NOAA 24-hr D\n25-Year Rainfall=6.68\"\n0.75\n0.7\n0.65 Runoff Area=5,250 sf\nRunoff Volume=2,818 cf\n0.6\n0.55\n(cfs) 0.5 Runoff Depth=6.44\"\n0.45\nFlow 0.4 Flow Length=150'\nTc=1.4 min\n0.35\n0.3\n0.25 CN=0/98\n0.2\n0.15\n0.1\n0.05\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72\nTime (hours)" }, "reading_order": 7 }, { "id": "p154.9", "order": 40, "type": "text", "bbox": { "l": 267.6, "t": 155.76, "r": 315.36, "b": 147.12 }, "text": "Time (hours)", "attrs": { "block_label": "number" }, "reading_order": 8 }, { "id": "p154.10", "order": 41, "type": "footer", "bbox": { "l": 511.44, "t": 392.64, "r": 546.24, "b": 381.6 }, "text": "", "attrs": { "block_label": "footer_image" }, "reading_order": 9 } ] }, { "document_id": 16592, "page": 155, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 36, "counts_by_type": { "footnote": 3, "header": 1, "heading": 1, "table": 3, "table_cell": 28 }, "build_ms": 10, "items": [ { "id": "p155.1", "order": 1, "type": "header", "bbox": { "l": 53.52, "t": 738.72, "r": 561.12, "b": 698.4 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 25-Year Rainfall=6.68\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 42", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p155.2", "order": 2, "type": "heading", "bbox": { "l": 162, "t": 687.84, "r": 449.28, "b": 672.48 }, "text": "Summary for Pond 183P: WQ Infiltration Basin #1", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p155.3", "order": 3, "type": "table", "bbox": { "l": 54, "t": 669.36, "r": 523.2, "b": 511.44 }, "text": "", "attrs": { "block_label": "table", "n_rows": 8, "n_cols": 1, "integrity": { "cells_checked": 8, "cells_flagged": 2, "flags": [ { "row": 3, "col": 0, "coverage": 0.5, "text": "Discarded = 0.00 cfs @ 0.00 hrs, Volume= 0 cf" }, { "row": 4, "col": 0, "coverage": 0, "text": "Primary = 5.91 cfs @ 12.12 hrs, Volume= 17,388 cf" } ] } }, "children": [ { "id": "p155.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 54.48, "t": 669.36, "r": 523.2, "b": 649.62 }, "text": "Inflow Area = 108,596 sf, 29.12% Impervious, Inflow Depth = 2.34\" for 25-Year event", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 0 }, { "id": "p155.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 54.48, "t": 649.62, "r": 523.2, "b": 629.88 }, "text": "Inflow = 4.63 cfs @ 12.11 hrs, Volume= 21,191 cf", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 1 }, { "id": "p155.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 54.48, "t": 629.88, "r": 523.2, "b": 610.14 }, "text": "Outflow = 5.91 cfs @ 12.12 hrs, Volume= 17,388 cf, Atten= 0%, Lag= 0.5 min", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 2 }, { "id": "p155.3.4", "order": 7, "type": "table_cell", "bbox": { "l": 54.48, "t": 610.14, "r": 523.2, "b": 590.4 }, "text": "Discarded = 0.00 cfs @ 0.00 hrs, Volume= 0 cf", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 3 }, { "id": "p155.3.5", "order": 8, "type": "table_cell", "bbox": { "l": 54.48, "t": 590.4, "r": 523.2, "b": 570.66 }, "text": "Primary = 5.91 cfs @ 12.12 hrs, Volume= 17,388 cf", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 4 }, { "id": "p155.3.6", "order": 9, "type": "table_cell", "bbox": { "l": 69.023569, "t": 599.142469, "r": 195.539615, "b": 587.177889 }, "text": "Routed to Link 185L : POA", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p155.3.7", "order": 10, "type": "table_cell", "bbox": { "l": 54, "t": 575.142469, "r": 511.516876, "b": 539.177889 }, "text": "Routing by Stor-Ind method, Time Span= 0.00-72.00 hrs, dt= 0.01 hrs\\nStarting Elev= 97.00' Surf.Area= 6,008 sf Storage= 10,212 cf\\nPeak Elev= 99.23' @ 12.12 hrs Surf.Area= 6,981 sf Storage= 16,706 cf (6,495 cf above start)", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p155.3.8", "order": 11, "type": "table_cell", "bbox": { "l": 54, "t": 527.142469, "r": 407.986212, "b": 515.177889 }, "text": "Plug-Flow detention time= 627.7 min calculated for 7,176 cf (34% of inflow)", "attrs": { "row": 7, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 } ], "reading_order": 2 }, { "id": "p155.4", "order": 12, "type": "table", "bbox": { "l": 51.84, "t": 492.72, "r": 558.48, "b": 376.32 }, "text": "", "attrs": { "block_label": "table", "n_rows": 2, "n_cols": 5, "integrity": { "cells_checked": 8, "cells_flagged": 0 } }, "children": [ { "id": "p155.4.1", "order": 13, "type": "table_cell", "bbox": { "l": 54, "t": 491.142469, "r": 90.142207, "b": 465.257868 }, "text": "Volume\n#1", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p155.4.2", "order": 14, "type": "table_cell", "bbox": { "l": 120.355217, "t": 491.142469, "r": 148.95691, "b": 465.257868 }, "text": "Invert\n95.00'", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p155.4.3", "order": 15, "type": "table_cell", "bbox": { "l": 170.997811, "t": 491.142469, "r": 234.422951, "b": 465.257868 }, "text": "Avail.Storage\n16,706 cf", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p155.4.4", "order": 16, "type": "table_cell", "bbox": { "l": 246.044461, "t": 491.142469, "r": 502.944852, "b": 465.137889 }, "text": "Storage Description\nCustom Stage Data (Prismatic) Listed below (Recalc)", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p155.4.5", "order": 17, "type": "table_cell", "bbox": { "l": 57.360002, "t": 453.222448, "r": 101.273013, "b": 379.337871 }, "text": "Elevation\\n(feet)\n95.00\n96.00\n97.00\n98.00", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p155.4.6", "order": 18, "type": "table_cell", "bbox": { "l": 140.447365, "t": 453.222448, "r": 185.72688, "b": 379.337871 }, "text": "Surf.Area\\n(sq-ft)\n4,231\n5,092\n6,008\n6,981", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p155.4.7", "order": 19, "type": "table_cell", "bbox": { "l": 227.371027, "t": 453.222448, "r": 354.642567, "b": 379.337871 }, "text": "Inc.Store\\n(cubic-feet)\n0\n4,662\n5,550\n6,495", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p155.4.8", "order": 20, "type": "table_cell", "bbox": { "l": 216.402998, "t": 453.222448, "r": 354.689052, "b": 379.337871 }, "text": "Cum.Store\\n(cubic-feet)\n0\n4,662\n10,212\n16,706", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 7 } ], "reading_order": 3 }, { "id": "p155.5", "order": 21, "type": "table", "bbox": { "l": 52.08, "t": 367.92, "r": 555.84, "b": 278.4 }, "text": "", "attrs": { "block_label": "table", "n_rows": 3, "n_cols": 4, "integrity": { "cells_checked": 12, "cells_flagged": 0 } }, "children": [ { "id": "p155.5.1", "order": 22, "type": "table_cell", "bbox": { "l": 54, "t": 367.302451, "r": 86.679256, "b": 355.337871 }, "text": "Device", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p155.5.2", "order": 23, "type": "table_cell", "bbox": { "l": 98.407976, "t": 367.302451, "r": 135.030741, "b": 355.337871 }, "text": "Routing", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p155.5.3", "order": 24, "type": "table_cell", "bbox": { "l": 182.045624, "t": 367.302451, "r": 208.824841, "b": 355.337871 }, "text": "Invert", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p155.5.4", "order": 25, "type": "table_cell", "bbox": { "l": 220.650048, "t": 367.302451, "r": 290.014595, "b": 355.337871 }, "text": "Outlet Devices", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 3 }, { "id": "p155.5.5", "order": 26, "type": "table_cell", "bbox": { "l": 70.320002, "t": 353.382452, "r": 82.177372, "b": 341.417872 }, "text": "#1", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p155.5.6", "order": 27, "type": "table_cell", "bbox": { "l": 98.408891, "t": 353.382452, "r": 135.204992, "b": 341.417872 }, "text": "Primary", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p155.5.7", "order": 28, "type": "table_cell", "bbox": { "l": 354.69794, "t": 329.382452, "r": 383.299634, "b": 317.417872 }, "text": "97.60'", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p155.5.8", "order": 29, "type": "table_cell", "bbox": { "l": 220.679993, "t": 353.262472, "r": 512.979659, "b": 305.417872 }, "text": "15.0\" Round Culvert to Subsurface Basin\\nL= 35.0' RCP, square edge headwall, Ke= 0.500\\nInlet / Outlet Invert= 95.00' / 97.60' S= -0.0743'' Cc= 0.900\\nn= 0.012 Corrugated PP, smooth interior, Flow Area= 1.23 sf", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p155.5.9", "order": 30, "type": "table_cell", "bbox": { "l": 70.320002, "t": 305.382452, "r": 82.177372, "b": 281.417872 }, "text": "#2\n#3", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 8 }, { "id": "p155.5.10", "order": 31, "type": "table_cell", "bbox": { "l": 98.408891, "t": 305.382452, "r": 146.474595, "b": 281.417872 }, "text": "Device 1\nDiscarded", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 9 }, { "id": "p155.5.11", "order": 32, "type": "table_cell", "bbox": { "l": 180.288471, "t": 305.382452, "r": 208.918642, "b": 281.417872 }, "text": "97.00'\n95.00'", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 10 }, { "id": "p155.5.12", "order": 33, "type": "table_cell", "bbox": { "l": 220.679993, "t": 305.382452, "r": 531.965762, "b": 281.297892 }, "text": "4.0' long Sharp-Crested Rectangular Weir 2 End Contraction(s)\n3.100 in/hr Exfiltration X 0.00 over Surface area", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 11 } ], "reading_order": 4 }, { "id": "p155.6", "order": 34, "type": "footnote", "bbox": { "l": 51.6, "t": 528.96, "r": 409.92, "b": 502.08 }, "text": "Plug-Flow detention time= 627.7 min calculated for 7,176 cf (34% of inflow) Center-of-Mass det. time= 157.8 min (947.5 - 789.7)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 5 }, { "id": "p155.7", "order": 35, "type": "footnote", "bbox": { "l": 51.6, "t": 270, "r": 423.6, "b": 244.32 }, "text": "Discarded OutFlow Max=0.00 cfs @ 0.00 hrs HW=97.00' (Free Discharge)\n3=Exfiltration (Controls 0.00 cfs)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 6 }, { "id": "p155.8", "order": 36, "type": "footnote", "bbox": { "l": 52.08, "t": 234.72, "r": 469.68, "b": 196.32 }, "text": "Primary OutFlow Max=5.86 cfs @ 12.12 hrs HW=99.21' (Free Discharge)\n1=Culvert to Subsurface Basin (Inlet Controls 5.86 cfs @ 4.77 fps)\n2=Sharp-Crested Rectangular Weir (Passes 5.86 cfs of 36.01 cfs potential flow)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 7 } ] }, { "document_id": 16592, "page": 156, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 10, "counts_by_type": { "caption": 1, "figure": 1, "footnote": 2, "form_field": 1, "header": 3, "text": 2 }, "build_ms": 1, "items": [ { "id": "p156.1", "order": 1, "type": "header", "bbox": { "l": 361.2, "t": 738.72, "r": 560.64, "b": 711.6 }, "text": "NOAA 24-hr D 25-Year Rainfall=6.68\"\nPrinted 04/12/2025", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p156.2", "order": 2, "type": "header", "bbox": { "l": 53.04, "t": 738, "r": 395.28, "b": 699.6 }, "text": "102 Sams -REV 12-02-25\nPrepared by Haler Consulting\nHydroCAD[p156.2.2] 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "children": [ { "id": "p156.2.1", "order": 3, "type": "form_field", "bbox": { "l": 95.82, "t": 712.4, "r": 107.82, "b": 700.4 }, "text": "", "attrs": { "field_kind": "radio", "label": "ledR 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions …", "source": "glyph_estimate", "bbox_estimated": true }, "reading_order": 0 }, { "id": "p156.2.2", "order": 4, "type": "text", "bbox": { "l": 53.04, "t": 738, "r": 395.28, "b": 699.6 }, "text": "^{\\circledR}", "attrs": { "inline": true, "text_offset": 60, "text_span": 10, "bbox_estimated": true }, "reading_order": 1 } ], "level": 2, "reading_order": 1 }, { "id": "p156.3", "order": 5, "type": "header", "bbox": { "l": 517.2, "t": 711.12, "r": 559.2, "b": 699.36 }, "text": "Page 43", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 2 }, { "id": "p156.4", "order": 6, "type": "caption", "bbox": { "l": 200.64, "t": 687.84, "r": 409.44, "b": 672.96 }, "text": "Pond 183P: WQ Infiltration Basin #1", "attrs": { "block_label": "figure_title" }, "reading_order": 3 }, { "id": "p156.5", "order": 7, "type": "figure", "bbox": { "l": 66.24, "t": 666.48, "r": 486.96, "b": 409.2 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nInflow Area=108,596 sf\n5.91 cfs\n6 Peak Elev=99.23'\n5.91 cfs\n4.63 cfs\nStorage=16,706 cf\n5\n4\n(cfs)\nFlow\n3\n2\n1\n0.00 cfs\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72" }, "reading_order": 4 }, { "id": "p156.6", "order": 8, "type": "text", "bbox": { "l": 497.04, "t": 644.88, "r": 546.72, "b": 610.32 }, "text": "Inflow Outflow Discarded Primary", "attrs": { "block_label": "aside_text" }, "reading_order": 5 }, { "id": "p156.7", "order": 9, "type": "footnote", "bbox": { "l": 65.28, "t": 537.6, "r": 73.92, "b": 500.16 }, "text": "Flow (cfs)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 6 }, { "id": "p156.8", "order": 10, "type": "footnote", "bbox": { "l": 84.48, "t": 420.24, "r": 449.52, "b": 400.8 }, "text": "0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72 Time (hours)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 7 } ] }, { "document_id": 16592, "page": 157, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 11, "counts_by_type": { "caption": 1, "header": 1, "table": 1, "table_cell": 8 }, "build_ms": 28, "items": [ { "id": "p157.1", "order": 1, "type": "header", "bbox": { "l": 53.04, "t": 738.72, "r": 561.12, "b": 698.64 }, "text": "102 Sams - REV 12-02-25 NOAA 24-hr D 25-Year Rainfall=6.68\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 44", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p157.2", "order": 2, "type": "caption", "bbox": { "l": 153.6, "t": 687.84, "r": 457.44, "b": 672.96 }, "text": "Stage-Discharge for Pond 183P: WQ Infiltration Basin #1", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p157.3", "order": 3, "type": "table", "bbox": { "l": 54.48, "t": 663.12, "r": 506.4, "b": 58.32 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 8, "integrity": { "cells_checked": 8, "cells_flagged": 0 } }, "children": [ { "id": "p157.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 57.479999, "t": 661.126246, "r": 98.137287, "b": 64.158859 }, "text": "Elevation (feet)\n95.00\n95.05\n95.10\n95.15\n95.20\n95.25\n95.30\n95.35\n95.40\n95.45\n95.50\n95.55\n95.60\n95.65\n95.70\n95.75\n95.80\n95.85\n95.90\n95.95\n96.00\n96.05\n96.10\n96.15\n96.20\n96.25\n96.30\n96.35\n96.40\n96.45\n96.50\n96.55\n96.60\n96.65\n96.70\n96.75\n96.80\n96.85\n96.90\n96.95\n97.00\n97.05\n97.10\n97.15\n97.20\n97.25\n97.30\n97.35\n97.40\n97.45\n97.50\n97.55", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p157.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 109.680004, "t": 661.126246, "r": 154.533694, "b": 64.158859 }, "text": "Discharge (cfs)\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p157.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 166.080002, "t": 661.126246, "r": 211.180733, "b": 64.158859 }, "text": "Discarded (cfs)\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p157.3.4", "order": 7, "type": "table_cell", "bbox": { "l": 233.160004, "t": 661.126246, "r": 267.536512, "b": 64.158859 }, "text": "Primary (cfs)\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p157.3.5", "order": 8, "type": "table_cell", "bbox": { "l": 291, "t": 661.126246, "r": 331.657282, "b": 273.918854 }, "text": "Elevation (feet)\n97.60\n97.65\n97.70\n97.75\n97.80\n97.85\n97.90\n97.95\n98.00\n98.05\n98.10\n98.15\n98.20\n98.25\n98.30\n98.35\n98.40\n98.45\n98.50\n98.55\n98.60\n98.65\n98.70\n98.75\n98.80\n98.85\n98.90\n98.95\n99.00\n99.05\n99.10\n99.15\n99.20", "attrs": { "row": 0, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p157.3.6", "order": 9, "type": "table_cell", "bbox": { "l": 343.200005, "t": 661.126246, "r": 388.300713, "b": 273.918854 }, "text": "Discharge (cfs)\n0.00\n0.01\n0.05\n0.11\n0.19\n0.30\n0.42\n0.57\n0.73\n0.91\n1.10\n1.31\n1.54\n1.77\n2.01\n2.27\n2.53\n2.79\n3.06\n3.32\n3.58\n3.84\n4.08\n4.31\n4.52\n4.67\n4.85\n5.03\n5.20\n5.37\n5.53\n5.68\n5.83", "attrs": { "row": 0, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p157.3.7", "order": 10, "type": "table_cell", "bbox": { "l": 399.599991, "t": 661.126246, "r": 444.395578, "b": 273.918854 }, "text": "Discarded (cfs)\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00", "attrs": { "row": 0, "col": 6, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p157.3.8", "order": 11, "type": "table_cell", "bbox": { "l": 466.679993, "t": 661.126246, "r": 501.100731, "b": 273.918854 }, "text": "Primary (cfs)\n0.00\n0.01\n0.05\n0.11\n0.19\n0.30\n0.42\n0.57\n0.73\n0.91\n1.10\n1.31\n1.54\n1.77\n2.01\n2.27\n2.53\n2.79\n3.06\n3.32\n3.58\n3.84\n4.08\n4.31\n4.52\n4.67\n4.85\n5.03\n5.20\n5.37\n5.53\n5.68\n5.83", "attrs": { "row": 0, "col": 7, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 7 } ], "reading_order": 2 } ] }, { "document_id": 16592, "page": 158, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 9, "counts_by_type": { "caption": 1, "header": 1, "table": 1, "table_cell": 6 }, "build_ms": 13, "items": [ { "id": "p158.1", "order": 1, "type": "header", "bbox": { "l": 52.8, "t": 738.48, "r": 562.32, "b": 698.64 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 25-Year Rainfall=6.68\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 45", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p158.2", "order": 2, "type": "caption", "bbox": { "l": 144.96, "t": 688.08, "r": 465.6, "b": 672.72 }, "text": "Stage-Area-Storage for Pond 183P: WQ Infiltration Basin #1", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p158.3", "order": 3, "type": "table", "bbox": { "l": 55.92, "t": 662.64, "r": 468.48, "b": 59.04 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 6, "integrity": { "cells_checked": 6, "cells_flagged": 0 } }, "children": [ { "id": "p158.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 57.479999, "t": 661.126246, "r": 98.137287, "b": 64.158859 }, "text": "Elevation (feet)\n95.00\n95.05\n95.10\n95.15\n95.20\n95.25\n95.30\n95.35\n95.40\n95.45\n95.50\n95.55\n95.60\n95.65\n95.70\n95.75\n95.80\n95.85\n95.90\n95.95\n96.00\n96.05\n96.10\n96.15\n96.20\n96.25\n96.30\n96.35\n96.40\n96.45\n96.50\n96.55\n96.60\n96.65\n96.70\n96.75\n96.80\n96.85\n96.90\n96.95\n97.00\n97.05\n97.10\n97.15\n97.20\n97.25\n97.30\n97.35\n97.40\n97.45\n97.50\n97.55", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p158.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 139.439999, "t": 661.126246, "r": 173.816353, "b": 64.158859 }, "text": "Surface (sq-ft)\n4,231\n4,274\n4,317\n4,360\n4,403\n4,446\n4,489\n4,532\n4,575\n4,618\n4,662\n4,705\n4,748\n4,791\n4,834\n4,877\n4,920\n4,963\n5,006\n5,049\n5,092\n5,138\n5,184\n5,229\n5,275\n5,321\n5,367\n5,413\n5,458\n5,504\n5,550\n5,596\n5,642\n5,687\n5,733\n5,779\n5,825\n5,871\n5,916\n5,962\n6,008\n6,057\n6,105\n6,154\n6,203\n6,251\n6,300\n6,349\n6,397\n6,446\n6,495\n6,543", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p158.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 199.55999, "t": 661.126246, "r": 249.524304, "b": 64.158859 }, "text": "Storage (cubic-feet)\n0\n213\n427\n644\n863\n1,085\n1,308\n1,534\n1,761\n1,991\n2,223\n2,457\n2,694\n2,932\n3,173\n3,415\n3,660\n3,907\n4,157\n4,408\n4,662\n4,917\n5,175\n5,436\n5,698\n5,963\n6,230\n6,500\n6,772\n7,046\n7,322\n7,601\n7,882\n8,165\n8,450\n8,738\n9,028\n9,321\n9,615\n9,912\n10,212\n10,513\n10,817\n11,124\n11,433\n11,744\n12,058\n12,374\n12,693\n13,014\n13,337\n13,663", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p158.3.4", "order": 7, "type": "table_cell", "bbox": { "l": 273.240005, "t": 661.126246, "r": 313.897287, "b": 273.918854 }, "text": "Elevation (feet)\n97.60\n97.65\n97.70\n97.75\n97.80\n97.85\n97.90\n97.95\n98.00\n98.05\n98.10\n98.15\n98.20\n98.25\n98.30\n98.35\n98.40\n98.45\n98.50\n98.55\n98.60\n98.65\n98.70\n98.75\n98.80\n98.85\n98.90\n98.95\n99.00\n99.05\n99.10\n99.15\n99.20", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p158.3.5", "order": 8, "type": "table_cell", "bbox": { "l": 355.200005, "t": 661.126246, "r": 389.808242, "b": 273.918854 }, "text": "Surface (sq-ft)\n6,592\n6,640\n6,689\n6,738\n6,786\n6,835\n6,884\n6,932\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981\n6,981", "attrs": { "row": 0, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p158.3.6", "order": 9, "type": "table_cell", "bbox": { "l": 415.320008, "t": 661.126246, "r": 465.558002, "b": 273.918854 }, "text": "Storage (cubic-feet)\n13,991\n14,322\n14,655\n14,991\n15,329\n15,670\n16,013\n16,358\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706\n16,706", "attrs": { "row": 0, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 } ], "reading_order": 2 } ] }, { "document_id": 16592, "page": 159, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 49, "counts_by_type": { "footnote": 4, "header": 1, "heading": 1, "table": 3, "table_cell": 40 }, "build_ms": 10, "items": [ { "id": "p159.1", "order": 1, "type": "header", "bbox": { "l": 53.52, "t": 738.72, "r": 561.12, "b": 698.4 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 25-Year Rainfall=6.68\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 46", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p159.2", "order": 2, "type": "heading", "bbox": { "l": 162.24, "t": 687.6, "r": 450, "b": 672.72 }, "text": "Summary for Pond 184P: WQ Infiltration Basin #2", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p159.3", "order": 3, "type": "table", "bbox": { "l": 52.56, "t": 661.68, "r": 530.64, "b": 587.177889 }, "text": "", "attrs": { "block_label": "table", "n_rows": 4, "n_cols": 5, "integrity": { "cells_checked": 20, "cells_flagged": 3, "flags": [ { "row": 0, "col": 2, "coverage": 0.5, "text": "27.15% Impervious," }, { "row": 0, "col": 3, "coverage": 0.5, "text": "Inflow Depth =" }, { "row": 3, "col": 3, "coverage": 0, "text": "Volume=" } ] } }, "children": [ { "id": "p159.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 54, "t": 659.142458, "r": 107.356451, "b": 647.177878 }, "text": "Inflow Area =", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p159.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 157.764557, "t": 659.142458, "r": 204.64367, "b": 647.177878 }, "text": "86,443 sf,", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p159.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 243.792, "t": 661.68, "r": 339.408, "b": 649.4 }, "text": "27.15% Impervious,", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p159.3.4", "order": 7, "type": "table_cell", "bbox": { "l": 339.408, "t": 661.68, "r": 435.024, "b": 649.4 }, "text": "Inflow Depth =", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "column_header": true, "header_source": "heuristic" }, "reading_order": 3 }, { "id": "p159.3.5", "order": 8, "type": "table_cell", "bbox": { "l": 387.866087, "t": 659.142458, "r": 509.621823, "b": 647.177878 }, "text": "2.23\" for 25-Year event", "attrs": { "row": 0, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 4 }, { "id": "p159.3.6", "order": 9, "type": "table_cell", "bbox": { "l": 54, "t": 647.142458, "r": 82.003121, "b": 635.177878 }, "text": "Inflow =", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p159.3.7", "order": 10, "type": "table_cell", "bbox": { "l": 146.30738, "t": 647.142458, "r": 183.784219, "b": 635.177878 }, "text": "3.06 cfs @", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p159.3.8", "order": 11, "type": "table_cell", "bbox": { "l": 206.48939, "t": 647.142458, "r": 253.797341, "b": 635.177878 }, "text": "12.13 hrs,", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p159.3.9", "order": 12, "type": "table_cell", "bbox": { "l": 259.89396, "t": 647.142458, "r": 302.091703, "b": 635.177878 }, "text": "Volume=", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p159.3.10", "order": 13, "type": "table_cell", "bbox": { "l": 343.335198, "t": 647.142458, "r": 387.105235, "b": 635.177878 }, "text": "16,047 cf", "attrs": { "row": 1, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p159.3.11", "order": 14, "type": "table_cell", "bbox": { "l": 54, "t": 635.142458, "r": 102.065704, "b": 611.177878 }, "text": "Outflow =\nDiscarded =", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 10 }, { "id": "p159.3.12", "order": 15, "type": "table_cell", "bbox": { "l": 146.278902, "t": 635.142458, "r": 183.760976, "b": 611.177878 }, "text": "1.97 cfs @\n0.00 cfs @", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 11 }, { "id": "p159.3.13", "order": 16, "type": "table_cell", "bbox": { "l": 206.466148, "t": 635.142458, "r": 253.806345, "b": 611.177878 }, "text": "12.37 hrs,\n0.00 hrs,", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 12 }, { "id": "p159.3.14", "order": 17, "type": "table_cell", "bbox": { "l": 259.865483, "t": 623.142458, "r": 302.07223, "b": 599.177878 }, "text": "Volume=\nVolume=", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 13 }, { "id": "p159.3.15", "order": 18, "type": "table_cell", "bbox": { "l": 343.386918, "t": 635.142458, "r": 528.248175, "b": 611.177878 }, "text": "12,492 cf, Atten= 35%, Lag= 14.4 min\n0 cf", "attrs": { "row": 2, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 14 }, { "id": "p159.3.16", "order": 19, "type": "table_cell", "bbox": { "l": 54, "t": 611.142458, "r": 195.539615, "b": 587.177889 }, "text": "Primary =\nRouted to Link 185L : POA", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 15 }, { "id": "p159.3.17", "order": 20, "type": "table_cell", "bbox": { "l": 146.255659, "t": 611.142458, "r": 183.732499, "b": 599.177878 }, "text": "1.97 cfs @", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p159.3.18", "order": 21, "type": "table_cell", "bbox": { "l": 206.43767, "t": 611.142458, "r": 253.777868, "b": 599.177878 }, "text": "12.37 hrs,", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p159.3.19", "order": 22, "type": "table_cell", "bbox": { "l": 339.408, "t": 612.56, "r": 435.024, "b": 600.28 }, "text": "Volume=", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 18 }, { "id": "p159.3.20", "order": 23, "type": "table_cell", "bbox": { "l": 343.315724, "t": 611.142458, "r": 387.085761, "b": 599.177878 }, "text": "12,492 cf", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 } ], "reading_order": 2 }, { "id": "p159.4", "order": 24, "type": "table", "bbox": { "l": 52.32, "t": 492.48, "r": 557.04, "b": 365.28 }, "text": "", "attrs": { "block_label": "table", "n_rows": 2, "n_cols": 5, "integrity": { "cells_checked": 8, "cells_flagged": 0 } }, "children": [ { "id": "p159.4.1", "order": 25, "type": "table_cell", "bbox": { "l": 54, "t": 491.142469, "r": 90.142207, "b": 465.257868 }, "text": "Volume\n#1", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p159.4.2", "order": 26, "type": "table_cell", "bbox": { "l": 120.355217, "t": 491.142469, "r": 148.95691, "b": 465.257868 }, "text": "Invert\n91.00'", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p159.4.3", "order": 27, "type": "table_cell", "bbox": { "l": 170.997811, "t": 491.142469, "r": 234.422951, "b": 465.257868 }, "text": "Avail.Storage\n13,818 cf", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p159.4.4", "order": 28, "type": "table_cell", "bbox": { "l": 246.044461, "t": 491.142469, "r": 502.944852, "b": 465.137889 }, "text": "Storage Description\nCustom Stage Data (Prismatic) Listed below (Recalc)", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p159.4.5", "order": 29, "type": "table_cell", "bbox": { "l": 57.360002, "t": 453.222448, "r": 101.273013, "b": 367.337871 }, "text": "Elevation\\n(feet)\n91.00\n92.00\n93.00\n94.00\n94.50", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p159.4.6", "order": 30, "type": "table_cell", "bbox": { "l": 140.447365, "t": 453.222448, "r": 185.72688, "b": 367.337871 }, "text": "Surf.Area\\n(sq-ft)\n2,628\n3,320\n4,067\n5,010\n5,438", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p159.4.7", "order": 31, "type": "table_cell", "bbox": { "l": 227.371027, "t": 453.222448, "r": 354.642567, "b": 367.337871 }, "text": "Inc.Store\\n(cubic-feet)\n0\n2,974\n3,694\n4,539\n2,612", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p159.4.8", "order": 32, "type": "table_cell", "bbox": { "l": 216.402998, "t": 453.222448, "r": 354.689052, "b": 367.337871 }, "text": "Cum.Store\\n(cubic-feet)\n0\n2,974\n6,668\n11,206\n13,818", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 7 } ], "reading_order": 3 }, { "id": "p159.5", "order": 33, "type": "table", "bbox": { "l": 51.6, "t": 355.302451, "r": 555.12, "b": 266.88 }, "text": "", "attrs": { "block_label": "table", "n_rows": 3, "n_cols": 4, "integrity": { "cells_checked": 12, "cells_flagged": 0 } }, "children": [ { "id": "p159.5.1", "order": 34, "type": "table_cell", "bbox": { "l": 54, "t": 355.302451, "r": 86.679256, "b": 343.337871 }, "text": "Device", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p159.5.2", "order": 35, "type": "table_cell", "bbox": { "l": 98.407976, "t": 355.302451, "r": 135.030741, "b": 343.337871 }, "text": "Routing", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p159.5.3", "order": 36, "type": "table_cell", "bbox": { "l": 182.045624, "t": 355.302451, "r": 208.824841, "b": 343.337871 }, "text": "Invert", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p159.5.4", "order": 37, "type": "table_cell", "bbox": { "l": 220.650048, "t": 355.302451, "r": 290.014595, "b": 343.337871 }, "text": "Outlet Devices", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 3 }, { "id": "p159.5.5", "order": 38, "type": "table_cell", "bbox": { "l": 70.320002, "t": 341.382452, "r": 82.177372, "b": 329.417872 }, "text": "#1", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p159.5.6", "order": 39, "type": "table_cell", "bbox": { "l": 98.408891, "t": 341.382452, "r": 135.204992, "b": 329.417872 }, "text": "Primary", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p159.5.7", "order": 40, "type": "table_cell", "bbox": { "l": 354.69794, "t": 317.382452, "r": 383.299634, "b": 305.417872 }, "text": "93.80'", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p159.5.8", "order": 41, "type": "table_cell", "bbox": { "l": 220.679993, "t": 341.262472, "r": 512.979659, "b": 293.417872 }, "text": "6.0\" Round Culvert to Subsurface Basin\\nL= 35.0' RCP, square edge headwall, Ke= 0.500\\nInlet / Outlet Invert= 92.00' / 93.80' S= -0.0514'' Cc= 0.900\\nn= 0.012 Corrugated PP, smooth interior, Flow Area= 0.20 sf", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p159.5.9", "order": 42, "type": "table_cell", "bbox": { "l": 70.320002, "t": 293.382452, "r": 82.177372, "b": 269.417872 }, "text": "#2\n#3", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 8 }, { "id": "p159.5.10", "order": 43, "type": "table_cell", "bbox": { "l": 98.408891, "t": 293.382452, "r": 146.474595, "b": 269.417872 }, "text": "Device 1\nDiscarded", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 9 }, { "id": "p159.5.11", "order": 44, "type": "table_cell", "bbox": { "l": 180.288471, "t": 293.382452, "r": 208.918642, "b": 269.417872 }, "text": "93.00'\n91.00'", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 10 }, { "id": "p159.5.12", "order": 45, "type": "table_cell", "bbox": { "l": 220.679993, "t": 293.382452, "r": 531.965762, "b": 269.29789200000005 }, "text": "4.0' long Sharp-Crested Rectangular Weir 2 End Contraction(s)\n1.050 in/hr Exfiltration X 0.00 over Surface area", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 11 } ], "reading_order": 4 }, { "id": "p159.6", "order": 46, "type": "footnote", "bbox": { "l": 52.08, "t": 575.04, "r": 513.6, "b": 537.84 }, "text": "Routing by Stor-Ind method, Time Span= 0.00-72.00 hrs, dt= 0.01 hrs\nStarting Elev= 93.00' Surf.Area= 4,067 sf Storage= 6,668 cf\nPeak Elev= 99.85' @ 12.37 hrs Surf.Area= 5,438 sf Storage= 13,818 cf (7,151 cf above start)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 5 }, { "id": "p159.7", "order": 47, "type": "footnote", "bbox": { "l": 51.84, "t": 528.72, "r": 409.92, "b": 502.08 }, "text": "Plug-Flow detention time= 617.6 min calculated for 5,824 cf (36% of inflow) Center-of-Mass det. time= 196.8 min ( 991.9 - 795.2 )", "attrs": { "block_label": "vision_footnote" }, "reading_order": 6 }, { "id": "p159.8", "order": 48, "type": "footnote", "bbox": { "l": 51.84, "t": 258.72, "r": 424.08, "b": 232.32 }, "text": "Discarded OutFlow Max=0.00 cfs @ 0.00 hrs HW=93.00' (Free Discharge)\n3=Exfiltration (Controls 0.00 cfs)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 7 }, { "id": "p159.9", "order": 49, "type": "footnote", "bbox": { "l": 50.64, "t": 222.48, "r": 474.96, "b": 182.88 }, "text": "Primary OutFlow Max=1.96 cfs @ 12.37 hrs HW=99.75' (Free Discharge)\n1=Culvert to Subsurface Basin (Outlet Controls 1.96 cfs @ 9.97 fps)\n2=Sharp-Crested Rectangular Weir (Passes 1.96 cfs of 149.56 cfs potential flow)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 8 } ] }, { "document_id": 16592, "page": 160, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 7, "counts_by_type": { "caption": 1, "figure": 1, "footnote": 1, "header": 3, "text": 1 }, "build_ms": 0, "items": [ { "id": "p160.1", "order": 1, "type": "header", "bbox": { "l": 361.44, "t": 738.96, "r": 560.64, "b": 711.12 }, "text": "NOAA 24-hr D 25-Year Rainfall=6.68\"\nPrinted 04/12/2025", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p160.2", "order": 2, "type": "header", "bbox": { "l": 52.56, "t": 738, "r": 392.88, "b": 699.36 }, "text": "102 Sams -REV 12-02-25 NOAA\nPrepared by Haler Consulting\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p160.3", "order": 3, "type": "header", "bbox": { "l": 517.2, "t": 711.12, "r": 559.2, "b": 699.36 }, "text": "Page 47", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 2 }, { "id": "p160.4", "order": 4, "type": "caption", "bbox": { "l": 201.12, "t": 687.6, "r": 410.64, "b": 672.96 }, "text": "Pond 184P: WQ Infiltration Basin #2", "attrs": { "block_label": "figure_title" }, "reading_order": 3 }, { "id": "p160.5", "order": 5, "type": "figure", "bbox": { "l": 66, "t": 667.44, "r": 486.96, "b": 410.16 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n3.06 cfs\nInflow Area=86,443 sf\nPeak Elev=99.85'\n3\nStorage=13,818 cf\n1.97 cfs\n1.97 cfs\n2\n(cfs)\nFlow\n1\n0.00 cfs\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72" }, "reading_order": 4 }, { "id": "p160.6", "order": 6, "type": "text", "bbox": { "l": 497.04, "t": 644.88, "r": 546.96, "b": 610.32 }, "text": "Inflow Outflow Discarded Primary", "attrs": { "block_label": "aside_text" }, "reading_order": 5 }, { "id": "p160.7", "order": 7, "type": "footnote", "bbox": { "l": 84.24, "t": 420.24, "r": 449.28, "b": 400.8 }, "text": "0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72 Time (hours)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 6 } ] }, { "document_id": 16592, "page": 161, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 11, "counts_by_type": { "caption": 1, "header": 1, "table": 1, "table_cell": 8 }, "build_ms": 26, "items": [ { "id": "p161.1", "order": 1, "type": "header", "bbox": { "l": 52.8, "t": 738.72, "r": 561.84, "b": 698.64 }, "text": "102 Sams -REV 12-02-25 NOAA 24-hr D 25-Year Rainfall=6.68\"\nPrepared by Haler Consulting Printed 04/12/2025\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC Page 48", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p161.2", "order": 2, "type": "caption", "bbox": { "l": 153.6, "t": 687.84, "r": 458.16, "b": 672.96 }, "text": "Stage-Discharge for Pond 184P: WQ Infiltration Basin #2", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p161.3", "order": 3, "type": "table", "bbox": { "l": 54.48, "t": 662.88, "r": 505.68, "b": 62.4 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 8, "integrity": { "cells_checked": 8, "cells_flagged": 0 } }, "children": [ { "id": "p161.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 57.479999, "t": 661.126246, "r": 98.137287, "b": 64.158859 }, "text": "Elevation (feet)\n91.00\n91.10\n91.20\n91.30\n91.40\n91.50\n91.60\n91.70\n91.80\n91.90\n92.00\n92.10\n92.20\n92.30\n92.40\n92.50\n92.60\n92.70\n92.80\n92.90\n93.00\n93.10\n93.20\n93.30\n93.40\n93.50\n93.60\n93.70\n93.80\n93.90\n94.00\n94.10\n94.20\n94.30\n94.40\n94.50\n94.60\n94.70\n94.80\n94.90\n95.00\n95.10\n95.20\n95.30\n95.40\n95.50\n95.60\n95.70\n95.80\n95.90\n96.00\n96.10", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p161.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 109.680004, "t": 661.126246, "r": 154.533694, "b": 64.158859 }, "text": "Discharge (cfs)\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.03\n0.11\n0.23\n0.36\n0.47\n0.56\n0.63\n0.70\n0.76\n0.80\n0.84\n0.88\n0.91\n0.95\n0.98\n1.01\n1.05\n1.08\n1.11\n1.13\n1.16\n1.19\n1.22", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p161.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 166.080002, "t": 661.126246, "r": 211.180733, "b": 64.158859 }, "text": "Discarded (cfs)\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p161.3.4", "order": 7, "type": "table_cell", "bbox": { "l": 233.160004, "t": 661.126246, "r": 267.536512, "b": 64.158859 }, "text": "Primary (cfs)\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.03\n0.11\n0.23\n0.36\n0.47\n0.56\n0.63\n0.70\n0.76\n0.80\n0.84\n0.88\n0.91\n0.95\n0.98\n1.01\n1.05\n1.08\n1.11\n1.13\n1.16\n1.19\n1.22", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p161.3.5", "order": 8, "type": "table_cell", "bbox": { "l": 291, "t": 661.126246, "r": 331.657282, "b": 229.75885000000005 }, "text": "Elevation (feet)\n96.20\n96.30\n96.40\n96.50\n96.60\n96.70\n96.80\n96.90\n97.00\n97.10\n97.20\n97.30\n97.40\n97.50\n97.60\n97.70\n97.80\n97.90\n98.00\n98.10\n98.20\n98.30\n98.40\n98.50\n98.60\n98.70\n98.80\n98.90\n99.00\n99.10\n99.20\n99.30\n99.40\n99.50\n99.60\n99.70\n99.80", "attrs": { "row": 0, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p161.3.6", "order": 9, "type": "table_cell", "bbox": { "l": 343.200005, "t": 661.126246, "r": 388.300713, "b": 229.75885000000005 }, "text": "Discharge (cfs)\n1.24\n1.27\n1.29\n1.32\n1.34\n1.37\n1.39\n1.41\n1.43\n1.46\n1.48\n1.50\n1.52\n1.54\n1.56\n1.58\n1.60\n1.62\n1.64\n1.66\n1.68\n1.70\n1.72\n1.74\n1.76\n1.78\n1.79\n1.81\n1.83\n1.85\n1.86\n1.88\n1.90\n1.92\n1.93\n1.95\n1.96", "attrs": { "row": 0, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p161.3.7", "order": 10, "type": "table_cell", "bbox": { "l": 399.599991, "t": 661.126246, "r": 444.395578, "b": 229.75885000000005 }, "text": "Discarded (cfs)\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00", "attrs": { "row": 0, "col": 6, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p161.3.8", "order": 11, "type": "table_cell", "bbox": { "l": 466.679993, "t": 661.126246, "r": 501.100731, "b": 229.75885000000005 }, "text": "Primary (cfs)\n1.24\n1.27\n1.29\n1.32\n1.34\n1.37\n1.39\n1.41\n1.43\n1.46\n1.48\n1.50\n1.52\n1.54\n1.56\n1.58\n1.60\n1.62\n1.64\n1.66\n1.68\n1.70\n1.72\n1.74\n1.76\n1.78\n1.79\n1.81\n1.83\n1.85\n1.86\n1.88\n1.90\n1.92\n1.93\n1.95\n1.96", "attrs": { "row": 0, "col": 7, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 7 } ], "reading_order": 2 } ] }, { "document_id": 16592, "page": 162, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 11, "counts_by_type": { "caption": 1, "header": 2, "table": 1, "table_cell": 6, "text": 1 }, "build_ms": 14, "items": [ { "id": "p162.1", "order": 1, "type": "header", "bbox": { "l": 361.44, "t": 738.96, "r": 561.6, "b": 702.72 }, "text": "NOAA 24-hr D 25-Year Rainfall=6.68\"\nPrinted 04/12/2025\nPage 49", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p162.2", "order": 2, "type": "header", "bbox": { "l": 51.84, "t": 738, "r": 396.72, "b": 699.12 }, "text": "102 Sams -REV 12-02-25\nPrepared by Haler Consulting\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p162.3", "order": 3, "type": "text", "bbox": { "l": 516.72, "t": 710.88, "r": 559.2, "b": 699.12 }, "text": "Page 49", "attrs": { "block_label": "number" }, "reading_order": 2 }, { "id": "p162.4", "order": 4, "type": "caption", "bbox": { "l": 145.2, "t": 688.08, "r": 466.32, "b": 672.72 }, "text": "Stage-Area-Storage for Pond 184P: WQ Infiltration Basin #2", "attrs": { "block_label": "figure_title" }, "reading_order": 3 }, { "id": "p162.5", "order": 5, "type": "table", "bbox": { "l": 56.4, "t": 661.2, "r": 468.96, "b": 62.4 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 6, "integrity": { "cells_checked": 6, "cells_flagged": 0 } }, "children": [ { "id": "p162.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 57.479999, "t": 661.126246, "r": 98.137287, "b": 64.158859 }, "text": "Elevation (feet)\n91.00\n91.10\n91.20\n91.30\n91.40\n91.50\n91.60\n91.70\n91.80\n91.90\n92.00\n92.10\n92.20\n92.30\n92.40\n92.50\n92.60\n92.70\n92.80\n92.90\n93.00\n93.10\n93.20\n93.30\n93.40\n93.50\n93.60\n93.70\n93.80\n93.90\n94.00\n94.10\n94.20\n94.30\n94.40\n94.50\n94.60\n94.70\n94.80\n94.90\n95.00\n95.10\n95.20\n95.30\n95.40\n95.50\n95.60\n95.70\n95.80\n95.90\n96.00\n96.10", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p162.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 139.439999, "t": 661.126246, "r": 174.048248, "b": 64.158859 }, "text": "Surface (sq-ft)\n2,628\n2,697\n2,766\n2,836\n2,905\n2,974\n3,043\n3,112\n3,182\n3,251\n3,320\n3,395\n3,469\n3,544\n3,619\n3,694\n3,768\n3,843\n3,918\n3,992\n4,067\n4,161\n4,256\n4,350\n4,444\n4,539\n4,633\n4,727\n4,821\n4,916\n5,010\n5,096\n5,181\n5,267\n5,352\n5,438\n5,438\n5,438\n5,438\n5,438\n5,438\n5,438\n5,438\n5,438\n5,438\n5,438\n5,438\n5,438\n5,438\n5,438\n5,438\n5,438", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p162.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 199.55999, "t": 661.126246, "r": 249.798008, "b": 64.158859 }, "text": "Storage (cubic-feet)\n0\n266\n539\n820\n1,107\n1,401\n1,701\n2,009\n2,324\n2,645\n2,974\n3,310\n3,653\n4,004\n4,362\n4,727\n5,100\n5,481\n5,869\n6,265\n6,668\n7,079\n7,500\n7,930\n8,370\n8,819\n9,277\n9,745\n10,223\n10,710\n11,206\n11,711\n12,225\n12,748\n13,278\n13,818\n13,818\n13,818\n13,818\n13,818\n13,818\n13,818\n13,818\n13,818\n13,818\n13,818\n13,818\n13,818\n13,818\n13,818\n13,818\n13,818", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p162.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 273.240005, "t": 661.126246, "r": 313.897287, "b": 229.75885000000005 }, "text": "Elevation (feet)\n96.20\n96.30\n96.40\n96.50\n96.60\n96.70\n96.80\n96.90\n97.00\n97.10\n97.20\n97.30\n97.40\n97.50\n97.60\n97.70\n97.80\n97.90\n98.00\n98.10\n98.20\n98.30\n98.40\n98.50\n98.60\n98.70\n98.80\n98.90\n99.00\n99.10\n99.20\n99.30\n99.40\n99.50\n99.60\n99.70\n99.80", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p162.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 355.200005, "t": 661.126246, "r": 389.576359, "b": 229.75885000000005 }, "text": "Surface (sq-ft)\n5,438\n5,438\n5,438\n5,438\n5,438\n5,438\n5,438\n5,438\n5,438\n5,438\n5,438\n5,438\n5,438\n5,438\n5,438\n5,438\n5,438\n5,438\n5,438\n5,438\n5,438\n5,438\n5,438\n5,438\n5,438\n5,438\n5,438\n5,438\n5,438\n5,438\n5,438\n5,438\n5,438\n5,438\n5,438\n5,438\n5,438", "attrs": { "row": 0, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p162.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 415.320008, "t": 661.126246, "r": 465.271564, "b": 229.75885000000005 }, "text": "Storage (cubic-feet)\n13,818\n13,818\n13,818\n13,818\n13,818\n13,818\n13,818\n13,818\n13,818\n13,818\n13,818\n13,818\n13,818\n13,818\n13,818\n13,818\n13,818\n13,818\n13,818\n13,818\n13,818\n13,818\n13,818\n13,818\n13,818\n13,818\n13,818\n13,818\n13,818\n13,818\n13,818\n13,818\n13,818\n13,818\n13,818\n13,818\n13,818", "attrs": { "row": 0, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 } ], "reading_order": 4 } ] }, { "document_id": 16592, "page": 163, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 9, "counts_by_type": { "caption": 1, "figure": 1, "header": 2, "heading": 2, "text": 3 }, "build_ms": 0, "items": [ { "id": "p163.1", "order": 1, "type": "header", "bbox": { "l": 360.72, "t": 738.96, "r": 560.88, "b": 711.84 }, "text": "NOAA 24-hr D 25-Year Rainfall=6.68\"\nPrinted 04/12/2025", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p163.2", "order": 2, "type": "header", "bbox": { "l": 52.8, "t": 737.76, "r": 395.28, "b": 699.36 }, "text": "102 Sams -REV 12-02-25\nPrepared by Haler Consulting\nHydroCAD® 10.20-2h s/n 10351 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p163.3", "order": 3, "type": "text", "bbox": { "l": 517.2, "t": 711.12, "r": 559.2, "b": 699.12 }, "text": "Page 50", "attrs": { "block_label": "number" }, "reading_order": 2 }, { "id": "p163.4", "order": 4, "type": "heading", "bbox": { "l": 221.04, "t": 687.6, "r": 392.16, "b": 672.48 }, "text": "Summary for Link 185L: POA", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 3 }, { "id": "p163.5", "order": 5, "type": "text", "bbox": { "l": 52.32, "t": 660, "r": 516, "b": 622.32 }, "text": "Inflow Area = 536,539 sf, 11.25% Impervious, Inflow Depth = 0.92\" for 25-Year event\nInflow = 7.07 cfs @ 12.10 hrs, Volume= 41,085 cf\nPrimary = 7.07 cfs @ 12.10 hrs, Volume= 41,085 cf, Atten= 0%, Lag= 0.0 min", "reading_order": 4 }, { "id": "p163.6", "order": 6, "type": "text", "bbox": { "l": 52.08, "t": 611.52, "r": 366.96, "b": 597.84 }, "text": "Primary outflow = Inflow, Time Span = 0.00-72.00 hrs, dt = 0.01 hrs", "reading_order": 5 }, { "id": "p163.7", "order": 7, "type": "heading", "bbox": { "l": 259.2, "t": 586.32, "r": 352.56, "b": 572.4 }, "text": "Link 185L: POA", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 6 }, { "id": "p163.8", "order": 8, "type": "caption", "bbox": { "l": 252.96, "t": 566.4, "r": 303.6, "b": 555.6 }, "text": "Hydrograph", "attrs": { "block_label": "figure_title" }, "reading_order": 7 }, { "id": "p163.9", "order": 9, "type": "figure", "bbox": { "l": 62.4, "t": 562.08, "r": 552, "b": 299.76 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Inflow\n7.07 cfs Primary\n7 Inflow Area=536,539 sf\n7.07 cfs\n6\n5\n(cfs)\n4\nFlow\n3\n2\n1\n0\n0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 32 34 36 38 40 42 44 46 48 50 52 54 56 58 60 62 64 66 68 70 72\nTime (hours)" }, "reading_order": 8 } ] }, { "document_id": 16592, "page": 164, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 1, "counts_by_type": { "heading": 1 }, "build_ms": 0, "items": [ { "id": "p164.1", "order": 1, "type": "heading", "bbox": { "l": 251.76, "t": 717.12, "r": 358.8, "b": 697.44 }, "text": "APPENDIX G", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 0 } ] }, { "document_id": 16592, "page": 165, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 12, "counts_by_type": { "table": 1, "table_cell": 10, "text": 1 }, "build_ms": 1, "items": [ { "id": "p165.1", "order": 1, "type": "text", "bbox": { "l": 102.24, "t": 701.04, "r": 496.8, "b": 672.72 }, "text": "Duration of infiltration period, t = $ \\frac{Volume of runoff to be infiltrated (cf) × 12 in/ft^{3}}{Infiltration area (sf)} × Recharge rate (in/hr)} $", "reading_order": 0 }, { "id": "p165.2", "order": 2, "type": "table", "bbox": { "l": 97.92, "t": 653.52, "r": 512.88, "b": 557.28 }, "text": "", "attrs": { "block_label": "table", "n_rows": 2, "n_cols": 5, "integrity": { "cells_checked": 10, "cells_flagged": 0 } }, "children": [ { "id": "p165.2.1", "order": 3, "type": "table_cell", "bbox": { "l": 131.399998, "t": 644.222107, "r": 155.401115, "b": 631.071087 }, "text": "Basin", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "pdf" }, "reading_order": 0 }, { "id": "p165.2.2", "order": 4, "type": "table_cell", "bbox": { "l": 196.200005, "t": 651.182106, "r": 279.781662, "b": 623.75109 }, "text": "infiltration volume (cf)", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "pdf" }, "reading_order": 1 }, { "id": "p165.2.3", "order": 5, "type": "table_cell", "bbox": { "l": 291.120003, "t": 651.182106, "r": 374.145631, "b": 623.75109 }, "text": "Basin Surface Area (sf)", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "pdf" }, "reading_order": 2 }, { "id": "p165.2.4", "order": 6, "type": "table_cell", "bbox": { "l": 388.199982, "t": 651.182106, "r": 452.621666, "b": 623.75109 }, "text": "Recharge Rate (in/hr)", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "pdf" }, "reading_order": 3 }, { "id": "p165.2.5", "order": 7, "type": "table_cell", "bbox": { "l": 477.359985, "t": 644.222107, "r": 499.723962, "b": 631.071087 }, "text": "t (hr)", "attrs": { "row": 0, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "pdf" }, "reading_order": 4 }, { "id": "p165.2.6", "order": 8, "type": "table_cell", "bbox": { "l": 105.839996, "t": 616.622105, "r": 180.663416, "b": 559.431095 }, "text": "Surface #1\nSurface #2\nSubsurface (TYP)", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p165.2.7", "order": 9, "type": "table_cell", "bbox": { "l": 224.400009, "t": 616.622105, "r": 251.850154, "b": 559.431095 }, "text": "34901\n18586\n3080", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p165.2.8", "order": 10, "type": "table_cell", "bbox": { "l": 321.852389, "t": 616.622105, "r": 343.839083, "b": 559.431095 }, "text": "4231\n2628\n533", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 7 }, { "id": "p165.2.9", "order": 11, "type": "table_cell", "bbox": { "l": 410.930847, "t": 616.622105, "r": 430.140396, "b": 559.431095 }, "text": "3.1\n1.05\n3.25", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 8 }, { "id": "p165.2.10", "order": 12, "type": "table_cell", "bbox": { "l": 478.807747, "t": 616.622105, "r": 498.133667, "b": 559.431095 }, "text": "31.9\n80.8\n21.3", "attrs": { "row": 1, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 9 } ], "reading_order": 1 } ] }, { "document_id": 16592, "page": 166, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 26, "counts_by_type": { "figure": 2, "header": 1, "heading": 1, "table": 1, "table_cell": 20, "text": 1 }, "build_ms": 5, "items": [ { "id": "p166.1", "order": 1, "type": "header", "bbox": { "l": 50.64, "t": 737.04, "r": 90.72, "b": 728.4 }, "text": "Input Values", "attrs": { "block_label": "figure_title" }, "level": 2, "reading_order": 0 }, { "id": "p166.2", "order": 2, "type": "figure", "bbox": { "l": 48.96, "t": 739.92, "r": 547.92, "b": 382.32 }, "text": "", "attrs": { "block_label": "image", "embedded_text": "Input Values\n3.10 R Recharge rate (permeability rate) (in/hr)\nSpecific yield, Sy (dimensionless)\n0.150 Sy default value is 0.15; max value is 0.2 provided that a lab test data is submitted\nHorizontal hydraulic conductivity (in/hr)\n50.00 Kh Kh = 5xRecharge Rate (R) in the costal plan; Kh=R outside the coastal plan\n19.300 x 1/2 length of basin (x direction, in feet)\n54.800 y 1/2 width of basin (y direction, in feet)\n31.90 t Duration of infiltration period (hours)\n10.00 hi(0) Initial thickness of saturated zone (feet)\n15.901 h(max) Maximum thickness of saturated zone (beneath center of basin at end of infiltration period)\n5.901 Δh(max) Maximum groundwater mounding (beneath center of basin at end of infiltration period)\nDistance from\nGround-water center of basin in x\nMounding, in feet direction, in feet\n5.901 0\n5.742 10 Re-Calculate Now\n5.265 20\n4.664 30 Groundwater Mounding, in feet\n4.117 40 7.000\n3.627 50\n3.188 60 6.000\n2.796 70\n5.000\n2.445 80\n2.133 90 4.000\n3.000\n2.000\n1.000\n0.000\n0 10 20 30 40 50 60 70 80 90 100" }, "reading_order": 1 }, { "id": "p166.3", "order": 3, "type": "table", "bbox": { "l": 49.2, "t": 737.27544, "r": 499.68, "b": 600 }, "text": "", "attrs": { "block_label": "table", "n_rows": 8, "n_cols": 3, "integrity": { "cells_checked": 20, "cells_flagged": 2, "flags": [ { "row": 4, "col": 2, "coverage": 0.31, "text": "Kh = 5xRecharge Rate (R) in the cost plan; Kh=R outside the…" }, { "row": 7, "col": 1, "coverage": 0, "text": "Δ h(max)" } ] } }, "children": [ { "id": "p166.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 52.320002, "t": 737.27544, "r": 89.365547, "b": 728.361958 }, "text": "Input values", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 0 }, { "id": "p166.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 92.399998, "t": 727.519583, "r": 106.738359, "b": 717.7293569999999 }, "text": "3.10", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 1 }, { "id": "p166.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 137.879997, "t": 727.030072, "r": 143.224497, "b": 718.146646 }, "text": "R", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 2 }, { "id": "p166.3.4", "order": 7, "type": "table_cell", "bbox": { "l": 193.799996, "t": 727.519583, "r": 328.739753, "b": 717.7293569999999 }, "text": "Recharge rate (permeability rate) (in/hr)", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 3 }, { "id": "p166.3.5", "order": 8, "type": "table_cell", "bbox": { "l": 88.320002, "t": 706.639586, "r": 106.725607, "b": 696.84936 }, "text": "0.150", "attrs": { "row": 2, "col": 0, "rowspan": 2, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p166.3.6", "order": 9, "type": "table_cell", "bbox": { "l": 137.399998, "t": 706.639586, "r": 145.047608, "b": 696.84936 }, "text": "Sy", "attrs": { "row": 2, "col": 1, "rowspan": 2, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p166.3.7", "order": 10, "type": "table_cell", "bbox": { "l": 193.799996, "t": 717.079584, "r": 302.66425, "b": 707.289359 }, "text": "Specific yield, Sy (dimensionless)", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p166.3.8", "order": 11, "type": "table_cell", "bbox": { "l": 193.799996, "t": 706.639586, "r": 457.151983, "b": 696.84936 }, "text": "default value is 0.15; max value is 0.2 provided that a lab test data is submitted", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p166.3.9", "order": 12, "type": "table_cell", "bbox": { "l": 89.76, "t": 685.759589, "r": 108.165605, "b": 675.969363 }, "text": "50.00", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p166.3.10", "order": 13, "type": "table_cell", "bbox": { "l": 193.799996, "t": 685.759589, "r": 202.489824, "b": 675.969363 }, "text": "Kh", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p166.3.11", "order": 14, "type": "table_cell", "bbox": { "l": 349.52, "t": 684.9164, "r": 499.68, "b": 672.7855 }, "text": "Kh = 5xRecharge Rate (R) in the cost plan; Kh=R outside the coastal plan", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 10 }, { "id": "p166.3.12", "order": 15, "type": "table_cell", "bbox": { "l": 85.679999, "t": 675.079584, "r": 108.165605, "b": 633.249358 }, "text": "19.300\n54.800\n31.90\n10.00", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 11 }, { "id": "p166.3.13", "order": 16, "type": "table_cell", "bbox": { "l": 133.560002, "t": 675.079584, "r": 148.855066, "b": 633.249358 }, "text": "x\ny\nt\nhi(0)", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 12 }, { "id": "p166.3.14", "order": 17, "type": "table_cell", "bbox": { "l": 193.799996, "t": 675.079584, "r": 326.254894, "b": 633.249358 }, "text": "1/2 length of basin (x direction, in feet)\n1/2 width of basin (y direction, in feet)\nDuration of infiltration period (hours)\nInitial thickness of saturated zone (feet)", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 13 }, { "id": "p166.3.15", "order": 18, "type": "table_cell", "bbox": { "l": 87.840002, "t": 621.955438, "r": 108.300341, "b": 613.041956 }, "text": "15.901", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p166.3.16", "order": 19, "type": "table_cell", "bbox": { "l": 129.479999, "t": 622.639586, "r": 152.930555, "b": 612.8493599999999 }, "text": "h(max)", "attrs": { "row": 6, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p166.3.17", "order": 20, "type": "table_cell", "bbox": { "l": 193.799996, "t": 622.639586, "r": 499.410574, "b": 612.8493599999999 }, "text": "Maximum thickness of saturated zone (beneath center of basin at end of infiltration period)", "attrs": { "row": 6, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p166.3.18", "order": 21, "type": "table_cell", "bbox": { "l": 91.560002, "t": 611.275434, "r": 108.265531, "b": 602.361953 }, "text": "5.901", "attrs": { "row": 7, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p166.3.19", "order": 22, "type": "table_cell", "bbox": { "l": 199.36, "t": 612.1309, "r": 349.52, "b": 600 }, "text": "Δ h(max)", "attrs": { "row": 7, "col": 1, "rowspan": 1, "colspan": 1 }, "reading_order": 18 }, { "id": "p166.3.20", "order": 23, "type": "table_cell", "bbox": { "l": 193.799996, "t": 611.959582, "r": 487.173732, "b": 602.169357 }, "text": "Maximum groundwater mounding (beneath center of basin at end of infiltration period)", "attrs": { "row": 7, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 } ], "reading_order": 2 }, { "id": "p166.4", "order": 24, "type": "figure", "bbox": { "l": 50.4, "t": 580.08, "r": 549.6, "b": 383.28 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Mounding, in feet direction, in feet\n5.901 0\n5.742 10 Re-Calculate Now\n5.265 20\n4.664 30 Groundwater Mounding, in feet\n4.117 40 7.000\n3.627 50\n3.188 60 6.000\n2.796 70\n5.000\n2.445 80\n2.133 90 4.000\n3.000\n2.000\n1.000\n0.000\n0 10 20 30 40 50 60 70 80 90 100" }, "reading_order": 3 }, { "id": "p166.5", "order": 25, "type": "heading", "bbox": { "l": 58.56, "t": 381.12, "r": 115.68, "b": 369.6 }, "text": "Disclaimer", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 4 }, { "id": "p166.6", "order": 26, "type": "text", "bbox": { "l": 49.44, "t": 358.56, "r": 559.92, "b": 263.52 }, "text": "This spreadsheet solving the Hantush (1967) equation for ground-water mounding beneath an infiltration basin is made available to the general public as a convenience for those wishing to replicate values documented in the USGS Scientific Investigations Report 2010-5102 \"Groundwater Mounding Beneath Hypothetical Stormwater Infiltration Basins\" or to calculate values based on user-specified site conditions. Any changes made to the spreadsheet (other than values identified as user-specified) after transmission from the USGS could have unintended, undesirable consequences. These consequences could include, but may not be limited to: erroneous output, numerical instabilities, and violations of underlying assumptions that are inherent in results presented in the accompanying USGS published report. The USGS assumes no responsibility for the consequences of any changes made to the spreadsheet. If changes are made to the spreadsheet, the user is responsible for documenting the changes and justifying the results and conclusions.", "reading_order": 5 } ] }, { "document_id": 16592, "page": 167, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 17, "counts_by_type": { "figure": 2, "header": 1, "heading": 1, "table": 1, "table_cell": 11, "text": 1 }, "build_ms": 3, "items": [ { "id": "p167.1", "order": 1, "type": "header", "bbox": { "l": 50.64, "t": 737.04, "r": 90.72, "b": 728.4 }, "text": "Input Values", "attrs": { "block_label": "figure_title" }, "level": 2, "reading_order": 0 }, { "id": "p167.2", "order": 2, "type": "figure", "bbox": { "l": 48.96, "t": 739.68, "r": 547.68, "b": 382.32 }, "text": "", "attrs": { "block_label": "image", "embedded_text": "Input Values\n1.05 R Recharge rate (permeability rate) (in/hr)\nSpecific yield, Sy (dimensionless)\n0.150 Sy default value is 0.15; max value is 0.2 provided that a lab test data is submitted\nHorizontal hydraulic conductivity (in/hr)\n50.00 Kh Kh = 5xRecharge Rate (R) in the costal plan; Kh=R outside the coastal plan\n14.725 x 1/2 length of basin (x direction, in feet)\n44.625 y 1/2 width of basin (y direction, in feet)\n80.80 t Duration of infiltration period (hours)\n10.00 hi(0) Initial thickness of saturated zone (feet)\n11.941 h(max) Maximum thickness of saturated zone (beneath center of basin at end of infiltration period)\n1.941 Δh(max) Maximum groundwater mounding (beneath center of basin at end of infiltration period)\nDistance from\nGround-water center of basin in x\nMounding, in feet direction, in feet\n1.941 0\n1.870 10 Re-Calculate Now\n1.693 20\n1.509 30 Groundwater Mounding, in feet\n1.351 40 2.500\n1.214 50\n1.095 60\n2.000\n0.990 70\n0.897 80\n0.814 1.500\n90\n1.000\n0.500\n0.000\n0 10 20 30 40 50 60 70 80 90 100" }, "reading_order": 1 }, { "id": "p167.3", "order": 3, "type": "table", "bbox": { "l": 48.72, "t": 737.27544, "r": 499.92, "b": 598.56 }, "text": "", "attrs": { "block_label": "table", "n_rows": 6, "n_cols": 2, "integrity": { "cells_checked": 11, "cells_flagged": 1, "flags": [ { "row": 5, "col": 1, "coverage": 0, "text": "Δ h(max)" } ] } }, "children": [ { "id": "p167.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 52.320002, "t": 737.27544, "r": 89.365547, "b": 728.361958 }, "text": "Input values", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 0 }, { "id": "p167.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 92.399998, "t": 727.519583, "r": 106.738359, "b": 717.7293569999999 }, "text": "1.05", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 1 }, { "id": "p167.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 137.879997, "t": 727.030072, "r": 143.224497, "b": 718.146646 }, "text": "R", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 2 }, { "id": "p167.3.4", "order": 7, "type": "table_cell", "bbox": { "l": 88.320002, "t": 706.639586, "r": 106.725607, "b": 696.84936 }, "text": "0.150", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 3 }, { "id": "p167.3.5", "order": 8, "type": "table_cell", "bbox": { "l": 137.399998, "t": 706.639586, "r": 145.047608, "b": 696.84936 }, "text": "Sy", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p167.3.6", "order": 9, "type": "table_cell", "bbox": { "l": 85.679999, "t": 685.759589, "r": 108.165605, "b": 633.249358 }, "text": "50.00\n14.725\n44.625\n80.80\n10.00", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p167.3.7", "order": 10, "type": "table_cell", "bbox": { "l": 133.560002, "t": 685.759589, "r": 202.489824, "b": 633.249358 }, "text": "Kh\nx\ny\nt\nhi(0)", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p167.3.8", "order": 11, "type": "table_cell", "bbox": { "l": 87.840002, "t": 621.955438, "r": 108.300341, "b": 613.041956 }, "text": "11.941", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p167.3.9", "order": 12, "type": "table_cell", "bbox": { "l": 129.479999, "t": 622.639586, "r": 152.930555, "b": 612.8493599999999 }, "text": "h(max)", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p167.3.10", "order": 13, "type": "table_cell", "bbox": { "l": 91.560002, "t": 611.275434, "r": 108.265531, "b": 602.361953 }, "text": "1.941", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p167.3.11", "order": 14, "type": "table_cell", "bbox": { "l": 274.32, "t": 612.024, "r": 499.92, "b": 598.56 }, "text": "Δ h(max)", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1 }, "reading_order": 10 } ], "reading_order": 2 }, { "id": "p167.4", "order": 15, "type": "figure", "bbox": { "l": 50.4, "t": 581.04, "r": 549.36, "b": 382.08 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Mounding, in feet direction, in feet\n1.941 0\n1.870 10 Re-Calculate Now\n1.693 20\n1.509 30 Groundwater Mounding, in feet\n1.351 40 2.500\n1.214 50\n1.095 60\n2.000\n0.990 70\n0.897 80\n0.814 1.500\n90\n1.000\n0.500\n0.000\n0 10 20 30 40 50 60 70 80 90 100" }, "reading_order": 3 }, { "id": "p167.5", "order": 16, "type": "heading", "bbox": { "l": 58.56, "t": 381.12, "r": 115.68, "b": 369.6 }, "text": "Disclaimer", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 4 }, { "id": "p167.6", "order": 17, "type": "text", "bbox": { "l": 49.68, "t": 358.56, "r": 559.92, "b": 263.52 }, "text": "This spreadsheet solving the Hantush (1967) equation for ground-water mounding beneath an infiltration basin is made available to the general public as a convenience for those wishing to replicate values documented in the USGS Scientific Investigations Report 2010-5102 \"Groundwater Mounding Beneath Hypothetical Stormwater Infiltration Basins\" or to calculate values based on user-specified site conditions. Any changes made to the spreadsheet (other than values identified as user-specified) after transmission from the USGS could have unintended, undesirable consequences. These consequences could include, but may not be limited to: erroneous output, numerical instabilities, and violations of underlying assumptions that are inherent in results presented in the accompanying USGS published report. The USGS assumes no responsibility for the consequences of any changes made to the spreadsheet. If changes are made to the spreadsheet, the user is responsible for documenting the changes and justifying the results and conclusions.", "reading_order": 5 } ] }, { "document_id": 16592, "page": 168, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 26, "counts_by_type": { "figure": 2, "header": 1, "heading": 1, "table": 1, "table_cell": 20, "text": 1 }, "build_ms": 5, "items": [ { "id": "p168.1", "order": 1, "type": "header", "bbox": { "l": 50.64, "t": 737.04, "r": 90.72, "b": 728.4 }, "text": "Input Values", "attrs": { "block_label": "figure_title" }, "level": 2, "reading_order": 0 }, { "id": "p168.2", "order": 2, "type": "figure", "bbox": { "l": 48.96, "t": 739.68, "r": 548.88, "b": 382.32 }, "text": "", "attrs": { "block_label": "image", "embedded_text": "Input Values\n3.25 R Recharge rate (permeability rate) (in/hr)\nSpecific yield, Sy (dimensionless)\n0.150 Sy default value is 0.15; max value is 0.2 provided that a lab test data is submitted\nHorizontal hydraulic conductivity (in/hr)\n50.00 Kh Kh = 5xRecharge Rate (R) in the costal plan; Kh=R outside the coastal plan\n20.500 x 1/2 length of basin (x direction, in feet)\n6.500 y 1/2 width of basin (y direction, in feet)\n21.30 t Duration of infiltration period (hours)\n10.00 hi(0) Initial thickness of saturated zone (feet)\n11.309 h(max) Maximum thickness of saturated zone (beneath center of basin at end of infiltration period)\n1.309 Δh(max) Maximum groundwater mounding (beneath center of basin at end of infiltration period)\nDistance from\nGround-water center of basin in x\nMounding, in feet direction, in feet\n1.309 0\n1.251 10 Re-Calculate Now\n1.044 20\n0.790 30 Groundwater Mounding, in feet\n0.628 40 1.400\n0.511 50\n0.421 60 1.200\n0.349 70\n1.000\n0.290 80\n0.241 90 0.800\n0.600\n0.400\n0.200\n0.000\n0 10 20 30 40 50 60 70 80 90 100" }, "reading_order": 1 }, { "id": "p168.3", "order": 3, "type": "table", "bbox": { "l": 48.96, "t": 737.27544, "r": 499.44, "b": 599.28 }, "text": "", "attrs": { "block_label": "table", "n_rows": 8, "n_cols": 3, "integrity": { "cells_checked": 20, "cells_flagged": 2, "flags": [ { "row": 4, "col": 2, "coverage": 0.31, "text": "Kh = 5xRecharge Rate (R) in the cost plan; Kh=R outside the…" }, { "row": 7, "col": 1, "coverage": 0, "text": "Δ h(max)" } ] } }, "children": [ { "id": "p168.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 52.320002, "t": 737.27544, "r": 89.365547, "b": 728.361958 }, "text": "Input values", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 0 }, { "id": "p168.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 92.399998, "t": 727.519583, "r": 106.738359, "b": 717.7293569999999 }, "text": "3.25", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 1 }, { "id": "p168.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 137.879997, "t": 727.030072, "r": 143.224497, "b": 718.146646 }, "text": "R", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 2 }, { "id": "p168.3.4", "order": 7, "type": "table_cell", "bbox": { "l": 193.799996, "t": 727.519583, "r": 328.739753, "b": 717.7293569999999 }, "text": "Recharge rate (permeability rate) (in/hr)", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 3 }, { "id": "p168.3.5", "order": 8, "type": "table_cell", "bbox": { "l": 88.320002, "t": 706.639586, "r": 106.725607, "b": 696.84936 }, "text": "0.150", "attrs": { "row": 2, "col": 0, "rowspan": 2, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p168.3.6", "order": 9, "type": "table_cell", "bbox": { "l": 137.399998, "t": 706.639586, "r": 145.047608, "b": 696.84936 }, "text": "Sy", "attrs": { "row": 2, "col": 1, "rowspan": 2, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p168.3.7", "order": 10, "type": "table_cell", "bbox": { "l": 193.799996, "t": 717.079584, "r": 302.66425, "b": 707.289359 }, "text": "Specific yield, Sy (dimensionless)", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p168.3.8", "order": 11, "type": "table_cell", "bbox": { "l": 193.799996, "t": 706.639586, "r": 457.151983, "b": 696.84936 }, "text": "default value is 0.15; max value is 0.2 provided that a lab test data is submitted", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p168.3.9", "order": 12, "type": "table_cell", "bbox": { "l": 89.76, "t": 685.759589, "r": 108.165605, "b": 675.969363 }, "text": "50.00", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p168.3.10", "order": 13, "type": "table_cell", "bbox": { "l": 193.799996, "t": 685.759589, "r": 202.489824, "b": 675.969363 }, "text": "Kh", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p168.3.11", "order": 14, "type": "table_cell", "bbox": { "l": 349.28, "t": 684.6545, "r": 499.44, "b": 672.4582 }, "text": "Kh = 5xRecharge Rate (R) in the cost plan; Kh=R outside the coastal plan", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 10 }, { "id": "p168.3.12", "order": 15, "type": "table_cell", "bbox": { "l": 85.679999, "t": 675.079584, "r": 108.165605, "b": 633.249358 }, "text": "20.500\n6.500\n21.30\n10.00", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 11 }, { "id": "p168.3.13", "order": 16, "type": "table_cell", "bbox": { "l": 133.560002, "t": 675.079584, "r": 148.855066, "b": 633.249358 }, "text": "x\ny\nt\nhi(0)", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 12 }, { "id": "p168.3.14", "order": 17, "type": "table_cell", "bbox": { "l": 193.799996, "t": 675.079584, "r": 326.254894, "b": 633.249358 }, "text": "1/2 length of basin (x direction, in feet)\n1/2 width of basin (y direction, in feet)\nDuration of infiltration period (hours)\nInitial thickness of saturated zone (feet)", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 13 }, { "id": "p168.3.15", "order": 18, "type": "table_cell", "bbox": { "l": 87.840002, "t": 621.955438, "r": 108.300341, "b": 613.041956 }, "text": "11.309", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p168.3.16", "order": 19, "type": "table_cell", "bbox": { "l": 129.479999, "t": 622.639586, "r": 152.930555, "b": 612.8493599999999 }, "text": "h(max)", "attrs": { "row": 6, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p168.3.17", "order": 20, "type": "table_cell", "bbox": { "l": 193.799996, "t": 622.639586, "r": 499.410574, "b": 612.8493599999999 }, "text": "Maximum thickness of saturated zone (beneath center of basin at end of infiltration period)", "attrs": { "row": 6, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p168.3.18", "order": 21, "type": "table_cell", "bbox": { "l": 91.560002, "t": 611.275434, "r": 108.265531, "b": 602.361953 }, "text": "1.309", "attrs": { "row": 7, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p168.3.19", "order": 22, "type": "table_cell", "bbox": { "l": 199.12, "t": 611.4764, "r": 349.28, "b": 599.28 }, "text": "Δ h(max)", "attrs": { "row": 7, "col": 1, "rowspan": 1, "colspan": 1 }, "reading_order": 18 }, { "id": "p168.3.20", "order": 23, "type": "table_cell", "bbox": { "l": 193.799996, "t": 611.959582, "r": 487.173732, "b": 602.169357 }, "text": "Maximum groundwater mounding (beneath center of basin at end of infiltration period)", "attrs": { "row": 7, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 } ], "reading_order": 2 }, { "id": "p168.4", "order": 24, "type": "figure", "bbox": { "l": 50.64, "t": 580.56, "r": 551.28, "b": 382.8 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Mounding, in feet direction, in feet\n1.309 0\n1.251 10 Re-Calculate Now\n1.044 20\n0.790 30 Groundwater Mounding, in feet\n0.628 40 1.400\n0.511 50\n0.421 60 1.200\n0.349 70\n1.000\n0.290 80\n0.241 90 0.800\n0.600\n0.400\n0.200\n0.000\n0 10 20 30 40 50 60 70 80 90 100" }, "reading_order": 3 }, { "id": "p168.5", "order": 25, "type": "heading", "bbox": { "l": 58.56, "t": 381.12, "r": 115.68, "b": 369.6 }, "text": "Disclaimer", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 4 }, { "id": "p168.6", "order": 26, "type": "text", "bbox": { "l": 49.68, "t": 358.56, "r": 559.92, "b": 263.52 }, "text": "This spreadsheet solving the Hantush (1967) equation for ground-water mounding beneath an infiltration basin is made available to the general public as a convenience for those wishing to replicate values documented in the USGS Scientific Investigations Report 2010-5102 \"Groundwater Mounding Beneath Hypothetical Stormwater Infiltration Basins\" or to calculate values based on user-specified site conditions. Any changes made to the spreadsheet (other than values identified as user-specified) after transmission from the USGS could have unintended, undesirable consequences. These consequences could include, but may not be limited to: erroneous output, numerical instabilities, and violations of underlying assumptions that are inherent in results presented in the accompanying USGS published report. The USGS assumes no responsibility for the consequences of any changes made to the spreadsheet. If changes are made to the spreadsheet, the user is responsible for documenting the changes and justifying the results and conclusions.", "reading_order": 5 } ] }, { "document_id": 16592, "page": 169, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 1, "counts_by_type": { "heading": 1 }, "build_ms": 0, "items": [ { "id": "p169.1", "order": 1, "type": "heading", "bbox": { "l": 251.76, "t": 717.12, "r": 359.04, "b": 697.44 }, "text": "APPENDIX H", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 0 } ] }, { "document_id": 16592, "page": 170, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 17, "counts_by_type": { "figure": 1, "formula": 1, "heading": 2, "list": 1, "list_item": 3, "text": 8, "title": 1 }, "build_ms": 1, "items": [ { "id": "p170.1", "order": 1, "type": "text", "bbox": { "l": 88.08, "t": 671.28, "r": 196.8, "b": 654.24 }, "text": "September 4, 2025", "reading_order": 0 }, { "id": "p170.2", "order": 2, "type": "title", "bbox": { "l": 217.68, "t": 718.8, "r": 393.84, "b": 671.52 }, "text": "Haler Consulting LLC\n640 Herman Road Unit 1\nJackson, New Jersey 08527", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p170.3", "order": 3, "type": "text", "bbox": { "l": 87.84, "t": 623.04, "r": 209.28, "b": 567.6 }, "text": "Owner/Location: Prop. subdivision 102 Sams Road Jackson, NJ", "reading_order": 2 }, { "id": "p170.4", "order": 4, "type": "heading", "bbox": { "l": 270.48, "t": 638.64, "r": 341.28, "b": 623.52 }, "text": "SOIL LOG", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 3 }, { "id": "p170.5", "order": 5, "type": "list", "bbox": { "l": 87.6, "t": 556.08, "r": 414.72, "b": 496.08 }, "text": "", "attrs": { "item_count": 3 }, "children": [ { "id": "p170.5.1", "order": 6, "type": "list_item", "bbox": { "l": 88.08, "t": 556.08, "r": 212.88, "b": 542.4 }, "text": "Test Pit #1 9-04-25 el. 98.0", "reading_order": 0 }, { "id": "p170.5.2", "order": 7, "type": "list_item", "bbox": { "l": 87.6, "t": 533.28, "r": 357.12, "b": 518.64 }, "text": "0'- 12\" 10YR3/1 Very Dark Gray, Loose, SG, Topsoil", "reading_order": 1 }, { "id": "p170.5.3", "order": 8, "type": "list_item", "bbox": { "l": 88.32, "t": 510.24, "r": 414.72, "b": 496.08 }, "text": "12\"-50\" 10YR5/6 Yellowish Brown, Medium, Loose, Gravelly sand", "reading_order": 2 } ], "reading_order": 4 }, { "id": "p170.6", "order": 9, "type": "text", "bbox": { "l": 88.32, "t": 487.2, "r": 405.84, "b": 473.76 }, "text": "50\"-80\" 7.5YR6/6 Reddish Yellow, Medium, Loose, Loamy Sand\nPT-1 @ 4.5 FEET\n= 12.2 IN/HR(K4)", "reading_order": 5 }, { "id": "p170.7", "order": 10, "type": "text", "bbox": { "l": 411.84, "t": 475.2, "r": 496.56, "b": 451.92 }, "text": "$[p170.7.1]$", "children": [ { "id": "p170.7.1", "order": 11, "type": "formula", "bbox": { "l": 411.84, "t": 475.2, "r": 496.56, "b": 451.92 }, "text": "\\begin{array}{l}PT-1@4.5FEET\\\\=12.2IN/HR(K4)\\end{array}", "attrs": { "latex": "\\begin{array}{l}PT-1@4.5FEET\\\\=12.2IN/HR(K4)\\end{array}", "inline": true, "text_offset": 1, "text_span": 10, "bbox_estimated": true, "notation": "latex", "alt": "begin array l PT minus 1@4.5 FEET equals 12.2 IN over HR of K4 end array", "mathml": "PT−1@4.5FEET=12.2IN/HR(K4)" }, "reading_order": 0 } ], "reading_order": 6 }, { "id": "p170.8", "order": 12, "type": "text", "bbox": { "l": 88.08, "t": 453.36, "r": 423.12, "b": 427.92 }, "text": "80”–100” 7.5YR6/8 Reddish Yellow, Loose, Very Fine, Granular, Sand Mottles @ 87 inches Water @92 inches", "reading_order": 7 }, { "id": "p170.9", "order": 13, "type": "heading", "bbox": { "l": 87.84, "t": 419.52, "r": 135.6, "b": 404.64 }, "text": "NOTE:", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 8 }, { "id": "p170.10", "order": 14, "type": "text", "bbox": { "l": 88.32, "t": 404.88, "r": 449.76, "b": 388.56 }, "text": "Estimated Seasonal High Water Table @ 87 inches (el. 90.3).", "reading_order": 9 }, { "id": "p170.11", "order": 15, "type": "figure", "bbox": { "l": 96.48, "t": 354, "r": 138.96, "b": 324.48 }, "text": "", "attrs": { "block_label": "image" }, "reading_order": 10 }, { "id": "p170.12", "order": 16, "type": "text", "bbox": { "l": 88.8, "t": 312.48, "r": 279.84, "b": 303.12 }, "text": "·", "reading_order": 11 }, { "id": "p170.13", "order": 17, "type": "text", "bbox": { "l": 88.32, "t": 302.88, "r": 163.44, "b": 275.04 }, "text": "Eric Halpert\n(NJPE#55771)", "reading_order": 12 } ] }, { "document_id": 16592, "page": 171, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 16, "counts_by_type": { "figure": 1, "heading": 2, "list": 1, "list_item": 3, "text": 8, "title": 1 }, "build_ms": 1, "items": [ { "id": "p171.1", "order": 1, "type": "title", "bbox": { "l": 217.44, "t": 718.56, "r": 393.84, "b": 671.28 }, "text": "Haler Consulting LLC\n640 Herman Road Unit 1\nJackson, New Jersey 08527", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 0 }, { "id": "p171.2", "order": 2, "type": "text", "bbox": { "l": 88.32, "t": 654.72, "r": 196.56, "b": 638.64 }, "text": "September 4, 2025", "reading_order": 1 }, { "id": "p171.3", "order": 3, "type": "text", "bbox": { "l": 88.32, "t": 606.72, "r": 209.28, "b": 551.52 }, "text": "Owner/Location:\nProp. subdivision\n102 Sams Road\nJackson, NJ", "reading_order": 2 }, { "id": "p171.4", "order": 4, "type": "heading", "bbox": { "l": 270.72, "t": 622.56, "r": 341.28, "b": 607.44 }, "text": "SOIL LOG", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 3 }, { "id": "p171.5", "order": 5, "type": "list", "bbox": { "l": 88.08, "t": 537.36, "r": 414.24, "b": 474.48 }, "text": "", "attrs": { "item_count": 3 }, "children": [ { "id": "p171.5.1", "order": 6, "type": "list_item", "bbox": { "l": 88.08, "t": 537.36, "r": 223.2, "b": 523.44 }, "text": "Test Pit #2 9-04-25 el. 96.8", "reading_order": 0 }, { "id": "p171.5.2", "order": 7, "type": "list_item", "bbox": { "l": 88.08, "t": 511.44, "r": 342.96, "b": 497.28 }, "text": "0'- 10\" 10YR3/3 Dark Brown, Loose, SG, Topsoil", "reading_order": 1 }, { "id": "p171.5.3", "order": 8, "type": "list_item", "bbox": { "l": 88.32, "t": 488.4, "r": 414.24, "b": 474.48 }, "text": "12\"- 40\" 10YR5/8 Yellowish Brown, Medium, Loose, Gravelly sand", "reading_order": 2 } ], "reading_order": 4 }, { "id": "p171.6", "order": 9, "type": "text", "bbox": { "l": 88.32, "t": 465.6, "r": 396.24, "b": 451.92 }, "text": "40\"- 75\" 7.5YR4/6 Strong Brown, Medium, Loose, Loamy Sand\nPT-2 @ 4.5 FEET\n= 14.5 IN/HR(K4)", "reading_order": 5 }, { "id": "p171.7", "order": 10, "type": "text", "bbox": { "l": 87.84, "t": 430.8, "r": 386.64, "b": 405.36 }, "text": "75”–100” 7.5YR4/4 Brown, Loose, Very Fine, Granular, Sand Mottles @ 85 inches Water @95 inches", "reading_order": 6 }, { "id": "p171.8", "order": 11, "type": "text", "bbox": { "l": 411.36, "t": 453.84, "r": 496.8, "b": 429.84 }, "text": "PT-2 @ 4.5 FEET\n= 14.5 IN/HR(K4)", "reading_order": 7 }, { "id": "p171.9", "order": 12, "type": "heading", "bbox": { "l": 88.32, "t": 394.08, "r": 135.36, "b": 379.68 }, "text": "NOTE:", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 8 }, { "id": "p171.10", "order": 13, "type": "text", "bbox": { "l": 88.32, "t": 379.68, "r": 449.76, "b": 363.12 }, "text": "Estimated Seasonal High Water Table @ 85 inches (el. 89.7).", "reading_order": 9 }, { "id": "p171.11", "order": 14, "type": "figure", "bbox": { "l": 96.72, "t": 328.32, "r": 138.96, "b": 299.28 }, "text": "", "attrs": { "block_label": "image" }, "reading_order": 10 }, { "id": "p171.12", "order": 15, "type": "text", "bbox": { "l": 88.8, "t": 286.8, "r": 279.6, "b": 278.16 }, "text": "·", "reading_order": 11 }, { "id": "p171.13", "order": 16, "type": "text", "bbox": { "l": 88.32, "t": 277.44, "r": 162.72, "b": 250.08 }, "text": "Eric Halpert\n(NJPE#55771)", "reading_order": 12 } ] }, { "document_id": 16592, "page": 172, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 12, "counts_by_type": { "figure": 2, "text": 10 }, "build_ms": 4, "items": [ { "id": "p172.1", "order": 1, "type": "figure", "bbox": { "l": 28.56, "t": 724.8, "r": 581.52, "b": 194.64 }, "text": "", "attrs": { "block_label": "image" }, "reading_order": 0 }, { "id": "p172.2", "order": 2, "type": "text", "bbox": { "l": 176.4, "t": 239.76, "r": 264.48, "b": 216.24 }, "text": "(IN FEET)\n1 inch = 150 ft.", "reading_order": 1 }, { "id": "p172.3", "order": 3, "type": "text", "bbox": { "l": 257.76, "t": 213.12, "r": 522.96, "b": 133.68 }, "text": "TEST PIT LOCATION MAP\nPRELIMINARY AND MAJOR SUBDIVISION\n102 SAMS ROAD\nBLOCK 20101 LOT 29&30\nTOWNSHIP OF JACKSON, OCEAN COUNTY, NEW JERSEY\nAPPLICANT: SHAKKI LLC", "reading_order": 2 }, { "id": "p172.4", "order": 4, "type": "text", "bbox": { "l": 532.8, "t": 132, "r": 574.56, "b": 111.36 }, "text": "PROJECT NO.\n25-018", "reading_order": 3 }, { "id": "p172.5", "order": 5, "type": "text", "bbox": { "l": 223.2, "t": 121.2, "r": 366.24, "b": 72 }, "text": "HALER\nCONSULTING\nSITE ENGINEERING", "reading_order": 4 }, { "id": "p172.6", "order": 6, "type": "figure", "bbox": { "l": 383.76, "t": 115.44, "r": 523.2, "b": 35.52 }, "text": "", "attrs": { "block_label": "image" }, "children": [ { "id": "p172.6.1", "order": 7, "type": "text", "bbox": { "l": 418.32, "t": 63.84, "r": 481.44, "b": 54.48 }, "text": "ERIC HALPERT", "reading_order": 0 }, { "id": "p172.6.2", "order": 8, "type": "text", "bbox": { "l": 380.88, "t": 54.48, "r": 521.28, "b": 36.96 }, "text": "PROFESSIONAL ENGINEER AND PLANNER\nNJ PE LIC. NO. 55771 NJ PP LIC. NO. 6488\nDATE\n10-06-2025", "reading_order": 1 } ], "reading_order": 5 }, { "id": "p172.7", "order": 9, "type": "text", "bbox": { "l": 539.28, "t": 105.6, "r": 569.28, "b": 86.4 }, "text": "SCALE\n1\" = 150'", "reading_order": 6 }, { "id": "p172.8", "order": 10, "type": "text", "bbox": { "l": 533.76, "t": 80.64, "r": 576, "b": 61.2 }, "text": "DATE\n10-06-2025", "reading_order": 7 }, { "id": "p172.9", "order": 11, "type": "text", "bbox": { "l": 215.28, "t": 66.72, "r": 372, "b": 35.76 }, "text": "640 HERMAN ROAD, UNIT 1. JACKSON, NEW JERSEY 08527\nPH.(732) 806-7541 F.(732) 806-7439\nOFFICE@HALERCONSULTING.COM\nCOA 24GA28321300", "reading_order": 8 }, { "id": "p172.10", "order": 12, "type": "text", "bbox": { "l": 537.6, "t": 54.96, "r": 569.76, "b": 36.24 }, "text": "SHEET NO.\n1 OF 1", "reading_order": 9 } ] }, { "document_id": 16592, "page": 173, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 13, "counts_by_type": { "figure": 2, "footer": 5, "header": 1, "text": 5 }, "build_ms": 0, "items": [ { "id": "p173.1", "order": 1, "type": "header", "bbox": { "l": 213.36, "t": 756.72, "r": 398.4, "b": 746.4 }, "text": "Hydrologic Soil Group—Ocean County, New Jersey", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p173.2", "order": 2, "type": "text", "bbox": { "l": 83.28, "t": 756.24, "r": 90.48, "b": 720.96 }, "text": "74° 16' 58\" W", "attrs": { "block_label": "aside_text" }, "reading_order": 1 }, { "id": "p173.3", "order": 3, "type": "text", "bbox": { "l": 522.48, "t": 755.28, "r": 529.2, "b": 721.44 }, "text": "74° 16′ 40″ W", "attrs": { "block_label": "aside_text" }, "reading_order": 2 }, { "id": "p173.4", "order": 4, "type": "figure", "bbox": { "l": 57.12, "t": 731.52, "r": 554.88, "b": 40.32 }, "text": "", "attrs": { "block_label": "image" }, "reading_order": 3 }, { "id": "p173.5", "order": 5, "type": "text", "bbox": { "l": 73.92, "t": 712.08, "r": 80.64, "b": 689.76 }, "text": "4438140", "attrs": { "block_label": "aside_text" }, "reading_order": 4 }, { "id": "p173.6", "order": 6, "type": "text", "bbox": { "l": 41.04, "t": 709.2, "r": 69.12, "b": 698.4 }, "text": "40° 5' 28\" N", "attrs": { "block_label": "aside_text" }, "reading_order": 5 }, { "id": "p173.7", "order": 7, "type": "text", "bbox": { "l": 542.4, "t": 708.48, "r": 570.96, "b": 699.6 }, "text": "40° 5' 28\" N", "attrs": { "block_label": "aside_text" }, "reading_order": 6 }, { "id": "p173.8", "order": 8, "type": "figure", "bbox": { "l": 87.6, "t": 92.64, "r": 381.84, "b": 46.8 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Map Scale: 1:2,660 if printed on A portrait (8.5\" x 11\") sheet.\nMeters\nN 0 35 70 140 210\nFeet\n0 100 200 400 600\nMap projection: Web Mercator Corner coordinates: WGS84 Edge tics: UTM Zone 18N WGS84" }, "reading_order": 7 }, { "id": "p173.9", "order": 9, "type": "footer", "bbox": { "l": 69.12, "t": 36.96, "r": 183.6, "b": 17.76 }, "text": "", "attrs": { "block_label": "footer_image" }, "reading_order": 8 }, { "id": "p173.10", "order": 10, "type": "footer", "bbox": { "l": 70.8, "t": 35.52, "r": 90, "b": 21.12 }, "text": "", "attrs": { "block_label": "footer_image" }, "reading_order": 9 }, { "id": "p173.11", "order": 11, "type": "footer", "bbox": { "l": 245.28, "t": 36.24, "r": 366.48, "b": 17.28 }, "text": "Web Soil Survey\nNational Cooperative Soil Survey", "attrs": { "block_label": "footer" }, "reading_order": 10 }, { "id": "p173.12", "order": 12, "type": "footer", "bbox": { "l": 498.72, "t": 36.96, "r": 540.96, "b": 27.12 }, "text": "10/20/2025", "attrs": { "block_label": "number" }, "reading_order": 11 }, { "id": "p173.13", "order": 13, "type": "footer", "bbox": { "l": 497.76, "t": 26.16, "r": 540.96, "b": 16.56 }, "text": "Page 1 of 4", "attrs": { "block_label": "number" }, "reading_order": 12 } ] }, { "document_id": 16592, "page": 174, "width": 792, "height": 612, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 792, "height_pt": 612, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 17, "counts_by_type": { "figure": 1, "footer": 4, "form_field": 1, "header": 1, "heading": 2, "text": 8 }, "build_ms": 2, "items": [ { "id": "p174.1", "order": 1, "type": "header", "bbox": { "l": 302.16, "t": 576.48, "r": 489.36, "b": 565.92 }, "text": "Hydrologic Soil Group—Ocean County, New Jersey", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p174.2", "order": 2, "type": "heading", "bbox": { "l": 224.4, "t": 522.24, "r": 308.16, "b": 508.08 }, "text": "MAP LEGEND", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p174.3", "order": 3, "type": "text", "bbox": { "l": 141.6, "t": 494.88, "r": 216.24, "b": 485.04 }, "text": "Area of Interest (AOI)", "reading_order": 2 }, { "id": "p174.4", "order": 4, "type": "text", "bbox": { "l": 288.24, "t": 494.88, "r": 321.12, "b": 483.36 }, "text": "□ C", "children": [ { "id": "p174.4.1", "order": 5, "type": "form_field", "bbox": { "l": 288.24, "t": 494.88, "r": 299.76, "b": 483.36 }, "text": "", "attrs": { "field_kind": "checkbox", "label": "□ C", "source": "glyph_estimate", "bbox_estimated": true, "label_source": "parent_text", "label_ref": "p174.4", "text_offset": 0, "text_span": 1 }, "reading_order": 0 } ], "reading_order": 3 }, { "id": "p174.5", "order": 6, "type": "figure", "bbox": { "l": 144.96, "t": 491.76, "r": 390.24, "b": 119.76 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "of Interest (AOI) C\nArea of Interest (AOI)\nC/D\nSoils\nD\nSoil Rating Polygons\nA Not rated or not available\nA/D Water Features\nStreams and Canals\nB\nTransportation\nB/D\nRails\nC\nInterstate Highways\nC/D\nUS Routes\nD\nMajor Roads\nNot rated or not available\nLocal Roads\nSoil Rating Lines\nBackground\nA\nAerial Photography\nA/D\nB\nB/D\nC\nC/D\nD\nNot rated or not available\nSoil Rating Points\nA\nA/D\nB\nB/D" }, "reading_order": 4 }, { "id": "p174.6", "order": 7, "type": "text", "bbox": { "l": 142.08, "t": 468, "r": 162, "b": 459.12 }, "text": "Soils", "reading_order": 5 }, { "id": "p174.7", "order": 8, "type": "heading", "bbox": { "l": 531.6, "t": 522.24, "r": 649.2, "b": 508.08 }, "text": "MAP INFORMATION", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 6 }, { "id": "p174.8", "order": 9, "type": "text", "bbox": { "l": 470.88, "t": 496.32, "r": 677.04, "b": 475.68 }, "text": "The soil surveys that comprise your AOI were mapped at 1:24,000.", "reading_order": 7 }, { "id": "p174.9", "order": 10, "type": "text", "bbox": { "l": 471.12, "t": 467.04, "r": 647.28, "b": 455.04 }, "text": "Warning: Soil Map may not be valid at this scale.", "reading_order": 8 }, { "id": "p174.10", "order": 11, "type": "text", "bbox": { "l": 471.12, "t": 450.96, "r": 700.56, "b": 401.76 }, "text": "Enlargement of maps beyond the scale of mapping can cause misunderstanding of the detail of mapping and accuracy of soil line placement. The maps do not show the small areas of contrasting soils that could have been shown at a more detailed scale.", "reading_order": 9 }, { "id": "p174.11", "order": 12, "type": "text", "bbox": { "l": 470.64, "t": 392.4, "r": 673.68, "b": 371.76 }, "text": "Please rely on the bar scale on each map sheet for map measurements.", "reading_order": 10 }, { "id": "p174.12", "order": 13, "type": "text", "bbox": { "l": 470.64, "t": 367.2, "r": 705.6, "b": 137.28 }, "text": "Source of Map: Natural Resources Conservation Service\nWeb Soil Survey URL:\nCoordinate System: Web Mercator (EPSG:3857)\nMaps from the Web Soil Survey are based on the Web Mercator projection, which preserves direction and shape but distorts distance and area. A projection that preserves area, such as the Albers equal-area conic projection, should be used if more accurate calculations of distance or area are required.\nThis product is generated from the USDA-NRCS certified data as of the version date(s) listed below.\nSoil Survey Area: Ocean County, New Jersey\nSurvey Area Data: Version 23, Aug 28, 2025\nSoil map units are labeled (as space allows) for map scales 1:50,000 or larger.\nDate(s) aerial images were photographed: Jun 4, 2022—Jul 22, 2022\nThe orthophoto or other base map on which the soil lines were compiled and digitized probably differs from the background imagery displayed on these maps. As a result, some minor shifting of map unit boundaries may be evident.", "reading_order": 11 }, { "id": "p174.13", "order": 14, "type": "footer", "bbox": { "l": 70.56, "t": 35.52, "r": 90, "b": 20.64 }, "text": "", "attrs": { "block_label": "footer_image" }, "reading_order": 12 }, { "id": "p174.14", "order": 15, "type": "footer", "bbox": { "l": 99.12, "t": 36.24, "r": 184.08, "b": 17.28 }, "text": "Natural Resources\nConservation Service", "attrs": { "block_label": "footer" }, "reading_order": 13 }, { "id": "p174.15", "order": 16, "type": "footer", "bbox": { "l": 335.28, "t": 36.24, "r": 456.24, "b": 16.8 }, "text": "Web Soil Survey\nNational Cooperative Soil Survey", "attrs": { "block_label": "footer" }, "reading_order": 14 }, { "id": "p174.16", "order": 17, "type": "footer", "bbox": { "l": 677.76, "t": 36.72, "r": 721.44, "b": 16.56 }, "text": "10/20/2025\nPage 2 of 4", "attrs": { "block_label": "footer" }, "reading_order": 15 } ] }, { "document_id": 16592, "page": 175, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 30, "counts_by_type": { "footer": 4, "header": 1, "heading": 1, "table": 1, "table_cell": 23 }, "build_ms": 1, "items": [ { "id": "p175.1", "order": 1, "type": "header", "bbox": { "l": 34.32, "t": 756.72, "r": 220.32, "b": 745.92 }, "text": "Hydrologic Soil Group—Ocean County, New Jersey", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p175.2", "order": 2, "type": "heading", "bbox": { "l": 124.56, "t": 699.84, "r": 286.8, "b": 682.32 }, "text": "Hydrologic Soil Group", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p175.3", "order": 3, "type": "table", "bbox": { "l": 71.04, "t": 645.84, "r": 540, "b": 491.52 }, "text": "", "attrs": { "block_label": "table", "n_rows": 5, "n_cols": 5, "integrity": { "cells_checked": 23, "cells_flagged": 0 } }, "children": [ { "id": "p175.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 87.082, "t": 635.78531, "r": 150.202, "b": 626.85731 }, "text": "Map unit symbol", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p175.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 183.922, "t": 635.78531, "r": 239.93, "b": 626.85731 }, "text": "Map unit name", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p175.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 292.75399, "t": 635.78531, "r": 317.64199, "b": 626.85731 }, "text": "Rating", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p175.3.4", "order": 7, "type": "table_cell", "bbox": { "l": 374.87399, "t": 635.78531, "r": 422.88999, "b": 626.85731 }, "text": "Acres in AOI", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 3 }, { "id": "p175.3.5", "order": 8, "type": "table_cell", "bbox": { "l": 465.17798, "t": 635.78531, "r": 520.74598, "b": 626.85731 }, "text": "Percent of AOI", "attrs": { "row": 0, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 4 }, { "id": "p175.3.6", "order": 9, "type": "table_cell", "bbox": { "l": 74.45, "t": 618.68531, "r": 100.234, "b": 609.75731 }, "text": "DocBO", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p175.3.7", "order": 10, "type": "table_cell", "bbox": { "l": 167.73, "t": 618.68531, "r": 247.314, "b": 580.95731 }, "text": "Downer loamy sand, 0 to 5 percent slopes, Northern Tidewater Area", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p175.3.8", "order": 11, "type": "table_cell", "bbox": { "l": 261.01, "t": 618.68531, "r": 266.346, "b": 609.75731 }, "text": "A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p175.3.9", "order": 12, "type": "table_cell", "bbox": { "l": 431.74598, "t": 618.68531, "r": 442.86598, "b": 609.75731 }, "text": "5.5", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p175.3.10", "order": 13, "type": "table_cell", "bbox": { "l": 514.26597, "t": 618.68531, "r": 536.94597, "b": 609.75731 }, "text": "29.5%", "attrs": { "row": 1, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p175.3.11", "order": 14, "type": "table_cell", "bbox": { "l": 74.45, "t": 574.18531, "r": 97.562, "b": 565.25731 }, "text": "MumA", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p175.3.12", "order": 15, "type": "table_cell", "bbox": { "l": 167.73, "t": 574.18531, "r": 253.538, "b": 555.65731 }, "text": "Mullica sandy loam, 0 to 2 percent slopes", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 }, { "id": "p175.3.13", "order": 16, "type": "table_cell", "bbox": { "l": 261.01, "t": 574.18531, "r": 274.346, "b": 565.25731 }, "text": "A/D", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 12 }, { "id": "p175.3.14", "order": 17, "type": "table_cell", "bbox": { "l": 431.74598, "t": 574.18531, "r": 442.86598, "b": 565.25731 }, "text": "2.8", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p175.3.15", "order": 18, "type": "table_cell", "bbox": { "l": 514.26597, "t": 574.18531, "r": 536.94597, "b": 565.25731 }, "text": "15.0%", "attrs": { "row": 2, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p175.3.16", "order": 19, "type": "table_cell", "bbox": { "l": 74.45, "t": 548.88531, "r": 99.794, "b": 539.95731 }, "text": "SacBO", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p175.3.17", "order": 20, "type": "table_cell", "bbox": { "l": 167.73, "t": 548.88531, "r": 255.322, "b": 511.15731 }, "text": "Sassafras sandy loam, 2 to 5 percent slopes, Northern Tidewater Area", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p175.3.18", "order": 21, "type": "table_cell", "bbox": { "l": 258.624, "t": 553.248, "r": 352.416, "b": 522.384 }, "text": "B", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 17 }, { "id": "p175.3.19", "order": 22, "type": "table_cell", "bbox": { "l": 427.29798, "t": 548.88531, "r": 442.86598, "b": 539.95731 }, "text": "10.4", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p175.3.20", "order": 23, "type": "table_cell", "bbox": { "l": 514.26597, "t": 548.88531, "r": 536.94597, "b": 539.95731 }, "text": "55.5%", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p175.3.21", "order": 24, "type": "table_cell", "bbox": { "l": 74.45, "t": 504.38532, "r": 171.21, "b": 495.45732 }, "text": "Totals for Area of Interest", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 20 }, { "id": "p175.3.22", "order": 25, "type": "table_cell", "bbox": { "l": 427.29798, "t": 504.38532, "r": 442.86598, "b": 495.45732 }, "text": "18.7", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p175.3.23", "order": 26, "type": "table_cell", "bbox": { "l": 509.81797, "t": 504.38532, "r": 536.94597, "b": 495.45732 }, "text": "100.0%", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 22 } ], "reading_order": 2 }, { "id": "p175.4", "order": 27, "type": "footer", "bbox": { "l": 35.04, "t": 63.6, "r": 53.52, "b": 48.96 }, "text": "", "attrs": { "block_label": "footer_image" }, "reading_order": 3 }, { "id": "p175.5", "order": 28, "type": "footer", "bbox": { "l": 63.12, "t": 63.36, "r": 147.6, "b": 44.4 }, "text": "Natural Resources\nConservation Service", "attrs": { "block_label": "footer" }, "reading_order": 4 }, { "id": "p175.6", "order": 29, "type": "footer", "bbox": { "l": 245.52, "t": 63.6, "r": 365.76, "b": 43.92 }, "text": "Web Soil Survey\nNational Cooperative Soil Survey", "attrs": { "block_label": "footer" }, "reading_order": 5 }, { "id": "p175.7", "order": 30, "type": "footer", "bbox": { "l": 534, "t": 64.32, "r": 577.44, "b": 43.92 }, "text": "10/20/2025\nPage 3 of 4", "attrs": { "block_label": "footer" }, "reading_order": 6 } ] }, { "document_id": 16592, "page": 176, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 15, "counts_by_type": { "footer": 4, "header": 1, "heading": 2, "text": 8 }, "build_ms": 1, "items": [ { "id": "p176.1", "order": 1, "type": "header", "bbox": { "l": 34.08, "t": 756.96, "r": 220.56, "b": 745.68 }, "text": "Hydrologic Soil Group—Ocean County, New Jersey", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p176.2", "order": 2, "type": "heading", "bbox": { "l": 124.08, "t": 700.8, "r": 204.24, "b": 684.48 }, "text": "Description", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p176.3", "order": 3, "type": "text", "bbox": { "l": 122.88, "t": 670.08, "r": 484.56, "b": 619.92 }, "text": "Hydrologic soil groups are based on estimates of runoff potential. Soils are assigned to one of four groups according to the rate of water infiltration when the soils are not protected by vegetation, are thoroughly wet, and receive precipitation from long-duration storms.", "reading_order": 2 }, { "id": "p176.4", "order": 4, "type": "text", "bbox": { "l": 122.88, "t": 610.32, "r": 475.92, "b": 584.88 }, "text": "The soils in the United States are assigned to four groups (A, B, C, and D) and three dual classes (A/D, B/D, and C/D). The groups are defined as follows:", "reading_order": 3 }, { "id": "p176.5", "order": 5, "type": "text", "bbox": { "l": 123.12, "t": 574.08, "r": 452.64, "b": 525.12 }, "text": "Group A. Soils having a high infiltration rate (low runoff potential) when thoroughly wet. These consist mainly of deep, well drained to excessively drained sands or gravelly sands. These soils have a high rate of water transmission.", "reading_order": 4 }, { "id": "p176.6", "order": 6, "type": "text", "bbox": { "l": 122.88, "t": 514.08, "r": 471.6, "b": 464.4 }, "text": "Group B. Soils having a moderate infiltration rate when thoroughly wet. These consist chiefly of moderately deep or deep, moderately well drained or well drained soils that have moderately fine texture to moderately coarse texture. These soils have a moderate rate of water transmission.", "reading_order": 5 }, { "id": "p176.7", "order": 7, "type": "text", "bbox": { "l": 122.88, "t": 454.08, "r": 483.36, "b": 404.88 }, "text": "Group C. Soils having a slow infiltration rate when thoroughly wet. These consist chiefly of soils having a layer that impedes the downward movement of water or soils of moderately fine texture or fine texture. These soils have a slow rate of water transmission.", "reading_order": 6 }, { "id": "p176.8", "order": 8, "type": "text", "bbox": { "l": 122.88, "t": 394.32, "r": 469.44, "b": 332.16 }, "text": "Group D. Soils having a very slow infiltration rate (high runoff potential) when thoroughly wet. These consist chiefly of clays that have a high shrink-swell potential, soils that have a high water table, soils that have a claypan or clay layer at or near the surface, and soils that are shallow over nearly impervious material. These soils have a very slow rate of water transmission.", "reading_order": 7 }, { "id": "p176.9", "order": 9, "type": "text", "bbox": { "l": 122.88, "t": 322.32, "r": 486, "b": 284.88 }, "text": "If a soil is assigned to a dual hydrologic group (A/D, B/D, or C/D), the first letter is for drained areas and the second is for undrained areas. Only the soils that in their natural condition are in group D are assigned to dual classes.", "reading_order": 8 }, { "id": "p176.10", "order": 10, "type": "heading", "bbox": { "l": 124.08, "t": 276.96, "r": 227.76, "b": 260.64 }, "text": "Rating Options", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 9 }, { "id": "p176.11", "order": 11, "type": "text", "bbox": { "l": 122.88, "t": 246.72, "r": 321.36, "b": 197.28 }, "text": "Aggregation Method: Dominant Condition\nComponent Percent Cutoff: None Specified\nTie-break Rule: Higher", "reading_order": 10 }, { "id": "p176.12", "order": 12, "type": "footer", "bbox": { "l": 35.04, "t": 63.6, "r": 53.76, "b": 48.96 }, "text": "", "attrs": { "block_label": "footer_image" }, "reading_order": 11 }, { "id": "p176.13", "order": 13, "type": "footer", "bbox": { "l": 62.4, "t": 63.36, "r": 147.36, "b": 44.16 }, "text": "Natural Resources\nConservation Service", "attrs": { "block_label": "footer" }, "reading_order": 12 }, { "id": "p176.14", "order": 14, "type": "footer", "bbox": { "l": 245.28, "t": 63.6, "r": 365.76, "b": 43.92 }, "text": "Web Soil Survey\nNational Cooperative Soil Survey", "attrs": { "block_label": "footer" }, "reading_order": 13 }, { "id": "p176.15", "order": 15, "type": "footer", "bbox": { "l": 533.76, "t": 64.32, "r": 577.68, "b": 43.92 }, "text": "10/20/2025\nPage 4 of 4", "attrs": { "block_label": "footer" }, "reading_order": 14 } ] }, { "document_id": 16592, "page": 177, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 6, "counts_by_type": { "figure": 2, "footer": 1, "text": 3 }, "build_ms": 0, "items": [ { "id": "p177.1", "order": 1, "type": "figure", "bbox": { "l": 19.68, "t": 778.08, "r": 549.84, "b": 64.08 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart" }, "reading_order": 0 }, { "id": "p177.2", "order": 2, "type": "text", "bbox": { "l": 531.36, "t": 94.08, "r": 571.44, "b": 83.04 }, "text": "40° 5' 28\" N", "attrs": { "block_label": "aside_text" }, "reading_order": 1 }, { "id": "p177.3", "order": 3, "type": "text", "bbox": { "l": 82.32, "t": 69.84, "r": 89.76, "b": 37.44 }, "text": "74° 16' 40\" W", "reading_order": 2 }, { "id": "p177.4", "order": 4, "type": "text", "bbox": { "l": 521.76, "t": 69.84, "r": 528.48, "b": 37.2 }, "text": "74° 16' 58\" W", "reading_order": 3 }, { "id": "p177.5", "order": 5, "type": "figure", "bbox": { "l": 72, "t": 33.4816, "r": 89.4545, "b": 21.4816 }, "text": "", "attrs": { "source": "pdf_image" }, "reading_order": 4 }, { "id": "p177.6", "order": 6, "type": "footer", "bbox": { "l": 236.4, "t": 45.36, "r": 374.88, "b": 34.56 }, "text": "Soil Map—Ocean County, New Jersey", "attrs": { "block_label": "vision_footnote" }, "reading_order": 5 } ] }, { "document_id": 16592, "page": 178, "width": 792, "height": 612, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 792, "height_pt": 612, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 51, "counts_by_type": { "footer": 4, "header": 1, "heading": 2, "table": 1, "table_cell": 38, "text": 5 }, "build_ms": 7, "items": [ { "id": "p178.1", "order": 1, "type": "header", "bbox": { "l": 326.16, "t": 576.48, "r": 465.84, "b": 566.16 }, "text": "Soil Map—Ocean County, New Jersey", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p178.2", "order": 2, "type": "heading", "bbox": { "l": 224.4, "t": 522.24, "r": 308.16, "b": 508.08 }, "text": "MAP LEGEND", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p178.3", "order": 3, "type": "table", "bbox": { "l": 70.32, "t": 509.28, "r": 403.92, "b": 97.44 }, "text": "", "attrs": { "block_label": "table", "n_rows": 14, "n_cols": 3, "integrity": { "cells_checked": 26, "cells_flagged": 1, "flags": [ { "row": 6, "col": 2, "coverage": 0, "text": "Stream and Canals" } ] } }, "children": [ { "id": "p178.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 143.8, "t": 493.8184, "r": 214.199, "b": 486.0064 }, "text": "Area of Interest (AOI)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p178.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 183.56, "t": 482.6184, "r": 250.088, "b": 474.8064 }, "text": "Area of Interest (AOI)", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p178.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 313.16001, "t": 493.8184, "r": 345.45101, "b": 486.0064 }, "text": "Spoil Area", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p178.3.4", "order": 7, "type": "table_cell", "bbox": { "l": 70.32, "t": 493.44, "r": 181.52, "b": 477.6 }, "text": "", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 3 }, { "id": "p178.3.5", "order": 8, "type": "table_cell", "bbox": { "l": 181.52, "t": 493.44, "r": 292.72, "b": 477.6 }, "text": "Area of Interest (AOI)", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1 }, "reading_order": 4 }, { "id": "p178.3.6", "order": 9, "type": "table_cell", "bbox": { "l": 313.16001, "t": 478.385, "r": 347.40401, "b": 470.573 }, "text": "Stony Spot", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p178.3.7", "order": 10, "type": "table_cell", "bbox": { "l": 143.8, "t": 467.185, "r": 160.53, "b": 459.373 }, "text": "Soils", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 6 }, { "id": "p178.3.8", "order": 11, "type": "table_cell", "bbox": { "l": 70.32, "t": 461.76, "r": 181.52, "b": 445.92 }, "text": "", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 7 }, { "id": "p178.3.9", "order": 12, "type": "table_cell", "bbox": { "l": 183.56, "t": 455.985, "r": 255.919, "b": 417.3062 }, "text": "Soil Map Unit Polygons\nSoil Map Unit Lines\nSoil Map Unit Points", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 8 }, { "id": "p178.3.10", "order": 13, "type": "table_cell", "bbox": { "l": 313.16001, "t": 462.9516, "r": 363.35701, "b": 424.27279999999996 }, "text": "Very Stony Spot\nWet Spot\nOther", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 9 }, { "id": "p178.3.11", "order": 14, "type": "table_cell", "bbox": { "l": 150.8, "t": 409.68479, "r": 225.882, "b": 401.87279 }, "text": "Special Point Features", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 10 }, { "id": "p178.3.12", "order": 15, "type": "table_cell", "bbox": { "l": 70.32, "t": 398.4, "r": 181.52, "b": 382.56 }, "text": "", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 11 }, { "id": "p178.3.13", "order": 16, "type": "table_cell", "bbox": { "l": 183.56, "t": 398.4848, "r": 208.459, "b": 390.6728 }, "text": "Blowout", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 12 }, { "id": "p178.3.14", "order": 17, "type": "table_cell", "bbox": { "l": 273.40001, "t": 401.21799999999996, "r": 323.70901, "b": 393.406 }, "text": "Water Features", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p178.3.15", "order": 18, "type": "table_cell", "bbox": { "l": 70.32, "t": 382.56, "r": 181.52, "b": 366.72 }, "text": "", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 14 }, { "id": "p178.3.16", "order": 19, "type": "table_cell", "bbox": { "l": 183.56, "t": 383.05138999999997, "r": 215.844, "b": 375.23938999999996 }, "text": "Borrow Pit", "attrs": { "row": 6, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p178.3.17", "order": 20, "type": "table_cell", "bbox": { "l": 292.72, "t": 382.56, "r": 403.92, "b": 366.72 }, "text": "Stream and Canals", "attrs": { "row": 6, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 16 }, { "id": "p178.3.18", "order": 21, "type": "table_cell", "bbox": { "l": 70.32, "t": 366.72, "r": 181.52, "b": 350.88 }, "text": "", "attrs": { "row": 7, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 17 }, { "id": "p178.3.19", "order": 22, "type": "table_cell", "bbox": { "l": 183.56, "t": 367.61798999999996, "r": 213.905, "b": 359.80599 }, "text": "Clay Spot", "attrs": { "row": 7, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p178.3.20", "order": 23, "type": "table_cell", "bbox": { "l": 273.40001, "t": 374.5846, "r": 322.40701, "b": 366.7726 }, "text": "Transportation", "attrs": { "row": 7, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p178.3.21", "order": 24, "type": "table_cell", "bbox": { "l": 70.32, "t": 350.88, "r": 181.52, "b": 335.04 }, "text": "◇", "attrs": { "row": 8, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 20 }, { "id": "p178.3.22", "order": 25, "type": "table_cell", "bbox": { "l": 183.56, "t": 352.1846, "r": 242.689, "b": 344.3726 }, "text": "Closed Depression", "attrs": { "row": 8, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p178.3.23", "order": 26, "type": "table_cell", "bbox": { "l": 313.16001, "t": 363.38459, "r": 328.71401, "b": 355.57259 }, "text": "Rails", "attrs": { "row": 8, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 22 }, { "id": "p178.3.24", "order": 27, "type": "table_cell", "bbox": { "l": 70.32, "t": 335.04, "r": 181.52, "b": 319.2 }, "text": "✗", "attrs": { "row": 9, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 23 }, { "id": "p178.3.25", "order": 28, "type": "table_cell", "bbox": { "l": 183.56, "t": 336.7512, "r": 214.29, "b": 328.9392 }, "text": "Gravel Pit", "attrs": { "row": 9, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 24 }, { "id": "p178.3.26", "order": 29, "type": "table_cell", "bbox": { "l": 313.16001, "t": 347.9512, "r": 374.62701, "b": 340.1392 }, "text": "Interstate Highways", "attrs": { "row": 9, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 25 }, { "id": "p178.3.27", "order": 30, "type": "table_cell", "bbox": { "l": 70.32, "t": 319.2, "r": 181.52, "b": 303.36 }, "text": "⁂", "attrs": { "row": 10, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 26 }, { "id": "p178.3.28", "order": 31, "type": "table_cell", "bbox": { "l": 183.56, "t": 321.3178, "r": 225.574, "b": 313.5058 }, "text": "Gravelly Spot", "attrs": { "row": 10, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 27 }, { "id": "p178.3.29", "order": 32, "type": "table_cell", "bbox": { "l": 313.16001, "t": 332.5178, "r": 347.00501, "b": 324.7058 }, "text": "US Routes", "attrs": { "row": 10, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 28 }, { "id": "p178.3.30", "order": 33, "type": "table_cell", "bbox": { "l": 70.32, "t": 303.36, "r": 181.52, "b": 287.52 }, "text": "❄", "attrs": { "row": 11, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 29 }, { "id": "p178.3.31", "order": 34, "type": "table_cell", "bbox": { "l": 183.56, "t": 305.88441, "r": 235.29, "b": 267.20562 }, "text": "Landfill\nLava Flow\nMarsh or swamp", "attrs": { "row": 11, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 30 }, { "id": "p178.3.32", "order": 35, "type": "table_cell", "bbox": { "l": 273.40001, "t": 317.08441, "r": 352.83601, "b": 278.40562 }, "text": "Major Roads\nLocal Roads\nBackground", "attrs": { "row": 11, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 31 }, { "id": "p178.3.33", "order": 36, "type": "table_cell", "bbox": { "l": 70.32, "t": 255.84, "r": 181.52, "b": 240 }, "text": "❄", "attrs": { "row": 12, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 32 }, { "id": "p178.3.34", "order": 37, "type": "table_cell", "bbox": { "l": 183.56, "t": 259.58422, "r": 248.261, "b": 190.03859999999997 }, "text": "Mine or Quarry\nMiscellaneous Water\nPerennial Water\nRock Outcrop\nSaline Spot", "attrs": { "row": 12, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 33 }, { "id": "p178.3.35", "order": 38, "type": "table_cell", "bbox": { "l": 313.16001, "t": 275.01762, "r": 372.68801, "b": 267.20562 }, "text": "Aerial Photography", "attrs": { "row": 12, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 34 }, { "id": "p178.3.36", "order": 39, "type": "table_cell", "bbox": { "l": 70.32, "t": 176.64, "r": 181.52, "b": 160.8 }, "text": "❄", "attrs": { "row": 13, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 35 }, { "id": "p178.3.37", "order": 40, "type": "table_cell", "bbox": { "l": 183.56, "t": 182.41719, "r": 251.649, "b": 112.87153999999998 }, "text": "Sandy Spot\nSeverely Eroded Spot\nSinkhole\nSlide or Slip\nSodic Spot", "attrs": { "row": 13, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 36 }, { "id": "p178.3.38", "order": 41, "type": "table_cell", "bbox": { "l": 292.72, "t": 176.64, "r": 403.92, "b": 160.8 }, "text": "", "attrs": { "row": 13, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 37 } ], "reading_order": 2 }, { "id": "p178.4", "order": 42, "type": "heading", "bbox": { "l": 531.6, "t": 522.24, "r": 649.2, "b": 508.08 }, "text": "MAP INFORMATION", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 3 }, { "id": "p178.5", "order": 43, "type": "text", "bbox": { "l": 470.88, "t": 496.32, "r": 677.04, "b": 475.68 }, "text": "The soil surveys that comprise your AOI were mapped at 1:24,000.", "reading_order": 4 }, { "id": "p178.6", "order": 44, "type": "text", "bbox": { "l": 471.12, "t": 467.04, "r": 647.28, "b": 455.04 }, "text": "Warning: Soil Map may not be valid at this scale.", "reading_order": 5 }, { "id": "p178.7", "order": 45, "type": "text", "bbox": { "l": 471.12, "t": 450.96, "r": 700.56, "b": 401.52 }, "text": "Enlargement of maps beyond the scale of mapping can cause misunderstanding of the detail of mapping and accuracy of soil line placement. The maps do not show the small areas of contrasting soils that could have been shown at a more detailed scale.", "reading_order": 6 }, { "id": "p178.8", "order": 46, "type": "text", "bbox": { "l": 470.4, "t": 392.4, "r": 673.68, "b": 371.76 }, "text": "Please rely on the bar scale on each map sheet for map measurements.", "reading_order": 7 }, { "id": "p178.9", "order": 47, "type": "text", "bbox": { "l": 470.88, "t": 367.2, "r": 705.6, "b": 137.28 }, "text": "Source of Map: Natural Resources Conservation Service\nWeb Soil Survey URL:\nCoordinate System: Web Mercator (EPSG:3857)\nMaps from the Web Soil Survey are based on the Web Mercator projection, which preserves direction and shape but distorts distance and area. A projection that preserves area, such as the Albers equal-area conic projection, should be used if more accurate calculations of distance or area are required.\nThis product is generated from the USDA-NRCS certified data as of the version date(s) listed below.\nSoil Survey Area: Ocean County, New Jersey\nSurvey Area Data: Version 23, Aug 28, 2025\nSoil map units are labeled (as space allows) for map scales 1:50,000 or larger.\nDate(s) aerial images were photographed: Jun 4, 2022—Jul 22, 2022\nThe orthophoto or other base map on which the soil lines were compiled and digitized probably differs from the background imagery displayed on these maps. As a result, some minor shifting of map unit boundaries may be evident.", "reading_order": 8 }, { "id": "p178.10", "order": 48, "type": "footer", "bbox": { "l": 70.56, "t": 35.52, "r": 90, "b": 20.64 }, "text": "", "attrs": { "block_label": "footer_image" }, "reading_order": 9 }, { "id": "p178.11", "order": 49, "type": "footer", "bbox": { "l": 99.12, "t": 36, "r": 184.08, "b": 17.28 }, "text": "Natural Resources\nConservation Service", "attrs": { "block_label": "footer" }, "reading_order": 10 }, { "id": "p178.12", "order": 50, "type": "footer", "bbox": { "l": 335.04, "t": 36.24, "r": 456.24, "b": 16.8 }, "text": "Web Soil Survey\nNational Cooperative Soil Survey", "attrs": { "block_label": "footer" }, "reading_order": 11 }, { "id": "p178.13", "order": 51, "type": "footer", "bbox": { "l": 677.76, "t": 36.48, "r": 721.92, "b": 16.8 }, "text": "10/20/2025\nPage 2 of 3", "attrs": { "block_label": "footer" }, "reading_order": 12 } ] }, { "document_id": 16592, "page": 179, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 26, "counts_by_type": { "footer": 4, "header": 1, "heading": 1, "table": 1, "table_cell": 19 }, "build_ms": 1, "items": [ { "id": "p179.1", "order": 1, "type": "header", "bbox": { "l": 34.56, "t": 756.72, "r": 173.04, "b": 745.92 }, "text": "Soil Map—Ocean County, New Jersey", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p179.2", "order": 2, "type": "heading", "bbox": { "l": 125.04, "t": 700.08, "r": 247.92, "b": 682.56 }, "text": "Map Unit Legend", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p179.3", "order": 3, "type": "table", "bbox": { "l": 71.04, "t": 661.68, "r": 540, "b": 530.4 }, "text": "", "attrs": { "block_label": "table", "n_rows": 5, "n_cols": 4, "integrity": { "cells_checked": 19, "cells_flagged": 0 } }, "children": [ { "id": "p179.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 97.858, "t": 652.5853099999999, "r": 162.754, "b": 643.65731 }, "text": "Map Unit Symbol", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p179.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 218.01001, "t": 652.5853099999999, "r": 275.79401, "b": 643.65731 }, "text": "Map Unit Name", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p179.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 339.89001, "t": 652.5853099999999, "r": 387.90601, "b": 643.65731 }, "text": "Acres in AOI", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p179.3.4", "order": 7, "type": "table_cell", "bbox": { "l": 453.514, "t": 652.5853099999999, "r": 509.082, "b": 643.65731 }, "text": "Percent of AOI", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 3 }, { "id": "p179.3.5", "order": 8, "type": "table_cell", "bbox": { "l": 74.45, "t": 635.48531, "r": 100.234, "b": 626.55731 }, "text": "DocBO", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p179.3.6", "order": 9, "type": "table_cell", "bbox": { "l": 191.05001, "t": 635.48531, "r": 286.64201, "b": 607.35731 }, "text": "Downer loamy sand, 0 to 5 percent slopes, Northern Tidewater Area", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p179.3.7", "order": 10, "type": "table_cell", "bbox": { "l": 408.42602, "t": 635.48531, "r": 419.54602, "b": 626.55731 }, "text": "5.5", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p179.3.8", "order": 11, "type": "table_cell", "bbox": { "l": 514.26599, "t": 635.48531, "r": 536.94599, "b": 626.55731 }, "text": "29.5%", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p179.3.9", "order": 12, "type": "table_cell", "bbox": { "l": 74.45, "t": 600.5853099999999, "r": 97.562, "b": 591.65731 }, "text": "MumA", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p179.3.10", "order": 13, "type": "table_cell", "bbox": { "l": 191.05001, "t": 600.5853099999999, "r": 283.53001, "b": 582.05731 }, "text": "Mullica sandy loam, 0 to 2 percent slopes", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p179.3.11", "order": 14, "type": "table_cell", "bbox": { "l": 408.42602, "t": 600.5853099999999, "r": 419.54602, "b": 591.65731 }, "text": "2.8", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p179.3.12", "order": 15, "type": "table_cell", "bbox": { "l": 514.26599, "t": 600.5853099999999, "r": 536.94599, "b": 591.65731 }, "text": "15.0%", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 }, { "id": "p179.3.13", "order": 16, "type": "table_cell", "bbox": { "l": 74.45, "t": 575.28531, "r": 99.794, "b": 566.35731 }, "text": "SacBO", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 12 }, { "id": "p179.3.14", "order": 17, "type": "table_cell", "bbox": { "l": 191.05001, "t": 575.28531, "r": 294.21001, "b": 547.15731 }, "text": "Sassafras sandy loam, 2 to 5 percent slopes, Northern Tidewater Area", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p179.3.15", "order": 18, "type": "table_cell", "bbox": { "l": 403.97802, "t": 575.28531, "r": 419.54602, "b": 566.35731 }, "text": "10.4", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p179.3.16", "order": 19, "type": "table_cell", "bbox": { "l": 514.26599, "t": 575.28531, "r": 536.94599, "b": 566.35731 }, "text": "55.5%", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p179.3.17", "order": 20, "type": "table_cell", "bbox": { "l": 74.45, "t": 540.38532, "r": 171.21, "b": 531.45732 }, "text": "Totals for Area of Interest", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 16 }, { "id": "p179.3.18", "order": 21, "type": "table_cell", "bbox": { "l": 403.97802, "t": 540.38532, "r": 419.54602, "b": 531.45732 }, "text": "18.7", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p179.3.19", "order": 22, "type": "table_cell", "bbox": { "l": 509.818, "t": 540.38532, "r": 536.946, "b": 531.45732 }, "text": "100.0%", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 } ], "reading_order": 2 }, { "id": "p179.4", "order": 23, "type": "footer", "bbox": { "l": 35.04, "t": 63.84, "r": 53.76, "b": 48.72 }, "text": "", "attrs": { "block_label": "footer_image" }, "reading_order": 3 }, { "id": "p179.5", "order": 24, "type": "footer", "bbox": { "l": 63.12, "t": 63.36, "r": 147.6, "b": 44.16 }, "text": "Natural Resources\nConservation Service", "attrs": { "block_label": "footer" }, "reading_order": 4 }, { "id": "p179.6", "order": 25, "type": "footer", "bbox": { "l": 245.28, "t": 63.6, "r": 365.76, "b": 43.92 }, "text": "Web Soil Survey\nNational Cooperative Soil Survey", "attrs": { "block_label": "footer" }, "reading_order": 5 }, { "id": "p179.7", "order": 26, "type": "footer", "bbox": { "l": 534, "t": 64.32, "r": 577.44, "b": 43.68 }, "text": "10/20/2025\nPage 3 of 3", "attrs": { "block_label": "footer" }, "reading_order": 6 } ] }, { "document_id": 16592, "page": 180, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 1, "counts_by_type": { "heading": 1 }, "build_ms": 0, "items": [ { "id": "p180.1", "order": 1, "type": "heading", "bbox": { "l": 255.36, "t": 717.36, "r": 355.68, "b": 697.2 }, "text": "APPENDIX I", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 0 } ] }, { "document_id": 16592, "page": 181, "width": 2592, "height": 1728, "rotation": 270, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 2592, "height_pt": 1728, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 2, "counts_by_type": { "figure": 1, "header": 1 }, "build_ms": 1, "items": [ { "id": "p181.1", "order": 1, "type": "header", "bbox": { "l": 200.4, "t": 1622.4, "r": 335.4, "b": 1602.9 }, "text": "GRAPHIC SCALE", "attrs": { "block_label": "vision_footnote" }, "level": 2, "reading_order": 0 }, { "id": "p181.2", "order": 2, "type": "figure", "bbox": { "l": 2071.5, "t": 307.5, "r": 2549.1, "b": 55.5 }, "text": "", "attrs": { "role": "page_header", "block_label": "header_image" }, "reading_order": 1 } ] }, { "document_id": 16592, "page": 182, "width": 2592, "height": 1728, "rotation": 270, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 2592, "height_pt": 1728, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 9, "counts_by_type": { "figure": 6, "header": 2, "text": 1 }, "build_ms": 0, "items": [ { "id": "p182.1", "order": 1, "type": "header", "bbox": { "l": 199.8, "t": 1621.8, "r": 335.4, "b": 1603.2 }, "text": "GRAPHIC SCALE", "attrs": { "block_label": "vision_footnote" }, "level": 2, "reading_order": 0 }, { "id": "p182.2", "order": 2, "type": "header", "bbox": { "l": 2283, "t": 84, "r": 2463.9, "b": 60 }, "text": "PROFESSIONAL ENGINEER AND PLANNER\nNJ PE LIC. NO. 55771 NJ PP LIC. NO. 6488", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p182.3", "order": 3, "type": "figure", "bbox": { "l": 1067.48, "t": 1159.9799, "r": 1246.9399, "b": 1006.6799 }, "text": "", "attrs": { "source": "pdf_image" }, "reading_order": 2 }, { "id": "p182.4", "order": 4, "type": "figure", "bbox": { "l": 703.1, "t": 1055.2199, "r": 846.62, "b": 875.0399 }, "text": "", "attrs": { "source": "pdf_image" }, "reading_order": 3 }, { "id": "p182.5", "order": 5, "type": "figure", "bbox": { "l": 1345.1599, "t": 914.46, "r": 1463.6599, "b": 738.12 }, "text": "", "attrs": { "source": "pdf_image" }, "reading_order": 4 }, { "id": "p182.6", "order": 6, "type": "figure", "bbox": { "l": 759.56, "t": 758.88, "r": 937.58, "b": 633.6 }, "text": "", "attrs": { "source": "pdf_image" }, "reading_order": 5 }, { "id": "p182.7", "order": 7, "type": "figure", "bbox": { "l": 1378.46, "t": 534.84, "r": 1460.12, "b": 372.96 }, "text": "", "attrs": { "source": "pdf_image" }, "reading_order": 6 }, { "id": "p182.8", "order": 8, "type": "figure", "bbox": { "l": 853.1, "t": 398.58, "r": 1014.4399, "b": 317.9399 }, "text": "", "attrs": { "source": "pdf_image" }, "reading_order": 7 }, { "id": "p182.9", "order": 9, "type": "text", "bbox": { "l": 2111.4, "t": 90.6, "r": 2242.8, "b": 60.3 }, "text": "PH.(732) 806-7541 F.(732) 806-7439 OFFICE@HALERCONSULTING.COM COA 24GA28321300", "reading_order": 8 } ] }, { "document_id": 16592, "page": 183, "width": 2592, "height": 1728, "rotation": 270, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 2592, "height_pt": 1728, "engine": "paddleocr_vl", "source_run_id": 16703, "item_count": 11, "counts_by_type": { "figure": 7, "footer": 1, "text": 3 }, "build_ms": 0, "items": [ { "id": "p183.1", "order": 1, "type": "text", "bbox": { "l": 204.6, "t": 1621.2, "r": 338.1, "b": 1603.8 }, "text": "GRAPHIC SCALE", "reading_order": 0 }, { "id": "p183.2", "order": 2, "type": "figure", "bbox": { "l": 1067.48, "t": 1159.9799, "r": 1246.9399, "b": 1006.6799 }, "text": "", "attrs": { "source": "pdf_image" }, "reading_order": 1 }, { "id": "p183.3", "order": 3, "type": "figure", "bbox": { "l": 703.1, "t": 1055.2199, "r": 846.62, "b": 875.0399 }, "text": "", "attrs": { "source": "pdf_image" }, "reading_order": 2 }, { "id": "p183.4", "order": 4, "type": "figure", "bbox": { "l": 1345.1599, "t": 914.46, "r": 1463.6599, "b": 738.12 }, "text": "", "attrs": { "source": "pdf_image" }, "reading_order": 3 }, { "id": "p183.5", "order": 5, "type": "figure", "bbox": { "l": 759.56, "t": 758.88, "r": 937.58, "b": 633.6 }, "text": "", "attrs": { "source": "pdf_image" }, "reading_order": 4 }, { "id": "p183.6", "order": 6, "type": "figure", "bbox": { "l": 1378.46, "t": 534.84, "r": 1460.12, "b": 372.96 }, "text": "", "attrs": { "source": "pdf_image" }, "reading_order": 5 }, { "id": "p183.7", "order": 7, "type": "figure", "bbox": { "l": 853.1, "t": 398.58, "r": 1014.4399, "b": 317.9399 }, "text": "", "attrs": { "source": "pdf_image" }, "reading_order": 6 }, { "id": "p183.8", "order": 8, "type": "text", "bbox": { "l": 2118, "t": 279.3, "r": 2539.2, "b": 175.5 }, "text": "COLLECTION DRAINAGE AREA MAP PLAN\nPRELIMINARY AND MAJOR SUBDIVISION\n102 SAMS ROAD\nBLOCK 20101 LOT 29&30\nTOWNSHIP OF JACKSON, OCEAN COUNTY, NEW JERSEY\nAPPLICANT: SHAKKI LLC", "reading_order": 7 }, { "id": "p183.9", "order": 9, "type": "text", "bbox": { "l": 2481, "t": 180.9, "r": 2532.3, "b": 169.5 }, "text": "PROJECT NO", "reading_order": 8 }, { "id": "p183.10", "order": 10, "type": "figure", "bbox": { "l": 2334.6, "t": 156.3, "r": 2426.4, "b": 95.7 }, "text": "", "attrs": { "block_label": "image" }, "reading_order": 9 }, { "id": "p183.11", "order": 11, "type": "footer", "bbox": { "l": 2493, "t": 69.6, "r": 2531.1, "b": 57 }, "text": "C1002", "attrs": { "block_label": "number" }, "reading_order": 10 } ] } ] }