{ "document_id": 11809, "filename": "STORMWATER-REPORT-DEC-2025.pdf", "engine": "paddleocr_vl", "source_run_id": 11920, "generated_at": "2026-10-29T22:50:10+00:00", "page_count": 180, "counts_by_type": { "caption": 108, "figure": 96, "footer": 24, "footnote": 36, "form_field": 12, "formula": 1, "header": 152, "heading": 111, "list": 7, "list_item": 27, "table": 164, "table_cell": 2908, "text": 406, "title": 43 }, "timings": { "total_ms": 29095, "structure_ms": 12585, "text_layer_ms": 469, "build_ms": 727 }, "pages": [ { "document_id": 11809, "page": 1, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 6, "counts_by_type": { "form_field": 1, "heading": 1, "text": 3, "title": 1 }, "build_ms": 10, "items": [ { "id": "p1.1", "order": 1, "type": "text", "bbox": { "l": 114.48, "t": 707.28, "r": 509.04, "b": 618.72 }, "text": "STORMWATER MANAGEMENT REPORT\nfor\n156 East Commodore Boulevard Warehouse\nBlock 2202 Lot 3", "reading_order": 0 }, { "id": "p1.2", "order": 2, "type": "title", "bbox": { "l": 204.96, "t": 574.08, "r": 420, "b": 506.16 }, "text": "JACKSON TOWNSHIP\nOCEAN COUNTY\nNEW JERSEY", "level": 2, "reading_order": 1 }, { "id": "p1.3", "order": 3, "type": "heading", "bbox": { "l": 258.96, "t": 487.68, "r": 366.48, "b": 470.88 }, "text": "PREPARED BY:", "level": 3, "reading_order": 2 }, { "id": "p1.4", "order": 4, "type": "text", "bbox": { "l": 160.56, "t": 452.88, "r": 464.64, "b": 276 }, "text": "PROFESSIONAL DESIGN SERVICES, L.L.C.\n1245 AIRPORT ROAD\nSUITE 1\nLAKEWOOD, NJ 08701\n732-363-0060\nPDS Ref. No. 320157\nGraham J. Macfarlane, P.E., C. M.E.\nNJ License No. 37110", "children": [ { "id": "p1.4.1", "order": 5, "type": "form_field", "bbox": { "l": 204.312, "t": 355.701, "r": 424.903, "b": 271.86 }, "text": "", "attrs": { "field_kind": "signature", "label": "Graham J. Macfarlane, P.E., C. M.E.", "pdf_field_name": "Signature2", "source": "acroform", "label_source": "parent_text", "label_ref": "p1.4" }, "reading_order": 0 } ], "reading_order": 3 }, { "id": "p1.5", "order": 6, "type": "text", "bbox": { "l": 257.52, "t": 266.88, "r": 368.64, "b": 250.8 }, "text": "December 9, 2025", "reading_order": 4 } ] }, { "document_id": 11809, "page": 2, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 13, "counts_by_type": { "heading": 5, "list": 1, "list_item": 5, "text": 2 }, "build_ms": 1, "items": [ { "id": "p2.1", "order": 1, "type": "heading", "bbox": { "l": 270.96, "t": 720.24, "r": 341.04, "b": 705.36 }, "text": "CONTENTS", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 0 }, { "id": "p2.2", "order": 2, "type": "text", "bbox": { "l": 70.32, "t": 664.56, "r": 540, "b": 568.32 }, "text": "I PROJECT DESCRIPTION ..... 1\nII EXISTING HYDROLOGY AND SOILS ..... 2\nIII REGULATORY STANDARDS ..... 3\nIV METHODOLOGY ..... 7\nV STORMWATER MANAGEMENT PLAN ..... 9", "attrs": { "block_label": "content" }, "reading_order": 1 }, { "id": "p2.3", "order": 3, "type": "heading", "bbox": { "l": 70.56, "t": 540.48, "r": 146.16, "b": 526.56 }, "text": "APPENDICES", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 2 }, { "id": "p2.4", "order": 4, "type": "list", "bbox": { "l": 72, "t": 519.4717479999999, "r": 328.156397, "b": 423.412909 }, "text": "", "attrs": { "item_count": 5 }, "children": [ { "id": "p2.4.1", "order": 5, "type": "list_item", "bbox": { "l": 72, "t": 519.4717479999999, "r": 299.379123, "b": 506.212904 }, "text": "PRE-DEVELOPED CALCULATIONS", "marker": "A.", "reading_order": 0 }, { "id": "p2.4.2", "order": 6, "type": "list_item", "bbox": { "l": 72, "t": 498.711753, "r": 306.555429, "b": 485.452909 }, "text": "POST-DEVELOPED CALCULATIONS", "marker": "B.", "reading_order": 1 }, { "id": "p2.4.3", "order": 7, "type": "list_item", "bbox": { "l": 72, "t": 478.071761, "r": 328.156397, "b": 464.812918 }, "text": "COLLECTION SYSTEM CALCULATIONS", "marker": "C.", "reading_order": 2 }, { "id": "p2.4.4", "order": 8, "type": "list_item", "bbox": { "l": 72, "t": 457.311744, "r": 284.215705, "b": 444.0529 }, "text": "SOIL EROSION CALCULATIONS", "marker": "D.", "reading_order": 3 }, { "id": "p2.4.5", "order": 9, "type": "list_item", "bbox": { "l": 72, "t": 436.671752, "r": 271.226491, "b": 423.412909 }, "text": "GROUNDWATER MOUNDING", "marker": "E.", "reading_order": 4 } ], "reading_order": 3 }, { "id": "p2.5", "order": 10, "type": "heading", "bbox": { "l": 70.08, "t": 395.76, "r": 170.16, "b": 382.08 }, "text": "LIST OF FIGURES", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 4 }, { "id": "p2.6", "order": 11, "type": "heading", "bbox": { "l": 72, "t": 374.511748, "r": 170.926256, "b": 361.252905 }, "text": "1. ROAD MAP", "attrs": { "split_from": "leading_line" }, "level": 3, "reading_order": 5 }, { "id": "p2.7", "order": 12, "type": "text", "bbox": { "l": 69.6, "t": 361.252905, "r": 224.16, "b": 339.612891 }, "text": "2. TOPOGRAPHIC MAP", "attrs": { "block_label": "content" }, "reading_order": 6 }, { "id": "p2.8", "order": 13, "type": "heading", "bbox": { "l": 72, "t": 333.111739, "r": 170.171594, "b": 319.852896 }, "text": "3. SOILS MAP", "attrs": { "split_from": "trailing_line" }, "level": 3, "reading_order": 7 } ] }, { "document_id": 11809, "page": 3, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 3, "counts_by_type": { "heading": 1, "text": 2 }, "build_ms": 0, "items": [ { "id": "p3.1", "order": 1, "type": "heading", "bbox": { "l": 70.08, "t": 719.04, "r": 251.52, "b": 705.84 }, "text": "I PROJECT DESCRIPTION", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 0 }, { "id": "p3.2", "order": 2, "type": "text", "bbox": { "l": 69.6, "t": 691.44, "r": 541.68, "b": 621.6 }, "text": "Development of the subject premises known as Block 2202 Lot 3 within Jackson Township, Ocean County, NJ is proposed. The subject parcel encompasses a total land area of approximately 2.2 acres.", "reading_order": 1 }, { "id": "p3.3", "order": 3, "type": "text", "bbox": { "l": 69.6, "t": 608.64, "r": 541.92, "b": 454.8 }, "text": "It is proposed to develop the site with a new multi-tenant warehouse building in accordance with the Land Use and Development Regulations of Jackson Township. Construction of a Stormwater Management system is proposed for compliance with current regulations of Jackson Township, Ocean County and the Ocean County SCD, as well as the NJ Stormwater Management Rules, NJAC 7:8. This report outlines the methodologies and results for management of the increased stormwater runoff created as a result of the development.", "reading_order": 2 } ] }, { "document_id": 11809, "page": 4, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 17, "counts_by_type": { "heading": 1, "table": 1, "table_cell": 12, "text": 3 }, "build_ms": 3, "items": [ { "id": "p4.1", "order": 1, "type": "heading", "bbox": { "l": 70.32, "t": 718.8, "r": 302.64, "b": 706.08 }, "text": "II EXISTING HYDROLOGY & SOILS", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 0 }, { "id": "p4.2", "order": 2, "type": "text", "bbox": { "l": 68.64, "t": 691.68, "r": 543.12, "b": 482.88 }, "text": "The project site lies within the watershed of the South Branch of the Metedeconk River. Figure 2 is a copy of the USGS Quadrangle Topography Map with the site located. The site generally slopes from the west to east. The existing elevations range from about 110 feet above MSL to 120 feet above MSL. Figure 1 is a copy of the site's Location Map. Figure 2 is a copy of the USGS Quadrangle Topography Map with the site located. Development of the site is not restricted by the presence of freshwater wetlands, flood hazard area or Category One Riparian buffers. According to the Ocean County Soil Survey, the following soil types exist on the project site:", "reading_order": 1 }, { "id": "p4.3", "order": 3, "type": "table", "bbox": { "l": 105.84, "t": 444.72, "r": 503.52, "b": 373.68 }, "text": "", "attrs": { "block_label": "table", "n_rows": 3, "n_cols": 4, "integrity": { "cells_checked": 12, "cells_flagged": 0 } }, "children": [ { "id": "p4.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 108, "t": 443.511748, "r": 156.389735, "b": 430.252905 }, "text": "Soil Type", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p4.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 290.37951, "t": 443.511748, "r": 318.46987, "b": 430.252905 }, "text": "% Slope", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p4.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 351.251671, "t": 443.511748, "r": 440.498277, "b": 430.252905 }, "text": "Depth to SHWT *", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p4.3.4", "order": 7, "type": "table_cell", "bbox": { "l": 470.082147, "t": 443.511748, "r": 501.530447, "b": 430.252905 }, "text": "HSG *", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 3 }, { "id": "p4.3.5", "order": 8, "type": "table_cell", "bbox": { "l": 108, "t": 415.911757, "r": 222.688724, "b": 402.652914 }, "text": "LasB - Lakewood Sand", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p4.3.6", "order": 9, "type": "table_cell", "bbox": { "l": 288.923055, "t": 415.911757, "r": 304.888856, "b": 402.652914 }, "text": "2-5", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p4.3.7", "order": 10, "type": "table_cell", "bbox": { "l": 379.028188, "t": 415.911757, "r": 412.564652, "b": 402.652914 }, "text": ">6 feet", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p4.3.8", "order": 11, "type": "table_cell", "bbox": { "l": 481.469915, "t": 415.911757, "r": 490.117508, "b": 402.652914 }, "text": "A", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p4.3.9", "order": 12, "type": "table_cell", "bbox": { "l": 108, "t": 388.311767, "r": 219.710313, "b": 375.052924 }, "text": "BerAr- Berryland Sand", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p4.3.10", "order": 13, "type": "table_cell", "bbox": { "l": 288.938962, "t": 388.311767, "r": 304.904763, "b": 375.052924 }, "text": "0-2", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p4.3.11", "order": 14, "type": "table_cell", "bbox": { "l": 371.019321, "t": 388.311767, "r": 420.529633, "b": 375.052924 }, "text": "0-6 inches", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p4.3.12", "order": 15, "type": "table_cell", "bbox": { "l": 475.39753, "t": 388.311767, "r": 496.116204, "b": 375.052924 }, "text": "A/D", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 } ], "reading_order": 2 }, { "id": "p4.4", "order": 16, "type": "text", "bbox": { "l": 69.6, "t": 332.16, "r": 542.16, "b": 234.72 }, "text": "Lakewood sand would typically comprised of 90% sand grains. Permeability of the series is rapid, and greater than 2 inches per hour; the series is considered excessively drained. The soil does not retain water for long periods of time. The soil series is not associated with flood plains, and depth to seasonal high water table is typically greater than 6 feet.", "reading_order": 3 }, { "id": "p4.5", "order": 17, "type": "text", "bbox": { "l": 68.64, "t": 222.24, "r": 541.92, "b": 124.32 }, "text": "Based on the mapping, Berryland Sand is also depicted on site. This soil series is typically poorly drained, and could impose limitations on development based on high water table. However, the site specific soils investigations did not reveal these findings. We would defer to the site specific data and evaluations in lieu of the published data in the Soil Survey.", "reading_order": 4 } ] }, { "document_id": 11809, "page": 5, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 12, "counts_by_type": { "figure": 1, "footnote": 1, "table": 1, "table_cell": 3, "text": 6 }, "build_ms": 1, "items": [ { "id": "p5.1", "order": 1, "type": "figure", "bbox": { "l": 35.76, "t": 765.12, "r": 575.28, "b": 129.84 }, "text": "", "attrs": { "block_label": "image" }, "reading_order": 0 }, { "id": "p5.2", "order": 2, "type": "text", "bbox": { "l": 433.44, "t": 758.4, "r": 519.6, "b": 742.56 }, "text": "Vista Center", "reading_order": 1 }, { "id": "p5.3", "order": 3, "type": "text", "bbox": { "l": 414.72, "t": 457.2, "r": 514.08, "b": 439.44 }, "text": "Jackson's Mills", "reading_order": 2 }, { "id": "p5.4", "order": 4, "type": "text", "bbox": { "l": 260.64, "t": 146.16, "r": 337.44, "b": 135.6 }, "text": "SCALE IN FEET", "reading_order": 3 }, { "id": "p5.5", "order": 5, "type": "text", "bbox": { "l": 54.48, "t": 120.48, "r": 275.28, "b": 19.44 }, "text": "PDS\nPROFESSIONAL DESIGN SERVICES, L.L.C.\nCONSULTING ENGINEERS, LAND SURVEYORS, PLANNERS, ENVIRONMENTAL SCIENTISTS, CONSTRUCTION SERVICES\n1245 AIRPORT ROAD, SUITE 1, LAKEWOOD, NEW JERSEY 08701\nPHONE 732 363 0060 FAX 732 363 0073 ENGINEERING@PDS-NJ.COM WWW.PDS-NJ.COM NEW JERSEY STATE BOARD OF P.E. & L.S. CERTIFICATE OF AUTHORIZATION NO. 24GA28125400", "reading_order": 4 }, { "id": "p5.6", "order": 6, "type": "text", "bbox": { "l": 400.8, "t": 120.72, "r": 478.32, "b": 64.56 }, "text": "DCATION MAF\nFOR\nBLOCK 2202\nLOT 3", "reading_order": 5 }, { "id": "p5.7", "order": 7, "type": "text", "bbox": { "l": 341.04, "t": 54.48, "r": 529.44, "b": 30.48 }, "text": "TOWNSHIP OF JACKSON\nOCEAN COUNTY NEW JERSEY", "reading_order": 6 }, { "id": "p5.8", "order": 8, "type": "table", "bbox": { "l": 304.08, "t": 26.16, "r": 542.16, "b": 16.8 }, "text": "", "attrs": { "n_rows": 1, "n_cols": 3, "integrity": { "cells_checked": 3, "cells_flagged": 0 } }, "children": [ { "id": "p5.8.1", "order": 9, "type": "table_cell", "bbox": { "l": 304.98, "t": 23.565110000000004, "r": 354.670103, "b": 17.692741999999953 }, "text": "DRAFTED BY: BK", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 0 }, { "id": "p5.8.2", "order": 10, "type": "table_cell", "bbox": { "l": 385.74, "t": 23.565110000000004, "r": 435.796938, "b": 17.692741999999953 }, "text": "DATE: 08/25/2025", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 1 }, { "id": "p5.8.3", "order": 11, "type": "table_cell", "bbox": { "l": 490.14, "t": 23.62510999999995, "r": 541.291292, "b": 17.812741999999957 }, "text": "PROJECT: 320157", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 2 } ], "reading_order": 7 }, { "id": "p5.9", "order": 12, "type": "footnote", "bbox": { "l": 44.4, "t": 475.2, "r": 168.48, "b": 444.48 }, "text": "COMMODORE BLVD", "attrs": { "block_label": "vision_footnote" }, "reading_order": 8 } ] }, { "document_id": 11809, "page": 6, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 20, "counts_by_type": { "figure": 2, "heading": 2, "text": 16 }, "build_ms": 1, "items": [ { "id": "p6.1", "order": 1, "type": "figure", "bbox": { "l": 42.96, "t": 763.92, "r": 570.48, "b": 150.48 }, "text": "", "attrs": { "block_label": "image" }, "reading_order": 0 }, { "id": "p6.2", "order": 2, "type": "text", "bbox": { "l": 436.32, "t": 758.4, "r": 522.96, "b": 742.56 }, "text": "Vista Center", "reading_order": 1 }, { "id": "p6.3", "order": 3, "type": "text", "bbox": { "l": 238.08, "t": 533.76, "r": 448.32, "b": 497.76 }, "text": "ANRD Jackson's Mills Jacksons Jake Mills Dam", "reading_order": 2 }, { "id": "p6.4", "order": 4, "type": "text", "bbox": { "l": 348.24, "t": 487.2, "r": 391.2, "b": 450.24 }, "text": "ackson\nMills\nLake\nJackson's Mills Mills", "reading_order": 3 }, { "id": "p6.5", "order": 5, "type": "text", "bbox": { "l": 45.6, "t": 475.92, "r": 171.12, "b": 445.68 }, "text": "COMMODORE BLVD", "reading_order": 4 }, { "id": "p6.6", "order": 6, "type": "text", "bbox": { "l": 405.12, "t": 462.48, "r": 559.92, "b": 436.32 }, "text": "Jackson's Mills Mills", "reading_order": 5 }, { "id": "p6.7", "order": 7, "type": "text", "bbox": { "l": 172.56, "t": 411.12, "r": 231.12, "b": 384 }, "text": "SITE", "reading_order": 6 }, { "id": "p6.8", "order": 8, "type": "text", "bbox": { "l": 180, "t": 174, "r": 206.16, "b": 163.44 }, "text": "1000", "reading_order": 7 }, { "id": "p6.9", "order": 9, "type": "text", "bbox": { "l": 260.64, "t": 146.16, "r": 337.44, "b": 135.84 }, "text": "SCALE IN FEET", "reading_order": 8 }, { "id": "p6.10", "order": 10, "type": "figure", "bbox": { "l": 130.08, "t": 126, "r": 180.24, "b": 106.08 }, "text": "", "attrs": { "block_label": "image" }, "children": [ { "id": "p6.10.1", "order": 11, "type": "heading", "bbox": { "l": 146.16, "t": 123.84, "r": 178.8, "b": 106.56 }, "text": "PDS", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 0 } ], "reading_order": 9 }, { "id": "p6.11", "order": 12, "type": "text", "bbox": { "l": 53.04, "t": 104.88, "r": 271.68, "b": 88.8 }, "text": "PROFESSIONAL DESIGN SERVICES, L.L.C.", "reading_order": 10 }, { "id": "p6.12", "order": 13, "type": "text", "bbox": { "l": 71.28, "t": 88.8, "r": 257.76, "b": 20.4 }, "text": "CONSULTING ENGINEERS, LAND SURVEYORS, PLANNERS, ENVIRONMENTAL SCIENTISTS, CONSTRUCTION SERVICES AIRPORT ROAD, SUITE 1, LAKEWOOD, NEW JERSEY 0870 PHONE 732 363 0060 FAX 732 363 0073 ENGINEERING@PDS-NJ.COM WWW.PDS-NJ.COM NEW JERSEY STATE BOARD OF P.E. & L.S. CERTIFICATE OF AUTHORIZATION NO. 24GA28125400", "reading_order": 11 }, { "id": "p6.13", "order": 14, "type": "heading", "bbox": { "l": 402, "t": 122.16, "r": 469.92, "b": 109.44 }, "text": "QUAD MAP", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 12 }, { "id": "p6.14", "order": 15, "type": "text", "bbox": { "l": 426.72, "t": 105.6, "r": 445.92, "b": 95.04 }, "text": "FOR", "reading_order": 13 }, { "id": "p6.15", "order": 16, "type": "text", "bbox": { "l": 404.88, "t": 89.52, "r": 467.04, "b": 65.04 }, "text": "BLOCK 2202\nLOT 3", "reading_order": 14 }, { "id": "p6.16", "order": 17, "type": "text", "bbox": { "l": 341.28, "t": 54.48, "r": 529.44, "b": 30.96 }, "text": "TOWNSHIP OF JACKSON\nOCEAN COUNTY NEW JERSEY", "reading_order": 15 }, { "id": "p6.17", "order": 18, "type": "text", "bbox": { "l": 304.08, "t": 25.92, "r": 543.36, "b": 16.8 }, "text": "DATE: 08/25/2025", "reading_order": 16 }, { "id": "p6.18", "order": 19, "type": "text", "bbox": { "l": 488.88, "t": 25.92, "r": 542.16, "b": 17.04 }, "text": "PROJECT: 320157", "reading_order": 17 }, { "id": "p6.19", "order": 20, "type": "text", "bbox": { "l": 303.84, "t": 25.44, "r": 355.68, "b": 17.52 }, "text": "DRAFTED BY: BK", "reading_order": 18 } ] }, { "document_id": 11809, "page": 7, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 15, "counts_by_type": { "figure": 1, "heading": 2, "table": 1, "table_cell": 3, "text": 8 }, "build_ms": 1, "items": [ { "id": "p7.1", "order": 1, "type": "figure", "bbox": { "l": 42, "t": 731.52, "r": 570.96, "b": 137.52 }, "text": "", "attrs": { "block_label": "image" }, "reading_order": 0 }, { "id": "p7.2", "order": 2, "type": "text", "bbox": { "l": 62.88, "t": 723.6, "r": 132.96, "b": 714.24 }, "text": "556500 556600", "reading_order": 1 }, { "id": "p7.3", "order": 3, "type": "text", "bbox": { "l": 157.44, "t": 723.36, "r": 510.96, "b": 713.76 }, "text": "556700 556800 556900 557000 557100 557200 557300 557400", "reading_order": 2 }, { "id": "p7.4", "order": 4, "type": "text", "bbox": { "l": 535.44, "t": 722.88, "r": 558, "b": 714 }, "text": "557500", "reading_order": 3 }, { "id": "p7.5", "order": 5, "type": "text", "bbox": { "l": 260.64, "t": 146.4, "r": 337.44, "b": 135.6 }, "text": "SCALE IN FEET", "reading_order": 4 }, { "id": "p7.6", "order": 6, "type": "heading", "bbox": { "l": 130.32, "t": 125.76, "r": 180.72, "b": 106.08 }, "text": "PDS", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 5 }, { "id": "p7.7", "order": 7, "type": "text", "bbox": { "l": 54.24, "t": 120.72, "r": 275.76, "b": 19.2 }, "text": "PROFESSIONAL DESIGN SERVICES, L.L.C.\nCONSULTING ENGINEERS, LAND SURVEYORS, PLANNERS, ENVIRONMENTAL SCIENTISTS, CONSTRUCTION SERVICES\n1245 AIRPORT ROAD, SUITE 1, LAKEWOOD, NEW JERSEY 08701\nPHONE 732 363 0060 FAX 732 363 0073 ENGINEERING@PDS-NJ.COM WWW.PDS-NJ.COM NEW JERSEY STATE BOARD OF P.E. & L.S. CERTIFICATE OF AUTHORIZATION NO. 24GA28125400", "reading_order": 6 }, { "id": "p7.8", "order": 8, "type": "heading", "bbox": { "l": 401.76, "t": 122.16, "r": 469.92, "b": 109.2 }, "text": "SOILS MAP", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 7 }, { "id": "p7.9", "order": 9, "type": "text", "bbox": { "l": 426.72, "t": 105.6, "r": 445.68, "b": 95.04 }, "text": "FOR", "reading_order": 8 }, { "id": "p7.10", "order": 10, "type": "text", "bbox": { "l": 405.12, "t": 89.52, "r": 467.04, "b": 65.04 }, "text": "BLOCK 2202\nLOT 3", "reading_order": 9 }, { "id": "p7.11", "order": 11, "type": "text", "bbox": { "l": 341.28, "t": 54.48, "r": 529.2, "b": 30.72 }, "text": "TOWNSHIP OF JACKSON\nOCEAN COUNTY NEW JERSEY", "reading_order": 10 }, { "id": "p7.12", "order": 12, "type": "table", "bbox": { "l": 303.36, "t": 25.92, "r": 542.16, "b": 16.8 }, "text": "", "attrs": { "n_rows": 1, "n_cols": 3, "integrity": { "cells_checked": 3, "cells_flagged": 0 } }, "children": [ { "id": "p7.12.1", "order": 13, "type": "table_cell", "bbox": { "l": 304.98, "t": 23.565110000000004, "r": 354.670103, "b": 17.692741999999953 }, "text": "DRAFTED BY: BK", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 0 }, { "id": "p7.12.2", "order": 14, "type": "table_cell", "bbox": { "l": 385.74, "t": 23.565110000000004, "r": 435.796938, "b": 17.692741999999953 }, "text": "DATE: 08/25/2025", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 1 }, { "id": "p7.12.3", "order": 15, "type": "table_cell", "bbox": { "l": 490.14, "t": 23.62510999999995, "r": 541.291292, "b": 17.812741999999957 }, "text": "PROJECT: 320157", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 2 } ], "reading_order": 11 } ] }, { "document_id": 11809, "page": 8, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 15, "counts_by_type": { "header": 1, "heading": 1, "list": 1, "list_item": 8, "text": 4 }, "build_ms": 1, "items": [ { "id": "p8.1", "order": 1, "type": "header", "bbox": { "l": 106.08, "t": 718.8, "r": 271.44, "b": 706.32 }, "text": "REGULATORY STANDARDS", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p8.2", "order": 2, "type": "text", "bbox": { "l": 71.04, "t": 718.56, "r": 86.88, "b": 706.8 }, "text": "Ⅲ", "attrs": { "block_label": "number" }, "reading_order": 1 }, { "id": "p8.3", "order": 3, "type": "heading", "bbox": { "l": 105.84, "t": 690.72, "r": 265.2, "b": 677.76 }, "text": "A. Applicable Regulations", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 2 }, { "id": "p8.4", "order": 4, "type": "text", "bbox": { "l": 105.12, "t": 663.84, "r": 541.44, "b": 621.12 }, "text": "All increased stormwater runoff resulting from the proposed development must be managed both qualitatively and quantitatively in accordance with New Jersey Regulations.", "reading_order": 3 }, { "id": "p8.5", "order": 5, "type": "text", "bbox": { "l": 105.12, "t": 608.64, "r": 542.4, "b": 400.56 }, "text": "The Flood Hazard Area, Freshwater Wetland Regulations and Residential Site Improvement Standards (RSIS), as administered by the New Jersey Department of Environmental Protection (NJDEP) requires the utilization of best available technology to minimize the amount of stormwater runoff, maintain existing onsite infiltration, simulate natural drainage systems and minimize the discharge of pollutants to ground or surface waters. The overall goal of the post-construction stormwater management system design shall be to meet the erosion control, groundwater recharge, stormwater runoff quantity and quality standards at N.J.A.C. 7:8-5.4 and 5.5.", "reading_order": 4 }, { "id": "p8.6", "order": 6, "type": "text", "bbox": { "l": 142.08, "t": 387.6, "r": 387.12, "b": 374.16 }, "text": "The stormwater management must be designed to:", "reading_order": 5 }, { "id": "p8.7", "order": 7, "type": "list", "bbox": { "l": 141.36, "t": 360.24, "r": 541.44, "b": 70.08 }, "text": "", "attrs": { "item_count": 8 }, "children": [ { "id": "p8.7.1", "order": 8, "type": "list_item", "bbox": { "l": 142.56, "t": 360.24, "r": 475.92, "b": 346.08 }, "text": "Reduce flood damage, including damage to life and property;", "marker": "1.", "reading_order": 0 }, { "id": "p8.7.2", "order": 9, "type": "list_item", "bbox": { "l": 141.36, "t": 332.4, "r": 541.2, "b": 291.36 }, "text": "Minimize, to the extent practical, any increase in stormwater runoff from any new development;", "marker": "2.", "reading_order": 1 }, { "id": "p8.7.3", "order": 10, "type": "list_item", "bbox": { "l": 141.6, "t": 276.96, "r": 501.84, "b": 263.28 }, "text": "Reduce soil erosion from any development or construction project;", "marker": "3.", "reading_order": 2 }, { "id": "p8.7.4", "order": 11, "type": "list_item", "bbox": { "l": 141.6, "t": 249.84, "r": 541.44, "b": 208.8 }, "text": "Assure the adequacy of exiting and proposed culverts and bridges, and other in-stream structures;", "marker": "4.", "reading_order": 3 }, { "id": "p8.7.5", "order": 12, "type": "list_item", "bbox": { "l": 142.08, "t": 194.16, "r": 335.76, "b": 180.96 }, "text": "Maintain groundwater recharge;", "marker": "5.", "reading_order": 4 }, { "id": "p8.7.6", "order": 13, "type": "list_item", "bbox": { "l": 141.84, "t": 167.04, "r": 531.12, "b": 153.12 }, "text": "Prevent, to the greatest extent feasible, an increase in nonpoint pollution;", "marker": "6.", "reading_order": 5 }, { "id": "p8.7.7", "order": 14, "type": "list_item", "bbox": { "l": 142.56, "t": 139.92, "r": 540.96, "b": 97.68 }, "text": "Maintain the integrity of stream channels for their biological functions, as well as for drainage;", "marker": "7.", "reading_order": 6 }, { "id": "p8.7.8", "order": 15, "type": "list_item", "bbox": { "l": 141.6, "t": 84.24, "r": 541.44, "b": 70.08 }, "text": "Minimize pollutants in stormwater runoff from new and existing", "marker": "8.", "reading_order": 7 } ], "reading_order": 6 } ] }, { "document_id": 11809, "page": 9, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 13, "counts_by_type": { "heading": 2, "list": 2, "list_item": 6, "text": 3 }, "build_ms": 1, "items": [ { "id": "p9.1", "order": 1, "type": "text", "bbox": { "l": 177.12, "t": 719.28, "r": 541.92, "b": 593.76 }, "text": "development in order to restore, enhance and maintain the chemical, physical, and biological integrity of the waters of the State, to protect public health, to safeguard fish and aquatic life and scenic and ecological values and to enhance the domestic, municipal, recreational, industrial and other uses of water; and", "reading_order": 0 }, { "id": "p9.2", "order": 2, "type": "list", "bbox": { "l": 141.6, "t": 581.52, "r": 541.44, "b": 482.88 }, "text": "", "attrs": { "item_count": 2 }, "children": [ { "id": "p9.2.1", "order": 3, "type": "list_item", "bbox": { "l": 141.6, "t": 581.52, "r": 541.44, "b": 539.52 }, "text": "Protect public safety through the proper design and operation of stormwater management basins.", "marker": "9.", "reading_order": 0 }, { "id": "p9.2.2", "order": 4, "type": "list_item", "bbox": { "l": 142.32, "t": 526.08, "r": 540.48, "b": 482.88 }, "text": "Utilize Green Infrastructure Standards outlined in NJAC 7:8-5.3 to satisfy groundwater recharge and stormwater runoff quality standards.", "marker": "10.", "reading_order": 1 } ], "reading_order": 1 }, { "id": "p9.3", "order": 5, "type": "text", "bbox": { "l": 105.36, "t": 470.88, "r": 540.96, "b": 428.16 }, "text": "Analysis will utilize the New Jersey Stormwater Best Management Practices (BMP) Manual as guidance. Overall stormwater management shall take into account the following:", "reading_order": 2 }, { "id": "p9.4", "order": 6, "type": "list", "bbox": { "l": 105.36, "t": 415.68, "r": 541.2, "b": 235.92 }, "text": "", "attrs": { "item_count": 4 }, "children": [ { "id": "p9.4.1", "order": 7, "type": "list_item", "bbox": { "l": 105.36, "t": 415.68, "r": 541.2, "b": 345.12 }, "text": "Existing site conditions, including: environmentally critical areas; wetlands; flood prone areas; slopes; depth to SHWT; soil type; permeability; texture; drainage area and drainage patterns; and the presence of limestone.", "marker": "1.", "reading_order": 0 }, { "id": "p9.4.2", "order": 8, "type": "list_item", "bbox": { "l": 140.64, "t": 332.88, "r": 500.4, "b": 317.76 }, "text": "Designed to minimize maintenance and ensure proper functioning.", "marker": "2.", "reading_order": 1 }, { "id": "p9.4.3", "order": 9, "type": "list_item", "bbox": { "l": 105.6, "t": 305.04, "r": 540.96, "b": 263.76 }, "text": "Designed, constructed and installed to be strong, durable and corrosion resistant.", "marker": "3.", "reading_order": 2 }, { "id": "p9.4.4", "order": 10, "type": "list_item", "bbox": { "l": 141.12, "t": 249.84, "r": 396.96, "b": 235.92 }, "text": "Designed to meet minimum safety standards.", "marker": "4.", "reading_order": 3 } ], "reading_order": 3 }, { "id": "p9.5", "order": 11, "type": "heading", "bbox": { "l": 105.84, "t": 222.24, "r": 327.84, "b": 208.08 }, "text": "B. Design and Performance Standards", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 4 }, { "id": "p9.6", "order": 12, "type": "heading", "bbox": { "l": 142.08, "t": 194.88, "r": 258.48, "b": 180.72 }, "text": "1. Erosion Control", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 5 }, { "id": "p9.7", "order": 13, "type": "text", "bbox": { "l": 177.6, "t": 167.28, "r": 540.96, "b": 96.96 }, "text": "The minimum design and performance standards for erosion control are those established under the Soil Erosion and Sediment Control Act, N.J.S.A. 4:24-39 et seq. and implementing rules.", "reading_order": 6 } ] }, { "document_id": 11809, "page": 10, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 9, "counts_by_type": { "heading": 2, "list": 1, "list_item": 2, "text": 4 }, "build_ms": 1, "items": [ { "id": "p10.1", "order": 1, "type": "heading", "bbox": { "l": 141.36, "t": 719.04, "r": 293.76, "b": 705.12 }, "text": "2. Groundwater Recharge", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 0 }, { "id": "p10.2", "order": 2, "type": "text", "bbox": { "l": 177.12, "t": 691.68, "r": 540.96, "b": 648.48 }, "text": "The minimum design and performance standards for groundwater recharge require compliance with either of the following:", "reading_order": 1 }, { "id": "p10.3", "order": 3, "type": "text", "bbox": { "l": 176.64, "t": 636.48, "r": 541.92, "b": 539.52 }, "text": "a. Demonstrate through hydrologic and hydraulic analysis that the site\nand its stormwater management measures maintain 100 percent of the\naverage annual pre-construction groundwater recharge volume for the\nsite.", "reading_order": 2 }, { "id": "p10.4", "order": 4, "type": "text", "bbox": { "l": 177.12, "t": 525.84, "r": 541.44, "b": 456 }, "text": "b. Demonstrate through hydrologic and hydraulic analysis that the increase of stormwater runoff volume from pre-construction to post-construction for the two-year storm is infiltrated.", "reading_order": 3 }, { "id": "p10.5", "order": 5, "type": "heading", "bbox": { "l": 141.6, "t": 443.76, "r": 261.6, "b": 428.4 }, "text": "3. Runoff Quantity", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 4 }, { "id": "p10.6", "order": 6, "type": "text", "bbox": { "l": 177.12, "t": 415.44, "r": 541.44, "b": 372.96 }, "text": "In order to control stormwater runoff quantity impacts one of the following must be demonstrated:", "reading_order": 5 }, { "id": "p10.7", "order": 7, "type": "list", "bbox": { "l": 175.92, "t": 360.24, "r": 543.6, "b": 68.88 }, "text": "", "attrs": { "item_count": 2 }, "children": [ { "id": "p10.7.1", "order": 8, "type": "list_item", "bbox": { "l": 176.88, "t": 360.24, "r": 542.16, "b": 235.68 }, "text": "Demonstrate through hydrologic and hydraulic analysis that for stormwater leaving the site, post-construction runoff hydrographs for the 2, 10 and 100-year storm events do not exceed, at any point in time, the pre-construction runoff hydrographs for the same storm events;", "marker": "a.", "reading_order": 0 }, { "id": "p10.7.2", "order": 9, "type": "list_item", "bbox": { "l": 175.92, "t": 222.96, "r": 543.6, "b": 68.88 }, "text": "Demonstrate through hydrologic and hydraulic analysis that there is no increase, as compared to the pre-construction condition, in the peak runoff rates of stormwater leaving the site for the 2, 10 and 100-year storm events and that the increase volume or change in timing of stormwater runoff will not increase flood damage at or downstream of the site. This analysis shall include the analysis of impacts of", "marker": "b.", "reading_order": 1 } ], "reading_order": 6 } ] }, { "document_id": 11809, "page": 11, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 5, "counts_by_type": { "heading": 1, "text": 4 }, "build_ms": 0, "items": [ { "id": "p11.1", "order": 1, "type": "text", "bbox": { "l": 213.36, "t": 719.04, "r": 541.68, "b": 676.56 }, "text": "existing land uses and projected land uses assuming full development under existing zoning and land use ordinances in the drainage area;", "reading_order": 0 }, { "id": "p11.2", "order": 2, "type": "text", "bbox": { "l": 175.44, "t": 662.88, "r": 541.44, "b": 510.72 }, "text": "c. Design stormwater management measures so that the post-construction peak runoff rates for the 2, 10 and 100-year storm events are 50, 75 and 80 percent, respectively, of the pre-construction peak runoff rates. The percentages apply only to the post-construction stormwater runoff that is attributable to the portion of the site on which the proposed development or project is to be constructed.", "reading_order": 1 }, { "id": "p11.3", "order": 3, "type": "heading", "bbox": { "l": 105.6, "t": 498.48, "r": 214.8, "b": 484.08 }, "text": "4. Water Quality", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 2 }, { "id": "p11.4", "order": 4, "type": "text", "bbox": { "l": 140.16, "t": 469.92, "r": 542.4, "b": 344.4 }, "text": "Stormwater management measures shall be designed to reduce the post-construction load of total suspended solids (TSS) in stormwater runoff generated from the water quality design storm by 95 percent of the anticipated load from the development site expressed as an annual average, since the site is located within the watershed of a Category One Waterway.", "reading_order": 3 }, { "id": "p11.5", "order": 5, "type": "text", "bbox": { "l": 141.36, "t": 304.8, "r": 543.12, "b": 235.68 }, "text": "Direct run-off from building roof tops is not considered contaminated since it has not\ncontacted the pavement or the ground surface, and is not subject to satisfaction of\nthe TSS removal criteria.", "reading_order": 4 } ] }, { "document_id": 11809, "page": 12, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 2, "counts_by_type": { "heading": 1, "text": 1 }, "build_ms": 1, "items": [ { "id": "p12.1", "order": 1, "type": "heading", "bbox": { "l": 70.56, "t": 719.04, "r": 209.28, "b": 705.84 }, "text": "IV METHODOLOGY", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 0 }, { "id": "p12.2", "order": 2, "type": "text", "bbox": { "l": 70.56, "t": 709.44, "r": 545.28, "b": 66.96 }, "text": "The overall design will control stormwater runoff and pollutants closer to their source while providing site design measures that can significantly reduce the overall impact of land development on stormwater runoff as required by the Stormwater Management Rules.\nThe methodology typically used to estimate the stormwater runoff peak flows and volumes for the required storm events is the 24-hour storm using the rainfall distribution recommended by the U.S. Department of Agriculture Soil Conservation Service as defined in Technical Release - 55 (TR-55) dated June 1986. The time of concentrations utilized will be calculated for each contributory area utilizing the TR-55 methodology.\nFor the purpose of calculating runoff coefficients and groundwater recharge, a preconstruction condition of a site or portion thereof are assumed to be in good condition. A runoff coefficient or a groundwater recharge land cover for an existing condition may be used on all or a portion of the site if the hydrologic condition has existed on the site or portion of the site for at least five years without interruption prior to the time of application.\nThe runoff computations shall account for all significant land features and structures, such as ponds, wetlands, depressions, hedgerows, or culverts, that may reduce pre-construction stormwater runoff rates and volumes.\nIn computing stormwater runoff from all design storms, the computations consider the relative stormwater runoff rates and/or volumes of pervious and impervious surfaces separately to accurately compute the rates and volume of stormwater runoff from the site.\nThe water quality design storm is 1.25 inches of rainfall in two hours. Water quality calculations shall take into account the distribution of rain from the water quality design storm, as reflected in the Stormwater Rules.\nAll hydrologic and flood routing computations will utilize the HydroCad Stormwater", "attrs": { "block_label": "abstract" }, "reading_order": 1 } ] }, { "document_id": 11809, "page": 13, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 2, "counts_by_type": { "text": 2 }, "build_ms": 0, "items": [ { "id": "p13.1", "order": 1, "type": "text", "bbox": { "l": 68.64, "t": 719.52, "r": 541.92, "b": 538.8 }, "text": "Modeling Software. The stormwater drainage collection system will be designed in accordance with RSIS standards. The Rational Formula was used to compute peak runoff rates for design of the proposed internal collection system. A 10 year frequency storm was used for design as required by RSIS and the rainfall intensities were obtained from the NJDEP Rainfall Intensity Curves. The sub-areas tributary to each inlet are shown on the Drainage Area Plans. Soil erosion and sediment controls will also be employed as required by the \"Standards for Soil Erosion and Sediment Control in New Jersey.\"", "attrs": { "block_label": "abstract" }, "reading_order": 0 }, { "id": "p13.2", "order": 2, "type": "text", "bbox": { "l": 70.32, "t": 525.84, "r": 541.2, "b": 482.4 }, "text": "Copies of the TR-55 hydrologic computations, detention basin routings, and Rational Formula computations are contained within the appendices of this report.", "reading_order": 1 } ] }, { "document_id": 11809, "page": 14, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 9, "counts_by_type": { "heading": 4, "text": 5 }, "build_ms": 1, "items": [ { "id": "p14.1", "order": 1, "type": "heading", "bbox": { "l": 70.8, "t": 719.04, "r": 327.84, "b": 706.08 }, "text": "V STORMWATER MANAGEMENT PLAN", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 0 }, { "id": "p14.2", "order": 2, "type": "heading", "bbox": { "l": 106.32, "t": 691.2, "r": 187.44, "b": 678 }, "text": "Erosion Control", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p14.3", "order": 3, "type": "text", "bbox": { "l": 105.36, "t": 663.84, "r": 541.68, "b": 594.72 }, "text": "The project complies with the \"New Jersey Standards for Soil Erosion and Sediment Control\". Certification for the project is required from the Ocean County Soil Conservation District.", "reading_order": 2 }, { "id": "p14.4", "order": 4, "type": "heading", "bbox": { "l": 106.32, "t": 580.56, "r": 221.76, "b": 567.84 }, "text": "Groundwater Recharge", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 3 }, { "id": "p14.5", "order": 5, "type": "text", "bbox": { "l": 105.36, "t": 552.96, "r": 542.4, "b": 400.8 }, "text": "All increased run-off from the 2 year storm event will recharge the groundwater through the stormwater management system. In accordance with the NJ Stormwater Management Rules, NJAC 7:8-5.4, the project shall maintain 100 percent of the average annual pre-construction groundwater recharge volume for the site, or demonstrate that the increase of stormwater run-off from pre-construction to post-construction for the two year storm is infiltrated.", "reading_order": 4 }, { "id": "p14.6", "order": 6, "type": "text", "bbox": { "l": 104.88, "t": 387.84, "r": 542.4, "b": 234.96 }, "text": "As shown in the flood routings, the site will not produce any additional run-off during the 2 year storm event, and will provide for full recharge from any additional impervious surfaces. All run-off generated will be infiltrated on site through the rain garden/bio-retention facility and small scale infiltration basin. Since the design provides groundwater recharge of increased run-off from the 2 year storm event, the design complies with the applicable standard.", "reading_order": 5 }, { "id": "p14.7", "order": 7, "type": "heading", "bbox": { "l": 106.32, "t": 194.88, "r": 189.6, "b": 180.72 }, "text": "Runoff Quantity", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 6 }, { "id": "p14.8", "order": 8, "type": "text", "bbox": { "l": 105.36, "t": 167.28, "r": 541.2, "b": 125.28 }, "text": "Analysis of pre-developed conditions confirms that run-off from the project site is directed to the east property line.", "reading_order": 7 }, { "id": "p14.9", "order": 9, "type": "text", "bbox": { "l": 105.36, "t": 111.84, "r": 541.68, "b": 70.56 }, "text": "The stormwater management plan consists of on-site collection system and a series of small-scale infiltration basins (SSIB), both surface and sub-surface. Pre-treatment", "reading_order": 8 } ] }, { "document_id": 11809, "page": 15, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 34, "counts_by_type": { "caption": 1, "heading": 2, "table": 2, "table_cell": 28, "text": 1 }, "build_ms": 2, "items": [ { "id": "p15.1", "order": 1, "type": "text", "bbox": { "l": 105.12, "t": 719.76, "r": 542.88, "b": 620.64 }, "text": "forebay is provided for the surface SSIB's to provide water quality and TSS removal in accordance with adopted regulations. The overall system will maintain peak discharge rates to less than those required by State adopted Stormwater Management criteria. The following is a summary of the runoff from the site:", "reading_order": 0 }, { "id": "p15.2", "order": 2, "type": "heading", "bbox": { "l": 230.88, "t": 609.12, "r": 381.12, "b": 594.96 }, "text": "A. Pre-developed Conditions", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p15.3", "order": 3, "type": "table", "bbox": { "l": 172.08, "t": 554.16, "r": 438.48, "b": 411.84 }, "text": "", "attrs": { "block_label": "table", "n_rows": 4, "n_cols": 3, "integrity": { "cells_checked": 12, "cells_flagged": 0 } }, "children": [ { "id": "p15.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 190.799996, "t": 537.831756, "r": 220.192135, "b": 510.772917 }, "text": "Storm Event", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "pdf" }, "reading_order": 0 }, { "id": "p15.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 250.080002, "t": 537.831756, "r": 324.862738, "b": 496.972899 }, "text": "Exist Peak Discharge from Site (CFS)", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "pdf" }, "reading_order": 1 }, { "id": "p15.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 347.519989, "t": 537.831756, "r": 428.245091, "b": 510.772917 }, "text": "Allowable Peak Discharge (CFS)", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "pdf" }, "reading_order": 2 }, { "id": "p15.3.4", "order": 7, "type": "table_cell", "bbox": { "l": 190.680004, "t": 495.951759, "r": 220.272201, "b": 482.692915 }, "text": "2 year", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 3 }, { "id": "p15.3.5", "order": 8, "type": "table_cell", "bbox": { "l": 276.924805, "t": 495.951759, "r": 297.885037, "b": 482.692915 }, "text": "1.43", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p15.3.6", "order": 9, "type": "table_cell", "bbox": { "l": 377.414143, "t": 495.951759, "r": 398.374374, "b": 482.692915 }, "text": "0.71", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p15.3.7", "order": 10, "type": "table_cell", "bbox": { "l": 187.680004, "t": 467.871757, "r": 223.260838, "b": 454.612913 }, "text": "10 year", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p15.3.8", "order": 11, "type": "table_cell", "bbox": { "l": 276.919124, "t": 467.871757, "r": 297.879355, "b": 454.612913 }, "text": "2.32", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p15.3.9", "order": 12, "type": "table_cell", "bbox": { "l": 377.408461, "t": 467.871757, "r": 398.368693, "b": 454.612913 }, "text": "1.74", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p15.3.10", "order": 13, "type": "table_cell", "bbox": { "l": 184.680004, "t": 439.791755, "r": 226.249476, "b": 426.532912 }, "text": "100 year", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p15.3.11", "order": 14, "type": "table_cell", "bbox": { "l": 276.913443, "t": 439.791755, "r": 297.873674, "b": 426.532912 }, "text": "5.23", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p15.3.12", "order": 15, "type": "table_cell", "bbox": { "l": 377.40278, "t": 439.791755, "r": 398.363011, "b": 426.532912 }, "text": "4.18", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 } ], "reading_order": 2 }, { "id": "p15.4", "order": 16, "type": "heading", "bbox": { "l": 228.48, "t": 388.08, "r": 383.28, "b": 373.92 }, "text": "C. Post-developed Conditions", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 3 }, { "id": "p15.5", "order": 17, "type": "caption", "bbox": { "l": 106.32, "t": 360.72, "r": 366, "b": 346.32 }, "text": "Post-developed run-off rates are tabulated as follows:", "attrs": { "block_label": "figure_title" }, "reading_order": 4 }, { "id": "p15.6", "order": 18, "type": "table", "bbox": { "l": 148.32, "t": 306.24, "r": 463.2, "b": 148.56 }, "text": "", "attrs": { "block_label": "table", "n_rows": 4, "n_cols": 4, "integrity": { "cells_checked": 16, "cells_flagged": 1, "flags": [ { "row": 0, "col": 2, "coverage": 0.33, "text": "Post-Developed Discharge (CFS)" } ] } }, "children": [ { "id": "p15.6.1", "order": 19, "type": "table_cell", "bbox": { "l": 158.040001, "t": 283.071761, "r": 187.43214, "b": 256.01289999999995 }, "text": "Storm Event", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "pdf" }, "reading_order": 0 }, { "id": "p15.6.2", "order": 20, "type": "table_cell", "bbox": { "l": 208.679993, "t": 303.71173, "r": 264.681613, "b": 235.25290500000006 }, "text": "Allowable Permissible Peak Discharge (CFS)", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "pdf" }, "reading_order": 1 }, { "id": "p15.6.3", "order": 21, "type": "table_cell", "bbox": { "l": 305.76, "t": 306.24, "r": 384.48, "b": 266.82 }, "text": "Post-Developed Discharge (CFS)", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "column_header": true, "header_source": "pdf" }, "reading_order": 2 }, { "id": "p15.6.4", "order": 22, "type": "table_cell", "bbox": { "l": 398.759995, "t": 303.71173, "r": 428.114097, "b": 290.452887 }, "text": "Status", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "pdf" }, "reading_order": 3 }, { "id": "p15.6.5", "order": 23, "type": "table_cell", "bbox": { "l": 157.919999, "t": 234.231765, "r": 187.512196, "b": 220.97292100000004 }, "text": "2 year", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p15.6.6", "order": 24, "type": "table_cell", "bbox": { "l": 226.198888, "t": 234.231765, "r": 247.159119, "b": 220.97292100000004 }, "text": "0.71", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p15.6.7", "order": 25, "type": "table_cell", "bbox": { "l": 310.159585, "t": 234.231765, "r": 331.119817, "b": 220.97292100000004 }, "text": "0.24", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p15.6.8", "order": 26, "type": "table_cell", "bbox": { "l": 390.167782, "t": 234.231765, "r": 436.236499, "b": 220.97292100000004 }, "text": "Complies", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p15.6.9", "order": 27, "type": "table_cell", "bbox": { "l": 162.359997, "t": 206.15176299999996, "r": 182.969238, "b": 179.09290099999998 }, "text": "10 year", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p15.6.10", "order": 28, "type": "table_cell", "bbox": { "l": 226.200005, "t": 206.15176299999996, "r": 247.160236, "b": 192.89292 }, "text": "1.74", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p15.6.11", "order": 29, "type": "table_cell", "bbox": { "l": 310.160702, "t": 206.15176299999996, "r": 331.120934, "b": 192.89292 }, "text": "0.95", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p15.6.12", "order": 30, "type": "table_cell", "bbox": { "l": 390.288672, "t": 206.15176299999996, "r": 436.321363, "b": 192.89292 }, "text": "Complies", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 }, { "id": "p15.6.13", "order": 31, "type": "table_cell", "bbox": { "l": 162.359997, "t": 178.07176100000004, "r": 182.969238, "b": 151.01289999999995 }, "text": "100 year", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 12 }, { "id": "p15.6.14", "order": 32, "type": "table_cell", "bbox": { "l": 226.200005, "t": 178.07176100000004, "r": 247.160236, "b": 164.81291799999997 }, "text": "4.18", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p15.6.15", "order": 33, "type": "table_cell", "bbox": { "l": 310.160702, "t": 178.07176100000004, "r": 331.120934, "b": 164.81291799999997 }, "text": "3.71", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p15.6.16", "order": 34, "type": "table_cell", "bbox": { "l": 390.288672, "t": 178.07176100000004, "r": 436.321363, "b": 164.81291799999997 }, "text": "Complies", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 } ], "reading_order": 5 } ] }, { "document_id": 11809, "page": 16, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 12, "counts_by_type": { "header": 1, "heading": 1, "table": 1, "table_cell": 6, "text": 3 }, "build_ms": 1, "items": [ { "id": "p16.1", "order": 1, "type": "header", "bbox": { "l": 106.08, "t": 718.56, "r": 299.04, "b": 705.6 }, "text": "Water Quality and Green Infrastructure", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p16.2", "order": 2, "type": "text", "bbox": { "l": 105.12, "t": 691.68, "r": 541.92, "b": 620.64 }, "text": "The project will allow for full infiltration from all run-off resulting from the Water Quality Design Storm. Accordingly, the project satisfies the requirement for water quality. The project complies with the applicable standards.", "reading_order": 1 }, { "id": "p16.3", "order": 3, "type": "text", "bbox": { "l": 104.88, "t": 608.64, "r": 541.68, "b": 538.32 }, "text": "Green Infrastructure is complied with by using small-scale infiltration basins with pre-treatment forebay, and with direct contributory area to any component is limited to 2.5 acres (which is not required to include the component itself), and tabulated as follows:", "reading_order": 2 }, { "id": "p16.4", "order": 4, "type": "table", "bbox": { "l": 140.4, "t": 526.32, "r": 513.12, "b": 456.24 }, "text": "", "attrs": { "block_label": "table", "n_rows": 2, "n_cols": 3, "integrity": { "cells_checked": 6, "cells_flagged": 0 } }, "children": [ { "id": "p16.4.1", "order": 5, "type": "table_cell", "bbox": { "l": 144, "t": 526.311744, "r": 156.636119, "b": 513.0529 }, "text": "ID", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 0 }, { "id": "p16.4.2", "order": 6, "type": "table_cell", "bbox": { "l": 288.002871, "t": 526.311744, "r": 358.128553, "b": 513.0529 }, "text": "Drainage Area", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 1 }, { "id": "p16.4.3", "order": 7, "type": "table_cell", "bbox": { "l": 431.872635, "t": 526.311744, "r": 496.913543, "b": 513.0529 }, "text": "Pre-treatment", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 2 }, { "id": "p16.4.4", "order": 8, "type": "table_cell", "bbox": { "l": 144, "t": 498.711753, "r": 204.562764, "b": 457.852918 }, "text": "SSIB #1\nSSIB #2 UG\nSSIB #3 UG", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p16.4.5", "order": 9, "type": "table_cell", "bbox": { "l": 287.874677, "t": 498.711753, "r": 336.311245, "b": 457.852918 }, "text": "1.29 acres\n0.46 acres\n0.46 acres", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p16.4.6", "order": 10, "type": "table_cell", "bbox": { "l": 431.772045, "t": 498.711753, "r": 511.554966, "b": 457.852918 }, "text": "yes\nyes\nN/A for Rooftop", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 } ], "reading_order": 3 }, { "id": "p16.5", "order": 11, "type": "heading", "bbox": { "l": 105.84, "t": 429.36, "r": 172.08, "b": 415.44 }, "text": "Maintenance", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 4 }, { "id": "p16.6", "order": 12, "type": "text", "bbox": { "l": 104.88, "t": 401.52, "r": 541.92, "b": 332.16 }, "text": "All components of the stormwater management system will be owned and maintained by the land owner. Refer to the Stormwater System Maintenance Plan for additional information.", "reading_order": 5 } ] }, { "document_id": 11809, "page": 17, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 23, "counts_by_type": { "table": 1, "table_cell": 20, "text": 2 }, "build_ms": 1, "items": [ { "id": "p17.1", "order": 1, "type": "text", "bbox": { "l": 105.6, "t": 719.52, "r": 178.08, "b": 705.12 }, "text": "Time to Drain", "reading_order": 0 }, { "id": "p17.2", "order": 2, "type": "text", "bbox": { "l": 105.6, "t": 692.16, "r": 358.56, "b": 677.28 }, "text": "Time to drain for each SSIB is tabulated as follows:", "reading_order": 1 }, { "id": "p17.3", "order": 3, "type": "table", "bbox": { "l": 101.52, "t": 639.12, "r": 546, "b": 495.6 }, "text": "", "attrs": { "block_label": "table", "n_rows": 5, "n_cols": 4, "integrity": { "cells_checked": 16, "cells_flagged": 0 } }, "children": [ { "id": "p17.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 128.040001, "t": 636.231754, "r": 187.527383, "b": 622.97291 }, "text": "Structure ID", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "pdf" }, "reading_order": 0 }, { "id": "p17.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 221.160004, "t": 636.231754, "r": 317.03322, "b": 609.172903 }, "text": "Volume of Storage to First Outlet (CF)", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "pdf" }, "reading_order": 1 }, { "id": "p17.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 342.240005, "t": 636.231754, "r": 421.012718, "b": 609.172903 }, "text": "Outflow (CF/hr) @ 1.0 in/hr", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "pdf" }, "reading_order": 2 }, { "id": "p17.3.4", "order": 7, "type": "table_cell", "bbox": { "l": 444.960022, "t": 636.231754, "r": 538.327465, "b": 622.97291 }, "text": "Time to Drain (hrs)", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "pdf" }, "reading_order": 3 }, { "id": "p17.3.5", "order": 8, "type": "table_cell", "bbox": { "l": 137.640003, "t": 608.151763, "r": 177.911251, "b": 594.89292 }, "text": "SSIB #1", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p17.3.6", "order": 9, "type": "table_cell", "bbox": { "l": 255.643766, "t": 608.151763, "r": 282.592634, "b": 594.89292 }, "text": "3,544", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p17.3.7", "order": 10, "type": "table_cell", "bbox": { "l": 372.54197, "t": 608.151763, "r": 390.627655, "b": 594.89292 }, "text": "170", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p17.3.8", "order": 11, "type": "table_cell", "bbox": { "l": 485.607446, "t": 608.151763, "r": 497.584721, "b": 594.89292 }, "text": "21", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p17.3.9", "order": 12, "type": "table_cell", "bbox": { "l": 127.439999, "t": 580.071761, "r": 188.002762, "b": 566.812918 }, "text": "SSIB #2 UG", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p17.3.10", "order": 13, "type": "table_cell", "bbox": { "l": 255.650411, "t": 580.071761, "r": 282.59928, "b": 566.812918 }, "text": "2,178", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p17.3.11", "order": 14, "type": "table_cell", "bbox": { "l": 372.548615, "t": 580.071761, "r": 390.514528, "b": 566.812918 }, "text": "218", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p17.3.12", "order": 15, "type": "table_cell", "bbox": { "l": 485.614091, "t": 580.071761, "r": 497.591366, "b": 566.812918 }, "text": "10", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 }, { "id": "p17.3.13", "order": 16, "type": "table_cell", "bbox": { "l": 127.560002, "t": 551.871757, "r": 188.122765, "b": 538.6129129999999 }, "text": "SSIB #3 UG", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 12 }, { "id": "p17.3.14", "order": 17, "type": "table_cell", "bbox": { "l": 255.556835, "t": 551.871757, "r": 282.505704, "b": 538.6129129999999 }, "text": "4,791", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p17.3.15", "order": 18, "type": "table_cell", "bbox": { "l": 372.574812, "t": 551.871757, "r": 390.540724, "b": 538.6129129999999 }, "text": "308", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p17.3.16", "order": 19, "type": "table_cell", "bbox": { "l": 480.969151, "t": 551.871757, "r": 501.929382, "b": 538.6129129999999 }, "text": "15.5", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p17.3.17", "order": 20, "type": "table_cell", "bbox": { "l": 101.52, "t": 524.304, "r": 212.64, "b": 495.6 }, "text": "", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 16 }, { "id": "p17.3.18", "order": 21, "type": "table_cell", "bbox": { "l": 212.64, "t": 524.304, "r": 323.76, "b": 495.6 }, "text": "", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1 }, "reading_order": 17 }, { "id": "p17.3.19", "order": 22, "type": "table_cell", "bbox": { "l": 323.76, "t": 524.304, "r": 434.88, "b": 495.6 }, "text": "", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 18 }, { "id": "p17.3.20", "order": 23, "type": "table_cell", "bbox": { "l": 434.88, "t": 524.304, "r": 546, "b": 495.6 }, "text": "", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 19 } ], "reading_order": 2 } ] }, { "document_id": 11809, "page": 18, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 2, "counts_by_type": { "heading": 1, "text": 1 }, "build_ms": 0, "items": [ { "id": "p18.1", "order": 1, "type": "text", "bbox": { "l": 151.68, "t": 688.08, "r": 459.6, "b": 670.758977 }, "text": "APPENDIX A", "reading_order": 0 }, { "id": "p18.2", "order": 2, "type": "heading", "bbox": { "l": 153.600002, "t": 654.859196, "r": 457.962956, "b": 639.478982 }, "text": "PRE-DEVELOPED CONDITION CALCULATIONS", "attrs": { "split_from": "trailing_line" }, "level": 3, "reading_order": 1 } ] }, { "document_id": 11809, "page": 19, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 4, "counts_by_type": { "figure": 1, "footer": 2, "text": 1 }, "build_ms": 0, "items": [ { "id": "p19.1", "order": 1, "type": "figure", "bbox": { "l": 54.48, "t": 732.72, "r": 557.52, "b": 73.92 }, "text": "", "attrs": { "block_label": "image" }, "reading_order": 0 }, { "id": "p19.2", "order": 2, "type": "text", "bbox": { "l": 271.92, "t": 305.52, "r": 397.68, "b": 280.8 }, "text": "COMPOSITE", "reading_order": 1 }, { "id": "p19.3", "order": 3, "type": "footer", "bbox": { "l": 70.8, "t": 101.52, "r": 259.2, "b": 62.64 }, "text": "", "attrs": { "block_label": "footer_image" }, "reading_order": 2 }, { "id": "p19.4", "order": 4, "type": "footer", "bbox": { "l": 287.52, "t": 86.4, "r": 549.6, "b": 56.16 }, "text": "Routing Diagram for PRE DEV\nPrepared by Professional Design Services, Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "footer" }, "reading_order": 3 } ] }, { "document_id": 11809, "page": 20, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 29, "counts_by_type": { "form_field": 2, "table": 2, "table_cell": 25 }, "build_ms": 2, "items": [ { "id": "p20.1", "order": 1, "type": "table", "bbox": { "l": 52.8, "t": 738.48, "r": 571.44, "b": 697.44 }, "text": "", "attrs": { "block_label": "table", "n_rows": 3, "n_cols": 3, "integrity": { "cells_checked": 5, "cells_flagged": 0 } }, "children": [ { "id": "p20.1.1", "order": 2, "type": "table_cell", "bbox": { "l": 54, "t": 737.984717, "r": 108.934265, "b": 724.019651 }, "text": "PRE DEV", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 0 }, { "id": "p20.1.2", "order": 3, "type": "table_cell", "bbox": { "l": 54, "t": 724.06687, "r": 272.267766, "b": 711.061006 }, "text": "Prepared by Professional Design Services", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 1 }, { "id": "p20.1.3", "order": 4, "type": "table_cell", "bbox": { "l": 463.832107, "t": 724.140786, "r": 557.581301, "b": 712.153607 }, "text": "Printed 12/31/2025", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 2 }, { "id": "p20.1.4", "order": 5, "type": "table_cell", "bbox": { "l": 52.8, "t": 711.12, "r": 398.56, "b": 697.44 }, "text": "HydroCAD ○ledR 10.20-6a s/n 02223 ○ledC 2024 HydroCAD Software Solutions LLC", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 2 }, "children": [ { "id": "p20.1.4.1", "order": 6, "type": "form_field", "bbox": { "l": 93.75, "t": 711.12, "r": 105.75, "b": 699.12 }, "text": "", "attrs": { "field_kind": "radio", "label": "ledR 10.20-6a s/n 02223", "source": "glyph_estimate", "bbox_estimated": true, "row": 2, "col": 0, "rowspan": 1, "colspan": 2, "label_source": "parent_text", "label_ref": "p20.1.4", "text_offset": 9, "text_span": 1 }, "reading_order": 0 }, { "id": "p20.1.4.2", "order": 7, "type": "form_field", "bbox": { "l": 207.48, "t": 711.12, "r": 219.48, "b": 699.12 }, "text": "", "attrs": { "field_kind": "radio", "label": "ledC 2024 HydroCAD Software Solutions LLC", "source": "glyph_estimate", "bbox_estimated": true, "row": 2, "col": 0, "rowspan": 1, "colspan": 2, "label_source": "parent_text", "label_ref": "p20.1.4", "text_offset": 34, "text_span": 1 }, "reading_order": 1 } ], "reading_order": 3 }, { "id": "p20.1.5", "order": 8, "type": "table_cell", "bbox": { "l": 523.86, "t": 711.120786, "r": 557.898863, "b": 699.133607 }, "text": "Page 2", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 } ], "reading_order": 0 }, { "id": "p20.2", "order": 9, "type": "table", "bbox": { "l": 52.32, "t": 687.04687, "r": 470.4, "b": 589.2 }, "text": "", "attrs": { "block_label": "table", "n_rows": 3, "n_cols": 10, "integrity": { "cells_checked": 19, "cells_flagged": 0 } }, "children": [ { "id": "p20.2.1", "order": 10, "type": "table_cell", "bbox": { "l": 245.16, "t": 687.04687, "r": 370.14915, "b": 674.041006 }, "text": "Rainfall Events Listing", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 10, "bbox_refit": true }, "reading_order": 0 }, { "id": "p20.2.2", "order": 11, "type": "table_cell", "bbox": { "l": 67.08, "t": 661.21453, "r": 97.674875, "b": 650.246371 }, "text": "Event#", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 1 }, { "id": "p20.2.3", "order": 12, "type": "table_cell", "bbox": { "l": 110.817011, "t": 661.21453, "r": 137.031502, "b": 636.566639 }, "text": "Event Name", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 2 }, { "id": "p20.2.4", "order": 13, "type": "table_cell", "bbox": { "l": 169.740401, "t": 661.21453, "r": 220.532022, "b": 650.246371 }, "text": "Storm Type", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 3 }, { "id": "p20.2.5", "order": 14, "type": "table_cell", "bbox": { "l": 236.401455, "t": 661.21453, "r": 262.612998, "b": 650.246371 }, "text": "Curve", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p20.2.6", "order": 15, "type": "table_cell", "bbox": { "l": 275.757099, "t": 661.21453, "r": 300.337177, "b": 650.246371 }, "text": "Mode", "attrs": { "row": 1, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p20.2.7", "order": 16, "type": "table_cell", "bbox": { "l": 319.972738, "t": 661.21453, "r": 357.113128, "b": 636.566639 }, "text": "Duration (hours)", "attrs": { "row": 1, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p20.2.8", "order": 17, "type": "table_cell", "bbox": { "l": 370.201209, "t": 661.21453, "r": 386.044106, "b": 650.246371 }, "text": "B/B", "attrs": { "row": 1, "col": 6, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p20.2.9", "order": 18, "type": "table_cell", "bbox": { "l": 399.121376, "t": 661.21453, "r": 434.104498, "b": 636.566639 }, "text": "Depth (inches)", "attrs": { "row": 1, "col": 7, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p20.2.10", "order": 19, "type": "table_cell", "bbox": { "l": 447.181767, "t": 661.21453, "r": 469.019806, "b": 650.246371 }, "text": "AMC", "attrs": { "row": 1, "col": 8, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 9 }, { "id": "p20.2.11", "order": 20, "type": "table_cell", "bbox": { "l": 92.28, "t": 630.19443, "r": 97.744424, "b": 591.866806 }, "text": "1\n2\n3", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 10 }, { "id": "p20.2.12", "order": 21, "type": "table_cell", "bbox": { "l": 110.818745, "t": 630.19443, "r": 156.706144, "b": 591.866806 }, "text": "2 YEAR\n10 YEAR\n100 YEAR", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 11 }, { "id": "p20.2.13", "order": 22, "type": "table_cell", "bbox": { "l": 169.734273, "t": 630.19443, "r": 223.261054, "b": 591.866806 }, "text": "NOAA 24-hr\nNOAA 24-hr\nNOAA 24-hr", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 12 }, { "id": "p20.2.14", "order": 23, "type": "table_cell", "bbox": { "l": 236.391396, "t": 630.19443, "r": 243.490233, "b": 591.866806 }, "text": "D\nD\nD", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 13 }, { "id": "p20.2.15", "order": 24, "type": "table_cell", "bbox": { "l": 275.749988, "t": 630.19443, "r": 306.888357, "b": 591.866806 }, "text": "Default\nDefault\nDefault", "attrs": { "row": 2, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 14 }, { "id": "p20.2.16", "order": 25, "type": "table_cell", "bbox": { "l": 332.5053, "t": 630.19443, "r": 357.098154, "b": 591.866806 }, "text": "24.00\n24.00\n24.00", "attrs": { "row": 2, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 15 }, { "id": "p20.2.17", "order": 26, "type": "table_cell", "bbox": { "l": 370.181321, "t": 630.19443, "r": 375.648693, "b": 591.866806 }, "text": "1\n1\n1", "attrs": { "row": 2, "col": 6, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 16 }, { "id": "p20.2.18", "order": 27, "type": "table_cell", "bbox": { "l": 414.940454, "t": 630.19443, "r": 434.068885, "b": 591.866806 }, "text": "3.42\n5.38\n9.48", "attrs": { "row": 2, "col": 7, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 17 }, { "id": "p20.2.19", "order": 28, "type": "table_cell", "bbox": { "l": 447.157949, "t": 630.19443, "r": 452.625321, "b": 591.866806 }, "text": "2\n2\n2", "attrs": { "row": 2, "col": 8, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 18 }, { "id": "p20.2.20", "order": 29, "type": "table_cell", "bbox": { "l": 428.592, "t": 647.232, "r": 470.4, "b": 627.888 }, "text": "", "attrs": { "row": 2, "col": 9, "rowspan": 1, "colspan": 1 }, "reading_order": 19 } ], "reading_order": 1 } ] }, { "document_id": 11809, "page": 21, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 10, "counts_by_type": { "caption": 1, "header": 2, "table": 1, "table_cell": 6 }, "build_ms": 1, "items": [ { "id": "p21.1", "order": 1, "type": "header", "bbox": { "l": 52.08, "t": 737.28, "r": 391.92, "b": 698.64 }, "text": "PRE DEV\nPrepared by Professional Design Services\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p21.2", "order": 2, "type": "header", "bbox": { "l": 461.52, "t": 724.56, "r": 560.16, "b": 698.88 }, "text": "Printed 12/31/2025\nPage 3", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p21.3", "order": 3, "type": "caption", "bbox": { "l": 240.96, "t": 687.36, "r": 373.68, "b": 672.48 }, "text": "Area Listing (all nodes)", "attrs": { "block_label": "figure_title" }, "reading_order": 2 }, { "id": "p21.4", "order": 4, "type": "table", "bbox": { "l": 51.6, "t": 662.88, "r": 358.8, "b": 549.84 }, "text": "", "attrs": { "block_label": "table", "n_rows": 2, "n_cols": 3, "integrity": { "cells_checked": 6, "cells_flagged": 0 } }, "children": [ { "id": "p21.4.1", "order": 5, "type": "table_cell", "bbox": { "l": 97.620155, "t": 661.21453, "r": 128.276947, "b": 636.566639 }, "text": "Area (acres)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 0 }, { "id": "p21.4.2", "order": 6, "type": "table_cell", "bbox": { "l": 150.119899, "t": 661.21453, "r": 164.311676, "b": 650.246371 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 1 }, { "id": "p21.4.3", "order": 7, "type": "table_cell", "bbox": { "l": 183.897114, "t": 661.21453, "r": 293.129565, "b": 636.566639 }, "text": "Description (subcatchment-numbers)", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 2 }, { "id": "p21.4.4", "order": 8, "type": "table_cell", "bbox": { "l": 103.68, "t": 630.19443, "r": 128.870403, "b": 550.767658 }, "text": "0.110\n0.780\n0.150\n0.300\n1.080\n2.420", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p21.4.5", "order": 9, "type": "table_cell", "bbox": { "l": 153.356131, "t": 630.19443, "r": 164.524784, "b": 550.767658 }, "text": "39\n72\n96\n98\n30\n56", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p21.4.6", "order": 10, "type": "table_cell", "bbox": { "l": 183.893021, "t": 630.19443, "r": 354.587462, "b": 550.767658 }, "text": ">75% Grass cover, Good, HSG A (1S)\nDirt roads, HSG A (1S)\nGravel surface, HSG A (2S)\nPaved parking, HSG A (2S)\nWoods, Good, HSG A (1S)\nTOTAL AREA", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 } ], "reading_order": 3 } ] }, { "document_id": 11809, "page": 22, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 10, "counts_by_type": { "header": 2, "heading": 1, "table": 1, "table_cell": 6 }, "build_ms": 1, "items": [ { "id": "p22.1", "order": 1, "type": "header", "bbox": { "l": 51.84, "t": 737.52, "r": 392.16, "b": 698.64 }, "text": "PRE DEV\nPrepared by Professional Design Services\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p22.2", "order": 2, "type": "header", "bbox": { "l": 461.28, "t": 724.8, "r": 560.16, "b": 699.12 }, "text": "Printed 12/31/2025\nPage 4", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p22.3", "order": 3, "type": "heading", "bbox": { "l": 243.12, "t": 687.84, "r": 371.04, "b": 672.24 }, "text": "Soil Listing (all nodes)", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 2 }, { "id": "p22.4", "order": 4, "type": "table", "bbox": { "l": 52.08, "t": 662.88, "r": 264.96, "b": 549.6 }, "text": "", "attrs": { "block_label": "table", "n_rows": 2, "n_cols": 3, "integrity": { "cells_checked": 5, "cells_flagged": 0 } }, "children": [ { "id": "p22.4.1", "order": 5, "type": "table_cell", "bbox": { "l": 97.620155, "t": 661.21453, "r": 128.276947, "b": 564.507341 }, "text": "Area (acres)\n2.420\n0.000\n0.000\n0.000\n0.000", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p22.4.2", "order": 6, "type": "table_cell", "bbox": { "l": 147.895639, "t": 661.21453, "r": 179.021232, "b": 564.507341 }, "text": "Soil Group\nHSG A\nHSG B\nHSG C\nHSG D\nOther", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p22.4.3", "order": 7, "type": "table_cell", "bbox": { "l": 198.657776, "t": 661.21453, "r": 261.482101, "b": 619.226271 }, "text": "Subcatchment Numbers\n1S, 2S", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p22.4.4", "order": 8, "type": "table_cell", "bbox": { "l": 104.280497, "t": 561.735817, "r": 128.870403, "b": 550.767658 }, "text": "2.420", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 3 }, { "id": "p22.4.5", "order": 9, "type": "table_cell", "bbox": { "l": 123.04, "t": 565.7829, "r": 194, "b": 549.6 }, "text": "", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1 }, "reading_order": 4 }, { "id": "p22.4.6", "order": 10, "type": "table_cell", "bbox": { "l": 198.656793, "t": 561.735817, "r": 261.989069, "b": 550.767658 }, "text": "TOTAL AREA", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 } ], "reading_order": 3 } ] }, { "document_id": 11809, "page": 23, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 18, "counts_by_type": { "form_field": 2, "table": 2, "table_cell": 14 }, "build_ms": 2, "items": [ { "id": "p23.1", "order": 1, "type": "table", "bbox": { "l": 51.36, "t": 738.24, "r": 570.48, "b": 697.68 }, "text": "", "attrs": { "block_label": "table", "n_rows": 3, "n_cols": 3, "integrity": { "cells_checked": 5, "cells_flagged": 0 } }, "children": [ { "id": "p23.1.1", "order": 2, "type": "table_cell", "bbox": { "l": 54, "t": 737.984717, "r": 108.934265, "b": 724.019651 }, "text": "PRE DEV", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 0 }, { "id": "p23.1.2", "order": 3, "type": "table_cell", "bbox": { "l": 54, "t": 724.06687, "r": 272.267766, "b": 711.061006 }, "text": "Prepared by Professional Design Services", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 1 }, { "id": "p23.1.3", "order": 4, "type": "table_cell", "bbox": { "l": 463.832107, "t": 724.140786, "r": 557.581301, "b": 712.153607 }, "text": "Printed 12/31/2025", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 2 }, { "id": "p23.1.4", "order": 5, "type": "table_cell", "bbox": { "l": 51.36, "t": 711.2, "r": 397.44, "b": 697.68 }, "text": "HydroCAD ○ledR 10.20-6a s/n 02223 ○ledC 2024 HydroCAD Software Solutions LLC", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 2 }, "children": [ { "id": "p23.1.4.1", "order": 6, "type": "form_field", "bbox": { "l": 92.34, "t": 711.2, "r": 104.34, "b": 699.2 }, "text": "", "attrs": { "field_kind": "radio", "label": "ledR 10.20-6a s/n 02223", "source": "glyph_estimate", "bbox_estimated": true, "row": 2, "col": 0, "rowspan": 1, "colspan": 2, "label_source": "parent_text", "label_ref": "p23.1.4", "text_offset": 9, "text_span": 1 }, "reading_order": 0 }, { "id": "p23.1.4.2", "order": 7, "type": "form_field", "bbox": { "l": 206.19, "t": 711.2, "r": 218.19, "b": 699.2 }, "text": "", "attrs": { "field_kind": "radio", "label": "ledC 2024 HydroCAD Software Solutions LLC", "source": "glyph_estimate", "bbox_estimated": true, "row": 2, "col": 0, "rowspan": 1, "colspan": 2, "label_source": "parent_text", "label_ref": "p23.1.4", "text_offset": 34, "text_span": 1 }, "reading_order": 1 } ], "reading_order": 3 }, { "id": "p23.1.5", "order": 8, "type": "table_cell", "bbox": { "l": 523.86, "t": 711.120786, "r": 557.898863, "b": 699.133607 }, "text": "Page 5", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 } ], "reading_order": 0 }, { "id": "p23.2", "order": 9, "type": "table", "bbox": { "l": 52.32, "t": 687.04687, "r": 576.96, "b": 548.64 }, "text": "", "attrs": { "block_label": "table", "n_rows": 2, "n_cols": 8, "integrity": { "cells_checked": 9, "cells_flagged": 0 } }, "children": [ { "id": "p23.2.1", "order": 10, "type": "table_cell", "bbox": { "l": 234.84, "t": 687.04687, "r": 381.190932, "b": 674.041006 }, "text": "Ground Covers (all nodes)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 8, "bbox_refit": true }, "reading_order": 0 }, { "id": "p23.2.2", "order": 11, "type": "table_cell", "bbox": { "l": 77.52, "t": 661.21453, "r": 109.24942, "b": 550.767658 }, "text": "HSG-A (acres)\n0.110\n0.780\n0.150\n0.300\n1.080\n2.420", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p23.2.3", "order": 12, "type": "table_cell", "bbox": { "l": 132.179961, "t": 661.21453, "r": 163.90545, "b": 550.767658 }, "text": "HSG-B (acres)\n0.000\n0.000\n0.000\n0.000\n0.000\n0.000", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p23.2.4", "order": 13, "type": "table_cell", "bbox": { "l": 186.299376, "t": 661.21453, "r": 218.56148, "b": 550.767658 }, "text": "HSG-C (acres)\n0.000\n0.000\n0.000\n0.000\n0.000\n0.000", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p23.2.5", "order": 14, "type": "table_cell", "bbox": { "l": 240.959337, "t": 661.21453, "r": 273.217509, "b": 550.767658 }, "text": "HSG-D (acres)\n0.000\n0.000\n0.000\n0.000\n0.000\n0.000", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p23.2.6", "order": 15, "type": "table_cell", "bbox": { "l": 296.639455, "t": 661.21453, "r": 327.873539, "b": 550.767658 }, "text": "Other (acres)\n0.000\n0.000\n0.000\n0.000\n0.000\n0.000", "attrs": { "row": 1, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p23.2.7", "order": 16, "type": "table_cell", "bbox": { "l": 351.300399, "t": 661.21453, "r": 382.529569, "b": 550.767658 }, "text": "Total (acres)\n0.110\n0.780\n0.150\n0.300\n1.080\n2.420", "attrs": { "row": 1, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p23.2.8", "order": 17, "type": "table_cell", "bbox": { "l": 395.015187, "t": 661.21453, "r": 505.631435, "b": 550.767658 }, "text": "Ground Cover\n>75% Grass cover, Good\nDirt roads\nGravel surface\nPaved parking\nWoods, Good\nTOTAL AREA", "attrs": { "row": 1, "col": 6, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 7 }, { "id": "p23.2.9", "order": 18, "type": "table_cell", "bbox": { "l": 512.486535, "t": 661.21453, "r": 575.341766, "b": 564.507341 }, "text": "Subcatchment Numbers\n1S\n1S\n2S\n2S\n1S", "attrs": { "row": 1, "col": 7, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 8 } ], "reading_order": 1 } ] }, { "document_id": 11809, "page": 24, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 3, "counts_by_type": { "footer": 1, "text": 2 }, "build_ms": 0, "items": [ { "id": "p24.1", "order": 1, "type": "text", "bbox": { "l": 120.72, "t": 688.08, "r": 490.08, "b": 650.64 }, "text": "Time span=5.00-20.00 hrs, dt=0.05 hrs, 301 points\nRunoff by SCS TR-20 method, UH=Delmarva, Weighted-CN\nReach routing by Stor-Ind+Trans method - Pond routing by Stor-Ind method", "reading_order": 0 }, { "id": "p24.2", "order": 2, "type": "text", "bbox": { "l": 49.44, "t": 643.92, "r": 566.64, "b": 508.32 }, "text": "Subcatchment1S: POROUS\nRunoff Area=1.970 ac 0.00% Impervious Runoff Depth>0.08\"\nFlow Length=430' Tc=19.1 min CN=47 Runoff=0.03 cfs 0.012 af\nSubcatchment2S: IMPERVIOUS\nRunoff Area=0.450 ac 66.67% Impervious Runoff Depth>2.84\"\nFlow Length=280' Tc=2.6 min CN=97 Runoff=1.43 cfs 0.106 af\nReach 3R: COMPOSITE\nInflow=1.43 cfs 0.119 af\nOutflow=1.43 cfs 0.119 af\nTotal Runoff Area = 2.420 ac Runoff Volume = 0.119 af Average Runoff Depth = 0.59\"\n87.60% Pervious = 2.120 ac 12.40% Impervious = 0.300 ac", "attrs": { "block_label": "algorithm" }, "reading_order": 1 }, { "id": "p24.3", "order": 3, "type": "footer", "bbox": { "l": 49.44, "t": 739.92, "r": 558, "b": 700.32 }, "text": "PRE DEV NOAA 24-hr D 2 YEAR Rainfall=3.42\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 6", "attrs": { "block_label": "footer" }, "reading_order": 2 } ] }, { "document_id": 11809, "page": 25, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 53, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "table": 1, "table_cell": 46, "text": 2, "title": 1 }, "build_ms": 5, "items": [ { "id": "p25.1", "order": 1, "type": "header", "bbox": { "l": 52.32, "t": 738.72, "r": 561.36, "b": 698.64 }, "text": "PRE DEV NOAA 24-hr D 2 YEAR Rainfall=3.42\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 7", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p25.2", "order": 2, "type": "title", "bbox": { "l": 183.6, "t": 687.6, "r": 434.64, "b": 672.72 }, "text": "Summary for Subcatchment 1S: POROUS", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p25.3", "order": 3, "type": "text", "bbox": { "l": 53.04, "t": 660, "r": 463.68, "b": 634.32 }, "text": "Runoff = 0.03 cfs @ 14.19 hrs, Volume= 0.012 af, Depth> 0.08\"\nRouted to Reach 3R : COMPOSITE", "reading_order": 2 }, { "id": "p25.4", "order": 4, "type": "text", "bbox": { "l": 52.08, "t": 624.24, "r": 541.44, "b": 598.8 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Weighted-CN, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs NOAA 24-hr D 2 YEAR Rainfall=3.42\"", "reading_order": 3 }, { "id": "p25.5", "order": 5, "type": "table", "bbox": { "l": 52.8, "t": 589.44, "r": 559.2, "b": 390.133607 }, "text": "", "attrs": { "block_label": "table", "n_rows": 9, "n_cols": 7, "integrity": { "cells_checked": 35, "cells_flagged": 0 } }, "children": [ { "id": "p25.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 69.659595, "t": 588.002283, "r": 113.82741, "b": 576.0151040000001 }, "text": "Area (ac)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p25.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 130.796358, "t": 588.002283, "r": 146.30665, "b": 576.0151040000001 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p25.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 289.05701, "t": 501.001484, "r": 342.773751, "b": 489.014305 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p25.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 52.8, "t": 571.5055, "r": 125.1429, "b": 553.5709 }, "text": "", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 3 }, { "id": "p25.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 87, "t": 574.200786, "r": 113.874482, "b": 538.454072 }, "text": "1.080\n0.110\n0.780", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p25.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 134.275244, "t": 574.200786, "r": 146.219458, "b": 538.454072 }, "text": "30\n39\n72", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p25.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 160.552515, "t": 574.200786, "r": 320.843443, "b": 538.454072 }, "text": "Woods, Good, HSG A\n>75% Grass cover, Good, HSG A\nDirt roads, HSG A", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 4, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p25.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 52.8, "t": 517.7018, "r": 125.1429, "b": 499.7673 }, "text": "", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 7 }, { "id": "p25.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 87, "t": 524.761019, "r": 113.874482, "b": 512.7738400000001 }, "text": "1.970", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p25.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 134.275244, "t": 536.6407859999999, "r": 146.219458, "b": 524.653607 }, "text": "47", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p25.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 160.552515, "t": 536.6407859999999, "r": 248.909626, "b": 524.653607 }, "text": "Weighted Average", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 4, "bbox_refit": true }, "reading_order": 10 }, { "id": "p25.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 52.8, "t": 499.7673, "r": 125.1429, "b": 481.8327 }, "text": "", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 11 }, { "id": "p25.5.13", "order": 18, "type": "table_cell", "bbox": { "l": 87, "t": 536.6407859999999, "r": 113.874482, "b": 524.653607 }, "text": "1.970", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 12 }, { "id": "p25.5.14", "order": 19, "type": "table_cell", "bbox": { "l": 197.4857, "t": 499.7673, "r": 269.8286, "b": 481.8327 }, "text": "", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 13 }, { "id": "p25.5.15", "order": 20, "type": "table_cell", "bbox": { "l": 160.555738, "t": 524.761019, "r": 273.392044, "b": 512.7738400000001 }, "text": "100.00% Pervious Area", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 4, "bbox_refit": true }, "reading_order": 14 }, { "id": "p25.5.16", "order": 21, "type": "table_cell", "bbox": { "l": 65.459598, "t": 501.001484, "r": 89.993572, "b": 477.134538 }, "text": "Tc (min)", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p25.5.17", "order": 22, "type": "table_cell", "bbox": { "l": 100.682141, "t": 501.001484, "r": 133.545916, "b": 477.134538 }, "text": "Length (feet)", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p25.5.18", "order": 23, "type": "table_cell", "bbox": { "l": 149.815612, "t": 501.001484, "r": 177.28086, "b": 477.134538 }, "text": "Slope (ft/ft)", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p25.5.19", "order": 24, "type": "table_cell", "bbox": { "l": 188.028505, "t": 501.001484, "r": 225.633446, "b": 477.134538 }, "text": "Velocity (ft/sec)", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p25.5.20", "order": 25, "type": "table_cell", "bbox": { "l": 236.50354, "t": 501.001484, "r": 278.288957, "b": 477.134538 }, "text": "Capacity (cfs)", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p25.5.21", "order": 26, "type": "table_cell", "bbox": { "l": 160.552704, "t": 588.002283, "r": 214.269445, "b": 576.0151040000001 }, "text": "Description", "attrs": { "row": 4, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 20 }, { "id": "p25.5.22", "order": 27, "type": "table_cell", "bbox": { "l": 69, "t": 475.320786, "r": 89.902375, "b": 463.333607 }, "text": "15.0", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p25.5.23", "order": 28, "type": "table_cell", "bbox": { "l": 115.676959, "t": 475.320786, "r": 133.59328, "b": 463.333607 }, "text": "100", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 22 }, { "id": "p25.5.24", "order": 29, "type": "table_cell", "bbox": { "l": 144.351666, "t": 475.320786, "r": 177.198256, "b": 463.333607 }, "text": "0.0450", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 23 }, { "id": "p25.5.25", "order": 30, "type": "table_cell", "bbox": { "l": 204.705395, "t": 475.320786, "r": 225.60777, "b": 463.333607 }, "text": "0.11", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 24 }, { "id": "p25.5.26", "order": 31, "type": "table_cell", "bbox": { "l": 342.1714, "t": 463.8982, "r": 414.5143, "b": 445.9636 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 25 }, { "id": "p25.5.27", "order": 32, "type": "table_cell", "bbox": { "l": 289.079669, "t": 475.140334, "r": 516.213084, "b": 451.452765 }, "text": "Sheet Flow, Woods: Light underbrush n= 0.400 P2= 3.42\"", "attrs": { "row": 5, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 26 }, { "id": "p25.5.28", "order": 33, "type": "table_cell", "bbox": { "l": 75.000034, "t": 451.560177, "r": 89.930302, "b": 439.572998 }, "text": "2.5", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 27 }, { "id": "p25.5.29", "order": 34, "type": "table_cell", "bbox": { "l": 115.679107, "t": 451.560177, "r": 133.595429, "b": 439.572998 }, "text": "140", "attrs": { "row": 6, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 28 }, { "id": "p25.5.30", "order": 35, "type": "table_cell", "bbox": { "l": 144.353814, "t": 451.560177, "r": 177.200404, "b": 439.572998 }, "text": "0.0350", "attrs": { "row": 6, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 29 }, { "id": "p25.5.31", "order": 36, "type": "table_cell", "bbox": { "l": 204.707543, "t": 451.560177, "r": 225.609918, "b": 439.572998 }, "text": "0.94", "attrs": { "row": 6, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 30 }, { "id": "p25.5.32", "order": 37, "type": "table_cell", "bbox": { "l": 342.1714, "t": 445.9636, "r": 414.5143, "b": 428.0291 }, "text": "", "attrs": { "row": 6, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 31 }, { "id": "p25.5.33", "order": 38, "type": "table_cell", "bbox": { "l": 289.079669, "t": 451.379725, "r": 432.324312, "b": 427.692157 }, "text": "Shallow Concentrated Flow, Woodland Kv= 5.0 fps", "attrs": { "row": 6, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 32 }, { "id": "p25.5.34", "order": 39, "type": "table_cell", "bbox": { "l": 75.000034, "t": 427.799569, "r": 89.930302, "b": 415.81239 }, "text": "1.6", "attrs": { "row": 7, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 33 }, { "id": "p25.5.35", "order": 40, "type": "table_cell", "bbox": { "l": 115.679107, "t": 427.799569, "r": 133.595429, "b": 415.81239 }, "text": "190", "attrs": { "row": 7, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 34 }, { "id": "p25.5.36", "order": 41, "type": "table_cell", "bbox": { "l": 144.353814, "t": 427.799569, "r": 177.200404, "b": 415.81239 }, "text": "0.0150", "attrs": { "row": 7, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 35 }, { "id": "p25.5.37", "order": 42, "type": "table_cell", "bbox": { "l": 204.707543, "t": 427.799569, "r": 225.609918, "b": 415.81239 }, "text": "1.97", "attrs": { "row": 7, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 36 }, { "id": "p25.5.38", "order": 43, "type": "table_cell", "bbox": { "l": 342.1714, "t": 428.0291, "r": 414.5143, "b": 410.0945 }, "text": "", "attrs": { "row": 7, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 37 }, { "id": "p25.5.39", "order": 44, "type": "table_cell", "bbox": { "l": 289.079669, "t": 427.619117, "r": 432.324312, "b": 403.931548 }, "text": "Shallow Concentrated Flow, Unpaved Kv= 16.1 fps", "attrs": { "row": 7, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 38 }, { "id": "p25.5.40", "order": 45, "type": "table_cell", "bbox": { "l": 69, "t": 402.120786, "r": 89.902375, "b": 390.133607 }, "text": "19.1", "attrs": { "row": 8, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 39 }, { "id": "p25.5.41", "order": 46, "type": "table_cell", "bbox": { "l": 115.676959, "t": 402.120786, "r": 133.59328, "b": 390.133607 }, "text": "430", "attrs": { "row": 8, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 40 }, { "id": "p25.5.42", "order": 47, "type": "table_cell", "bbox": { "l": 144.351666, "t": 402.120786, "r": 168.229354, "b": 390.133607 }, "text": "Total", "attrs": { "row": 8, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 41 }, { "id": "p25.5.43", "order": 48, "type": "table_cell", "bbox": { "l": 269.8286, "t": 410.0945, "r": 342.1714, "b": 392.16 }, "text": "", "attrs": { "row": 8, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 42 }, { "id": "p25.5.44", "order": 49, "type": "table_cell", "bbox": { "l": 342.1714, "t": 410.0945, "r": 414.5143, "b": 392.16 }, "text": "", "attrs": { "row": 8, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 43 }, { "id": "p25.5.45", "order": 50, "type": "table_cell", "bbox": { "l": 414.5143, "t": 410.0945, "r": 486.8571, "b": 392.16 }, "text": "", "attrs": { "row": 8, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 44 }, { "id": "p25.5.46", "order": 51, "type": "table_cell", "bbox": { "l": 486.8571, "t": 410.0945, "r": 559.2, "b": 392.16 }, "text": "", "attrs": { "row": 8, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 45 } ], "reading_order": 4 }, { "id": "p25.6", "order": 52, "type": "caption", "bbox": { "l": 222.24, "t": 378, "r": 393.36, "b": 363.12 }, "text": "Subcatchment 1S: POROUS", "attrs": { "block_label": "figure_title" }, "reading_order": 5 }, { "id": "p25.7", "order": 53, "type": "figure", "bbox": { "l": 62.64, "t": 358.56, "r": 551.28, "b": 91.68 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nRunoff\n0.028\n0.03 cfs\nNOAA 24-hr D\n0.026\n0.024\n2 YEAR Rainfall=3.42\"\n0.022\n0.02 Runoff Area=1.970 ac\n0.018 Runoff Volume=0.012 af\n(cfs) Runoff Depth>0.08\"\n0.016\n0.014\nFlow Flow Length=430'\n0.012\n0.01 Tc=19.1 min\n0.008 CN=47\n0.006\n0.004\n0.002\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 6 } ] }, { "document_id": 11809, "page": 26, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 40, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "table": 1, "table_cell": 32, "text": 3, "title": 1 }, "build_ms": 4, "items": [ { "id": "p26.1", "order": 1, "type": "header", "bbox": { "l": 52.8, "t": 738.48, "r": 561.12, "b": 698.64 }, "text": "PRE DEV NOAA 24-hr D 2 YEAR Rainfall=3.42\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 8", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p26.2", "order": 2, "type": "title", "bbox": { "l": 171.6, "t": 687.36, "r": 446.88, "b": 672.48 }, "text": "Summary for Subcatchment 2S: IMPERVIOUS", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p26.3", "order": 3, "type": "text", "bbox": { "l": 52.08, "t": 659.52, "r": 245.04, "b": 646.32 }, "text": "[49] Hint: Tc<2dt may require smaller dt", "reading_order": 2 }, { "id": "p26.4", "order": 4, "type": "text", "bbox": { "l": 52.08, "t": 636.48, "r": 462.48, "b": 610.32 }, "text": "Runoff = 1.43 cfs @ 12.10 hrs, Volume= 0.106 af, Depth> 2.84\"\nRouted to Reach 3R : COMPOSITE", "reading_order": 3 }, { "id": "p26.5", "order": 5, "type": "text", "bbox": { "l": 52.08, "t": 600.72, "r": 541.68, "b": 574.56 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Weighted-CN, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs NOAA 24-hr D 2 YEAR Rainfall=3.42\"", "reading_order": 4 }, { "id": "p26.6", "order": 6, "type": "table", "bbox": { "l": 52.8, "t": 565.2, "r": 559.2, "b": 390.133607 }, "text": "", "attrs": { "block_label": "table", "n_rows": 6, "n_cols": 7, "integrity": { "cells_checked": 25, "cells_flagged": 0 } }, "children": [ { "id": "p26.6.1", "order": 7, "type": "table_cell", "bbox": { "l": 69.659595, "t": 564.242748, "r": 113.82741, "b": 552.255569 }, "text": "Area (ac)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p26.6.2", "order": 8, "type": "table_cell", "bbox": { "l": 130.796358, "t": 564.242748, "r": 146.30665, "b": 552.255569 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p26.6.3", "order": 9, "type": "table_cell", "bbox": { "l": 289.05701, "t": 477.241717, "r": 342.773751, "b": 465.254538 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p26.6.4", "order": 10, "type": "table_cell", "bbox": { "l": 52.8, "t": 547.872, "r": 125.1429, "b": 530.544 }, "text": "", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 3 }, { "id": "p26.6.5", "order": 11, "type": "table_cell", "bbox": { "l": 87, "t": 550.440786, "r": 113.874482, "b": 489.014072 }, "text": "0.150\n0.300\n0.450\n0.150\n0.300", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p26.6.6", "order": 12, "type": "table_cell", "bbox": { "l": 134.275244, "t": 550.440786, "r": 146.219458, "b": 512.7736070000001 }, "text": "96\n98\n97", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p26.6.7", "order": 13, "type": "table_cell", "bbox": { "l": 160.552515, "t": 550.440786, "r": 278.161136, "b": 489.014072 }, "text": "Gravel surface, HSG A\nPaved parking, HSG A\nWeighted Average\n33.33% Pervious Area\n66.67% Impervious Area", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 4, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p26.6.8", "order": 14, "type": "table_cell", "bbox": { "l": 65.459598, "t": 477.241717, "r": 89.993572, "b": 453.374771 }, "text": "Tc (min)", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p26.6.9", "order": 15, "type": "table_cell", "bbox": { "l": 100.682141, "t": 477.241717, "r": 133.545916, "b": 453.374771 }, "text": "Length (feet)", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p26.6.10", "order": 16, "type": "table_cell", "bbox": { "l": 149.815612, "t": 477.241717, "r": 177.28086, "b": 453.374771 }, "text": "Slope (ft/ft)", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p26.6.11", "order": 17, "type": "table_cell", "bbox": { "l": 188.028505, "t": 477.241717, "r": 225.633446, "b": 453.374771 }, "text": "Velocity (ft/sec)", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p26.6.12", "order": 18, "type": "table_cell", "bbox": { "l": 236.50354, "t": 477.241717, "r": 278.288957, "b": 453.374771 }, "text": "Capacity (cfs)", "attrs": { "row": 2, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 }, { "id": "p26.6.13", "order": 19, "type": "table_cell", "bbox": { "l": 160.552704, "t": 564.242748, "r": 214.269445, "b": 552.255569 }, "text": "Description", "attrs": { "row": 2, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 12 }, { "id": "p26.6.14", "order": 20, "type": "table_cell", "bbox": { "l": 75, "t": 451.560786, "r": 89.930268, "b": 439.573607 }, "text": "1.2", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p26.6.15", "order": 21, "type": "table_cell", "bbox": { "l": 115.679073, "t": 451.560786, "r": 133.595394, "b": 439.573607 }, "text": "100", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p26.6.16", "order": 22, "type": "table_cell", "bbox": { "l": 144.35378, "t": 451.560786, "r": 177.20037, "b": 439.573607 }, "text": "0.0200", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p26.6.17", "order": 23, "type": "table_cell", "bbox": { "l": 204.707509, "t": 451.560786, "r": 225.609884, "b": 439.573607 }, "text": "1.42", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p26.6.18", "order": 24, "type": "table_cell", "bbox": { "l": 342.1714, "t": 443.904, "r": 414.5143, "b": 426.576 }, "text": "", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 17 }, { "id": "p26.6.19", "order": 25, "type": "table_cell", "bbox": { "l": 289.079635, "t": 451.380334, "r": 476.803587, "b": 427.692765 }, "text": "Sheet Flow,\\nSmooth surfaces n= 0.011 P2= 3.42\"", "attrs": { "row": 3, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 18 }, { "id": "p26.6.20", "order": 26, "type": "table_cell", "bbox": { "l": 75, "t": 427.800177, "r": 89.930268, "b": 415.812998 }, "text": "1.4", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p26.6.21", "order": 27, "type": "table_cell", "bbox": { "l": 115.679073, "t": 427.800177, "r": 133.595394, "b": 415.812998 }, "text": "180", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p26.6.22", "order": 28, "type": "table_cell", "bbox": { "l": 144.35378, "t": 427.800177, "r": 177.20037, "b": 415.812998 }, "text": "0.0110", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p26.6.23", "order": 29, "type": "table_cell", "bbox": { "l": 204.707509, "t": 427.800177, "r": 225.609884, "b": 415.812998 }, "text": "2.13", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 22 }, { "id": "p26.6.24", "order": 30, "type": "table_cell", "bbox": { "l": 342.1714, "t": 426.576, "r": 414.5143, "b": 409.248 }, "text": "", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 23 }, { "id": "p26.6.25", "order": 31, "type": "table_cell", "bbox": { "l": 289.079635, "t": 427.619725, "r": 432.324278, "b": 403.932157 }, "text": "Shallow Concentrated Flow,\\nPaved Kv= 20.3 fps", "attrs": { "row": 4, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 24 }, { "id": "p26.6.26", "order": 32, "type": "table_cell", "bbox": { "l": 75, "t": 402.120786, "r": 89.930268, "b": 390.133607 }, "text": "2.6", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 25 }, { "id": "p26.6.27", "order": 33, "type": "table_cell", "bbox": { "l": 115.679073, "t": 402.120786, "r": 133.595394, "b": 390.133607 }, "text": "280", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 26 }, { "id": "p26.6.28", "order": 34, "type": "table_cell", "bbox": { "l": 144.35378, "t": 402.120786, "r": 168.231468, "b": 390.133607 }, "text": "Total", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 27 }, { "id": "p26.6.29", "order": 35, "type": "table_cell", "bbox": { "l": 269.8286, "t": 409.248, "r": 342.1714, "b": 391.92 }, "text": "", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 28 }, { "id": "p26.6.30", "order": 36, "type": "table_cell", "bbox": { "l": 342.1714, "t": 409.248, "r": 414.5143, "b": 391.92 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 29 }, { "id": "p26.6.31", "order": 37, "type": "table_cell", "bbox": { "l": 414.5143, "t": 409.248, "r": 486.8571, "b": 391.92 }, "text": "", "attrs": { "row": 5, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 30 }, { "id": "p26.6.32", "order": 38, "type": "table_cell", "bbox": { "l": 486.8571, "t": 409.248, "r": 559.2, "b": 391.92 }, "text": "", "attrs": { "row": 5, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 31 } ], "reading_order": 5 }, { "id": "p26.7", "order": 39, "type": "caption", "bbox": { "l": 210.48, "t": 378, "r": 405.6, "b": 363.12 }, "text": "Subcatchment 2S: IMPERVIOUS", "attrs": { "block_label": "figure_title" }, "reading_order": 6 }, { "id": "p26.8", "order": 40, "type": "figure", "bbox": { "l": 60.72, "t": 366.96, "r": 552.24, "b": 89.76 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nRunoff\n1.43 cfs\nNOAA 24-hr D\n2 YEAR Rainfall=3.42\"\nRunoff Area=0.450 ac\nRunoff Volume=0.106 af\n1\n(cfs) Runoff Depth>2.84\"\nFlow Flow Length=280'\nTc=2.6 min\nCN=97\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 7 } ] }, { "document_id": 11809, "page": 27, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 7, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "heading": 1, "text": 3 }, "build_ms": 0, "items": [ { "id": "p27.1", "order": 1, "type": "header", "bbox": { "l": 52.8, "t": 738.48, "r": 561.6, "b": 698.88 }, "text": "PRE DEV NOAA 24-hr D 2 YEAR Rainfall=3.42\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 9", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p27.2", "order": 2, "type": "heading", "bbox": { "l": 196.8, "t": 687.6, "r": 420.96, "b": 672.48 }, "text": "Summary for Reach 3R: COMPOSITE", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p27.3", "order": 3, "type": "text", "bbox": { "l": 52.08, "t": 659.52, "r": 250.8, "b": 646.08 }, "text": "[40] Hint: Not Described (Outflow=Inflow)", "reading_order": 2 }, { "id": "p27.4", "order": 4, "type": "text", "bbox": { "l": 52.56, "t": 636.48, "r": 517.92, "b": 598.08 }, "text": "Inflow Area = 2.420 ac, 12.40% Impervious, Inflow Depth > 0.59\" for 2 YEAR event\nInflow = 1.43 cfs @ 12.10 hrs, Volume= 0.119 af\nOutflow = 1.43 cfs @ 12.10 hrs, Volume= 0.119 af, Atten=0%, Lag=0.0 min", "reading_order": 3 }, { "id": "p27.5", "order": 5, "type": "text", "bbox": { "l": 51.84, "t": 588.48, "r": 420.96, "b": 574.8 }, "text": "Routing by Stor-Ind+Trans method, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs", "reading_order": 4 }, { "id": "p27.6", "order": 6, "type": "caption", "bbox": { "l": 235.68, "t": 563.76, "r": 379.68, "b": 548.64 }, "text": "Reach 3R: COMPOSITE", "attrs": { "block_label": "figure_title" }, "reading_order": 5 }, { "id": "p27.7", "order": 7, "type": "figure", "bbox": { "l": 60.24, "t": 549.6, "r": 553.44, "b": 274.08 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nInflow\n1.43 cfs Outflow\n1.43 cfs\nInflow Area=2.420 ac\n1\n(cfs)\nFlow\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 6 } ] }, { "document_id": 11809, "page": 28, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 2, "counts_by_type": { "footer": 1, "text": 1 }, "build_ms": 0, "items": [ { "id": "p28.1", "order": 1, "type": "text", "bbox": { "l": 49.2, "t": 722.4, "r": 564.72, "b": 508.32 }, "text": "Prepared by Professional Design Services\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC\nPrinted 12/31/2025\nPage 10\nTime span=5.00-20.00 hrs, dt=0.05 hrs, 301 points\nRunoff by SCS TR-20 method, UH=Delmarva, Weighted-CN\nReach routing by Stor-Ind+Trans method - Pond routing by Stor-Ind method\nSubcatchment1S: POROUS\nFlow Length=430' Tc=19.1 min CN=47 Runoff=0.40 cfs 0.092 af\nSubcatchment2S: IMPERVIOUS\nFlow Length=280' Tc=2.6 min CN=97 Runoff=2.28 cfs 0.172 af\nReach 3R: COMPOSITE\nTotal Runoff Area = 2.420 ac Runoff Volume = 0.264 af Average Runoff Depth = 1.31'\n87.60% Pervious = 2.120 ac 12.40% Impervious = 0.300 ac", "attrs": { "block_label": "algorithm" }, "reading_order": 0 }, { "id": "p28.2", "order": 2, "type": "footer", "bbox": { "l": 49.44, "t": 739.68, "r": 558.48, "b": 699.84 }, "text": "PRE DEV\nNOAA 24-hr D 10 YEAR Rainfall=5.38\"\nPrepared by Professional Design Services\nPrinted 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC\nPage 10", "attrs": { "block_label": "footer" }, "reading_order": 1 } ] }, { "document_id": 11809, "page": 29, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 53, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "table": 1, "table_cell": 46, "text": 2, "title": 1 }, "build_ms": 5, "items": [ { "id": "p29.1", "order": 1, "type": "header", "bbox": { "l": 52.56, "t": 738.72, "r": 561.12, "b": 698.64 }, "text": "PRE DEV NOAA 24-hr D 10 YEAR Rainfall=5.38\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 11", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p29.2", "order": 2, "type": "title", "bbox": { "l": 183.6, "t": 687.6, "r": 434.64, "b": 672.72 }, "text": "Summary for Subcatchment 1S: POROUS", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p29.3", "order": 3, "type": "text", "bbox": { "l": 52.8, "t": 660, "r": 463.44, "b": 634.32 }, "text": "Runoff = 0.40 cfs @ 12.53 hrs, Volume= 0.092 af, Depth> 0.56\"\nRouted to Reach 3R : COMPOSITE", "reading_order": 2 }, { "id": "p29.4", "order": 4, "type": "text", "bbox": { "l": 52.08, "t": 624.24, "r": 541.44, "b": 598.56 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Weighted-CN, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs NOAA 24-hr D 10 YEAR Rainfall=5.38\"", "reading_order": 3 }, { "id": "p29.5", "order": 5, "type": "table", "bbox": { "l": 52.8, "t": 589.2, "r": 559.2, "b": 390.133607 }, "text": "", "attrs": { "block_label": "table", "n_rows": 9, "n_cols": 7, "integrity": { "cells_checked": 35, "cells_flagged": 0 } }, "children": [ { "id": "p29.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 69.659595, "t": 588.002283, "r": 113.82741, "b": 576.0151040000001 }, "text": "Area (ac)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p29.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 130.796358, "t": 588.002283, "r": 146.30665, "b": 576.0151040000001 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p29.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 289.05701, "t": 501.001484, "r": 342.773751, "b": 489.014305 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p29.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 52.8, "t": 571.3091, "r": 125.1429, "b": 553.4182 }, "text": "", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 3 }, { "id": "p29.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 87, "t": 574.200786, "r": 113.874482, "b": 538.454072 }, "text": "1.080\n0.110\n0.780", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p29.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 134.275244, "t": 574.200786, "r": 146.219458, "b": 538.454072 }, "text": "30\n39\n72", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p29.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 160.552515, "t": 574.200786, "r": 320.843443, "b": 538.454072 }, "text": "Woods, Good, HSG A\n>75% Grass cover, Good, HSG A\nDirt roads, HSG A", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 4, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p29.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 52.8, "t": 517.6364, "r": 125.1429, "b": 499.7455 }, "text": "", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 7 }, { "id": "p29.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 87, "t": 524.761019, "r": 113.874482, "b": 512.7738400000001 }, "text": "1.970", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p29.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 134.275244, "t": 536.6407859999999, "r": 146.219458, "b": 524.653607 }, "text": "47", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p29.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 160.552515, "t": 536.6407859999999, "r": 248.909626, "b": 524.653607 }, "text": "Weighted Average", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 4, "bbox_refit": true }, "reading_order": 10 }, { "id": "p29.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 52.8, "t": 499.7455, "r": 125.1429, "b": 481.8545 }, "text": "", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 11 }, { "id": "p29.5.13", "order": 18, "type": "table_cell", "bbox": { "l": 87, "t": 536.6407859999999, "r": 113.874482, "b": 524.653607 }, "text": "1.970", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 12 }, { "id": "p29.5.14", "order": 19, "type": "table_cell", "bbox": { "l": 197.4857, "t": 499.7455, "r": 269.8286, "b": 481.8545 }, "text": "", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 13 }, { "id": "p29.5.15", "order": 20, "type": "table_cell", "bbox": { "l": 160.555738, "t": 524.761019, "r": 273.392044, "b": 512.7738400000001 }, "text": "100.00% Pervious Area", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 4, "bbox_refit": true }, "reading_order": 14 }, { "id": "p29.5.16", "order": 21, "type": "table_cell", "bbox": { "l": 65.459598, "t": 501.001484, "r": 89.993572, "b": 477.134538 }, "text": "Tc (min)", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p29.5.17", "order": 22, "type": "table_cell", "bbox": { "l": 100.682141, "t": 501.001484, "r": 133.545916, "b": 477.134538 }, "text": "Length (feet)", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p29.5.18", "order": 23, "type": "table_cell", "bbox": { "l": 149.815612, "t": 501.001484, "r": 177.28086, "b": 477.134538 }, "text": "Slope (ft/ft)", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p29.5.19", "order": 24, "type": "table_cell", "bbox": { "l": 188.028505, "t": 501.001484, "r": 225.633446, "b": 477.134538 }, "text": "Velocity (ft/sec)", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p29.5.20", "order": 25, "type": "table_cell", "bbox": { "l": 236.50354, "t": 501.001484, "r": 278.288957, "b": 477.134538 }, "text": "Capacity (cfs)", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p29.5.21", "order": 26, "type": "table_cell", "bbox": { "l": 160.552704, "t": 588.002283, "r": 214.269445, "b": 576.0151040000001 }, "text": "Description", "attrs": { "row": 4, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 20 }, { "id": "p29.5.22", "order": 27, "type": "table_cell", "bbox": { "l": 69, "t": 475.320786, "r": 89.902375, "b": 463.333607 }, "text": "15.0", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p29.5.23", "order": 28, "type": "table_cell", "bbox": { "l": 115.676959, "t": 475.320786, "r": 133.59328, "b": 463.333607 }, "text": "100", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 22 }, { "id": "p29.5.24", "order": 29, "type": "table_cell", "bbox": { "l": 144.351666, "t": 475.320786, "r": 177.198256, "b": 463.333607 }, "text": "0.0450", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 23 }, { "id": "p29.5.25", "order": 30, "type": "table_cell", "bbox": { "l": 204.705395, "t": 475.320786, "r": 225.60777, "b": 463.333607 }, "text": "0.11", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 24 }, { "id": "p29.5.26", "order": 31, "type": "table_cell", "bbox": { "l": 342.1714, "t": 463.9636, "r": 414.5143, "b": 446.0727 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 25 }, { "id": "p29.5.27", "order": 32, "type": "table_cell", "bbox": { "l": 289.079669, "t": 475.140334, "r": 516.213084, "b": 451.452765 }, "text": "Sheet Flow, Woods: Light underbrush n= 0.400 P2= 3.42\"", "attrs": { "row": 5, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 26 }, { "id": "p29.5.28", "order": 33, "type": "table_cell", "bbox": { "l": 75.000034, "t": 451.560177, "r": 89.930302, "b": 439.572998 }, "text": "2.5", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 27 }, { "id": "p29.5.29", "order": 34, "type": "table_cell", "bbox": { "l": 115.679107, "t": 451.560177, "r": 133.595429, "b": 439.572998 }, "text": "140", "attrs": { "row": 6, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 28 }, { "id": "p29.5.30", "order": 35, "type": "table_cell", "bbox": { "l": 144.353814, "t": 451.560177, "r": 177.200404, "b": 439.572998 }, "text": "0.0350", "attrs": { "row": 6, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 29 }, { "id": "p29.5.31", "order": 36, "type": "table_cell", "bbox": { "l": 204.707543, "t": 451.560177, "r": 225.609918, "b": 439.572998 }, "text": "0.94", "attrs": { "row": 6, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 30 }, { "id": "p29.5.32", "order": 37, "type": "table_cell", "bbox": { "l": 342.1714, "t": 446.0727, "r": 414.5143, "b": 428.1818 }, "text": "", "attrs": { "row": 6, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 31 }, { "id": "p29.5.33", "order": 38, "type": "table_cell", "bbox": { "l": 289.079669, "t": 451.379725, "r": 432.324312, "b": 427.692157 }, "text": "Shallow Concentrated Flow, Woodland Kv= 5.0 fps", "attrs": { "row": 6, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 32 }, { "id": "p29.5.34", "order": 39, "type": "table_cell", "bbox": { "l": 75.000034, "t": 427.799569, "r": 89.930302, "b": 415.81239 }, "text": "1.6", "attrs": { "row": 7, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 33 }, { "id": "p29.5.35", "order": 40, "type": "table_cell", "bbox": { "l": 115.679107, "t": 427.799569, "r": 133.595429, "b": 415.81239 }, "text": "190", "attrs": { "row": 7, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 34 }, { "id": "p29.5.36", "order": 41, "type": "table_cell", "bbox": { "l": 144.353814, "t": 427.799569, "r": 177.200404, "b": 415.81239 }, "text": "0.0150", "attrs": { "row": 7, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 35 }, { "id": "p29.5.37", "order": 42, "type": "table_cell", "bbox": { "l": 204.707543, "t": 427.799569, "r": 225.609918, "b": 415.81239 }, "text": "1.97", "attrs": { "row": 7, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 36 }, { "id": "p29.5.38", "order": 43, "type": "table_cell", "bbox": { "l": 342.1714, "t": 428.1818, "r": 414.5143, "b": 410.2909 }, "text": "", "attrs": { "row": 7, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 37 }, { "id": "p29.5.39", "order": 44, "type": "table_cell", "bbox": { "l": 289.079669, "t": 427.619117, "r": 432.324312, "b": 403.931548 }, "text": "Shallow Concentrated Flow, Unpaved Kv= 16.1 fps", "attrs": { "row": 7, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 38 }, { "id": "p29.5.40", "order": 45, "type": "table_cell", "bbox": { "l": 69, "t": 402.120786, "r": 89.902375, "b": 390.133607 }, "text": "19.1", "attrs": { "row": 8, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 39 }, { "id": "p29.5.41", "order": 46, "type": "table_cell", "bbox": { "l": 115.676959, "t": 402.120786, "r": 133.59328, "b": 390.133607 }, "text": "430", "attrs": { "row": 8, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 40 }, { "id": "p29.5.42", "order": 47, "type": "table_cell", "bbox": { "l": 144.351666, "t": 402.120786, "r": 168.229354, "b": 390.133607 }, "text": "Total", "attrs": { "row": 8, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 41 }, { "id": "p29.5.43", "order": 48, "type": "table_cell", "bbox": { "l": 269.8286, "t": 410.2909, "r": 342.1714, "b": 392.4 }, "text": "", "attrs": { "row": 8, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 42 }, { "id": "p29.5.44", "order": 49, "type": "table_cell", "bbox": { "l": 342.1714, "t": 410.2909, "r": 414.5143, "b": 392.4 }, "text": "", "attrs": { "row": 8, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 43 }, { "id": "p29.5.45", "order": 50, "type": "table_cell", "bbox": { "l": 414.5143, "t": 410.2909, "r": 486.8571, "b": 392.4 }, "text": "", "attrs": { "row": 8, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 44 }, { "id": "p29.5.46", "order": 51, "type": "table_cell", "bbox": { "l": 486.8571, "t": 410.2909, "r": 559.2, "b": 392.4 }, "text": "", "attrs": { "row": 8, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 45 } ], "reading_order": 4 }, { "id": "p29.6", "order": 52, "type": "caption", "bbox": { "l": 222.48, "t": 377.76, "r": 393.36, "b": 363.12 }, "text": "Subcatchment 1S: POROUS", "attrs": { "block_label": "figure_title" }, "reading_order": 5 }, { "id": "p29.7", "order": 53, "type": "figure", "bbox": { "l": 62.88, "t": 358.56, "r": 550.08, "b": 90.48 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n0.44 Runoff\n0.42 0.40 cfs\n0.38 NOAA 24-hr D\n0.4\n10 YEAR Rainfall=5.38\"\n0.36\n0.34\nRunoff Area=1.970 ac\n0.32\n0.3\nRunoff Volume=0.092 af\n0.28\n0.26\n(cfs) 0.24 Runoff Depth>0.56\"\n0.22\nFlow 0.2 Flow Length=430'\n0.18\n0.16 Tc=19.1 min\n0.14\n0.12 CN=47\n0.1\n0.08\n0.06\n0.04\n0.02\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 6 } ] }, { "document_id": 11809, "page": 30, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 40, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "table": 1, "table_cell": 32, "text": 3, "title": 1 }, "build_ms": 4, "items": [ { "id": "p30.1", "order": 1, "type": "header", "bbox": { "l": 52.8, "t": 738.72, "r": 561.12, "b": 698.64 }, "text": "PRE DEV NOAA 24-hr D 10 YEAR Rainfall=5.38\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 12", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p30.2", "order": 2, "type": "title", "bbox": { "l": 171.84, "t": 687.36, "r": 446.88, "b": 672.48 }, "text": "Summary for Subcatchment 2S: IMPERVIOUS", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p30.3", "order": 3, "type": "text", "bbox": { "l": 52.08, "t": 659.52, "r": 245.04, "b": 646.32 }, "text": "[49] Hint: Tc<2dt may require smaller dt", "reading_order": 2 }, { "id": "p30.4", "order": 4, "type": "text", "bbox": { "l": 51.84, "t": 636.72, "r": 462.72, "b": 610.56 }, "text": "Runoff = 2.28 cfs @ 12.10 hrs, Volume= 0.172 af, Depth> 4.59\"\nRouted to Reach 3R : COMPOSITE", "reading_order": 3 }, { "id": "p30.5", "order": 5, "type": "text", "bbox": { "l": 52.08, "t": 600.72, "r": 541.68, "b": 574.8 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Weighted-CN, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs NOAA 24-hr D 10 YEAR Rainfall=5.38\"", "reading_order": 4 }, { "id": "p30.6", "order": 6, "type": "table", "bbox": { "l": 53.04, "t": 565.2, "r": 559.2, "b": 390.133607 }, "text": "", "attrs": { "block_label": "table", "n_rows": 6, "n_cols": 7, "integrity": { "cells_checked": 25, "cells_flagged": 0 } }, "children": [ { "id": "p30.6.1", "order": 7, "type": "table_cell", "bbox": { "l": 69.659595, "t": 564.242748, "r": 113.82741, "b": 552.255569 }, "text": "Area (ac)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p30.6.2", "order": 8, "type": "table_cell", "bbox": { "l": 130.796358, "t": 564.242748, "r": 146.30665, "b": 552.255569 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p30.6.3", "order": 9, "type": "table_cell", "bbox": { "l": 289.05701, "t": 477.241717, "r": 342.773751, "b": 465.254538 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p30.6.4", "order": 10, "type": "table_cell", "bbox": { "l": 53.04, "t": 547.824, "r": 125.3486, "b": 530.448 }, "text": "", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 3 }, { "id": "p30.6.5", "order": 11, "type": "table_cell", "bbox": { "l": 87, "t": 550.440786, "r": 113.874482, "b": 489.014072 }, "text": "0.150\n0.300\n0.450\n0.150\n0.300", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p30.6.6", "order": 12, "type": "table_cell", "bbox": { "l": 134.275244, "t": 550.440786, "r": 146.219458, "b": 512.7736070000001 }, "text": "96\n98\n97", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p30.6.7", "order": 13, "type": "table_cell", "bbox": { "l": 160.552515, "t": 550.440786, "r": 278.161136, "b": 489.014072 }, "text": "Gravel surface, HSG A\nPaved parking, HSG A\nWeighted Average\n33.33% Pervious Area\n66.67% Impervious Area", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 4, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p30.6.8", "order": 14, "type": "table_cell", "bbox": { "l": 65.459598, "t": 477.241717, "r": 89.993572, "b": 453.374771 }, "text": "Tc (min)", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p30.6.9", "order": 15, "type": "table_cell", "bbox": { "l": 100.682141, "t": 477.241717, "r": 133.545916, "b": 453.374771 }, "text": "Length (feet)", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p30.6.10", "order": 16, "type": "table_cell", "bbox": { "l": 149.815612, "t": 477.241717, "r": 177.28086, "b": 453.374771 }, "text": "Slope (ft/ft)", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p30.6.11", "order": 17, "type": "table_cell", "bbox": { "l": 188.028505, "t": 477.241717, "r": 225.633446, "b": 453.374771 }, "text": "Velocity (ft/sec)", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p30.6.12", "order": 18, "type": "table_cell", "bbox": { "l": 236.50354, "t": 477.241717, "r": 278.288957, "b": 453.374771 }, "text": "Capacity (cfs)", "attrs": { "row": 2, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 }, { "id": "p30.6.13", "order": 19, "type": "table_cell", "bbox": { "l": 160.552704, "t": 564.242748, "r": 214.269445, "b": 552.255569 }, "text": "Description", "attrs": { "row": 2, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 12 }, { "id": "p30.6.14", "order": 20, "type": "table_cell", "bbox": { "l": 75, "t": 451.560786, "r": 89.930268, "b": 439.573607 }, "text": "1.2", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p30.6.15", "order": 21, "type": "table_cell", "bbox": { "l": 115.679073, "t": 451.560786, "r": 133.595394, "b": 439.573607 }, "text": "100", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p30.6.16", "order": 22, "type": "table_cell", "bbox": { "l": 144.35378, "t": 451.560786, "r": 177.20037, "b": 439.573607 }, "text": "0.0200", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p30.6.17", "order": 23, "type": "table_cell", "bbox": { "l": 204.707509, "t": 451.560786, "r": 225.609884, "b": 439.573607 }, "text": "1.42", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p30.6.18", "order": 24, "type": "table_cell", "bbox": { "l": 342.2743, "t": 443.568, "r": 414.5829, "b": 426.192 }, "text": "", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 17 }, { "id": "p30.6.19", "order": 25, "type": "table_cell", "bbox": { "l": 289.079635, "t": 451.380334, "r": 476.803587, "b": 427.692765 }, "text": "Sheet Flow,\\nSmooth surfaces n= 0.011 P2= 3.42\"", "attrs": { "row": 3, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 18 }, { "id": "p30.6.20", "order": 26, "type": "table_cell", "bbox": { "l": 75, "t": 427.800177, "r": 89.930268, "b": 415.812998 }, "text": "1.4", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p30.6.21", "order": 27, "type": "table_cell", "bbox": { "l": 115.679073, "t": 427.800177, "r": 133.595394, "b": 415.812998 }, "text": "180", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p30.6.22", "order": 28, "type": "table_cell", "bbox": { "l": 144.35378, "t": 427.800177, "r": 177.20037, "b": 415.812998 }, "text": "0.0110", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p30.6.23", "order": 29, "type": "table_cell", "bbox": { "l": 204.707509, "t": 427.800177, "r": 225.609884, "b": 415.812998 }, "text": "2.13", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 22 }, { "id": "p30.6.24", "order": 30, "type": "table_cell", "bbox": { "l": 342.2743, "t": 426.192, "r": 414.5829, "b": 408.816 }, "text": "", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 23 }, { "id": "p30.6.25", "order": 31, "type": "table_cell", "bbox": { "l": 289.079635, "t": 427.619725, "r": 432.324278, "b": 403.932157 }, "text": "Shallow Concentrated Flow,\\nPaved Kv= 20.3 fps", "attrs": { "row": 4, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 24 }, { "id": "p30.6.26", "order": 32, "type": "table_cell", "bbox": { "l": 75, "t": 402.120786, "r": 89.930268, "b": 390.133607 }, "text": "2.6", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 25 }, { "id": "p30.6.27", "order": 33, "type": "table_cell", "bbox": { "l": 115.679073, "t": 402.120786, "r": 133.595394, "b": 390.133607 }, "text": "280", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 26 }, { "id": "p30.6.28", "order": 34, "type": "table_cell", "bbox": { "l": 144.35378, "t": 402.120786, "r": 168.231468, "b": 390.133607 }, "text": "Total", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 27 }, { "id": "p30.6.29", "order": 35, "type": "table_cell", "bbox": { "l": 269.9657, "t": 408.816, "r": 342.2743, "b": 391.44 }, "text": "", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 28 }, { "id": "p30.6.30", "order": 36, "type": "table_cell", "bbox": { "l": 342.2743, "t": 408.816, "r": 414.5829, "b": 391.44 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 29 }, { "id": "p30.6.31", "order": 37, "type": "table_cell", "bbox": { "l": 414.5829, "t": 408.816, "r": 486.8914, "b": 391.44 }, "text": "", "attrs": { "row": 5, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 30 }, { "id": "p30.6.32", "order": 38, "type": "table_cell", "bbox": { "l": 486.8914, "t": 408.816, "r": 559.2, "b": 391.44 }, "text": "", "attrs": { "row": 5, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 31 } ], "reading_order": 5 }, { "id": "p30.7", "order": 39, "type": "caption", "bbox": { "l": 210.48, "t": 378, "r": 405.6, "b": 363.12 }, "text": "Subcatchment 2S: IMPERVIOUS", "attrs": { "block_label": "figure_title" }, "reading_order": 6 }, { "id": "p30.8", "order": 40, "type": "figure", "bbox": { "l": 60.72, "t": 364.56, "r": 552.48, "b": 90 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nRunoff\n2.28 cfs\nNOAA 24-hr D\n2 10 YEAR Rainfall=5.38\"\nRunoff Area=0.450 ac\nRunoff Volume=0.172 af\n(cfs) Runoff Depth>4.59\"\nFlow Flow Length=280'\n1\nTc=2.6 min\nCN=97\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 7 } ] }, { "document_id": 11809, "page": 31, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 7, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "heading": 1, "text": 3 }, "build_ms": 0, "items": [ { "id": "p31.1", "order": 1, "type": "header", "bbox": { "l": 52.56, "t": 738.48, "r": 561.12, "b": 698.88 }, "text": "PRE DEV NOAA 24-hr D 10 YEAR Rainfall=5.38\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 13", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p31.2", "order": 2, "type": "heading", "bbox": { "l": 196.8, "t": 687.6, "r": 420.72, "b": 672.48 }, "text": "Summary for Reach 3R: COMPOSITE", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p31.3", "order": 3, "type": "text", "bbox": { "l": 52.08, "t": 659.52, "r": 250.8, "b": 646.08 }, "text": "[40] Hint: Not Described (Outflow=Inflow)", "reading_order": 2 }, { "id": "p31.4", "order": 4, "type": "text", "bbox": { "l": 52.32, "t": 636.24, "r": 517.92, "b": 598.32 }, "text": "Inflow Area = 2.420 ac, 12.40% Impervious, Inflow Depth > 1.31\" for 10 YEAR event\nInflow = 2.32 cfs @ 12.10 hrs, Volume= 0.264 af\nOutflow = 2.32 cfs @ 12.10 hrs, Volume= 0.264 af, Atten=0%, Lag=0.0 min", "reading_order": 3 }, { "id": "p31.5", "order": 5, "type": "text", "bbox": { "l": 51.84, "t": 588.72, "r": 420.96, "b": 574.8 }, "text": "Routing by Stor-Ind+Trans method, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs", "reading_order": 4 }, { "id": "p31.6", "order": 6, "type": "caption", "bbox": { "l": 235.92, "t": 563.76, "r": 379.44, "b": 548.64 }, "text": "Reach 3R: COMPOSITE", "attrs": { "block_label": "figure_title" }, "reading_order": 5 }, { "id": "p31.7", "order": 7, "type": "figure", "bbox": { "l": 60.72, "t": 549.84, "r": 553.44, "b": 274.32 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nInflow\n2.32 cfs Outflow\n2.32 cfs\nInflow Area=2.420 ac\n2\n(cfs)\nFlow\n1\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 6 } ] }, { "document_id": 11809, "page": 32, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 3, "counts_by_type": { "footer": 1, "text": 2 }, "build_ms": 0, "items": [ { "id": "p32.1", "order": 1, "type": "text", "bbox": { "l": 50.64, "t": 690.72, "r": 560.64, "b": 556.32 }, "text": "Time span=5.00-20.00 hrs, dt=0.05 hrs, 301 points\nRunoff by SCS TR-20 method, UH=Delmarva, Weighted-CN\nReach routing by Stor-Ind+Trans method - Pond routing by Stor-Ind method\nSubcatchment1S: POROUS\nFlow Length=430' Tc=19.1 min CN=47 Runoff=2.68 cfs 0.406 af\nSubcatchment2S: IMPERVIOUS\nFlow Length=280' Tc=2.6 min CN=97 Runoff=4.05 cfs 0.309 af\nReach 3R: COMPOSITE", "attrs": { "block_label": "algorithm" }, "reading_order": 0 }, { "id": "p32.2", "order": 2, "type": "text", "bbox": { "l": 49.44, "t": 643.44, "r": 566.4, "b": 508.8 }, "text": "Subcatchment1S: POROUS\nRunoff Area=1.970 ac 0.00% Impervious Runoff Depth>2.47\"\nFlow Length=430' Tc=19.1 min CN=47 Runoff=2.68 cfs 0.406 af\nSubcatchment2S: IMPERVIOUS\nRunoff Area=0.450 ac 66.67% Impervious Runoff Depth>8.24\"\nFlow Length=280' Tc=2.6 min CN=97 Runoff=4.05 cfs 0.309 af\nReach 3R: COMPOSITE\nInflow=5.23 cfs 0.715 af\nOutflow=5.23 cfs 0.715 af\nTotal Runoff Area = 2.420 ac Runoff Volume = 0.715 af Average Runoff Depth = 3.55\"\n87.60% Pervious = 2.120 ac 12.40% Impervious = 0.300 ac", "attrs": { "block_label": "algorithm" }, "reading_order": 1 }, { "id": "p32.3", "order": 3, "type": "footer", "bbox": { "l": 51.12, "t": 739.92, "r": 559.92, "b": 699.84 }, "text": "PRE DEV NOAA 24-hr D 100 YEAR Rainfall=9.48\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 14", "attrs": { "block_label": "footer" }, "reading_order": 2 } ] }, { "document_id": 11809, "page": 33, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 53, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "table": 1, "table_cell": 46, "text": 2, "title": 1 }, "build_ms": 10, "items": [ { "id": "p33.1", "order": 1, "type": "header", "bbox": { "l": 52.8, "t": 738.24, "r": 560.88, "b": 698.88 }, "text": "PRE DEV NOAA 24-hr D 100 YEAR Rainfall=9.48\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 15", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p33.2", "order": 2, "type": "title", "bbox": { "l": 183.6, "t": 687.36, "r": 434.64, "b": 672.72 }, "text": "Summary for Subcatchment 1S: POROUS", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p33.3", "order": 3, "type": "text", "bbox": { "l": 52.32, "t": 660, "r": 463.2, "b": 634.32 }, "text": "Runoff = 2.68 cfs @ 12.35 hrs, Volume= 0.406 af, Depth> 2.47\"\nRouted to Reach 3R : COMPOSITE", "reading_order": 2 }, { "id": "p33.4", "order": 4, "type": "text", "bbox": { "l": 52.08, "t": 624.24, "r": 541.44, "b": 598.56 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Weighted-CN, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs NOAA 24-hr D 100 YEAR Rainfall=9.48\"", "reading_order": 3 }, { "id": "p33.5", "order": 5, "type": "table", "bbox": { "l": 52.8, "t": 589.2, "r": 559.2, "b": 390.133607 }, "text": "", "attrs": { "block_label": "table", "n_rows": 9, "n_cols": 7, "integrity": { "cells_checked": 35, "cells_flagged": 0 } }, "children": [ { "id": "p33.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 69.659595, "t": 588.002283, "r": 113.82741, "b": 576.0151040000001 }, "text": "Area (ac)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p33.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 130.796358, "t": 588.002283, "r": 146.30665, "b": 576.0151040000001 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p33.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 289.05701, "t": 501.001484, "r": 342.773751, "b": 489.014305 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p33.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 52.8, "t": 571.2655, "r": 125.1429, "b": 553.3309 }, "text": "", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 3 }, { "id": "p33.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 87, "t": 574.200786, "r": 113.874482, "b": 538.454072 }, "text": "1.080\n0.110\n0.780", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p33.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 134.275244, "t": 574.200786, "r": 146.219458, "b": 538.454072 }, "text": "30\n39\n72", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p33.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 160.552515, "t": 574.200786, "r": 320.843443, "b": 538.454072 }, "text": "Woods, Good, HSG A\n>75% Grass cover, Good, HSG A\nDirt roads, HSG A", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 4, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p33.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 52.8, "t": 517.4618, "r": 125.1429, "b": 499.5273 }, "text": "", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 7 }, { "id": "p33.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 87, "t": 524.761019, "r": 113.874482, "b": 512.7738400000001 }, "text": "1.970", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p33.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 134.275244, "t": 536.6407859999999, "r": 146.219458, "b": 524.653607 }, "text": "47", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p33.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 160.552515, "t": 536.6407859999999, "r": 248.909626, "b": 524.653607 }, "text": "Weighted Average", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 4, "bbox_refit": true }, "reading_order": 10 }, { "id": "p33.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 52.8, "t": 499.5273, "r": 125.1429, "b": 481.5927 }, "text": "", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 11 }, { "id": "p33.5.13", "order": 18, "type": "table_cell", "bbox": { "l": 87, "t": 536.6407859999999, "r": 113.874482, "b": 524.653607 }, "text": "1.970", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 12 }, { "id": "p33.5.14", "order": 19, "type": "table_cell", "bbox": { "l": 197.4857, "t": 499.5273, "r": 269.8286, "b": 481.5927 }, "text": "", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 13 }, { "id": "p33.5.15", "order": 20, "type": "table_cell", "bbox": { "l": 160.555738, "t": 524.761019, "r": 273.392044, "b": 512.7738400000001 }, "text": "100.00% Pervious Area", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 4, "bbox_refit": true }, "reading_order": 14 }, { "id": "p33.5.16", "order": 21, "type": "table_cell", "bbox": { "l": 65.459598, "t": 501.001484, "r": 89.993572, "b": 477.134538 }, "text": "Tc (min)", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p33.5.17", "order": 22, "type": "table_cell", "bbox": { "l": 100.682141, "t": 501.001484, "r": 133.545916, "b": 477.134538 }, "text": "Length (feet)", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p33.5.18", "order": 23, "type": "table_cell", "bbox": { "l": 149.815612, "t": 501.001484, "r": 177.28086, "b": 477.134538 }, "text": "Slope (ft/ft)", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p33.5.19", "order": 24, "type": "table_cell", "bbox": { "l": 188.028505, "t": 501.001484, "r": 225.633446, "b": 477.134538 }, "text": "Velocity (ft/sec)", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p33.5.20", "order": 25, "type": "table_cell", "bbox": { "l": 236.50354, "t": 501.001484, "r": 278.288957, "b": 477.134538 }, "text": "Capacity (cfs)", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p33.5.21", "order": 26, "type": "table_cell", "bbox": { "l": 160.552704, "t": 588.002283, "r": 214.269445, "b": 576.0151040000001 }, "text": "Description", "attrs": { "row": 4, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 20 }, { "id": "p33.5.22", "order": 27, "type": "table_cell", "bbox": { "l": 69, "t": 475.320786, "r": 89.902375, "b": 463.333607 }, "text": "15.0", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p33.5.23", "order": 28, "type": "table_cell", "bbox": { "l": 115.676959, "t": 475.320786, "r": 133.59328, "b": 463.333607 }, "text": "100", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 22 }, { "id": "p33.5.24", "order": 29, "type": "table_cell", "bbox": { "l": 144.351666, "t": 475.320786, "r": 177.198256, "b": 463.333607 }, "text": "0.0450", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 23 }, { "id": "p33.5.25", "order": 30, "type": "table_cell", "bbox": { "l": 204.705395, "t": 475.320786, "r": 225.60777, "b": 463.333607 }, "text": "0.11", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 24 }, { "id": "p33.5.26", "order": 31, "type": "table_cell", "bbox": { "l": 342.1714, "t": 463.6582, "r": 414.5143, "b": 445.7236 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 25 }, { "id": "p33.5.27", "order": 32, "type": "table_cell", "bbox": { "l": 289.079669, "t": 475.140334, "r": 516.213084, "b": 451.452765 }, "text": "Sheet Flow, Woods: Light underbrush n= 0.400 P2= 3.42\"", "attrs": { "row": 5, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 26 }, { "id": "p33.5.28", "order": 33, "type": "table_cell", "bbox": { "l": 75.000034, "t": 451.560177, "r": 89.930302, "b": 439.572998 }, "text": "2.5", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 27 }, { "id": "p33.5.29", "order": 34, "type": "table_cell", "bbox": { "l": 115.679107, "t": 451.560177, "r": 133.595429, "b": 439.572998 }, "text": "140", "attrs": { "row": 6, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 28 }, { "id": "p33.5.30", "order": 35, "type": "table_cell", "bbox": { "l": 144.353814, "t": 451.560177, "r": 177.200404, "b": 439.572998 }, "text": "0.0350", "attrs": { "row": 6, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 29 }, { "id": "p33.5.31", "order": 36, "type": "table_cell", "bbox": { "l": 204.707543, "t": 451.560177, "r": 225.609918, "b": 439.572998 }, "text": "0.94", "attrs": { "row": 6, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 30 }, { "id": "p33.5.32", "order": 37, "type": "table_cell", "bbox": { "l": 342.1714, "t": 445.7236, "r": 414.5143, "b": 427.7891 }, "text": "", "attrs": { "row": 6, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 31 }, { "id": "p33.5.33", "order": 38, "type": "table_cell", "bbox": { "l": 289.079669, "t": 451.379725, "r": 432.324312, "b": 427.692157 }, "text": "Shallow Concentrated Flow, Woodland Kv= 5.0 fps", "attrs": { "row": 6, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 32 }, { "id": "p33.5.34", "order": 39, "type": "table_cell", "bbox": { "l": 75.000034, "t": 427.799569, "r": 89.930302, "b": 415.81239 }, "text": "1.6", "attrs": { "row": 7, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 33 }, { "id": "p33.5.35", "order": 40, "type": "table_cell", "bbox": { "l": 115.679107, "t": 427.799569, "r": 133.595429, "b": 415.81239 }, "text": "190", "attrs": { "row": 7, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 34 }, { "id": "p33.5.36", "order": 41, "type": "table_cell", "bbox": { "l": 144.353814, "t": 427.799569, "r": 177.200404, "b": 415.81239 }, "text": "0.0150", "attrs": { "row": 7, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 35 }, { "id": "p33.5.37", "order": 42, "type": "table_cell", "bbox": { "l": 204.707543, "t": 427.799569, "r": 225.609918, "b": 415.81239 }, "text": "1.97", "attrs": { "row": 7, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 36 }, { "id": "p33.5.38", "order": 43, "type": "table_cell", "bbox": { "l": 342.1714, "t": 427.7891, "r": 414.5143, "b": 409.8545 }, "text": "", "attrs": { "row": 7, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 37 }, { "id": "p33.5.39", "order": 44, "type": "table_cell", "bbox": { "l": 289.079669, "t": 427.619117, "r": 432.324312, "b": 403.931548 }, "text": "Shallow Concentrated Flow, Unpaved Kv= 16.1 fps", "attrs": { "row": 7, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 38 }, { "id": "p33.5.40", "order": 45, "type": "table_cell", "bbox": { "l": 69, "t": 402.120786, "r": 89.902375, "b": 390.133607 }, "text": "19.1", "attrs": { "row": 8, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 39 }, { "id": "p33.5.41", "order": 46, "type": "table_cell", "bbox": { "l": 115.676959, "t": 402.120786, "r": 133.59328, "b": 390.133607 }, "text": "430", "attrs": { "row": 8, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 40 }, { "id": "p33.5.42", "order": 47, "type": "table_cell", "bbox": { "l": 144.351666, "t": 402.120786, "r": 168.229354, "b": 390.133607 }, "text": "Total", "attrs": { "row": 8, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 41 }, { "id": "p33.5.43", "order": 48, "type": "table_cell", "bbox": { "l": 269.8286, "t": 409.8545, "r": 342.1714, "b": 391.92 }, "text": "", "attrs": { "row": 8, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 42 }, { "id": "p33.5.44", "order": 49, "type": "table_cell", "bbox": { "l": 342.1714, "t": 409.8545, "r": 414.5143, "b": 391.92 }, "text": "", "attrs": { "row": 8, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 43 }, { "id": "p33.5.45", "order": 50, "type": "table_cell", "bbox": { "l": 414.5143, "t": 409.8545, "r": 486.8571, "b": 391.92 }, "text": "", "attrs": { "row": 8, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 44 }, { "id": "p33.5.46", "order": 51, "type": "table_cell", "bbox": { "l": 486.8571, "t": 409.8545, "r": 559.2, "b": 391.92 }, "text": "", "attrs": { "row": 8, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 45 } ], "reading_order": 4 }, { "id": "p33.6", "order": 52, "type": "caption", "bbox": { "l": 222, "t": 377.76, "r": 393.36, "b": 362.88 }, "text": "Subcatchment 1S: POROUS", "attrs": { "block_label": "figure_title" }, "reading_order": 5 }, { "id": "p33.7", "order": 53, "type": "figure", "bbox": { "l": 61.2, "t": 363.84, "r": 551.76, "b": 90.72 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n3\nRunoff\n2.68 cfs\nNOAA 24-hr D\n100 YEAR Rainfall=9.48\"\nRunoff Area=1.970 ac\n2\nRunoff Volume=0.406 af\n(cfs) Runoff Depth>2.47\"\nFlow Flow Length=430'\n1 Tc=19.1 min\nCN=47\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 6 } ] }, { "document_id": 11809, "page": 34, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 40, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "table": 1, "table_cell": 32, "text": 3, "title": 1 }, "build_ms": 4, "items": [ { "id": "p34.1", "order": 1, "type": "header", "bbox": { "l": 52.8, "t": 738.72, "r": 561.12, "b": 698.88 }, "text": "PRE DEV NOAA 24-hr D 100 YEAR Rainfall=9.48\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 16", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p34.2", "order": 2, "type": "title", "bbox": { "l": 171.84, "t": 687.36, "r": 446.88, "b": 672.48 }, "text": "Summary for Subcatchment 2S: IMPERVIOUS", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p34.3", "order": 3, "type": "text", "bbox": { "l": 52.08, "t": 659.52, "r": 245.04, "b": 646.32 }, "text": "[49] Hint: Tc<2dt may require smaller dt", "reading_order": 2 }, { "id": "p34.4", "order": 4, "type": "text", "bbox": { "l": 51.84, "t": 636.72, "r": 462.24, "b": 610.56 }, "text": "Runoff = 4.05 cfs @ 12.10 hrs, Volume= 0.309 af, Depth> 8.24\"\nRouted to Reach 3R : COMPOSITE", "reading_order": 3 }, { "id": "p34.5", "order": 5, "type": "text", "bbox": { "l": 52.08, "t": 600.72, "r": 541.68, "b": 574.8 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Weighted-CN, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs NOAA 24-hr D 100 YEAR Rainfall=9.48\"", "reading_order": 4 }, { "id": "p34.6", "order": 6, "type": "table", "bbox": { "l": 53.04, "t": 565.68, "r": 558.96, "b": 390.133607 }, "text": "", "attrs": { "block_label": "table", "n_rows": 6, "n_cols": 7, "integrity": { "cells_checked": 25, "cells_flagged": 0 } }, "children": [ { "id": "p34.6.1", "order": 7, "type": "table_cell", "bbox": { "l": 69.659595, "t": 564.242748, "r": 113.82741, "b": 552.255569 }, "text": "Area (ac)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p34.6.2", "order": 8, "type": "table_cell", "bbox": { "l": 130.796358, "t": 564.242748, "r": 146.30665, "b": 552.255569 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p34.6.3", "order": 9, "type": "table_cell", "bbox": { "l": 289.05701, "t": 477.241717, "r": 342.773751, "b": 465.254538 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p34.6.4", "order": 10, "type": "table_cell", "bbox": { "l": 53.04, "t": 548.328, "r": 125.3143, "b": 530.976 }, "text": "", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 3 }, { "id": "p34.6.5", "order": 11, "type": "table_cell", "bbox": { "l": 87, "t": 550.440786, "r": 113.874482, "b": 489.014072 }, "text": "0.150\n0.300\n0.450\n0.150\n0.300", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p34.6.6", "order": 12, "type": "table_cell", "bbox": { "l": 134.275244, "t": 550.440786, "r": 146.219458, "b": 512.7736070000001 }, "text": "96\n98\n97", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p34.6.7", "order": 13, "type": "table_cell", "bbox": { "l": 160.552515, "t": 550.440786, "r": 278.161136, "b": 489.014072 }, "text": "Gravel surface, HSG A\nPaved parking, HSG A\nWeighted Average\n33.33% Pervious Area\n66.67% Impervious Area", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 4, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p34.6.8", "order": 14, "type": "table_cell", "bbox": { "l": 65.459598, "t": 477.241717, "r": 89.993572, "b": 453.374771 }, "text": "Tc (min)", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p34.6.9", "order": 15, "type": "table_cell", "bbox": { "l": 100.682141, "t": 477.241717, "r": 133.545916, "b": 453.374771 }, "text": "Length (feet)", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p34.6.10", "order": 16, "type": "table_cell", "bbox": { "l": 149.815612, "t": 477.241717, "r": 177.28086, "b": 453.374771 }, "text": "Slope (ft/ft)", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p34.6.11", "order": 17, "type": "table_cell", "bbox": { "l": 188.028505, "t": 477.241717, "r": 225.633446, "b": 453.374771 }, "text": "Velocity (ft/sec)", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p34.6.12", "order": 18, "type": "table_cell", "bbox": { "l": 236.50354, "t": 477.241717, "r": 278.288957, "b": 453.374771 }, "text": "Capacity (cfs)", "attrs": { "row": 2, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 }, { "id": "p34.6.13", "order": 19, "type": "table_cell", "bbox": { "l": 160.552704, "t": 564.242748, "r": 214.269445, "b": 552.255569 }, "text": "Description", "attrs": { "row": 2, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 12 }, { "id": "p34.6.14", "order": 20, "type": "table_cell", "bbox": { "l": 75, "t": 451.560786, "r": 89.930268, "b": 439.573607 }, "text": "1.2", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p34.6.15", "order": 21, "type": "table_cell", "bbox": { "l": 115.679073, "t": 451.560786, "r": 133.595394, "b": 439.573607 }, "text": "100", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p34.6.16", "order": 22, "type": "table_cell", "bbox": { "l": 144.35378, "t": 451.560786, "r": 177.20037, "b": 439.573607 }, "text": "0.0200", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p34.6.17", "order": 23, "type": "table_cell", "bbox": { "l": 204.707509, "t": 451.560786, "r": 225.609884, "b": 439.573607 }, "text": "1.42", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p34.6.18", "order": 24, "type": "table_cell", "bbox": { "l": 342.1371, "t": 444.216, "r": 414.4114, "b": 426.864 }, "text": "", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 17 }, { "id": "p34.6.19", "order": 25, "type": "table_cell", "bbox": { "l": 289.079635, "t": 451.380334, "r": 476.803587, "b": 427.692765 }, "text": "Sheet Flow, Smooth surfaces n= 0.011 P2= 3.42\"", "attrs": { "row": 3, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 18 }, { "id": "p34.6.20", "order": 26, "type": "table_cell", "bbox": { "l": 75, "t": 427.800177, "r": 89.930268, "b": 415.812998 }, "text": "1.4", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p34.6.21", "order": 27, "type": "table_cell", "bbox": { "l": 115.679073, "t": 427.800177, "r": 133.595394, "b": 415.812998 }, "text": "180", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p34.6.22", "order": 28, "type": "table_cell", "bbox": { "l": 144.35378, "t": 427.800177, "r": 177.20037, "b": 415.812998 }, "text": "0.0110", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p34.6.23", "order": 29, "type": "table_cell", "bbox": { "l": 204.707509, "t": 427.800177, "r": 225.609884, "b": 415.812998 }, "text": "2.13", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 22 }, { "id": "p34.6.24", "order": 30, "type": "table_cell", "bbox": { "l": 342.1371, "t": 426.864, "r": 414.4114, "b": 409.512 }, "text": "", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 23 }, { "id": "p34.6.25", "order": 31, "type": "table_cell", "bbox": { "l": 289.079635, "t": 427.619725, "r": 432.324278, "b": 403.932157 }, "text": "Shallow Concentrated Flow, Paved Kv= 20.3 fps", "attrs": { "row": 4, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 24 }, { "id": "p34.6.26", "order": 32, "type": "table_cell", "bbox": { "l": 75, "t": 402.120786, "r": 89.930268, "b": 390.133607 }, "text": "2.6", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 25 }, { "id": "p34.6.27", "order": 33, "type": "table_cell", "bbox": { "l": 115.679073, "t": 402.120786, "r": 133.595394, "b": 390.133607 }, "text": "280", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 26 }, { "id": "p34.6.28", "order": 34, "type": "table_cell", "bbox": { "l": 144.35378, "t": 402.120786, "r": 168.231468, "b": 390.133607 }, "text": "Total", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 27 }, { "id": "p34.6.29", "order": 35, "type": "table_cell", "bbox": { "l": 269.8629, "t": 409.512, "r": 342.1371, "b": 392.16 }, "text": "", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 28 }, { "id": "p34.6.30", "order": 36, "type": "table_cell", "bbox": { "l": 342.1371, "t": 409.512, "r": 414.4114, "b": 392.16 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 29 }, { "id": "p34.6.31", "order": 37, "type": "table_cell", "bbox": { "l": 414.4114, "t": 409.512, "r": 486.6857, "b": 392.16 }, "text": "", "attrs": { "row": 5, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 30 }, { "id": "p34.6.32", "order": 38, "type": "table_cell", "bbox": { "l": 486.6857, "t": 409.512, "r": 558.96, "b": 392.16 }, "text": "", "attrs": { "row": 5, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 31 } ], "reading_order": 5 }, { "id": "p34.7", "order": 39, "type": "caption", "bbox": { "l": 210.48, "t": 378, "r": 405.6, "b": 363.12 }, "text": "Subcatchment 2S: IMPERVIOUS", "attrs": { "block_label": "figure_title" }, "reading_order": 6 }, { "id": "p34.8", "order": 40, "type": "figure", "bbox": { "l": 60.96, "t": 363.84, "r": 552, "b": 90.24 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nRunoff\n4.05 cfs\nNOAA 24-hr D\n4\n100 YEAR Rainfall=9.48\"\nRunoff Area=0.450 ac\n3\nRunoff Volume=0.309 af\n(cfs) Runoff Depth>8.24\"\nFlow 2 Flow Length=280'\nTc=2.6 min\nCN=97\n1\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 7 } ] }, { "document_id": 11809, "page": 35, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 7, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "heading": 1, "text": 3 }, "build_ms": 0, "items": [ { "id": "p35.1", "order": 1, "type": "header", "bbox": { "l": 52.8, "t": 738.48, "r": 561.12, "b": 698.88 }, "text": "PRE DEV NOAA 24-hr D 100 YEAR Rainfall=9.48\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 17", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p35.2", "order": 2, "type": "heading", "bbox": { "l": 196.8, "t": 687.6, "r": 420.96, "b": 672.48 }, "text": "Summary for Reach 3R: COMPOSITE", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p35.3", "order": 3, "type": "text", "bbox": { "l": 52.08, "t": 659.52, "r": 251.04, "b": 646.08 }, "text": "[40] Hint: Not Described (Outflow=Inflow)", "reading_order": 2 }, { "id": "p35.4", "order": 4, "type": "text", "bbox": { "l": 52.32, "t": 636.48, "r": 518.64, "b": 598.32 }, "text": "Inflow Area = 2.420 ac, 12.40% Impervious, Inflow Depth > 3.55\" for 100 YEAR event\nInflow = 5.23 cfs @ 12.11 hrs, Volume= 0.715 af\nOutflow = 5.23 cfs @ 12.11 hrs, Volume= 0.715 af, Atten=0%, Lag=0.0 min", "reading_order": 3 }, { "id": "p35.5", "order": 5, "type": "text", "bbox": { "l": 51.84, "t": 588.72, "r": 420.96, "b": 574.8 }, "text": "Routing by Stor-Ind+Trans method, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs", "reading_order": 4 }, { "id": "p35.6", "order": 6, "type": "caption", "bbox": { "l": 235.68, "t": 563.76, "r": 379.68, "b": 548.64 }, "text": "Reach 3R: COMPOSITE", "attrs": { "block_label": "figure_title" }, "reading_order": 5 }, { "id": "p35.7", "order": 7, "type": "figure", "bbox": { "l": 61.44, "t": 549.84, "r": 554.64, "b": 274.32 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nInflow\n5.23 cfs Outflow\n5.23 cfs\nInflow Area=2.420 ac\n5\n4\n(cfs)\n3\nFlow\n2\n1\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 6 } ] }, { "document_id": 11809, "page": 36, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 2, "counts_by_type": { "heading": 1, "text": 1 }, "build_ms": 0, "items": [ { "id": "p36.1", "order": 1, "type": "text", "bbox": { "l": 145.44, "t": 592.08, "r": 464.4, "b": 574.158986 }, "text": "APPENDIX B", "reading_order": 0 }, { "id": "p36.2", "order": 2, "type": "heading", "bbox": { "l": 149.279995, "t": 558.259194, "r": 462.270548, "b": 542.87898 }, "text": "POST-DEVELOPED CONDITION CALCULATIONS", "attrs": { "split_from": "trailing_line" }, "level": 3, "reading_order": 1 } ] }, { "document_id": 11809, "page": 37, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 6, "counts_by_type": { "caption": 1, "figure": 1, "footer": 2, "text": 2 }, "build_ms": 0, "items": [ { "id": "p37.1", "order": 1, "type": "figure", "bbox": { "l": 54, "t": 731.04, "r": 558.72, "b": 68.16 }, "text": "", "attrs": { "block_label": "image" }, "reading_order": 0 }, { "id": "p37.2", "order": 2, "type": "caption", "bbox": { "l": 311.52, "t": 312.72, "r": 355.2, "b": 302.4 }, "text": "COMPOSITE", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p37.3", "order": 3, "type": "text", "bbox": { "l": 229.92, "t": 88.08, "r": 257.76, "b": 64.32 }, "text": "Link\nRouting Diagram for POST DEV\nPrepared by Professional Design Services, Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC", "reading_order": 2 }, { "id": "p37.4", "order": 4, "type": "text", "bbox": { "l": 288, "t": 85.92, "r": 550.32, "b": 56.16 }, "text": "Routing Diagram for POST DEV\nPrepared by Professional Design Services, Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC", "reading_order": 3 }, { "id": "p37.5", "order": 5, "type": "footer", "bbox": { "l": 72, "t": 98.64, "r": 112.8, "b": 68.16 }, "text": "", "attrs": { "block_label": "footer_image" }, "reading_order": 4 }, { "id": "p37.6", "order": 6, "type": "footer", "bbox": { "l": 127.92, "t": 85.92, "r": 157.2, "b": 73.44 }, "text": "Reach", "attrs": { "block_label": "footer" }, "reading_order": 5 } ] }, { "document_id": 11809, "page": 38, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 27, "counts_by_type": { "caption": 1, "form_field": 1, "table": 2, "table_cell": 23 }, "build_ms": 2, "items": [ { "id": "p38.1", "order": 1, "type": "table", "bbox": { "l": 53.28, "t": 738.48, "r": 571.2, "b": 697.68 }, "text": "", "attrs": { "block_label": "table", "n_rows": 3, "n_cols": 3, "integrity": { "cells_checked": 5, "cells_flagged": 0 } }, "children": [ { "id": "p38.1.1", "order": 2, "type": "table_cell", "bbox": { "l": 54, "t": 737.984717, "r": 117.280769, "b": 724.019651 }, "text": "POST DEV", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 0 }, { "id": "p38.1.2", "order": 3, "type": "table_cell", "bbox": { "l": 54, "t": 724.06687, "r": 272.267766, "b": 711.061006 }, "text": "Prepared by Professional Design Services", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 1 }, { "id": "p38.1.3", "order": 4, "type": "table_cell", "bbox": { "l": 463.832107, "t": 724.140786, "r": 557.581301, "b": 712.153607 }, "text": "Printed 12/31/2025", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 2 }, { "id": "p38.1.4", "order": 5, "type": "table_cell", "bbox": { "l": 53.28, "t": 711.28, "r": 398.56, "b": 697.68 }, "text": "HydroCAD ○ledR 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 2 }, "children": [ { "id": "p38.1.4.1", "order": 6, "type": "form_field", "bbox": { "l": 96.44, "t": 711.28, "r": 108.44, "b": 699.28 }, "text": "", "attrs": { "field_kind": "radio", "label": "ledR 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions …", "source": "glyph_estimate", "bbox_estimated": true, "row": 2, "col": 0, "rowspan": 1, "colspan": 2, "label_source": "parent_text", "label_ref": "p38.1.4", "text_offset": 9, "text_span": 1 }, "reading_order": 0 } ], "reading_order": 3 }, { "id": "p38.1.5", "order": 7, "type": "table_cell", "bbox": { "l": 523.86, "t": 711.120786, "r": 557.898863, "b": 699.133607 }, "text": "Page 2", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 } ], "reading_order": 0 }, { "id": "p38.2", "order": 8, "type": "caption", "bbox": { "l": 243.36, "t": 687.6, "r": 371.28, "b": 672.24 }, "text": "Rainfall Events Listing", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p38.3", "order": 9, "type": "table", "bbox": { "l": 52.32, "t": 682.8, "r": 470.64, "b": 575.52 }, "text": "", "attrs": { "block_label": "table", "n_rows": 2, "n_cols": 9, "integrity": { "cells_checked": 18, "cells_flagged": 0 } }, "children": [ { "id": "p38.3.1", "order": 10, "type": "table_cell", "bbox": { "l": 67.08, "t": 661.21453, "r": 97.674875, "b": 650.246371 }, "text": "Event#", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 0 }, { "id": "p38.3.2", "order": 11, "type": "table_cell", "bbox": { "l": 110.817011, "t": 661.21453, "r": 137.031502, "b": 636.566639 }, "text": "Event Name", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 1 }, { "id": "p38.3.3", "order": 12, "type": "table_cell", "bbox": { "l": 169.740401, "t": 661.21453, "r": 220.532022, "b": 650.246371 }, "text": "Storm Type", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 2 }, { "id": "p38.3.4", "order": 13, "type": "table_cell", "bbox": { "l": 236.401455, "t": 661.21453, "r": 262.612998, "b": 650.246371 }, "text": "Curve", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 3 }, { "id": "p38.3.5", "order": 14, "type": "table_cell", "bbox": { "l": 275.757099, "t": 661.21453, "r": 300.337177, "b": 650.246371 }, "text": "Mode", "attrs": { "row": 0, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p38.3.6", "order": 15, "type": "table_cell", "bbox": { "l": 319.972738, "t": 661.21453, "r": 357.113128, "b": 636.566639 }, "text": "Duration (hours)", "attrs": { "row": 0, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p38.3.7", "order": 16, "type": "table_cell", "bbox": { "l": 370.201209, "t": 661.21453, "r": 386.044106, "b": 650.246371 }, "text": "B/B", "attrs": { "row": 0, "col": 6, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p38.3.8", "order": 17, "type": "table_cell", "bbox": { "l": 399.121376, "t": 661.21453, "r": 434.104498, "b": 636.566639 }, "text": "Depth (inches)", "attrs": { "row": 0, "col": 7, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p38.3.9", "order": 18, "type": "table_cell", "bbox": { "l": 447.181767, "t": 661.21453, "r": 469.019806, "b": 650.246371 }, "text": "AMC", "attrs": { "row": 0, "col": 8, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p38.3.10", "order": 19, "type": "table_cell", "bbox": { "l": 92.28, "t": 630.19443, "r": 97.744424, "b": 578.1870739999999 }, "text": "1\n2\n3\n4", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 9 }, { "id": "p38.3.11", "order": 20, "type": "table_cell", "bbox": { "l": 110.818745, "t": 630.19443, "r": 156.706144, "b": 578.1870739999999 }, "text": "2 YEAR\n10 YEAR\n25 year\n100 YEAR", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 10 }, { "id": "p38.3.12", "order": 21, "type": "table_cell", "bbox": { "l": 169.734273, "t": 630.19443, "r": 223.261054, "b": 578.1870739999999 }, "text": "NOAA 24-hr\nNOAA 24-hr\nNOAA 24-hr\nNOAA 24-hr", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 11 }, { "id": "p38.3.13", "order": 22, "type": "table_cell", "bbox": { "l": 236.391396, "t": 630.19443, "r": 243.490233, "b": 578.1870739999999 }, "text": "D\nD\nD\nD", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 12 }, { "id": "p38.3.14", "order": 23, "type": "table_cell", "bbox": { "l": 275.749988, "t": 630.19443, "r": 306.888357, "b": 578.1870739999999 }, "text": "Default\nDefault\nDefault\nDefault", "attrs": { "row": 1, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 13 }, { "id": "p38.3.15", "order": 24, "type": "table_cell", "bbox": { "l": 332.5053, "t": 630.19443, "r": 357.098154, "b": 578.1870739999999 }, "text": "24.00\n24.00\n24.00\n24.00", "attrs": { "row": 1, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 14 }, { "id": "p38.3.16", "order": 25, "type": "table_cell", "bbox": { "l": 370.181321, "t": 630.19443, "r": 375.648693, "b": 578.1870739999999 }, "text": "1\n1\n1\n1", "attrs": { "row": 1, "col": 6, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 15 }, { "id": "p38.3.17", "order": 26, "type": "table_cell", "bbox": { "l": 414.940454, "t": 630.19443, "r": 434.068885, "b": 578.1870739999999 }, "text": "3.42\n5.38\n6.68\n9.48", "attrs": { "row": 1, "col": 7, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 16 }, { "id": "p38.3.18", "order": 27, "type": "table_cell", "bbox": { "l": 447.157949, "t": 630.19443, "r": 452.625321, "b": 578.1870739999999 }, "text": "2\n2\n2\n2", "attrs": { "row": 1, "col": 8, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 17 } ], "reading_order": 2 } ] }, { "document_id": 11809, "page": 39, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 10, "counts_by_type": { "header": 2, "heading": 1, "table": 1, "table_cell": 6 }, "build_ms": 1, "items": [ { "id": "p39.1", "order": 1, "type": "header", "bbox": { "l": 51.6, "t": 738.24, "r": 391.92, "b": 698.64 }, "text": "POST DEV\nPrepared by Professional Design Services\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p39.2", "order": 2, "type": "header", "bbox": { "l": 461.52, "t": 724.56, "r": 560.16, "b": 698.88 }, "text": "Printed 12/31/2025\nPage 3", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p39.3", "order": 3, "type": "heading", "bbox": { "l": 240.96, "t": 687.36, "r": 373.68, "b": 672.48 }, "text": "Area Listing (all nodes)", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 2 }, { "id": "p39.4", "order": 4, "type": "table", "bbox": { "l": 52.32, "t": 663.12, "r": 397.68, "b": 576 }, "text": "", "attrs": { "block_label": "table", "n_rows": 2, "n_cols": 3, "integrity": { "cells_checked": 6, "cells_flagged": 0 } }, "children": [ { "id": "p39.4.1", "order": 5, "type": "table_cell", "bbox": { "l": 97.620155, "t": 661.21453, "r": 128.276947, "b": 636.566639 }, "text": "Area (acres)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 0 }, { "id": "p39.4.2", "order": 6, "type": "table_cell", "bbox": { "l": 150.119899, "t": 661.21453, "r": 164.311676, "b": 650.246371 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 1 }, { "id": "p39.4.3", "order": 7, "type": "table_cell", "bbox": { "l": 183.897114, "t": 661.21453, "r": 293.129565, "b": 636.566639 }, "text": "Description (subcatchment-numbers)", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 2 }, { "id": "p39.4.4", "order": 8, "type": "table_cell", "bbox": { "l": 103.68, "t": 630.19443, "r": 128.870403, "b": 578.127122 }, "text": "0.820\n0.790\n0.730\n2.340", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p39.4.5", "order": 9, "type": "table_cell", "bbox": { "l": 153.356131, "t": 630.19443, "r": 164.524784, "b": 578.127122 }, "text": "39\n98\n98\n77", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p39.4.6", "order": 10, "type": "table_cell", "bbox": { "l": 183.893021, "t": 630.19443, "r": 395.020265, "b": 578.127122 }, "text": ">75% Grass cover, Good, HSG A (1S, 6S, 10S)\nPaved parking, HSG A (2S, 11S)\nRoofs, HSG A (5S, 8S)\nTOTAL AREA", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 } ], "reading_order": 3 } ] }, { "document_id": 11809, "page": 40, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 10, "counts_by_type": { "header": 2, "heading": 1, "table": 1, "table_cell": 6 }, "build_ms": 1, "items": [ { "id": "p40.1", "order": 1, "type": "header", "bbox": { "l": 51.6, "t": 737.76, "r": 392.16, "b": 698.64 }, "text": "POST DEV\nPrepared by Professional Design Services\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p40.2", "order": 2, "type": "header", "bbox": { "l": 461.28, "t": 724.56, "r": 559.92, "b": 699.12 }, "text": "Printed 12/31/2025\nPage 4", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p40.3", "order": 3, "type": "heading", "bbox": { "l": 243.12, "t": 687.6, "r": 371.04, "b": 672.48 }, "text": "Soil Listing (all nodes)", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 2 }, { "id": "p40.4", "order": 4, "type": "table", "bbox": { "l": 51.6, "t": 663.84, "r": 330.72, "b": 549.36 }, "text": "", "attrs": { "block_label": "table", "n_rows": 2, "n_cols": 3, "integrity": { "cells_checked": 5, "cells_flagged": 0 } }, "children": [ { "id": "p40.4.1", "order": 5, "type": "table_cell", "bbox": { "l": 97.620155, "t": 661.21453, "r": 128.276947, "b": 564.507341 }, "text": "Area (acres)\n2.340\n0.000\n0.000\n0.000\n0.000", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p40.4.2", "order": 6, "type": "table_cell", "bbox": { "l": 147.895639, "t": 661.21453, "r": 179.021232, "b": 564.507341 }, "text": "Soil Group\nHSG A\nHSG B\nHSG C\nHSG D\nOther", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p40.4.3", "order": 7, "type": "table_cell", "bbox": { "l": 198.657776, "t": 661.21453, "r": 326.511528, "b": 619.226271 }, "text": "Subcatchment Numbers\n1S, 2S, 5S, 6S, 8S, 10S, 11S", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p40.4.4", "order": 8, "type": "table_cell", "bbox": { "l": 104.280497, "t": 561.735817, "r": 128.870403, "b": 550.767658 }, "text": "2.340", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 3 }, { "id": "p40.4.5", "order": 9, "type": "table_cell", "bbox": { "l": 144.64, "t": 565.7143, "r": 237.68, "b": 549.36 }, "text": "", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1 }, "reading_order": 4 }, { "id": "p40.4.6", "order": 10, "type": "table_cell", "bbox": { "l": 198.656793, "t": 561.735817, "r": 261.989069, "b": 550.767658 }, "text": "TOTAL AREA", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 } ], "reading_order": 3 } ] }, { "document_id": 11809, "page": 41, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 25, "counts_by_type": { "form_field": 1, "table": 2, "table_cell": 22 }, "build_ms": 2, "items": [ { "id": "p41.1", "order": 1, "type": "table", "bbox": { "l": 52.56, "t": 738.96, "r": 568.32, "b": 697.2 }, "text": "", "attrs": { "block_label": "table", "n_rows": 3, "n_cols": 3, "integrity": { "cells_checked": 5, "cells_flagged": 0 } }, "children": [ { "id": "p41.1.1", "order": 2, "type": "table_cell", "bbox": { "l": 54, "t": 737.984717, "r": 117.280769, "b": 724.019651 }, "text": "POST DEV", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 0 }, { "id": "p41.1.2", "order": 3, "type": "table_cell", "bbox": { "l": 54, "t": 724.06687, "r": 272.267766, "b": 711.061006 }, "text": "Prepared by Professional Design Services", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 1 }, { "id": "p41.1.3", "order": 4, "type": "table_cell", "bbox": { "l": 463.832107, "t": 724.140786, "r": 557.581301, "b": 712.153607 }, "text": "Printed 12/31/2025", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 2 }, { "id": "p41.1.4", "order": 5, "type": "table_cell", "bbox": { "l": 52.56, "t": 711.12, "r": 396.4, "b": 697.2 }, "text": "HydroCAD ○ledR 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 2 }, "children": [ { "id": "p41.1.4.1", "order": 6, "type": "form_field", "bbox": { "l": 95.54, "t": 711.12, "r": 107.54, "b": 699.12 }, "text": "", "attrs": { "field_kind": "radio", "label": "ledR 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions …", "source": "glyph_estimate", "bbox_estimated": true, "row": 2, "col": 0, "rowspan": 1, "colspan": 2, "label_source": "parent_text", "label_ref": "p41.1.4", "text_offset": 9, "text_span": 1 }, "reading_order": 0 } ], "reading_order": 3 }, { "id": "p41.1.5", "order": 7, "type": "table_cell", "bbox": { "l": 523.86, "t": 711.120786, "r": 557.898863, "b": 699.133607 }, "text": "Page 5", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 } ], "reading_order": 0 }, { "id": "p41.2", "order": 8, "type": "table", "bbox": { "l": 51.84, "t": 690, "r": 577.2, "b": 560.88 }, "text": "", "attrs": { "block_label": "table", "n_rows": 3, "n_cols": 8, "integrity": { "cells_checked": 17, "cells_flagged": 0 } }, "children": [ { "id": "p41.2.1", "order": 9, "type": "table_cell", "bbox": { "l": 234.84, "t": 687.04687, "r": 381.190932, "b": 674.041006 }, "text": "Ground Covers (all nodes)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 8, "bbox_refit": true }, "reading_order": 0 }, { "id": "p41.2.2", "order": 10, "type": "table_cell", "bbox": { "l": 77.52, "t": 661.21453, "r": 108.649906, "b": 619.226271 }, "text": "HSG-A (acres)\n0.820", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p41.2.3", "order": 11, "type": "table_cell", "bbox": { "l": 132.179961, "t": 661.21453, "r": 163.305936, "b": 619.226271 }, "text": "HSG-B (acres)\n0.000", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p41.2.4", "order": 12, "type": "table_cell", "bbox": { "l": 186.299376, "t": 661.21453, "r": 217.965515, "b": 619.226271 }, "text": "HSG-C (acres)\n0.000", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p41.2.5", "order": 13, "type": "table_cell", "bbox": { "l": 240.959337, "t": 661.21453, "r": 272.625476, "b": 619.226271 }, "text": "HSG-D (acres)\n0.000", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p41.2.6", "order": 14, "type": "table_cell", "bbox": { "l": 296.639455, "t": 661.21453, "r": 327.274025, "b": 619.226271 }, "text": "Other (acres)\n0.000", "attrs": { "row": 1, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p41.2.7", "order": 15, "type": "table_cell", "bbox": { "l": 351.300399, "t": 661.21453, "r": 381.968002, "b": 619.226271 }, "text": "Total (acres)\n0.820", "attrs": { "row": 1, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p41.2.8", "order": 16, "type": "table_cell", "bbox": { "l": 395.01617, "t": 661.21453, "r": 505.631435, "b": 619.226271 }, "text": "Ground Cover\n>75% Grass cover, Good", "attrs": { "row": 1, "col": 6, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 7 }, { "id": "p41.2.9", "order": 17, "type": "table_cell", "bbox": { "l": 512.493415, "t": 661.21453, "r": 575.341766, "b": 605.5465389999999 }, "text": "Subcatchment Numbers\n1S, 6S, 10S", "attrs": { "row": 1, "col": 7, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 8 }, { "id": "p41.2.10", "order": 18, "type": "table_cell", "bbox": { "l": 84.06, "t": 602.834966, "r": 109.24942, "b": 564.44739 }, "text": "0.790\n0.730\n2.340", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 9 }, { "id": "p41.2.11", "order": 19, "type": "table_cell", "bbox": { "l": 138.71603, "t": 602.834966, "r": 163.90545, "b": 564.44739 }, "text": "0.000\n0.000\n0.000", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 10 }, { "id": "p41.2.12", "order": 20, "type": "table_cell", "bbox": { "l": 193.372059, "t": 602.834966, "r": 218.56148, "b": 564.44739 }, "text": "0.000\n0.000\n0.000", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 11 }, { "id": "p41.2.13", "order": 21, "type": "table_cell", "bbox": { "l": 248.028089, "t": 602.834966, "r": 273.217509, "b": 564.44739 }, "text": "0.000\n0.000\n0.000", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 12 }, { "id": "p41.2.14", "order": 22, "type": "table_cell", "bbox": { "l": 302.684119, "t": 602.834966, "r": 327.873539, "b": 564.44739 }, "text": "0.000\n0.000\n0.000", "attrs": { "row": 2, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 13 }, { "id": "p41.2.15", "order": 23, "type": "table_cell", "bbox": { "l": 357.340149, "t": 602.834966, "r": 382.529569, "b": 564.44739 }, "text": "0.790\n0.730\n2.340", "attrs": { "row": 2, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 14 }, { "id": "p41.2.16", "order": 24, "type": "table_cell", "bbox": { "l": 395.015187, "t": 602.834966, "r": 458.347464, "b": 564.44739 }, "text": "Paved parking\nRoofs\nTOTAL AREA", "attrs": { "row": 2, "col": 6, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 15 }, { "id": "p41.2.17", "order": 25, "type": "table_cell", "bbox": { "l": 512.486535, "t": 602.834966, "r": 547.454915, "b": 578.1870739999999 }, "text": "2S, 11S\n5S, 8S", "attrs": { "row": 2, "col": 7, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 16 } ], "reading_order": 1 } ] }, { "document_id": 11809, "page": 42, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 21, "counts_by_type": { "text": 21 }, "build_ms": 2, "items": [ { "id": "p42.1", "order": 1, "type": "text", "bbox": { "l": 51.36, "t": 738.96, "r": 560.88, "b": 700.8 }, "text": "POST DEV NOAA 24-hr D 2 YEAR Rainfall=3.42\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 6", "reading_order": 0 }, { "id": "p42.2", "order": 2, "type": "text", "bbox": { "l": 120.48, "t": 687.12, "r": 490.32, "b": 651.12 }, "text": "Time span=5.00-20.00 hrs, dt=0.05 hrs, 301 points\nRunoff by SCS TR-20 method, UH=Delmarva, Weighted-CN\nReach routing by Stor-Ind+Trans method - Pond routing by Stor-Ind method", "reading_order": 1 }, { "id": "p42.3", "order": 3, "type": "text", "bbox": { "l": 257.76, "t": 640.08, "r": 560.16, "b": 616.32 }, "text": "Subcatchment1S: POROUS\nRunoff Area=0.570 ac 0.00% Impervious Runoff Depth>0.00\"\nFlow Length=310' Tc=12.9 min CN=39 Runoff=0.00 cfs 0.000 af", "reading_order": 2 }, { "id": "p42.4", "order": 4, "type": "text", "bbox": { "l": 258.96, "t": 605.28, "r": 560.16, "b": 580.8 }, "text": "Runoff Area=0.720 ac 100.00% Impervious Runoff Depth>2.91\" Flow Length=310' Tc=13.1 min CN=98 Runoff=1.36 cfs 0.175 af", "reading_order": 3 }, { "id": "p42.5", "order": 5, "type": "text", "bbox": { "l": 51.6, "t": 604.08, "r": 216.96, "b": 592.08 }, "text": "Subcatchment2S: IMPERVIOUS", "reading_order": 4 }, { "id": "p42.6", "order": 6, "type": "text", "bbox": { "l": 52.32, "t": 568.8, "r": 559.92, "b": 546 }, "text": "Subcatchment5S: IMPERVIOUS Runoff Area=0.270 ac 100.00% Impervious Runoff Depth>2.92\" Flow Length=180' Slope=0.0100'/' Tc=1.6 min CN=98 Runoff=0.93 cfs 0.066 af", "reading_order": 5 }, { "id": "p42.7", "order": 7, "type": "text", "bbox": { "l": 277.2, "t": 533.28, "r": 559.92, "b": 522 }, "text": "Subcatchment6S: POROUS\nRunoff Area=0.190 ac 0.00% Impervious Runoff Depth>0.00\"", "reading_order": 6 }, { "id": "p42.8", "order": 8, "type": "text", "bbox": { "l": 256.8, "t": 520.8, "r": 560.16, "b": 509.28 }, "text": "Flow Length=250' Tc=12.4 min CN=39 Runoff=0.00 cfs 0.000 af", "reading_order": 7 }, { "id": "p42.9", "order": 9, "type": "text", "bbox": { "l": 52.56, "t": 497.28, "r": 560.4, "b": 473.76 }, "text": "Subcatchment8S: PROP WAREHOUSE Runoff Area=0.460 ac 100.00% Impervious Runoff Depth>2.92\" Flow Length=280' Slope=0.0100'/' Tc=2.6 min CN=98 Runoff=1.48 cfs 0.112 af", "reading_order": 8 }, { "id": "p42.10", "order": 10, "type": "text", "bbox": { "l": 52.56, "t": 462.48, "r": 560.16, "b": 440.16 }, "text": "Runoff Area=0.060 ac 0.00% Impervious Runoff Depth>0.00\"\nTc=2.0 min CN=39 Runoff=0.00 cfs 0.000 af", "reading_order": 9 }, { "id": "p42.11", "order": 11, "type": "text", "bbox": { "l": 51.6, "t": 461.52, "r": 251.76, "b": 449.52 }, "text": "Subcatchment10S: BY-PASS POROUS", "reading_order": 10 }, { "id": "p42.12", "order": 12, "type": "text", "bbox": { "l": 52.32, "t": 426.24, "r": 559.2, "b": 403.2 }, "text": "Runoff Area=0.070 ac 100.00% Impervious Runoff Depth>2.92\"\nTc=2.0 min CN=98 Runoff=0.24 cfs 0.017 af", "reading_order": 11 }, { "id": "p42.13", "order": 13, "type": "text", "bbox": { "l": 51.6, "t": 425.52, "r": 203.76, "b": 413.76 }, "text": "Subcatchment11S: BY-PASS", "reading_order": 12 }, { "id": "p42.14", "order": 14, "type": "text", "bbox": { "l": 51.6, "t": 390, "r": 172.8, "b": 378.48 }, "text": "Reach 10: COMPOSITE", "reading_order": 13 }, { "id": "p42.15", "order": 15, "type": "text", "bbox": { "l": 446.4, "t": 390.96, "r": 559.92, "b": 379.44 }, "text": "Inflow=0.24 cfs 0.040 af", "reading_order": 14 }, { "id": "p42.16", "order": 16, "type": "text", "bbox": { "l": 440.64, "t": 378, "r": 560.4, "b": 366.72 }, "text": "Outflow=0.24 cfs 0.040 af", "reading_order": 15 }, { "id": "p42.17", "order": 17, "type": "text", "bbox": { "l": 52.56, "t": 355.2, "r": 559.68, "b": 330.72 }, "text": "Pond 3P: SSIB #1 SURFACE BASIN Peak Elevation=111.65' Storage=3,983 cfs Inflow=1.36 cfs 0.175 af Discarded=0.09 cfs 0.081 af Primary=0.19 cfs 0.023 af Outflow=0.28 cfs 0.104 af", "reading_order": 16 }, { "id": "p42.18", "order": 18, "type": "text", "bbox": { "l": 51.36, "t": 319.44, "r": 559.44, "b": 307.44 }, "text": "Pond 8P: SSIB #2 UNDERGROUND Peak Elev=108.37' Storage=0.025 af Inflow=0.93 cfs 0.066 af", "reading_order": 17 }, { "id": "p42.19", "order": 19, "type": "text", "bbox": { "l": 182.4, "t": 306.48, "r": 559.44, "b": 295.68 }, "text": "Discarded=0.09 cfs 0.065 af Primary=0.00 cfs 0.000 af Outflow=0.09 cfs 0.065 af", "reading_order": 18 }, { "id": "p42.20", "order": 20, "type": "text", "bbox": { "l": 53.04, "t": 283.2, "r": 560.4, "b": 259.44 }, "text": "Pond 9P: SSIB #3 UNDERGROUND Peak Elev=111.92' Storage=0.047 af Inflow=1.48 cfs 0.112 af Discarded=0.12 cfs 0.102 af Primary=0.00 cfs 0.000 af Outflow=0.12 cfs 0.102 af", "reading_order": 19 }, { "id": "p42.21", "order": 21, "type": "text", "bbox": { "l": 122.64, "t": 247.44, "r": 568.32, "b": 224.16 }, "text": "Total Runoff Area = 2.340 ac Runoff Volume = 0.369 af Average Runoff Depth = 1.89\"\n35.04% Pervious = 0.820 ac 64.96% Impervious = 1.520 ac", "reading_order": 20 } ] }, { "document_id": 11809, "page": 43, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 51, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "table": 1, "table_cell": 43, "text": 3, "title": 1 }, "build_ms": 5, "items": [ { "id": "p43.1", "order": 1, "type": "header", "bbox": { "l": 52.8, "t": 738.72, "r": 561.36, "b": 698.88 }, "text": "POST DEV NOAA 24-hr D 2 YEAR Rainfall=3.42\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 7", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p43.2", "order": 2, "type": "title", "bbox": { "l": 183.6, "t": 687.36, "r": 434.4, "b": 672.48 }, "text": "Summary for Subcatchment 1S: POROUS", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p43.3", "order": 3, "type": "text", "bbox": { "l": 51.84, "t": 659.28, "r": 274.08, "b": 646.08 }, "text": "[73] Warning: Peak may fall outside time span", "reading_order": 2 }, { "id": "p43.4", "order": 4, "type": "text", "bbox": { "l": 52.32, "t": 636.72, "r": 463.2, "b": 610.56 }, "text": "Runoff = 0.00 cfs @ 20.00 hrs, Volume= 0.000 af, Depth> 0.00\"\nRouted to Pond 3P : SSIB #1 SURFACE BASIN", "reading_order": 3 }, { "id": "p43.5", "order": 5, "type": "text", "bbox": { "l": 52.08, "t": 600.72, "r": 541.44, "b": 575.04 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Weighted-CN, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs NOAA 24-hr D 2 YEAR Rainfall=3.42\"", "reading_order": 4 }, { "id": "p43.6", "order": 6, "type": "table", "bbox": { "l": 52.56, "t": 566.4, "r": 559.2, "b": 413.04 }, "text": "", "attrs": { "block_label": "table", "n_rows": 8, "n_cols": 7, "integrity": { "cells_checked": 32, "cells_flagged": 2, "flags": [ { "row": 1, "col": 4, "coverage": 0, "text": "Grass cover, Good, HSG A" }, { "row": 2, "col": 4, "coverage": 0, "text": "Pervious Area" } ] } }, "children": [ { "id": "p43.6.1", "order": 7, "type": "table_cell", "bbox": { "l": 69.659595, "t": 564.242748, "r": 113.82741, "b": 552.255569 }, "text": "Area (ac)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p43.6.2", "order": 8, "type": "table_cell", "bbox": { "l": 130.796358, "t": 564.242748, "r": 146.30665, "b": 552.255569 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p43.6.3", "order": 9, "type": "table_cell", "bbox": { "l": 289.05701, "t": 512.881252, "r": 342.773751, "b": 500.894072 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p43.6.4", "order": 10, "type": "table_cell", "bbox": { "l": 52.56, "t": 547.23, "r": 124.9371, "b": 528.06 }, "text": "", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 3 }, { "id": "p43.6.5", "order": 11, "type": "table_cell", "bbox": { "l": 87, "t": 550.440786, "r": 113.874482, "b": 538.453607 }, "text": "0.570", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p43.6.6", "order": 12, "type": "table_cell", "bbox": { "l": 134.275244, "t": 550.440786, "r": 146.219458, "b": 538.453607 }, "text": "39", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p43.6.7", "order": 13, "type": "table_cell", "bbox": { "l": 160.552515, "t": 550.440786, "r": 188.318517, "b": 538.453607 }, "text": ">75%", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p43.6.8", "order": 14, "type": "table_cell", "bbox": { "l": 342.0686, "t": 547.23, "r": 559.2, "b": 528.06 }, "text": "Grass cover, Good, HSG A", "attrs": { "row": 1, "col": 4, "rowspan": 1, "colspan": 3 }, "reading_order": 7 }, { "id": "p43.6.9", "order": 15, "type": "table_cell", "bbox": { "l": 52.56, "t": 528.06, "r": 124.9371, "b": 508.89 }, "text": "", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 8 }, { "id": "p43.6.10", "order": 16, "type": "table_cell", "bbox": { "l": 87, "t": 536.6407859999999, "r": 113.874482, "b": 524.653607 }, "text": "0.570", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p43.6.11", "order": 17, "type": "table_cell", "bbox": { "l": 197.3143, "t": 528.06, "r": 269.6914, "b": 508.89 }, "text": "", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 10 }, { "id": "p43.6.12", "order": 18, "type": "table_cell", "bbox": { "l": 160.555738, "t": 536.6407859999999, "r": 202.951254, "b": 524.653607 }, "text": "100.00%", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 }, { "id": "p43.6.13", "order": 19, "type": "table_cell", "bbox": { "l": 342.0686, "t": 528.06, "r": 559.2, "b": 508.89 }, "text": "Pervious Area", "attrs": { "row": 2, "col": 4, "rowspan": 1, "colspan": 3 }, "reading_order": 12 }, { "id": "p43.6.14", "order": 20, "type": "table_cell", "bbox": { "l": 65.459598, "t": 512.881252, "r": 89.993572, "b": 489.014305 }, "text": "Tc (min)", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p43.6.15", "order": 21, "type": "table_cell", "bbox": { "l": 100.682141, "t": 512.881252, "r": 133.545916, "b": 489.014305 }, "text": "Length (feet)", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p43.6.16", "order": 22, "type": "table_cell", "bbox": { "l": 149.815612, "t": 512.881252, "r": 177.28086, "b": 489.014305 }, "text": "Slope (ft/ft)", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p43.6.17", "order": 23, "type": "table_cell", "bbox": { "l": 188.028505, "t": 512.881252, "r": 225.633446, "b": 489.014305 }, "text": "Velocity (ft/sec)", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p43.6.18", "order": 24, "type": "table_cell", "bbox": { "l": 236.50354, "t": 512.881252, "r": 278.288957, "b": 489.014305 }, "text": "Capacity (cfs)", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p43.6.19", "order": 25, "type": "table_cell", "bbox": { "l": 160.552704, "t": 564.242748, "r": 214.269445, "b": 552.255569 }, "text": "Description", "attrs": { "row": 3, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 18 }, { "id": "p43.6.20", "order": 26, "type": "table_cell", "bbox": { "l": 69, "t": 487.200786, "r": 89.902375, "b": 475.213607 }, "text": "11.7", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p43.6.21", "order": 27, "type": "table_cell", "bbox": { "l": 115.676959, "t": 487.200786, "r": 133.59328, "b": 475.213607 }, "text": "100", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p43.6.22", "order": 28, "type": "table_cell", "bbox": { "l": 144.351666, "t": 487.200786, "r": 177.198256, "b": 475.213607 }, "text": "0.0300", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p43.6.23", "order": 29, "type": "table_cell", "bbox": { "l": 204.705395, "t": 487.200786, "r": 225.60777, "b": 475.213607 }, "text": "0.14", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 22 }, { "id": "p43.6.24", "order": 30, "type": "table_cell", "bbox": { "l": 342.0686, "t": 489.72, "r": 414.4457, "b": 470.55 }, "text": "", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 23 }, { "id": "p43.6.25", "order": 31, "type": "table_cell", "bbox": { "l": 289.079669, "t": 487.020334, "r": 461.873354, "b": 439.572157 }, "text": "Sheet Flow,\\nGrass: Dense n= 0.240 P2= 3.42\"\\nShallow Concentrated Flow,\\nGrassed Waterway Kv= 15.0 fps", "attrs": { "row": 4, "col": 5, "rowspan": 2, "colspan": 2, "bbox_refit": true }, "reading_order": 24 }, { "id": "p43.6.26", "order": 32, "type": "table_cell", "bbox": { "l": 75.000034, "t": 463.440177, "r": 89.930302, "b": 451.452998 }, "text": "0.3", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 25 }, { "id": "p43.6.27", "order": 33, "type": "table_cell", "bbox": { "l": 121.678067, "t": 463.440177, "r": 133.622282, "b": 451.452998 }, "text": "50", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 26 }, { "id": "p43.6.28", "order": 34, "type": "table_cell", "bbox": { "l": 144.354889, "t": 463.440177, "r": 177.201478, "b": 451.452998 }, "text": "0.0350", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 27 }, { "id": "p43.6.29", "order": 35, "type": "table_cell", "bbox": { "l": 204.708617, "t": 463.440177, "r": 225.610992, "b": 451.452998 }, "text": "2.81", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 28 }, { "id": "p43.6.30", "order": 36, "type": "table_cell", "bbox": { "l": 342.0686, "t": 470.55, "r": 414.4457, "b": 451.38 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 29 }, { "id": "p43.6.31", "order": 37, "type": "table_cell", "bbox": { "l": 75.000034, "t": 439.679569, "r": 89.930302, "b": 427.69239 }, "text": "0.9", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 30 }, { "id": "p43.6.32", "order": 38, "type": "table_cell", "bbox": { "l": 115.679107, "t": 439.679569, "r": 133.595429, "b": 427.69239 }, "text": "160", "attrs": { "row": 6, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 31 }, { "id": "p43.6.33", "order": 39, "type": "table_cell", "bbox": { "l": 197.3143, "t": 451.38, "r": 269.6914, "b": 432.21 }, "text": "", "attrs": { "row": 6, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 32 }, { "id": "p43.6.34", "order": 40, "type": "table_cell", "bbox": { "l": 204.713988, "t": 439.679569, "r": 225.616363, "b": 427.69239 }, "text": "3.00", "attrs": { "row": 6, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 33 }, { "id": "p43.6.35", "order": 41, "type": "table_cell", "bbox": { "l": 342.0686, "t": 451.38, "r": 414.4457, "b": 432.21 }, "text": "", "attrs": { "row": 6, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 34 }, { "id": "p43.6.36", "order": 42, "type": "table_cell", "bbox": { "l": 289.079669, "t": 439.499117, "r": 415.020239, "b": 427.511938 }, "text": "Direct Entry, PIPE FLOW", "attrs": { "row": 6, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 35 }, { "id": "p43.6.37", "order": 43, "type": "table_cell", "bbox": { "l": 69, "t": 425.880786, "r": 89.902375, "b": 413.893607 }, "text": "12.9", "attrs": { "row": 7, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 36 }, { "id": "p43.6.38", "order": 44, "type": "table_cell", "bbox": { "l": 115.676959, "t": 425.880786, "r": 133.59328, "b": 413.893607 }, "text": "310", "attrs": { "row": 7, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 37 }, { "id": "p43.6.39", "order": 45, "type": "table_cell", "bbox": { "l": 144.351666, "t": 425.880786, "r": 168.229354, "b": 413.893607 }, "text": "Total", "attrs": { "row": 7, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 38 }, { "id": "p43.6.40", "order": 46, "type": "table_cell", "bbox": { "l": 269.6914, "t": 432.21, "r": 342.0686, "b": 413.04 }, "text": "", "attrs": { "row": 7, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 39 }, { "id": "p43.6.41", "order": 47, "type": "table_cell", "bbox": { "l": 342.0686, "t": 432.21, "r": 414.4457, "b": 413.04 }, "text": "", "attrs": { "row": 7, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 40 }, { "id": "p43.6.42", "order": 48, "type": "table_cell", "bbox": { "l": 414.4457, "t": 432.21, "r": 486.8229, "b": 413.04 }, "text": "", "attrs": { "row": 7, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 41 }, { "id": "p43.6.43", "order": 49, "type": "table_cell", "bbox": { "l": 486.8229, "t": 432.21, "r": 559.2, "b": 413.04 }, "text": "", "attrs": { "row": 7, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 42 } ], "reading_order": 5 }, { "id": "p43.7", "order": 50, "type": "caption", "bbox": { "l": 222.48, "t": 401.52, "r": 393.36, "b": 386.88 }, "text": "Subcatchment 1S: POROUS", "attrs": { "block_label": "figure_title" }, "reading_order": 6 }, { "id": "p43.8", "order": 51, "type": "figure", "bbox": { "l": 62.88, "t": 380.88, "r": 548.88, "b": 114.24 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n0.000 Runoff\n0.000 0.00 cfs\n0.000 NOAA 24-hr D\n0.000\n0.000 2 YEAR Rainfall=3.42\"\n0.000 Runoff Area=0.570 ac\n0.000\nRunoff Volume=0.000 af\n0.000\n0.000\n(cfs) 0.000 Runoff Depth>0.00\"\n0.000\nFlow 0.000 Flow Length=310'\n0.000 Tc=12.9 min\n0.000\nCN=39\n0.000\n0.000\n0\n0\n0\n0\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 7 } ] }, { "document_id": 11809, "page": 44, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 43, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "table": 1, "table_cell": 36, "text": 2, "title": 1 }, "build_ms": 4, "items": [ { "id": "p44.1", "order": 1, "type": "header", "bbox": { "l": 52.56, "t": 738.72, "r": 560.88, "b": 698.64 }, "text": "POST DEV NOAA 24-hr D 2 YEAR Rainfall=3.42\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 8", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p44.2", "order": 2, "type": "title", "bbox": { "l": 171.84, "t": 687.36, "r": 447.12, "b": 672.72 }, "text": "Summary for Subcatchment 2S: IMPERVIOUS", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p44.3", "order": 3, "type": "text", "bbox": { "l": 52.56, "t": 660, "r": 464.16, "b": 634.08 }, "text": "Runoff = 1.36 cfs @ 12.22 hrs, Volume= 0.175 af, Depth> 2.91\"\nRouted to Pond 3P : SSIB #1 SURFACE BASIN", "reading_order": 2 }, { "id": "p44.4", "order": 4, "type": "text", "bbox": { "l": 52.08, "t": 624.48, "r": 541.44, "b": 598.56 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Weighted-CN, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs NOAA 24-hr D 2 YEAR Rainfall=3.42\"", "reading_order": 3 }, { "id": "p44.5", "order": 5, "type": "table", "bbox": { "l": 52.32, "t": 590.16, "r": 559.2, "b": 436.56 }, "text": "", "attrs": { "block_label": "table", "n_rows": 7, "n_cols": 7, "integrity": { "cells_checked": 28, "cells_flagged": 0 } }, "children": [ { "id": "p44.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 69.659595, "t": 588.002283, "r": 113.82741, "b": 576.0151040000001 }, "text": "Area (ac)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p44.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 130.796358, "t": 588.002283, "r": 146.30665, "b": 576.0151040000001 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p44.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 289.05701, "t": 536.641352, "r": 342.773751, "b": 524.654172 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p44.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 87, "t": 574.200786, "r": 113.874482, "b": 548.4137069999999 }, "text": "0.720\n0.720", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p44.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 134.275244, "t": 574.200786, "r": 284.133244, "b": 548.4137069999999 }, "text": "98\n100.00% Impervious Area", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p44.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 160.552515, "t": 574.200786, "r": 268.608987, "b": 562.213607 }, "text": "Paved parking, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true }, "reading_order": 5 }, { "id": "p44.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 65.459598, "t": 536.641352, "r": 89.993572, "b": 512.774405 }, "text": "Tc\\n(min)", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p44.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 100.682141, "t": 536.641352, "r": 133.545916, "b": 512.774405 }, "text": "Length\\n(feet)", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p44.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 149.815612, "t": 536.641352, "r": 177.28086, "b": 512.774405 }, "text": "Slope\\n(ft/ft)", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p44.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 188.028505, "t": 536.641352, "r": 225.633446, "b": 512.774405 }, "text": "Velocity\\n(ft/sec)", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p44.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 236.50354, "t": 536.641352, "r": 278.288957, "b": 512.774405 }, "text": "Capacity\\n(cfs)", "attrs": { "row": 2, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p44.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 160.552704, "t": 588.002283, "r": 214.269445, "b": 576.0151040000001 }, "text": "Description", "attrs": { "row": 2, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 11 }, { "id": "p44.5.13", "order": 18, "type": "table_cell", "bbox": { "l": 69, "t": 510.960886, "r": 89.902375, "b": 498.973707 }, "text": "11.7", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 12 }, { "id": "p44.5.14", "order": 19, "type": "table_cell", "bbox": { "l": 115.676959, "t": 510.960886, "r": 133.59328, "b": 498.973707 }, "text": "100", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p44.5.15", "order": 20, "type": "table_cell", "bbox": { "l": 144.351666, "t": 510.960886, "r": 177.198256, "b": 498.973707 }, "text": "0.0300", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p44.5.16", "order": 21, "type": "table_cell", "bbox": { "l": 204.705395, "t": 510.960886, "r": 225.60777, "b": 498.973707 }, "text": "0.14", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p44.5.17", "order": 22, "type": "table_cell", "bbox": { "l": 341.9657, "t": 513.36, "r": 414.3771, "b": 494.16 }, "text": "", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 16 }, { "id": "p44.5.18", "order": 23, "type": "table_cell", "bbox": { "l": 289.079669, "t": 510.780434, "r": 461.873354, "b": 463.332257 }, "text": "Sheet Flow,\\nGrass: Dense n= 0.240 P2= 3.42\"\\nShallow Concentrated Flow,\\nGrassed Waterway Kv= 15.0 fps", "attrs": { "row": 3, "col": 5, "rowspan": 2, "colspan": 2, "bbox_refit": true }, "reading_order": 17 }, { "id": "p44.5.19", "order": 24, "type": "table_cell", "bbox": { "l": 75.000034, "t": 487.200277, "r": 89.930302, "b": 475.213098 }, "text": "0.5", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p44.5.20", "order": 25, "type": "table_cell", "bbox": { "l": 121.678067, "t": 487.200277, "r": 133.622282, "b": 475.213098 }, "text": "50", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p44.5.21", "order": 26, "type": "table_cell", "bbox": { "l": 144.354889, "t": 487.200277, "r": 177.201478, "b": 475.213098 }, "text": "0.0110", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p44.5.22", "order": 27, "type": "table_cell", "bbox": { "l": 204.708617, "t": 487.200277, "r": 225.610992, "b": 475.213098 }, "text": "1.57", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p44.5.23", "order": 28, "type": "table_cell", "bbox": { "l": 341.9657, "t": 494.16, "r": 414.3771, "b": 474.96 }, "text": "", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 22 }, { "id": "p44.5.24", "order": 29, "type": "table_cell", "bbox": { "l": 75.000034, "t": 463.439669, "r": 89.930302, "b": 451.45249 }, "text": "0.9", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 23 }, { "id": "p44.5.25", "order": 30, "type": "table_cell", "bbox": { "l": 115.679107, "t": 463.439669, "r": 133.595429, "b": 451.45249 }, "text": "160", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 24 }, { "id": "p44.5.26", "order": 31, "type": "table_cell", "bbox": { "l": 197.1429, "t": 474.96, "r": 269.5543, "b": 455.76 }, "text": "", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 25 }, { "id": "p44.5.27", "order": 32, "type": "table_cell", "bbox": { "l": 204.713988, "t": 463.439669, "r": 225.616363, "b": 451.45249 }, "text": "3.00", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 26 }, { "id": "p44.5.28", "order": 33, "type": "table_cell", "bbox": { "l": 341.9657, "t": 474.96, "r": 414.3771, "b": 455.76 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 27 }, { "id": "p44.5.29", "order": 34, "type": "table_cell", "bbox": { "l": 289.079669, "t": 463.259217, "r": 415.020239, "b": 451.272038 }, "text": "Direct Entry, PIPE FLOW", "attrs": { "row": 5, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 28 }, { "id": "p44.5.30", "order": 35, "type": "table_cell", "bbox": { "l": 69, "t": 449.640786, "r": 89.902375, "b": 437.653607 }, "text": "13.1", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 29 }, { "id": "p44.5.31", "order": 36, "type": "table_cell", "bbox": { "l": 115.676959, "t": 449.640786, "r": 133.59328, "b": 437.653607 }, "text": "310", "attrs": { "row": 6, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 30 }, { "id": "p44.5.32", "order": 37, "type": "table_cell", "bbox": { "l": 144.351666, "t": 449.640786, "r": 168.229354, "b": 437.653607 }, "text": "Total", "attrs": { "row": 6, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 31 }, { "id": "p44.5.33", "order": 38, "type": "table_cell", "bbox": { "l": 269.5543, "t": 455.76, "r": 341.9657, "b": 436.56 }, "text": "", "attrs": { "row": 6, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 32 }, { "id": "p44.5.34", "order": 39, "type": "table_cell", "bbox": { "l": 341.9657, "t": 455.76, "r": 414.3771, "b": 436.56 }, "text": "", "attrs": { "row": 6, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 33 }, { "id": "p44.5.35", "order": 40, "type": "table_cell", "bbox": { "l": 414.3771, "t": 455.76, "r": 486.7886, "b": 436.56 }, "text": "", "attrs": { "row": 6, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 34 }, { "id": "p44.5.36", "order": 41, "type": "table_cell", "bbox": { "l": 486.7886, "t": 455.76, "r": 559.2, "b": 436.56 }, "text": "", "attrs": { "row": 6, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 35 } ], "reading_order": 4 }, { "id": "p44.6", "order": 42, "type": "caption", "bbox": { "l": 210.48, "t": 425.52, "r": 405.6, "b": 410.4 }, "text": "Subcatchment 2S: IMPERVIOUS", "attrs": { "block_label": "figure_title" }, "reading_order": 5 }, { "id": "p44.7", "order": 43, "type": "figure", "bbox": { "l": 60.96, "t": 410.16, "r": 553.68, "b": 136.32 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nRunoff\n1.36 cfs\nNOAA 24-hr D\n2 YEAR Rainfall=3.42\"\nRunoff Area=0.720 ac\n1\nRunoff Volume=0.175 af\n(cfs) Runoff Depth>2.91\"\nFlow Flow Length=310'\nTc=13.1 min\nCN=98\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 6 } ] }, { "document_id": 11809, "page": 45, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 41, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "table": 1, "table_cell": 33, "text": 3, "title": 1 }, "build_ms": 3, "items": [ { "id": "p45.1", "order": 1, "type": "header", "bbox": { "l": 52.8, "t": 738.48, "r": 560.88, "b": 698.88 }, "text": "POST DEV NOAA 24-hr D 2 YEAR Rainfall=3.42\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 9", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p45.2", "order": 2, "type": "title", "bbox": { "l": 171.84, "t": 687.36, "r": 446.88, "b": 672.48 }, "text": "Summary for Subcatchment 5S: IMPERVIOUS", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p45.3", "order": 3, "type": "text", "bbox": { "l": 51.84, "t": 659.52, "r": 245.04, "b": 646.32 }, "text": "[49] Hint: Tc<2dt may require smaller dt", "reading_order": 2 }, { "id": "p45.4", "order": 4, "type": "text", "bbox": { "l": 52.08, "t": 636.48, "r": 463.44, "b": 610.56 }, "text": "Runoff = 0.93 cfs @ 12.08 hrs, Volume= 0.066 af, Depth> 2.92\"\nRouted to Pond 8P : SSIB #2 UNDERGROUND", "reading_order": 3 }, { "id": "p45.5", "order": 5, "type": "text", "bbox": { "l": 52.08, "t": 600.72, "r": 541.68, "b": 574.8 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Weighted-CN, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs NOAA 24-hr D 2 YEAR Rainfall=3.42\"", "reading_order": 4 }, { "id": "p45.6", "order": 6, "type": "table", "bbox": { "l": 52.56, "t": 565.44, "r": 559.44, "b": 437.28 }, "text": "", "attrs": { "block_label": "table", "n_rows": 7, "n_cols": 6, "integrity": { "cells_checked": 27, "cells_flagged": 1, "flags": [ { "row": 2, "col": 2, "coverage": 0, "text": "Impervious Area" } ] } }, "children": [ { "id": "p45.6.1", "order": 7, "type": "table_cell", "bbox": { "l": 69.659595, "t": 564.242748, "r": 113.82741, "b": 552.255569 }, "text": "Area (ac)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p45.6.2", "order": 8, "type": "table_cell", "bbox": { "l": 130.796358, "t": 564.242748, "r": 146.30665, "b": 552.255569 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p45.6.3", "order": 9, "type": "table_cell", "bbox": { "l": 289.05701, "t": 512.881252, "r": 342.773751, "b": 500.894072 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p45.6.4", "order": 10, "type": "table_cell", "bbox": { "l": 87, "t": 550.440786, "r": 113.874482, "b": 538.453607 }, "text": "0.270", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 3 }, { "id": "p45.6.5", "order": 11, "type": "table_cell", "bbox": { "l": 134.275244, "t": 550.440786, "r": 146.219458, "b": 538.453607 }, "text": "98", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p45.6.6", "order": 12, "type": "table_cell", "bbox": { "l": 160.552515, "t": 550.440786, "r": 228.007251, "b": 538.453607 }, "text": "Roofs, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true }, "reading_order": 5 }, { "id": "p45.6.7", "order": 13, "type": "table_cell", "bbox": { "l": 87, "t": 536.6407859999999, "r": 113.874482, "b": 524.653607 }, "text": "0.270", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p45.6.8", "order": 14, "type": "table_cell", "bbox": { "l": 160.555738, "t": 536.6407859999999, "r": 202.951254, "b": 524.653607 }, "text": "100.00%", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p45.6.9", "order": 15, "type": "table_cell", "bbox": { "l": 221.52, "t": 528.8229, "r": 559.44, "b": 510.5143 }, "text": "Impervious Area", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 4 }, "reading_order": 8 }, { "id": "p45.6.10", "order": 16, "type": "table_cell", "bbox": { "l": 65.459598, "t": 512.881252, "r": 89.993572, "b": 489.014305 }, "text": "Tc (min)", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p45.6.11", "order": 17, "type": "table_cell", "bbox": { "l": 100.682141, "t": 512.881252, "r": 133.545916, "b": 489.014305 }, "text": "Length (feet)", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p45.6.12", "order": 18, "type": "table_cell", "bbox": { "l": 149.815612, "t": 512.881252, "r": 177.28086, "b": 489.014305 }, "text": "Slope (ft/ft)", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 }, { "id": "p45.6.13", "order": 19, "type": "table_cell", "bbox": { "l": 188.028505, "t": 512.881252, "r": 225.633446, "b": 489.014305 }, "text": "Velocity (ft/sec)", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 12 }, { "id": "p45.6.14", "order": 20, "type": "table_cell", "bbox": { "l": 236.50354, "t": 512.881252, "r": 278.288957, "b": 489.014305 }, "text": "Capacity (cfs)", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p45.6.15", "order": 21, "type": "table_cell", "bbox": { "l": 160.552704, "t": 564.242748, "r": 214.269445, "b": 552.255569 }, "text": "Description", "attrs": { "row": 3, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p45.6.16", "order": 22, "type": "table_cell", "bbox": { "l": 75, "t": 487.200786, "r": 89.930268, "b": 475.213607 }, "text": "0.9", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p45.6.17", "order": 23, "type": "table_cell", "bbox": { "l": 121.678033, "t": 487.200786, "r": 133.622247, "b": 475.213607 }, "text": "50", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p45.6.18", "order": 24, "type": "table_cell", "bbox": { "l": 144.354854, "t": 487.200786, "r": 177.201444, "b": 475.213607 }, "text": "0.0100", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p45.6.19", "order": 25, "type": "table_cell", "bbox": { "l": 204.708583, "t": 487.200786, "r": 225.610958, "b": 475.213607 }, "text": "0.94", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p45.6.20", "order": 26, "type": "table_cell", "bbox": { "l": 390.48, "t": 492.2057, "r": 474.96, "b": 473.8971 }, "text": "", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 19 }, { "id": "p45.6.21", "order": 27, "type": "table_cell", "bbox": { "l": 289.079635, "t": 487.020334, "r": 476.803587, "b": 463.332765 }, "text": "Sheet Flow, Smooth surfaces n= 0.011 P2= 3.42\"", "attrs": { "row": 4, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p45.6.22", "order": 28, "type": "table_cell", "bbox": { "l": 75, "t": 463.440177, "r": 89.930268, "b": 451.452998 }, "text": "0.7", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p45.6.23", "order": 29, "type": "table_cell", "bbox": { "l": 115.679073, "t": 463.440177, "r": 133.595394, "b": 451.452998 }, "text": "130", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 22 }, { "id": "p45.6.24", "order": 30, "type": "table_cell", "bbox": { "l": 221.52, "t": 473.8971, "r": 306, "b": 455.5886 }, "text": "", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 23 }, { "id": "p45.6.25", "order": 31, "type": "table_cell", "bbox": { "l": 204.713954, "t": 463.440177, "r": 225.616329, "b": 451.452998 }, "text": "3.00", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 24 }, { "id": "p45.6.26", "order": 32, "type": "table_cell", "bbox": { "l": 390.48, "t": 473.8971, "r": 474.96, "b": 455.5886 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 25 }, { "id": "p45.6.27", "order": 33, "type": "table_cell", "bbox": { "l": 289.079635, "t": 463.259725, "r": 415.020205, "b": 451.272546 }, "text": "Direct Entry, PIPE FLOW", "attrs": { "row": 5, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 26 }, { "id": "p45.6.28", "order": 34, "type": "table_cell", "bbox": { "l": 75, "t": 449.640786, "r": 89.930268, "b": 437.653607 }, "text": "1.6", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 27 }, { "id": "p45.6.29", "order": 35, "type": "table_cell", "bbox": { "l": 115.679073, "t": 449.640786, "r": 133.595394, "b": 437.653607 }, "text": "180", "attrs": { "row": 6, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 28 }, { "id": "p45.6.30", "order": 36, "type": "table_cell", "bbox": { "l": 144.35378, "t": 449.640786, "r": 168.231468, "b": 437.653607 }, "text": "Total", "attrs": { "row": 6, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 29 }, { "id": "p45.6.31", "order": 37, "type": "table_cell", "bbox": { "l": 306, "t": 455.5886, "r": 390.48, "b": 437.28 }, "text": "", "attrs": { "row": 6, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 30 }, { "id": "p45.6.32", "order": 38, "type": "table_cell", "bbox": { "l": 390.48, "t": 455.5886, "r": 474.96, "b": 437.28 }, "text": "", "attrs": { "row": 6, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 31 }, { "id": "p45.6.33", "order": 39, "type": "table_cell", "bbox": { "l": 474.96, "t": 455.5886, "r": 559.44, "b": 437.28 }, "text": "", "attrs": { "row": 6, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 32 } ], "reading_order": 5 }, { "id": "p45.7", "order": 40, "type": "caption", "bbox": { "l": 210.24, "t": 425.52, "r": 405.6, "b": 410.64 }, "text": "Subcatchment 5S: IMPERVIOUS", "attrs": { "block_label": "figure_title" }, "reading_order": 6 }, { "id": "p45.8", "order": 41, "type": "figure", "bbox": { "l": 60.96, "t": 412.32, "r": 553.2, "b": 136.32 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nRunoff\n1\n0.93 cfs\nNOAA 24-hr D\n2 YEAR Rainfall=3.42\"\nRunoff Area=0.270 ac\nRunoff Volume=0.066 af\n(cfs) Runoff Depth>2.92\"\nFlow Flow Length=180'\nSlope=0.0100 '/'\nTc=1.6 min\nCN=98\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 7 } ] }, { "document_id": 11809, "page": 46, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 40, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "table": 1, "table_cell": 32, "text": 3, "title": 1 }, "build_ms": 4, "items": [ { "id": "p46.1", "order": 1, "type": "header", "bbox": { "l": 52.8, "t": 738.72, "r": 561.36, "b": 698.64 }, "text": "POST DEV NOAA 24-hr D 2 YEAR Rainfall=3.42\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 10", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p46.2", "order": 2, "type": "title", "bbox": { "l": 183.84, "t": 687.36, "r": 434.4, "b": 672.48 }, "text": "Summary for Subcatchment 6S: POROUS", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p46.3", "order": 3, "type": "text", "bbox": { "l": 52.08, "t": 659.52, "r": 274.08, "b": 646.08 }, "text": "[73] Warning: Peak may fall outside time span", "reading_order": 2 }, { "id": "p46.4", "order": 4, "type": "text", "bbox": { "l": 52.08, "t": 636.72, "r": 462.72, "b": 610.56 }, "text": "Runoff = 0.00 cfs @ 20.00 hrs, Volume= 0.000 af, Depth> 0.00\"\nRouted to Pond 8P : SSIB #2 UNDERGROUND", "reading_order": 3 }, { "id": "p46.5", "order": 5, "type": "text", "bbox": { "l": 52.08, "t": 600.72, "r": 541.44, "b": 574.8 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Weighted-CN, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs NOAA 24-hr D 2 YEAR Rainfall=3.42\"", "reading_order": 4 }, { "id": "p46.6", "order": 6, "type": "table", "bbox": { "l": 52.56, "t": 566.16, "r": 559.2, "b": 425.773607 }, "text": "", "attrs": { "block_label": "table", "n_rows": 7, "n_cols": 7, "integrity": { "cells_checked": 26, "cells_flagged": 0 } }, "children": [ { "id": "p46.6.1", "order": 7, "type": "table_cell", "bbox": { "l": 69.659595, "t": 564.242748, "r": 113.82741, "b": 552.255569 }, "text": "Area (ac)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p46.6.2", "order": 8, "type": "table_cell", "bbox": { "l": 130.796358, "t": 564.242748, "r": 146.30665, "b": 552.255569 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p46.6.3", "order": 9, "type": "table_cell", "bbox": { "l": 289.05701, "t": 512.881252, "r": 342.773751, "b": 500.894072 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p46.6.4", "order": 10, "type": "table_cell", "bbox": { "l": 87, "t": 536.6407859999999, "r": 113.874482, "b": 524.653607 }, "text": "0.190", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 3 }, { "id": "p46.6.5", "order": 11, "type": "table_cell", "bbox": { "l": 134.275244, "t": 550.440786, "r": 146.219458, "b": 538.453607 }, "text": "39", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p46.6.6", "order": 12, "type": "table_cell", "bbox": { "l": 160.552515, "t": 550.440786, "r": 320.843443, "b": 538.453607 }, "text": ">75% Grass cover, Good, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true }, "reading_order": 5 }, { "id": "p46.6.7", "order": 13, "type": "table_cell", "bbox": { "l": 87, "t": 550.440786, "r": 113.874482, "b": 538.453607 }, "text": "0.190", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 6 }, { "id": "p46.6.8", "order": 14, "type": "table_cell", "bbox": { "l": 160.555738, "t": 536.6407859999999, "r": 273.392044, "b": 524.653607 }, "text": "100.00% Pervious Area", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 5, "bbox_refit": true }, "reading_order": 7 }, { "id": "p46.6.9", "order": 15, "type": "table_cell", "bbox": { "l": 65.459598, "t": 512.881252, "r": 89.993572, "b": 489.014305 }, "text": "Tc (min)", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p46.6.10", "order": 16, "type": "table_cell", "bbox": { "l": 100.682141, "t": 512.881252, "r": 133.545916, "b": 489.014305 }, "text": "Length (feet)", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p46.6.11", "order": 17, "type": "table_cell", "bbox": { "l": 149.815612, "t": 512.881252, "r": 177.28086, "b": 489.014305 }, "text": "Slope (ft/ft)", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p46.6.12", "order": 18, "type": "table_cell", "bbox": { "l": 188.028505, "t": 512.881252, "r": 225.633446, "b": 489.014305 }, "text": "Velocity (ft/sec)", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 }, { "id": "p46.6.13", "order": 19, "type": "table_cell", "bbox": { "l": 236.50354, "t": 512.881252, "r": 278.288957, "b": 489.014305 }, "text": "Capacity (cfs)", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 12 }, { "id": "p46.6.14", "order": 20, "type": "table_cell", "bbox": { "l": 160.552704, "t": 564.242748, "r": 214.269445, "b": 552.255569 }, "text": "Description", "attrs": { "row": 3, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 13 }, { "id": "p46.6.15", "order": 21, "type": "table_cell", "bbox": { "l": 69, "t": 487.200786, "r": 89.902375, "b": 475.213607 }, "text": "11.3", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p46.6.16", "order": 22, "type": "table_cell", "bbox": { "l": 121.676993, "t": 487.200786, "r": 133.621207, "b": 475.213607 }, "text": "90", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p46.6.17", "order": 23, "type": "table_cell", "bbox": { "l": 144.353814, "t": 487.200786, "r": 177.200404, "b": 475.213607 }, "text": "0.0270", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p46.6.18", "order": 24, "type": "table_cell", "bbox": { "l": 204.707543, "t": 487.200786, "r": 225.609918, "b": 475.213607 }, "text": "0.13", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p46.6.19", "order": 25, "type": "table_cell", "bbox": { "l": 342.0686, "t": 486.48, "r": 414.4457, "b": 466.56 }, "text": "", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 18 }, { "id": "p46.6.20", "order": 26, "type": "table_cell", "bbox": { "l": 289.079669, "t": 487.020334, "r": 461.873354, "b": 439.572157 }, "text": "Sheet Flow,\\nGrass: Dense n= 0.240 P2= 3.42\"\\nShallow Concentrated Flow,\\nPaved Kv= 20.3 fps", "attrs": { "row": 4, "col": 5, "rowspan": 2, "colspan": 2, "bbox_refit": true }, "reading_order": 19 }, { "id": "p46.6.21", "order": 27, "type": "table_cell", "bbox": { "l": 75.000034, "t": 463.440177, "r": 89.930302, "b": 451.452998 }, "text": "1.1", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p46.6.22", "order": 28, "type": "table_cell", "bbox": { "l": 115.679107, "t": 463.440177, "r": 133.595429, "b": 451.452998 }, "text": "160", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p46.6.23", "order": 29, "type": "table_cell", "bbox": { "l": 144.353814, "t": 463.440177, "r": 177.200404, "b": 451.452998 }, "text": "0.0150", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 22 }, { "id": "p46.6.24", "order": 30, "type": "table_cell", "bbox": { "l": 204.707543, "t": 463.440177, "r": 225.609918, "b": 451.452998 }, "text": "2.49", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 23 }, { "id": "p46.6.25", "order": 31, "type": "table_cell", "bbox": { "l": 342.0686, "t": 466.56, "r": 414.4457, "b": 446.64 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 24 }, { "id": "p46.6.26", "order": 32, "type": "table_cell", "bbox": { "l": 69, "t": 437.760786, "r": 89.902375, "b": 425.773607 }, "text": "12.4", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 25 }, { "id": "p46.6.27", "order": 33, "type": "table_cell", "bbox": { "l": 115.676959, "t": 437.760786, "r": 133.59328, "b": 425.773607 }, "text": "250", "attrs": { "row": 6, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 26 }, { "id": "p46.6.28", "order": 34, "type": "table_cell", "bbox": { "l": 144.351666, "t": 437.760786, "r": 168.229354, "b": 425.773607 }, "text": "Total", "attrs": { "row": 6, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 27 }, { "id": "p46.6.29", "order": 35, "type": "table_cell", "bbox": { "l": 269.6914, "t": 446.64, "r": 342.0686, "b": 426.72 }, "text": "", "attrs": { "row": 6, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 28 }, { "id": "p46.6.30", "order": 36, "type": "table_cell", "bbox": { "l": 342.0686, "t": 446.64, "r": 414.4457, "b": 426.72 }, "text": "", "attrs": { "row": 6, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 29 }, { "id": "p46.6.31", "order": 37, "type": "table_cell", "bbox": { "l": 414.4457, "t": 446.64, "r": 486.8229, "b": 426.72 }, "text": "", "attrs": { "row": 6, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 30 }, { "id": "p46.6.32", "order": 38, "type": "table_cell", "bbox": { "l": 486.8229, "t": 446.64, "r": 559.2, "b": 426.72 }, "text": "", "attrs": { "row": 6, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 31 } ], "reading_order": 5 }, { "id": "p46.7", "order": 39, "type": "caption", "bbox": { "l": 222.24, "t": 413.52, "r": 393.12, "b": 398.4 }, "text": "Subcatchment 6S: POROUS", "attrs": { "block_label": "figure_title" }, "reading_order": 6 }, { "id": "p46.8", "order": 40, "type": "figure", "bbox": { "l": 62.64, "t": 390.48, "r": 549.36, "b": 126.24 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nRunoff\n0.000 0.00 cfs\n0.000 NOAA 24-hr D\n2 YEAR Rainfall=3.42\"\n0.000\nRunoff Area=0.190 ac\n0.000\n0\nRunoff Volume=0.000 af\n0\n(cfs) 0 Runoff Depth>0.00\"\nFlow 0 Flow Length=250'\n0 Tc=12.4 min\nCN=39\n0\n0\n0\n0\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 7 } ] }, { "document_id": 11809, "page": 47, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 44, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "table": 1, "table_cell": 36, "text": 3, "title": 1 }, "build_ms": 4, "items": [ { "id": "p47.1", "order": 1, "type": "header", "bbox": { "l": 52.8, "t": 738.72, "r": 560.88, "b": 698.64 }, "text": "POST DEV NOAA 24-hr D 2 YEAR Rainfall=3.42\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 11", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p47.2", "order": 2, "type": "title", "bbox": { "l": 131.76, "t": 687.6, "r": 488.88, "b": 672.48 }, "text": "Summary for Subcatchment 8S: PROP WAREHOUSE BLDG", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p47.3", "order": 3, "type": "text", "bbox": { "l": 51.6, "t": 659.52, "r": 245.04, "b": 646.32 }, "text": "[49] Hint: Tc<2dt may require smaller dt", "reading_order": 2 }, { "id": "p47.4", "order": 4, "type": "text", "bbox": { "l": 51.84, "t": 636.48, "r": 463.44, "b": 610.56 }, "text": "Runoff = 1.48 cfs @ 12.10 hrs, Volume= 0.112 af, Depth> 2.92\"\nRouted to Pond 9P : SSIB #3 UNDERGROUND", "reading_order": 3 }, { "id": "p47.5", "order": 5, "type": "text", "bbox": { "l": 51.84, "t": 600.72, "r": 541.68, "b": 574.8 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Weighted-CN, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs NOAA 24-hr D 2 YEAR Rainfall=3.42\"", "reading_order": 4 }, { "id": "p47.6", "order": 6, "type": "table", "bbox": { "l": 52.56, "t": 566.88, "r": 558.96, "b": 413.28 }, "text": "", "attrs": { "block_label": "table", "n_rows": 7, "n_cols": 6, "integrity": { "cells_checked": 29, "cells_flagged": 0 } }, "children": [ { "id": "p47.6.1", "order": 7, "type": "table_cell", "bbox": { "l": 69.659595, "t": 564.242748, "r": 113.82741, "b": 552.255569 }, "text": "Area (ac)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p47.6.2", "order": 8, "type": "table_cell", "bbox": { "l": 130.796358, "t": 564.242748, "r": 146.30665, "b": 552.255569 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p47.6.3", "order": 9, "type": "table_cell", "bbox": { "l": 289.05701, "t": 512.881252, "r": 342.773751, "b": 500.894072 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p47.6.4", "order": 10, "type": "table_cell", "bbox": { "l": 87, "t": 550.440786, "r": 113.874482, "b": 524.653607 }, "text": "0.460\n0.460", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p47.6.5", "order": 11, "type": "table_cell", "bbox": { "l": 134.275244, "t": 550.440786, "r": 146.219458, "b": 538.453607 }, "text": "98", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p47.6.6", "order": 12, "type": "table_cell", "bbox": { "l": 160.552515, "t": 550.440786, "r": 284.133244, "b": 524.653607 }, "text": "Roofs, HSG A\n100.00% Impervious Area", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p47.6.7", "order": 13, "type": "table_cell", "bbox": { "l": 65.459598, "t": 512.881252, "r": 89.993572, "b": 489.014305 }, "text": "Tc (min)", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p47.6.8", "order": 14, "type": "table_cell", "bbox": { "l": 100.682141, "t": 512.881252, "r": 133.545916, "b": 489.014305 }, "text": "Length (feet)", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p47.6.9", "order": 15, "type": "table_cell", "bbox": { "l": 149.815612, "t": 512.881252, "r": 177.28086, "b": 489.014305 }, "text": "Slope (ft/ft)", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p47.6.10", "order": 16, "type": "table_cell", "bbox": { "l": 188.028505, "t": 512.881252, "r": 225.633446, "b": 489.014305 }, "text": "Velocity (ft/sec)", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p47.6.11", "order": 17, "type": "table_cell", "bbox": { "l": 236.50354, "t": 512.881252, "r": 278.288957, "b": 489.014305 }, "text": "Capacity (cfs)", "attrs": { "row": 2, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p47.6.12", "order": 18, "type": "table_cell", "bbox": { "l": 160.552704, "t": 564.242748, "r": 214.269445, "b": 552.255569 }, "text": "Description", "attrs": { "row": 2, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 }, { "id": "p47.6.13", "order": 19, "type": "table_cell", "bbox": { "l": 75, "t": 487.200786, "r": 89.930268, "b": 475.213607 }, "text": "1.5", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 12 }, { "id": "p47.6.14", "order": 20, "type": "table_cell", "bbox": { "l": 115.679073, "t": 487.200786, "r": 133.595394, "b": 475.213607 }, "text": "100", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p47.6.15", "order": 21, "type": "table_cell", "bbox": { "l": 144.35378, "t": 487.200786, "r": 177.20037, "b": 475.213607 }, "text": "0.0100", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p47.6.16", "order": 22, "type": "table_cell", "bbox": { "l": 204.707509, "t": 487.200786, "r": 225.609884, "b": 475.213607 }, "text": "1.08", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p47.6.17", "order": 23, "type": "table_cell", "bbox": { "l": 390.16, "t": 498.6133, "r": 474.56, "b": 481.5467 }, "text": "", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 16 }, { "id": "p47.6.18", "order": 24, "type": "table_cell", "bbox": { "l": 289.079635, "t": 487.020334, "r": 348.768483, "b": 475.033155 }, "text": "Sheet Flow,", "attrs": { "row": 3, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p47.6.19", "order": 25, "type": "table_cell", "bbox": { "l": 75, "t": 463.440177, "r": 89.930268, "b": 451.452998 }, "text": "0.3", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p47.6.20", "order": 26, "type": "table_cell", "bbox": { "l": 121.678033, "t": 463.440177, "r": 133.622247, "b": 451.452998 }, "text": "40", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p47.6.21", "order": 27, "type": "table_cell", "bbox": { "l": 144.354854, "t": 463.440177, "r": 177.201444, "b": 451.452998 }, "text": "0.0100", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p47.6.22", "order": 28, "type": "table_cell", "bbox": { "l": 204.708583, "t": 463.440177, "r": 225.610958, "b": 451.452998 }, "text": "2.03", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p47.6.23", "order": 29, "type": "table_cell", "bbox": { "l": 390.16, "t": 481.5467, "r": 474.56, "b": 464.48 }, "text": "", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 22 }, { "id": "p47.6.24", "order": 30, "type": "table_cell", "bbox": { "l": 289.079635, "t": 475.319945, "r": 476.803587, "b": 463.332765 }, "text": "Smooth surfaces\\nn= 0.011\\nP2= 3.42\"", "attrs": { "row": 4, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 23 }, { "id": "p47.6.25", "order": 31, "type": "table_cell", "bbox": { "l": 75, "t": 439.679569, "r": 89.930268, "b": 427.69239 }, "text": "0.8", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 24 }, { "id": "p47.6.26", "order": 32, "type": "table_cell", "bbox": { "l": 115.679073, "t": 439.679569, "r": 133.595394, "b": 427.69239 }, "text": "140", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 25 }, { "id": "p47.6.27", "order": 33, "type": "table_cell", "bbox": { "l": 221.36, "t": 464.48, "r": 305.76, "b": 447.4133 }, "text": "", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 26 }, { "id": "p47.6.28", "order": 34, "type": "table_cell", "bbox": { "l": 204.713954, "t": 439.679569, "r": 225.616329, "b": 427.69239 }, "text": "3.00", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 27 }, { "id": "p47.6.29", "order": 35, "type": "table_cell", "bbox": { "l": 390.16, "t": 464.48, "r": 474.56, "b": 447.4133 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 28 }, { "id": "p47.6.30", "order": 36, "type": "table_cell", "bbox": { "l": 289.079635, "t": 463.259725, "r": 432.324278, "b": 427.511938 }, "text": "Shallow Concentrated Flow,\\nPaved Kv= 20.3 fps\nDirect Entry, PIPE FLOW", "attrs": { "row": 5, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 29 }, { "id": "p47.6.31", "order": 37, "type": "table_cell", "bbox": { "l": 75, "t": 425.880786, "r": 89.930268, "b": 413.893607 }, "text": "2.6", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 30 }, { "id": "p47.6.32", "order": 38, "type": "table_cell", "bbox": { "l": 115.679073, "t": 425.880786, "r": 133.595394, "b": 413.893607 }, "text": "280", "attrs": { "row": 6, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 31 }, { "id": "p47.6.33", "order": 39, "type": "table_cell", "bbox": { "l": 144.35378, "t": 425.880786, "r": 168.231468, "b": 413.893607 }, "text": "Total", "attrs": { "row": 6, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 32 }, { "id": "p47.6.34", "order": 40, "type": "table_cell", "bbox": { "l": 305.76, "t": 430.3467, "r": 390.16, "b": 413.28 }, "text": "", "attrs": { "row": 6, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 33 }, { "id": "p47.6.35", "order": 41, "type": "table_cell", "bbox": { "l": 390.16, "t": 430.3467, "r": 474.56, "b": 413.28 }, "text": "", "attrs": { "row": 6, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 34 }, { "id": "p47.6.36", "order": 42, "type": "table_cell", "bbox": { "l": 474.56, "t": 430.3467, "r": 558.96, "b": 413.28 }, "text": "", "attrs": { "row": 6, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 35 } ], "reading_order": 5 }, { "id": "p47.7", "order": 43, "type": "caption", "bbox": { "l": 170.4, "t": 401.52, "r": 448.08, "b": 386.88 }, "text": "Subcatchment 8S: PROP WAREHOUSE BLDG", "attrs": { "block_label": "figure_title" }, "reading_order": 6 }, { "id": "p47.8", "order": 44, "type": "figure", "bbox": { "l": 60.96, "t": 383.76, "r": 553.44, "b": 113.76 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nRunoff\n1.48 cfs\nNOAA 24-hr D\n2 YEAR Rainfall=3.42\"\nRunoff Area=0.460 ac\n1 Runoff Volume=0.112 af\n(cfs) Runoff Depth>2.92\"\nFlow Flow Length=280'\nSlope=0.0100 '/'\nTc=2.6 min\nCN=98\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 7 } ] }, { "document_id": 11809, "page": 48, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 22, "counts_by_type": { "caption": 2, "figure": 1, "header": 1, "list": 1, "list_item": 3, "table": 1, "table_cell": 11, "text": 1, "title": 1 }, "build_ms": 2, "items": [ { "id": "p48.1", "order": 1, "type": "header", "bbox": { "l": 52.32, "t": 738.72, "r": 561.12, "b": 698.4 }, "text": "POST DEV NOAA 24-hr D 2 YEAR Rainfall=3.42\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 12", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p48.2", "order": 2, "type": "title", "bbox": { "l": 151.2, "t": 687.6, "r": 468.48, "b": 672.72 }, "text": "Summary for Subcatchment 10S: BY-PASS POROUS", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p48.3", "order": 3, "type": "list", "bbox": { "l": 52.08, "t": 659.52, "r": 463.68, "b": 598.8 }, "text": "", "attrs": { "item_count": 3 }, "children": [ { "id": "p48.3.1", "order": 4, "type": "list_item", "bbox": { "l": 52.08, "t": 659.52, "r": 246, "b": 647.28 }, "text": "[49] Hint: Tc<2dt may require smaller dt", "reading_order": 0 }, { "id": "p48.3.2", "order": 5, "type": "list_item", "bbox": { "l": 52.08, "t": 647.04, "r": 274.56, "b": 634.32 }, "text": "[73] Warning: Peak may fall outside time span", "reading_order": 1 }, { "id": "p48.3.3", "order": 6, "type": "list_item", "bbox": { "l": 52.08, "t": 624.72, "r": 463.68, "b": 598.8 }, "text": "Runoff = 0.00 cfs @ 20.00 hrs, Volume= 0.000 af, Depth> 0.00\"\nRouted to Reach 10 : COMPOSITE", "reading_order": 2 } ], "reading_order": 2 }, { "id": "p48.4", "order": 7, "type": "text", "bbox": { "l": 52.32, "t": 588.96, "r": 541.44, "b": 563.04 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Weighted-CN, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs NOAA 24-hr D 2 YEAR Rainfall=3.42\"", "reading_order": 3 }, { "id": "p48.5", "order": 8, "type": "table", "bbox": { "l": 52.32, "t": 552.96, "r": 560.4, "b": 461.04 }, "text": "", "attrs": { "block_label": "table", "n_rows": 4, "n_cols": 3, "integrity": { "cells_checked": 11, "cells_flagged": 0 } }, "children": [ { "id": "p48.5.1", "order": 9, "type": "table_cell", "bbox": { "l": 69.659595, "t": 552.362981, "r": 113.82741, "b": 540.375802 }, "text": "Area (ac)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p48.5.2", "order": 10, "type": "table_cell", "bbox": { "l": 130.796358, "t": 552.362981, "r": 146.30665, "b": 540.375802 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p48.5.3", "order": 11, "type": "table_cell", "bbox": { "l": 289.05701, "t": 501.001252, "r": 342.773751, "b": 489.014072 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p48.5.4", "order": 12, "type": "table_cell", "bbox": { "l": 87, "t": 524.760786, "r": 113.874482, "b": 512.7736070000001 }, "text": "0.060", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 3 }, { "id": "p48.5.5", "order": 13, "type": "table_cell", "bbox": { "l": 134.275244, "t": 538.560786, "r": 146.219458, "b": 526.573607 }, "text": "39", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p48.5.6", "order": 14, "type": "table_cell", "bbox": { "l": 160.552515, "t": 538.560786, "r": 320.843443, "b": 526.573607 }, "text": ">75% Grass cover, Good, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p48.5.7", "order": 15, "type": "table_cell", "bbox": { "l": 87, "t": 538.560786, "r": 113.874482, "b": 526.573607 }, "text": "0.060", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p48.5.8", "order": 16, "type": "table_cell", "bbox": { "l": 160.555738, "t": 524.760786, "r": 273.392044, "b": 512.7736070000001 }, "text": "100.00% Pervious Area", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 7 }, { "id": "p48.5.9", "order": 17, "type": "table_cell", "bbox": { "l": 65.459598, "t": 501.001252, "r": 89.993572, "b": 463.333607 }, "text": "Tc (min)\n2.0", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 8 }, { "id": "p48.5.10", "order": 18, "type": "table_cell", "bbox": { "l": 100.682141, "t": 501.001252, "r": 352.94681, "b": 463.153155 }, "text": "Length (feet)\nDirect Entry,", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 9 }, { "id": "p48.5.11", "order": 19, "type": "table_cell", "bbox": { "l": 149.815612, "t": 501.001252, "r": 278.288957, "b": 477.134305 }, "text": "Slope (ft/ft) Velocity (ft/sec) Capacity (cfs)", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 } ], "reading_order": 4 }, { "id": "p48.6", "order": 20, "type": "caption", "bbox": { "l": 190.08, "t": 451.2, "r": 426.96, "b": 436.56 }, "text": "Subcatchment 10S: BY-PASS POROUS", "attrs": { "block_label": "figure_title" }, "reading_order": 5 }, { "id": "p48.7", "order": 21, "type": "caption", "bbox": { "l": 254.4, "t": 430.32, "r": 306.72, "b": 419.52 }, "text": "Hydrograph", "attrs": { "block_label": "figure_title" }, "reading_order": 6 }, { "id": "p48.8", "order": 22, "type": "figure", "bbox": { "l": 63.36, "t": 427.68, "r": 551.04, "b": 164.64 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n0 Runoff\n0 0.00 cfs\n0 NOAA 24-hr D\n0\n0 2 YEAR Rainfall=3.42\"\n0\n0\n0 Runoff Area=0.060 ac\n0\nRunoff Volume=0.000 af\n0\n0\n(cfs) 0\n0 Runoff Depth>0.00\"\nFlow 0\n0 Tc=2.0 min\n0\n0 CN=39\n0\n0\n0\n0\n0\n0\n0\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 7 } ] }, { "document_id": 11809, "page": 49, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 24, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "table": 1, "table_cell": 16, "text": 3, "title": 1 }, "build_ms": 2, "items": [ { "id": "p49.1", "order": 1, "type": "header", "bbox": { "l": 52.56, "t": 738.48, "r": 561.12, "b": 698.4 }, "text": "POST DEV NOAA 24-hr D 2 YEAR Rainfall=3.42\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 13", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p49.2", "order": 2, "type": "title", "bbox": { "l": 139.68, "t": 687.6, "r": 480.72, "b": 672.48 }, "text": "Summary for Subcatchment 11S: BY-PASS IMPERVIOUS", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p49.3", "order": 3, "type": "text", "bbox": { "l": 51.84, "t": 659.28, "r": 245.04, "b": 646.32 }, "text": "[49] Hint: Tc<2dt may require smaller dt", "reading_order": 2 }, { "id": "p49.4", "order": 4, "type": "text", "bbox": { "l": 52.08, "t": 636.24, "r": 463.44, "b": 612 }, "text": "Runoff = 0.24 cfs @ 12.09 hrs, Volume= 0.017 af, Depth> 2.92\"\nRouted to Reach 10 : COMPOSITE", "reading_order": 3 }, { "id": "p49.5", "order": 5, "type": "text", "bbox": { "l": 52.08, "t": 600.72, "r": 541.68, "b": 575.04 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Weighted-CN, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs NOAA 24-hr D 2 YEAR Rainfall=3.42\"", "reading_order": 4 }, { "id": "p49.6", "order": 6, "type": "table", "bbox": { "l": 52.8, "t": 564.96, "r": 559.44, "b": 474.96 }, "text": "", "attrs": { "block_label": "table", "n_rows": 4, "n_cols": 4, "integrity": { "cells_checked": 13, "cells_flagged": 1, "flags": [ { "row": 2, "col": 2, "coverage": 0, "text": "Impervious Area" } ] } }, "children": [ { "id": "p49.6.1", "order": 7, "type": "table_cell", "bbox": { "l": 69.659595, "t": 564.242748, "r": 113.82741, "b": 552.255569 }, "text": "Area (ac)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p49.6.2", "order": 8, "type": "table_cell", "bbox": { "l": 130.796358, "t": 564.242748, "r": 146.30665, "b": 552.255569 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p49.6.3", "order": 9, "type": "table_cell", "bbox": { "l": 289.05701, "t": 512.881252, "r": 342.773751, "b": 500.894072 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p49.6.4", "order": 10, "type": "table_cell", "bbox": { "l": 432.78, "t": 564.96, "r": 559.44, "b": 546.96 }, "text": "", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 3 }, { "id": "p49.6.5", "order": 11, "type": "table_cell", "bbox": { "l": 87, "t": 550.440786, "r": 113.874482, "b": 538.453607 }, "text": "0.070", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p49.6.6", "order": 12, "type": "table_cell", "bbox": { "l": 134.275244, "t": 550.440786, "r": 146.219458, "b": 538.453607 }, "text": "98", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p49.6.7", "order": 13, "type": "table_cell", "bbox": { "l": 160.552515, "t": 550.440786, "r": 268.608987, "b": 538.453607 }, "text": "Paved parking, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p49.6.8", "order": 14, "type": "table_cell", "bbox": { "l": 432.78, "t": 546.96, "r": 559.44, "b": 528.96 }, "text": "", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 7 }, { "id": "p49.6.9", "order": 15, "type": "table_cell", "bbox": { "l": 87, "t": 536.6407859999999, "r": 113.874482, "b": 524.653607 }, "text": "0.070", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p49.6.10", "order": 16, "type": "table_cell", "bbox": { "l": 160.555738, "t": 536.6407859999999, "r": 202.951254, "b": 524.653607 }, "text": "100.00%", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p49.6.11", "order": 17, "type": "table_cell", "bbox": { "l": 306.12, "t": 528.96, "r": 432.78, "b": 510.96 }, "text": "Impervious Area", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 10 }, { "id": "p49.6.12", "order": 18, "type": "table_cell", "bbox": { "l": 432.78, "t": 528.96, "r": 559.44, "b": 510.96 }, "text": "", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 11 }, { "id": "p49.6.13", "order": 19, "type": "table_cell", "bbox": { "l": 65.459598, "t": 512.881252, "r": 352.94681, "b": 475.033155 }, "text": "Tc (min)\nDirect Entry,", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 12 }, { "id": "p49.6.14", "order": 20, "type": "table_cell", "bbox": { "l": 100.682141, "t": 512.881252, "r": 133.545916, "b": 489.014305 }, "text": "Length (feet)", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p49.6.15", "order": 21, "type": "table_cell", "bbox": { "l": 149.815612, "t": 512.881252, "r": 177.28086, "b": 489.014305 }, "text": "Slope (ft/ft)", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p49.6.16", "order": 22, "type": "table_cell", "bbox": { "l": 188.028505, "t": 512.881252, "r": 225.633446, "b": 489.014305 }, "text": "Velocity (ft/sec)", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 } ], "reading_order": 5 }, { "id": "p49.7", "order": 23, "type": "caption", "bbox": { "l": 178.08, "t": 463.2, "r": 439.92, "b": 447.84 }, "text": "Subcatchment 11S: BY-PASS IMPERVIOUS", "attrs": { "block_label": "figure_title" }, "reading_order": 6 }, { "id": "p49.8", "order": 24, "type": "figure", "bbox": { "l": 62.16, "t": 443.04, "r": 551.76, "b": 176.16 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n0.26 Runoff\n0.25 0.24 cfs\n0.24\n0.23 NOAA 24-hr D\n0.22\n2 YEAR Rainfall=3.42\"\n0.21\n0.2\n0.18 Runoff Area=0.070 ac\n0.19\n0.16 Runoff Volume=0.017 af\n0.17\n0.15\n(cfs) 0.14 Runoff Depth>2.92\"\n0.13\nFlow Tc=2.0 min\n0.12\n0.11\n0.09 CN=98\n0.1\n0.08\n0.07\n0.06\n0.05\n0.04\n0.03\n0.02\n0.01\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 7 } ] }, { "document_id": 11809, "page": 50, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 9, "counts_by_type": { "caption": 1, "figure": 1, "header": 3, "heading": 1, "text": 3 }, "build_ms": 0, "items": [ { "id": "p50.1", "order": 1, "type": "header", "bbox": { "l": 356.4, "t": 739.2, "r": 560.88, "b": 713.52 }, "text": "NOAA 24-hr D 2 YEAR Rainfall=3.42\"\nPrinted 12/31/2025", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p50.2", "order": 2, "type": "header", "bbox": { "l": 442.56, "t": 738.96, "r": 563.04, "b": 699.84 }, "text": "2 YEAR Rainfall=3.42\"\nPrinted 12/31/2025\nPage 14", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p50.3", "order": 3, "type": "header", "bbox": { "l": 51.12, "t": 738.72, "r": 390.24, "b": 698.88 }, "text": "POST DEV NOAA\nPrepared by Professional Design Services\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 2 }, { "id": "p50.4", "order": 4, "type": "heading", "bbox": { "l": 198, "t": 687.36, "r": 419.76, "b": 672.48 }, "text": "Summary for Reach 10: COMPOSITE", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 3 }, { "id": "p50.5", "order": 5, "type": "text", "bbox": { "l": 52.08, "t": 659.52, "r": 250.8, "b": 646.08 }, "text": "[40] Hint: Not Described (Outflow=Inflow)", "reading_order": 4 }, { "id": "p50.6", "order": 6, "type": "text", "bbox": { "l": 52.32, "t": 636.24, "r": 517.68, "b": 598.08 }, "text": "Inflow Area = 2.340 ac, 64.96% Impervious, Inflow Depth > 0.21\" for 2 YEAR event\nInflow = 0.24 cfs @ 12.09 hrs, Volume= 0.040 af\nOutflow = 0.24 cfs @ 12.09 hrs, Volume= 0.040 af, Atten=0%, Lag=0.0 min", "reading_order": 5 }, { "id": "p50.7", "order": 7, "type": "text", "bbox": { "l": 51.84, "t": 588.48, "r": 420.96, "b": 574.8 }, "text": "Routing by Stor-Ind+Trans method, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs", "reading_order": 6 }, { "id": "p50.8", "order": 8, "type": "caption", "bbox": { "l": 236.64, "t": 563.52, "r": 378.48, "b": 548.64 }, "text": "Reach 10: COMPOSITE", "attrs": { "block_label": "figure_title" }, "reading_order": 7 }, { "id": "p50.9", "order": 9, "type": "figure", "bbox": { "l": 62.4, "t": 549.6, "r": 553.44, "b": 275.04 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nInflow\n0.26 0.24 cfs Outflow\n0.24 cfs\n0.24 Inflow Area=2.340 ac\n0.22\n0.2\n0.18\n0.16\n(cfs) 0.14\nFlow 0.12\n0.1\n0.08\n0.06\n0.04\n0.02\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 8 } ] }, { "document_id": 11809, "page": 51, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 33, "counts_by_type": { "footnote": 2, "header": 1, "heading": 2, "table": 2, "table_cell": 25, "text": 1 }, "build_ms": 7, "items": [ { "id": "p51.1", "order": 1, "type": "header", "bbox": { "l": 52.32, "t": 739.44, "r": 562.08, "b": 698.64 }, "text": "POST DEV NOAA 24-hr D 2 YEAR Rainfall=3.42\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 15", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p51.2", "order": 2, "type": "heading", "bbox": { "l": 162.24, "t": 687.84, "r": 457.44, "b": 672.72 }, "text": "Summary for Pond 3P: SSIB #1 SURFACE BASIN", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p51.3", "order": 3, "type": "heading", "bbox": { "l": 52.32, "t": 659.52, "r": 301.44, "b": 645.84 }, "text": "[82] Warning: Early inflow requires earlier time span", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 2 }, { "id": "p51.4", "order": 4, "type": "text", "bbox": { "l": 52.08, "t": 641.76, "r": 549.6, "b": 490.08 }, "text": "Inflow Area = 1.290 ac, 55.81% Impervious, Inflow Depth > 1.63\" for 2 YEAR event\nInflow = 1.36 cfs @ 12.22 hrs, Volume= 0.175 af\nOutflow = 0.28 cfs @ 13.18 hrs, Volume= 0.104 af, Atten= 79%, Lag= 57.6 min\nDiscarded = 0.09 cfs @ 13.18 hrs, Volume= 0.081 af\nPrimary = 0.19 cfs @ 13.18 hrs, Volume= 0.023 af\n\nRouted to Reach 10 : COMPOSITE\n\nRouting by Stor-Ind method, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs\nPeak Elev= 111.65' @ 13.18 hrs Surf.Area= 2,939 sf Storage= 3,983 cf\n\nPlug-Flow detention time= 167.6 min calculated for 0.104 af (59% of inflow)\nCenter-of-Mass det. time= 81.6 min ( 831.1 - 749.5 )", "attrs": { "block_label": "algorithm" }, "reading_order": 3 }, { "id": "p51.5", "order": 5, "type": "table", "bbox": { "l": 52.56, "t": 481.084378, "r": 558.72, "b": 355.2 }, "text": "", "attrs": { "block_label": "table", "n_rows": 3, "n_cols": 5, "integrity": { "cells_checked": 13, "cells_flagged": 1, "flags": [ { "row": 1, "col": 4, "coverage": 0.33, "text": "Listed below (Recalc)" } ] } }, "children": [ { "id": "p51.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 54, "t": 481.084378, "r": 90.412668, "b": 469.097199 }, "text": "Volume", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p51.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 123.533158, "t": 481.084378, "r": 150.396899, "b": 469.097199 }, "text": "Invert", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p51.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 173.452885, "t": 481.084378, "r": 237.330802, "b": 469.097199 }, "text": "Avail.Storage", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p51.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 249.465135, "t": 481.084378, "r": 343.783612, "b": 469.097199 }, "text": "Storage Description", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 2, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 3 }, { "id": "p51.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 66.12, "t": 467.280786, "r": 78.064214, "b": 455.293607 }, "text": "#1", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p51.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 115.437146, "t": 467.280786, "r": 150.335304, "b": 455.293607 }, "text": "110.00'", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p51.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 193.071317, "t": 467.280786, "r": 237.260614, "b": 455.293607 }, "text": "12,950 cf", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p51.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 249.479803, "t": 467.100334, "r": 406.4517, "b": 455.113155 }, "text": "Custom Stage Data (Prismatic)", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p51.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 457.488, "t": 465.24, "r": 558.72, "b": 449.52 }, "text": "Listed below (Recalc)", "attrs": { "row": 1, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 8 }, { "id": "p51.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 57.719307, "t": 443.521252, "r": 101.897863, "b": 358.334538 }, "text": "Elevation\\n(feet)\n110.00\n111.00\n112.00\n113.00\n114.00", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 9 }, { "id": "p51.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 142.191327, "t": 443.521252, "r": 187.562155, "b": 358.334538 }, "text": "Surf.Area\\n(sq-ft)\n2,000\n2,450\n3,200\n4,000\n4,600", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 10 }, { "id": "p51.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 230.21009, "t": 443.521252, "r": 358.898543, "b": 358.334538 }, "text": "Inc.Store\\n(cubic-feet)\n0\n2,225\n2,825\n3,600\n4,300", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 11 }, { "id": "p51.5.13", "order": 18, "type": "table_cell", "bbox": { "l": 219.361478, "t": 443.521252, "r": 358.999511, "b": 358.334538 }, "text": "Cum.Store\\n(cubic-feet)\n0\n2,225\n5,050\n8,650\n12,950", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 12 } ], "reading_order": 4 }, { "id": "p51.6", "order": 19, "type": "table", "bbox": { "l": 51.6, "t": 347.04, "r": 455.28, "b": 258.96 }, "text": "", "attrs": { "block_label": "table", "n_rows": 3, "n_cols": 4, "integrity": { "cells_checked": 12, "cells_flagged": 0 } }, "children": [ { "id": "p51.6.1", "order": 20, "type": "table_cell", "bbox": { "l": 53.999914, "t": 346.562183, "r": 86.825021, "b": 320.773607 }, "text": "Device\n#1", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p51.6.2", "order": 21, "type": "table_cell", "bbox": { "l": 98.873425, "t": 346.562183, "r": 147.222394, "b": 320.773607 }, "text": "Routing\nDiscarded", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p51.6.3", "order": 22, "type": "table_cell", "bbox": { "l": 175.965845, "t": 346.562183, "r": 210.937439, "b": 320.773607 }, "text": "Invert\n110.00'", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p51.6.4", "order": 23, "type": "table_cell", "bbox": { "l": 223.01377, "t": 346.562183, "r": 453.384188, "b": 308.892765 }, "text": "Outlet Devices\n1.000 in/hr Exfiltration over Surface area\\nConductivity to Groundwater Elevation = 106.00'", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p51.6.5", "order": 24, "type": "table_cell", "bbox": { "l": 70.44, "t": 309.000177, "r": 82.384214, "b": 297.012998 }, "text": "#2", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p51.6.6", "order": 25, "type": "table_cell", "bbox": { "l": 98.876253, "t": 309.000177, "r": 135.868946, "b": 297.012998 }, "text": "Primary", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p51.6.7", "order": 26, "type": "table_cell", "bbox": { "l": 175.97229, "t": 309.000177, "r": 210.870449, "b": 297.012998 }, "text": "111.50'", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p51.6.8", "order": 27, "type": "table_cell", "bbox": { "l": 223.01982, "t": 309.000177, "r": 451.453995, "b": 285.133231 }, "text": "12.0\" W x 4.0\" H Vert. Orifice/Grate C= 0.600\\nLimited to weir flow at low heads", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p51.6.9", "order": 28, "type": "table_cell", "bbox": { "l": 70.44, "t": 285.240643, "r": 82.384214, "b": 273.253464 }, "text": "#3", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p51.6.10", "order": 29, "type": "table_cell", "bbox": { "l": 98.876253, "t": 285.240643, "r": 135.868946, "b": 273.253464 }, "text": "Primary", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p51.6.11", "order": 30, "type": "table_cell", "bbox": { "l": 175.97229, "t": 285.240643, "r": 210.870449, "b": 273.253464 }, "text": "113.00'", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p51.6.12", "order": 31, "type": "table_cell", "bbox": { "l": 223.01982, "t": 285.240643, "r": 439.81483, "b": 261.373697 }, "text": "24.0\" x 48.0\" Horiz. Orifice/Grate C= 0.600\\nLimited to weir flow at low heads", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 } ], "reading_order": 5 }, { "id": "p51.7", "order": 32, "type": "footnote", "bbox": { "l": 51.6, "t": 250.56, "r": 439.2, "b": 224.16 }, "text": "Discarded OutFlow Max=0.09 cfs @ 13.18 hrs HW=111.65' (Free Discharge)\n1=Exfiltration (Controls 0.09 cfs)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 6 }, { "id": "p51.8", "order": 33, "type": "footnote", "bbox": { "l": 52.08, "t": 214.8, "r": 426.96, "b": 177.36 }, "text": "Primary OutFlow Max=0.19 cfs @ 13.18 hrs HW=111.65' (Free Discharge)\n2=Orifice/Grate (Orifice Controls 0.19 cfs @ 1.25 fps)\n3=Orifice/Grate (Controls 0.00 cfs)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 7 } ] }, { "document_id": 11809, "page": 52, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 3, "counts_by_type": { "caption": 1, "figure": 1, "header": 1 }, "build_ms": 0, "items": [ { "id": "p52.1", "order": 1, "type": "header", "bbox": { "l": 51.84, "t": 738, "r": 563.52, "b": 698.64 }, "text": "POST DEV NOAA 24-hr D 2 YEAR Rainfall=3.42\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 16", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p52.2", "order": 2, "type": "caption", "bbox": { "l": 201.6, "t": 687.84, "r": 415.68, "b": 673.2 }, "text": "Pond 3P: SSIB #1 SURFACE BASIN", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p52.3", "order": 3, "type": "figure", "bbox": { "l": 62.16, "t": 670.56, "r": 552.24, "b": 399.12 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nInflow\n1.36 cfs Outflow\nInflow Area=1.290 ac Primary\nDiscarded\nPeak Elev=111.65'\nStorage=3,983 cf\n1\n(cfs)\nFlow\n0.28 cfs\n0.19 cfs\n0.09 cfs\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 2 } ] }, { "document_id": 11809, "page": 53, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 11, "counts_by_type": { "caption": 1, "header": 1, "table": 1, "table_cell": 8 }, "build_ms": 18, "items": [ { "id": "p53.1", "order": 1, "type": "header", "bbox": { "l": 51.84, "t": 737.76, "r": 560.88, "b": 698.64 }, "text": "POST DEV NOAA 24-hr D 2 YEAR Rainfall=3.42\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 17", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p53.2", "order": 2, "type": "caption", "bbox": { "l": 152.88, "t": 687.6, "r": 467.52, "b": 672.72 }, "text": "Stage-Discharge for Pond 3P: SSIB #1 SURFACE BASIN", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p53.3", "order": 3, "type": "table", "bbox": { "l": 55.2, "t": 662.16, "r": 500.16, "b": 56.64 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 8, "integrity": { "cells_checked": 8, "cells_flagged": 0 } }, "children": [ { "id": "p53.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 57.3, "t": 661.21453, "r": 97.73433, "b": 59.66617199999996 }, "text": "Elevation (feet)\n110.00\n110.05\n110.10\n110.15\n110.20\n110.25\n110.30\n110.35\n110.40\n110.45\n110.50\n110.55\n110.60\n110.65\n110.70\n110.75\n110.80\n110.85\n110.90\n110.95\n111.00\n111.05\n111.10\n111.15\n111.20\n111.25\n111.30\n111.35\n111.40\n111.45\n111.50\n111.55\n111.60\n111.65\n111.70\n111.75\n111.80\n111.85\n111.90\n111.95\n112.00\n112.05\n112.10\n112.15\n112.20\n112.25\n112.30\n112.35\n112.40\n112.45\n112.50\n112.55\n112.60", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p53.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 109.260182, "t": 661.21453, "r": 153.49646, "b": 59.66617199999996 }, "text": "Discharge (cfs)\n0.00\n0.05\n0.05\n0.05\n0.05\n0.05\n0.05\n0.05\n0.06\n0.06\n0.06\n0.06\n0.06\n0.06\n0.06\n0.06\n0.06\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.08\n0.08\n0.08\n0.08\n0.08\n0.08\n0.09\n0.12\n0.19\n0.28\n0.38\n0.50\n0.62\n0.75\n0.86\n0.94\n1.02\n1.09\n1.16\n1.22\n1.28\n1.33\n1.39\n1.44\n1.49\n1.54\n1.58\n1.63\n1.67", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p53.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 165.000251, "t": 661.21453, "r": 209.236529, "b": 59.66617199999996 }, "text": "Discarded (cfs)\n0.00\n0.05\n0.05\n0.05\n0.05\n0.05\n0.05\n0.05\n0.06\n0.06\n0.06\n0.06\n0.06\n0.06\n0.06\n0.06\n0.06\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.08\n0.08\n0.08\n0.08\n0.08\n0.08\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.11\n0.11\n0.11\n0.11\n0.11\n0.11\n0.12\n0.12\n0.12\n0.12\n0.12", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p53.3.4", "order": 7, "type": "table_cell", "bbox": { "l": 231.060808, "t": 661.21453, "r": 264.933898, "b": 59.66617199999996 }, "text": "Primary (cfs)\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.04\n0.10\n0.19\n0.29\n0.40\n0.53\n0.66\n0.76\n0.84\n0.92\n0.99\n1.05\n1.11\n1.17\n1.22\n1.27\n1.32\n1.37\n1.42\n1.46\n1.51\n1.55", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p53.3.5", "order": 8, "type": "table_cell", "bbox": { "l": 287.88, "t": 661.21453, "r": 328.31433, "b": 332.666219 }, "text": "Elevation (feet)\n112.65\n112.70\n112.75\n112.80\n112.85\n112.90\n112.95\n113.00\n113.05\n113.10\n113.15\n113.20\n113.25\n113.30\n113.35\n113.40\n113.45\n113.50\n113.55\n113.60\n113.65\n113.70\n113.75\n113.80\n113.85\n113.90\n113.95\n114.00", "attrs": { "row": 0, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p53.3.6", "order": 9, "type": "table_cell", "bbox": { "l": 339.840182, "t": 661.21453, "r": 384.649982, "b": 332.606268 }, "text": "Discharge (cfs)\n1.72\n1.76\n1.80\n1.84\n1.88\n1.92\n1.95\n1.99\n2.47\n3.30\n4.38\n5.64\n7.07\n8.65\n10.36\n12.19\n14.14\n16.20\n18.37\n20.63\n22.98\n25.43\n27.97\n30.59\n33.29\n36.07\n38.93\n41.14", "attrs": { "row": 0, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p53.3.7", "order": 10, "type": "table_cell", "bbox": { "l": 395.580251, "t": 661.21453, "r": 440.261303, "b": 332.606268 }, "text": "Discarded (cfs)\n0.13\n0.13\n0.13\n0.13\n0.13\n0.14\n0.14\n0.14\n0.14\n0.14\n0.14\n0.15\n0.15\n0.15\n0.15\n0.15\n0.15\n0.16\n0.16\n0.16\n0.16\n0.16\n0.17\n0.17\n0.17\n0.17\n0.17\n0.17", "attrs": { "row": 0, "col": 6, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p53.3.8", "order": 11, "type": "table_cell", "bbox": { "l": 461.640808, "t": 661.21453, "r": 496.12324, "b": 332.606268 }, "text": "Primary (cfs)\n1.59\n1.63\n1.67\n1.71\n1.74\n1.78\n1.82\n1.85\n2.33\n3.16\n4.23\n5.50\n6.92\n8.50\n10.21\n12.04\n13.99\n16.05\n18.21\n20.47\n22.82\n25.27\n27.80\n30.42\n33.12\n35.90\n38.76\n40.97", "attrs": { "row": 0, "col": 7, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 7 } ], "reading_order": 2 } ] }, { "document_id": 11809, "page": 54, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 10, "counts_by_type": { "caption": 1, "header": 1, "table": 2, "table_cell": 6 }, "build_ms": 14, "items": [ { "id": "p54.1", "order": 1, "type": "header", "bbox": { "l": 51.84, "t": 738.48, "r": 561.36, "b": 698.88 }, "text": "POST DEV NOAA 24-hr D 2 YEAR Rainfall=3.42\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 18", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p54.2", "order": 2, "type": "caption", "bbox": { "l": 144.24, "t": 687.6, "r": 475.92, "b": 672.72 }, "text": "Stage-Area-Storage for Pond 3P: SSIB #1 SURFACE BASIN", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p54.3", "order": 3, "type": "table", "bbox": { "l": 56.64, "t": 662.64, "r": 255.6, "b": 56.88 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 3, "integrity": { "cells_checked": 3, "cells_flagged": 0 } }, "children": [ { "id": "p54.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 57.3, "t": 661.21453, "r": 97.73433, "b": 59.66617199999996 }, "text": "Elevation (feet)\n110.00\n110.05\n110.10\n110.15\n110.20\n110.25\n110.30\n110.35\n110.40\n110.45\n110.50\n110.55\n110.60\n110.65\n110.70\n110.75\n110.80\n110.85\n110.90\n110.95\n111.00\n111.05\n111.10\n111.15\n111.20\n111.25\n111.30\n111.35\n111.40\n111.45\n111.50\n111.55\n111.60\n111.65\n111.70\n111.75\n111.80\n111.85\n111.90\n111.95\n112.00\n112.05\n112.10\n112.15\n112.20\n112.25\n112.30\n112.35\n112.40\n112.45\n112.50\n112.55\n112.60", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p54.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 138.719912, "t": 661.21453, "r": 172.604796, "b": 59.66617199999996 }, "text": "Surface (sq-ft)\n2,000\n2,022\n2,045\n2,068\n2,090\n2,113\n2,135\n2,157\n2,180\n2,203\n2,225\n2,247\n2,270\n2,293\n2,315\n2,338\n2,360\n2,382\n2,405\n2,428\n2,450\n2,487\n2,525\n2,563\n2,600\n2,638\n2,675\n2,712\n2,750\n2,788\n2,825\n2,862\n2,900\n2,938\n2,975\n3,013\n3,050\n3,087\n3,125\n3,163\n3,200\n3,240\n3,280\n3,320\n3,360\n3,400\n3,440\n3,480\n3,520\n3,560\n3,600\n3,640\n3,680", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p54.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 198.240851, "t": 661.21453, "r": 247.503763, "b": 59.66617199999996 }, "text": "Storage (cubic-feet)\n0\n101\n202\n305\n409\n514\n620\n728\n836\n946\n1,056\n1,168\n1,281\n1,395\n1,510\n1,627\n1,744\n1,863\n1,982\n2,103\n2,225\n2,348\n2,474\n2,601\n2,730\n2,861\n2,994\n3,128\n3,265\n3,403\n3,544\n3,686\n3,830\n3,976\n4,124\n4,273\n4,425\n4,578\n4,734\n4,891\n5,050\n5,211\n5,374\n5,539\n5,706\n5,875\n6,046\n6,219\n6,394\n6,571\n6,750\n6,931\n7,114", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 } ], "reading_order": 2 }, { "id": "p54.4", "order": 7, "type": "table", "bbox": { "l": 266.16, "t": 663.6, "r": 464.64, "b": 331.44 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 3, "integrity": { "cells_checked": 3, "cells_flagged": 0 } }, "children": [ { "id": "p54.4.1", "order": 8, "type": "table_cell", "bbox": { "l": 270.42, "t": 661.21453, "r": 310.85433, "b": 332.666219 }, "text": "Elevation (feet)\n112.65\n112.70\n112.75\n112.80\n112.85\n112.90\n112.95\n113.00\n113.05\n113.10\n113.15\n113.20\n113.25\n113.30\n113.35\n113.40\n113.45\n113.50\n113.55\n113.60\n113.65\n113.70\n113.75\n113.80\n113.85\n113.90\n113.95\n114.00", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p54.4.2", "order": 9, "type": "table_cell", "bbox": { "l": 351.839912, "t": 661.21453, "r": 386.330207, "b": 332.606268 }, "text": "Surface (sq-ft)\n3,720\n3,760\n3,800\n3,840\n3,880\n3,920\n3,960\n4,000\n4,030\n4,060\n4,090\n4,120\n4,150\n4,180\n4,210\n4,240\n4,270\n4,300\n4,330\n4,360\n4,390\n4,420\n4,450\n4,480\n4,510\n4,540\n4,570\n4,600", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p54.4.3", "order": 10, "type": "table_cell", "bbox": { "l": 411.360851, "t": 661.21453, "r": 461.330403, "b": 332.606268 }, "text": "Storage (cubic-feet)\n7,299\n7,486\n7,675\n7,866\n8,059\n8,254\n8,451\n8,650\n8,851\n9,053\n9,257\n9,462\n9,669\n9,877\n10,087\n10,298\n10,511\n10,725\n10,941\n11,158\n11,377\n11,597\n11,819\n12,042\n12,267\n12,493\n12,721\n12,950", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 } ], "reading_order": 3 } ] }, { "document_id": 11809, "page": 55, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 34, "counts_by_type": { "footnote": 1, "header": 1, "heading": 3, "table": 2, "table_cell": 26, "text": 1 }, "build_ms": 6, "items": [ { "id": "p55.1", "order": 1, "type": "header", "bbox": { "l": 52.56, "t": 738.72, "r": 561.12, "b": 698.64 }, "text": "POST DEV NOAA 24-hr D 2 YEAR Rainfall=3.42\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 19", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p55.2", "order": 2, "type": "heading", "bbox": { "l": 163.68, "t": 687.6, "r": 455.76, "b": 672.72 }, "text": "Summary for Pond 8P: SSIB #2 UNDERGROUND", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p55.3", "order": 3, "type": "heading", "bbox": { "l": 52.32, "t": 659.52, "r": 301.44, "b": 645.84 }, "text": "[82] Warning: Early inflow requires earlier time span", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 2 }, { "id": "p55.4", "order": 4, "type": "text", "bbox": { "l": 52.08, "t": 639.84, "r": 553.44, "b": 489.84 }, "text": "Inflow Area = 0.460 ac, 58.70% Impervious, Inflow Depth > 1.71\" for 2 YEAR event\nInflow = 0.93 cfs @ 12.08 hrs, Volume= 0.066 af\nOutflow = 0.09 cfs @ 12.99 hrs, Volume= 0.065 af, Atten= 91%, Lag= 54.4 min\nDiscarded = 0.09 cfs @ 12.99 hrs, Volume= 0.065 af\nPrimary = 0.00 cfs @ 5.00 hrs, Volume= 0.000 af\nRouted to Reach 10: COMPOSITE\n\nRouting by Stor-Ind method, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs\nPeak Elev= 108.37' @ 12.99 hrs Surf.Area= 0.064 ac Storage= 0.025 af\n\nPlug-Flow detention time= 100.6 min calculated for 0.065 af (99% of inflow)\nCenter-of-Mass det. time= 98.8 min (834.8 - 736.1)", "attrs": { "block_label": "algorithm" }, "reading_order": 3 }, { "id": "p55.5", "order": 5, "type": "table", "bbox": { "l": 52.32, "t": 482.64, "r": 556.8, "b": 370.213607 }, "text": "", "attrs": { "block_label": "table", "n_rows": 3, "n_cols": 4, "integrity": { "cells_checked": 10, "cells_flagged": 0 } }, "children": [ { "id": "p55.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 54, "t": 481.084378, "r": 549.157135, "b": 443.412765 }, "text": "Volume\n#1A\n0.192 af Overall - 0.072 af Embedded = 0.120 af x 40.0% Voids", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p55.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 115.437146, "t": 481.084378, "r": 150.396899, "b": 455.293607 }, "text": "Invert\n107.50'", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p55.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 167.453925, "t": 481.084378, "r": 231.331841, "b": 455.293607 }, "text": "Avail.Storage\n0.048 af", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p55.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 243.466175, "t": 481.084378, "r": 412.943681, "b": 455.113155 }, "text": "Storage Description\n41.95\"W x 66.33\"L x 3.00\"H Field A", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p55.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 66.12, "t": 443.520177, "r": 85.228595, "b": 431.532998 }, "text": "#2A", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p55.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 115.437146, "t": 443.520177, "r": 150.335304, "b": 431.532998 }, "text": "107.83'", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p55.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 192.471958, "t": 443.520177, "r": 231.290655, "b": 431.532998 }, "text": "0.057 af", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p55.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 243.479769, "t": 443.520177, "r": 509.915235, "b": 384.013929 }, "text": "ADS N-12 24\" x 36 Inside #1\\nInside = 23.8\"W x 23.8\"H => 3.10 sf x 20.00\"L = 62.0 cf\\nOutside = 28.0\"W x 28.0\"H => 3.92 sf x 20.00\"L = 78.4 cf\\n36 Chambers in 12 Rows\\n40.28' Header x 3.10 sf x 2 = 249.8 cf Inside", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p55.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 52.32, "t": 398.352, "r": 178.44, "b": 377.28 }, "text": "", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 8 }, { "id": "p55.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 178.44, "t": 398.352, "r": 304.56, "b": 377.28 }, "text": "", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1 }, "reading_order": 9 }, { "id": "p55.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 192.48, "t": 382.200786, "r": 231.298697, "b": 370.213607 }, "text": "0.105 af", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p55.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 243.477069, "t": 382.200786, "r": 354.519595, "b": 370.213607 }, "text": "Total Available Storage", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 } ], "reading_order": 4 }, { "id": "p55.6", "order": 18, "type": "heading", "bbox": { "l": 66.96, "t": 358.8, "r": 295.44, "b": 345.36 }, "text": "Storage Group A created with Chamber Wizard", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 5 }, { "id": "p55.7", "order": 19, "type": "table", "bbox": { "l": 49.2, "t": 335.76, "r": 563.28, "b": 196.08 }, "text": "", "attrs": { "block_label": "table", "n_rows": 4, "n_cols": 4, "integrity": { "cells_checked": 14, "cells_flagged": 2, "flags": [ { "row": 2, "col": 1, "coverage": 0, "text": "Max=0.09 cfs @ 12.99 hrs" }, { "row": 3, "col": 1, "coverage": 0, "text": "Max=0.00 cfs @ 5.00 hrs" } ] } }, "children": [ { "id": "p55.7.1", "order": 20, "type": "table_cell", "bbox": { "l": 54.000153, "t": 334.681717, "r": 86.82526, "b": 308.893607 }, "text": "Device\n#1", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p55.7.2", "order": 21, "type": "table_cell", "bbox": { "l": 98.873664, "t": 334.681717, "r": 147.222394, "b": 308.893607 }, "text": "Routing\nDiscarded", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p55.7.3", "order": 22, "type": "table_cell", "bbox": { "l": 175.965845, "t": 334.681717, "r": 210.937678, "b": 308.893607 }, "text": "Invert\n107.50'", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p55.7.4", "order": 23, "type": "table_cell", "bbox": { "l": 223.014009, "t": 334.681717, "r": 453.384188, "b": 297.012765 }, "text": "Outlet Devices\n1.000 in/hr Exfiltration over Surface area\\nConductivity to Groundwater Elevation = 105.00'", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p55.7.5", "order": 24, "type": "table_cell", "bbox": { "l": 70.44, "t": 297.120177, "r": 82.384214, "b": 285.132998 }, "text": "#2", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p55.7.6", "order": 25, "type": "table_cell", "bbox": { "l": 98.876253, "t": 297.120177, "r": 135.868946, "b": 285.132998 }, "text": "Primary", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p55.7.7", "order": 26, "type": "table_cell", "bbox": { "l": 175.97229, "t": 297.120177, "r": 210.870449, "b": 285.132998 }, "text": "109.00'", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p55.7.8", "order": 27, "type": "table_cell", "bbox": { "l": 223.01982, "t": 297.120177, "r": 445.634412, "b": 273.253231 }, "text": "8.0\" W x 4.0\" H Vert. Orifice/Grate C= 0.600\\nLimited to weir flow at low heads", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p55.7.9", "order": 28, "type": "table_cell", "bbox": { "l": 53.999519, "t": 261.300424, "r": 231.763157, "b": 237.43347700000004 }, "text": "Discarded OutFlow\n1=Exfiltration ( Controls 0.09 cfs)", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 8 }, { "id": "p55.7.10", "order": 29, "type": "table_cell", "bbox": { "l": 306.24, "t": 275.8971, "r": 434.76, "b": 255.9429 }, "text": "Max=0.09 cfs @ 12.99 hrs", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1 }, "reading_order": 9 }, { "id": "p55.7.11", "order": 30, "type": "table_cell", "bbox": { "l": 288.212459, "t": 261.48087599999997, "r": 436.986672, "b": 249.493697 }, "text": "HW=108.37' (Free Discharge)", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p55.7.12", "order": 31, "type": "table_cell", "bbox": { "l": 54, "t": 225.66078600000003, "r": 240.461861, "b": 201.79384000000005 }, "text": "Primary OutFlow\n2=Orifice/Grate ( Controls 0.00 cfs)", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 11 }, { "id": "p55.7.13", "order": 32, "type": "table_cell", "bbox": { "l": 306.24, "t": 235.9886, "r": 434.76, "b": 216.0343 }, "text": "Max=0.00 cfs @ 5.00 hrs", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1 }, "reading_order": 12 }, { "id": "p55.7.14", "order": 33, "type": "table_cell", "bbox": { "l": 270.45344, "t": 225.84123799999998, "r": 419.227653, "b": 213.854059 }, "text": "HW=107.50' (Free Discharge)", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 } ], "reading_order": 6 }, { "id": "p55.8", "order": 34, "type": "footnote", "bbox": { "l": 190.32, "t": 382.08, "r": 357.36, "b": 368.88 }, "text": "0.105 af Total Available Storage", "attrs": { "block_label": "vision_footnote" }, "reading_order": 7 } ] }, { "document_id": 11809, "page": 56, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 6, "counts_by_type": { "figure": 1, "footer": 1, "header": 1, "text": 2, "title": 1 }, "build_ms": 1, "items": [ { "id": "p56.1", "order": 1, "type": "header", "bbox": { "l": 53.04, "t": 738.72, "r": 560.88, "b": 698.16 }, "text": "POST DEV NOAA 24-hr D 2 YEAR Rainfall=3.42\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 20", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p56.2", "order": 2, "type": "title", "bbox": { "l": 126.48, "t": 687.84, "r": 494.4, "b": 672.72 }, "text": "Pond 8P: SSIB #2 UNDERGROUND - Chamber Wizard Field A", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p56.3", "order": 3, "type": "text", "bbox": { "l": 49.68, "t": 661.44, "r": 543.12, "b": 406.08 }, "text": "Chamber Model = ADS N-12 24\" (ADS N-12® Pipe)\nInside= 23.8\"W x 23.8\"H => 3.10 sf x 20.00'L = 62.0 cf\nOutside= 28.0\"W x 28.0\"H => 3.92 sf x 20.00'L = 78.4 cf\n28.0\" Wide + 13.4\" Spacing = 41.4\" C-C Row Spacing\n3 Chambers/Row x 20.00' Long +2.33' Header x 2 = 64.67' Row Length +10.0\" End Stone x 2 = 66.33' Base Length\n12 Rows x 28.0\" Wide + 13.4\" Spacing x 11 + 10.0\" Side Stone x 2 = 41.95' Base Width\n4.0\" Stone Base + 28.0\" Chamber Height + 4.0\" Stone Cover = 3.00' Field Height\n36 Chambers x 62.0 cf + 40.28' Header x 3.10 sf x 2 = 2,481.8 cf Chamber Storage\n36 Chambers x 78.4 cf + 40.28' Header x 3.92 sf x 2 = 3,137.9 cf Displacement\n8,348.3 cf Field - 3,137.9 cf Chambers = 5,210.4 cf Stone x 40.0% Voids = 2,084.2 cf Stone Storage\nChamber Storage + Stone Storage = 4,565.9 cf = 0.105 af\nOverall Storage Efficiency = 54.7%\nOverall System Size = 66.33' x 41.95' x 3.00'", "attrs": { "block_label": "algorithm" }, "reading_order": 2 }, { "id": "p56.4", "order": 4, "type": "text", "bbox": { "l": 52.08, "t": 400.8, "r": 127.92, "b": 360.48 }, "text": "36 Chambers\n309.2 cy Field\n193.0 cy Stone", "reading_order": 3 }, { "id": "p56.5", "order": 5, "type": "figure", "bbox": { "l": 223.68, "t": 346.8, "r": 387.84, "b": 93.36 }, "text": "", "attrs": { "block_label": "image" }, "reading_order": 4 }, { "id": "p56.6", "order": 6, "type": "footer", "bbox": { "l": 223.2, "t": 66.48, "r": 387.12, "b": 53.76 }, "text": "0101010101010101010", "attrs": { "block_label": "footer" }, "reading_order": 5 } ] }, { "document_id": 11809, "page": 57, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 3, "counts_by_type": { "caption": 1, "figure": 1, "header": 1 }, "build_ms": 0, "items": [ { "id": "p57.1", "order": 1, "type": "header", "bbox": { "l": 52.32, "t": 737.52, "r": 562.56, "b": 698.64 }, "text": "POST DEV NOAA 24-hr D 2 YEAR Rainfall=3.42\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 21", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p57.2", "order": 2, "type": "caption", "bbox": { "l": 203.28, "t": 687.84, "r": 413.76, "b": 672.96 }, "text": "Pond 8P: SSIB #2 UNDERGROUND", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p57.3", "order": 3, "type": "figure", "bbox": { "l": 61.92, "t": 672.72, "r": 552, "b": 400.08 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nInflow\n0.93 cfs Outflow\nInflow Area=0.460 ac Primary\nDiscarded\n1\nPeak Elev=108.37'\nStorage=0.025 af\n(cfs)\nFlow\n0.09 cfs\n0.09 cfs\n0.00 cfs\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 2 } ] }, { "document_id": 11809, "page": 58, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 12, "counts_by_type": { "caption": 1, "header": 1, "table": 2, "table_cell": 8 }, "build_ms": 15, "items": [ { "id": "p58.1", "order": 1, "type": "header", "bbox": { "l": 51.6, "t": 738, "r": 560.64, "b": 698.64 }, "text": "POST DEV NOAA 24-hr D 2 YEAR Rainfall=3.42\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 22", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p58.2", "order": 2, "type": "caption", "bbox": { "l": 153.84, "t": 687.84, "r": 466.32, "b": 672.72 }, "text": "Stage-Discharge for Pond 8P: SSIB #2 UNDERGROUND", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p58.3", "order": 3, "type": "table", "bbox": { "l": 56.4, "t": 661.92, "r": 275.04, "b": 56.64 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 4, "integrity": { "cells_checked": 4, "cells_flagged": 0 } }, "children": [ { "id": "p58.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 57.3, "t": 661.21453, "r": 97.73433, "b": 59.66617199999996 }, "text": "Elevation (feet)\n107.50\n107.55\n107.60\n107.65\n107.70\n107.75\n107.80\n107.85\n107.90\n107.95\n108.00\n108.05\n108.10\n108.15\n108.20\n108.25\n108.30\n108.35\n108.40\n108.45\n108.50\n108.55\n108.60\n108.65\n108.70\n108.75\n108.80\n108.85\n108.90\n108.95\n109.00\n109.05\n109.10\n109.15\n109.20\n109.25\n109.30\n109.35\n109.40\n109.45\n109.50\n109.55\n109.60\n109.65\n109.70\n109.75\n109.80\n109.85\n109.90\n109.95\n110.00\n110.05\n110.10", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p58.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 109.260182, "t": 661.21453, "r": 153.49646, "b": 59.66617199999996 }, "text": "Discharge (cfs)\n0.00\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.08\n0.08\n0.08\n0.08\n0.08\n0.08\n0.08\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.13\n0.17\n0.23\n0.30\n0.38\n0.46\n0.55\n0.62\n0.68\n0.73\n0.77\n0.82\n0.86\n0.90\n0.94\n0.97\n1.01\n1.04\n1.07\n1.10\n1.13\n1.16", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p58.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 165.000251, "t": 661.21453, "r": 209.236529, "b": 59.66617199999996 }, "text": "Discarded (cfs)\n0.00\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.08\n0.08\n0.08\n0.08\n0.08\n0.08\n0.08\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.11\n0.11\n0.11\n0.11\n0.11\n0.11\n0.11\n0.11\n0.12\n0.12\n0.12\n0.12\n0.12\n0.12\n0.12\n0.12\n0.13\n0.13\n0.13\n0.13\n0.13", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p58.3.4", "order": 7, "type": "table_cell", "bbox": { "l": 231.060808, "t": 661.21453, "r": 264.933898, "b": 59.66617199999996 }, "text": "Primary (cfs)\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.02\n0.07\n0.12\n0.19\n0.27\n0.35\n0.44\n0.50\n0.56\n0.61\n0.66\n0.70\n0.74\n0.78\n0.81\n0.85\n0.88\n0.91\n0.95\n0.98\n1.00\n1.03", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 } ], "reading_order": 2 }, { "id": "p58.4", "order": 8, "type": "table", "bbox": { "l": 282.24, "t": 662.88, "r": 498.24, "b": 550.8 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 4, "integrity": { "cells_checked": 4, "cells_flagged": 0 } }, "children": [ { "id": "p58.4.1", "order": 9, "type": "table_cell", "bbox": { "l": 287.88, "t": 661.21453, "r": 328.31433, "b": 551.0662580000001 }, "text": "Elevation (feet)\n110.15\n110.20\n110.25\n110.30\n110.35\n110.40\n110.45\n110.50", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p58.4.2", "order": 10, "type": "table_cell", "bbox": { "l": 339.840182, "t": 661.21453, "r": 384.526148, "b": 551.006306 }, "text": "Discharge (cfs)\n1.19\n1.22\n1.25\n1.27\n1.30\n1.33\n1.35\n1.38", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p58.4.3", "order": 11, "type": "table_cell", "bbox": { "l": 395.580251, "t": 661.21453, "r": 440.263268, "b": 551.006306 }, "text": "Discarded (cfs)\n0.13\n0.13\n0.14\n0.14\n0.14\n0.14\n0.14\n0.14", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p58.4.4", "order": 12, "type": "table_cell", "bbox": { "l": 461.640808, "t": 661.21453, "r": 496.000389, "b": 551.006306 }, "text": "Primary (cfs)\n1.06\n1.09\n1.11\n1.14\n1.16\n1.19\n1.21\n1.23", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 } ], "reading_order": 3 } ] }, { "document_id": 11809, "page": 59, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 10, "counts_by_type": { "caption": 1, "header": 1, "table": 2, "table_cell": 6 }, "build_ms": 9, "items": [ { "id": "p59.1", "order": 1, "type": "header", "bbox": { "l": 51.6, "t": 738.48, "r": 561.6, "b": 698.88 }, "text": "POST DEV NOAA 24-hr D 2 YEAR Rainfall=3.42\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 23", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p59.2", "order": 2, "type": "caption", "bbox": { "l": 146.16, "t": 687.84, "r": 474.48, "b": 672.72 }, "text": "Stage-Area-Storage for Pond 8P: SSIB #2 UNDERGROUND", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p59.3", "order": 3, "type": "table", "bbox": { "l": 56.64, "t": 661.21453, "r": 235.68, "b": 57.12 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 3, "integrity": { "cells_checked": 3, "cells_flagged": 0 } }, "children": [ { "id": "p59.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 57.3, "t": 661.21453, "r": 97.73433, "b": 59.66617199999996 }, "text": "Elevation (feet)\n107.50\n107.55\n107.60\n107.65\n107.70\n107.75\n107.80\n107.85\n107.90\n107.95\n108.00\n108.05\n108.10\n108.15\n108.20\n108.25\n108.30\n108.35\n108.40\n108.45\n108.50\n108.55\n108.60\n108.65\n108.70\n108.75\n108.80\n108.85\n108.90\n108.95\n109.00\n109.05\n109.10\n109.15\n109.20\n109.25\n109.30\n109.35\n109.40\n109.45\n109.50\n109.55\n109.60\n109.65\n109.70\n109.75\n109.80\n109.85\n109.90\n109.95\n110.00\n110.05\n110.10", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p59.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 125.040179, "t": 661.21453, "r": 159.530474, "b": 59.66617199999996 }, "text": "Surface (acres)\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p59.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 182.880513, "t": 661.21453, "r": 228.350762, "b": 59.66617199999996 }, "text": "Storage (acre-feet)\n0.000\n0.001\n0.003\n0.004\n0.005\n0.006\n0.008\n0.009\n0.010\n0.011\n0.012\n0.013\n0.014\n0.016\n0.018\n0.020\n0.022\n0.024\n0.026\n0.028\n0.030\n0.032\n0.034\n0.036\n0.039\n0.041\n0.043\n0.045\n0.048\n0.050\n0.052\n0.055\n0.057\n0.059\n0.062\n0.064\n0.066\n0.068\n0.071\n0.073\n0.075\n0.077\n0.079\n0.081\n0.083\n0.085\n0.087\n0.089\n0.090\n0.092\n0.093\n0.094\n0.095", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 } ], "reading_order": 2 }, { "id": "p59.4", "order": 7, "type": "table", "bbox": { "l": 246.48, "t": 662.4, "r": 425.04, "b": 551.006306 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 3, "integrity": { "cells_checked": 3, "cells_flagged": 0 } }, "children": [ { "id": "p59.4.1", "order": 8, "type": "table_cell", "bbox": { "l": 251.28, "t": 661.21453, "r": 291.71433, "b": 551.0662580000001 }, "text": "Elevation (feet)\n110.15\n110.20\n110.25\n110.30\n110.35\n110.40\n110.45\n110.50", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p59.4.2", "order": 9, "type": "table_cell", "bbox": { "l": 319.020179, "t": 661.21453, "r": 352.90408, "b": 551.0662580000001 }, "text": "Surface (acres)\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p59.4.3", "order": 10, "type": "table_cell", "bbox": { "l": 376.860513, "t": 661.21453, "r": 422.930276, "b": 551.006306 }, "text": "Storage (acre-feet)\n0.096\n0.097\n0.098\n0.100\n0.101\n0.102\n0.104\n0.105", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 } ], "reading_order": 3 } ] }, { "document_id": 11809, "page": 60, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 32, "counts_by_type": { "footnote": 1, "header": 1, "heading": 3, "table": 2, "table_cell": 24, "text": 1 }, "build_ms": 6, "items": [ { "id": "p60.1", "order": 1, "type": "header", "bbox": { "l": 52.32, "t": 738.72, "r": 561.36, "b": 698.64 }, "text": "POST DEV NOAA 24-hr D 2 YEAR Rainfall=3.42\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 24", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p60.2", "order": 2, "type": "heading", "bbox": { "l": 163.68, "t": 687.6, "r": 455.76, "b": 672.72 }, "text": "Summary for Pond 9P: SSIB #3 UNDERGROUND", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p60.3", "order": 3, "type": "heading", "bbox": { "l": 52.32, "t": 659.52, "r": 301.44, "b": 645.84 }, "text": "[82] Warning: Early inflow requires earlier time span", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 2 }, { "id": "p60.4", "order": 4, "type": "text", "bbox": { "l": 52.32, "t": 638.4, "r": 551.76, "b": 489.84 }, "text": "Inflow Area = 0.460 ac, 100.00% Impervious, Inflow Depth > 2.92\" for 2 YEAR event\nInflow = 1.48 cfs @ 12.10 hrs, Volume= 0.112 af\nOutflow = 0.12 cfs @ 13.25 hrs, Volume= 0.102 af, Atten= 92%, Lag= 69.2 min\nDiscarded = 0.12 cfs @ 13.25 hrs, Volume= 0.102 af\nPrimary = 0.00 cfs @ 5.00 hrs, Volume= 0.000 af\nRouted to Reach 10: COMPOSITE\n\nRouting by Stor-Ind method, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs\nPeak Elev= 111.92' @ 13.25 hrs Surf.Area= 0.085 ac Storage= 0.047 af\n\nPlug-Flow detention time= 144.1 min calculated for 0.101 af (91% of inflow)\nCenter-of-Mass det. time= 111.3 min (848.5 - 737.2)", "attrs": { "block_label": "algorithm" }, "reading_order": 3 }, { "id": "p60.5", "order": 5, "type": "table", "bbox": { "l": 52.32, "t": 482.64, "r": 556.8, "b": 370.213607 }, "text": "", "attrs": { "block_label": "table", "n_rows": 3, "n_cols": 4, "integrity": { "cells_checked": 10, "cells_flagged": 0 } }, "children": [ { "id": "p60.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 54, "t": 481.084378, "r": 549.157135, "b": 443.412765 }, "text": "Volume\n#1A\n0.255 af Overall - 0.096 af Embedded = 0.159 af x 40.0% Voids", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p60.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 115.437146, "t": 481.084378, "r": 150.396899, "b": 455.293607 }, "text": "Invert\n110.80'", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p60.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 167.453925, "t": 481.084378, "r": 231.331841, "b": 455.293607 }, "text": "Avail.Storage\n0.063 af", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p60.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 243.466175, "t": 481.084378, "r": 412.943681, "b": 455.113155 }, "text": "Storage Description\n55.75'W x 66.33'L x 3.00'H Field A", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p60.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 66.12, "t": 443.520177, "r": 85.228595, "b": 431.532998 }, "text": "#2A", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p60.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 115.437146, "t": 443.520177, "r": 150.335304, "b": 431.532998 }, "text": "111.13'", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p60.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 192.471958, "t": 443.520177, "r": 231.290655, "b": 431.532998 }, "text": "0.076 af", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p60.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 243.479769, "t": 443.520177, "r": 509.915235, "b": 384.013929 }, "text": "ADS N-12 24\" x 48 Inside #1\\nInside = 23.8\"W x 23.8\"H => 3.10 sf x 20.00'L = 62.0 cf\\nOutside = 28.0\"W x 28.0\"H => 3.92 sf x 20.00'L = 78.4 cf\\n48 Chambers in 16 Rows\\n54.08' Header x 3.10 sf x 2 = 335.3 cf Inside", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p60.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 52.32, "t": 397.2, "r": 178.44, "b": 375.84 }, "text": "", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 8 }, { "id": "p60.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 178.44, "t": 397.2, "r": 304.56, "b": 375.84 }, "text": "", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1 }, "reading_order": 9 }, { "id": "p60.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 192.48, "t": 382.200786, "r": 231.298697, "b": 370.213607 }, "text": "0.139 af", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p60.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 243.477069, "t": 382.200786, "r": 354.519595, "b": 370.213607 }, "text": "Total Available Storage", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 } ], "reading_order": 4 }, { "id": "p60.6", "order": 18, "type": "heading", "bbox": { "l": 67.2, "t": 358.8, "r": 295.44, "b": 345.36 }, "text": "Storage Group A created with Chamber Wizard", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 5 }, { "id": "p60.7", "order": 19, "type": "table", "bbox": { "l": 49.2, "t": 335.52, "r": 562.8, "b": 196.8 }, "text": "", "attrs": { "block_label": "table", "n_rows": 4, "n_cols": 4, "integrity": { "cells_checked": 12, "cells_flagged": 2, "flags": [ { "row": 2, "col": 1, "coverage": 0, "text": "Max=0.12 cfs @ 13.25 hrs HW=111.92' (Free Discharge)" }, { "row": 3, "col": 1, "coverage": 0.29, "text": "Max=0.00 cfs @ 5.00 hrs HW=110.80' (Free Discharge)" } ] } }, "children": [ { "id": "p60.7.1", "order": 20, "type": "table_cell", "bbox": { "l": 54.000153, "t": 334.681717, "r": 86.82526, "b": 308.893607 }, "text": "Device\n#1", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p60.7.2", "order": 21, "type": "table_cell", "bbox": { "l": 98.873664, "t": 334.681717, "r": 147.222394, "b": 308.893607 }, "text": "Routing\nDiscarded", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p60.7.3", "order": 22, "type": "table_cell", "bbox": { "l": 175.965845, "t": 334.681717, "r": 210.937678, "b": 308.893607 }, "text": "Invert\n110.80'", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p60.7.4", "order": 23, "type": "table_cell", "bbox": { "l": 223.014009, "t": 334.681717, "r": 453.384188, "b": 297.012765 }, "text": "Outlet Devices\n1.000 in/hr Exfiltration over Surface area\\nConductivity to Groundwater Elevation = 108.00'", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p60.7.5", "order": 24, "type": "table_cell", "bbox": { "l": 70.44, "t": 297.120177, "r": 82.384214, "b": 285.132998 }, "text": "#2", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p60.7.6", "order": 25, "type": "table_cell", "bbox": { "l": 98.876253, "t": 297.120177, "r": 135.868946, "b": 285.132998 }, "text": "Primary", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p60.7.7", "order": 26, "type": "table_cell", "bbox": { "l": 175.97229, "t": 297.120177, "r": 210.870449, "b": 285.132998 }, "text": "113.00'", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p60.7.8", "order": 27, "type": "table_cell", "bbox": { "l": 223.01982, "t": 297.120177, "r": 451.453995, "b": 273.253231 }, "text": "12.0\" W x 6.0\" H Vert. Orifice/Grate C= 0.600\\nLimited to weir flow at low heads", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p60.7.9", "order": 28, "type": "table_cell", "bbox": { "l": 53.999519, "t": 261.300424, "r": 231.763157, "b": 237.43347700000004 }, "text": "Discarded OutFlow\n1=Exfiltration ( Controls 0.12 cfs)", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 8 }, { "id": "p60.7.10", "order": 29, "type": "table_cell", "bbox": { "l": 306, "t": 276.0686, "r": 562.8, "b": 256.2514 }, "text": "Max=0.12 cfs @ 13.25 hrs HW=111.92' (Free Discharge)", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 2 }, "reading_order": 9 }, { "id": "p60.7.11", "order": 30, "type": "table_cell", "bbox": { "l": 54, "t": 225.66078600000003, "r": 240.461861, "b": 201.79384000000005 }, "text": "Primary OutFlow\n2=Orifice/Grate ( Controls 0.00 cfs)", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 10 }, { "id": "p60.7.12", "order": 31, "type": "table_cell", "bbox": { "l": 306, "t": 236.4343, "r": 562.8, "b": 216.6171 }, "text": "Max=0.00 cfs @ 5.00 hrs HW=110.80' (Free Discharge)", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 2 }, "reading_order": 11 } ], "reading_order": 6 }, { "id": "p60.8", "order": 32, "type": "footnote", "bbox": { "l": 190.32, "t": 381.84, "r": 357.36, "b": 368.88 }, "text": "0.139 af Total Available Storage", "attrs": { "block_label": "vision_footnote" }, "reading_order": 7 } ] }, { "document_id": 11809, "page": 61, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 7, "counts_by_type": { "figure": 1, "footer": 1, "header": 2, "text": 2, "title": 1 }, "build_ms": 1, "items": [ { "id": "p61.1", "order": 1, "type": "header", "bbox": { "l": 360.72, "t": 739.44, "r": 560.4, "b": 700.8 }, "text": "NOAA 24-hr D 2 YEAR Rainfall=3.42\"\nPrinted 12/31/2025\nPage 25", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p61.2", "order": 2, "type": "header", "bbox": { "l": 50.88, "t": 737.52, "r": 393.12, "b": 698.88 }, "text": "POST DEV NOAA\nPrepared by Professional Design Services\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p61.3", "order": 3, "type": "title", "bbox": { "l": 126.48, "t": 687.84, "r": 494.4, "b": 672.72 }, "text": "Pond 9P: SSIB #3 UNDERGROUND - Chamber Wizard Field A", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 2 }, { "id": "p61.4", "order": 4, "type": "text", "bbox": { "l": 49.68, "t": 662.64, "r": 544.8, "b": 406.08 }, "text": "Chamber Model = ADS N-12 24\" (ADS N-12® Pipe)\nInside= 23.8\"W x 23.8\"H => 3.10 sf x 20.00'L = 62.0 cf\nOutside= 28.0\"W x 28.0\"H => 3.92 sf x 20.00'L = 78.4 cf\n28.0\" Wide + 13.4\" Spacing = 41.4\" C-C Row Spacing\n3 Chambers/Row x 20.00' Long +2.33' Header x 2 = 64.67' Row Length +10.0\" End Stone x 2 = 66.33' Base Length\n16 Rows x 28.0\" Wide + 13.4\" Spacing x 15 + 10.0\" Side Stone x 2 = 55.75' Base Width\n4.0\" Stone Base + 28.0\" Chamber Height + 4.0\" Stone Cover = 3.00' Field Height\n48 Chambers x 62.0 cf + 54.08' Header x 3.10 sf x 2 = 3,311.3 cf Chamber Storage\n48 Chambers x 78.4 cf + 54.08' Header x 3.92 sf x 2 = 4,186.8 cf Displacement\n11,094.6 cf Field - 4,186.8 cf Chambers = 6,907.8 cf Stone x 40.0% Voids = 2,763.1 cf Stone Storage\nChamber Storage + Stone Storage = 6,074.4 cf = 0.139 af\nOverall Storage Efficiency = 54.8%\nOverall System Size = 66.33' x 55.75' x 3.00'", "attrs": { "block_label": "algorithm" }, "reading_order": 3 }, { "id": "p61.5", "order": 5, "type": "text", "bbox": { "l": 51.84, "t": 400.56, "r": 127.92, "b": 360.48 }, "text": "48 Chambers\n410.9 cy Field\n255.8 cy Stone", "reading_order": 4 }, { "id": "p61.6", "order": 6, "type": "figure", "bbox": { "l": 196.8, "t": 348.96, "r": 414.72, "b": 92.88 }, "text": "", "attrs": { "block_label": "image" }, "reading_order": 5 }, { "id": "p61.7", "order": 7, "type": "footer", "bbox": { "l": 197.04, "t": 66.24, "r": 414.48, "b": 53.76 }, "text": "101010", "attrs": { "block_label": "footer" }, "reading_order": 6 } ] }, { "document_id": 11809, "page": 62, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 3, "counts_by_type": { "caption": 1, "figure": 1, "header": 1 }, "build_ms": 0, "items": [ { "id": "p62.1", "order": 1, "type": "header", "bbox": { "l": 52.56, "t": 737.52, "r": 562.08, "b": 698.64 }, "text": "POST DEV NOAA 24-hr D 2 YEAR Rainfall=3.42\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 26", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p62.2", "order": 2, "type": "caption", "bbox": { "l": 203.28, "t": 687.84, "r": 413.76, "b": 672.96 }, "text": "Pond 9P: SSIB #3 UNDERGROUND", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p62.3", "order": 3, "type": "figure", "bbox": { "l": 60.96, "t": 670.56, "r": 552.24, "b": 400.08 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nInflow\n1.48 cfs Outflow\nInflow Area=0.460 ac Primary\nDiscarded\nPeak Elev=111.92'\nStorage=0.047 af\n1\n(cfs)\nFlow\n0.12 cfs\n0.12 cfs\n0.00 cfs\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 2 } ] }, { "document_id": 11809, "page": 63, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 12, "counts_by_type": { "caption": 1, "header": 1, "table": 2, "table_cell": 8 }, "build_ms": 14, "items": [ { "id": "p63.1", "order": 1, "type": "header", "bbox": { "l": 51.84, "t": 738.48, "r": 560.88, "b": 698.64 }, "text": "POST DEV NOAA 24-hr D 2 YEAR Rainfall=3.42\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 27", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p63.2", "order": 2, "type": "caption", "bbox": { "l": 154.08, "t": 687.84, "r": 466.08, "b": 672.72 }, "text": "Stage-Discharge for Pond 9P: SSIB #3 UNDERGROUND", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p63.3", "order": 3, "type": "table", "bbox": { "l": 56.88, "t": 661.44, "r": 275.28, "b": 56.88 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 4, "integrity": { "cells_checked": 4, "cells_flagged": 0 } }, "children": [ { "id": "p63.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 57.3, "t": 661.21453, "r": 97.73433, "b": 59.66617199999996 }, "text": "Elevation (feet)\n110.80\n110.85\n110.90\n110.95\n111.00\n111.05\n111.10\n111.15\n111.20\n111.25\n111.30\n111.35\n111.40\n111.45\n111.50\n111.55\n111.60\n111.65\n111.70\n111.75\n111.80\n111.85\n111.90\n111.95\n112.00\n112.05\n112.10\n112.15\n112.20\n112.25\n112.30\n112.35\n112.40\n112.45\n112.50\n112.55\n112.60\n112.65\n112.70\n112.75\n112.80\n112.85\n112.90\n112.95\n113.00\n113.05\n113.10\n113.15\n113.20\n113.25\n113.30\n113.35\n113.40", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p63.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 109.260182, "t": 661.21453, "r": 153.49646, "b": 59.66617199999996 }, "text": "Discharge (cfs)\n0.00\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.11\n0.11\n0.11\n0.11\n0.11\n0.11\n0.11\n0.12\n0.12\n0.12\n0.12\n0.12\n0.12\n0.13\n0.13\n0.13\n0.13\n0.13\n0.13\n0.13\n0.14\n0.14\n0.14\n0.14\n0.14\n0.14\n0.15\n0.15\n0.15\n0.15\n0.15\n0.15\n0.19\n0.26\n0.34\n0.45\n0.56\n0.69\n0.83\n0.98", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p63.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 165.000251, "t": 661.21453, "r": 209.236529, "b": 59.66617199999996 }, "text": "Discarded (cfs)\n0.00\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.11\n0.11\n0.11\n0.11\n0.11\n0.11\n0.11\n0.12\n0.12\n0.12\n0.12\n0.12\n0.12\n0.13\n0.13\n0.13\n0.13\n0.13\n0.13\n0.13\n0.14\n0.14\n0.14\n0.14\n0.14\n0.14\n0.15\n0.15\n0.15\n0.15\n0.15\n0.15\n0.15\n0.16\n0.16\n0.16\n0.16\n0.16\n0.16\n0.17", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p63.3.4", "order": 7, "type": "table_cell", "bbox": { "l": 231.060808, "t": 661.21453, "r": 264.933898, "b": 59.66617199999996 }, "text": "Primary (cfs)\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.04\n0.10\n0.19\n0.29\n0.40\n0.53\n0.66\n0.81", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 } ], "reading_order": 2 }, { "id": "p63.4", "order": 8, "type": "table", "bbox": { "l": 282.24, "t": 662.88, "r": 498.24, "b": 550.56 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 4, "integrity": { "cells_checked": 4, "cells_flagged": 0 } }, "children": [ { "id": "p63.4.1", "order": 9, "type": "table_cell", "bbox": { "l": 287.88, "t": 661.21453, "r": 328.31433, "b": 551.0662580000001 }, "text": "Elevation (feet)\n113.45\n113.50\n113.55\n113.60\n113.65\n113.70\n113.75\n113.80", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p63.4.2", "order": 10, "type": "table_cell", "bbox": { "l": 339.840182, "t": 661.21453, "r": 384.526148, "b": 551.006306 }, "text": "Discharge (cfs)\n1.14\n1.30\n1.44\n1.56\n1.67\n1.77\n1.86\n1.95", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p63.4.3", "order": 11, "type": "table_cell", "bbox": { "l": 395.580251, "t": 661.21453, "r": 440.263268, "b": 551.006306 }, "text": "Discarded (cfs)\n0.17\n0.17\n0.17\n0.17\n0.17\n0.17\n0.18\n0.18", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p63.4.4", "order": 12, "type": "table_cell", "bbox": { "l": 461.640808, "t": 661.21453, "r": 496.000389, "b": 551.006306 }, "text": "Primary (cfs)\n0.97\n1.13\n1.27\n1.39\n1.50\n1.59\n1.68\n1.77", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 } ], "reading_order": 3 } ] }, { "document_id": 11809, "page": 64, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 10, "counts_by_type": { "caption": 1, "header": 1, "table": 2, "table_cell": 6 }, "build_ms": 10, "items": [ { "id": "p64.1", "order": 1, "type": "header", "bbox": { "l": 51.84, "t": 738.48, "r": 561.36, "b": 698.88 }, "text": "POST DEV NOAA 24-hr D 2 YEAR Rainfall=3.42\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 28", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p64.2", "order": 2, "type": "caption", "bbox": { "l": 146.16, "t": 687.6, "r": 474.48, "b": 672.96 }, "text": "Stage-Area-Storage for Pond 9P: SSIB #3 UNDERGROUND", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p64.3", "order": 3, "type": "table", "bbox": { "l": 57.3, "t": 661.21453, "r": 235.92, "b": 56.88 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 3, "integrity": { "cells_checked": 3, "cells_flagged": 0 } }, "children": [ { "id": "p64.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 57.3, "t": 661.21453, "r": 97.73433, "b": 59.66617199999996 }, "text": "Elevation (feet)\n110.80\n110.85\n110.90\n110.95\n111.00\n111.05\n111.10\n111.15\n111.20\n111.25\n111.30\n111.35\n111.40\n111.45\n111.50\n111.55\n111.60\n111.65\n111.70\n111.75\n111.80\n111.85\n111.90\n111.95\n112.00\n112.05\n112.10\n112.15\n112.20\n112.25\n112.30\n112.35\n112.40\n112.45\n112.50\n112.55\n112.60\n112.65\n112.70\n112.75\n112.80\n112.85\n112.90\n112.95\n113.00\n113.05\n113.10\n113.15\n113.20\n113.25\n113.30\n113.35\n113.40", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p64.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 125.040179, "t": 661.21453, "r": 159.530474, "b": 59.66617199999996 }, "text": "Surface (acres)\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p64.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 182.880513, "t": 661.21453, "r": 228.350762, "b": 59.66617199999996 }, "text": "Storage (acre-feet)\n0.000\n0.002\n0.003\n0.005\n0.007\n0.008\n0.010\n0.012\n0.013\n0.015\n0.016\n0.017\n0.019\n0.021\n0.024\n0.026\n0.029\n0.031\n0.034\n0.037\n0.040\n0.042\n0.045\n0.048\n0.051\n0.054\n0.057\n0.060\n0.064\n0.067\n0.070\n0.073\n0.076\n0.079\n0.082\n0.085\n0.088\n0.091\n0.094\n0.097\n0.100\n0.103\n0.105\n0.108\n0.111\n0.113\n0.116\n0.118\n0.120\n0.122\n0.124\n0.125\n0.126", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 } ], "reading_order": 2 }, { "id": "p64.4", "order": 7, "type": "table", "bbox": { "l": 246.48, "t": 662.16, "r": 425.04, "b": 551.006306 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 3, "integrity": { "cells_checked": 3, "cells_flagged": 0 } }, "children": [ { "id": "p64.4.1", "order": 8, "type": "table_cell", "bbox": { "l": 251.28, "t": 661.21453, "r": 291.71433, "b": 551.0662580000001 }, "text": "Elevation (feet)\n113.45\n113.50\n113.55\n113.60\n113.65\n113.70\n113.75\n113.80", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p64.4.2", "order": 9, "type": "table_cell", "bbox": { "l": 319.020179, "t": 661.21453, "r": 352.90408, "b": 551.0662580000001 }, "text": "Surface (acres)\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p64.4.3", "order": 10, "type": "table_cell", "bbox": { "l": 376.860513, "t": 661.21453, "r": 422.930276, "b": 551.006306 }, "text": "Storage (acre-feet)\n0.128\n0.129\n0.131\n0.133\n0.134\n0.136\n0.138\n0.139", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 } ], "reading_order": 3 } ] }, { "document_id": 11809, "page": 65, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 18, "counts_by_type": { "text": 18 }, "build_ms": 2, "items": [ { "id": "p65.1", "order": 1, "type": "text", "bbox": { "l": 50.88, "t": 738.96, "r": 561.6, "b": 700.56 }, "text": "POST DEV NOAA 24-hr D 10 YEAR Rainfall=5.38\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 29", "reading_order": 0 }, { "id": "p65.2", "order": 2, "type": "text", "bbox": { "l": 120.48, "t": 687.36, "r": 490.32, "b": 650.88 }, "text": "Time span=5.00-20.00 hrs, dt=0.05 hrs, 301 points\nRunoff by SCS TR-20 method, UH=Delmarva, Weighted-CN\nReach routing by Stor-Ind+Trans method - Pond routing by Stor-Ind method", "reading_order": 1 }, { "id": "p65.3", "order": 3, "type": "text", "bbox": { "l": 257.76, "t": 640.08, "r": 560.16, "b": 616.32 }, "text": "Subcatchment1S: POROUS\nRunoff Area=0.570 ac 0.00% Impervious Runoff Depth>0.21\"\nFlow Length=310' Tc=12.9 min CN=39 Runoff=0.03 cfs 0.010 af", "reading_order": 2 }, { "id": "p65.4", "order": 4, "type": "text", "bbox": { "l": 259.44, "t": 605.28, "r": 559.92, "b": 580.8 }, "text": "Subcatchment2S: IMPERVIOUS\nRunoff Area=0.720 ac 100.00% Impervious Runoff Depth>4.66\"\nFlow Length=310' Tc=13.1 min CN=98 Runoff=2.16 cfs 0.280 af", "reading_order": 3 }, { "id": "p65.5", "order": 5, "type": "text", "bbox": { "l": 52.32, "t": 568.8, "r": 560.16, "b": 546 }, "text": "Subcatchment5S: IMPERVIOUS Runoff Area=0.270 ac 100.00% Impervious Runoff Depth>4.66\" Flow Length=180' Slope=0.0100'/' Tc=1.6 min CN=98 Runoff=1.48 cfs 0.105 af", "reading_order": 4 }, { "id": "p65.6", "order": 6, "type": "text", "bbox": { "l": 59.52, "t": 533.76, "r": 559.2, "b": 509.52 }, "text": "Runoff Area=0.190 ac 0.00% Impervious Runoff Depth>0.22\" Flow Length=250' Tc=12.4 min CN=39 Runoff=0.01 cfs 0.003 af", "reading_order": 5 }, { "id": "p65.7", "order": 7, "type": "text", "bbox": { "l": 51.6, "t": 532.56, "r": 196.32, "b": 520.8 }, "text": "Subcatchment6S: POROUS", "reading_order": 6 }, { "id": "p65.8", "order": 8, "type": "text", "bbox": { "l": 52.56, "t": 497.52, "r": 560.16, "b": 473.52 }, "text": "Subcatchment8S: PROP WAREHOUSE Runoff Area=0.460 ac 100.00% Impervious Runoff Depth>4.66\" Flow Length=280' Slope=0.0100'/' Tc=2.6 min CN=98 Runoff=2.35 cfs 0.179 af", "reading_order": 7 }, { "id": "p65.9", "order": 9, "type": "text", "bbox": { "l": 52.08, "t": 462.48, "r": 559.68, "b": 439.92 }, "text": "Subcatchment10S: BY-PASSPOROUS Runoff Area=0.060 ac 0.00% Impervious Runoff Depth>0.22\" Tc=2.0 min CN=39 Runoff=0.00 cfs 0.001 af", "reading_order": 8 }, { "id": "p65.10", "order": 10, "type": "text", "bbox": { "l": 52.08, "t": 426.48, "r": 559.68, "b": 402.96 }, "text": "Runoff Area=0.070 ac 100.00% Impervious Runoff Depth>4.66\"\nTc=2.0 min CN=98 Runoff=0.37 cfs 0.027 af", "reading_order": 9 }, { "id": "p65.11", "order": 11, "type": "text", "bbox": { "l": 51.6, "t": 425.52, "r": 203.76, "b": 413.76 }, "text": "Subcatchment11S: BY-PASS", "reading_order": 10 }, { "id": "p65.12", "order": 12, "type": "text", "bbox": { "l": 51.6, "t": 390, "r": 172.8, "b": 378.48 }, "text": "Reach 10: COMPOSITE", "reading_order": 11 }, { "id": "p65.13", "order": 13, "type": "text", "bbox": { "l": 441.36, "t": 390.96, "r": 560.64, "b": 366.96 }, "text": "Inflow=1.00 cfs 0.149 af\nOutflow=1.00 cfs 0.149 af", "reading_order": 12 }, { "id": "p65.14", "order": 14, "type": "text", "bbox": { "l": 52.8, "t": 355.2, "r": 559.44, "b": 330.72 }, "text": "Pond 3P: SSIB #1 SURFACE BASIN Peak Elev= $ 112.02' $ Storage=5,118 cf Inflow= $ 2.16 $ cfs 0.290 af Discarded=0.10 cfs 0.089 af Primary=0.95 cfs 0.120 af Outflow=1.05 cfs 0.209 af", "reading_order": 13 }, { "id": "p65.15", "order": 15, "type": "text", "bbox": { "l": 51.6, "t": 319.44, "r": 559.44, "b": 307.44 }, "text": "Pond 8P: SSIB #2 UNDERGROUND Peak Elev=108.89' Storage=0.047 af Inflow=1.48 cfs 0.108 af", "reading_order": 14 }, { "id": "p65.16", "order": 16, "type": "text", "bbox": { "l": 182.4, "t": 306.72, "r": 559.44, "b": 295.44 }, "text": "Discarded=0.10 cfs 0.088 af Primary=0.00 cfs 0.000 af Outflow=0.10 cfs 0.088 af", "reading_order": 15 }, { "id": "p65.17", "order": 17, "type": "text", "bbox": { "l": 52.8, "t": 283.68, "r": 561.36, "b": 259.92 }, "text": "Pond 9P: SSIB #3 UNDERGROUND Peak Elev=112.59' Storage=0.087 af Inflow=2.35 cfs 0.179 af Discarded=0.14 cfs 0.127 af Primary=0.00 cfs 0.000 af Outflow=0.14 cfs 0.127 af", "reading_order": 16 }, { "id": "p65.18", "order": 18, "type": "text", "bbox": { "l": 122.64, "t": 247.68, "r": 568.8, "b": 223.92 }, "text": "Total Runoff Area = 2.340 ac Runoff Volume = 0.605 af Average Runoff Depth = 3.10\"\n35.04% Pervious = 0.820 ac 64.96% Impervious = 1.520 ac", "reading_order": 17 } ] }, { "document_id": 11809, "page": 66, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 46, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "heading": 1, "table": 1, "table_cell": 39, "text": 2 }, "build_ms": 4, "items": [ { "id": "p66.1", "order": 1, "type": "header", "bbox": { "l": 52.56, "t": 738.48, "r": 560.88, "b": 698.88 }, "text": "POST DEV NOAA 24-hr D 10 YEAR Rainfall=5.38\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 30", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p66.2", "order": 2, "type": "heading", "bbox": { "l": 183.6, "t": 687.36, "r": 434.64, "b": 672.72 }, "text": "Summary for Subcatchment 1S: POROUS", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p66.3", "order": 3, "type": "text", "bbox": { "l": 52.8, "t": 660, "r": 464.16, "b": 634.32 }, "text": "Runoff = 0.03 cfs @ 13.03 hrs, Volume= 0.010 af, Depth> 0.21\"\nRouted to Pond 3P : SSIB #1 SURFACE BASIN", "reading_order": 2 }, { "id": "p66.4", "order": 4, "type": "text", "bbox": { "l": 52.08, "t": 624.24, "r": 541.44, "b": 598.8 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Weighted-CN, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs NOAA 24-hr D 10 YEAR Rainfall=5.38\"", "reading_order": 3 }, { "id": "p66.5", "order": 5, "type": "table", "bbox": { "l": 52.56, "t": 589.92, "r": 559.44, "b": 436.8 }, "text": "", "attrs": { "block_label": "table", "n_rows": 8, "n_cols": 7, "integrity": { "cells_checked": 31, "cells_flagged": 0 } }, "children": [ { "id": "p66.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 69.659595, "t": 588.002283, "r": 113.82741, "b": 576.0151040000001 }, "text": "Area (ac)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p66.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 130.796358, "t": 588.002283, "r": 146.30665, "b": 576.0151040000001 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p66.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 289.05701, "t": 536.641352, "r": 342.773751, "b": 524.654172 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p66.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 87, "t": 560.400886, "r": 113.874482, "b": 548.4137069999999 }, "text": "0.570", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 3 }, { "id": "p66.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 134.275244, "t": 574.200786, "r": 146.219458, "b": 562.213607 }, "text": "39", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p66.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 160.552515, "t": 574.200786, "r": 320.843443, "b": 562.213607 }, "text": ">75% Grass cover, Good, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true }, "reading_order": 5 }, { "id": "p66.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 87, "t": 574.200786, "r": 113.874482, "b": 562.213607 }, "text": "0.570", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 6 }, { "id": "p66.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 160.555738, "t": 560.400886, "r": 273.392044, "b": 548.4137069999999 }, "text": "100.00% Pervious Area", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 4, "bbox_refit": true }, "reading_order": 7 }, { "id": "p66.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 65.459598, "t": 536.641352, "r": 89.993572, "b": 512.774405 }, "text": "Tc\\n(min)", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p66.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 100.682141, "t": 536.641352, "r": 133.545916, "b": 512.774405 }, "text": "Length\\n(feet)", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p66.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 149.815612, "t": 536.641352, "r": 177.28086, "b": 512.774405 }, "text": "Slope\\n(ft/ft)", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p66.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 188.028505, "t": 536.641352, "r": 225.633446, "b": 512.774405 }, "text": "Velocity\\n(ft/sec)", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 }, { "id": "p66.5.13", "order": 18, "type": "table_cell", "bbox": { "l": 236.50354, "t": 536.641352, "r": 278.288957, "b": 512.774405 }, "text": "Capacity\\n(cfs)", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 12 }, { "id": "p66.5.14", "order": 19, "type": "table_cell", "bbox": { "l": 160.552704, "t": 588.002283, "r": 214.269445, "b": 576.0151040000001 }, "text": "Description", "attrs": { "row": 3, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 13 }, { "id": "p66.5.15", "order": 20, "type": "table_cell", "bbox": { "l": 69, "t": 510.960886, "r": 89.902375, "b": 498.973707 }, "text": "11.7", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p66.5.16", "order": 21, "type": "table_cell", "bbox": { "l": 115.676959, "t": 510.960886, "r": 133.59328, "b": 498.973707 }, "text": "100", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p66.5.17", "order": 22, "type": "table_cell", "bbox": { "l": 144.351666, "t": 510.960886, "r": 177.198256, "b": 498.973707 }, "text": "0.0300", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p66.5.18", "order": 23, "type": "table_cell", "bbox": { "l": 204.705395, "t": 510.960886, "r": 225.60777, "b": 498.973707 }, "text": "0.14", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p66.5.19", "order": 24, "type": "table_cell", "bbox": { "l": 342.2057, "t": 513.36, "r": 414.6171, "b": 494.22 }, "text": "", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 18 }, { "id": "p66.5.20", "order": 25, "type": "table_cell", "bbox": { "l": 289.079669, "t": 510.780434, "r": 461.873354, "b": 487.092865 }, "text": "Sheet Flow,\\nGrass: Dense n= 0.240 P2= 3.42\"", "attrs": { "row": 4, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 19 }, { "id": "p66.5.21", "order": 26, "type": "table_cell", "bbox": { "l": 75.000034, "t": 487.200277, "r": 89.930302, "b": 475.213098 }, "text": "0.3", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p66.5.22", "order": 27, "type": "table_cell", "bbox": { "l": 121.678067, "t": 487.200277, "r": 133.622282, "b": 475.213098 }, "text": "50", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p66.5.23", "order": 28, "type": "table_cell", "bbox": { "l": 144.354889, "t": 487.200277, "r": 177.201478, "b": 475.213098 }, "text": "0.0350", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 22 }, { "id": "p66.5.24", "order": 29, "type": "table_cell", "bbox": { "l": 204.708617, "t": 487.200277, "r": 225.610992, "b": 475.213098 }, "text": "2.81", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 23 }, { "id": "p66.5.25", "order": 30, "type": "table_cell", "bbox": { "l": 342.2057, "t": 494.22, "r": 414.6171, "b": 475.08 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 24 }, { "id": "p66.5.26", "order": 31, "type": "table_cell", "bbox": { "l": 289.079669, "t": 487.019825, "r": 449.370597, "b": 463.332257 }, "text": "Shallow Concentrated Flow,\\nGrassed Waterway Kv= 15.0 fps", "attrs": { "row": 5, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 25 }, { "id": "p66.5.27", "order": 32, "type": "table_cell", "bbox": { "l": 75.000034, "t": 463.439669, "r": 89.930302, "b": 451.45249 }, "text": "0.9", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 26 }, { "id": "p66.5.28", "order": 33, "type": "table_cell", "bbox": { "l": 115.679107, "t": 463.439669, "r": 133.595429, "b": 451.45249 }, "text": "160", "attrs": { "row": 6, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 27 }, { "id": "p66.5.29", "order": 34, "type": "table_cell", "bbox": { "l": 197.3829, "t": 475.08, "r": 269.7943, "b": 455.94 }, "text": "", "attrs": { "row": 6, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 28 }, { "id": "p66.5.30", "order": 35, "type": "table_cell", "bbox": { "l": 204.713988, "t": 463.439669, "r": 225.616363, "b": 451.45249 }, "text": "3.00", "attrs": { "row": 6, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 29 }, { "id": "p66.5.31", "order": 36, "type": "table_cell", "bbox": { "l": 342.2057, "t": 475.08, "r": 414.6171, "b": 455.94 }, "text": "", "attrs": { "row": 6, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 30 }, { "id": "p66.5.32", "order": 37, "type": "table_cell", "bbox": { "l": 289.079669, "t": 463.259217, "r": 415.020239, "b": 451.272038 }, "text": "Direct Entry, PIPE FLOW", "attrs": { "row": 6, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 31 }, { "id": "p66.5.33", "order": 38, "type": "table_cell", "bbox": { "l": 69, "t": 449.640786, "r": 89.902375, "b": 437.653607 }, "text": "12.9", "attrs": { "row": 7, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 32 }, { "id": "p66.5.34", "order": 39, "type": "table_cell", "bbox": { "l": 115.676959, "t": 449.640786, "r": 133.59328, "b": 437.653607 }, "text": "310", "attrs": { "row": 7, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 33 }, { "id": "p66.5.35", "order": 40, "type": "table_cell", "bbox": { "l": 144.351666, "t": 449.640786, "r": 168.229354, "b": 437.653607 }, "text": "Total", "attrs": { "row": 7, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 34 }, { "id": "p66.5.36", "order": 41, "type": "table_cell", "bbox": { "l": 269.7943, "t": 455.94, "r": 342.2057, "b": 436.8 }, "text": "", "attrs": { "row": 7, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 35 }, { "id": "p66.5.37", "order": 42, "type": "table_cell", "bbox": { "l": 342.2057, "t": 455.94, "r": 414.6171, "b": 436.8 }, "text": "", "attrs": { "row": 7, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 36 }, { "id": "p66.5.38", "order": 43, "type": "table_cell", "bbox": { "l": 414.6171, "t": 455.94, "r": 487.0286, "b": 436.8 }, "text": "", "attrs": { "row": 7, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 37 }, { "id": "p66.5.39", "order": 44, "type": "table_cell", "bbox": { "l": 487.0286, "t": 455.94, "r": 559.44, "b": 436.8 }, "text": "", "attrs": { "row": 7, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 38 } ], "reading_order": 4 }, { "id": "p66.6", "order": 45, "type": "caption", "bbox": { "l": 222.72, "t": 425.28, "r": 393.36, "b": 410.64 }, "text": "Subcatchment 1S: POROUS", "attrs": { "block_label": "figure_title" }, "reading_order": 5 }, { "id": "p66.7", "order": 46, "type": "figure", "bbox": { "l": 62.4, "t": 404.88, "r": 552.72, "b": 138.24 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n0.032 Runoff\n0.03 0.03 cfs\n0.028 NOAA 24-hr D\n10 YEAR Rainfall=5.38\"\n0.026\n0.024\n0.022 Runoff Area=0.570 ac\n0.02 Runoff Volume=0.010 af\n(cfs) Runoff Depth>0.21\"\n0.018\n0.016\nFlow 0.014 Flow Length=310'\nTc=12.9 min\n0.012\n0.01\nCN=39\n0.008\n0.006\n0.004\n0.002\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 6 } ] }, { "document_id": 11809, "page": 67, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 46, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "heading": 1, "table": 1, "table_cell": 38, "text": 3 }, "build_ms": 4, "items": [ { "id": "p67.1", "order": 1, "type": "header", "bbox": { "l": 52.56, "t": 738.48, "r": 560.4, "b": 698.64 }, "text": "POST DEV NOAA 24-hr D 10 YEAR Rainfall=5.38\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 31", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p67.2", "order": 2, "type": "heading", "bbox": { "l": 171.84, "t": 687.6, "r": 447.36, "b": 672.72 }, "text": "Summary for Subcatchment 2S: IMPERVIOUS", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p67.3", "order": 3, "type": "text", "bbox": { "l": 53.28, "t": 660, "r": 306.72, "b": 634.56 }, "text": "Runoff = 2.16 cfs @ 12.22 hrs, Volume=\nRouted to Pond 3P : SSIB #1 SURFACE BASIN\n0.280 af, Depth> 4.66\"", "reading_order": 2 }, { "id": "p67.4", "order": 4, "type": "text", "bbox": { "l": 345.12, "t": 659.76, "r": 463.68, "b": 646.8 }, "text": "0.280 af, Depth> 4.66\"", "reading_order": 3 }, { "id": "p67.5", "order": 5, "type": "text", "bbox": { "l": 52.08, "t": 624.48, "r": 541.44, "b": 598.56 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Weighted-CN, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs NOAA 24-hr D 10 YEAR Rainfall=5.38\"", "reading_order": 4 }, { "id": "p67.6", "order": 6, "type": "table", "bbox": { "l": 52.32, "t": 589.92, "r": 559.2, "b": 436.56 }, "text": "", "attrs": { "block_label": "table", "n_rows": 8, "n_cols": 7, "integrity": { "cells_checked": 30, "cells_flagged": 0 } }, "children": [ { "id": "p67.6.1", "order": 7, "type": "table_cell", "bbox": { "l": 69.659595, "t": 588.002283, "r": 113.82741, "b": 576.0151040000001 }, "text": "Area (ac)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p67.6.2", "order": 8, "type": "table_cell", "bbox": { "l": 130.796358, "t": 588.002283, "r": 146.30665, "b": 576.0151040000001 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p67.6.3", "order": 9, "type": "table_cell", "bbox": { "l": 289.05701, "t": 536.641352, "r": 342.773751, "b": 524.654172 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p67.6.4", "order": 10, "type": "table_cell", "bbox": { "l": 87, "t": 560.400886, "r": 113.874482, "b": 548.4137069999999 }, "text": "0.720", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 3 }, { "id": "p67.6.5", "order": 11, "type": "table_cell", "bbox": { "l": 134.275244, "t": 574.200786, "r": 146.219458, "b": 562.213607 }, "text": "98", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p67.6.6", "order": 12, "type": "table_cell", "bbox": { "l": 160.552515, "t": 574.200786, "r": 268.608987, "b": 562.213607 }, "text": "Paved parking, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true }, "reading_order": 5 }, { "id": "p67.6.7", "order": 13, "type": "table_cell", "bbox": { "l": 87, "t": 574.200786, "r": 113.874482, "b": 562.213607 }, "text": "0.720", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 6 }, { "id": "p67.6.8", "order": 14, "type": "table_cell", "bbox": { "l": 160.555738, "t": 560.400886, "r": 284.133244, "b": 548.4137069999999 }, "text": "100.00% Impervious Area", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 4, "bbox_refit": true }, "reading_order": 7 }, { "id": "p67.6.9", "order": 15, "type": "table_cell", "bbox": { "l": 65.459598, "t": 536.641352, "r": 89.993572, "b": 512.774405 }, "text": "Tc\\n(min)", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p67.6.10", "order": 16, "type": "table_cell", "bbox": { "l": 100.682141, "t": 536.641352, "r": 133.545916, "b": 512.774405 }, "text": "Length\\n(feet)", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p67.6.11", "order": 17, "type": "table_cell", "bbox": { "l": 149.815612, "t": 536.641352, "r": 177.28086, "b": 512.774405 }, "text": "Slope\\n(ft/ft)", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p67.6.12", "order": 18, "type": "table_cell", "bbox": { "l": 188.028505, "t": 536.641352, "r": 225.633446, "b": 512.774405 }, "text": "Velocity\\n(ft/sec)", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 }, { "id": "p67.6.13", "order": 19, "type": "table_cell", "bbox": { "l": 236.50354, "t": 536.641352, "r": 278.288957, "b": 512.774405 }, "text": "Capacity\\n(cfs)", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 12 }, { "id": "p67.6.14", "order": 20, "type": "table_cell", "bbox": { "l": 160.552704, "t": 588.002283, "r": 214.269445, "b": 576.0151040000001 }, "text": "Description", "attrs": { "row": 3, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 13 }, { "id": "p67.6.15", "order": 21, "type": "table_cell", "bbox": { "l": 69, "t": 510.960886, "r": 89.902375, "b": 498.973707 }, "text": "11.7", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p67.6.16", "order": 22, "type": "table_cell", "bbox": { "l": 115.676959, "t": 510.960886, "r": 133.59328, "b": 498.973707 }, "text": "100", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p67.6.17", "order": 23, "type": "table_cell", "bbox": { "l": 144.351666, "t": 510.960886, "r": 177.198256, "b": 498.973707 }, "text": "0.0300", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p67.6.18", "order": 24, "type": "table_cell", "bbox": { "l": 204.705395, "t": 510.960886, "r": 225.60777, "b": 498.973707 }, "text": "0.14", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p67.6.19", "order": 25, "type": "table_cell", "bbox": { "l": 341.9657, "t": 513.24, "r": 414.3771, "b": 494.07 }, "text": "", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 18 }, { "id": "p67.6.20", "order": 26, "type": "table_cell", "bbox": { "l": 289.079669, "t": 510.780434, "r": 461.873354, "b": 463.332257 }, "text": "Sheet Flow,\\nGrass: Dense n= 0.240 P2= 3.42\"\\nShallow Concentrated Flow,\\nGrassed Waterway Kv= 15.0 fps", "attrs": { "row": 4, "col": 5, "rowspan": 2, "colspan": 2, "bbox_refit": true }, "reading_order": 19 }, { "id": "p67.6.21", "order": 27, "type": "table_cell", "bbox": { "l": 75.000034, "t": 487.200277, "r": 89.930302, "b": 475.213098 }, "text": "0.5", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p67.6.22", "order": 28, "type": "table_cell", "bbox": { "l": 121.678067, "t": 487.200277, "r": 133.622282, "b": 475.213098 }, "text": "50", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p67.6.23", "order": 29, "type": "table_cell", "bbox": { "l": 144.354889, "t": 487.200277, "r": 177.201478, "b": 475.213098 }, "text": "0.0110", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 22 }, { "id": "p67.6.24", "order": 30, "type": "table_cell", "bbox": { "l": 204.708617, "t": 487.200277, "r": 225.610992, "b": 475.213098 }, "text": "1.57", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 23 }, { "id": "p67.6.25", "order": 31, "type": "table_cell", "bbox": { "l": 341.9657, "t": 494.07, "r": 414.3771, "b": 474.9 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 24 }, { "id": "p67.6.26", "order": 32, "type": "table_cell", "bbox": { "l": 75.000034, "t": 463.439669, "r": 89.930302, "b": 451.45249 }, "text": "0.9", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 25 }, { "id": "p67.6.27", "order": 33, "type": "table_cell", "bbox": { "l": 115.679107, "t": 463.439669, "r": 133.595429, "b": 451.45249 }, "text": "160", "attrs": { "row": 6, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 26 }, { "id": "p67.6.28", "order": 34, "type": "table_cell", "bbox": { "l": 197.1429, "t": 474.9, "r": 269.5543, "b": 455.73 }, "text": "", "attrs": { "row": 6, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 27 }, { "id": "p67.6.29", "order": 35, "type": "table_cell", "bbox": { "l": 204.713988, "t": 463.439669, "r": 225.616363, "b": 451.45249 }, "text": "3.00", "attrs": { "row": 6, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 28 }, { "id": "p67.6.30", "order": 36, "type": "table_cell", "bbox": { "l": 341.9657, "t": 474.9, "r": 414.3771, "b": 455.73 }, "text": "", "attrs": { "row": 6, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 29 }, { "id": "p67.6.31", "order": 37, "type": "table_cell", "bbox": { "l": 289.079669, "t": 463.259217, "r": 415.020239, "b": 451.272038 }, "text": "Direct Entry, PIPE FLOW", "attrs": { "row": 6, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 30 }, { "id": "p67.6.32", "order": 38, "type": "table_cell", "bbox": { "l": 69, "t": 449.640786, "r": 89.902375, "b": 437.653607 }, "text": "13.1", "attrs": { "row": 7, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 31 }, { "id": "p67.6.33", "order": 39, "type": "table_cell", "bbox": { "l": 115.676959, "t": 449.640786, "r": 133.59328, "b": 437.653607 }, "text": "310", "attrs": { "row": 7, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 32 }, { "id": "p67.6.34", "order": 40, "type": "table_cell", "bbox": { "l": 144.351666, "t": 449.640786, "r": 168.229354, "b": 437.653607 }, "text": "Total", "attrs": { "row": 7, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 33 }, { "id": "p67.6.35", "order": 41, "type": "table_cell", "bbox": { "l": 269.5543, "t": 455.73, "r": 341.9657, "b": 436.56 }, "text": "", "attrs": { "row": 7, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 34 }, { "id": "p67.6.36", "order": 42, "type": "table_cell", "bbox": { "l": 341.9657, "t": 455.73, "r": 414.3771, "b": 436.56 }, "text": "", "attrs": { "row": 7, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 35 }, { "id": "p67.6.37", "order": 43, "type": "table_cell", "bbox": { "l": 414.3771, "t": 455.73, "r": 486.7886, "b": 436.56 }, "text": "", "attrs": { "row": 7, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 36 }, { "id": "p67.6.38", "order": 44, "type": "table_cell", "bbox": { "l": 486.7886, "t": 455.73, "r": 559.2, "b": 436.56 }, "text": "", "attrs": { "row": 7, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 37 } ], "reading_order": 5 }, { "id": "p67.7", "order": 45, "type": "caption", "bbox": { "l": 210.24, "t": 425.52, "r": 405.6, "b": 410.4 }, "text": "Subcatchment 2S: IMPERVIOUS", "attrs": { "block_label": "figure_title" }, "reading_order": 6 }, { "id": "p67.8", "order": 46, "type": "figure", "bbox": { "l": 60.96, "t": 411.36, "r": 553.68, "b": 136.08 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nRunoff\n2.16 cfs\nNOAA 24-hr D\n2\n10 YEAR Rainfall=5.38\"\nRunoff Area=0.720 ac\nRunoff Volume=0.280 af\n(cfs) Runoff Depth>4.66\"\nFlow Flow Length=310'\n1\nTc=13.1 min\nCN=98\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 7 } ] }, { "document_id": 11809, "page": 68, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 39, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "table": 1, "table_cell": 31, "text": 3, "title": 1 }, "build_ms": 3, "items": [ { "id": "p68.1", "order": 1, "type": "header", "bbox": { "l": 52.8, "t": 738.72, "r": 561.12, "b": 698.88 }, "text": "POST DEV NOAA 24-hr D 10 YEAR Rainfall=5.38\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 32", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p68.2", "order": 2, "type": "title", "bbox": { "l": 171.84, "t": 687.36, "r": 446.88, "b": 672.48 }, "text": "Summary for Subcatchment 5S: IMPERVIOUS", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p68.3", "order": 3, "type": "text", "bbox": { "l": 51.84, "t": 659.52, "r": 245.04, "b": 646.32 }, "text": "[49] Hint: Tc<2dt may require smaller dt", "reading_order": 2 }, { "id": "p68.4", "order": 4, "type": "text", "bbox": { "l": 52.08, "t": 636.72, "r": 463.68, "b": 610.8 }, "text": "Runoff = 1.48 cfs @ 12.08 hrs, Volume= 0.105 af, Depth> 4.66\"\nRouted to Pond 8P : SSIB #2 UNDERGROUND", "reading_order": 3 }, { "id": "p68.5", "order": 5, "type": "text", "bbox": { "l": 52.08, "t": 600.96, "r": 541.68, "b": 574.8 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Weighted-CN, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs NOAA 24-hr D 10 YEAR Rainfall=5.38\"", "reading_order": 4 }, { "id": "p68.6", "order": 6, "type": "table", "bbox": { "l": 52.56, "t": 565.44, "r": 559.44, "b": 436.8 }, "text": "", "attrs": { "block_label": "table", "n_rows": 6, "n_cols": 7, "integrity": { "cells_checked": 24, "cells_flagged": 0 } }, "children": [ { "id": "p68.6.1", "order": 7, "type": "table_cell", "bbox": { "l": 69.659595, "t": 564.242748, "r": 113.82741, "b": 552.255569 }, "text": "Area (ac)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p68.6.2", "order": 8, "type": "table_cell", "bbox": { "l": 130.796358, "t": 564.242748, "r": 146.30665, "b": 552.255569 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p68.6.3", "order": 9, "type": "table_cell", "bbox": { "l": 289.05701, "t": 512.881252, "r": 342.773751, "b": 500.894072 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p68.6.4", "order": 10, "type": "table_cell", "bbox": { "l": 87, "t": 550.440786, "r": 113.874482, "b": 524.653607 }, "text": "0.270\n0.270", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p68.6.5", "order": 11, "type": "table_cell", "bbox": { "l": 134.275244, "t": 550.440786, "r": 284.133244, "b": 524.653607 }, "text": "98\n100.00% Impervious Area", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p68.6.6", "order": 12, "type": "table_cell", "bbox": { "l": 160.552515, "t": 550.440786, "r": 228.007251, "b": 538.453607 }, "text": "Roofs, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true }, "reading_order": 5 }, { "id": "p68.6.7", "order": 13, "type": "table_cell", "bbox": { "l": 65.459598, "t": 512.881252, "r": 89.993572, "b": 489.014305 }, "text": "Tc (min)", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p68.6.8", "order": 14, "type": "table_cell", "bbox": { "l": 100.682141, "t": 512.881252, "r": 133.545916, "b": 489.014305 }, "text": "Length (feet)", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p68.6.9", "order": 15, "type": "table_cell", "bbox": { "l": 149.815612, "t": 512.881252, "r": 177.28086, "b": 489.014305 }, "text": "Slope (ft/ft)", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p68.6.10", "order": 16, "type": "table_cell", "bbox": { "l": 188.028505, "t": 512.881252, "r": 225.633446, "b": 489.014305 }, "text": "Velocity (ft/sec)", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p68.6.11", "order": 17, "type": "table_cell", "bbox": { "l": 236.50354, "t": 512.881252, "r": 278.288957, "b": 489.014305 }, "text": "Capacity (cfs)", "attrs": { "row": 2, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p68.6.12", "order": 18, "type": "table_cell", "bbox": { "l": 160.552704, "t": 564.242748, "r": 214.269445, "b": 552.255569 }, "text": "Description", "attrs": { "row": 2, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 11 }, { "id": "p68.6.13", "order": 19, "type": "table_cell", "bbox": { "l": 75, "t": 487.200786, "r": 89.930268, "b": 475.213607 }, "text": "0.9", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 12 }, { "id": "p68.6.14", "order": 20, "type": "table_cell", "bbox": { "l": 121.678033, "t": 487.200786, "r": 133.622247, "b": 475.213607 }, "text": "50", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p68.6.15", "order": 21, "type": "table_cell", "bbox": { "l": 144.354854, "t": 487.200786, "r": 177.201444, "b": 475.213607 }, "text": "0.0100", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p68.6.16", "order": 22, "type": "table_cell", "bbox": { "l": 204.708583, "t": 487.200786, "r": 225.610958, "b": 475.213607 }, "text": "0.94", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p68.6.17", "order": 23, "type": "table_cell", "bbox": { "l": 342.2057, "t": 491.9314, "r": 414.6171, "b": 473.5543 }, "text": "", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 16 }, { "id": "p68.6.18", "order": 24, "type": "table_cell", "bbox": { "l": 289.079635, "t": 487.020334, "r": 476.803587, "b": 463.332765 }, "text": "Sheet Flow, Smooth surfaces n= 0.011 P2= 3.42\"", "attrs": { "row": 3, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 17 }, { "id": "p68.6.19", "order": 25, "type": "table_cell", "bbox": { "l": 75, "t": 463.440177, "r": 89.930268, "b": 451.452998 }, "text": "0.7", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p68.6.20", "order": 26, "type": "table_cell", "bbox": { "l": 115.679073, "t": 463.440177, "r": 133.595394, "b": 451.452998 }, "text": "130", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p68.6.21", "order": 27, "type": "table_cell", "bbox": { "l": 197.3829, "t": 473.5543, "r": 269.7943, "b": 455.1771 }, "text": "", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 20 }, { "id": "p68.6.22", "order": 28, "type": "table_cell", "bbox": { "l": 204.713954, "t": 463.440177, "r": 225.616329, "b": 451.452998 }, "text": "3.00", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p68.6.23", "order": 29, "type": "table_cell", "bbox": { "l": 342.2057, "t": 473.5543, "r": 414.6171, "b": 455.1771 }, "text": "", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 22 }, { "id": "p68.6.24", "order": 30, "type": "table_cell", "bbox": { "l": 289.079635, "t": 463.259725, "r": 415.020205, "b": 451.272546 }, "text": "Direct Entry, PIPE FLOW", "attrs": { "row": 4, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 23 }, { "id": "p68.6.25", "order": 31, "type": "table_cell", "bbox": { "l": 75, "t": 449.640786, "r": 89.930268, "b": 437.653607 }, "text": "1.6", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 24 }, { "id": "p68.6.26", "order": 32, "type": "table_cell", "bbox": { "l": 115.679073, "t": 449.640786, "r": 133.595394, "b": 437.653607 }, "text": "180", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 25 }, { "id": "p68.6.27", "order": 33, "type": "table_cell", "bbox": { "l": 144.35378, "t": 449.640786, "r": 168.231468, "b": 437.653607 }, "text": "Total", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 26 }, { "id": "p68.6.28", "order": 34, "type": "table_cell", "bbox": { "l": 269.7943, "t": 455.1771, "r": 342.2057, "b": 436.8 }, "text": "", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 27 }, { "id": "p68.6.29", "order": 35, "type": "table_cell", "bbox": { "l": 342.2057, "t": 455.1771, "r": 414.6171, "b": 436.8 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 28 }, { "id": "p68.6.30", "order": 36, "type": "table_cell", "bbox": { "l": 414.6171, "t": 455.1771, "r": 487.0286, "b": 436.8 }, "text": "", "attrs": { "row": 5, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 29 }, { "id": "p68.6.31", "order": 37, "type": "table_cell", "bbox": { "l": 487.0286, "t": 455.1771, "r": 559.44, "b": 436.8 }, "text": "", "attrs": { "row": 5, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 30 } ], "reading_order": 5 }, { "id": "p68.7", "order": 38, "type": "caption", "bbox": { "l": 210.24, "t": 425.52, "r": 405.6, "b": 410.64 }, "text": "Subcatchment 5S: IMPERVIOUS", "attrs": { "block_label": "figure_title" }, "reading_order": 6 }, { "id": "p68.8", "order": 39, "type": "figure", "bbox": { "l": 60.48, "t": 412.32, "r": 553.68, "b": 136.32 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nRunoff\n1.48 cfs\nNOAA 24-hr D\n10 YEAR Rainfall=5.38\"\nRunoff Area=0.270 ac\n1 Runoff Volume=0.105 af\n(cfs) Runoff Depth>4.66\"\nFlow Flow Length=180'\nSlope=0.0100 '/'\nTc=1.6 min\nCN=98\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 7 } ] }, { "document_id": 11809, "page": 69, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 39, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "heading": 1, "table": 1, "table_cell": 32, "text": 2 }, "build_ms": 4, "items": [ { "id": "p69.1", "order": 1, "type": "header", "bbox": { "l": 52.32, "t": 738.48, "r": 561.12, "b": 698.64 }, "text": "POST DEV NOAA 24-hr D 10 YEAR Rainfall=5.38\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 33", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p69.2", "order": 2, "type": "heading", "bbox": { "l": 183.6, "t": 687.36, "r": 434.64, "b": 672.72 }, "text": "Summary for Subcatchment 6S: POROUS", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p69.3", "order": 3, "type": "text", "bbox": { "l": 52.56, "t": 660, "r": 463.92, "b": 634.32 }, "text": "Runoff = 0.01 cfs @ 13.01 hrs, Volume= 0.003 af, Depth> 0.22\"\nRouted to Pond 8P : SSIB #2 UNDERGROUND", "reading_order": 2 }, { "id": "p69.4", "order": 4, "type": "text", "bbox": { "l": 52.08, "t": 624.24, "r": 541.44, "b": 598.8 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Weighted-CN, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs NOAA 24-hr D 10 YEAR Rainfall=5.38\"", "reading_order": 3 }, { "id": "p69.5", "order": 5, "type": "table", "bbox": { "l": 52.32, "t": 589.92, "r": 559.2, "b": 449.533607 }, "text": "", "attrs": { "block_label": "table", "n_rows": 7, "n_cols": 6, "integrity": { "cells_checked": 27, "cells_flagged": 0 } }, "children": [ { "id": "p69.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 69.659595, "t": 588.002283, "r": 113.82741, "b": 576.0151040000001 }, "text": "Area (ac)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p69.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 130.796358, "t": 588.002283, "r": 146.30665, "b": 576.0151040000001 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p69.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 289.05701, "t": 536.641352, "r": 342.773751, "b": 524.654172 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p69.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 87, "t": 560.400886, "r": 113.874482, "b": 548.4137069999999 }, "text": "0.190", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 3 }, { "id": "p69.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 134.275244, "t": 574.200786, "r": 146.219458, "b": 562.213607 }, "text": "39", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p69.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 160.552515, "t": 574.200786, "r": 320.843443, "b": 562.213607 }, "text": ">75% Grass cover, Good, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true }, "reading_order": 5 }, { "id": "p69.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 87, "t": 574.200786, "r": 113.874482, "b": 562.213607 }, "text": "0.190", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p69.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 160.555738, "t": 560.400886, "r": 273.392044, "b": 548.4137069999999 }, "text": "100.00% Pervious Area", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 5, "bbox_refit": true }, "reading_order": 7 }, { "id": "p69.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 65.459598, "t": 536.641352, "r": 89.993572, "b": 512.774405 }, "text": "Tc (min)", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p69.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 100.682141, "t": 536.641352, "r": 133.545916, "b": 512.774405 }, "text": "Length (feet)", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p69.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 149.815612, "t": 536.641352, "r": 177.28086, "b": 512.774405 }, "text": "Slope (ft/ft)", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p69.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 188.028505, "t": 536.641352, "r": 225.633446, "b": 512.774405 }, "text": "Velocity (ft/sec)", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 }, { "id": "p69.5.13", "order": 18, "type": "table_cell", "bbox": { "l": 236.50354, "t": 536.641352, "r": 278.288957, "b": 512.774405 }, "text": "Capacity (cfs)", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 12 }, { "id": "p69.5.14", "order": 19, "type": "table_cell", "bbox": { "l": 160.552704, "t": 588.002283, "r": 214.269445, "b": 576.0151040000001 }, "text": "Description", "attrs": { "row": 3, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p69.5.15", "order": 20, "type": "table_cell", "bbox": { "l": 69, "t": 510.960886, "r": 89.902375, "b": 498.973707 }, "text": "11.3", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p69.5.16", "order": 21, "type": "table_cell", "bbox": { "l": 121.676993, "t": 510.960886, "r": 133.621207, "b": 498.973707 }, "text": "90", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p69.5.17", "order": 22, "type": "table_cell", "bbox": { "l": 144.353814, "t": 510.960886, "r": 177.200404, "b": 498.973707 }, "text": "0.0270", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p69.5.18", "order": 23, "type": "table_cell", "bbox": { "l": 204.707543, "t": 510.960886, "r": 225.609918, "b": 498.973707 }, "text": "0.13", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p69.5.19", "order": 24, "type": "table_cell", "bbox": { "l": 390.24, "t": 511.2, "r": 474.72, "b": 491.52 }, "text": "", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 18 }, { "id": "p69.5.20", "order": 25, "type": "table_cell", "bbox": { "l": 289.079669, "t": 510.780434, "r": 461.873354, "b": 487.092865 }, "text": "Sheet Flow, Grass: Dense n= 0.240 P2= 3.42\"", "attrs": { "row": 4, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p69.5.21", "order": 26, "type": "table_cell", "bbox": { "l": 75.000034, "t": 487.200277, "r": 89.930302, "b": 475.213098 }, "text": "1.1", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p69.5.22", "order": 27, "type": "table_cell", "bbox": { "l": 115.679107, "t": 487.200277, "r": 133.595429, "b": 475.213098 }, "text": "160", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p69.5.23", "order": 28, "type": "table_cell", "bbox": { "l": 144.353814, "t": 487.200277, "r": 177.200404, "b": 475.213098 }, "text": "0.0150", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 22 }, { "id": "p69.5.24", "order": 29, "type": "table_cell", "bbox": { "l": 204.707543, "t": 487.200277, "r": 225.609918, "b": 475.213098 }, "text": "2.49", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 23 }, { "id": "p69.5.25", "order": 30, "type": "table_cell", "bbox": { "l": 390.24, "t": 491.52, "r": 474.72, "b": 471.84 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 24 }, { "id": "p69.5.26", "order": 31, "type": "table_cell", "bbox": { "l": 289.079669, "t": 487.019825, "r": 432.324312, "b": 463.332257 }, "text": "Shallow Concentrated Flow, Paved Kv= 20.3 fps", "attrs": { "row": 5, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 25 }, { "id": "p69.5.27", "order": 32, "type": "table_cell", "bbox": { "l": 69, "t": 461.520786, "r": 89.902375, "b": 449.533607 }, "text": "12.4", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 26 }, { "id": "p69.5.28", "order": 33, "type": "table_cell", "bbox": { "l": 115.676959, "t": 461.520786, "r": 133.59328, "b": 449.533607 }, "text": "250", "attrs": { "row": 6, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 27 }, { "id": "p69.5.29", "order": 34, "type": "table_cell", "bbox": { "l": 144.351666, "t": 461.520786, "r": 168.229354, "b": 449.533607 }, "text": "Total", "attrs": { "row": 6, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 28 }, { "id": "p69.5.30", "order": 35, "type": "table_cell", "bbox": { "l": 305.76, "t": 471.84, "r": 390.24, "b": 452.16 }, "text": "", "attrs": { "row": 6, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 29 }, { "id": "p69.5.31", "order": 36, "type": "table_cell", "bbox": { "l": 390.24, "t": 471.84, "r": 474.72, "b": 452.16 }, "text": "", "attrs": { "row": 6, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 30 }, { "id": "p69.5.32", "order": 37, "type": "table_cell", "bbox": { "l": 474.72, "t": 471.84, "r": 559.2, "b": 452.16 }, "text": "", "attrs": { "row": 6, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 31 } ], "reading_order": 4 }, { "id": "p69.6", "order": 38, "type": "caption", "bbox": { "l": 222.72, "t": 437.04, "r": 393.12, "b": 422.4 }, "text": "Subcatchment 6S: POROUS", "attrs": { "block_label": "figure_title" }, "reading_order": 5 }, { "id": "p69.7", "order": 39, "type": "figure", "bbox": { "l": 62.88, "t": 414.24, "r": 552.48, "b": 148.8 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n0.011 Runoff\n0.01 0.01 cfs\n0.009 NOAA 24-hr D\n0.009\n0.008 10 YEAR Rainfall=5.38\"\n0.008\n0.007 Runoff Area=0.190 ac\n0.007\n0.006 Runoff Volume=0.003 af\n(cfs) 0.005 Runoff Depth>0.22\"\n0.006\nFlow Flow Length=250'\n0.005\n0.004\nTc=12.4 min\n0.004\n0.003\n0.003 CN=39\n0.002\n0.002\n0.001\n0.001\n0.000\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 6 } ] }, { "document_id": 11809, "page": 70, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 44, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "table": 1, "table_cell": 36, "text": 3, "title": 1 }, "build_ms": 4, "items": [ { "id": "p70.1", "order": 1, "type": "header", "bbox": { "l": 52.56, "t": 738.72, "r": 560.64, "b": 698.64 }, "text": "POST DEV NOAA 24-hr D 10 YEAR Rainfall=5.38\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 34", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p70.2", "order": 2, "type": "title", "bbox": { "l": 131.76, "t": 687.6, "r": 488.88, "b": 672.48 }, "text": "Summary for Subcatchment 8S: PROP WAREHOUSE BLDG", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p70.3", "order": 3, "type": "text", "bbox": { "l": 51.6, "t": 659.52, "r": 245.04, "b": 646.32 }, "text": "[49] Hint: Tc<2dt may require smaller dt", "reading_order": 2 }, { "id": "p70.4", "order": 4, "type": "text", "bbox": { "l": 51.84, "t": 636.72, "r": 463.68, "b": 610.56 }, "text": "Runoff = 2.35 cfs @ 12.10 hrs, Volume= 0.179 af, Depth> 4.66\"\nRouted to Pond 9P : SSIB #3 UNDERGROUND", "reading_order": 3 }, { "id": "p70.5", "order": 5, "type": "text", "bbox": { "l": 52.08, "t": 600.72, "r": 541.68, "b": 574.8 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Weighted-CN, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs NOAA 24-hr D 10 YEAR Rainfall=5.38\"", "reading_order": 4 }, { "id": "p70.6", "order": 6, "type": "table", "bbox": { "l": 52.32, "t": 566.4, "r": 558.96, "b": 413.52 }, "text": "", "attrs": { "block_label": "table", "n_rows": 7, "n_cols": 6, "integrity": { "cells_checked": 29, "cells_flagged": 0 } }, "children": [ { "id": "p70.6.1", "order": 7, "type": "table_cell", "bbox": { "l": 69.659595, "t": 564.242748, "r": 113.82741, "b": 552.255569 }, "text": "Area (ac)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p70.6.2", "order": 8, "type": "table_cell", "bbox": { "l": 130.796358, "t": 564.242748, "r": 146.30665, "b": 552.255569 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p70.6.3", "order": 9, "type": "table_cell", "bbox": { "l": 289.05701, "t": 512.881252, "r": 342.773751, "b": 500.894072 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p70.6.4", "order": 10, "type": "table_cell", "bbox": { "l": 87, "t": 550.440786, "r": 113.874482, "b": 524.653607 }, "text": "0.460\n0.460", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p70.6.5", "order": 11, "type": "table_cell", "bbox": { "l": 134.275244, "t": 550.440786, "r": 146.219458, "b": 538.453607 }, "text": "98", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p70.6.6", "order": 12, "type": "table_cell", "bbox": { "l": 160.552515, "t": 550.440786, "r": 284.133244, "b": 524.653607 }, "text": "Roofs, HSG A\n100.00% Impervious Area", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p70.6.7", "order": 13, "type": "table_cell", "bbox": { "l": 65.459598, "t": 512.881252, "r": 89.993572, "b": 489.014305 }, "text": "Tc (min)", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p70.6.8", "order": 14, "type": "table_cell", "bbox": { "l": 100.682141, "t": 512.881252, "r": 133.545916, "b": 489.014305 }, "text": "Length (feet)", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p70.6.9", "order": 15, "type": "table_cell", "bbox": { "l": 149.815612, "t": 512.881252, "r": 177.28086, "b": 489.014305 }, "text": "Slope (ft/ft)", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p70.6.10", "order": 16, "type": "table_cell", "bbox": { "l": 188.028505, "t": 512.881252, "r": 225.633446, "b": 489.014305 }, "text": "Velocity (ft/sec)", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p70.6.11", "order": 17, "type": "table_cell", "bbox": { "l": 236.50354, "t": 512.881252, "r": 278.288957, "b": 489.014305 }, "text": "Capacity (cfs)", "attrs": { "row": 2, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p70.6.12", "order": 18, "type": "table_cell", "bbox": { "l": 160.552704, "t": 564.242748, "r": 214.269445, "b": 552.255569 }, "text": "Description", "attrs": { "row": 2, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 }, { "id": "p70.6.13", "order": 19, "type": "table_cell", "bbox": { "l": 75, "t": 487.200786, "r": 89.930268, "b": 475.213607 }, "text": "1.5", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 12 }, { "id": "p70.6.14", "order": 20, "type": "table_cell", "bbox": { "l": 115.679073, "t": 487.200786, "r": 133.595394, "b": 475.213607 }, "text": "100", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p70.6.15", "order": 21, "type": "table_cell", "bbox": { "l": 144.35378, "t": 487.200786, "r": 177.20037, "b": 475.213607 }, "text": "0.0100", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p70.6.16", "order": 22, "type": "table_cell", "bbox": { "l": 204.707509, "t": 487.200786, "r": 225.609884, "b": 475.213607 }, "text": "1.08", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p70.6.17", "order": 23, "type": "table_cell", "bbox": { "l": 390.08, "t": 489.96, "r": 474.52, "b": 470.85 }, "text": "", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 16 }, { "id": "p70.6.18", "order": 24, "type": "table_cell", "bbox": { "l": 289.079635, "t": 487.020334, "r": 476.803587, "b": 463.332765 }, "text": "Sheet Flow, Smooth surfaces n= 0.011 P2= 3.42\"", "attrs": { "row": 3, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p70.6.19", "order": 25, "type": "table_cell", "bbox": { "l": 75, "t": 463.440177, "r": 89.930268, "b": 451.452998 }, "text": "0.3", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p70.6.20", "order": 26, "type": "table_cell", "bbox": { "l": 121.678033, "t": 463.440177, "r": 133.622247, "b": 451.452998 }, "text": "40", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p70.6.21", "order": 27, "type": "table_cell", "bbox": { "l": 144.354854, "t": 463.440177, "r": 177.201444, "b": 451.452998 }, "text": "0.0100", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p70.6.22", "order": 28, "type": "table_cell", "bbox": { "l": 204.708583, "t": 463.440177, "r": 225.610958, "b": 451.452998 }, "text": "2.03", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p70.6.23", "order": 29, "type": "table_cell", "bbox": { "l": 390.08, "t": 470.85, "r": 474.52, "b": 451.74 }, "text": "", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 22 }, { "id": "p70.6.24", "order": 30, "type": "table_cell", "bbox": { "l": 289.079635, "t": 463.259725, "r": 432.324278, "b": 439.572157 }, "text": "Shallow Concentrated Flow, Paved Kv= 20.3 fps", "attrs": { "row": 4, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 23 }, { "id": "p70.6.25", "order": 31, "type": "table_cell", "bbox": { "l": 75, "t": 439.679569, "r": 89.930268, "b": 427.69239 }, "text": "0.8", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 24 }, { "id": "p70.6.26", "order": 32, "type": "table_cell", "bbox": { "l": 115.679073, "t": 439.679569, "r": 133.595394, "b": 427.69239 }, "text": "140", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 25 }, { "id": "p70.6.27", "order": 33, "type": "table_cell", "bbox": { "l": 221.2, "t": 451.74, "r": 305.64, "b": 432.63 }, "text": "", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 26 }, { "id": "p70.6.28", "order": 34, "type": "table_cell", "bbox": { "l": 204.713954, "t": 439.679569, "r": 225.616329, "b": 427.69239 }, "text": "3.00", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 27 }, { "id": "p70.6.29", "order": 35, "type": "table_cell", "bbox": { "l": 390.08, "t": 451.74, "r": 474.52, "b": 432.63 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 28 }, { "id": "p70.6.30", "order": 36, "type": "table_cell", "bbox": { "l": 289.079635, "t": 439.499117, "r": 415.020205, "b": 427.511938 }, "text": "Direct Entry, PIPE FLOW", "attrs": { "row": 5, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 29 }, { "id": "p70.6.31", "order": 37, "type": "table_cell", "bbox": { "l": 75, "t": 425.880786, "r": 89.930268, "b": 413.893607 }, "text": "2.6", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 30 }, { "id": "p70.6.32", "order": 38, "type": "table_cell", "bbox": { "l": 115.679073, "t": 425.880786, "r": 133.595394, "b": 413.893607 }, "text": "280", "attrs": { "row": 6, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 31 }, { "id": "p70.6.33", "order": 39, "type": "table_cell", "bbox": { "l": 144.35378, "t": 425.880786, "r": 168.231468, "b": 413.893607 }, "text": "Total", "attrs": { "row": 6, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 32 }, { "id": "p70.6.34", "order": 40, "type": "table_cell", "bbox": { "l": 305.64, "t": 432.63, "r": 390.08, "b": 413.52 }, "text": "", "attrs": { "row": 6, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 33 }, { "id": "p70.6.35", "order": 41, "type": "table_cell", "bbox": { "l": 390.08, "t": 432.63, "r": 474.52, "b": 413.52 }, "text": "", "attrs": { "row": 6, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 34 }, { "id": "p70.6.36", "order": 42, "type": "table_cell", "bbox": { "l": 474.52, "t": 432.63, "r": 558.96, "b": 413.52 }, "text": "", "attrs": { "row": 6, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 35 } ], "reading_order": 5 }, { "id": "p70.7", "order": 43, "type": "caption", "bbox": { "l": 170.4, "t": 401.52, "r": 448.08, "b": 386.88 }, "text": "Subcatchment 8S: PROP WAREHOUSE BLDG", "attrs": { "block_label": "figure_title" }, "reading_order": 6 }, { "id": "p70.8", "order": 44, "type": "figure", "bbox": { "l": 60.96, "t": 384.48, "r": 553.44, "b": 113.76 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nRunoff\n2.35 cfs\nNOAA 24-hr D\n2 10 YEAR Rainfall=5.38\"\nRunoff Area=0.460 ac\nRunoff Volume=0.179 af\n(cfs) Runoff Depth>4.66\"\nFlow Flow Length=280'\nSlope=0.0100 '/'\n1\nTc=2.6 min\nCN=98\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 7 } ] }, { "document_id": 11809, "page": 71, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 17, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "table": 1, "table_cell": 9, "text": 3, "title": 1 }, "build_ms": 2, "items": [ { "id": "p71.1", "order": 1, "type": "header", "bbox": { "l": 52.56, "t": 738.48, "r": 560.88, "b": 698.64 }, "text": "POST DEV NOAA 24-hr D 10 YEAR Rainfall=5.38\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 35", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p71.2", "order": 2, "type": "title", "bbox": { "l": 151.44, "t": 687.6, "r": 468.24, "b": 672.72 }, "text": "Summary for Subcatchment 10S: BY-PASS POROUS", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p71.3", "order": 3, "type": "text", "bbox": { "l": 51.84, "t": 659.28, "r": 245.04, "b": 646.32 }, "text": "[49] Hint: Tc<2dt may require smaller dt", "reading_order": 2 }, { "id": "p71.4", "order": 4, "type": "text", "bbox": { "l": 52.08, "t": 636.48, "r": 463.2, "b": 610.8 }, "text": "Runoff = 0.00 cfs @ 12.50 hrs, Volume= 0.001 af, Depth> 0.22\"\nRouted to Reach 10 : COMPOSITE", "reading_order": 3 }, { "id": "p71.5", "order": 5, "type": "text", "bbox": { "l": 52.08, "t": 600.72, "r": 541.68, "b": 575.04 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Weighted-CN, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs NOAA 24-hr D 10 YEAR Rainfall=5.38\"", "reading_order": 4 }, { "id": "p71.6", "order": 6, "type": "table", "bbox": { "l": 53.28, "t": 564.96, "r": 559.2, "b": 475.033155 }, "text": "", "attrs": { "block_label": "table", "n_rows": 3, "n_cols": 3, "integrity": { "cells_checked": 9, "cells_flagged": 0 } }, "children": [ { "id": "p71.6.1", "order": 7, "type": "table_cell", "bbox": { "l": 69.659595, "t": 564.242748, "r": 113.82741, "b": 552.255569 }, "text": "Area (ac)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p71.6.2", "order": 8, "type": "table_cell", "bbox": { "l": 130.796358, "t": 564.242748, "r": 146.30665, "b": 552.255569 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p71.6.3", "order": 9, "type": "table_cell", "bbox": { "l": 289.05701, "t": 512.881252, "r": 342.773751, "b": 500.894072 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p71.6.4", "order": 10, "type": "table_cell", "bbox": { "l": 87, "t": 550.440786, "r": 113.874482, "b": 524.653607 }, "text": "0.060\n0.060", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p71.6.5", "order": 11, "type": "table_cell", "bbox": { "l": 134.275244, "t": 550.440786, "r": 273.392044, "b": 524.653607 }, "text": "39\n100.00% Pervious Area", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p71.6.6", "order": 12, "type": "table_cell", "bbox": { "l": 160.552515, "t": 550.440786, "r": 320.843443, "b": 538.453607 }, "text": ">75% Grass cover, Good, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p71.6.7", "order": 13, "type": "table_cell", "bbox": { "l": 65.459598, "t": 512.881252, "r": 89.993572, "b": 475.213607 }, "text": "Tc (min)\n2.0", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p71.6.8", "order": 14, "type": "table_cell", "bbox": { "l": 100.682141, "t": 512.881252, "r": 352.94681, "b": 475.033155 }, "text": "Length (feet)\nDirect Entry,", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 7 }, { "id": "p71.6.9", "order": 15, "type": "table_cell", "bbox": { "l": 149.815612, "t": 512.881252, "r": 278.288957, "b": 489.014305 }, "text": "Slope (ft/ft) Velocity (ft/sec) Capacity (cfs)", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 } ], "reading_order": 5 }, { "id": "p71.7", "order": 16, "type": "caption", "bbox": { "l": 190.32, "t": 462.96, "r": 426.96, "b": 447.84 }, "text": "Subcatchment 10S: BY-PASS POROUS", "attrs": { "block_label": "figure_title" }, "reading_order": 6 }, { "id": "p71.8", "order": 17, "type": "figure", "bbox": { "l": 61.92, "t": 442.8, "r": 555.6, "b": 176.4 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nRunoff\n0.004\n0.00 cfs\n0.004\n0.003 NOAA 24-hr D\n10 YEAR Rainfall=5.38\"\n0.003\n0.003\n0.003 Runoff Area=0.060 ac\n0.003\n0.002 Runoff Volume=0.001 af\n(cfs) Runoff Depth>0.22\"\n0.002\n0.002\nFlow Tc=2.0 min\n0.002\n0.002\n0.001 CN=39\n0.001\n0.001\n0.001\n0.001\n0.000\n0.000\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 7 } ] }, { "document_id": 11809, "page": 72, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 24, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "table": 1, "table_cell": 16, "text": 3, "title": 1 }, "build_ms": 2, "items": [ { "id": "p72.1", "order": 1, "type": "header", "bbox": { "l": 52.8, "t": 738.48, "r": 560.64, "b": 698.64 }, "text": "POST DEV NOAA 24-hr D 10 YEAR Rainfall=5.38\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 36", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p72.2", "order": 2, "type": "title", "bbox": { "l": 139.68, "t": 687.6, "r": 480.72, "b": 672.48 }, "text": "Summary for Subcatchment 11S: BY-PASS IMPERVIOUS", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p72.3", "order": 3, "type": "text", "bbox": { "l": 51.84, "t": 659.52, "r": 245.04, "b": 646.32 }, "text": "[49] Hint: Tc<2dt may require smaller dt", "reading_order": 2 }, { "id": "p72.4", "order": 4, "type": "text", "bbox": { "l": 51.84, "t": 636.24, "r": 463.68, "b": 610.8 }, "text": "Runoff = 0.37 cfs @ 12.09 hrs, Volume= 0.027 af, Depth> 4.66\"\nRouted to Reach 10 : COMPOSITE", "reading_order": 3 }, { "id": "p72.5", "order": 5, "type": "text", "bbox": { "l": 52.08, "t": 600.72, "r": 541.68, "b": 575.04 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Weighted-CN, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs NOAA 24-hr D 10 YEAR Rainfall=5.38\"", "reading_order": 4 }, { "id": "p72.6", "order": 6, "type": "table", "bbox": { "l": 52.8, "t": 564.96, "r": 559.44, "b": 474.96 }, "text": "", "attrs": { "block_label": "table", "n_rows": 4, "n_cols": 4, "integrity": { "cells_checked": 13, "cells_flagged": 1, "flags": [ { "row": 2, "col": 2, "coverage": 0, "text": "Impervious Area" } ] } }, "children": [ { "id": "p72.6.1", "order": 7, "type": "table_cell", "bbox": { "l": 69.659595, "t": 564.242748, "r": 113.82741, "b": 552.255569 }, "text": "Area (ac)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p72.6.2", "order": 8, "type": "table_cell", "bbox": { "l": 130.796358, "t": 564.242748, "r": 146.30665, "b": 552.255569 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p72.6.3", "order": 9, "type": "table_cell", "bbox": { "l": 289.05701, "t": 512.881252, "r": 342.773751, "b": 500.894072 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p72.6.4", "order": 10, "type": "table_cell", "bbox": { "l": 432.78, "t": 564.96, "r": 559.44, "b": 546.96 }, "text": "", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 3 }, { "id": "p72.6.5", "order": 11, "type": "table_cell", "bbox": { "l": 87, "t": 550.440786, "r": 113.874482, "b": 538.453607 }, "text": "0.070", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p72.6.6", "order": 12, "type": "table_cell", "bbox": { "l": 134.275244, "t": 550.440786, "r": 146.219458, "b": 538.453607 }, "text": "98", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p72.6.7", "order": 13, "type": "table_cell", "bbox": { "l": 160.552515, "t": 550.440786, "r": 268.608987, "b": 538.453607 }, "text": "Paved parking, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p72.6.8", "order": 14, "type": "table_cell", "bbox": { "l": 432.78, "t": 546.96, "r": 559.44, "b": 528.96 }, "text": "", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 7 }, { "id": "p72.6.9", "order": 15, "type": "table_cell", "bbox": { "l": 87, "t": 536.6407859999999, "r": 113.874482, "b": 524.653607 }, "text": "0.070", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p72.6.10", "order": 16, "type": "table_cell", "bbox": { "l": 160.555738, "t": 536.6407859999999, "r": 202.951254, "b": 524.653607 }, "text": "100.00%", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p72.6.11", "order": 17, "type": "table_cell", "bbox": { "l": 306.12, "t": 528.96, "r": 432.78, "b": 510.96 }, "text": "Impervious Area", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 10 }, { "id": "p72.6.12", "order": 18, "type": "table_cell", "bbox": { "l": 432.78, "t": 528.96, "r": 559.44, "b": 510.96 }, "text": "", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 11 }, { "id": "p72.6.13", "order": 19, "type": "table_cell", "bbox": { "l": 65.459598, "t": 512.881252, "r": 352.94681, "b": 475.033155 }, "text": "Tc (min)\nDirect Entry,", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 12 }, { "id": "p72.6.14", "order": 20, "type": "table_cell", "bbox": { "l": 100.682141, "t": 512.881252, "r": 133.545916, "b": 489.014305 }, "text": "Length (feet)", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p72.6.15", "order": 21, "type": "table_cell", "bbox": { "l": 149.815612, "t": 512.881252, "r": 177.28086, "b": 489.014305 }, "text": "Slope (ft/ft)", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p72.6.16", "order": 22, "type": "table_cell", "bbox": { "l": 188.028505, "t": 512.881252, "r": 225.633446, "b": 489.014305 }, "text": "Velocity (ft/sec)", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 } ], "reading_order": 5 }, { "id": "p72.7", "order": 23, "type": "caption", "bbox": { "l": 178.08, "t": 463.2, "r": 439.92, "b": 447.84 }, "text": "Subcatchment 11S: BY-PASS IMPERVIOUS", "attrs": { "block_label": "figure_title" }, "reading_order": 6 }, { "id": "p72.8", "order": 24, "type": "figure", "bbox": { "l": 61.92, "t": 442.56, "r": 553.2, "b": 175.44 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nRunoff\n0.4\n0.37 cfs\n0.38\n0.36 NOAA 24-hr D\n0.32 10 YEAR Rainfall=5.38\"\n0.34\nRunoff Area=0.070 ac\n0.3\n0.28\nRunoff Volume=0.027 af\n0.26\n0.24\n(cfs) 0.22 Runoff Depth>4.66\"\n0.2\nFlow 0.18 Tc=2.0 min\n0.14 CN=98\n0.16\n0.12\n0.1\n0.08\n0.06\n0.04\n0.02\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 7 } ] }, { "document_id": 11809, "page": 73, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 7, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "heading": 1, "text": 3 }, "build_ms": 0, "items": [ { "id": "p73.1", "order": 1, "type": "header", "bbox": { "l": 53.04, "t": 738.48, "r": 561.12, "b": 698.88 }, "text": "POST DEV NOAA 24-hr D 10 YEAR Rainfall=5.38\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 37", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p73.2", "order": 2, "type": "heading", "bbox": { "l": 198, "t": 687.6, "r": 419.76, "b": 672.48 }, "text": "Summary for Reach 10: COMPOSITE", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p73.3", "order": 3, "type": "text", "bbox": { "l": 52.08, "t": 659.52, "r": 250.8, "b": 646.08 }, "text": "[40] Hint: Not Described (Outflow=Inflow)", "reading_order": 2 }, { "id": "p73.4", "order": 4, "type": "text", "bbox": { "l": 52.56, "t": 636.72, "r": 517.92, "b": 598.32 }, "text": "Inflow Area = 2.340 ac, 64.96% Impervious, Inflow Depth > 0.76\" for 10 YEAR event\nInflow = 1.00 cfs @ 12.65 hrs, Volume= 0.149 af\nOutflow = 1.00 cfs @ 12.65 hrs, Volume= 0.149 af, Atten=0%, Lag=0.0 min", "reading_order": 3 }, { "id": "p73.5", "order": 5, "type": "text", "bbox": { "l": 51.84, "t": 588.72, "r": 421.2, "b": 574.56 }, "text": "Routing by Stor-Ind+Trans method, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs", "reading_order": 4 }, { "id": "p73.6", "order": 6, "type": "caption", "bbox": { "l": 236.64, "t": 563.52, "r": 378.48, "b": 548.64 }, "text": "Reach 10: COMPOSITE", "attrs": { "block_label": "figure_title" }, "reading_order": 5 }, { "id": "p73.7", "order": 7, "type": "figure", "bbox": { "l": 63.36, "t": 542.88, "r": 553.92, "b": 273.6 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nInflow\n1.00 cfs Outflow\n1.00 cfs\n1 Inflow Area=2.340 ac\n(cfs)\nFlow\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 6 } ] }, { "document_id": 11809, "page": 74, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 40, "counts_by_type": { "footnote": 2, "header": 1, "heading": 2, "table": 3, "table_cell": 30, "text": 2 }, "build_ms": 8, "items": [ { "id": "p74.1", "order": 1, "type": "header", "bbox": { "l": 53.28, "t": 738.96, "r": 560.16, "b": 698.4 }, "text": "POST DEV NOAA 24-hr D 10 YEAR Rainfall=5.38\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 38", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p74.2", "order": 2, "type": "heading", "bbox": { "l": 162.24, "t": 687.84, "r": 457.44, "b": 672.72 }, "text": "Summary for Pond 3P: SSIB #1 SURFACE BASIN", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p74.3", "order": 3, "type": "heading", "bbox": { "l": 52.32, "t": 659.52, "r": 301.44, "b": 645.84 }, "text": "[82] Warning: Early inflow requires earlier time span", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 2 }, { "id": "p74.4", "order": 4, "type": "table", "bbox": { "l": 52.56, "t": 637.92, "r": 531.12, "b": 564.135336 }, "text": "", "attrs": { "block_label": "table", "n_rows": 3, "n_cols": 2, "integrity": { "cells_checked": 6, "cells_flagged": 1, "flags": [ { "row": 1, "col": 1, "coverage": 0.58, "text": "1.05 cfs @ 12.67 hrs, Volume= 0.209 af, Atten= 51%, Lag= 26…" } ] } }, "children": [ { "id": "p74.4.1", "order": 5, "type": "table_cell", "bbox": { "l": 54, "t": 635.521352, "r": 107.727482, "b": 611.654405 }, "text": "Inflow Area =\nInflow =", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p74.4.2", "order": 6, "type": "table_cell", "bbox": { "l": 147.777121, "t": 635.521352, "r": 508.70722, "b": 611.654405 }, "text": "1.290 ac, 55.81% Impervious, Inflow Depth > 2.70\" for 10 YEAR event\n2.16 cfs @ 12.22 hrs, Volume= 0.290 af", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p74.4.3", "order": 7, "type": "table_cell", "bbox": { "l": 54, "t": 611.7618170000001, "r": 90.412668, "b": 599.774638 }, "text": "Outflow =", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 2 }, { "id": "p74.4.4", "order": 8, "type": "table_cell", "bbox": { "l": 291.84, "t": 613.92, "r": 531.12, "b": 601.92 }, "text": "1.05 cfs @ 12.67 hrs, Volume= 0.209 af, Atten= 51%, Lag= 26.5 min", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1 }, "reading_order": 3 }, { "id": "p74.4.5", "order": 9, "type": "table_cell", "bbox": { "l": 54, "t": 599.8820499999999, "r": 237.878603, "b": 564.135336 }, "text": "Discarded =\nPrimary =\nRouted to Reach 10 : COMPOSITE", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p74.4.6", "order": 10, "type": "table_cell", "bbox": { "l": 147.769602, "t": 599.8820499999999, "r": 305.136775, "b": 576.0151040000001 }, "text": "0.10 cfs @ 12.67 hrs, Volume= 0.089 af\n0.95 cfs @ 12.67 hrs, Volume= 0.120 af", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 } ], "reading_order": 3 }, { "id": "p74.5", "order": 11, "type": "text", "bbox": { "l": 51.84, "t": 553.2, "r": 408.72, "b": 526.8 }, "text": "Routing by Stor-Ind method, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs\nPeak Elev= 112.02' @ 12.67 hrs Surf.Area= 3,217 sf Storage= 5,118 cf", "reading_order": 4 }, { "id": "p74.6", "order": 12, "type": "text", "bbox": { "l": 52.08, "t": 517.44, "r": 413.52, "b": 491.28 }, "text": "Plug-Flow detention time = 129.4 min calculated for 0.208 af (72% of inflow) Center-of-Mass det. time = 59.2 min (812.0 - 752.7)", "reading_order": 5 }, { "id": "p74.7", "order": 13, "type": "table", "bbox": { "l": 52.08, "t": 481.2, "r": 558.48, "b": 355.92 }, "text": "", "attrs": { "block_label": "table", "n_rows": 3, "n_cols": 5, "integrity": { "cells_checked": 12, "cells_flagged": 1, "flags": [ { "row": 1, "col": 3, "coverage": 0.33, "text": "Custom Stage Data (Prismatic)Listed below (Recalc)" } ] } }, "children": [ { "id": "p74.7.1", "order": 14, "type": "table_cell", "bbox": { "l": 54, "t": 481.084378, "r": 90.412668, "b": 469.097199 }, "text": "Volume", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p74.7.2", "order": 15, "type": "table_cell", "bbox": { "l": 123.533158, "t": 481.084378, "r": 150.396899, "b": 469.097199 }, "text": "Invert", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p74.7.3", "order": 16, "type": "table_cell", "bbox": { "l": 173.452885, "t": 481.084378, "r": 237.330802, "b": 469.097199 }, "text": "Avail.Storage", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p74.7.4", "order": 17, "type": "table_cell", "bbox": { "l": 249.465135, "t": 481.084378, "r": 343.783612, "b": 469.097199 }, "text": "Storage Description", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 2, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 3 }, { "id": "p74.7.5", "order": 18, "type": "table_cell", "bbox": { "l": 66.12, "t": 467.280786, "r": 78.064214, "b": 455.293607 }, "text": "#1", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p74.7.6", "order": 19, "type": "table_cell", "bbox": { "l": 115.437146, "t": 467.280786, "r": 150.335304, "b": 455.293607 }, "text": "110.00'", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p74.7.7", "order": 20, "type": "table_cell", "bbox": { "l": 193.071317, "t": 467.280786, "r": 237.260614, "b": 455.293607 }, "text": "12,950 cf", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p74.7.8", "order": 21, "type": "table_cell", "bbox": { "l": 355.92, "t": 465.54, "r": 558.48, "b": 449.88 }, "text": "Custom Stage Data (Prismatic)Listed below (Recalc)", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 2 }, "reading_order": 7 }, { "id": "p74.7.9", "order": 22, "type": "table_cell", "bbox": { "l": 57.719307, "t": 443.521252, "r": 101.897863, "b": 358.334538 }, "text": "Elevation\\n(feet)\n110.00\n111.00\n112.00\n113.00\n114.00", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 8 }, { "id": "p74.7.10", "order": 23, "type": "table_cell", "bbox": { "l": 142.191327, "t": 443.521252, "r": 187.562155, "b": 358.334538 }, "text": "Surf.Area\\n(sq-ft)\n2,000\n2,450\n3,200\n4,000\n4,600", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 9 }, { "id": "p74.7.11", "order": 24, "type": "table_cell", "bbox": { "l": 230.21009, "t": 443.521252, "r": 358.898543, "b": 358.334538 }, "text": "Inc.Store\\n(cubic-feet)\n0\n2,225\n2,825\n3,600\n4,300", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 10 }, { "id": "p74.7.12", "order": 25, "type": "table_cell", "bbox": { "l": 219.361478, "t": 443.521252, "r": 358.999511, "b": 358.334538 }, "text": "Cum.Store\\n(cubic-feet)\n0\n2,225\n5,050\n8,650\n12,950", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 11 } ], "reading_order": 6 }, { "id": "p74.8", "order": 26, "type": "table", "bbox": { "l": 51.36, "t": 347.04, "r": 455.28, "b": 259.2 }, "text": "", "attrs": { "block_label": "table", "n_rows": 3, "n_cols": 4, "integrity": { "cells_checked": 12, "cells_flagged": 0 } }, "children": [ { "id": "p74.8.1", "order": 27, "type": "table_cell", "bbox": { "l": 53.999914, "t": 346.562183, "r": 86.825021, "b": 320.773607 }, "text": "Device\n#1", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p74.8.2", "order": 28, "type": "table_cell", "bbox": { "l": 98.873425, "t": 346.562183, "r": 147.222394, "b": 320.773607 }, "text": "Routing\nDiscarded", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p74.8.3", "order": 29, "type": "table_cell", "bbox": { "l": 175.965845, "t": 346.562183, "r": 210.937439, "b": 320.773607 }, "text": "Invert\n110.00'", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p74.8.4", "order": 30, "type": "table_cell", "bbox": { "l": 223.01377, "t": 346.562183, "r": 453.384188, "b": 308.892765 }, "text": "Outlet Devices\n1.000 in/hr Exfiltration over Surface area\\nConductivity to Groundwater Elevation = 106.00'", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p74.8.5", "order": 31, "type": "table_cell", "bbox": { "l": 70.44, "t": 309.000177, "r": 82.384214, "b": 297.012998 }, "text": "#2", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p74.8.6", "order": 32, "type": "table_cell", "bbox": { "l": 98.876253, "t": 309.000177, "r": 135.868946, "b": 297.012998 }, "text": "Primary", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p74.8.7", "order": 33, "type": "table_cell", "bbox": { "l": 175.97229, "t": 309.000177, "r": 210.870449, "b": 297.012998 }, "text": "111.50'", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p74.8.8", "order": 34, "type": "table_cell", "bbox": { "l": 223.01982, "t": 309.000177, "r": 451.453995, "b": 285.133231 }, "text": "12.0\" W x 4.0\" H Vert. Orifice/Grate C= 0.600\\nLimited to weir flow at low heads", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p74.8.9", "order": 35, "type": "table_cell", "bbox": { "l": 70.44, "t": 285.240643, "r": 82.384214, "b": 273.253464 }, "text": "#3", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p74.8.10", "order": 36, "type": "table_cell", "bbox": { "l": 98.876253, "t": 285.240643, "r": 135.868946, "b": 273.253464 }, "text": "Primary", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p74.8.11", "order": 37, "type": "table_cell", "bbox": { "l": 175.97229, "t": 285.240643, "r": 210.870449, "b": 273.253464 }, "text": "113.00'", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p74.8.12", "order": 38, "type": "table_cell", "bbox": { "l": 223.01982, "t": 285.240643, "r": 439.81483, "b": 261.373697 }, "text": "24.0\" x 48.0\" Horiz. Orifice/Grate C= 0.600\\nLimited to weir flow at low heads", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 } ], "reading_order": 7 }, { "id": "p74.9", "order": 39, "type": "footnote", "bbox": { "l": 51.12, "t": 250.56, "r": 439.44, "b": 224.16 }, "text": "Discarded OutFlow Max=0.10 cfs @ 12.67 hrs HW=112.02' (Free Discharge)\n1=Exfiltration (Controls 0.10 cfs)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 8 }, { "id": "p74.10", "order": 40, "type": "footnote", "bbox": { "l": 51.84, "t": 214.8, "r": 427.2, "b": 177.12 }, "text": "Primary OutFlow Max=0.95 cfs @ 12.67 hrs HW=112.02' (Free Discharge)\n2=Orifice/Grate (Orifice Controls 0.95 cfs @ 2.84 fps)\n3=Orifice/Grate (Controls 0.00 cfs)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 9 } ] }, { "document_id": 11809, "page": 75, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 3, "counts_by_type": { "caption": 1, "figure": 1, "header": 1 }, "build_ms": 0, "items": [ { "id": "p75.1", "order": 1, "type": "header", "bbox": { "l": 52.08, "t": 738.24, "r": 562.56, "b": 698.64 }, "text": "POST DEV NOAA 24-hr D 10 YEAR Rainfall=5.38\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 39", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p75.2", "order": 2, "type": "caption", "bbox": { "l": 201.36, "t": 687.84, "r": 415.68, "b": 673.2 }, "text": "Pond 3P: SSIB #1 SURFACE BASIN", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p75.3", "order": 3, "type": "figure", "bbox": { "l": 62.88, "t": 670.32, "r": 552.48, "b": 399.36 }, "text": "", "attrs": { "block_label": "image", "embedded_text": "Hydrograph\nInflow\n2.16 cfs Outflow\nInflow Area=1.290 ac Primary\nDiscarded\nPeak Elev=112.02'\nStorage=5,118 cf\n2\n1.05 cfs\n(cfs)\nFlow 1 0.95 cfs\n0.10 cfs\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 2 } ] }, { "document_id": 11809, "page": 76, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 11, "counts_by_type": { "caption": 1, "header": 1, "table": 1, "table_cell": 8 }, "build_ms": 20, "items": [ { "id": "p76.1", "order": 1, "type": "header", "bbox": { "l": 52.08, "t": 738.48, "r": 561.12, "b": 698.64 }, "text": "POST DEV NOAA 24-hr D 10 YEAR Rainfall=5.38\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 40", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p76.2", "order": 2, "type": "caption", "bbox": { "l": 152.88, "t": 687.6, "r": 467.52, "b": 672.72 }, "text": "Stage-Discharge for Pond 3P: SSIB #1 SURFACE BASIN", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p76.3", "order": 3, "type": "table", "bbox": { "l": 55.2, "t": 662.16, "r": 500.16, "b": 56.64 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 8, "integrity": { "cells_checked": 8, "cells_flagged": 0 } }, "children": [ { "id": "p76.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 57.3, "t": 661.21453, "r": 97.73433, "b": 59.66617199999996 }, "text": "Elevation (feet)\n110.00\n110.05\n110.10\n110.15\n110.20\n110.25\n110.30\n110.35\n110.40\n110.45\n110.50\n110.55\n110.60\n110.65\n110.70\n110.75\n110.80\n110.85\n110.90\n110.95\n111.00\n111.05\n111.10\n111.15\n111.20\n111.25\n111.30\n111.35\n111.40\n111.45\n111.50\n111.55\n111.60\n111.65\n111.70\n111.75\n111.80\n111.85\n111.90\n111.95\n112.00\n112.05\n112.10\n112.15\n112.20\n112.25\n112.30\n112.35\n112.40\n112.45\n112.50\n112.55\n112.60", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p76.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 109.260182, "t": 661.21453, "r": 153.49646, "b": 59.66617199999996 }, "text": "Discharge (cfs)\n0.00\n0.05\n0.05\n0.05\n0.05\n0.05\n0.05\n0.05\n0.06\n0.06\n0.06\n0.06\n0.06\n0.06\n0.06\n0.06\n0.06\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.08\n0.08\n0.08\n0.08\n0.08\n0.08\n0.09\n0.12\n0.19\n0.28\n0.38\n0.50\n0.62\n0.75\n0.86\n0.94\n1.02\n1.09\n1.16\n1.22\n1.28\n1.33\n1.39\n1.44\n1.49\n1.54\n1.58\n1.63\n1.67", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p76.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 165.000251, "t": 661.21453, "r": 209.236529, "b": 59.66617199999996 }, "text": "Discarded (cfs)\n0.00\n0.05\n0.05\n0.05\n0.05\n0.05\n0.05\n0.05\n0.06\n0.06\n0.06\n0.06\n0.06\n0.06\n0.06\n0.06\n0.06\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.08\n0.08\n0.08\n0.08\n0.08\n0.08\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.11\n0.11\n0.11\n0.11\n0.11\n0.11\n0.12\n0.12\n0.12\n0.12\n0.12", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p76.3.4", "order": 7, "type": "table_cell", "bbox": { "l": 231.060808, "t": 661.21453, "r": 264.933898, "b": 59.66617199999996 }, "text": "Primary (cfs)\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.04\n0.10\n0.19\n0.29\n0.40\n0.53\n0.66\n0.76\n0.84\n0.92\n0.99\n1.05\n1.11\n1.17\n1.22\n1.27\n1.32\n1.37\n1.42\n1.46\n1.51\n1.55", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p76.3.5", "order": 8, "type": "table_cell", "bbox": { "l": 287.88, "t": 661.21453, "r": 328.31433, "b": 332.666219 }, "text": "Elevation (feet)\n112.65\n112.70\n112.75\n112.80\n112.85\n112.90\n112.95\n113.00\n113.05\n113.10\n113.15\n113.20\n113.25\n113.30\n113.35\n113.40\n113.45\n113.50\n113.55\n113.60\n113.65\n113.70\n113.75\n113.80\n113.85\n113.90\n113.95\n114.00", "attrs": { "row": 0, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p76.3.6", "order": 9, "type": "table_cell", "bbox": { "l": 339.840182, "t": 661.21453, "r": 384.649982, "b": 332.606268 }, "text": "Discharge (cfs)\n1.72\n1.76\n1.80\n1.84\n1.88\n1.92\n1.95\n1.99\n2.47\n3.30\n4.38\n5.64\n7.07\n8.65\n10.36\n12.19\n14.14\n16.20\n18.37\n20.63\n22.98\n25.43\n27.97\n30.59\n33.29\n36.07\n38.93\n41.14", "attrs": { "row": 0, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p76.3.7", "order": 10, "type": "table_cell", "bbox": { "l": 395.580251, "t": 661.21453, "r": 440.261303, "b": 332.606268 }, "text": "Discarded (cfs)\n0.13\n0.13\n0.13\n0.13\n0.13\n0.14\n0.14\n0.14\n0.14\n0.14\n0.14\n0.15\n0.15\n0.15\n0.15\n0.15\n0.15\n0.16\n0.16\n0.16\n0.16\n0.16\n0.17\n0.17\n0.17\n0.17\n0.17\n0.17", "attrs": { "row": 0, "col": 6, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p76.3.8", "order": 11, "type": "table_cell", "bbox": { "l": 461.640808, "t": 661.21453, "r": 496.12324, "b": 332.606268 }, "text": "Primary (cfs)\n1.59\n1.63\n1.67\n1.71\n1.74\n1.78\n1.82\n1.85\n2.33\n3.16\n4.23\n5.50\n6.92\n8.50\n10.21\n12.04\n13.99\n16.05\n18.21\n20.47\n22.82\n25.27\n27.80\n30.42\n33.12\n35.90\n38.76\n40.97", "attrs": { "row": 0, "col": 7, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 7 } ], "reading_order": 2 } ] }, { "document_id": 11809, "page": 77, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 10, "counts_by_type": { "caption": 1, "header": 1, "table": 2, "table_cell": 6 }, "build_ms": 14, "items": [ { "id": "p77.1", "order": 1, "type": "header", "bbox": { "l": 51.84, "t": 738.48, "r": 561.36, "b": 698.88 }, "text": "POST DEV NOAA 24-hr D 10 YEAR Rainfall=5.38\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 41", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p77.2", "order": 2, "type": "caption", "bbox": { "l": 144.24, "t": 687.6, "r": 475.92, "b": 672.72 }, "text": "Stage-Area-Storage for Pond 3P: SSIB #1 SURFACE BASIN", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p77.3", "order": 3, "type": "table", "bbox": { "l": 56.88, "t": 662.64, "r": 255.6, "b": 56.88 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 3, "integrity": { "cells_checked": 3, "cells_flagged": 0 } }, "children": [ { "id": "p77.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 57.3, "t": 661.21453, "r": 97.73433, "b": 59.66617199999996 }, "text": "Elevation (feet)\n110.00\n110.05\n110.10\n110.15\n110.20\n110.25\n110.30\n110.35\n110.40\n110.45\n110.50\n110.55\n110.60\n110.65\n110.70\n110.75\n110.80\n110.85\n110.90\n110.95\n111.00\n111.05\n111.10\n111.15\n111.20\n111.25\n111.30\n111.35\n111.40\n111.45\n111.50\n111.55\n111.60\n111.65\n111.70\n111.75\n111.80\n111.85\n111.90\n111.95\n112.00\n112.05\n112.10\n112.15\n112.20\n112.25\n112.30\n112.35\n112.40\n112.45\n112.50\n112.55\n112.60", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p77.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 138.719912, "t": 661.21453, "r": 172.604796, "b": 59.66617199999996 }, "text": "Surface (sq-ft)\n2,000\n2,022\n2,045\n2,068\n2,090\n2,113\n2,135\n2,157\n2,180\n2,203\n2,225\n2,247\n2,270\n2,293\n2,315\n2,338\n2,360\n2,382\n2,405\n2,428\n2,450\n2,487\n2,525\n2,563\n2,600\n2,638\n2,675\n2,712\n2,750\n2,788\n2,825\n2,862\n2,900\n2,938\n2,975\n3,013\n3,050\n3,087\n3,125\n3,163\n3,200\n3,240\n3,280\n3,320\n3,360\n3,400\n3,440\n3,480\n3,520\n3,560\n3,600\n3,640\n3,680", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p77.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 198.240851, "t": 661.21453, "r": 247.503763, "b": 59.66617199999996 }, "text": "Storage (cubic-feet)\n0\n101\n202\n305\n409\n514\n620\n728\n836\n946\n1,056\n1,168\n1,281\n1,395\n1,510\n1,627\n1,744\n1,863\n1,982\n2,103\n2,225\n2,348\n2,474\n2,601\n2,730\n2,861\n2,994\n3,128\n3,265\n3,403\n3,544\n3,686\n3,830\n3,976\n4,124\n4,273\n4,425\n4,578\n4,734\n4,891\n5,050\n5,211\n5,374\n5,539\n5,706\n5,875\n6,046\n6,219\n6,394\n6,571\n6,750\n6,931\n7,114", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 } ], "reading_order": 2 }, { "id": "p77.4", "order": 7, "type": "table", "bbox": { "l": 266.16, "t": 663.36, "r": 464.64, "b": 331.44 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 3, "integrity": { "cells_checked": 3, "cells_flagged": 0 } }, "children": [ { "id": "p77.4.1", "order": 8, "type": "table_cell", "bbox": { "l": 270.42, "t": 661.21453, "r": 310.85433, "b": 332.666219 }, "text": "Elevation (feet)\n112.65\n112.70\n112.75\n112.80\n112.85\n112.90\n112.95\n113.00\n113.05\n113.10\n113.15\n113.20\n113.25\n113.30\n113.35\n113.40\n113.45\n113.50\n113.55\n113.60\n113.65\n113.70\n113.75\n113.80\n113.85\n113.90\n113.95\n114.00", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p77.4.2", "order": 9, "type": "table_cell", "bbox": { "l": 351.839912, "t": 661.21453, "r": 386.330207, "b": 332.606268 }, "text": "Surface (sq-ft)\n3,720\n3,760\n3,800\n3,840\n3,880\n3,920\n3,960\n4,000\n4,030\n4,060\n4,090\n4,120\n4,150\n4,180\n4,210\n4,240\n4,270\n4,300\n4,330\n4,360\n4,390\n4,420\n4,450\n4,480\n4,510\n4,540\n4,570\n4,600", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p77.4.3", "order": 10, "type": "table_cell", "bbox": { "l": 411.360851, "t": 661.21453, "r": 461.330403, "b": 332.606268 }, "text": "Storage (cubic-feet)\n7,299\n7,486\n7,675\n7,866\n8,059\n8,254\n8,451\n8,650\n8,851\n9,053\n9,257\n9,462\n9,669\n9,877\n10,087\n10,298\n10,511\n10,725\n10,941\n11,158\n11,377\n11,597\n11,819\n12,042\n12,267\n12,493\n12,721\n12,950", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 } ], "reading_order": 3 } ] }, { "document_id": 11809, "page": 78, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 32, "counts_by_type": { "footnote": 1, "header": 1, "heading": 3, "table": 2, "table_cell": 24, "text": 1 }, "build_ms": 5, "items": [ { "id": "p78.1", "order": 1, "type": "header", "bbox": { "l": 53.28, "t": 738.72, "r": 559.92, "b": 698.64 }, "text": "POST DEV NOAA 24-hr D 10 YEAR Rainfall=5.38\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 42", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p78.2", "order": 2, "type": "heading", "bbox": { "l": 163.68, "t": 687.6, "r": 455.76, "b": 672.72 }, "text": "Summary for Pond 8P: SSIB #2 UNDERGROUND", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p78.3", "order": 3, "type": "heading", "bbox": { "l": 52.32, "t": 659.52, "r": 301.44, "b": 645.84 }, "text": "[82] Warning: Early inflow requires earlier time span", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 2 }, { "id": "p78.4", "order": 4, "type": "text", "bbox": { "l": 51.84, "t": 639.12, "r": 551.28, "b": 490.08 }, "text": "Inflow Area = 0.460 ac, 58.70% Impervious, Inflow Depth > 2.83\" for 10 YEAR event\nInflow = 1.48 cfs @ 12.08 hrs, Volume= 0.108 af\nOutflow = 0.10 cfs @ 13.45 hrs, Volume= 0.088 af, Atten= 93%, Lag= 82.1 min\nDiscarded = 0.10 cfs @ 13.45 hrs, Volume= 0.088 af\nPrimary = 0.00 cfs @ 5.00 hrs, Volume= 0.000 af\nRouted to Reach 10: COMPOSITE\n\nRouting by Stor-Ind method, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs\nPeak Elev= 108.89' @ 13.45 hrs Surf.Area= 0.064 ac Storage= 0.047 af\n\nPlug-Flow detention time= 160.2 min calculated for 0.088 af (81% of inflow)\nCenter-of-Mass det. time= 102.6 min (841.8 - 739.2)", "attrs": { "block_label": "algorithm" }, "reading_order": 3 }, { "id": "p78.5", "order": 5, "type": "table", "bbox": { "l": 52.32, "t": 482.64, "r": 556.8, "b": 370.213607 }, "text": "", "attrs": { "block_label": "table", "n_rows": 3, "n_cols": 4, "integrity": { "cells_checked": 10, "cells_flagged": 0 } }, "children": [ { "id": "p78.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 54, "t": 481.084378, "r": 549.157135, "b": 443.412765 }, "text": "Volume\n#1A\n0.192 af Overall - 0.072 af Embedded = 0.120 af x 40.0% Voids", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p78.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 115.437146, "t": 481.084378, "r": 150.396899, "b": 455.293607 }, "text": "Invert\n107.50'", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p78.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 167.453925, "t": 481.084378, "r": 231.331841, "b": 455.293607 }, "text": "Avail.Storage\n0.048 af", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p78.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 243.466175, "t": 481.084378, "r": 412.943681, "b": 455.113155 }, "text": "Storage Description\n41.95\"W x 66.33\"L x 3.00\"H Field A", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p78.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 66.12, "t": 443.520177, "r": 85.228595, "b": 431.532998 }, "text": "#2A", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p78.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 115.437146, "t": 443.520177, "r": 150.335304, "b": 431.532998 }, "text": "107.83'", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p78.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 192.471958, "t": 443.520177, "r": 231.290655, "b": 431.532998 }, "text": "0.057 af", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p78.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 243.479769, "t": 443.520177, "r": 509.915235, "b": 384.013929 }, "text": "ADS N-12 24\" x 36 Inside #1\\nInside= 23.8\"W x 23.8\"H => 3.10 sf x 20.00\"L = 62.0 cf\\nOutside= 28.0\"W x 28.0\"H => 3.92 sf x 20.00\"L = 78.4 cf\\n36 Chambers in 12 Rows\\n40.28' Header x 3.10 sf x 2 = 249.8 cf Inside", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p78.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 52.32, "t": 398.544, "r": 178.44, "b": 377.52 }, "text": "", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 8 }, { "id": "p78.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 178.44, "t": 398.544, "r": 304.56, "b": 377.52 }, "text": "", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1 }, "reading_order": 9 }, { "id": "p78.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 192.48, "t": 382.200786, "r": 231.298697, "b": 370.213607 }, "text": "0.105 af", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p78.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 243.477069, "t": 382.200786, "r": 354.519595, "b": 370.213607 }, "text": "Total Available Storage", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 } ], "reading_order": 4 }, { "id": "p78.6", "order": 18, "type": "heading", "bbox": { "l": 66.96, "t": 358.8, "r": 295.2, "b": 345.36 }, "text": "Storage Group A created with Chamber Wizard", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 5 }, { "id": "p78.7", "order": 19, "type": "table", "bbox": { "l": 48.96, "t": 336, "r": 562.56, "b": 196.56 }, "text": "", "attrs": { "block_label": "table", "n_rows": 4, "n_cols": 4, "integrity": { "cells_checked": 12, "cells_flagged": 2, "flags": [ { "row": 2, "col": 1, "coverage": 0, "text": "Max=0.10 cfs @ 13.45 hrs HW=108.89' (Free Discharge)" }, { "row": 3, "col": 1, "coverage": 0.29, "text": "Max=0.00 cfs @ 5.00 hrs HW=107.50' (Free Discharge)" } ] } }, "children": [ { "id": "p78.7.1", "order": 20, "type": "table_cell", "bbox": { "l": 54.000153, "t": 334.681717, "r": 86.82526, "b": 308.893607 }, "text": "Device\n#1", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p78.7.2", "order": 21, "type": "table_cell", "bbox": { "l": 98.873664, "t": 334.681717, "r": 147.222394, "b": 308.893607 }, "text": "Routing\nDiscarded", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p78.7.3", "order": 22, "type": "table_cell", "bbox": { "l": 175.965845, "t": 334.681717, "r": 210.937678, "b": 308.893607 }, "text": "Invert\n107.50'", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p78.7.4", "order": 23, "type": "table_cell", "bbox": { "l": 223.014009, "t": 334.681717, "r": 453.384188, "b": 297.012765 }, "text": "Outlet Devices\n1.000 in/hr Exfiltration over Surface area\\nConductivity to Groundwater Elevation = 105.00'", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p78.7.5", "order": 24, "type": "table_cell", "bbox": { "l": 70.44, "t": 297.120177, "r": 82.384214, "b": 285.132998 }, "text": "#2", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p78.7.6", "order": 25, "type": "table_cell", "bbox": { "l": 98.876253, "t": 297.120177, "r": 135.868946, "b": 285.132998 }, "text": "Primary", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p78.7.7", "order": 26, "type": "table_cell", "bbox": { "l": 175.97229, "t": 297.120177, "r": 210.870449, "b": 285.132998 }, "text": "109.00'", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p78.7.8", "order": 27, "type": "table_cell", "bbox": { "l": 223.01982, "t": 297.120177, "r": 445.634412, "b": 273.253231 }, "text": "8.0\" W x 4.0\" H Vert. Orifice/Grate C= 0.600\\nLimited to weir flow at low heads", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p78.7.9", "order": 28, "type": "table_cell", "bbox": { "l": 53.999519, "t": 261.300424, "r": 231.763157, "b": 237.43347700000004 }, "text": "Discarded OutFlow\n1=Exfiltration ( Controls 0.10 cfs)", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 8 }, { "id": "p78.7.10", "order": 29, "type": "table_cell", "bbox": { "l": 305.76, "t": 276.24, "r": 562.56, "b": 256.32 }, "text": "Max=0.10 cfs @ 13.45 hrs HW=108.89' (Free Discharge)", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 2 }, "reading_order": 9 }, { "id": "p78.7.11", "order": 30, "type": "table_cell", "bbox": { "l": 54, "t": 225.66078600000003, "r": 240.461861, "b": 201.79384000000005 }, "text": "Primary OutFlow\n2=Orifice/Grate ( Controls 0.00 cfs)", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 10 }, { "id": "p78.7.12", "order": 31, "type": "table_cell", "bbox": { "l": 305.76, "t": 236.4, "r": 562.56, "b": 216.48 }, "text": "Max=0.00 cfs @ 5.00 hrs HW=107.50' (Free Discharge)", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 2 }, "reading_order": 11 } ], "reading_order": 6 }, { "id": "p78.8", "order": 32, "type": "footnote", "bbox": { "l": 190.32, "t": 382.08, "r": 357.36, "b": 368.88 }, "text": "0.105 af Total Available Storage", "attrs": { "block_label": "vision_footnote" }, "reading_order": 7 } ] }, { "document_id": 11809, "page": 79, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 6, "counts_by_type": { "figure": 1, "footer": 1, "header": 1, "text": 2, "title": 1 }, "build_ms": 0, "items": [ { "id": "p79.1", "order": 1, "type": "header", "bbox": { "l": 53.04, "t": 738.72, "r": 560.88, "b": 698.4 }, "text": "POST DEV NOAA 24-hr D 10 YEAR Rainfall=5.38\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 43", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p79.2", "order": 2, "type": "title", "bbox": { "l": 126.48, "t": 687.84, "r": 494.16, "b": 672.72 }, "text": "Pond 8P: SSIB #2 UNDERGROUND - Chamber Wizard Field A", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p79.3", "order": 3, "type": "text", "bbox": { "l": 49.68, "t": 661.44, "r": 543.12, "b": 406.08 }, "text": "Chamber Model = ADS N-12 24\" (ADS N-12® Pipe)\nInside= 23.8\"W x 23.8\"H => 3.10 sf x 20.00'L = 62.0 cf\nOutside= 28.0\"W x 28.0\"H => 3.92 sf x 20.00'L = 78.4 cf\n28.0\" Wide + 13.4\" Spacing = 41.4\" C-C Row Spacing\n3 Chambers/Row x 20.00' Long +2.33' Header x 2 = 64.67' Row Length +10.0\" End Stone x 2 = 66.33' Base Length\n12 Rows x 28.0\" Wide + 13.4\" Spacing x 11 + 10.0\" Side Stone x 2 = 41.95' Base Width\n4.0\" Stone Base + 28.0\" Chamber Height + 4.0\" Stone Cover = 3.00' Field Height\n36 Chambers x 62.0 cf + 40.28' Header x 3.10 sf x 2 = 2,481.8 cf Chamber Storage\n36 Chambers x 78.4 cf + 40.28' Header x 3.92 sf x 2 = 3,137.9 cf Displacement\n8,348.3 cf Field - 3,137.9 cf Chambers = 5,210.4 cf Stone x 40.0% Voids = 2,084.2 cf Stone Storage\nChamber Storage + Stone Storage = 4,565.9 cf = 0.105 af\nOverall Storage Efficiency = 54.7%\nOverall System Size = 66.33' x 41.95' x 3.00'", "attrs": { "block_label": "algorithm" }, "reading_order": 2 }, { "id": "p79.4", "order": 4, "type": "text", "bbox": { "l": 52.08, "t": 400.8, "r": 127.92, "b": 360.48 }, "text": "36 Chambers\n309.2 cy Field\n193.0 cy Stone", "reading_order": 3 }, { "id": "p79.5", "order": 5, "type": "figure", "bbox": { "l": 223.68, "t": 346.8, "r": 387.84, "b": 93.36 }, "text": "", "attrs": { "block_label": "image" }, "reading_order": 4 }, { "id": "p79.6", "order": 6, "type": "footer", "bbox": { "l": 223.2, "t": 66.48, "r": 387.12, "b": 53.76 }, "text": "010101", "attrs": { "block_label": "footer" }, "reading_order": 5 } ] }, { "document_id": 11809, "page": 80, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 3, "counts_by_type": { "caption": 1, "figure": 1, "header": 1 }, "build_ms": 0, "items": [ { "id": "p80.1", "order": 1, "type": "header", "bbox": { "l": 51.84, "t": 738.24, "r": 563.52, "b": 698.64 }, "text": "POST DEV NOAA 24-hr D 10 YEAR Rainfall=5.38\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 44", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p80.2", "order": 2, "type": "caption", "bbox": { "l": 203.28, "t": 687.84, "r": 413.76, "b": 672.96 }, "text": "Pond 8P: SSIB #2 UNDERGROUND", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p80.3", "order": 3, "type": "figure", "bbox": { "l": 60.96, "t": 672.72, "r": 552.24, "b": 400.08 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nInflow\n1.48 cfs Outflow\nInflow Area=0.460 ac Primary\nDiscarded\nPeak Elev=108.89'\nStorage=0.047 af\n1\n(cfs)\nFlow\n0.10 cfs\n0.10 cfs\n0.00 cfs\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 2 } ] }, { "document_id": 11809, "page": 81, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 12, "counts_by_type": { "caption": 1, "header": 1, "table": 2, "table_cell": 8 }, "build_ms": 13, "items": [ { "id": "p81.1", "order": 1, "type": "header", "bbox": { "l": 51.84, "t": 738.48, "r": 561.6, "b": 698.64 }, "text": "POST DEV NOAA 24-hr D 10 YEAR Rainfall=5.38\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 45", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p81.2", "order": 2, "type": "caption", "bbox": { "l": 153.84, "t": 687.84, "r": 466.32, "b": 672.72 }, "text": "Stage-Discharge for Pond 8P: SSIB #2 UNDERGROUND", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p81.3", "order": 3, "type": "table", "bbox": { "l": 56.4, "t": 661.92, "r": 275.04, "b": 56.64 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 4, "integrity": { "cells_checked": 4, "cells_flagged": 0 } }, "children": [ { "id": "p81.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 57.3, "t": 661.21453, "r": 97.73433, "b": 59.66617199999996 }, "text": "Elevation (feet)\n107.50\n107.55\n107.60\n107.65\n107.70\n107.75\n107.80\n107.85\n107.90\n107.95\n108.00\n108.05\n108.10\n108.15\n108.20\n108.25\n108.30\n108.35\n108.40\n108.45\n108.50\n108.55\n108.60\n108.65\n108.70\n108.75\n108.80\n108.85\n108.90\n108.95\n109.00\n109.05\n109.10\n109.15\n109.20\n109.25\n109.30\n109.35\n109.40\n109.45\n109.50\n109.55\n109.60\n109.65\n109.70\n109.75\n109.80\n109.85\n109.90\n109.95\n110.00\n110.05\n110.10", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p81.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 109.260182, "t": 661.21453, "r": 153.49646, "b": 59.66617199999996 }, "text": "Discharge (cfs)\n0.00\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.08\n0.08\n0.08\n0.08\n0.08\n0.08\n0.08\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.13\n0.17\n0.23\n0.30\n0.38\n0.46\n0.55\n0.62\n0.68\n0.73\n0.77\n0.82\n0.86\n0.90\n0.94\n0.97\n1.01\n1.04\n1.07\n1.10\n1.13\n1.16", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p81.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 165.000251, "t": 661.21453, "r": 209.236529, "b": 59.66617199999996 }, "text": "Discarded (cfs)\n0.00\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.08\n0.08\n0.08\n0.08\n0.08\n0.08\n0.08\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.11\n0.11\n0.11\n0.11\n0.11\n0.11\n0.11\n0.11\n0.12\n0.12\n0.12\n0.12\n0.12\n0.12\n0.12\n0.12\n0.13\n0.13\n0.13\n0.13\n0.13", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p81.3.4", "order": 7, "type": "table_cell", "bbox": { "l": 231.060808, "t": 661.21453, "r": 264.933898, "b": 59.66617199999996 }, "text": "Primary (cfs)\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.02\n0.07\n0.12\n0.19\n0.27\n0.35\n0.44\n0.50\n0.56\n0.61\n0.66\n0.70\n0.74\n0.78\n0.81\n0.85\n0.88\n0.91\n0.95\n0.98\n1.00\n1.03", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 } ], "reading_order": 2 }, { "id": "p81.4", "order": 8, "type": "table", "bbox": { "l": 282.24, "t": 662.88, "r": 498.24, "b": 550.8 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 4, "integrity": { "cells_checked": 4, "cells_flagged": 0 } }, "children": [ { "id": "p81.4.1", "order": 9, "type": "table_cell", "bbox": { "l": 287.88, "t": 661.21453, "r": 328.31433, "b": 551.0662580000001 }, "text": "Elevation (feet)\n110.15\n110.20\n110.25\n110.30\n110.35\n110.40\n110.45\n110.50", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p81.4.2", "order": 10, "type": "table_cell", "bbox": { "l": 339.840182, "t": 661.21453, "r": 384.526148, "b": 551.006306 }, "text": "Discharge (cfs)\n1.19\n1.22\n1.25\n1.27\n1.30\n1.33\n1.35\n1.38", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p81.4.3", "order": 11, "type": "table_cell", "bbox": { "l": 395.580251, "t": 661.21453, "r": 440.263268, "b": 551.006306 }, "text": "Discarded (cfs)\n0.13\n0.13\n0.14\n0.14\n0.14\n0.14\n0.14\n0.14", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p81.4.4", "order": 12, "type": "table_cell", "bbox": { "l": 461.640808, "t": 661.21453, "r": 496.000389, "b": 551.006306 }, "text": "Primary (cfs)\n1.06\n1.09\n1.11\n1.14\n1.16\n1.19\n1.21\n1.23", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 } ], "reading_order": 3 } ] }, { "document_id": 11809, "page": 82, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 10, "counts_by_type": { "caption": 1, "header": 1, "table": 2, "table_cell": 6 }, "build_ms": 9, "items": [ { "id": "p82.1", "order": 1, "type": "header", "bbox": { "l": 51.6, "t": 738.48, "r": 562.08, "b": 699.12 }, "text": "POST DEV NOAA 24-hr D 10 YEAR Rainfall=5.38\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 46", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p82.2", "order": 2, "type": "caption", "bbox": { "l": 146.16, "t": 687.84, "r": 474.48, "b": 672.72 }, "text": "Stage-Area-Storage for Pond 8P: SSIB #2 UNDERGROUND", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p82.3", "order": 3, "type": "table", "bbox": { "l": 56.64, "t": 661.21453, "r": 235.68, "b": 57.12 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 3, "integrity": { "cells_checked": 3, "cells_flagged": 0 } }, "children": [ { "id": "p82.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 57.3, "t": 661.21453, "r": 97.73433, "b": 59.66617199999996 }, "text": "Elevation (feet)\n107.50\n107.55\n107.60\n107.65\n107.70\n107.75\n107.80\n107.85\n107.90\n107.95\n108.00\n108.05\n108.10\n108.15\n108.20\n108.25\n108.30\n108.35\n108.40\n108.45\n108.50\n108.55\n108.60\n108.65\n108.70\n108.75\n108.80\n108.85\n108.90\n108.95\n109.00\n109.05\n109.10\n109.15\n109.20\n109.25\n109.30\n109.35\n109.40\n109.45\n109.50\n109.55\n109.60\n109.65\n109.70\n109.75\n109.80\n109.85\n109.90\n109.95\n110.00\n110.05\n110.10", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p82.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 125.040179, "t": 661.21453, "r": 159.530474, "b": 59.66617199999996 }, "text": "Surface (acres)\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p82.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 182.880513, "t": 661.21453, "r": 228.350762, "b": 59.66617199999996 }, "text": "Storage (acre-feet)\n0.000\n0.001\n0.003\n0.004\n0.005\n0.006\n0.008\n0.009\n0.010\n0.011\n0.012\n0.013\n0.014\n0.016\n0.018\n0.020\n0.022\n0.024\n0.026\n0.028\n0.030\n0.032\n0.034\n0.036\n0.039\n0.041\n0.043\n0.045\n0.048\n0.050\n0.052\n0.055\n0.057\n0.059\n0.062\n0.064\n0.066\n0.068\n0.071\n0.073\n0.075\n0.077\n0.079\n0.081\n0.083\n0.085\n0.087\n0.089\n0.090\n0.092\n0.093\n0.094\n0.095", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 } ], "reading_order": 2 }, { "id": "p82.4", "order": 7, "type": "table", "bbox": { "l": 246.48, "t": 662.4, "r": 425.04, "b": 551.006306 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 3, "integrity": { "cells_checked": 3, "cells_flagged": 0 } }, "children": [ { "id": "p82.4.1", "order": 8, "type": "table_cell", "bbox": { "l": 251.28, "t": 661.21453, "r": 291.71433, "b": 551.0662580000001 }, "text": "Elevation (feet)\n110.15\n110.20\n110.25\n110.30\n110.35\n110.40\n110.45\n110.50", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p82.4.2", "order": 9, "type": "table_cell", "bbox": { "l": 319.020179, "t": 661.21453, "r": 352.90408, "b": 551.0662580000001 }, "text": "Surface (acres)\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p82.4.3", "order": 10, "type": "table_cell", "bbox": { "l": 376.860513, "t": 661.21453, "r": 422.930276, "b": 551.006306 }, "text": "Storage (acre-feet)\n0.096\n0.097\n0.098\n0.100\n0.101\n0.102\n0.104\n0.105", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 } ], "reading_order": 3 } ] }, { "document_id": 11809, "page": 83, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 32, "counts_by_type": { "footnote": 1, "header": 1, "heading": 3, "table": 2, "table_cell": 24, "text": 1 }, "build_ms": 6, "items": [ { "id": "p83.1", "order": 1, "type": "header", "bbox": { "l": 52.56, "t": 738.72, "r": 561.12, "b": 698.64 }, "text": "POST DEV NOAA 24-hr D 10 YEAR Rainfall=5.38\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 47", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p83.2", "order": 2, "type": "heading", "bbox": { "l": 163.68, "t": 687.6, "r": 455.52, "b": 672.72 }, "text": "Summary for Pond 9P: SSIB #3 UNDERGROUND", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p83.3", "order": 3, "type": "heading", "bbox": { "l": 52.32, "t": 659.52, "r": 301.44, "b": 645.84 }, "text": "[82] Warning: Early inflow requires earlier time span", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 2 }, { "id": "p83.4", "order": 4, "type": "text", "bbox": { "l": 51.84, "t": 639.36, "r": 551.52, "b": 490.32 }, "text": "Inflow Area = 0.460 ac,100.00% Impervious, Inflow Depth > 4.66\" for 10 YEAR event\nInflow = 2.35 cfs @ 12.10 hrs, Volume= 0.179 af\nOutflow = 0.14 cfs @ 13.59 hrs, Volume= 0.127 af, Atten= 94%, Lag= 89.8 min\nDiscarded = 0.14 cfs @ 13.59 hrs, Volume= 0.127 af\nPrimary = 0.00 cfs @ 5.00 hrs, Volume= 0.000 af\nRouted to Reach 10 : COMPOSITE\n\nRouting by Stor-Ind method, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs\nPeak Elev= 112.59' @ 13.59 hrs Surf.Area= 0.085 ac Storage= 0.087 af\n\nPlug-Flow detention time= 170.1 min calculated for 0.127 af (71% of inflow)\nCenter-of-Mass det. time= 99.5 min ( 833.8 - 734.2 )", "attrs": { "block_label": "algorithm" }, "reading_order": 3 }, { "id": "p83.5", "order": 5, "type": "table", "bbox": { "l": 52.32, "t": 482.64, "r": 556.8, "b": 370.213607 }, "text": "", "attrs": { "block_label": "table", "n_rows": 3, "n_cols": 4, "integrity": { "cells_checked": 10, "cells_flagged": 0 } }, "children": [ { "id": "p83.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 54, "t": 481.084378, "r": 549.157135, "b": 443.412765 }, "text": "Volume\n#1A\n0.255 af Overall - 0.096 af Embedded = 0.159 af x 40.0% Voids", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p83.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 115.437146, "t": 481.084378, "r": 150.396899, "b": 455.293607 }, "text": "Invert\n110.80'", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p83.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 167.453925, "t": 481.084378, "r": 231.331841, "b": 455.293607 }, "text": "Avail.Storage\n0.063 af", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p83.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 243.466175, "t": 481.084378, "r": 412.943681, "b": 455.113155 }, "text": "Storage Description\n55.75'W x 66.33'L x 3.00'H Field A", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p83.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 66.12, "t": 443.520177, "r": 85.228595, "b": 431.532998 }, "text": "#2A", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p83.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 115.437146, "t": 443.520177, "r": 150.335304, "b": 431.532998 }, "text": "111.13'", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p83.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 192.471958, "t": 443.520177, "r": 231.290655, "b": 431.532998 }, "text": "0.076 af", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p83.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 243.479769, "t": 443.520177, "r": 509.915235, "b": 384.013929 }, "text": "ADS N-12 24\" x 48 Inside #1\\nInside = 23.8\"W x 23.8\"H => 3.10 sf x 20.00'L = 62.0 cf\\nOutside = 28.0\"W x 28.0\"H => 3.92 sf x 20.00'L = 78.4 cf\\n48 Chambers in 16 Rows\\n54.08' Header x 3.10 sf x 2 = 335.3 cf Inside", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p83.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 52.32, "t": 397.392, "r": 178.44, "b": 376.08 }, "text": "", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 8 }, { "id": "p83.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 178.44, "t": 397.392, "r": 304.56, "b": 376.08 }, "text": "", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1 }, "reading_order": 9 }, { "id": "p83.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 192.48, "t": 382.200786, "r": 231.298697, "b": 370.213607 }, "text": "0.139 af", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p83.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 243.477069, "t": 382.200786, "r": 354.519595, "b": 370.213607 }, "text": "Total Available Storage", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 } ], "reading_order": 4 }, { "id": "p83.6", "order": 18, "type": "heading", "bbox": { "l": 67.2, "t": 358.8, "r": 295.44, "b": 345.36 }, "text": "Storage Group A created with Chamber Wizard", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 5 }, { "id": "p83.7", "order": 19, "type": "table", "bbox": { "l": 49.2, "t": 336.96, "r": 562.8, "b": 195.12 }, "text": "", "attrs": { "block_label": "table", "n_rows": 4, "n_cols": 4, "integrity": { "cells_checked": 12, "cells_flagged": 2, "flags": [ { "row": 2, "col": 1, "coverage": 0, "text": "Max=0.14 cfs @ 13.59 hrs HW=112.59' (Free Discharge)" }, { "row": 3, "col": 1, "coverage": 0.29, "text": "Max=0.00 cfs @ 5.00 hrs HW=110.80' (Free Discharge)" } ] } }, "children": [ { "id": "p83.7.1", "order": 20, "type": "table_cell", "bbox": { "l": 54.000153, "t": 334.681717, "r": 86.82526, "b": 308.893607 }, "text": "Device\n#1", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p83.7.2", "order": 21, "type": "table_cell", "bbox": { "l": 98.873664, "t": 334.681717, "r": 147.222394, "b": 308.893607 }, "text": "Routing\nDiscarded", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p83.7.3", "order": 22, "type": "table_cell", "bbox": { "l": 175.965845, "t": 334.681717, "r": 210.937678, "b": 308.893607 }, "text": "Invert\n110.80'", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p83.7.4", "order": 23, "type": "table_cell", "bbox": { "l": 223.014009, "t": 334.681717, "r": 453.384188, "b": 297.012765 }, "text": "Outlet Devices\n1.000 in/hr Exfiltration over Surface area\\nConductivity to Groundwater Elevation = 108.00'", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p83.7.5", "order": 24, "type": "table_cell", "bbox": { "l": 70.44, "t": 297.120177, "r": 82.384214, "b": 285.132998 }, "text": "#2", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p83.7.6", "order": 25, "type": "table_cell", "bbox": { "l": 98.876253, "t": 297.120177, "r": 135.868946, "b": 285.132998 }, "text": "Primary", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p83.7.7", "order": 26, "type": "table_cell", "bbox": { "l": 175.97229, "t": 297.120177, "r": 210.870449, "b": 285.132998 }, "text": "113.00'", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p83.7.8", "order": 27, "type": "table_cell", "bbox": { "l": 223.01982, "t": 297.120177, "r": 451.453995, "b": 273.253231 }, "text": "12.0\" W x 6.0\" H Vert. Orifice/Grate C= 0.600\\nLimited to weir flow at low heads", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p83.7.9", "order": 28, "type": "table_cell", "bbox": { "l": 53.999519, "t": 261.300424, "r": 231.763157, "b": 237.43347700000004 }, "text": "Discarded OutFlow\n1=Exfiltration ( Controls 0.14 cfs)", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 8 }, { "id": "p83.7.10", "order": 29, "type": "table_cell", "bbox": { "l": 306, "t": 276.1714, "r": 562.8, "b": 255.9086 }, "text": "Max=0.14 cfs @ 13.59 hrs HW=112.59' (Free Discharge)", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 2 }, "reading_order": 9 }, { "id": "p83.7.11", "order": 30, "type": "table_cell", "bbox": { "l": 54, "t": 225.66078600000003, "r": 240.461861, "b": 201.79384000000005 }, "text": "Primary OutFlow\n2=Orifice/Grate ( Controls 0.00 cfs)", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 10 }, { "id": "p83.7.12", "order": 31, "type": "table_cell", "bbox": { "l": 306, "t": 235.6457, "r": 562.8, "b": 215.3829 }, "text": "Max=0.00 cfs @ 5.00 hrs HW=110.80' (Free Discharge)", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 2 }, "reading_order": 11 } ], "reading_order": 6 }, { "id": "p83.8", "order": 32, "type": "footnote", "bbox": { "l": 190.32, "t": 381.84, "r": 357.36, "b": 368.88 }, "text": "0.139 af Total Available Storage", "attrs": { "block_label": "vision_footnote" }, "reading_order": 7 } ] }, { "document_id": 11809, "page": 84, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 6, "counts_by_type": { "figure": 1, "footer": 1, "header": 1, "text": 2, "title": 1 }, "build_ms": 1, "items": [ { "id": "p84.1", "order": 1, "type": "header", "bbox": { "l": 53.04, "t": 738.72, "r": 560.88, "b": 698.4 }, "text": "POST DEV NOAA 24-hr D 10 YEAR Rainfall=5.38\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 48", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p84.2", "order": 2, "type": "title", "bbox": { "l": 126.48, "t": 687.84, "r": 494.4, "b": 672.72 }, "text": "Pond 9P: SSIB #3 UNDERGROUND - Chamber Wizard Field A", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p84.3", "order": 3, "type": "text", "bbox": { "l": 49.68, "t": 662.4, "r": 544.8, "b": 405.84 }, "text": "Chamber Model = ADS N-12 24\" (ADS N-12® Pipe)\nInside= 23.8\"W x 23.8\"H => 3.10 sf x 20.00\"L = 62.0 cf\nOutside= 28.0\"W x 28.0\"H => 3.92 sf x 20.00\"L = 78.4 cf\n28.0\" Wide + 13.4\" Spacing = 41.4\" C-C Row Spacing\n3 Chambers/Row x 20.00' Long +2.33' Header x 2 = 64.67' Row Length +10.0\" End Stone x 2 = 66.33' Base Length\n16 Rows x 28.0\" Wide + 13.4\" Spacing x 15 + 10.0\" Side Stone x 2 = 55.75' Base Width\n4.0\" Stone Base + 28.0\" Chamber Height + 4.0\" Stone Cover = 3.00' Field Height\n48 Chambers x 62.0 cf + 54.08' Header x 3.10 sf x 2 = 3,311.3 cf Chamber Storage\n48 Chambers x 78.4 cf + 54.08' Header x 3.92 sf x 2 = 4,186.8 cf Displacement\n11,094.6 cf Field - 4,186.8 cf Chambers = 6,907.8 cf Stone x 40.0% Voids = 2,763.1 cf Stone Storage\nChamber Storage + Stone Storage = 6,074.4 cf = 0.139 af\nOverall Storage Efficiency = 54.8%\nOverall System Size = 66.33' x 55.75' x 3.00'", "attrs": { "block_label": "algorithm" }, "reading_order": 2 }, { "id": "p84.4", "order": 4, "type": "text", "bbox": { "l": 51.84, "t": 400.56, "r": 127.92, "b": 360.48 }, "text": "48 Chambers\n410.9 cy Field\n255.8 cy Stone", "reading_order": 3 }, { "id": "p84.5", "order": 5, "type": "figure", "bbox": { "l": 196.8, "t": 348.96, "r": 414.72, "b": 92.88 }, "text": "", "attrs": { "block_label": "image" }, "reading_order": 4 }, { "id": "p84.6", "order": 6, "type": "footer", "bbox": { "l": 197.04, "t": 66.24, "r": 414.48, "b": 53.76 }, "text": "101010", "attrs": { "block_label": "footer" }, "reading_order": 5 } ] }, { "document_id": 11809, "page": 85, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 3, "counts_by_type": { "caption": 1, "figure": 1, "header": 1 }, "build_ms": 0, "items": [ { "id": "p85.1", "order": 1, "type": "header", "bbox": { "l": 52.56, "t": 738, "r": 560.64, "b": 699.12 }, "text": "POST DEV NOAA 24-hr D 10 YEAR Rainfall=5.38\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 49", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p85.2", "order": 2, "type": "caption", "bbox": { "l": 203.28, "t": 687.84, "r": 413.76, "b": 672.96 }, "text": "Pond 9P: SSIB #3 UNDERGROUND", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p85.3", "order": 3, "type": "figure", "bbox": { "l": 61.2, "t": 673.2, "r": 552.24, "b": 399.84 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nInflow\n2.35 cfs Outflow\nInflow Area=0.460 ac Primary\nDiscarded\nPeak Elev=112.59'\nStorage=0.087 af\n2\n(cfs)\nFlow\n1\n0.14 cfs\n0.14 cfs\n0.00 cfs\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 2 } ] }, { "document_id": 11809, "page": 86, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 12, "counts_by_type": { "caption": 1, "header": 1, "table": 2, "table_cell": 8 }, "build_ms": 14, "items": [ { "id": "p86.1", "order": 1, "type": "header", "bbox": { "l": 51.84, "t": 738.48, "r": 561.36, "b": 698.64 }, "text": "POST DEV NOAA 24-hr D 10 YEAR Rainfall=5.38\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 50", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p86.2", "order": 2, "type": "caption", "bbox": { "l": 154.08, "t": 687.84, "r": 466.08, "b": 672.72 }, "text": "Stage-Discharge for Pond 9P: SSIB #3 UNDERGROUND", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p86.3", "order": 3, "type": "table", "bbox": { "l": 56.88, "t": 661.68, "r": 275.28, "b": 56.64 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 4, "integrity": { "cells_checked": 4, "cells_flagged": 0 } }, "children": [ { "id": "p86.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 57.3, "t": 661.21453, "r": 97.73433, "b": 59.66617199999996 }, "text": "Elevation (feet)\n110.80\n110.85\n110.90\n110.95\n111.00\n111.05\n111.10\n111.15\n111.20\n111.25\n111.30\n111.35\n111.40\n111.45\n111.50\n111.55\n111.60\n111.65\n111.70\n111.75\n111.80\n111.85\n111.90\n111.95\n112.00\n112.05\n112.10\n112.15\n112.20\n112.25\n112.30\n112.35\n112.40\n112.45\n112.50\n112.55\n112.60\n112.65\n112.70\n112.75\n112.80\n112.85\n112.90\n112.95\n113.00\n113.05\n113.10\n113.15\n113.20\n113.25\n113.30\n113.35\n113.40", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p86.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 109.260182, "t": 661.21453, "r": 153.49646, "b": 59.66617199999996 }, "text": "Discharge (cfs)\n0.00\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.11\n0.11\n0.11\n0.11\n0.11\n0.11\n0.11\n0.12\n0.12\n0.12\n0.12\n0.12\n0.12\n0.13\n0.13\n0.13\n0.13\n0.13\n0.13\n0.13\n0.14\n0.14\n0.14\n0.14\n0.14\n0.14\n0.15\n0.15\n0.15\n0.15\n0.15\n0.15\n0.19\n0.26\n0.34\n0.45\n0.56\n0.69\n0.83\n0.98", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p86.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 165.000251, "t": 661.21453, "r": 209.236529, "b": 59.66617199999996 }, "text": "Discarded (cfs)\n0.00\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.11\n0.11\n0.11\n0.11\n0.11\n0.11\n0.11\n0.12\n0.12\n0.12\n0.12\n0.12\n0.12\n0.13\n0.13\n0.13\n0.13\n0.13\n0.13\n0.13\n0.14\n0.14\n0.14\n0.14\n0.14\n0.14\n0.15\n0.15\n0.15\n0.15\n0.15\n0.15\n0.15\n0.16\n0.16\n0.16\n0.16\n0.16\n0.16\n0.17", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p86.3.4", "order": 7, "type": "table_cell", "bbox": { "l": 231.060808, "t": 661.21453, "r": 264.933898, "b": 59.66617199999996 }, "text": "Primary (cfs)\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.04\n0.10\n0.19\n0.29\n0.40\n0.53\n0.66\n0.81", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 } ], "reading_order": 2 }, { "id": "p86.4", "order": 8, "type": "table", "bbox": { "l": 282.24, "t": 662.88, "r": 498.24, "b": 550.56 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 4, "integrity": { "cells_checked": 4, "cells_flagged": 0 } }, "children": [ { "id": "p86.4.1", "order": 9, "type": "table_cell", "bbox": { "l": 287.88, "t": 661.21453, "r": 328.31433, "b": 551.0662580000001 }, "text": "Elevation (feet)\n113.45\n113.50\n113.55\n113.60\n113.65\n113.70\n113.75\n113.80", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p86.4.2", "order": 10, "type": "table_cell", "bbox": { "l": 339.840182, "t": 661.21453, "r": 384.526148, "b": 551.006306 }, "text": "Discharge (cfs)\n1.14\n1.30\n1.44\n1.56\n1.67\n1.77\n1.86\n1.95", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p86.4.3", "order": 11, "type": "table_cell", "bbox": { "l": 395.580251, "t": 661.21453, "r": 440.263268, "b": 551.006306 }, "text": "Discarded (cfs)\n0.17\n0.17\n0.17\n0.17\n0.17\n0.17\n0.18\n0.18", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p86.4.4", "order": 12, "type": "table_cell", "bbox": { "l": 461.640808, "t": 661.21453, "r": 496.000389, "b": 551.006306 }, "text": "Primary (cfs)\n0.97\n1.13\n1.27\n1.39\n1.50\n1.59\n1.68\n1.77", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 } ], "reading_order": 3 } ] }, { "document_id": 11809, "page": 87, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 10, "counts_by_type": { "caption": 1, "header": 1, "table": 2, "table_cell": 6 }, "build_ms": 9, "items": [ { "id": "p87.1", "order": 1, "type": "header", "bbox": { "l": 51.6, "t": 738.72, "r": 561.84, "b": 699.12 }, "text": "POST DEV NOAA 24-hr D 10 YEAR Rainfall=5.38\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 51", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p87.2", "order": 2, "type": "caption", "bbox": { "l": 146.16, "t": 687.6, "r": 474.48, "b": 672.96 }, "text": "Stage-Area-Storage for Pond 9P: SSIB #3 UNDERGROUND", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p87.3", "order": 3, "type": "table", "bbox": { "l": 57.3, "t": 661.21453, "r": 235.68, "b": 56.88 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 3, "integrity": { "cells_checked": 3, "cells_flagged": 0 } }, "children": [ { "id": "p87.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 57.3, "t": 661.21453, "r": 97.73433, "b": 59.66617199999996 }, "text": "Elevation (feet)\n110.80\n110.85\n110.90\n110.95\n111.00\n111.05\n111.10\n111.15\n111.20\n111.25\n111.30\n111.35\n111.40\n111.45\n111.50\n111.55\n111.60\n111.65\n111.70\n111.75\n111.80\n111.85\n111.90\n111.95\n112.00\n112.05\n112.10\n112.15\n112.20\n112.25\n112.30\n112.35\n112.40\n112.45\n112.50\n112.55\n112.60\n112.65\n112.70\n112.75\n112.80\n112.85\n112.90\n112.95\n113.00\n113.05\n113.10\n113.15\n113.20\n113.25\n113.30\n113.35\n113.40", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p87.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 125.040179, "t": 661.21453, "r": 159.530474, "b": 59.66617199999996 }, "text": "Surface (acres)\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p87.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 182.880513, "t": 661.21453, "r": 228.350762, "b": 59.66617199999996 }, "text": "Storage (acre-feet)\n0.000\n0.002\n0.003\n0.005\n0.007\n0.008\n0.010\n0.012\n0.013\n0.015\n0.016\n0.017\n0.019\n0.021\n0.024\n0.026\n0.029\n0.031\n0.034\n0.037\n0.040\n0.042\n0.045\n0.048\n0.051\n0.054\n0.057\n0.060\n0.064\n0.067\n0.070\n0.073\n0.076\n0.079\n0.082\n0.085\n0.088\n0.091\n0.094\n0.097\n0.100\n0.103\n0.105\n0.108\n0.111\n0.113\n0.116\n0.118\n0.120\n0.122\n0.124\n0.125\n0.126", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 } ], "reading_order": 2 }, { "id": "p87.4", "order": 7, "type": "table", "bbox": { "l": 246.48, "t": 662.16, "r": 425.04, "b": 551.006306 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 3, "integrity": { "cells_checked": 3, "cells_flagged": 0 } }, "children": [ { "id": "p87.4.1", "order": 8, "type": "table_cell", "bbox": { "l": 251.28, "t": 661.21453, "r": 291.71433, "b": 551.0662580000001 }, "text": "Elevation (feet)\n113.45\n113.50\n113.55\n113.60\n113.65\n113.70\n113.75\n113.80", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p87.4.2", "order": 9, "type": "table_cell", "bbox": { "l": 319.020179, "t": 661.21453, "r": 352.90408, "b": 551.0662580000001 }, "text": "Surface (acres)\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p87.4.3", "order": 10, "type": "table_cell", "bbox": { "l": 376.860513, "t": 661.21453, "r": 422.930276, "b": 551.006306 }, "text": "Storage (acre-feet)\n0.128\n0.129\n0.131\n0.133\n0.134\n0.136\n0.138\n0.139", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 } ], "reading_order": 3 } ] }, { "document_id": 11809, "page": 88, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 19, "counts_by_type": { "text": 19 }, "build_ms": 2, "items": [ { "id": "p88.1", "order": 1, "type": "text", "bbox": { "l": 51.36, "t": 738.96, "r": 561.36, "b": 700.32 }, "text": "POST DEV NOAA 24-hr D 25 year Rainfall=6.68\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 52", "reading_order": 0 }, { "id": "p88.2", "order": 2, "type": "text", "bbox": { "l": 120.48, "t": 687.36, "r": 490.32, "b": 650.88 }, "text": "Time span=5.00-20.00 hrs, dt=0.05 hrs, 301 points\nRunoff by SCS TR-20 method, UH=Delmarva, Weighted-CN\nReach routing by Stor-Ind+Trans method - Pond routing by Stor-Ind method", "reading_order": 1 }, { "id": "p88.3", "order": 3, "type": "text", "bbox": { "l": 257.76, "t": 640.08, "r": 560.16, "b": 616.32 }, "text": "Subcatchment1S: POROUS\nRunoff Area=0.570 ac 0.00% Impervious Runoff Depth>0.53\"\nFlow Length=310' Tc=12.9 min CN=39 Runoff=0.11 cfs 0.025 af", "reading_order": 2 }, { "id": "p88.4", "order": 4, "type": "text", "bbox": { "l": 259.92, "t": 605.28, "r": 559.68, "b": 581.52 }, "text": "Subcatchment2S: IMPERVIOUS\nRunoff Area=0.720 ac 100.00% Impervious Runoff Depth>5.81\"\nFlow Length=310' Tc=13.1 min CN=98 Runoff=2.68 cfs 0.349 af", "reading_order": 3 }, { "id": "p88.5", "order": 5, "type": "text", "bbox": { "l": 52.32, "t": 568.8, "r": 560.16, "b": 546 }, "text": "Subcatchment5S: IMPERVIOUS Runoff Area=0.270 ac 100.00% Impervious Runoff Depth>5.82\" Flow Length=180' Slope=0.0100'/' Tc=1.6 min CN=98 Runoff=1.84 cfs 0.131 af", "reading_order": 4 }, { "id": "p88.6", "order": 6, "type": "text", "bbox": { "l": 47.52, "t": 534.96, "r": 562.32, "b": 520.56 }, "text": "Runoff Area=0.190 ac 0.00% Impervious Runoff Depth>0.53\"", "reading_order": 5 }, { "id": "p88.7", "order": 7, "type": "text", "bbox": { "l": 51.6, "t": 532.56, "r": 196.32, "b": 520.8 }, "text": "Subcatchment6S: POROUS", "reading_order": 6 }, { "id": "p88.8", "order": 8, "type": "text", "bbox": { "l": 256.8, "t": 521.04, "r": 560.4, "b": 509.28 }, "text": "Flow Length=250' Tc=12.4 min CN=39 Runoff=0.04 cfs 0.008 af", "reading_order": 7 }, { "id": "p88.9", "order": 9, "type": "text", "bbox": { "l": 52.56, "t": 497.76, "r": 560.16, "b": 473.52 }, "text": "Subcatchment8S: PROP WAREHOUSE Runoff Area=0.460 ac 100.00% Impervious Runoff Depth>5.82\" Flow Length=280' Slope=0.0100'/' Tc=2.6 min CN=98 Runoff=2.92 cfs 0.223 af", "reading_order": 8 }, { "id": "p88.10", "order": 10, "type": "text", "bbox": { "l": 52.32, "t": 462.24, "r": 559.92, "b": 440.4 }, "text": "Subcatchment10S: BY-PASS POROUS Runoff Area=0.060 ac 0.00% Impervious Runoff Depth>0.54\" Tc=2.0 min CN=39 Runoff=0.02 cfs 0.003 af", "reading_order": 9 }, { "id": "p88.11", "order": 11, "type": "text", "bbox": { "l": 52.32, "t": 426.24, "r": 559.92, "b": 403.2 }, "text": "Subcatchment11S: BY-PASS Runoff Area=0.070 ac 100.00% Impervious Runoff Depth>5.82\" Tc=2.0 min CN=98 Runoff=0.46 cfs 0.034 af", "reading_order": 10 }, { "id": "p88.12", "order": 12, "type": "text", "bbox": { "l": 51.6, "t": 390, "r": 172.8, "b": 378.48 }, "text": "Reach 10: COMPOSITE", "reading_order": 11 }, { "id": "p88.13", "order": 13, "type": "text", "bbox": { "l": 446.64, "t": 390.96, "r": 559.92, "b": 379.2 }, "text": "Inflow=1.47 cfs 0.252 af", "reading_order": 12 }, { "id": "p88.14", "order": 14, "type": "text", "bbox": { "l": 440.64, "t": 378, "r": 560.16, "b": 366.72 }, "text": "Outflow=1.47 cfs 0.252 af", "reading_order": 13 }, { "id": "p88.15", "order": 15, "type": "text", "bbox": { "l": 52.56, "t": 355.2, "r": 559.68, "b": 330.48 }, "text": "Pond 3P: SSIB #1 SURFACE BASIN Peak Elev= $ 112.33' $ Storage= $ 6,132 $ cf Inflow= $ 2.75 $ cfs 0.374 af Discarded= $ 0.11 $ cfs 0.093 af Primary= $ 1.30 $ cfs 0.199 af Outflow= $ 1.41 $ cfs 0.291 af", "reading_order": 14 }, { "id": "p88.16", "order": 16, "type": "text", "bbox": { "l": 51.36, "t": 319.68, "r": 559.44, "b": 307.44 }, "text": "Pond 8P: SSIB #2 UNDERGROUND Peak Elev=109.14' Storage=0.059 af Inflow=1.84 cfs 0.139 af", "reading_order": 15 }, { "id": "p88.17", "order": 17, "type": "text", "bbox": { "l": 182.4, "t": 306.72, "r": 559.68, "b": 295.44 }, "text": "Discarded=0.11 cfs 0.096 af Primary=0.12 cfs 0.012 af Outflow=0.22 cfs 0.108 af", "reading_order": 16 }, { "id": "p88.18", "order": 18, "type": "text", "bbox": { "l": 53.04, "t": 283.92, "r": 559.44, "b": 259.92 }, "text": "Pond 9P: SSIB #3 UNDERGROUND Peak Elev=113.06' Storage=0.114 af Inflow=2.92 cfs 0.223 af Discarded=0.15 cfs 0.141 af Primary=0.05 cfs 0.004 af Outflow=0.21 cfs 0.146 af", "reading_order": 17 }, { "id": "p88.19", "order": 19, "type": "text", "bbox": { "l": 122.64, "t": 247.68, "r": 568.8, "b": 223.68 }, "text": "Total Runoff Area = 2.340 ac Runoff Volume = 0.773 af Average Runoff Depth = 3.97\"\n35.04% Pervious = 0.820 ac 64.96% Impervious = 1.520 ac", "reading_order": 18 } ] }, { "document_id": 11809, "page": 89, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 44, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "table": 1, "table_cell": 36, "text": 3, "title": 1 }, "build_ms": 4, "items": [ { "id": "p89.1", "order": 1, "type": "header", "bbox": { "l": 52.56, "t": 738.72, "r": 561.36, "b": 698.64 }, "text": "POST DEV NOAA 24-hr D 25 year Rainfall=6.68\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 53", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p89.2", "order": 2, "type": "title", "bbox": { "l": 183.6, "t": 687.36, "r": 434.64, "b": 672.72 }, "text": "Summary for Subcatchment 1S: POROUS", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p89.3", "order": 3, "type": "text", "bbox": { "l": 53.52, "t": 659.76, "r": 306.24, "b": 634.56 }, "text": "Runoff = 0.11 cfs @ 12.55 hrs, Volume=\nRouted to Pond 3P : SSIB #1 SURFACE BASIN\n0.025 af, Depth> 0.53\"", "reading_order": 2 }, { "id": "p89.4", "order": 4, "type": "text", "bbox": { "l": 345.12, "t": 659.76, "r": 463.68, "b": 647.04 }, "text": "0.025 af, Depth> 0.53\"", "reading_order": 3 }, { "id": "p89.5", "order": 5, "type": "text", "bbox": { "l": 52.08, "t": 624.48, "r": 541.44, "b": 598.56 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Weighted-CN, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs NOAA 24-hr D 25 year Rainfall=6.68\"", "reading_order": 4 }, { "id": "p89.6", "order": 6, "type": "table", "bbox": { "l": 52.32, "t": 590.16, "r": 559.44, "b": 436.8 }, "text": "", "attrs": { "block_label": "table", "n_rows": 7, "n_cols": 6, "integrity": { "cells_checked": 29, "cells_flagged": 0 } }, "children": [ { "id": "p89.6.1", "order": 7, "type": "table_cell", "bbox": { "l": 69.659595, "t": 588.002283, "r": 113.82741, "b": 576.0151040000001 }, "text": "Area (ac)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p89.6.2", "order": 8, "type": "table_cell", "bbox": { "l": 130.796358, "t": 588.002283, "r": 146.30665, "b": 576.0151040000001 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p89.6.3", "order": 9, "type": "table_cell", "bbox": { "l": 289.05701, "t": 536.641352, "r": 342.773751, "b": 524.654172 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p89.6.4", "order": 10, "type": "table_cell", "bbox": { "l": 87, "t": 574.200786, "r": 113.874482, "b": 548.4137069999999 }, "text": "0.570\n0.570", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p89.6.5", "order": 11, "type": "table_cell", "bbox": { "l": 134.275244, "t": 574.200786, "r": 273.392044, "b": 548.4137069999999 }, "text": "39\n100.00% Pervious Area", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p89.6.6", "order": 12, "type": "table_cell", "bbox": { "l": 160.552515, "t": 574.200786, "r": 320.843443, "b": 562.213607 }, "text": ">75% Grass cover, Good, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true }, "reading_order": 5 }, { "id": "p89.6.7", "order": 13, "type": "table_cell", "bbox": { "l": 65.459598, "t": 536.641352, "r": 89.993572, "b": 512.774405 }, "text": "Tc (min)", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p89.6.8", "order": 14, "type": "table_cell", "bbox": { "l": 100.682141, "t": 536.641352, "r": 133.545916, "b": 512.774405 }, "text": "Length (feet)", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p89.6.9", "order": 15, "type": "table_cell", "bbox": { "l": 149.815612, "t": 536.641352, "r": 177.28086, "b": 512.774405 }, "text": "Slope (ft/ft)", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p89.6.10", "order": 16, "type": "table_cell", "bbox": { "l": 188.028505, "t": 536.641352, "r": 225.633446, "b": 512.774405 }, "text": "Velocity (ft/sec)", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p89.6.11", "order": 17, "type": "table_cell", "bbox": { "l": 236.50354, "t": 536.641352, "r": 278.288957, "b": 512.774405 }, "text": "Capacity (cfs)", "attrs": { "row": 2, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p89.6.12", "order": 18, "type": "table_cell", "bbox": { "l": 160.552704, "t": 588.002283, "r": 214.269445, "b": 576.0151040000001 }, "text": "Description", "attrs": { "row": 2, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 }, { "id": "p89.6.13", "order": 19, "type": "table_cell", "bbox": { "l": 69, "t": 510.960886, "r": 89.902375, "b": 498.973707 }, "text": "11.7", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 12 }, { "id": "p89.6.14", "order": 20, "type": "table_cell", "bbox": { "l": 115.676959, "t": 510.960886, "r": 133.59328, "b": 498.973707 }, "text": "100", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p89.6.15", "order": 21, "type": "table_cell", "bbox": { "l": 144.351666, "t": 510.960886, "r": 177.198256, "b": 498.973707 }, "text": "0.0300", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p89.6.16", "order": 22, "type": "table_cell", "bbox": { "l": 204.705395, "t": 510.960886, "r": 225.60777, "b": 498.973707 }, "text": "0.14", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p89.6.17", "order": 23, "type": "table_cell", "bbox": { "l": 390.4, "t": 513.48, "r": 474.92, "b": 494.31 }, "text": "", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 16 }, { "id": "p89.6.18", "order": 24, "type": "table_cell", "bbox": { "l": 289.079669, "t": 510.780434, "r": 354.740625, "b": 487.092865 }, "text": "Sheet Flow, Grass: Dense n=0.240 P2=3.42\"", "attrs": { "row": 3, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p89.6.19", "order": 25, "type": "table_cell", "bbox": { "l": 75.000034, "t": 487.200277, "r": 89.930302, "b": 475.213098 }, "text": "0.3", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p89.6.20", "order": 26, "type": "table_cell", "bbox": { "l": 121.678067, "t": 487.200277, "r": 133.622282, "b": 475.213098 }, "text": "50", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p89.6.21", "order": 27, "type": "table_cell", "bbox": { "l": 144.354889, "t": 487.200277, "r": 177.201478, "b": 475.213098 }, "text": "0.0350", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p89.6.22", "order": 28, "type": "table_cell", "bbox": { "l": 204.708617, "t": 487.200277, "r": 225.610992, "b": 475.213098 }, "text": "2.81", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p89.6.23", "order": 29, "type": "table_cell", "bbox": { "l": 390.4, "t": 494.31, "r": 474.92, "b": 475.14 }, "text": "", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 22 }, { "id": "p89.6.24", "order": 30, "type": "table_cell", "bbox": { "l": 289.079669, "t": 487.019825, "r": 432.324312, "b": 463.332257 }, "text": "Shallow Concentrated Flow, Grassed Waterway Kv=15.0 fps", "attrs": { "row": 4, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 23 }, { "id": "p89.6.25", "order": 31, "type": "table_cell", "bbox": { "l": 75.000034, "t": 463.439669, "r": 89.930302, "b": 451.45249 }, "text": "0.9", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 24 }, { "id": "p89.6.26", "order": 32, "type": "table_cell", "bbox": { "l": 115.679107, "t": 463.439669, "r": 133.595429, "b": 451.45249 }, "text": "160", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 25 }, { "id": "p89.6.27", "order": 33, "type": "table_cell", "bbox": { "l": 221.36, "t": 475.14, "r": 305.88, "b": 455.97 }, "text": "", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 26 }, { "id": "p89.6.28", "order": 34, "type": "table_cell", "bbox": { "l": 204.713988, "t": 463.439669, "r": 225.616363, "b": 451.45249 }, "text": "3.00", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 27 }, { "id": "p89.6.29", "order": 35, "type": "table_cell", "bbox": { "l": 390.4, "t": 475.14, "r": 474.92, "b": 455.97 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 28 }, { "id": "p89.6.30", "order": 36, "type": "table_cell", "bbox": { "l": 289.079669, "t": 463.259217, "r": 415.020239, "b": 451.272038 }, "text": "Direct Entry, PIPE FLOW", "attrs": { "row": 5, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 29 }, { "id": "p89.6.31", "order": 37, "type": "table_cell", "bbox": { "l": 69, "t": 449.640786, "r": 89.902375, "b": 437.653607 }, "text": "12.9", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 30 }, { "id": "p89.6.32", "order": 38, "type": "table_cell", "bbox": { "l": 115.676959, "t": 449.640786, "r": 133.59328, "b": 437.653607 }, "text": "310", "attrs": { "row": 6, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 31 }, { "id": "p89.6.33", "order": 39, "type": "table_cell", "bbox": { "l": 144.351666, "t": 449.640786, "r": 168.229354, "b": 437.653607 }, "text": "Total", "attrs": { "row": 6, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 32 }, { "id": "p89.6.34", "order": 40, "type": "table_cell", "bbox": { "l": 305.88, "t": 455.97, "r": 390.4, "b": 436.8 }, "text": "", "attrs": { "row": 6, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 33 }, { "id": "p89.6.35", "order": 41, "type": "table_cell", "bbox": { "l": 390.4, "t": 455.97, "r": 474.92, "b": 436.8 }, "text": "", "attrs": { "row": 6, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 34 }, { "id": "p89.6.36", "order": 42, "type": "table_cell", "bbox": { "l": 474.92, "t": 455.97, "r": 559.44, "b": 436.8 }, "text": "", "attrs": { "row": 6, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 35 } ], "reading_order": 5 }, { "id": "p89.7", "order": 43, "type": "caption", "bbox": { "l": 222.24, "t": 425.28, "r": 393.36, "b": 410.64 }, "text": "Subcatchment 1S: POROUS", "attrs": { "block_label": "figure_title" }, "reading_order": 6 }, { "id": "p89.8", "order": 44, "type": "figure", "bbox": { "l": 64.08, "t": 409.44, "r": 552.24, "b": 137.28 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n0.12\nRunoff\n0.115\n0.11 cfs\n0.11\n0.105 NOAA 24-hr D\n0.1\n0.095 25 year Rainfall=6.68\"\n0.09\nRunoff Area=0.570 ac\n0.085\n0.08\nRunoff Volume=0.025 af\n0.075\n0.07\n(cfs) Runoff Depth>0.53\"\n0.065\n0.06\nFlow Flow Length=310'\n0.055\n0.05\nTc=12.9 min\n0.045\n0.04\n0.03 CN=39\n0.035\n0.025\n0.02\n0.015\n0.01\n0.005\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 7 } ] }, { "document_id": 11809, "page": 90, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 43, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "table": 1, "table_cell": 36, "text": 2, "title": 1 }, "build_ms": 3, "items": [ { "id": "p90.1", "order": 1, "type": "header", "bbox": { "l": 52.32, "t": 738.72, "r": 561.12, "b": 698.64 }, "text": "POST DEV NOAA 24-hr D 25 year Rainfall=6.68\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 54", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p90.2", "order": 2, "type": "title", "bbox": { "l": 171.84, "t": 687.6, "r": 447.36, "b": 672.72 }, "text": "Summary for Subcatchment 2S: IMPERVIOUS", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p90.3", "order": 3, "type": "text", "bbox": { "l": 52.56, "t": 660.24, "r": 463.92, "b": 634.32 }, "text": "Runoff = 2.68 cfs @ 12.22 hrs, Volume= 0.349 af, Depth> 5.81\"\nRouted to Pond 3P : SSIB #1 SURFACE BASIN", "reading_order": 2 }, { "id": "p90.4", "order": 4, "type": "text", "bbox": { "l": 52.08, "t": 624.48, "r": 541.44, "b": 598.56 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Weighted-CN, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs NOAA 24-hr D 25 year Rainfall=6.68\"", "reading_order": 3 }, { "id": "p90.5", "order": 5, "type": "table", "bbox": { "l": 52.32, "t": 590.16, "r": 559.2, "b": 436.56 }, "text": "", "attrs": { "block_label": "table", "n_rows": 7, "n_cols": 7, "integrity": { "cells_checked": 28, "cells_flagged": 0 } }, "children": [ { "id": "p90.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 69.659595, "t": 588.002283, "r": 113.82741, "b": 576.0151040000001 }, "text": "Area (ac)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p90.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 130.796358, "t": 588.002283, "r": 146.30665, "b": 576.0151040000001 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p90.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 289.05701, "t": 536.641352, "r": 342.773751, "b": 524.654172 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p90.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 87, "t": 574.200786, "r": 113.874482, "b": 548.4137069999999 }, "text": "0.720\n0.720", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p90.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 134.275244, "t": 574.200786, "r": 284.133244, "b": 548.4137069999999 }, "text": "98\n100.00% Impervious Area", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p90.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 160.552515, "t": 574.200786, "r": 268.608987, "b": 562.213607 }, "text": "Paved parking, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true }, "reading_order": 5 }, { "id": "p90.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 65.459598, "t": 536.641352, "r": 89.993572, "b": 512.774405 }, "text": "Tc\\n(min)", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p90.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 100.682141, "t": 536.641352, "r": 133.545916, "b": 512.774405 }, "text": "Length\\n(feet)", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p90.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 149.815612, "t": 536.641352, "r": 177.28086, "b": 512.774405 }, "text": "Slope\\n(ft/ft)", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p90.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 188.028505, "t": 536.641352, "r": 225.633446, "b": 512.774405 }, "text": "Velocity\\n(ft/sec)", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p90.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 236.50354, "t": 536.641352, "r": 278.288957, "b": 512.774405 }, "text": "Capacity\\n(cfs)", "attrs": { "row": 2, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p90.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 160.552704, "t": 588.002283, "r": 214.269445, "b": 576.0151040000001 }, "text": "Description", "attrs": { "row": 2, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 11 }, { "id": "p90.5.13", "order": 18, "type": "table_cell", "bbox": { "l": 69, "t": 510.960886, "r": 89.902375, "b": 498.973707 }, "text": "11.7", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 12 }, { "id": "p90.5.14", "order": 19, "type": "table_cell", "bbox": { "l": 115.676959, "t": 510.960886, "r": 133.59328, "b": 498.973707 }, "text": "100", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p90.5.15", "order": 20, "type": "table_cell", "bbox": { "l": 144.351666, "t": 510.960886, "r": 177.198256, "b": 498.973707 }, "text": "0.0300", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p90.5.16", "order": 21, "type": "table_cell", "bbox": { "l": 204.705395, "t": 510.960886, "r": 225.60777, "b": 498.973707 }, "text": "0.14", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p90.5.17", "order": 22, "type": "table_cell", "bbox": { "l": 341.9657, "t": 513.36, "r": 414.3771, "b": 494.16 }, "text": "", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 16 }, { "id": "p90.5.18", "order": 23, "type": "table_cell", "bbox": { "l": 289.079669, "t": 510.780434, "r": 461.873354, "b": 463.332257 }, "text": "Sheet Flow,\\nGrass: Dense n= 0.240 P2= 3.42\"\\nShallow Concentrated Flow,\\nGrassed Waterway Kv= 15.0 fps", "attrs": { "row": 3, "col": 5, "rowspan": 2, "colspan": 2, "bbox_refit": true }, "reading_order": 17 }, { "id": "p90.5.19", "order": 24, "type": "table_cell", "bbox": { "l": 75.000034, "t": 487.200277, "r": 89.930302, "b": 475.213098 }, "text": "0.5", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p90.5.20", "order": 25, "type": "table_cell", "bbox": { "l": 121.678067, "t": 487.200277, "r": 133.622282, "b": 475.213098 }, "text": "50", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p90.5.21", "order": 26, "type": "table_cell", "bbox": { "l": 144.354889, "t": 487.200277, "r": 177.201478, "b": 475.213098 }, "text": "0.0110", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p90.5.22", "order": 27, "type": "table_cell", "bbox": { "l": 204.708617, "t": 487.200277, "r": 225.610992, "b": 475.213098 }, "text": "1.57", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p90.5.23", "order": 28, "type": "table_cell", "bbox": { "l": 341.9657, "t": 494.16, "r": 414.3771, "b": 474.96 }, "text": "", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 22 }, { "id": "p90.5.24", "order": 29, "type": "table_cell", "bbox": { "l": 75.000034, "t": 463.439669, "r": 89.930302, "b": 451.45249 }, "text": "0.9", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 23 }, { "id": "p90.5.25", "order": 30, "type": "table_cell", "bbox": { "l": 115.679107, "t": 463.439669, "r": 133.595429, "b": 451.45249 }, "text": "160", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 24 }, { "id": "p90.5.26", "order": 31, "type": "table_cell", "bbox": { "l": 197.1429, "t": 474.96, "r": 269.5543, "b": 455.76 }, "text": "", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 25 }, { "id": "p90.5.27", "order": 32, "type": "table_cell", "bbox": { "l": 204.713988, "t": 463.439669, "r": 225.616363, "b": 451.45249 }, "text": "3.00", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 26 }, { "id": "p90.5.28", "order": 33, "type": "table_cell", "bbox": { "l": 341.9657, "t": 474.96, "r": 414.3771, "b": 455.76 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 27 }, { "id": "p90.5.29", "order": 34, "type": "table_cell", "bbox": { "l": 289.079669, "t": 463.259217, "r": 415.020239, "b": 451.272038 }, "text": "Direct Entry, PIPE FLOW", "attrs": { "row": 5, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 28 }, { "id": "p90.5.30", "order": 35, "type": "table_cell", "bbox": { "l": 69, "t": 449.640786, "r": 89.902375, "b": 437.653607 }, "text": "13.1", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 29 }, { "id": "p90.5.31", "order": 36, "type": "table_cell", "bbox": { "l": 115.676959, "t": 449.640786, "r": 133.59328, "b": 437.653607 }, "text": "310", "attrs": { "row": 6, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 30 }, { "id": "p90.5.32", "order": 37, "type": "table_cell", "bbox": { "l": 144.351666, "t": 449.640786, "r": 168.229354, "b": 437.653607 }, "text": "Total", "attrs": { "row": 6, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 31 }, { "id": "p90.5.33", "order": 38, "type": "table_cell", "bbox": { "l": 269.5543, "t": 455.76, "r": 341.9657, "b": 436.56 }, "text": "", "attrs": { "row": 6, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 32 }, { "id": "p90.5.34", "order": 39, "type": "table_cell", "bbox": { "l": 341.9657, "t": 455.76, "r": 414.3771, "b": 436.56 }, "text": "", "attrs": { "row": 6, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 33 }, { "id": "p90.5.35", "order": 40, "type": "table_cell", "bbox": { "l": 414.3771, "t": 455.76, "r": 486.7886, "b": 436.56 }, "text": "", "attrs": { "row": 6, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 34 }, { "id": "p90.5.36", "order": 41, "type": "table_cell", "bbox": { "l": 486.7886, "t": 455.76, "r": 559.2, "b": 436.56 }, "text": "", "attrs": { "row": 6, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 35 } ], "reading_order": 4 }, { "id": "p90.6", "order": 42, "type": "caption", "bbox": { "l": 210.48, "t": 425.52, "r": 405.6, "b": 410.4 }, "text": "Subcatchment 2S: IMPERVIOUS", "attrs": { "block_label": "figure_title" }, "reading_order": 5 }, { "id": "p90.7", "order": 43, "type": "figure", "bbox": { "l": 61.2, "t": 412.32, "r": 553.2, "b": 136.32 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n3\nRunoff\n2.68 cfs\nNOAA 24-hr D\n25 year Rainfall=6.68\"\nRunoff Area=0.720 ac\n2\nRunoff Volume=0.349 af\n(cfs) Runoff Depth>5.81\"\nFlow Flow Length=310'\nTc=13.1 min\n1\nCN=98\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 6 } ] }, { "document_id": 11809, "page": 91, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 38, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "table": 1, "table_cell": 30, "text": 3, "title": 1 }, "build_ms": 3, "items": [ { "id": "p91.1", "order": 1, "type": "header", "bbox": { "l": 52.8, "t": 738.48, "r": 561.12, "b": 698.88 }, "text": "POST DEV NOAA 24-hr D 25 year Rainfall=6.68\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 55", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p91.2", "order": 2, "type": "title", "bbox": { "l": 171.84, "t": 687.36, "r": 446.88, "b": 672.48 }, "text": "Summary for Subcatchment 5S: IMPERVIOUS", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p91.3", "order": 3, "type": "text", "bbox": { "l": 51.84, "t": 659.52, "r": 245.04, "b": 646.32 }, "text": "[49] Hint: Tc<2dt may require smaller dt", "reading_order": 2 }, { "id": "p91.4", "order": 4, "type": "text", "bbox": { "l": 52.08, "t": 636.48, "r": 463.2, "b": 610.56 }, "text": "Runoff = 1.84 cfs @ 12.08 hrs, Volume= 0.131 af, Depth> 5.82\"\nRouted to Pond 8P : SSIB #2 UNDERGROUND", "reading_order": 3 }, { "id": "p91.5", "order": 5, "type": "text", "bbox": { "l": 52.08, "t": 600.72, "r": 541.68, "b": 574.8 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Weighted-CN, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs NOAA 24-hr D 25 year Rainfall=6.68\"", "reading_order": 4 }, { "id": "p91.6", "order": 6, "type": "table", "bbox": { "l": 52.56, "t": 565.44, "r": 559.44, "b": 437.04 }, "text": "", "attrs": { "block_label": "table", "n_rows": 6, "n_cols": 6, "integrity": { "cells_checked": 24, "cells_flagged": 0 } }, "children": [ { "id": "p91.6.1", "order": 7, "type": "table_cell", "bbox": { "l": 69.659595, "t": 564.242748, "r": 113.82741, "b": 552.255569 }, "text": "Area (ac)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p91.6.2", "order": 8, "type": "table_cell", "bbox": { "l": 130.796358, "t": 564.242748, "r": 146.30665, "b": 552.255569 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p91.6.3", "order": 9, "type": "table_cell", "bbox": { "l": 289.05701, "t": 512.881252, "r": 342.773751, "b": 500.894072 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p91.6.4", "order": 10, "type": "table_cell", "bbox": { "l": 87, "t": 550.440786, "r": 113.874482, "b": 524.653607 }, "text": "0.270\n0.270", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p91.6.5", "order": 11, "type": "table_cell", "bbox": { "l": 134.275244, "t": 550.440786, "r": 284.133244, "b": 524.653607 }, "text": "98\n100.00% Impervious Area", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p91.6.6", "order": 12, "type": "table_cell", "bbox": { "l": 160.552515, "t": 550.440786, "r": 228.007251, "b": 538.453607 }, "text": "Roofs, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true }, "reading_order": 5 }, { "id": "p91.6.7", "order": 13, "type": "table_cell", "bbox": { "l": 65.459598, "t": 512.881252, "r": 89.993572, "b": 489.014305 }, "text": "Tc (min)", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p91.6.8", "order": 14, "type": "table_cell", "bbox": { "l": 100.682141, "t": 512.881252, "r": 133.545916, "b": 489.014305 }, "text": "Length (feet)", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p91.6.9", "order": 15, "type": "table_cell", "bbox": { "l": 149.815612, "t": 512.881252, "r": 177.28086, "b": 489.014305 }, "text": "Slope (ft/ft)", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p91.6.10", "order": 16, "type": "table_cell", "bbox": { "l": 188.028505, "t": 512.881252, "r": 225.633446, "b": 489.014305 }, "text": "Velocity (ft/sec)", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p91.6.11", "order": 17, "type": "table_cell", "bbox": { "l": 236.50354, "t": 512.881252, "r": 278.288957, "b": 489.014305 }, "text": "Capacity (cfs)", "attrs": { "row": 2, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p91.6.12", "order": 18, "type": "table_cell", "bbox": { "l": 160.552704, "t": 564.242748, "r": 214.269445, "b": 552.255569 }, "text": "Description", "attrs": { "row": 2, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 }, { "id": "p91.6.13", "order": 19, "type": "table_cell", "bbox": { "l": 75, "t": 487.200786, "r": 89.930268, "b": 475.213607 }, "text": "0.9", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 12 }, { "id": "p91.6.14", "order": 20, "type": "table_cell", "bbox": { "l": 121.678033, "t": 487.200786, "r": 133.622247, "b": 475.213607 }, "text": "50", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p91.6.15", "order": 21, "type": "table_cell", "bbox": { "l": 144.354854, "t": 487.200786, "r": 177.201444, "b": 475.213607 }, "text": "0.0100", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p91.6.16", "order": 22, "type": "table_cell", "bbox": { "l": 204.708583, "t": 487.200786, "r": 225.610958, "b": 475.213607 }, "text": "0.94", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p91.6.17", "order": 23, "type": "table_cell", "bbox": { "l": 390.48, "t": 492.0686, "r": 474.96, "b": 473.7257 }, "text": "", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 16 }, { "id": "p91.6.18", "order": 24, "type": "table_cell", "bbox": { "l": 289.079635, "t": 487.020334, "r": 476.803587, "b": 463.332765 }, "text": "Sheet Flow, Smooth surfaces n= 0.011 P2= 3.42\"", "attrs": { "row": 3, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p91.6.19", "order": 25, "type": "table_cell", "bbox": { "l": 75, "t": 463.440177, "r": 89.930268, "b": 451.452998 }, "text": "0.7", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p91.6.20", "order": 26, "type": "table_cell", "bbox": { "l": 115.679073, "t": 463.440177, "r": 133.595394, "b": 451.452998 }, "text": "130", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p91.6.21", "order": 27, "type": "table_cell", "bbox": { "l": 221.52, "t": 473.7257, "r": 306, "b": 455.3829 }, "text": "", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 20 }, { "id": "p91.6.22", "order": 28, "type": "table_cell", "bbox": { "l": 204.713954, "t": 463.440177, "r": 225.616329, "b": 451.452998 }, "text": "3.00", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p91.6.23", "order": 29, "type": "table_cell", "bbox": { "l": 390.48, "t": 473.7257, "r": 474.96, "b": 455.3829 }, "text": "", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 22 }, { "id": "p91.6.24", "order": 30, "type": "table_cell", "bbox": { "l": 289.079635, "t": 463.259725, "r": 415.020205, "b": 451.272546 }, "text": "Direct Entry, PIPE FLOW", "attrs": { "row": 4, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 23 }, { "id": "p91.6.25", "order": 31, "type": "table_cell", "bbox": { "l": 75, "t": 449.640786, "r": 89.930268, "b": 437.653607 }, "text": "1.6", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 24 }, { "id": "p91.6.26", "order": 32, "type": "table_cell", "bbox": { "l": 115.679073, "t": 449.640786, "r": 133.595394, "b": 437.653607 }, "text": "180", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 25 }, { "id": "p91.6.27", "order": 33, "type": "table_cell", "bbox": { "l": 144.35378, "t": 449.640786, "r": 168.231468, "b": 437.653607 }, "text": "Total", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 26 }, { "id": "p91.6.28", "order": 34, "type": "table_cell", "bbox": { "l": 306, "t": 455.3829, "r": 390.48, "b": 437.04 }, "text": "", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 27 }, { "id": "p91.6.29", "order": 35, "type": "table_cell", "bbox": { "l": 390.48, "t": 455.3829, "r": 474.96, "b": 437.04 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 28 }, { "id": "p91.6.30", "order": 36, "type": "table_cell", "bbox": { "l": 474.96, "t": 455.3829, "r": 559.44, "b": 437.04 }, "text": "", "attrs": { "row": 5, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 29 } ], "reading_order": 5 }, { "id": "p91.7", "order": 37, "type": "caption", "bbox": { "l": 210.24, "t": 425.52, "r": 405.84, "b": 410.4 }, "text": "Subcatchment 5S: IMPERVIOUS", "attrs": { "block_label": "figure_title" }, "reading_order": 6 }, { "id": "p91.8", "order": 38, "type": "figure", "bbox": { "l": 61.2, "t": 414, "r": 553.68, "b": 136.8 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n2 Runoff\n1.84 cfs\nNOAA 24-hr D\n25 year Rainfall=6.68\"\nRunoff Area=0.270 ac\nRunoff Volume=0.131 af\n(cfs) Runoff Depth>5.82\"\n1\nFlow Flow Length=180'\nSlope=0.0100 '/'\nTc=1.6 min\nCN=98\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 7 } ] }, { "document_id": 11809, "page": 92, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 42, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "heading": 1, "table": 1, "table_cell": 35, "text": 2 }, "build_ms": 3, "items": [ { "id": "p92.1", "order": 1, "type": "header", "bbox": { "l": 52.56, "t": 738.72, "r": 561.84, "b": 698.4 }, "text": "POST DEV NOAA 24-hr D 25 year Rainfall=6.68\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 56", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p92.2", "order": 2, "type": "heading", "bbox": { "l": 183.6, "t": 687.36, "r": 434.64, "b": 672.72 }, "text": "Summary for Subcatchment 6S: POROUS", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p92.3", "order": 3, "type": "text", "bbox": { "l": 52.56, "t": 660, "r": 464.4, "b": 634.32 }, "text": "Runoff = 0.04 cfs @ 12.46 hrs, Volume= 0.008 af, Depth> 0.53\"\nRouted to Pond 8P : SSIB #2 UNDERGROUND", "reading_order": 2 }, { "id": "p92.4", "order": 4, "type": "text", "bbox": { "l": 52.08, "t": 624.24, "r": 541.44, "b": 598.56 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Weighted-CN, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs NOAA 24-hr D 25 year Rainfall=6.68\"", "reading_order": 3 }, { "id": "p92.5", "order": 5, "type": "table", "bbox": { "l": 52.32, "t": 589.92, "r": 559.2, "b": 449.533607 }, "text": "", "attrs": { "block_label": "table", "n_rows": 7, "n_cols": 7, "integrity": { "cells_checked": 26, "cells_flagged": 0 } }, "children": [ { "id": "p92.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 69.659595, "t": 588.002283, "r": 113.82741, "b": 576.0151040000001 }, "text": "Area (ac)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p92.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 130.796358, "t": 588.002283, "r": 146.30665, "b": 576.0151040000001 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p92.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 289.05701, "t": 536.641352, "r": 342.773751, "b": 524.654172 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p92.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 52.32, "t": 570.1714, "r": 124.7314, "b": 550.4229 }, "text": "", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 3 }, { "id": "p92.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 87, "t": 560.400886, "r": 113.874482, "b": 548.4137069999999 }, "text": "0.190", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p92.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 134.275244, "t": 574.200786, "r": 146.219458, "b": 562.213607 }, "text": "39", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p92.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 160.552515, "t": 574.200786, "r": 320.843443, "b": 562.213607 }, "text": ">75% Grass cover, Good, HSG A", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 4, "bbox_refit": true }, "reading_order": 6 }, { "id": "p92.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 52.32, "t": 550.4229, "r": 124.7314, "b": 530.6743 }, "text": "", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 7 }, { "id": "p92.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 87, "t": 574.200786, "r": 113.874482, "b": 562.213607 }, "text": "0.190", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p92.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 197.1429, "t": 550.4229, "r": 269.5543, "b": 530.6743 }, "text": "", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 9 }, { "id": "p92.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 160.555738, "t": 560.400886, "r": 273.392044, "b": 548.4137069999999 }, "text": "100.00% Pervious Area", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 4, "bbox_refit": true }, "reading_order": 10 }, { "id": "p92.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 65.459598, "t": 536.641352, "r": 89.993572, "b": 512.774405 }, "text": "Tc (min)", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 }, { "id": "p92.5.13", "order": 18, "type": "table_cell", "bbox": { "l": 100.682141, "t": 536.641352, "r": 133.545916, "b": 512.774405 }, "text": "Length (feet)", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 12 }, { "id": "p92.5.14", "order": 19, "type": "table_cell", "bbox": { "l": 149.815612, "t": 536.641352, "r": 177.28086, "b": 512.774405 }, "text": "Slope (ft/ft)", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p92.5.15", "order": 20, "type": "table_cell", "bbox": { "l": 188.028505, "t": 536.641352, "r": 225.633446, "b": 512.774405 }, "text": "Velocity (ft/sec)", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p92.5.16", "order": 21, "type": "table_cell", "bbox": { "l": 236.50354, "t": 536.641352, "r": 278.288957, "b": 512.774405 }, "text": "Capacity (cfs)", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p92.5.17", "order": 22, "type": "table_cell", "bbox": { "l": 160.552704, "t": 588.002283, "r": 214.269445, "b": 576.0151040000001 }, "text": "Description", "attrs": { "row": 3, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 16 }, { "id": "p92.5.18", "order": 23, "type": "table_cell", "bbox": { "l": 69, "t": 510.960886, "r": 89.902375, "b": 498.973707 }, "text": "11.3", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p92.5.19", "order": 24, "type": "table_cell", "bbox": { "l": 121.676993, "t": 510.960886, "r": 133.621207, "b": 498.973707 }, "text": "90", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p92.5.20", "order": 25, "type": "table_cell", "bbox": { "l": 144.353814, "t": 510.960886, "r": 177.200404, "b": 498.973707 }, "text": "0.0270", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p92.5.21", "order": 26, "type": "table_cell", "bbox": { "l": 204.707543, "t": 510.960886, "r": 225.609918, "b": 498.973707 }, "text": "0.13", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p92.5.22", "order": 27, "type": "table_cell", "bbox": { "l": 341.9657, "t": 510.9257, "r": 414.3771, "b": 491.1771 }, "text": "", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 21 }, { "id": "p92.5.23", "order": 28, "type": "table_cell", "bbox": { "l": 289.079669, "t": 510.780434, "r": 461.873354, "b": 463.332257 }, "text": "Sheet Flow,\\nGrass: Dense n= 0.240 P2= 3.42\"\\nShallow Concentrated Flow,\\nPaved Kv= 20.3 fps", "attrs": { "row": 4, "col": 5, "rowspan": 2, "colspan": 2, "bbox_refit": true }, "reading_order": 22 }, { "id": "p92.5.24", "order": 29, "type": "table_cell", "bbox": { "l": 75.000034, "t": 487.200277, "r": 89.930302, "b": 475.213098 }, "text": "1.1", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 23 }, { "id": "p92.5.25", "order": 30, "type": "table_cell", "bbox": { "l": 115.679107, "t": 487.200277, "r": 133.595429, "b": 475.213098 }, "text": "160", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 24 }, { "id": "p92.5.26", "order": 31, "type": "table_cell", "bbox": { "l": 144.353814, "t": 487.200277, "r": 177.200404, "b": 475.213098 }, "text": "0.0150", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 25 }, { "id": "p92.5.27", "order": 32, "type": "table_cell", "bbox": { "l": 204.707543, "t": 487.200277, "r": 225.609918, "b": 475.213098 }, "text": "2.49", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 26 }, { "id": "p92.5.28", "order": 33, "type": "table_cell", "bbox": { "l": 341.9657, "t": 491.1771, "r": 414.3771, "b": 471.4286 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 27 }, { "id": "p92.5.29", "order": 34, "type": "table_cell", "bbox": { "l": 69, "t": 461.520786, "r": 89.902375, "b": 449.533607 }, "text": "12.4", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 28 }, { "id": "p92.5.30", "order": 35, "type": "table_cell", "bbox": { "l": 115.676959, "t": 461.520786, "r": 133.59328, "b": 449.533607 }, "text": "250", "attrs": { "row": 6, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 29 }, { "id": "p92.5.31", "order": 36, "type": "table_cell", "bbox": { "l": 144.351666, "t": 461.520786, "r": 168.229354, "b": 449.533607 }, "text": "Total", "attrs": { "row": 6, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 30 }, { "id": "p92.5.32", "order": 37, "type": "table_cell", "bbox": { "l": 269.5543, "t": 471.4286, "r": 341.9657, "b": 451.68 }, "text": "", "attrs": { "row": 6, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 31 }, { "id": "p92.5.33", "order": 38, "type": "table_cell", "bbox": { "l": 341.9657, "t": 471.4286, "r": 414.3771, "b": 451.68 }, "text": "", "attrs": { "row": 6, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 32 }, { "id": "p92.5.34", "order": 39, "type": "table_cell", "bbox": { "l": 414.3771, "t": 471.4286, "r": 486.7886, "b": 451.68 }, "text": "", "attrs": { "row": 6, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 33 }, { "id": "p92.5.35", "order": 40, "type": "table_cell", "bbox": { "l": 486.7886, "t": 471.4286, "r": 559.2, "b": 451.68 }, "text": "", "attrs": { "row": 6, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 34 } ], "reading_order": 4 }, { "id": "p92.6", "order": 41, "type": "caption", "bbox": { "l": 222.48, "t": 437.04, "r": 393.12, "b": 422.4 }, "text": "Subcatchment 6S: POROUS", "attrs": { "block_label": "figure_title" }, "reading_order": 5 }, { "id": "p92.7", "order": 42, "type": "figure", "bbox": { "l": 63.84, "t": 422.64, "r": 552.96, "b": 149.28 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n0.04 Runoff\n0.038 0.04 cfs\nNOAA 24-hr D\n0.036\n0.034\n0.032 25 year Rainfall=6.68\"\n0.03\n0.028 Runoff Area=0.190 ac\n0.024 Runoff Volume=0.008 af\n0.026\n(cfs) Runoff Depth>0.53\"\n0.022\n0.02\nFlow 0.018 Flow Length=250'\n0.016\n0.014 Tc=12.4 min\nCN=39\n0.012\n0.01\n0.008\n0.006\n0.004\n0.002\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 6 } ] }, { "document_id": 11809, "page": 93, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 44, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "table": 1, "table_cell": 36, "text": 3, "title": 1 }, "build_ms": 4, "items": [ { "id": "p93.1", "order": 1, "type": "header", "bbox": { "l": 52.56, "t": 738.72, "r": 561.12, "b": 698.64 }, "text": "POST DEV NOAA 24-hr D 25 year Rainfall=6.68\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 57", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p93.2", "order": 2, "type": "title", "bbox": { "l": 131.76, "t": 687.6, "r": 488.88, "b": 672.48 }, "text": "Summary for Subcatchment 8S: PROP WAREHOUSE BLDG", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p93.3", "order": 3, "type": "text", "bbox": { "l": 51.6, "t": 659.52, "r": 245.04, "b": 646.32 }, "text": "[49] Hint: Tc<2dt may require smaller dt", "reading_order": 2 }, { "id": "p93.4", "order": 4, "type": "text", "bbox": { "l": 51.84, "t": 636.48, "r": 463.44, "b": 610.56 }, "text": "Runoff = 2.92 cfs @ 12.10 hrs, Volume= 0.223 af, Depth> 5.82\"\nRouted to Pond 9P : SSIB #3 UNDERGROUND", "reading_order": 3 }, { "id": "p93.5", "order": 5, "type": "text", "bbox": { "l": 51.84, "t": 600.72, "r": 541.68, "b": 574.8 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Weighted-CN, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs NOAA 24-hr D 25 year Rainfall=6.68\"", "reading_order": 4 }, { "id": "p93.6", "order": 6, "type": "table", "bbox": { "l": 52.32, "t": 566.64, "r": 558.96, "b": 413.28 }, "text": "", "attrs": { "block_label": "table", "n_rows": 7, "n_cols": 6, "integrity": { "cells_checked": 29, "cells_flagged": 0 } }, "children": [ { "id": "p93.6.1", "order": 7, "type": "table_cell", "bbox": { "l": 69.659595, "t": 564.242748, "r": 113.82741, "b": 552.255569 }, "text": "Area (ac)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p93.6.2", "order": 8, "type": "table_cell", "bbox": { "l": 130.796358, "t": 564.242748, "r": 146.30665, "b": 552.255569 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p93.6.3", "order": 9, "type": "table_cell", "bbox": { "l": 289.05701, "t": 512.881252, "r": 342.773751, "b": 500.894072 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p93.6.4", "order": 10, "type": "table_cell", "bbox": { "l": 87, "t": 550.440786, "r": 113.874482, "b": 524.653607 }, "text": "0.460\n0.460", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p93.6.5", "order": 11, "type": "table_cell", "bbox": { "l": 134.275244, "t": 550.440786, "r": 146.219458, "b": 538.453607 }, "text": "98", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p93.6.6", "order": 12, "type": "table_cell", "bbox": { "l": 160.552515, "t": 550.440786, "r": 284.133244, "b": 524.653607 }, "text": "Roofs, HSG A\n100.00% Impervious Area", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p93.6.7", "order": 13, "type": "table_cell", "bbox": { "l": 65.459598, "t": 512.881252, "r": 89.993572, "b": 489.014305 }, "text": "Tc (min)", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p93.6.8", "order": 14, "type": "table_cell", "bbox": { "l": 100.682141, "t": 512.881252, "r": 133.545916, "b": 489.014305 }, "text": "Length (feet)", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p93.6.9", "order": 15, "type": "table_cell", "bbox": { "l": 149.815612, "t": 512.881252, "r": 177.28086, "b": 489.014305 }, "text": "Slope (ft/ft)", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p93.6.10", "order": 16, "type": "table_cell", "bbox": { "l": 188.028505, "t": 512.881252, "r": 225.633446, "b": 489.014305 }, "text": "Velocity (ft/sec)", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p93.6.11", "order": 17, "type": "table_cell", "bbox": { "l": 236.50354, "t": 512.881252, "r": 278.288957, "b": 489.014305 }, "text": "Capacity (cfs)", "attrs": { "row": 2, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p93.6.12", "order": 18, "type": "table_cell", "bbox": { "l": 160.552704, "t": 564.242748, "r": 214.269445, "b": 552.255569 }, "text": "Description", "attrs": { "row": 2, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 }, { "id": "p93.6.13", "order": 19, "type": "table_cell", "bbox": { "l": 75, "t": 487.200786, "r": 89.930268, "b": 475.213607 }, "text": "1.5", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 12 }, { "id": "p93.6.14", "order": 20, "type": "table_cell", "bbox": { "l": 115.679073, "t": 487.200786, "r": 133.595394, "b": 475.213607 }, "text": "100", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p93.6.15", "order": 21, "type": "table_cell", "bbox": { "l": 144.35378, "t": 487.200786, "r": 177.20037, "b": 475.213607 }, "text": "0.0100", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p93.6.16", "order": 22, "type": "table_cell", "bbox": { "l": 204.707509, "t": 487.200786, "r": 225.609884, "b": 475.213607 }, "text": "1.08", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p93.6.17", "order": 23, "type": "table_cell", "bbox": { "l": 390.08, "t": 489.96, "r": 474.52, "b": 470.79 }, "text": "", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 16 }, { "id": "p93.6.18", "order": 24, "type": "table_cell", "bbox": { "l": 289.079635, "t": 487.020334, "r": 476.803587, "b": 463.332765 }, "text": "Sheet Flow, Smooth surfaces n= 0.011 P2= 3.42\"", "attrs": { "row": 3, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p93.6.19", "order": 25, "type": "table_cell", "bbox": { "l": 75, "t": 463.440177, "r": 89.930268, "b": 451.452998 }, "text": "0.3", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p93.6.20", "order": 26, "type": "table_cell", "bbox": { "l": 121.678033, "t": 463.440177, "r": 133.622247, "b": 451.452998 }, "text": "40", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p93.6.21", "order": 27, "type": "table_cell", "bbox": { "l": 144.354854, "t": 463.440177, "r": 177.201444, "b": 451.452998 }, "text": "0.0100", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p93.6.22", "order": 28, "type": "table_cell", "bbox": { "l": 204.708583, "t": 463.440177, "r": 225.610958, "b": 451.452998 }, "text": "2.03", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p93.6.23", "order": 29, "type": "table_cell", "bbox": { "l": 390.08, "t": 470.79, "r": 474.52, "b": 451.62 }, "text": "", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 22 }, { "id": "p93.6.24", "order": 30, "type": "table_cell", "bbox": { "l": 289.079635, "t": 463.259725, "r": 432.324278, "b": 439.572157 }, "text": "Shallow Concentrated Flow, Paved Kv= 20.3 fps", "attrs": { "row": 4, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 23 }, { "id": "p93.6.25", "order": 31, "type": "table_cell", "bbox": { "l": 75, "t": 439.679569, "r": 89.930268, "b": 427.69239 }, "text": "0.8", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 24 }, { "id": "p93.6.26", "order": 32, "type": "table_cell", "bbox": { "l": 115.679073, "t": 439.679569, "r": 133.595394, "b": 427.69239 }, "text": "140", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 25 }, { "id": "p93.6.27", "order": 33, "type": "table_cell", "bbox": { "l": 221.2, "t": 451.62, "r": 305.64, "b": 432.45 }, "text": "", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 26 }, { "id": "p93.6.28", "order": 34, "type": "table_cell", "bbox": { "l": 204.713954, "t": 439.679569, "r": 225.616329, "b": 427.69239 }, "text": "3.00", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 27 }, { "id": "p93.6.29", "order": 35, "type": "table_cell", "bbox": { "l": 390.08, "t": 451.62, "r": 474.52, "b": 432.45 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 28 }, { "id": "p93.6.30", "order": 36, "type": "table_cell", "bbox": { "l": 289.079635, "t": 439.499117, "r": 415.020205, "b": 427.511938 }, "text": "Direct Entry, PIPE FLOW", "attrs": { "row": 5, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 29 }, { "id": "p93.6.31", "order": 37, "type": "table_cell", "bbox": { "l": 75, "t": 425.880786, "r": 89.930268, "b": 413.893607 }, "text": "2.6", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 30 }, { "id": "p93.6.32", "order": 38, "type": "table_cell", "bbox": { "l": 115.679073, "t": 425.880786, "r": 133.595394, "b": 413.893607 }, "text": "280", "attrs": { "row": 6, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 31 }, { "id": "p93.6.33", "order": 39, "type": "table_cell", "bbox": { "l": 144.35378, "t": 425.880786, "r": 168.231468, "b": 413.893607 }, "text": "Total", "attrs": { "row": 6, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 32 }, { "id": "p93.6.34", "order": 40, "type": "table_cell", "bbox": { "l": 305.64, "t": 432.45, "r": 390.08, "b": 413.28 }, "text": "", "attrs": { "row": 6, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 33 }, { "id": "p93.6.35", "order": 41, "type": "table_cell", "bbox": { "l": 390.08, "t": 432.45, "r": 474.52, "b": 413.28 }, "text": "", "attrs": { "row": 6, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 34 }, { "id": "p93.6.36", "order": 42, "type": "table_cell", "bbox": { "l": 474.52, "t": 432.45, "r": 558.96, "b": 413.28 }, "text": "", "attrs": { "row": 6, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 35 } ], "reading_order": 5 }, { "id": "p93.7", "order": 43, "type": "caption", "bbox": { "l": 170.4, "t": 401.52, "r": 448.08, "b": 386.88 }, "text": "Subcatchment 8S: PROP WAREHOUSE BLDG", "attrs": { "block_label": "figure_title" }, "reading_order": 6 }, { "id": "p93.8", "order": 44, "type": "figure", "bbox": { "l": 61.92, "t": 384.24, "r": 553.44, "b": 113.76 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nRunoff\n3 2.92 cfs\nNOAA 24-hr D\n25 year Rainfall=6.68\"\nRunoff Area=0.460 ac\n2 Runoff Volume=0.223 af\n(cfs) Runoff Depth>5.82\"\nFlow Flow Length=280'\nSlope=0.0100 '/'\n1\nTc=2.6 min\nCN=98\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 7 } ] }, { "document_id": 11809, "page": 94, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 17, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "table": 1, "table_cell": 9, "text": 3, "title": 1 }, "build_ms": 2, "items": [ { "id": "p94.1", "order": 1, "type": "header", "bbox": { "l": 52.8, "t": 738.48, "r": 560.88, "b": 698.64 }, "text": "POST DEV NOAA 24-hr D 25 year Rainfall=6.68\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 58", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p94.2", "order": 2, "type": "title", "bbox": { "l": 151.44, "t": 687.6, "r": 468.24, "b": 672.48 }, "text": "Summary for Subcatchment 10S: BY-PASS POROUS", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p94.3", "order": 3, "type": "text", "bbox": { "l": 51.6, "t": 659.28, "r": 245.04, "b": 646.32 }, "text": "[49] Hint: Tc<2dt may require smaller dt", "reading_order": 2 }, { "id": "p94.4", "order": 4, "type": "text", "bbox": { "l": 51.84, "t": 636, "r": 463.44, "b": 610.8 }, "text": "Runoff = 0.02 cfs @ 12.12 hrs, Volume= 0.003 af, Depth> 0.54\"\nRouted to Reach 10 : COMPOSITE", "reading_order": 3 }, { "id": "p94.5", "order": 5, "type": "text", "bbox": { "l": 52.08, "t": 600.72, "r": 541.68, "b": 574.8 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Weighted-CN, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs NOAA 24-hr D 25 year Rainfall=6.68\"", "reading_order": 4 }, { "id": "p94.6", "order": 6, "type": "table", "bbox": { "l": 53.04, "t": 565.2, "r": 559.2, "b": 474.96 }, "text": "", "attrs": { "block_label": "table", "n_rows": 3, "n_cols": 3, "integrity": { "cells_checked": 9, "cells_flagged": 0 } }, "children": [ { "id": "p94.6.1", "order": 7, "type": "table_cell", "bbox": { "l": 69.659595, "t": 564.242748, "r": 113.82741, "b": 552.255569 }, "text": "Area (ac)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p94.6.2", "order": 8, "type": "table_cell", "bbox": { "l": 130.796358, "t": 564.242748, "r": 146.30665, "b": 552.255569 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p94.6.3", "order": 9, "type": "table_cell", "bbox": { "l": 289.05701, "t": 512.881252, "r": 342.773751, "b": 500.894072 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p94.6.4", "order": 10, "type": "table_cell", "bbox": { "l": 87, "t": 550.440786, "r": 113.874482, "b": 524.653607 }, "text": "0.060\n0.060", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p94.6.5", "order": 11, "type": "table_cell", "bbox": { "l": 134.275244, "t": 550.440786, "r": 273.392044, "b": 524.653607 }, "text": "39\n100.00% Pervious Area", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p94.6.6", "order": 12, "type": "table_cell", "bbox": { "l": 160.552515, "t": 550.440786, "r": 320.843443, "b": 538.453607 }, "text": ">75% Grass cover, Good, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p94.6.7", "order": 13, "type": "table_cell", "bbox": { "l": 65.459598, "t": 512.881252, "r": 89.993572, "b": 475.213607 }, "text": "Tc (min)\n2.0", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p94.6.8", "order": 14, "type": "table_cell", "bbox": { "l": 100.682141, "t": 512.881252, "r": 352.94681, "b": 475.033155 }, "text": "Length (feet)\nDirect Entry,", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 7 }, { "id": "p94.6.9", "order": 15, "type": "table_cell", "bbox": { "l": 149.815612, "t": 512.881252, "r": 278.288957, "b": 489.014305 }, "text": "Slope (ft/ft) Velocity (ft/sec) Capacity (cfs)", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 } ], "reading_order": 5 }, { "id": "p94.7", "order": 16, "type": "caption", "bbox": { "l": 190.08, "t": 463.2, "r": 426.96, "b": 447.84 }, "text": "Subcatchment 10S: BY-PASS POROUS", "attrs": { "block_label": "figure_title" }, "reading_order": 6 }, { "id": "p94.8", "order": 17, "type": "figure", "bbox": { "l": 62.16, "t": 446.64, "r": 553.44, "b": 176.64 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nRunoff\n0.024\n0.023 0.02 cfs\nNOAA 24-hr D\n0.022\n0.021\n0.019 25 year Rainfall=6.68\"\n0.02\n0.017 Runoff Area=0.060 ac\n0.018\n0.015 Runoff Volume=0.003 af\n0.016\n(cfs) 0.013 Runoff Depth>0.54\"\n0.014\n0.012\nFlow 0.011 Tc=2.0 min\n0.01\n0.009 CN=39\n0.008\n0.007\n0.006\n0.005\n0.004\n0.003\n0.002\n0.001\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 7 } ] }, { "document_id": 11809, "page": 95, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 24, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "table": 1, "table_cell": 16, "text": 3, "title": 1 }, "build_ms": 2, "items": [ { "id": "p95.1", "order": 1, "type": "header", "bbox": { "l": 52.56, "t": 738.72, "r": 561.12, "b": 698.64 }, "text": "POST DEV NOAA 24-hr D 25 year Rainfall=6.68\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 59", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p95.2", "order": 2, "type": "title", "bbox": { "l": 139.68, "t": 687.6, "r": 480.72, "b": 672.48 }, "text": "Summary for Subcatchment 11S: BY-PASS IMPERVIOUS", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p95.3", "order": 3, "type": "text", "bbox": { "l": 51.84, "t": 659.52, "r": 245.04, "b": 646.32 }, "text": "[49] Hint: Tc<2dt may require smaller dt", "reading_order": 2 }, { "id": "p95.4", "order": 4, "type": "text", "bbox": { "l": 51.84, "t": 636.48, "r": 463.44, "b": 610.8 }, "text": "Runoff = 0.46 cfs @ 12.09 hrs, Volume= 0.034 af, Depth> 5.82\"\nRouted to Reach 10 : COMPOSITE", "reading_order": 3 }, { "id": "p95.5", "order": 5, "type": "text", "bbox": { "l": 52.08, "t": 600.72, "r": 541.68, "b": 574.8 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Weighted-CN, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs NOAA 24-hr D 25 year Rainfall=6.68\"", "reading_order": 4 }, { "id": "p95.6", "order": 6, "type": "table", "bbox": { "l": 52.8, "t": 564.96, "r": 559.2, "b": 474.72 }, "text": "", "attrs": { "block_label": "table", "n_rows": 4, "n_cols": 4, "integrity": { "cells_checked": 13, "cells_flagged": 1, "flags": [ { "row": 2, "col": 2, "coverage": 0, "text": "Impervious Area" } ] } }, "children": [ { "id": "p95.6.1", "order": 7, "type": "table_cell", "bbox": { "l": 69.659595, "t": 564.242748, "r": 113.82741, "b": 552.255569 }, "text": "Area (ac)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p95.6.2", "order": 8, "type": "table_cell", "bbox": { "l": 130.796358, "t": 564.242748, "r": 146.30665, "b": 552.255569 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p95.6.3", "order": 9, "type": "table_cell", "bbox": { "l": 289.05701, "t": 512.881252, "r": 342.773751, "b": 500.894072 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p95.6.4", "order": 10, "type": "table_cell", "bbox": { "l": 432.6, "t": 564.96, "r": 559.2, "b": 546.912 }, "text": "", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 3 }, { "id": "p95.6.5", "order": 11, "type": "table_cell", "bbox": { "l": 87, "t": 550.440786, "r": 113.874482, "b": 538.453607 }, "text": "0.070", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p95.6.6", "order": 12, "type": "table_cell", "bbox": { "l": 134.275244, "t": 550.440786, "r": 146.219458, "b": 538.453607 }, "text": "98", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p95.6.7", "order": 13, "type": "table_cell", "bbox": { "l": 160.552515, "t": 550.440786, "r": 268.608987, "b": 538.453607 }, "text": "Paved parking, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p95.6.8", "order": 14, "type": "table_cell", "bbox": { "l": 432.6, "t": 546.912, "r": 559.2, "b": 528.864 }, "text": "", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 7 }, { "id": "p95.6.9", "order": 15, "type": "table_cell", "bbox": { "l": 87, "t": 536.6407859999999, "r": 113.874482, "b": 524.653607 }, "text": "0.070", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p95.6.10", "order": 16, "type": "table_cell", "bbox": { "l": 160.555738, "t": 536.6407859999999, "r": 202.951254, "b": 524.653607 }, "text": "100.00%", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p95.6.11", "order": 17, "type": "table_cell", "bbox": { "l": 306, "t": 528.864, "r": 432.6, "b": 510.816 }, "text": "Impervious Area", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 10 }, { "id": "p95.6.12", "order": 18, "type": "table_cell", "bbox": { "l": 432.6, "t": 528.864, "r": 559.2, "b": 510.816 }, "text": "", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 11 }, { "id": "p95.6.13", "order": 19, "type": "table_cell", "bbox": { "l": 65.459598, "t": 512.881252, "r": 352.94681, "b": 475.033155 }, "text": "Tc (min)\nDirect Entry,", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 12 }, { "id": "p95.6.14", "order": 20, "type": "table_cell", "bbox": { "l": 100.682141, "t": 512.881252, "r": 133.545916, "b": 489.014305 }, "text": "Length (feet)", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p95.6.15", "order": 21, "type": "table_cell", "bbox": { "l": 149.815612, "t": 512.881252, "r": 177.28086, "b": 489.014305 }, "text": "Slope (ft/ft)", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p95.6.16", "order": 22, "type": "table_cell", "bbox": { "l": 188.028505, "t": 512.881252, "r": 225.633446, "b": 489.014305 }, "text": "Velocity (ft/sec)", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 } ], "reading_order": 5 }, { "id": "p95.7", "order": 23, "type": "caption", "bbox": { "l": 178.08, "t": 463.2, "r": 439.92, "b": 447.84 }, "text": "Subcatchment 11S: BY-PASS IMPERVIOUS", "attrs": { "block_label": "figure_title" }, "reading_order": 6 }, { "id": "p95.8", "order": 24, "type": "figure", "bbox": { "l": 62.88, "t": 443.52, "r": 553.2, "b": 175.68 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n0.52\nRunoff\n0.5\n0.48 0.46 cfs\n0.44 NOAA 24-hr D\n0.46\n0.4 25 year Rainfall=6.68\"\n0.42\n0.38\n0.36 Runoff Area=0.070 ac\n0.34\n0.32 Runoff Volume=0.034 af\n0.3\n(cfs) Runoff Depth>5.82\"\n0.28\n0.26\nFlow 0.22 Tc=2.0 min\n0.24\n0.18 CN=98\n0.2\n0.16\n0.14\n0.12\n0.1\n0.08\n0.06\n0.04\n0.02\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 7 } ] }, { "document_id": 11809, "page": 96, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 8, "counts_by_type": { "caption": 1, "figure": 1, "header": 2, "heading": 1, "text": 3 }, "build_ms": 0, "items": [ { "id": "p96.1", "order": 1, "type": "header", "bbox": { "l": 360, "t": 739.44, "r": 561.84, "b": 701.76 }, "text": "NOAA 24-hr D 25 year Rainfall=6.68\"\nPrinted 12/31/2025\nns LLC Page 60", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p96.2", "order": 2, "type": "header", "bbox": { "l": 50.64, "t": 738.72, "r": 389.52, "b": 699.12 }, "text": "POST DEV NOA\nPrepared by Professional Design Services\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p96.3", "order": 3, "type": "heading", "bbox": { "l": 198, "t": 687.6, "r": 419.76, "b": 672.48 }, "text": "Summary for Reach 10: COMPOSITE", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 2 }, { "id": "p96.4", "order": 4, "type": "text", "bbox": { "l": 52.08, "t": 659.52, "r": 250.8, "b": 646.08 }, "text": "[40] Hint: Not Described (Outflow=Inflow)", "reading_order": 3 }, { "id": "p96.5", "order": 5, "type": "text", "bbox": { "l": 52.32, "t": 636.48, "r": 517.68, "b": 598.08 }, "text": "Inflow Area = 2.340 ac, 64.96% Impervious, Inflow Depth > 1.29\" for 25 year event\nInflow = 1.47 cfs @ 12.68 hrs, Volume= 0.252 af\nOutflow = 1.47 cfs @ 12.68 hrs, Volume= 0.252 af, Atten=0%, Lag=0.0 min", "reading_order": 4 }, { "id": "p96.6", "order": 6, "type": "text", "bbox": { "l": 51.84, "t": 588.72, "r": 420.96, "b": 574.56 }, "text": "Routing by Stor-Ind+Trans method, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs", "reading_order": 5 }, { "id": "p96.7", "order": 7, "type": "caption", "bbox": { "l": 236.88, "t": 563.52, "r": 378.48, "b": 548.64 }, "text": "Reach 10: COMPOSITE", "attrs": { "block_label": "figure_title" }, "reading_order": 6 }, { "id": "p96.8", "order": 8, "type": "figure", "bbox": { "l": 62.16, "t": 543.36, "r": 554.16, "b": 273.36 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nInflow\n1.47 cfs Outflow\n1.47 cfs\nInflow Area=2.340 ac\n1\n(cfs)\nFlow\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 7 } ] }, { "document_id": 11809, "page": 97, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 32, "counts_by_type": { "footnote": 2, "header": 1, "heading": 2, "table": 2, "table_cell": 24, "text": 1 }, "build_ms": 7, "items": [ { "id": "p97.1", "order": 1, "type": "header", "bbox": { "l": 53.04, "t": 739.2, "r": 560.4, "b": 698.16 }, "text": "POST DEV NOAA 24-hr D 25 year Rainfall=6.68\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 61", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p97.2", "order": 2, "type": "heading", "bbox": { "l": 162, "t": 687.84, "r": 457.44, "b": 672.48 }, "text": "Summary for Pond 3P: SSIB #1 SURFACE BASIN", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p97.3", "order": 3, "type": "heading", "bbox": { "l": 52.32, "t": 659.52, "r": 301.44, "b": 645.84 }, "text": "[82] Warning: Early inflow requires earlier time span", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 2 }, { "id": "p97.4", "order": 4, "type": "text", "bbox": { "l": 53.04, "t": 641.04, "r": 550.32, "b": 489.84 }, "text": "Inflow Area = 1.290 ac, 55.81% Impervious, Inflow Depth > 3.48\" for 25 year event\nInflow = 2.75 cfs @ 12.23 hrs, Volume= 0.374 af\nOutflow = 1.41 cfs @ 12.65 hrs, Volume= 0.291 af, Atten=49%, Lag=25.4 min\nDiscarded = 0.11 cfs @ 12.65 hrs, Volume= 0.093 af\nPrimary = 1.30 cfs @ 12.65 hrs, Volume= 0.199 af\nRouted to Reach 10 : COMPOSITE\n\nRouting by Stor-Ind method, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs\nPeak Elev= 112.33' @ 12.65 hrs Surf.Area= 3,460 sf Storage= 6,132 cf\n\nPlug-Flow detention time= 120.4 min calculated for 0.290 af (78% of inflow)\nCenter-of-Mass det. time= 58.6 min ( 813.8 - 755.2 )", "attrs": { "block_label": "algorithm" }, "reading_order": 3 }, { "id": "p97.5", "order": 5, "type": "table", "bbox": { "l": 52.32, "t": 481.2, "r": 558.72, "b": 355.2 }, "text": "", "attrs": { "block_label": "table", "n_rows": 3, "n_cols": 5, "integrity": { "cells_checked": 12, "cells_flagged": 1, "flags": [ { "row": 1, "col": 3, "coverage": 0.33, "text": "Custom Stage Data (Prismatic)Listed below (Recalc)" } ] } }, "children": [ { "id": "p97.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 54, "t": 481.084378, "r": 90.412668, "b": 469.097199 }, "text": "Volume", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p97.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 123.533158, "t": 481.084378, "r": 150.396899, "b": 469.097199 }, "text": "Invert", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p97.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 173.452885, "t": 481.084378, "r": 237.330802, "b": 469.097199 }, "text": "Avail.Storage", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p97.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 249.465135, "t": 481.084378, "r": 343.783612, "b": 469.097199 }, "text": "Storage Description", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 2, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 3 }, { "id": "p97.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 66.12, "t": 467.280786, "r": 78.064214, "b": 455.293607 }, "text": "#1", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p97.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 115.437146, "t": 467.280786, "r": 150.335304, "b": 455.293607 }, "text": "110.00'", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p97.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 193.071317, "t": 467.280786, "r": 237.260614, "b": 455.293607 }, "text": "12,950 cf", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p97.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 356.16, "t": 465.45, "r": 558.72, "b": 449.7 }, "text": "Custom Stage Data (Prismatic)Listed below (Recalc)", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 2 }, "reading_order": 7 }, { "id": "p97.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 57.719307, "t": 443.521252, "r": 101.897863, "b": 358.334538 }, "text": "Elevation\\n(feet)\n110.00\n111.00\n112.00\n113.00\n114.00", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 8 }, { "id": "p97.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 142.191327, "t": 443.521252, "r": 187.562155, "b": 358.334538 }, "text": "Surf.Area\\n(sq-ft)\n2,000\n2,450\n3,200\n4,000\n4,600", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 9 }, { "id": "p97.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 230.21009, "t": 443.521252, "r": 358.898543, "b": 358.334538 }, "text": "Inc.Store\\n(cubic-feet)\n0\n2,225\n2,825\n3,600\n4,300", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 10 }, { "id": "p97.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 219.361478, "t": 443.521252, "r": 358.999511, "b": 358.334538 }, "text": "Cum.Store\\n(cubic-feet)\n0\n2,225\n5,050\n8,650\n12,950", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 11 } ], "reading_order": 4 }, { "id": "p97.6", "order": 18, "type": "table", "bbox": { "l": 51.6, "t": 347.04, "r": 455.28, "b": 258.72 }, "text": "", "attrs": { "block_label": "table", "n_rows": 3, "n_cols": 4, "integrity": { "cells_checked": 12, "cells_flagged": 0 } }, "children": [ { "id": "p97.6.1", "order": 19, "type": "table_cell", "bbox": { "l": 53.999914, "t": 346.562183, "r": 86.825021, "b": 320.773607 }, "text": "Device\n#1", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p97.6.2", "order": 20, "type": "table_cell", "bbox": { "l": 98.873425, "t": 346.562183, "r": 147.222394, "b": 320.773607 }, "text": "Routing\nDiscarded", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p97.6.3", "order": 21, "type": "table_cell", "bbox": { "l": 175.965845, "t": 346.562183, "r": 210.937439, "b": 320.773607 }, "text": "Invert\n110.00'", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p97.6.4", "order": 22, "type": "table_cell", "bbox": { "l": 223.01377, "t": 346.562183, "r": 453.384188, "b": 308.892765 }, "text": "Outlet Devices\n1.000 in/hr Exfiltration over Surface area\\nConductivity to Groundwater Elevation = 106.00'", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p97.6.5", "order": 23, "type": "table_cell", "bbox": { "l": 70.44, "t": 309.000177, "r": 82.384214, "b": 297.012998 }, "text": "#2", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p97.6.6", "order": 24, "type": "table_cell", "bbox": { "l": 98.876253, "t": 309.000177, "r": 135.868946, "b": 297.012998 }, "text": "Primary", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p97.6.7", "order": 25, "type": "table_cell", "bbox": { "l": 175.97229, "t": 309.000177, "r": 210.870449, "b": 297.012998 }, "text": "111.50'", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p97.6.8", "order": 26, "type": "table_cell", "bbox": { "l": 223.01982, "t": 309.000177, "r": 451.453995, "b": 285.133231 }, "text": "12.0\" W x 4.0\" H Vert. Orifice/Grate C= 0.600\\nLimited to weir flow at low heads", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p97.6.9", "order": 27, "type": "table_cell", "bbox": { "l": 70.44, "t": 285.240643, "r": 82.384214, "b": 273.253464 }, "text": "#3", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p97.6.10", "order": 28, "type": "table_cell", "bbox": { "l": 98.876253, "t": 285.240643, "r": 135.868946, "b": 273.253464 }, "text": "Primary", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p97.6.11", "order": 29, "type": "table_cell", "bbox": { "l": 175.97229, "t": 285.240643, "r": 210.870449, "b": 273.253464 }, "text": "113.00'", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p97.6.12", "order": 30, "type": "table_cell", "bbox": { "l": 223.01982, "t": 285.240643, "r": 439.81483, "b": 261.373697 }, "text": "24.0\" x 48.0\" Horiz. Orifice/Grate C= 0.600\\nLimited to weir flow at low heads", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 } ], "reading_order": 5 }, { "id": "p97.7", "order": 31, "type": "footnote", "bbox": { "l": 51.12, "t": 250.56, "r": 439.44, "b": 224.16 }, "text": "Discarded OutFlow Max=0.11 cfs @ 12.65 hrs HW=112.32' (Free Discharge)\n1=Exfiltration (Controls 0.11 cfs)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 6 }, { "id": "p97.8", "order": 32, "type": "footnote", "bbox": { "l": 51.84, "t": 214.8, "r": 427.2, "b": 177.12 }, "text": "Primary OutFlow Max=1.30 cfs @ 12.65 hrs HW=112.32' (Free Discharge)\n2=Orifice/Grate (Orifice Controls 1.30 cfs @ 3.90 fps)\n3=Orifice/Grate (Controls 0.00 cfs)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 7 } ] }, { "document_id": 11809, "page": 98, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 3, "counts_by_type": { "caption": 1, "figure": 1, "header": 1 }, "build_ms": 0, "items": [ { "id": "p98.1", "order": 1, "type": "header", "bbox": { "l": 52.32, "t": 738.48, "r": 562.32, "b": 698.4 }, "text": "POST DEV NOAA 24-hr D 25 year Rainfall=6.68\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 62", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p98.2", "order": 2, "type": "caption", "bbox": { "l": 201.6, "t": 687.84, "r": 415.68, "b": 673.2 }, "text": "Pond 3P: SSIB #1 SURFACE BASIN", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p98.3", "order": 3, "type": "figure", "bbox": { "l": 62.64, "t": 672.72, "r": 552.24, "b": 399.12 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nInflow\n2.75 cfs Outflow\n3 Inflow Area=1.290 ac Primary\nDiscarded\nPeak Elev=112.33'\nStorage=6,132 cf\n2\n1.41 cfs\n(cfs)\n1.30 cfs\nFlow\n1\n0.11 cfs\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 2 } ] }, { "document_id": 11809, "page": 99, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 11, "counts_by_type": { "caption": 1, "header": 1, "table": 1, "table_cell": 8 }, "build_ms": 18, "items": [ { "id": "p99.1", "order": 1, "type": "header", "bbox": { "l": 51.84, "t": 738.48, "r": 560.4, "b": 698.64 }, "text": "POST DEV NOAA 24-hr D 25 year Rainfall=6.68\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 63", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p99.2", "order": 2, "type": "caption", "bbox": { "l": 152.88, "t": 687.6, "r": 467.52, "b": 672.72 }, "text": "Stage-Discharge for Pond 3P: SSIB #1 SURFACE BASIN", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p99.3", "order": 3, "type": "table", "bbox": { "l": 55.2, "t": 662.16, "r": 500.16, "b": 56.88 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 8, "integrity": { "cells_checked": 8, "cells_flagged": 0 } }, "children": [ { "id": "p99.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 57.3, "t": 661.21453, "r": 97.73433, "b": 59.66617199999996 }, "text": "Elevation (feet)\n110.00\n110.05\n110.10\n110.15\n110.20\n110.25\n110.30\n110.35\n110.40\n110.45\n110.50\n110.55\n110.60\n110.65\n110.70\n110.75\n110.80\n110.85\n110.90\n110.95\n111.00\n111.05\n111.10\n111.15\n111.20\n111.25\n111.30\n111.35\n111.40\n111.45\n111.50\n111.55\n111.60\n111.65\n111.70\n111.75\n111.80\n111.85\n111.90\n111.95\n112.00\n112.05\n112.10\n112.15\n112.20\n112.25\n112.30\n112.35\n112.40\n112.45\n112.50\n112.55\n112.60", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p99.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 109.260182, "t": 661.21453, "r": 153.49646, "b": 59.66617199999996 }, "text": "Discharge (cfs)\n0.00\n0.05\n0.05\n0.05\n0.05\n0.05\n0.05\n0.05\n0.06\n0.06\n0.06\n0.06\n0.06\n0.06\n0.06\n0.06\n0.06\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.08\n0.08\n0.08\n0.08\n0.08\n0.08\n0.09\n0.12\n0.19\n0.28\n0.38\n0.50\n0.62\n0.75\n0.86\n0.94\n1.02\n1.09\n1.16\n1.22\n1.28\n1.33\n1.39\n1.44\n1.49\n1.54\n1.58\n1.63\n1.67", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p99.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 165.000251, "t": 661.21453, "r": 209.236529, "b": 59.66617199999996 }, "text": "Discarded (cfs)\n0.00\n0.05\n0.05\n0.05\n0.05\n0.05\n0.05\n0.05\n0.06\n0.06\n0.06\n0.06\n0.06\n0.06\n0.06\n0.06\n0.06\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.08\n0.08\n0.08\n0.08\n0.08\n0.08\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.11\n0.11\n0.11\n0.11\n0.11\n0.11\n0.12\n0.12\n0.12\n0.12\n0.12", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p99.3.4", "order": 7, "type": "table_cell", "bbox": { "l": 231.060808, "t": 661.21453, "r": 264.933898, "b": 59.66617199999996 }, "text": "Primary (cfs)\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.04\n0.10\n0.19\n0.29\n0.40\n0.53\n0.66\n0.76\n0.84\n0.92\n0.99\n1.05\n1.11\n1.17\n1.22\n1.27\n1.32\n1.37\n1.42\n1.46\n1.51\n1.55", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p99.3.5", "order": 8, "type": "table_cell", "bbox": { "l": 287.88, "t": 661.21453, "r": 328.31433, "b": 332.666219 }, "text": "Elevation (feet)\n112.65\n112.70\n112.75\n112.80\n112.85\n112.90\n112.95\n113.00\n113.05\n113.10\n113.15\n113.20\n113.25\n113.30\n113.35\n113.40\n113.45\n113.50\n113.55\n113.60\n113.65\n113.70\n113.75\n113.80\n113.85\n113.90\n113.95\n114.00", "attrs": { "row": 0, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p99.3.6", "order": 9, "type": "table_cell", "bbox": { "l": 339.840182, "t": 661.21453, "r": 384.649982, "b": 332.606268 }, "text": "Discharge (cfs)\n1.72\n1.76\n1.80\n1.84\n1.88\n1.92\n1.95\n1.99\n2.47\n3.30\n4.38\n5.64\n7.07\n8.65\n10.36\n12.19\n14.14\n16.20\n18.37\n20.63\n22.98\n25.43\n27.97\n30.59\n33.29\n36.07\n38.93\n41.14", "attrs": { "row": 0, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p99.3.7", "order": 10, "type": "table_cell", "bbox": { "l": 395.580251, "t": 661.21453, "r": 440.261303, "b": 332.606268 }, "text": "Discarded (cfs)\n0.13\n0.13\n0.13\n0.13\n0.13\n0.14\n0.14\n0.14\n0.14\n0.14\n0.14\n0.15\n0.15\n0.15\n0.15\n0.15\n0.15\n0.16\n0.16\n0.16\n0.16\n0.16\n0.17\n0.17\n0.17\n0.17\n0.17\n0.17", "attrs": { "row": 0, "col": 6, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p99.3.8", "order": 11, "type": "table_cell", "bbox": { "l": 461.640808, "t": 661.21453, "r": 496.12324, "b": 332.606268 }, "text": "Primary (cfs)\n1.59\n1.63\n1.67\n1.71\n1.74\n1.78\n1.82\n1.85\n2.33\n3.16\n4.23\n5.50\n6.92\n8.50\n10.21\n12.04\n13.99\n16.05\n18.21\n20.47\n22.82\n25.27\n27.80\n30.42\n33.12\n35.90\n38.76\n40.97", "attrs": { "row": 0, "col": 7, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 7 } ], "reading_order": 2 } ] }, { "document_id": 11809, "page": 100, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 10, "counts_by_type": { "caption": 1, "header": 1, "table": 2, "table_cell": 6 }, "build_ms": 14, "items": [ { "id": "p100.1", "order": 1, "type": "header", "bbox": { "l": 52.08, "t": 738.72, "r": 561.6, "b": 698.64 }, "text": "POST DEV NOAA 24-hr D 25 year Rainfall=6.68\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 64", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p100.2", "order": 2, "type": "caption", "bbox": { "l": 144.24, "t": 687.6, "r": 475.68, "b": 672.72 }, "text": "Stage-Area-Storage for Pond 3P: SSIB #1 SURFACE BASIN", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p100.3", "order": 3, "type": "table", "bbox": { "l": 56.88, "t": 662.88, "r": 255.84, "b": 56.64 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 3, "integrity": { "cells_checked": 3, "cells_flagged": 0 } }, "children": [ { "id": "p100.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 57.3, "t": 661.21453, "r": 97.73433, "b": 59.66617199999996 }, "text": "Elevation (feet)\n110.00\n110.05\n110.10\n110.15\n110.20\n110.25\n110.30\n110.35\n110.40\n110.45\n110.50\n110.55\n110.60\n110.65\n110.70\n110.75\n110.80\n110.85\n110.90\n110.95\n111.00\n111.05\n111.10\n111.15\n111.20\n111.25\n111.30\n111.35\n111.40\n111.45\n111.50\n111.55\n111.60\n111.65\n111.70\n111.75\n111.80\n111.85\n111.90\n111.95\n112.00\n112.05\n112.10\n112.15\n112.20\n112.25\n112.30\n112.35\n112.40\n112.45\n112.50\n112.55\n112.60", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p100.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 138.719912, "t": 661.21453, "r": 172.604796, "b": 59.66617199999996 }, "text": "Surface (sq-ft)\n2,000\n2,022\n2,045\n2,068\n2,090\n2,113\n2,135\n2,157\n2,180\n2,203\n2,225\n2,247\n2,270\n2,293\n2,315\n2,338\n2,360\n2,382\n2,405\n2,428\n2,450\n2,487\n2,525\n2,563\n2,600\n2,638\n2,675\n2,712\n2,750\n2,788\n2,825\n2,862\n2,900\n2,938\n2,975\n3,013\n3,050\n3,087\n3,125\n3,163\n3,200\n3,240\n3,280\n3,320\n3,360\n3,400\n3,440\n3,480\n3,520\n3,560\n3,600\n3,640\n3,680", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p100.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 198.240851, "t": 661.21453, "r": 247.503763, "b": 59.66617199999996 }, "text": "Storage (cubic-feet)\n0\n101\n202\n305\n409\n514\n620\n728\n836\n946\n1,056\n1,168\n1,281\n1,395\n1,510\n1,627\n1,744\n1,863\n1,982\n2,103\n2,225\n2,348\n2,474\n2,601\n2,730\n2,861\n2,994\n3,128\n3,265\n3,403\n3,544\n3,686\n3,830\n3,976\n4,124\n4,273\n4,425\n4,578\n4,734\n4,891\n5,050\n5,211\n5,374\n5,539\n5,706\n5,875\n6,046\n6,219\n6,394\n6,571\n6,750\n6,931\n7,114", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 } ], "reading_order": 2 }, { "id": "p100.4", "order": 7, "type": "table", "bbox": { "l": 266.16, "t": 663.6, "r": 464.64, "b": 331.44 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 3, "integrity": { "cells_checked": 3, "cells_flagged": 0 } }, "children": [ { "id": "p100.4.1", "order": 8, "type": "table_cell", "bbox": { "l": 270.42, "t": 661.21453, "r": 310.85433, "b": 332.666219 }, "text": "Elevation (feet)\n112.65\n112.70\n112.75\n112.80\n112.85\n112.90\n112.95\n113.00\n113.05\n113.10\n113.15\n113.20\n113.25\n113.30\n113.35\n113.40\n113.45\n113.50\n113.55\n113.60\n113.65\n113.70\n113.75\n113.80\n113.85\n113.90\n113.95\n114.00", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p100.4.2", "order": 9, "type": "table_cell", "bbox": { "l": 351.839912, "t": 661.21453, "r": 386.330207, "b": 332.606268 }, "text": "Surface (sq-ft)\n3,720\n3,760\n3,800\n3,840\n3,880\n3,920\n3,960\n4,000\n4,030\n4,060\n4,090\n4,120\n4,150\n4,180\n4,210\n4,240\n4,270\n4,300\n4,330\n4,360\n4,390\n4,420\n4,450\n4,480\n4,510\n4,540\n4,570\n4,600", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p100.4.3", "order": 10, "type": "table_cell", "bbox": { "l": 411.360851, "t": 661.21453, "r": 461.330403, "b": 332.606268 }, "text": "Storage (cubic-feet)\n7,299\n7,486\n7,675\n7,866\n8,059\n8,254\n8,451\n8,650\n8,851\n9,053\n9,257\n9,462\n9,669\n9,877\n10,087\n10,298\n10,511\n10,725\n10,941\n11,158\n11,377\n11,597\n11,819\n12,042\n12,267\n12,493\n12,721\n12,950", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 } ], "reading_order": 3 } ] }, { "document_id": 11809, "page": 101, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 30, "counts_by_type": { "footnote": 3, "header": 1, "heading": 3, "table": 2, "table_cell": 20, "text": 1 }, "build_ms": 6, "items": [ { "id": "p101.1", "order": 1, "type": "header", "bbox": { "l": 53.04, "t": 738.72, "r": 561.36, "b": 698.64 }, "text": "POST DEV NOAA 24-hr D 25 year Rainfall=6.68\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 65", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p101.2", "order": 2, "type": "heading", "bbox": { "l": 163.68, "t": 687.6, "r": 455.76, "b": 672.72 }, "text": "Summary for Pond 8P: SSIB #2 UNDERGROUND", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p101.3", "order": 3, "type": "heading", "bbox": { "l": 52.32, "t": 659.52, "r": 301.44, "b": 645.84 }, "text": "[82] Warning: Early inflow requires earlier time span", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 2 }, { "id": "p101.4", "order": 4, "type": "text", "bbox": { "l": 51.84, "t": 639.6, "r": 551.28, "b": 491.52 }, "text": "Inflow Area = 0.460 ac, 58.70% Impervious, Inflow Depth > 3.64\" for 25 year event\nInflow = 1.84 cfs @ 12.08 hrs, Volume= 0.139 af\nOutflow = 0.22 cfs @ 12.88 hrs, Volume= 0.108 af, Atten= 88%, Lag= 47.6 min\nDiscarded = 0.11 cfs @ 12.88 hrs, Volume= 0.096 af\nPrimary = 0.12 cfs @ 12.88 hrs, Volume= 0.012 af\nRouted to Reach 10 : COMPOSITE\n\nRouting by Stor-Ind method, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs\nPeak Elev= 109.14' @ 12.88 hrs Surf.Area= 0.064 ac Storage= 0.059 af\n\nPlug-Flow detention time= 151.0 min calculated for 0.108 af (77% of inflow)\nCenter-of-Mass det. time= 86.4 min ( 828.2 - 741.8 )", "attrs": { "block_label": "algorithm" }, "reading_order": 3 }, { "id": "p101.5", "order": 5, "type": "table", "bbox": { "l": 52.32, "t": 482.4, "r": 556.8, "b": 370.213607 }, "text": "", "attrs": { "block_label": "table", "n_rows": 3, "n_cols": 4, "integrity": { "cells_checked": 10, "cells_flagged": 0 } }, "children": [ { "id": "p101.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 54, "t": 481.084378, "r": 549.157135, "b": 443.412765 }, "text": "Volume\n#1A\n0.192 af Overall - 0.072 af Embedded = 0.120 af x 40.0% Voids", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p101.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 115.437146, "t": 481.084378, "r": 150.396899, "b": 455.293607 }, "text": "Invert\n107.50'", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p101.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 167.453925, "t": 481.084378, "r": 231.331841, "b": 455.293607 }, "text": "Avail.Storage\n0.048 af", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p101.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 243.466175, "t": 481.084378, "r": 412.943681, "b": 455.113155 }, "text": "Storage Description\n41.95\"W x 66.33\"L x 3.00\"H Field A", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p101.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 66.12, "t": 443.520177, "r": 85.228595, "b": 431.532998 }, "text": "#2A", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p101.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 115.437146, "t": 443.520177, "r": 150.335304, "b": 431.532998 }, "text": "107.83'", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p101.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 192.471958, "t": 443.520177, "r": 231.290655, "b": 431.532998 }, "text": "0.057 af", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p101.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 243.479769, "t": 443.520177, "r": 509.915235, "b": 384.013929 }, "text": "ADS N-12 24\" x 36 Inside #1\\nInside= 23.8\"W x 23.8\"H => 3.10 sf x 20.00\"L = 62.0 cf\\nOutside= 28.0\"W x 28.0\"H => 3.92 sf x 20.00\"L = 78.4 cf\\n36 Chambers in 12 Rows\\n40.28' Header x 3.10 sf x 2 = 249.8 cf Inside", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p101.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 52.32, "t": 398.304, "r": 178.44, "b": 377.28 }, "text": "", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 8 }, { "id": "p101.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 178.44, "t": 398.304, "r": 304.56, "b": 377.28 }, "text": "", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1 }, "reading_order": 9 }, { "id": "p101.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 192.48, "t": 382.200786, "r": 231.298697, "b": 370.213607 }, "text": "0.105 af", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p101.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 243.477069, "t": 382.200786, "r": 354.519595, "b": 370.213607 }, "text": "Total Available Storage", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 } ], "reading_order": 4 }, { "id": "p101.6", "order": 18, "type": "heading", "bbox": { "l": 66.96, "t": 358.8, "r": 295.44, "b": 345.36 }, "text": "Storage Group A created with Chamber Wizard", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 5 }, { "id": "p101.7", "order": 19, "type": "table", "bbox": { "l": 52.08, "t": 335.76, "r": 556.8, "b": 270.24 }, "text": "", "attrs": { "block_label": "table", "n_rows": 2, "n_cols": 4, "integrity": { "cells_checked": 8, "cells_flagged": 0 } }, "children": [ { "id": "p101.7.1", "order": 20, "type": "table_cell", "bbox": { "l": 54.000153, "t": 334.681717, "r": 86.82526, "b": 308.893607 }, "text": "Device\n#1", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p101.7.2", "order": 21, "type": "table_cell", "bbox": { "l": 98.873664, "t": 334.681717, "r": 147.222394, "b": 308.893607 }, "text": "Routing\nDiscarded", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p101.7.3", "order": 22, "type": "table_cell", "bbox": { "l": 175.965845, "t": 334.681717, "r": 210.937678, "b": 308.893607 }, "text": "Invert\n107.50'", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p101.7.4", "order": 23, "type": "table_cell", "bbox": { "l": 223.014009, "t": 334.681717, "r": 453.384188, "b": 297.012765 }, "text": "Outlet Devices\n1.000 in/hr Exfiltration over Surface area\\nConductivity to Groundwater Elevation = 105.00'", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p101.7.5", "order": 24, "type": "table_cell", "bbox": { "l": 70.44, "t": 297.120177, "r": 82.384214, "b": 285.132998 }, "text": "#2", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p101.7.6", "order": 25, "type": "table_cell", "bbox": { "l": 98.876253, "t": 297.120177, "r": 135.868946, "b": 285.132998 }, "text": "Primary", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p101.7.7", "order": 26, "type": "table_cell", "bbox": { "l": 175.97229, "t": 297.120177, "r": 210.870449, "b": 285.132998 }, "text": "109.00'", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p101.7.8", "order": 27, "type": "table_cell", "bbox": { "l": 223.01982, "t": 296.939725, "r": 378.049708, "b": 273.253231 }, "text": "8.0\" W × 4.0\" H Vert. Orifice/Grate C= 0.600\\nLimited to weir flow at low heads", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 } ], "reading_order": 6 }, { "id": "p101.8", "order": 28, "type": "footnote", "bbox": { "l": 190.32, "t": 381.84, "r": 357.36, "b": 368.88 }, "text": "0.105 af Total Available Storage", "attrs": { "block_label": "vision_footnote" }, "reading_order": 7 }, { "id": "p101.9", "order": 29, "type": "footnote", "bbox": { "l": 50.64, "t": 262.32, "r": 438, "b": 235.92 }, "text": "Discarded OutFlow Max=0.11 cfs @ 12.88 hrs HW=109.14' (Free Discharge)\n1=Exfiltration (Controls 0.11 cfs)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 8 }, { "id": "p101.10", "order": 30, "type": "footnote", "bbox": { "l": 51.84, "t": 226.8, "r": 426.72, "b": 200.88 }, "text": "Primary OutFlow Max=0.12 cfs @ 12.88 hrs HW=109.14' (Free Discharge)\n2=Orifice/Grate (Orifice Controls 0.12 cfs @ 1.21 fps)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 9 } ] }, { "document_id": 11809, "page": 102, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 7, "counts_by_type": { "figure": 1, "footer": 1, "header": 2, "text": 2, "title": 1 }, "build_ms": 1, "items": [ { "id": "p102.1", "order": 1, "type": "header", "bbox": { "l": 360.96, "t": 739.44, "r": 561.36, "b": 701.28 }, "text": "NOAA 24-hr D 25 year Rainfall=6.68\"\nPrinted 12/31/2025\nPage 66", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p102.2", "order": 2, "type": "header", "bbox": { "l": 51.12, "t": 736.56, "r": 392.88, "b": 698.64 }, "text": "POST DEV NOAA\nPrepared by Professional Design Services\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p102.3", "order": 3, "type": "title", "bbox": { "l": 126.48, "t": 687.84, "r": 494.4, "b": 672.72 }, "text": "Pond 8P: SSIB #2 UNDERGROUND - Chamber Wizard Field A", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 2 }, { "id": "p102.4", "order": 4, "type": "text", "bbox": { "l": 49.68, "t": 661.44, "r": 543.12, "b": 406.08 }, "text": "Chamber Model = ADS N-12 24\" (ADS N-12® Pipe)\nInside= 23.8\"W x 23.8\"H => 3.10 sf x 20.00'L = 62.0 cf\nOutside= 28.0\"W x 28.0\"H => 3.92 sf x 20.00'L = 78.4 cf\n28.0\" Wide + 13.4\" Spacing = 41.4\" C-C Row Spacing\n3 Chambers/Row x 20.00' Long +2.33' Header x 2 = 64.67' Row Length +10.0\" End Stone x 2 = 66.33' Base Length\n12 Rows x 28.0\" Wide + 13.4\" Spacing x 11 + 10.0\" Side Stone x 2 = 41.95' Base Width\n4.0\" Stone Base + 28.0\" Chamber Height + 4.0\" Stone Cover = 3.00' Field Height\n36 Chambers x 62.0 cf + 40.28' Header x 3.10 sf x 2 = 2,481.8 cf Chamber Storage\n36 Chambers x 78.4 cf + 40.28' Header x 3.92 sf x 2 = 3,137.9 cf Displacement\n8,348.3 cf Field - 3,137.9 cf Chambers = 5,210.4 cf Stone x 40.0% Voids = 2,084.2 cf Stone Storage\nChamber Storage + Stone Storage = 4,565.9 cf = 0.105 af\nOverall Storage Efficiency = 54.7%\nOverall System Size = 66.33' x 41.95' x 3.00'", "attrs": { "block_label": "algorithm" }, "reading_order": 3 }, { "id": "p102.5", "order": 5, "type": "text", "bbox": { "l": 52.08, "t": 400.8, "r": 127.92, "b": 360.48 }, "text": "36 Chambers\n309.2 cy Field\n193.0 cy Stone", "reading_order": 4 }, { "id": "p102.6", "order": 6, "type": "figure", "bbox": { "l": 223.44, "t": 346.8, "r": 387.84, "b": 93.36 }, "text": "", "attrs": { "block_label": "image" }, "reading_order": 5 }, { "id": "p102.7", "order": 7, "type": "footer", "bbox": { "l": 223.2, "t": 66.48, "r": 387.12, "b": 53.76 }, "text": "0101010101010101010", "attrs": { "block_label": "footer" }, "reading_order": 6 } ] }, { "document_id": 11809, "page": 103, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 3, "counts_by_type": { "caption": 1, "figure": 1, "header": 1 }, "build_ms": 0, "items": [ { "id": "p103.1", "order": 1, "type": "header", "bbox": { "l": 52.8, "t": 737.76, "r": 561.84, "b": 698.4 }, "text": "POST DEV NOAA 24-hr D 25 year Rainfall=6.68\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 67", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p103.2", "order": 2, "type": "caption", "bbox": { "l": 203.28, "t": 687.84, "r": 413.76, "b": 672.96 }, "text": "Pond 8P: SSIB #2 UNDERGROUND", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p103.3", "order": 3, "type": "figure", "bbox": { "l": 62.64, "t": 675.12, "r": 552.24, "b": 399.12 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nInflow\n1.84 cfs Outflow\nInflow Area=0.460 ac Primary\nDiscarded\n2\nPeak Elev=109.14'\nStorage=0.059 af\n(cfs)\n1\nFlow\n0.22 cfs\n0.11 cfs\n0.12 cfs\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 2 } ] }, { "document_id": 11809, "page": 104, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 12, "counts_by_type": { "caption": 1, "header": 1, "table": 2, "table_cell": 8 }, "build_ms": 14, "items": [ { "id": "p104.1", "order": 1, "type": "header", "bbox": { "l": 51.84, "t": 738.48, "r": 560.88, "b": 698.64 }, "text": "POST DEV NOAA 24-hr D 25 year Rainfall=6.68\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 68", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p104.2", "order": 2, "type": "caption", "bbox": { "l": 153.84, "t": 687.84, "r": 466.32, "b": 672.72 }, "text": "Stage-Discharge for Pond 8P: SSIB #2 UNDERGROUND", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p104.3", "order": 3, "type": "table", "bbox": { "l": 56.4, "t": 661.92, "r": 275.04, "b": 56.64 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 4, "integrity": { "cells_checked": 4, "cells_flagged": 0 } }, "children": [ { "id": "p104.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 57.3, "t": 661.21453, "r": 97.73433, "b": 59.66617199999996 }, "text": "Elevation (feet)\n107.50\n107.55\n107.60\n107.65\n107.70\n107.75\n107.80\n107.85\n107.90\n107.95\n108.00\n108.05\n108.10\n108.15\n108.20\n108.25\n108.30\n108.35\n108.40\n108.45\n108.50\n108.55\n108.60\n108.65\n108.70\n108.75\n108.80\n108.85\n108.90\n108.95\n109.00\n109.05\n109.10\n109.15\n109.20\n109.25\n109.30\n109.35\n109.40\n109.45\n109.50\n109.55\n109.60\n109.65\n109.70\n109.75\n109.80\n109.85\n109.90\n109.95\n110.00\n110.05\n110.10", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p104.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 109.260182, "t": 661.21453, "r": 153.49646, "b": 59.66617199999996 }, "text": "Discharge (cfs)\n0.00\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.08\n0.08\n0.08\n0.08\n0.08\n0.08\n0.08\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.13\n0.17\n0.23\n0.30\n0.38\n0.46\n0.55\n0.62\n0.68\n0.73\n0.77\n0.82\n0.86\n0.90\n0.94\n0.97\n1.01\n1.04\n1.07\n1.10\n1.13\n1.16", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p104.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 165.000251, "t": 661.21453, "r": 209.236529, "b": 59.66617199999996 }, "text": "Discarded (cfs)\n0.00\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.08\n0.08\n0.08\n0.08\n0.08\n0.08\n0.08\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.11\n0.11\n0.11\n0.11\n0.11\n0.11\n0.11\n0.11\n0.12\n0.12\n0.12\n0.12\n0.12\n0.12\n0.12\n0.12\n0.13\n0.13\n0.13\n0.13\n0.13", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p104.3.4", "order": 7, "type": "table_cell", "bbox": { "l": 231.060808, "t": 661.21453, "r": 264.933898, "b": 59.66617199999996 }, "text": "Primary (cfs)\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.02\n0.07\n0.12\n0.19\n0.27\n0.35\n0.44\n0.50\n0.56\n0.61\n0.66\n0.70\n0.74\n0.78\n0.81\n0.85\n0.88\n0.91\n0.95\n0.98\n1.00\n1.03", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 } ], "reading_order": 2 }, { "id": "p104.4", "order": 8, "type": "table", "bbox": { "l": 282.24, "t": 662.88, "r": 498.24, "b": 550.8 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 4, "integrity": { "cells_checked": 4, "cells_flagged": 0 } }, "children": [ { "id": "p104.4.1", "order": 9, "type": "table_cell", "bbox": { "l": 287.88, "t": 661.21453, "r": 328.31433, "b": 551.0662580000001 }, "text": "Elevation (feet)\n110.15\n110.20\n110.25\n110.30\n110.35\n110.40\n110.45\n110.50", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p104.4.2", "order": 10, "type": "table_cell", "bbox": { "l": 339.840182, "t": 661.21453, "r": 384.526148, "b": 551.006306 }, "text": "Discharge (cfs)\n1.19\n1.22\n1.25\n1.27\n1.30\n1.33\n1.35\n1.38", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p104.4.3", "order": 11, "type": "table_cell", "bbox": { "l": 395.580251, "t": 661.21453, "r": 440.263268, "b": 551.006306 }, "text": "Discarded (cfs)\n0.13\n0.13\n0.14\n0.14\n0.14\n0.14\n0.14\n0.14", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p104.4.4", "order": 12, "type": "table_cell", "bbox": { "l": 461.640808, "t": 661.21453, "r": 496.000389, "b": 551.006306 }, "text": "Primary (cfs)\n1.06\n1.09\n1.11\n1.14\n1.16\n1.19\n1.21\n1.23", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 } ], "reading_order": 3 } ] }, { "document_id": 11809, "page": 105, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 10, "counts_by_type": { "caption": 1, "header": 1, "table": 2, "table_cell": 6 }, "build_ms": 10, "items": [ { "id": "p105.1", "order": 1, "type": "header", "bbox": { "l": 51.84, "t": 738.48, "r": 562.08, "b": 698.64 }, "text": "POST DEV NOAA 24-hr D 25 year Rainfall=6.68\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 69", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p105.2", "order": 2, "type": "caption", "bbox": { "l": 146.16, "t": 687.84, "r": 474.48, "b": 672.72 }, "text": "Stage-Area-Storage for Pond 8P: SSIB #2 UNDERGROUND", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p105.3", "order": 3, "type": "table", "bbox": { "l": 56.4, "t": 661.21453, "r": 235.92, "b": 56.88 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 3, "integrity": { "cells_checked": 3, "cells_flagged": 0 } }, "children": [ { "id": "p105.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 57.3, "t": 661.21453, "r": 97.73433, "b": 59.66617199999996 }, "text": "Elevation (feet)\n107.50\n107.55\n107.60\n107.65\n107.70\n107.75\n107.80\n107.85\n107.90\n107.95\n108.00\n108.05\n108.10\n108.15\n108.20\n108.25\n108.30\n108.35\n108.40\n108.45\n108.50\n108.55\n108.60\n108.65\n108.70\n108.75\n108.80\n108.85\n108.90\n108.95\n109.00\n109.05\n109.10\n109.15\n109.20\n109.25\n109.30\n109.35\n109.40\n109.45\n109.50\n109.55\n109.60\n109.65\n109.70\n109.75\n109.80\n109.85\n109.90\n109.95\n110.00\n110.05\n110.10", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p105.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 125.040179, "t": 661.21453, "r": 159.530474, "b": 59.66617199999996 }, "text": "Surface (acres)\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p105.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 182.880513, "t": 661.21453, "r": 228.350762, "b": 59.66617199999996 }, "text": "Storage (acre-feet)\n0.000\n0.001\n0.003\n0.004\n0.005\n0.006\n0.008\n0.009\n0.010\n0.011\n0.012\n0.013\n0.014\n0.016\n0.018\n0.020\n0.022\n0.024\n0.026\n0.028\n0.030\n0.032\n0.034\n0.036\n0.039\n0.041\n0.043\n0.045\n0.048\n0.050\n0.052\n0.055\n0.057\n0.059\n0.062\n0.064\n0.066\n0.068\n0.071\n0.073\n0.075\n0.077\n0.079\n0.081\n0.083\n0.085\n0.087\n0.089\n0.090\n0.092\n0.093\n0.094\n0.095", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 } ], "reading_order": 2 }, { "id": "p105.4", "order": 7, "type": "table", "bbox": { "l": 246.48, "t": 662.4, "r": 425.04, "b": 551.006306 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 3, "integrity": { "cells_checked": 3, "cells_flagged": 0 } }, "children": [ { "id": "p105.4.1", "order": 8, "type": "table_cell", "bbox": { "l": 251.28, "t": 661.21453, "r": 291.71433, "b": 551.0662580000001 }, "text": "Elevation (feet)\n110.15\n110.20\n110.25\n110.30\n110.35\n110.40\n110.45\n110.50", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p105.4.2", "order": 9, "type": "table_cell", "bbox": { "l": 319.020179, "t": 661.21453, "r": 352.90408, "b": 551.0662580000001 }, "text": "Surface (acres)\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p105.4.3", "order": 10, "type": "table_cell", "bbox": { "l": 376.860513, "t": 661.21453, "r": 422.930276, "b": 551.006306 }, "text": "Storage (acre-feet)\n0.096\n0.097\n0.098\n0.100\n0.101\n0.102\n0.104\n0.105", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 } ], "reading_order": 3 } ] }, { "document_id": 11809, "page": 106, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 30, "counts_by_type": { "footnote": 3, "header": 1, "heading": 3, "table": 2, "table_cell": 20, "text": 1 }, "build_ms": 5, "items": [ { "id": "p106.1", "order": 1, "type": "header", "bbox": { "l": 52.8, "t": 738.72, "r": 561.6, "b": 698.64 }, "text": "POST DEV NOAA 24-hr D 25 year Rainfall=6.68\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 70", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p106.2", "order": 2, "type": "heading", "bbox": { "l": 163.68, "t": 687.6, "r": 455.76, "b": 672.72 }, "text": "Summary for Pond 9P: SSIB #3 UNDERGROUND", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p106.3", "order": 3, "type": "heading", "bbox": { "l": 52.32, "t": 659.52, "r": 301.44, "b": 645.84 }, "text": "[82] Warning: Early inflow requires earlier time span", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 2 }, { "id": "p106.4", "order": 4, "type": "text", "bbox": { "l": 53.76, "t": 640.08, "r": 554.64, "b": 490.32 }, "text": "Inflow Area = 0.460 ac, 100.00% Impervious, Inflow Depth > 5.82\" for 25 year event\nInflow = 2.92 cfs @ 12.10 hrs, Volume= 0.223 af\nOutflow = 0.21 cfs @ 13.40 hrs, Volume= 0.146 af, Atten= 93%, Lag= 78.6 min\nDiscarded = 0.15 cfs @ 13.40 hrs, Volume= 0.141 af\nPrimary = 0.05 cfs @ 13.40 hrs, Volume= 0.004 af\nRouted to Reach 10 : COMPOSITE\n\nRouting by Stor-Ind method, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs\nPeak Elev= 113.06' @ 13.40 hrs Surf.Area= 0.085 ac Storage= 0.114 af\n\nPlug-Flow detention time= 171.6 min calculated for 0.145 af (65% of inflow)\nCenter-of-Mass det. time= 94.1 min ( 827.4 - 733.4 )", "attrs": { "block_label": "algorithm" }, "reading_order": 3 }, { "id": "p106.5", "order": 5, "type": "table", "bbox": { "l": 52.32, "t": 482.64, "r": 556.8, "b": 370.213607 }, "text": "", "attrs": { "block_label": "table", "n_rows": 3, "n_cols": 4, "integrity": { "cells_checked": 10, "cells_flagged": 0 } }, "children": [ { "id": "p106.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 54, "t": 481.084378, "r": 549.157135, "b": 443.412765 }, "text": "Volume\n#1A\n0.255 af Overall - 0.096 af Embedded = 0.159 af x 40.0% Voids", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p106.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 115.437146, "t": 481.084378, "r": 150.396899, "b": 455.293607 }, "text": "Invert\n110.80'", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p106.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 167.453925, "t": 481.084378, "r": 231.331841, "b": 455.293607 }, "text": "Avail.Storage\n0.063 af", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p106.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 243.466175, "t": 481.084378, "r": 412.943681, "b": 455.113155 }, "text": "Storage Description\n55.75'W x 66.33'L x 3.00'H Field A", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p106.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 66.12, "t": 443.520177, "r": 85.228595, "b": 431.532998 }, "text": "#2A", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p106.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 115.437146, "t": 443.520177, "r": 150.335304, "b": 431.532998 }, "text": "111.13'", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p106.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 192.471958, "t": 443.520177, "r": 231.290655, "b": 431.532998 }, "text": "0.076 af", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p106.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 243.479769, "t": 443.520177, "r": 509.915235, "b": 384.013929 }, "text": "ADS N-12 24\" x 48 Inside #1\\nInside = 23.8\"W x 23.8\"H => 3.10 sf x 20.00'L = 62.0 cf\\nOutside = 28.0\"W x 28.0\"H => 3.92 sf x 20.00'L = 78.4 cf\\n48 Chambers in 16 Rows\\n54.08' Header x 3.10 sf x 2 = 335.3 cf Inside", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p106.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 52.32, "t": 397.008, "r": 178.44, "b": 375.6 }, "text": "", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 8 }, { "id": "p106.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 178.44, "t": 397.008, "r": 304.56, "b": 375.6 }, "text": "", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1 }, "reading_order": 9 }, { "id": "p106.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 192.48, "t": 382.200786, "r": 231.298697, "b": 370.213607 }, "text": "0.139 af", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p106.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 243.477069, "t": 382.200786, "r": 354.519595, "b": 370.213607 }, "text": "Total Available Storage", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 } ], "reading_order": 4 }, { "id": "p106.6", "order": 18, "type": "heading", "bbox": { "l": 67.2, "t": 358.8, "r": 295.44, "b": 345.36 }, "text": "Storage Group A created with Chamber Wizard", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 5 }, { "id": "p106.7", "order": 19, "type": "table", "bbox": { "l": 52.08, "t": 335.76, "r": 556.8, "b": 270 }, "text": "", "attrs": { "block_label": "table", "n_rows": 2, "n_cols": 4, "integrity": { "cells_checked": 8, "cells_flagged": 0 } }, "children": [ { "id": "p106.7.1", "order": 20, "type": "table_cell", "bbox": { "l": 54.000153, "t": 334.681717, "r": 86.82526, "b": 308.893607 }, "text": "Device\n#1", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p106.7.2", "order": 21, "type": "table_cell", "bbox": { "l": 98.873664, "t": 334.681717, "r": 147.222394, "b": 308.893607 }, "text": "Routing\nDiscarded", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p106.7.3", "order": 22, "type": "table_cell", "bbox": { "l": 175.965845, "t": 334.681717, "r": 210.937678, "b": 308.893607 }, "text": "Invert\n110.80'", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p106.7.4", "order": 23, "type": "table_cell", "bbox": { "l": 223.014009, "t": 334.681717, "r": 453.384188, "b": 297.012765 }, "text": "Outlet Devices\n1.000 in/hr Exfiltration over Surface area\\nConductivity to Groundwater Elevation = 108.00'", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p106.7.5", "order": 24, "type": "table_cell", "bbox": { "l": 70.44, "t": 297.120177, "r": 82.384214, "b": 285.132998 }, "text": "#2", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p106.7.6", "order": 25, "type": "table_cell", "bbox": { "l": 98.876253, "t": 297.120177, "r": 135.868946, "b": 285.132998 }, "text": "Primary", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p106.7.7", "order": 26, "type": "table_cell", "bbox": { "l": 175.97229, "t": 297.120177, "r": 210.870449, "b": 285.132998 }, "text": "113.00'", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p106.7.8", "order": 27, "type": "table_cell", "bbox": { "l": 223.01982, "t": 297.120177, "r": 451.453995, "b": 273.253231 }, "text": "12.0\" W x 6.0\" H Vert. Orifice/Grate C= 0.600\\nLimited to weir flow at low heads", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 } ], "reading_order": 6 }, { "id": "p106.8", "order": 28, "type": "footnote", "bbox": { "l": 190.32, "t": 381.84, "r": 357.36, "b": 368.88 }, "text": "0.139 af Total Available Storage", "attrs": { "block_label": "vision_footnote" }, "reading_order": 7 }, { "id": "p106.9", "order": 29, "type": "footnote", "bbox": { "l": 50.64, "t": 262.32, "r": 438, "b": 235.68 }, "text": "Discarded OutFlow Max=0.15 cfs @ 13.40 hrs HW=113.06' (Free Discharge)\n1=Exfiltration (Controls 0.15 cfs)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 8 }, { "id": "p106.10", "order": 30, "type": "footnote", "bbox": { "l": 51.84, "t": 227.04, "r": 426, "b": 200.64 }, "text": "Primary OutFlow Max=0.05 cfs @ 13.40 hrs HW=113.06' (Free Discharge)\n2=Orifice/Grate (Orifice Controls 0.05 cfs @ 0.81 fps)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 9 } ] }, { "document_id": 11809, "page": 107, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 8, "counts_by_type": { "figure": 1, "footer": 1, "header": 2, "text": 3, "title": 1 }, "build_ms": 1, "items": [ { "id": "p107.1", "order": 1, "type": "header", "bbox": { "l": 362.4, "t": 739.68, "r": 561.36, "b": 712.8 }, "text": "NOAA 24-hr D 25 year Rainfall=6.68\"\nPrinted 12/31/2025", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p107.2", "order": 2, "type": "header", "bbox": { "l": 51.12, "t": 738.72, "r": 391.68, "b": 698.64 }, "text": "POST DEV /N\nPrepared by Professional Design Services\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p107.3", "order": 3, "type": "text", "bbox": { "l": 516.72, "t": 711.36, "r": 559.2, "b": 698.88 }, "text": "Page 71", "attrs": { "block_label": "number" }, "reading_order": 2 }, { "id": "p107.4", "order": 4, "type": "title", "bbox": { "l": 126.72, "t": 687.6, "r": 494.4, "b": 672.96 }, "text": "Pond 9P: SSIB #3 UNDERGROUND - Chamber Wizard Field A", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 3 }, { "id": "p107.5", "order": 5, "type": "text", "bbox": { "l": 49.68, "t": 662.4, "r": 544.8, "b": 405.84 }, "text": "Chamber Model = ADS N-12 24\" (ADS N-12® Pipe)\nInside= 23.8\"W x 23.8\"H => 3.10 sf x 20.00\"L = 62.0 cf\nOutside= 28.0\"W x 28.0\"H => 3.92 sf x 20.00\"L = 78.4 cf\n28.0\" Wide + 13.4\" Spacing = 41.4\" C-C Row Spacing\n3 Chambers/Row x 20.00' Long +2.33' Header x 2 = 64.67' Row Length +10.0\" End Stone x 2 = 66.33' Base Length\n16 Rows x 28.0\" Wide + 13.4\" Spacing x 15 + 10.0\" Side Stone x 2 = 55.75' Base Width\n4.0\" Stone Base + 28.0\" Chamber Height + 4.0\" Stone Cover = 3.00' Field Height\n48 Chambers x 62.0 cf + 54.08' Header x 3.10 sf x 2 = 3,311.3 cf Chamber Storage\n48 Chambers x 78.4 cf + 54.08' Header x 3.92 sf x 2 = 4,186.8 cf Displacement\n11,094.6 cf Field - 4,186.8 cf Chambers = 6,907.8 cf Stone x 40.0% Voids = 2,763.1 cf Stone Storage\nChamber Storage + Stone Storage = 6,074.4 cf = 0.139 af\nOverall Storage Efficiency = 54.8%\nOverall System Size = 66.33' x 55.75' x 3.00'", "attrs": { "block_label": "algorithm" }, "reading_order": 4 }, { "id": "p107.6", "order": 6, "type": "text", "bbox": { "l": 51.84, "t": 400.56, "r": 127.92, "b": 360.72 }, "text": "48 Chambers\n410.9 cy Field\n255.8 cy Stone", "reading_order": 5 }, { "id": "p107.7", "order": 7, "type": "figure", "bbox": { "l": 196.8, "t": 348.96, "r": 414.72, "b": 92.88 }, "text": "", "attrs": { "block_label": "image" }, "reading_order": 6 }, { "id": "p107.8", "order": 8, "type": "footer", "bbox": { "l": 197.04, "t": 66.24, "r": 414.48, "b": 53.76 }, "text": "101010", "attrs": { "block_label": "footer" }, "reading_order": 7 } ] }, { "document_id": 11809, "page": 108, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 3, "counts_by_type": { "caption": 1, "figure": 1, "header": 1 }, "build_ms": 0, "items": [ { "id": "p108.1", "order": 1, "type": "header", "bbox": { "l": 52.32, "t": 738.48, "r": 563.04, "b": 698.4 }, "text": "POST DEV NOAA 24-hr D 25 year Rainfall=6.68\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 72", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p108.2", "order": 2, "type": "caption", "bbox": { "l": 203.04, "t": 688.08, "r": 413.76, "b": 672.96 }, "text": "Pond 9P: SSIB #3 UNDERGROUND", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p108.3", "order": 3, "type": "figure", "bbox": { "l": 62.16, "t": 671.28, "r": 552.48, "b": 398.64 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nInflow\n2.92 cfs Outflow\nInflow Area=0.460 ac Primary\nDiscarded\nPeak Elev=113.06'\n3\nStorage=0.114 af\n2\n(cfs)\nFlow\n1\n0.21 cfs\n0.15 cfs\n0.05 cfs\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 2 } ] }, { "document_id": 11809, "page": 109, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 12, "counts_by_type": { "caption": 1, "header": 1, "table": 2, "table_cell": 8 }, "build_ms": 15, "items": [ { "id": "p109.1", "order": 1, "type": "header", "bbox": { "l": 51.84, "t": 738.48, "r": 561.12, "b": 698.64 }, "text": "POST DEV NOAA 24-hr D 25 year Rainfall=6.68\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 73", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p109.2", "order": 2, "type": "caption", "bbox": { "l": 154.08, "t": 687.84, "r": 466.08, "b": 672.72 }, "text": "Stage-Discharge for Pond 9P: SSIB #3 UNDERGROUND", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p109.3", "order": 3, "type": "table", "bbox": { "l": 56.88, "t": 661.44, "r": 275.28, "b": 56.88 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 4, "integrity": { "cells_checked": 4, "cells_flagged": 0 } }, "children": [ { "id": "p109.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 57.3, "t": 661.21453, "r": 97.73433, "b": 59.66617199999996 }, "text": "Elevation (feet)\n110.80\n110.85\n110.90\n110.95\n111.00\n111.05\n111.10\n111.15\n111.20\n111.25\n111.30\n111.35\n111.40\n111.45\n111.50\n111.55\n111.60\n111.65\n111.70\n111.75\n111.80\n111.85\n111.90\n111.95\n112.00\n112.05\n112.10\n112.15\n112.20\n112.25\n112.30\n112.35\n112.40\n112.45\n112.50\n112.55\n112.60\n112.65\n112.70\n112.75\n112.80\n112.85\n112.90\n112.95\n113.00\n113.05\n113.10\n113.15\n113.20\n113.25\n113.30\n113.35\n113.40", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p109.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 109.260182, "t": 661.21453, "r": 153.49646, "b": 59.66617199999996 }, "text": "Discharge (cfs)\n0.00\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.11\n0.11\n0.11\n0.11\n0.11\n0.11\n0.11\n0.12\n0.12\n0.12\n0.12\n0.12\n0.12\n0.13\n0.13\n0.13\n0.13\n0.13\n0.13\n0.13\n0.14\n0.14\n0.14\n0.14\n0.14\n0.14\n0.15\n0.15\n0.15\n0.15\n0.15\n0.15\n0.19\n0.26\n0.34\n0.45\n0.56\n0.69\n0.83\n0.98", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p109.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 165.000251, "t": 661.21453, "r": 209.236529, "b": 59.66617199999996 }, "text": "Discarded (cfs)\n0.00\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.11\n0.11\n0.11\n0.11\n0.11\n0.11\n0.11\n0.12\n0.12\n0.12\n0.12\n0.12\n0.12\n0.13\n0.13\n0.13\n0.13\n0.13\n0.13\n0.13\n0.14\n0.14\n0.14\n0.14\n0.14\n0.14\n0.15\n0.15\n0.15\n0.15\n0.15\n0.15\n0.15\n0.16\n0.16\n0.16\n0.16\n0.16\n0.16\n0.17", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p109.3.4", "order": 7, "type": "table_cell", "bbox": { "l": 231.060808, "t": 661.21453, "r": 264.933898, "b": 59.66617199999996 }, "text": "Primary (cfs)\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.04\n0.10\n0.19\n0.29\n0.40\n0.53\n0.66\n0.81", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 } ], "reading_order": 2 }, { "id": "p109.4", "order": 8, "type": "table", "bbox": { "l": 282.24, "t": 662.88, "r": 498.24, "b": 550.56 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 4, "integrity": { "cells_checked": 4, "cells_flagged": 0 } }, "children": [ { "id": "p109.4.1", "order": 9, "type": "table_cell", "bbox": { "l": 287.88, "t": 661.21453, "r": 328.31433, "b": 551.0662580000001 }, "text": "Elevation (feet)\n113.45\n113.50\n113.55\n113.60\n113.65\n113.70\n113.75\n113.80", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p109.4.2", "order": 10, "type": "table_cell", "bbox": { "l": 339.840182, "t": 661.21453, "r": 384.526148, "b": 551.006306 }, "text": "Discharge (cfs)\n1.14\n1.30\n1.44\n1.56\n1.67\n1.77\n1.86\n1.95", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p109.4.3", "order": 11, "type": "table_cell", "bbox": { "l": 395.580251, "t": 661.21453, "r": 440.263268, "b": 551.006306 }, "text": "Discarded (cfs)\n0.17\n0.17\n0.17\n0.17\n0.17\n0.17\n0.18\n0.18", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p109.4.4", "order": 12, "type": "table_cell", "bbox": { "l": 461.640808, "t": 661.21453, "r": 496.000389, "b": 551.006306 }, "text": "Primary (cfs)\n0.97\n1.13\n1.27\n1.39\n1.50\n1.59\n1.68\n1.77", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 } ], "reading_order": 3 } ] }, { "document_id": 11809, "page": 110, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 10, "counts_by_type": { "caption": 1, "header": 1, "table": 2, "table_cell": 6 }, "build_ms": 9, "items": [ { "id": "p110.1", "order": 1, "type": "header", "bbox": { "l": 51.84, "t": 738.48, "r": 561.84, "b": 698.88 }, "text": "POST DEV NOAA 24-hr D 25 year Rainfall=6.68\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 74", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p110.2", "order": 2, "type": "caption", "bbox": { "l": 146.16, "t": 687.6, "r": 474.48, "b": 672.72 }, "text": "Stage-Area-Storage for Pond 9P: SSIB #3 UNDERGROUND", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p110.3", "order": 3, "type": "table", "bbox": { "l": 57.3, "t": 661.21453, "r": 235.92, "b": 56.88 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 3, "integrity": { "cells_checked": 3, "cells_flagged": 0 } }, "children": [ { "id": "p110.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 57.3, "t": 661.21453, "r": 97.73433, "b": 59.66617199999996 }, "text": "Elevation (feet)\n110.80\n110.85\n110.90\n110.95\n111.00\n111.05\n111.10\n111.15\n111.20\n111.25\n111.30\n111.35\n111.40\n111.45\n111.50\n111.55\n111.60\n111.65\n111.70\n111.75\n111.80\n111.85\n111.90\n111.95\n112.00\n112.05\n112.10\n112.15\n112.20\n112.25\n112.30\n112.35\n112.40\n112.45\n112.50\n112.55\n112.60\n112.65\n112.70\n112.75\n112.80\n112.85\n112.90\n112.95\n113.00\n113.05\n113.10\n113.15\n113.20\n113.25\n113.30\n113.35\n113.40", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p110.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 125.040179, "t": 661.21453, "r": 159.530474, "b": 59.66617199999996 }, "text": "Surface (acres)\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p110.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 182.880513, "t": 661.21453, "r": 228.350762, "b": 59.66617199999996 }, "text": "Storage (acre-feet)\n0.000\n0.002\n0.003\n0.005\n0.007\n0.008\n0.010\n0.012\n0.013\n0.015\n0.016\n0.017\n0.019\n0.021\n0.024\n0.026\n0.029\n0.031\n0.034\n0.037\n0.040\n0.042\n0.045\n0.048\n0.051\n0.054\n0.057\n0.060\n0.064\n0.067\n0.070\n0.073\n0.076\n0.079\n0.082\n0.085\n0.088\n0.091\n0.094\n0.097\n0.100\n0.103\n0.105\n0.108\n0.111\n0.113\n0.116\n0.118\n0.120\n0.122\n0.124\n0.125\n0.126", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 } ], "reading_order": 2 }, { "id": "p110.4", "order": 7, "type": "table", "bbox": { "l": 246.48, "t": 662.4, "r": 425.04, "b": 551.006306 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 3, "integrity": { "cells_checked": 3, "cells_flagged": 0 } }, "children": [ { "id": "p110.4.1", "order": 8, "type": "table_cell", "bbox": { "l": 251.28, "t": 661.21453, "r": 291.71433, "b": 551.0662580000001 }, "text": "Elevation (feet)\n113.45\n113.50\n113.55\n113.60\n113.65\n113.70\n113.75\n113.80", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p110.4.2", "order": 9, "type": "table_cell", "bbox": { "l": 319.020179, "t": 661.21453, "r": 352.90408, "b": 551.0662580000001 }, "text": "Surface (acres)\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p110.4.3", "order": 10, "type": "table_cell", "bbox": { "l": 376.860513, "t": 661.21453, "r": 422.930276, "b": 551.006306 }, "text": "Storage (acre-feet)\n0.128\n0.129\n0.131\n0.133\n0.134\n0.136\n0.138\n0.139", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 } ], "reading_order": 3 } ] }, { "document_id": 11809, "page": 111, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 19, "counts_by_type": { "footer": 1, "text": 18 }, "build_ms": 2, "items": [ { "id": "p111.1", "order": 1, "type": "text", "bbox": { "l": 120.24, "t": 687.36, "r": 490.32, "b": 651.12 }, "text": "Time span=5.00-20.00 hrs, dt=0.05 hrs, 301 points\nRunoff by SCS TR-20 method, UH=Delmarva, Weighted-CN\nReach routing by Stor-Ind+Trans method - Pond routing by Stor-Ind method", "reading_order": 0 }, { "id": "p111.2", "order": 2, "type": "text", "bbox": { "l": 257.76, "t": 640.08, "r": 560.16, "b": 616.32 }, "text": "Subcatchment1S: POROUS\nRunoff Area=0.570 ac 0.00% Impervious Runoff Depth>1.57\"\nFlow Length=310' Tc=12.9 min CN=39 Runoff=0.52 cfs 0.075 af", "reading_order": 1 }, { "id": "p111.3", "order": 3, "type": "text", "bbox": { "l": 259.44, "t": 605.28, "r": 559.92, "b": 580.56 }, "text": "Subcatchment2S: IMPERVIOUS\nRunoff Area=0.720 ac 100.00% Impervious Runoff Depth>8.29\"\nFlow Length=310' Tc=13.1 min CN=98 Runoff=3.82 cfs 0.498 af", "reading_order": 2 }, { "id": "p111.4", "order": 4, "type": "text", "bbox": { "l": 52.32, "t": 569.04, "r": 560.16, "b": 546 }, "text": "Subcatchment5S: IMPERVIOUS Runoff Area=0.270 ac 100.00% Impervious Runoff Depth>8.30\" Flow Length=180' Slope=0.0100'/' Tc=1.6 min CN=98 Runoff=2.61 cfs 0.187 af", "reading_order": 3 }, { "id": "p111.5", "order": 5, "type": "text", "bbox": { "l": 275.76, "t": 533.52, "r": 559.92, "b": 521.76 }, "text": "Subcatchment6S: POROUS\nRunoff Area=0.190 ac 0.00% Impervious Runoff Depth>1.57\"", "reading_order": 4 }, { "id": "p111.6", "order": 6, "type": "text", "bbox": { "l": 256.8, "t": 521.04, "r": 560.4, "b": 509.28 }, "text": "Flow Length=250' Tc=12.4 min CN=39 Runoff=0.18 cfs 0.025 af", "reading_order": 5 }, { "id": "p111.7", "order": 7, "type": "text", "bbox": { "l": 52.32, "t": 497.28, "r": 560.4, "b": 473.76 }, "text": "Subcatchment8S: PROP WAREHOUSE Runoff Area=0.460 ac 100.00% Impervious Runoff Depth>8.30\" Flow Length=280' Slope=0.0100'/' Tc=2.6 min CN=98 Runoff=4.15 cfs 0.318 af", "reading_order": 6 }, { "id": "p111.8", "order": 8, "type": "text", "bbox": { "l": 52.08, "t": 462.48, "r": 559.92, "b": 440.4 }, "text": "Subcatchment10S: BY-PASSPOROUS Runoff Area=0.060 ac 0.00% Impervious Runoff Depth>1.59\" Tc=2.0 min CN=39 Runoff=0.12 cfs 0.008 af", "reading_order": 7 }, { "id": "p111.9", "order": 9, "type": "text", "bbox": { "l": 52.32, "t": 426.48, "r": 559.44, "b": 403.2 }, "text": "Runoff Area=0.070 ac 100.00% Impervious Runoff Depth>8.30\"\nTc=2.0 min CN=98 Runoff=0.66 cfs 0.048 af", "reading_order": 8 }, { "id": "p111.10", "order": 10, "type": "text", "bbox": { "l": 51.6, "t": 425.52, "r": 203.76, "b": 413.76 }, "text": "Subcatchment11S: BY-PASS", "reading_order": 9 }, { "id": "p111.11", "order": 11, "type": "text", "bbox": { "l": 51.6, "t": 390, "r": 172.8, "b": 378.48 }, "text": "Reach 10: COMPOSITE", "reading_order": 10 }, { "id": "p111.12", "order": 12, "type": "text", "bbox": { "l": 447.84, "t": 390.72, "r": 559.92, "b": 379.44 }, "text": "Inflow=3.71 cfs 0.581 af", "reading_order": 11 }, { "id": "p111.13", "order": 13, "type": "text", "bbox": { "l": 440.4, "t": 378, "r": 560.16, "b": 366.72 }, "text": "Outflow=3.71 cfs 0.581 af", "reading_order": 12 }, { "id": "p111.14", "order": 14, "type": "text", "bbox": { "l": 52.56, "t": 355.2, "r": 559.68, "b": 330.72 }, "text": "Pond 3P: SSIB #1 SURFACE BASIN Peak Elev= $ 113.01' $ Storage= $ 8,676 $ cf Inflow= $ 4.30 $ cfs 0.572 af Discarded= $ 0.14 $ cfs 0.101 af Primary= $ 1.91 $ cfs 0.385 af Outflow= $ 2.05 $ cfs 0.486 af", "reading_order": 13 }, { "id": "p111.15", "order": 15, "type": "text", "bbox": { "l": 51.36, "t": 319.68, "r": 559.68, "b": 307.2 }, "text": "Pond 8P: SSIB #2 UNDERGROUND Peak Elev=109.52' Storage=0.076 af Inflow=2.68 cfs 0.212 af", "reading_order": 14 }, { "id": "p111.16", "order": 16, "type": "text", "bbox": { "l": 182.4, "t": 306.72, "r": 559.44, "b": 295.68 }, "text": "Discarded=0.12 cfs 0.105 af Primary=0.63 cfs 0.065 af Outflow=0.74 cfs 0.170 af", "reading_order": 15 }, { "id": "p111.17", "order": 17, "type": "text", "bbox": { "l": 52.56, "t": 283.68, "r": 561.84, "b": 260.16 }, "text": "Pond 9P: SSIB #3 UNDERGROUND Peak Elev=113.57' Storage=0.132 af Inflow=4.15 cfs 0.318 af Discarded=0.17 cfs 0.153 af Primary=1.32 cfs 0.075 af Outflow=1.49 cfs 0.228 af", "reading_order": 16 }, { "id": "p111.18", "order": 18, "type": "text", "bbox": { "l": 122.64, "t": 247.68, "r": 568.8, "b": 223.92 }, "text": "Total Runoff Area = 2.340 ac Runoff Volume = 1.158 af Average Runoff Depth = 5.94\"\n35.04% Pervious = 0.820 ac 64.96% Impervious = 1.520 ac", "reading_order": 17 }, { "id": "p111.19", "order": 19, "type": "footer", "bbox": { "l": 51.36, "t": 738.96, "r": 561.36, "b": 700.56 }, "text": "POST DEV NOAA 24-hr D 100 YEAR Rainfall=9.48\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 75", "attrs": { "block_label": "footer" }, "reading_order": 18 } ] }, { "document_id": 11809, "page": 112, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 46, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "heading": 1, "table": 1, "table_cell": 38, "text": 3 }, "build_ms": 4, "items": [ { "id": "p112.1", "order": 1, "type": "header", "bbox": { "l": 52.56, "t": 738.48, "r": 560.88, "b": 698.88 }, "text": "POST DEV NOAA 24-hr D 100 YEAR Rainfall=9.48\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 76", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p112.2", "order": 2, "type": "heading", "bbox": { "l": 183.6, "t": 687.36, "r": 434.64, "b": 672.72 }, "text": "Summary for Subcatchment 1S: POROUS", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p112.3", "order": 3, "type": "text", "bbox": { "l": 52.8, "t": 659.52, "r": 306.24, "b": 634.32 }, "text": "Runoff = 0.52 cfs @ 12.27 hrs, Volume=\nRouted to Pond 3P : SSIB #1 SURFACE BASIN\n0.075 af, Depth> 1.57\"", "reading_order": 2 }, { "id": "p112.4", "order": 4, "type": "text", "bbox": { "l": 345.12, "t": 659.76, "r": 463.44, "b": 647.04 }, "text": "0.075 af, Depth> 1.57\"", "reading_order": 3 }, { "id": "p112.5", "order": 5, "type": "text", "bbox": { "l": 52.32, "t": 624.24, "r": 541.44, "b": 598.8 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Weighted-CN, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs NOAA 24-hr D 100 YEAR Rainfall=9.48\"", "reading_order": 4 }, { "id": "p112.6", "order": 6, "type": "table", "bbox": { "l": 52.32, "t": 589.68, "r": 559.2, "b": 437.04 }, "text": "", "attrs": { "block_label": "table", "n_rows": 8, "n_cols": 7, "integrity": { "cells_checked": 30, "cells_flagged": 0 } }, "children": [ { "id": "p112.6.1", "order": 7, "type": "table_cell", "bbox": { "l": 69.659595, "t": 588.002283, "r": 113.82741, "b": 576.0151040000001 }, "text": "Area (ac)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p112.6.2", "order": 8, "type": "table_cell", "bbox": { "l": 130.796358, "t": 588.002283, "r": 146.30665, "b": 576.0151040000001 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p112.6.3", "order": 9, "type": "table_cell", "bbox": { "l": 289.05701, "t": 536.641352, "r": 342.773751, "b": 524.654172 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p112.6.4", "order": 10, "type": "table_cell", "bbox": { "l": 87, "t": 560.400886, "r": 113.874482, "b": 548.4137069999999 }, "text": "0.570", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 3 }, { "id": "p112.6.5", "order": 11, "type": "table_cell", "bbox": { "l": 134.275244, "t": 574.200786, "r": 146.219458, "b": 562.213607 }, "text": "39", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p112.6.6", "order": 12, "type": "table_cell", "bbox": { "l": 160.552515, "t": 574.200786, "r": 320.843443, "b": 562.213607 }, "text": ">75% Grass cover, Good, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true }, "reading_order": 5 }, { "id": "p112.6.7", "order": 13, "type": "table_cell", "bbox": { "l": 87, "t": 574.200786, "r": 113.874482, "b": 562.213607 }, "text": "0.570", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 6 }, { "id": "p112.6.8", "order": 14, "type": "table_cell", "bbox": { "l": 160.555738, "t": 560.400886, "r": 273.392044, "b": 548.4137069999999 }, "text": "100.00% Pervious Area", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 4, "bbox_refit": true }, "reading_order": 7 }, { "id": "p112.6.9", "order": 15, "type": "table_cell", "bbox": { "l": 65.459598, "t": 536.641352, "r": 89.993572, "b": 512.774405 }, "text": "Tc\\n(min)", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p112.6.10", "order": 16, "type": "table_cell", "bbox": { "l": 100.682141, "t": 536.641352, "r": 133.545916, "b": 512.774405 }, "text": "Length\\n(feet)", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p112.6.11", "order": 17, "type": "table_cell", "bbox": { "l": 149.815612, "t": 536.641352, "r": 177.28086, "b": 512.774405 }, "text": "Slope\\n(ft/ft)", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p112.6.12", "order": 18, "type": "table_cell", "bbox": { "l": 188.028505, "t": 536.641352, "r": 225.633446, "b": 512.774405 }, "text": "Velocity\\n(ft/sec)", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 }, { "id": "p112.6.13", "order": 19, "type": "table_cell", "bbox": { "l": 236.50354, "t": 536.641352, "r": 278.288957, "b": 512.774405 }, "text": "Capacity\\n(cfs)", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 12 }, { "id": "p112.6.14", "order": 20, "type": "table_cell", "bbox": { "l": 160.552704, "t": 588.002283, "r": 214.269445, "b": 576.0151040000001 }, "text": "Description", "attrs": { "row": 3, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 13 }, { "id": "p112.6.15", "order": 21, "type": "table_cell", "bbox": { "l": 69, "t": 510.960886, "r": 89.902375, "b": 498.973707 }, "text": "11.7", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p112.6.16", "order": 22, "type": "table_cell", "bbox": { "l": 115.676959, "t": 510.960886, "r": 133.59328, "b": 498.973707 }, "text": "100", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p112.6.17", "order": 23, "type": "table_cell", "bbox": { "l": 144.351666, "t": 510.960886, "r": 177.198256, "b": 498.973707 }, "text": "0.0300", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p112.6.18", "order": 24, "type": "table_cell", "bbox": { "l": 204.705395, "t": 510.960886, "r": 225.60777, "b": 498.973707 }, "text": "0.14", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p112.6.19", "order": 25, "type": "table_cell", "bbox": { "l": 341.9657, "t": 513.36, "r": 414.3771, "b": 494.28 }, "text": "", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 18 }, { "id": "p112.6.20", "order": 26, "type": "table_cell", "bbox": { "l": 289.079669, "t": 510.780434, "r": 461.873354, "b": 463.332257 }, "text": "Sheet Flow,\\nGrass: Dense n= 0.240 P2= 3.42\"\\nShallow Concentrated Flow,\\nGrassed Waterway Kv= 15.0 fps", "attrs": { "row": 4, "col": 5, "rowspan": 2, "colspan": 2, "bbox_refit": true }, "reading_order": 19 }, { "id": "p112.6.21", "order": 27, "type": "table_cell", "bbox": { "l": 75.000034, "t": 487.200277, "r": 89.930302, "b": 475.213098 }, "text": "0.3", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p112.6.22", "order": 28, "type": "table_cell", "bbox": { "l": 121.678067, "t": 487.200277, "r": 133.622282, "b": 475.213098 }, "text": "50", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p112.6.23", "order": 29, "type": "table_cell", "bbox": { "l": 144.354889, "t": 487.200277, "r": 177.201478, "b": 475.213098 }, "text": "0.0350", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 22 }, { "id": "p112.6.24", "order": 30, "type": "table_cell", "bbox": { "l": 204.708617, "t": 487.200277, "r": 225.610992, "b": 475.213098 }, "text": "2.81", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 23 }, { "id": "p112.6.25", "order": 31, "type": "table_cell", "bbox": { "l": 341.9657, "t": 494.28, "r": 414.3771, "b": 475.2 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 24 }, { "id": "p112.6.26", "order": 32, "type": "table_cell", "bbox": { "l": 75.000034, "t": 463.439669, "r": 89.930302, "b": 451.45249 }, "text": "0.9", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 25 }, { "id": "p112.6.27", "order": 33, "type": "table_cell", "bbox": { "l": 115.679107, "t": 463.439669, "r": 133.595429, "b": 451.45249 }, "text": "160", "attrs": { "row": 6, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 26 }, { "id": "p112.6.28", "order": 34, "type": "table_cell", "bbox": { "l": 197.1429, "t": 475.2, "r": 269.5543, "b": 456.12 }, "text": "", "attrs": { "row": 6, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 27 }, { "id": "p112.6.29", "order": 35, "type": "table_cell", "bbox": { "l": 204.713988, "t": 463.439669, "r": 225.616363, "b": 451.45249 }, "text": "3.00", "attrs": { "row": 6, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 28 }, { "id": "p112.6.30", "order": 36, "type": "table_cell", "bbox": { "l": 341.9657, "t": 475.2, "r": 414.3771, "b": 456.12 }, "text": "", "attrs": { "row": 6, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 29 }, { "id": "p112.6.31", "order": 37, "type": "table_cell", "bbox": { "l": 289.079669, "t": 463.259217, "r": 415.020239, "b": 451.272038 }, "text": "Direct Entry, PIPE FLOW", "attrs": { "row": 6, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 30 }, { "id": "p112.6.32", "order": 38, "type": "table_cell", "bbox": { "l": 69, "t": 449.640786, "r": 89.902375, "b": 437.653607 }, "text": "12.9", "attrs": { "row": 7, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 31 }, { "id": "p112.6.33", "order": 39, "type": "table_cell", "bbox": { "l": 115.676959, "t": 449.640786, "r": 133.59328, "b": 437.653607 }, "text": "310", "attrs": { "row": 7, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 32 }, { "id": "p112.6.34", "order": 40, "type": "table_cell", "bbox": { "l": 144.351666, "t": 449.640786, "r": 168.229354, "b": 437.653607 }, "text": "Total", "attrs": { "row": 7, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 33 }, { "id": "p112.6.35", "order": 41, "type": "table_cell", "bbox": { "l": 269.5543, "t": 456.12, "r": 341.9657, "b": 437.04 }, "text": "", "attrs": { "row": 7, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 34 }, { "id": "p112.6.36", "order": 42, "type": "table_cell", "bbox": { "l": 341.9657, "t": 456.12, "r": 414.3771, "b": 437.04 }, "text": "", "attrs": { "row": 7, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 35 }, { "id": "p112.6.37", "order": 43, "type": "table_cell", "bbox": { "l": 414.3771, "t": 456.12, "r": 486.7886, "b": 437.04 }, "text": "", "attrs": { "row": 7, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 36 }, { "id": "p112.6.38", "order": 44, "type": "table_cell", "bbox": { "l": 486.7886, "t": 456.12, "r": 559.2, "b": 437.04 }, "text": "", "attrs": { "row": 7, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 37 } ], "reading_order": 5 }, { "id": "p112.7", "order": 45, "type": "caption", "bbox": { "l": 222.48, "t": 425.28, "r": 393.36, "b": 410.64 }, "text": "Subcatchment 1S: POROUS", "attrs": { "block_label": "figure_title" }, "reading_order": 6 }, { "id": "p112.8", "order": 46, "type": "figure", "bbox": { "l": 62.4, "t": 408, "r": 553.68, "b": 137.52 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nRunoff\n0.55 0.52 cfs\n0.5 NOAA 24-hr D\n0.45 100 YEAR Rainfall=9.48\"\n0.4 Runoff Area=0.570 ac\n0.35 Runoff Volume=0.075 af\n(cfs) 0.3 Runoff Depth>1.57\"\nFlow 0.25 Flow Length=310'\n0.2 Tc=12.9 min\n0.15 CN=39\n0.1\n0.05\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 7 } ] }, { "document_id": 11809, "page": 113, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 46, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "heading": 1, "table": 1, "table_cell": 38, "text": 3 }, "build_ms": 4, "items": [ { "id": "p113.1", "order": 1, "type": "header", "bbox": { "l": 52.56, "t": 738.48, "r": 560.64, "b": 698.88 }, "text": "POST DEV NOAA 24-hr D 100 YEAR Rainfall=9.48\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 77", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p113.2", "order": 2, "type": "heading", "bbox": { "l": 171.84, "t": 687.6, "r": 447.36, "b": 672.72 }, "text": "Summary for Subcatchment 2S: IMPERVIOUS", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p113.3", "order": 3, "type": "text", "bbox": { "l": 53.04, "t": 660, "r": 306.48, "b": 634.56 }, "text": "Runoff = 3.82 cfs @ 12.22 hrs, Volume=\nRouted to Pond 3P : SSIB #1 SURFACE BASIN\n0.498 af, Depth> 8.29\"", "reading_order": 2 }, { "id": "p113.4", "order": 4, "type": "text", "bbox": { "l": 344.88, "t": 659.76, "r": 463.92, "b": 646.8 }, "text": "0.498 af, Depth> 8.29\"", "reading_order": 3 }, { "id": "p113.5", "order": 5, "type": "text", "bbox": { "l": 52.08, "t": 624.24, "r": 541.44, "b": 598.56 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Weighted-CN, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs NOAA 24-hr D 100 YEAR Rainfall=9.48\"", "reading_order": 4 }, { "id": "p113.6", "order": 6, "type": "table", "bbox": { "l": 52.32, "t": 589.92, "r": 559.2, "b": 436.56 }, "text": "", "attrs": { "block_label": "table", "n_rows": 8, "n_cols": 7, "integrity": { "cells_checked": 30, "cells_flagged": 0 } }, "children": [ { "id": "p113.6.1", "order": 7, "type": "table_cell", "bbox": { "l": 69.659595, "t": 588.002283, "r": 113.82741, "b": 576.0151040000001 }, "text": "Area (ac)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p113.6.2", "order": 8, "type": "table_cell", "bbox": { "l": 130.796358, "t": 588.002283, "r": 146.30665, "b": 576.0151040000001 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p113.6.3", "order": 9, "type": "table_cell", "bbox": { "l": 289.05701, "t": 536.641352, "r": 342.773751, "b": 524.654172 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p113.6.4", "order": 10, "type": "table_cell", "bbox": { "l": 87, "t": 560.400886, "r": 113.874482, "b": 548.4137069999999 }, "text": "0.720", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 3 }, { "id": "p113.6.5", "order": 11, "type": "table_cell", "bbox": { "l": 134.275244, "t": 574.200786, "r": 146.219458, "b": 562.213607 }, "text": "98", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p113.6.6", "order": 12, "type": "table_cell", "bbox": { "l": 160.552515, "t": 574.200786, "r": 268.608987, "b": 562.213607 }, "text": "Paved parking, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true }, "reading_order": 5 }, { "id": "p113.6.7", "order": 13, "type": "table_cell", "bbox": { "l": 87, "t": 574.200786, "r": 113.874482, "b": 562.213607 }, "text": "0.720", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 6 }, { "id": "p113.6.8", "order": 14, "type": "table_cell", "bbox": { "l": 160.555738, "t": 560.400886, "r": 284.133244, "b": 548.4137069999999 }, "text": "100.00% Impervious Area", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 4, "bbox_refit": true }, "reading_order": 7 }, { "id": "p113.6.9", "order": 15, "type": "table_cell", "bbox": { "l": 65.459598, "t": 536.641352, "r": 89.993572, "b": 512.774405 }, "text": "Tc\\n(min)", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p113.6.10", "order": 16, "type": "table_cell", "bbox": { "l": 100.682141, "t": 536.641352, "r": 133.545916, "b": 512.774405 }, "text": "Length\\n(feet)", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p113.6.11", "order": 17, "type": "table_cell", "bbox": { "l": 149.815612, "t": 536.641352, "r": 177.28086, "b": 512.774405 }, "text": "Slope\\n(ft/ft)", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p113.6.12", "order": 18, "type": "table_cell", "bbox": { "l": 188.028505, "t": 536.641352, "r": 225.633446, "b": 512.774405 }, "text": "Velocity\\n(ft/sec)", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 }, { "id": "p113.6.13", "order": 19, "type": "table_cell", "bbox": { "l": 236.50354, "t": 536.641352, "r": 278.288957, "b": 512.774405 }, "text": "Capacity\\n(cfs)", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 12 }, { "id": "p113.6.14", "order": 20, "type": "table_cell", "bbox": { "l": 160.552704, "t": 588.002283, "r": 214.269445, "b": 576.0151040000001 }, "text": "Description", "attrs": { "row": 3, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 13 }, { "id": "p113.6.15", "order": 21, "type": "table_cell", "bbox": { "l": 69, "t": 510.960886, "r": 89.902375, "b": 498.973707 }, "text": "11.7", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p113.6.16", "order": 22, "type": "table_cell", "bbox": { "l": 115.676959, "t": 510.960886, "r": 133.59328, "b": 498.973707 }, "text": "100", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p113.6.17", "order": 23, "type": "table_cell", "bbox": { "l": 144.351666, "t": 510.960886, "r": 177.198256, "b": 498.973707 }, "text": "0.0300", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p113.6.18", "order": 24, "type": "table_cell", "bbox": { "l": 204.705395, "t": 510.960886, "r": 225.60777, "b": 498.973707 }, "text": "0.14", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p113.6.19", "order": 25, "type": "table_cell", "bbox": { "l": 341.9657, "t": 513.24, "r": 414.3771, "b": 494.07 }, "text": "", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 18 }, { "id": "p113.6.20", "order": 26, "type": "table_cell", "bbox": { "l": 289.079669, "t": 510.780434, "r": 461.873354, "b": 463.332257 }, "text": "Sheet Flow,\\nGrass: Dense n= 0.240 P2= 3.42\"\\nShallow Concentrated Flow,\\nGrassed Waterway Kv= 15.0 fps", "attrs": { "row": 4, "col": 5, "rowspan": 2, "colspan": 2, "bbox_refit": true }, "reading_order": 19 }, { "id": "p113.6.21", "order": 27, "type": "table_cell", "bbox": { "l": 75.000034, "t": 487.200277, "r": 89.930302, "b": 475.213098 }, "text": "0.5", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p113.6.22", "order": 28, "type": "table_cell", "bbox": { "l": 121.678067, "t": 487.200277, "r": 133.622282, "b": 475.213098 }, "text": "50", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p113.6.23", "order": 29, "type": "table_cell", "bbox": { "l": 144.354889, "t": 487.200277, "r": 177.201478, "b": 475.213098 }, "text": "0.0110", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 22 }, { "id": "p113.6.24", "order": 30, "type": "table_cell", "bbox": { "l": 204.708617, "t": 487.200277, "r": 225.610992, "b": 475.213098 }, "text": "1.57", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 23 }, { "id": "p113.6.25", "order": 31, "type": "table_cell", "bbox": { "l": 341.9657, "t": 494.07, "r": 414.3771, "b": 474.9 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 24 }, { "id": "p113.6.26", "order": 32, "type": "table_cell", "bbox": { "l": 75.000034, "t": 463.439669, "r": 89.930302, "b": 451.45249 }, "text": "0.9", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 25 }, { "id": "p113.6.27", "order": 33, "type": "table_cell", "bbox": { "l": 115.679107, "t": 463.439669, "r": 133.595429, "b": 451.45249 }, "text": "160", "attrs": { "row": 6, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 26 }, { "id": "p113.6.28", "order": 34, "type": "table_cell", "bbox": { "l": 197.1429, "t": 474.9, "r": 269.5543, "b": 455.73 }, "text": "", "attrs": { "row": 6, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 27 }, { "id": "p113.6.29", "order": 35, "type": "table_cell", "bbox": { "l": 204.713988, "t": 463.439669, "r": 225.616363, "b": 451.45249 }, "text": "3.00", "attrs": { "row": 6, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 28 }, { "id": "p113.6.30", "order": 36, "type": "table_cell", "bbox": { "l": 341.9657, "t": 474.9, "r": 414.3771, "b": 455.73 }, "text": "", "attrs": { "row": 6, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 29 }, { "id": "p113.6.31", "order": 37, "type": "table_cell", "bbox": { "l": 289.079669, "t": 463.259217, "r": 415.020239, "b": 451.272038 }, "text": "Direct Entry, PIPE FLOW", "attrs": { "row": 6, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 30 }, { "id": "p113.6.32", "order": 38, "type": "table_cell", "bbox": { "l": 69, "t": 449.640786, "r": 89.902375, "b": 437.653607 }, "text": "13.1", "attrs": { "row": 7, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 31 }, { "id": "p113.6.33", "order": 39, "type": "table_cell", "bbox": { "l": 115.676959, "t": 449.640786, "r": 133.59328, "b": 437.653607 }, "text": "310", "attrs": { "row": 7, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 32 }, { "id": "p113.6.34", "order": 40, "type": "table_cell", "bbox": { "l": 144.351666, "t": 449.640786, "r": 168.229354, "b": 437.653607 }, "text": "Total", "attrs": { "row": 7, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 33 }, { "id": "p113.6.35", "order": 41, "type": "table_cell", "bbox": { "l": 269.5543, "t": 455.73, "r": 341.9657, "b": 436.56 }, "text": "", "attrs": { "row": 7, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 34 }, { "id": "p113.6.36", "order": 42, "type": "table_cell", "bbox": { "l": 341.9657, "t": 455.73, "r": 414.3771, "b": 436.56 }, "text": "", "attrs": { "row": 7, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 35 }, { "id": "p113.6.37", "order": 43, "type": "table_cell", "bbox": { "l": 414.3771, "t": 455.73, "r": 486.7886, "b": 436.56 }, "text": "", "attrs": { "row": 7, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 36 }, { "id": "p113.6.38", "order": 44, "type": "table_cell", "bbox": { "l": 486.7886, "t": 455.73, "r": 559.2, "b": 436.56 }, "text": "", "attrs": { "row": 7, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 37 } ], "reading_order": 5 }, { "id": "p113.7", "order": 45, "type": "caption", "bbox": { "l": 210.24, "t": 425.52, "r": 405.6, "b": 410.4 }, "text": "Subcatchment 2S: IMPERVIOUS", "attrs": { "block_label": "figure_title" }, "reading_order": 6 }, { "id": "p113.8", "order": 46, "type": "figure", "bbox": { "l": 61.44, "t": 410.16, "r": 553.44, "b": 136.8 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nRunoff\n4 3.82 cfs\nNOAA 24-hr D\n100 YEAR Rainfall=9.48\"\n3 Runoff Area=0.720 ac\nRunoff Volume=0.498 af\n(cfs) Runoff Depth>8.29\"\nFlow Flow Length=310'\n2\nTc=13.1 min\nCN=98\n1\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 7 } ] }, { "document_id": 11809, "page": 114, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 38, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "table": 1, "table_cell": 30, "text": 3, "title": 1 }, "build_ms": 3, "items": [ { "id": "p114.1", "order": 1, "type": "header", "bbox": { "l": 52.8, "t": 738.72, "r": 561.12, "b": 698.88 }, "text": "POST DEV NOAA 24-hr D 100 YEAR Rainfall=9.48\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 78", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p114.2", "order": 2, "type": "title", "bbox": { "l": 171.84, "t": 687.36, "r": 446.88, "b": 672.48 }, "text": "Summary for Subcatchment 5S: IMPERVIOUS", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p114.3", "order": 3, "type": "text", "bbox": { "l": 51.84, "t": 659.52, "r": 245.04, "b": 646.32 }, "text": "[49] Hint: Tc<2dt may require smaller dt", "reading_order": 2 }, { "id": "p114.4", "order": 4, "type": "text", "bbox": { "l": 52.08, "t": 636.48, "r": 463.44, "b": 610.8 }, "text": "Runoff = 2.61 cfs @ 12.08 hrs, Volume= 0.187 af, Depth> 8.30\"\nRouted to Pond 8P : SSIB #2 UNDERGROUND", "reading_order": 3 }, { "id": "p114.5", "order": 5, "type": "text", "bbox": { "l": 52.08, "t": 600.72, "r": 541.68, "b": 574.8 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Weighted-CN, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs NOAA 24-hr D 100 YEAR Rainfall=9.48\"", "reading_order": 4 }, { "id": "p114.6", "order": 6, "type": "table", "bbox": { "l": 52.56, "t": 565.44, "r": 559.44, "b": 437.04 }, "text": "", "attrs": { "block_label": "table", "n_rows": 6, "n_cols": 6, "integrity": { "cells_checked": 24, "cells_flagged": 0 } }, "children": [ { "id": "p114.6.1", "order": 7, "type": "table_cell", "bbox": { "l": 69.659595, "t": 564.242748, "r": 113.82741, "b": 552.255569 }, "text": "Area (ac)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p114.6.2", "order": 8, "type": "table_cell", "bbox": { "l": 130.796358, "t": 564.242748, "r": 146.30665, "b": 552.255569 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p114.6.3", "order": 9, "type": "table_cell", "bbox": { "l": 289.05701, "t": 512.881252, "r": 342.773751, "b": 500.894072 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p114.6.4", "order": 10, "type": "table_cell", "bbox": { "l": 87, "t": 550.440786, "r": 113.874482, "b": 524.653607 }, "text": "0.270\n0.270", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p114.6.5", "order": 11, "type": "table_cell", "bbox": { "l": 134.275244, "t": 550.440786, "r": 284.133244, "b": 524.653607 }, "text": "98\n100.00% Impervious Area", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p114.6.6", "order": 12, "type": "table_cell", "bbox": { "l": 160.552515, "t": 550.440786, "r": 228.007251, "b": 538.453607 }, "text": "Roofs, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true }, "reading_order": 5 }, { "id": "p114.6.7", "order": 13, "type": "table_cell", "bbox": { "l": 65.459598, "t": 512.881252, "r": 89.993572, "b": 489.014305 }, "text": "Tc (min)", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p114.6.8", "order": 14, "type": "table_cell", "bbox": { "l": 100.682141, "t": 512.881252, "r": 133.545916, "b": 489.014305 }, "text": "Length (feet)", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p114.6.9", "order": 15, "type": "table_cell", "bbox": { "l": 149.815612, "t": 512.881252, "r": 177.28086, "b": 489.014305 }, "text": "Slope (ft/ft)", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p114.6.10", "order": 16, "type": "table_cell", "bbox": { "l": 188.028505, "t": 512.881252, "r": 225.633446, "b": 489.014305 }, "text": "Velocity (ft/sec)", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p114.6.11", "order": 17, "type": "table_cell", "bbox": { "l": 236.50354, "t": 512.881252, "r": 278.288957, "b": 489.014305 }, "text": "Capacity (cfs)", "attrs": { "row": 2, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p114.6.12", "order": 18, "type": "table_cell", "bbox": { "l": 160.552704, "t": 564.242748, "r": 214.269445, "b": 552.255569 }, "text": "Description", "attrs": { "row": 2, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 }, { "id": "p114.6.13", "order": 19, "type": "table_cell", "bbox": { "l": 75, "t": 487.200786, "r": 89.930268, "b": 475.213607 }, "text": "0.9", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 12 }, { "id": "p114.6.14", "order": 20, "type": "table_cell", "bbox": { "l": 121.678033, "t": 487.200786, "r": 133.622247, "b": 475.213607 }, "text": "50", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p114.6.15", "order": 21, "type": "table_cell", "bbox": { "l": 144.354854, "t": 487.200786, "r": 177.201444, "b": 475.213607 }, "text": "0.0100", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p114.6.16", "order": 22, "type": "table_cell", "bbox": { "l": 204.708583, "t": 487.200786, "r": 225.610958, "b": 475.213607 }, "text": "0.94", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p114.6.17", "order": 23, "type": "table_cell", "bbox": { "l": 390.48, "t": 492.0686, "r": 474.96, "b": 473.7257 }, "text": "", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 16 }, { "id": "p114.6.18", "order": 24, "type": "table_cell", "bbox": { "l": 289.079635, "t": 487.020334, "r": 476.803587, "b": 463.332765 }, "text": "Sheet Flow, Smooth surfaces n= 0.011 P2= 3.42\"", "attrs": { "row": 3, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p114.6.19", "order": 25, "type": "table_cell", "bbox": { "l": 75, "t": 463.440177, "r": 89.930268, "b": 451.452998 }, "text": "0.7", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p114.6.20", "order": 26, "type": "table_cell", "bbox": { "l": 115.679073, "t": 463.440177, "r": 133.595394, "b": 451.452998 }, "text": "130", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p114.6.21", "order": 27, "type": "table_cell", "bbox": { "l": 221.52, "t": 473.7257, "r": 306, "b": 455.3829 }, "text": "", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 20 }, { "id": "p114.6.22", "order": 28, "type": "table_cell", "bbox": { "l": 204.713954, "t": 463.440177, "r": 225.616329, "b": 451.452998 }, "text": "3.00", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p114.6.23", "order": 29, "type": "table_cell", "bbox": { "l": 390.48, "t": 473.7257, "r": 474.96, "b": 455.3829 }, "text": "", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 22 }, { "id": "p114.6.24", "order": 30, "type": "table_cell", "bbox": { "l": 289.079635, "t": 463.259725, "r": 415.020205, "b": 451.272546 }, "text": "Direct Entry, PIPE FLOW", "attrs": { "row": 4, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 23 }, { "id": "p114.6.25", "order": 31, "type": "table_cell", "bbox": { "l": 75, "t": 449.640786, "r": 89.930268, "b": 437.653607 }, "text": "1.6", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 24 }, { "id": "p114.6.26", "order": 32, "type": "table_cell", "bbox": { "l": 115.679073, "t": 449.640786, "r": 133.595394, "b": 437.653607 }, "text": "180", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 25 }, { "id": "p114.6.27", "order": 33, "type": "table_cell", "bbox": { "l": 144.35378, "t": 449.640786, "r": 168.231468, "b": 437.653607 }, "text": "Total", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 26 }, { "id": "p114.6.28", "order": 34, "type": "table_cell", "bbox": { "l": 306, "t": 455.3829, "r": 390.48, "b": 437.04 }, "text": "", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 27 }, { "id": "p114.6.29", "order": 35, "type": "table_cell", "bbox": { "l": 390.48, "t": 455.3829, "r": 474.96, "b": 437.04 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 28 }, { "id": "p114.6.30", "order": 36, "type": "table_cell", "bbox": { "l": 474.96, "t": 455.3829, "r": 559.44, "b": 437.04 }, "text": "", "attrs": { "row": 5, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 29 } ], "reading_order": 5 }, { "id": "p114.7", "order": 37, "type": "caption", "bbox": { "l": 210.48, "t": 425.52, "r": 405.6, "b": 410.64 }, "text": "Subcatchment 5S: IMPERVIOUS", "attrs": { "block_label": "figure_title" }, "reading_order": 6 }, { "id": "p114.8", "order": 38, "type": "figure", "bbox": { "l": 60.48, "t": 412.32, "r": 553.68, "b": 136.56 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nRunoff\n2.61 cfs\nNOAA 24-hr D\n100 YEAR Rainfall=9.48\"\n2 Runoff Area=0.270 ac\nRunoff Volume=0.187 af\n(cfs) Runoff Depth>8.30\"\nFlow Flow Length=180'\n1 Slope=0.0100 '/'\nTc=1.6 min\nCN=98\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 7 } ] }, { "document_id": 11809, "page": 115, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 42, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "heading": 1, "table": 1, "table_cell": 35, "text": 2 }, "build_ms": 5, "items": [ { "id": "p115.1", "order": 1, "type": "header", "bbox": { "l": 52.56, "t": 738.24, "r": 560.64, "b": 698.88 }, "text": "POST DEV NOAA 24-hr D 100 YEAR Rainfall=9.48\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 79", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p115.2", "order": 2, "type": "heading", "bbox": { "l": 183.6, "t": 687.36, "r": 434.64, "b": 672.72 }, "text": "Summary for Subcatchment 6S: POROUS", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p115.3", "order": 3, "type": "text", "bbox": { "l": 52.56, "t": 660, "r": 464.16, "b": 634.32 }, "text": "Runoff = 0.18 cfs @ 12.27 hrs, Volume= 0.025 af, Depth> 1.57\"\nRouted to Pond 8P : SSIB #2 UNDERGROUND", "reading_order": 2 }, { "id": "p115.4", "order": 4, "type": "text", "bbox": { "l": 52.08, "t": 624.24, "r": 541.44, "b": 598.8 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Weighted-CN, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs NOAA 24-hr D 100 YEAR Rainfall=9.48\"", "reading_order": 3 }, { "id": "p115.5", "order": 5, "type": "table", "bbox": { "l": 52.32, "t": 589.92, "r": 559.2, "b": 449.533607 }, "text": "", "attrs": { "block_label": "table", "n_rows": 7, "n_cols": 7, "integrity": { "cells_checked": 26, "cells_flagged": 0 } }, "children": [ { "id": "p115.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 69.659595, "t": 588.002283, "r": 113.82741, "b": 576.0151040000001 }, "text": "Area (ac)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p115.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 130.796358, "t": 588.002283, "r": 146.30665, "b": 576.0151040000001 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p115.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 289.05701, "t": 536.641352, "r": 342.773751, "b": 524.654172 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p115.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 52.32, "t": 570.2057, "r": 124.7314, "b": 550.4914 }, "text": "", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 3 }, { "id": "p115.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 87, "t": 560.400886, "r": 113.874482, "b": 548.4137069999999 }, "text": "0.190", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p115.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 134.275244, "t": 574.200786, "r": 146.219458, "b": 562.213607 }, "text": "39", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p115.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 160.552515, "t": 574.200786, "r": 320.843443, "b": 562.213607 }, "text": ">75% Grass cover, Good, HSG A", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 4, "bbox_refit": true }, "reading_order": 6 }, { "id": "p115.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 52.32, "t": 550.4914, "r": 124.7314, "b": 530.7771 }, "text": "", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 7 }, { "id": "p115.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 87, "t": 574.200786, "r": 113.874482, "b": 562.213607 }, "text": "0.190", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p115.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 197.1429, "t": 550.4914, "r": 269.5543, "b": 530.7771 }, "text": "", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 9 }, { "id": "p115.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 160.555738, "t": 560.400886, "r": 273.392044, "b": 548.4137069999999 }, "text": "100.00% Pervious Area", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 4, "bbox_refit": true }, "reading_order": 10 }, { "id": "p115.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 65.459598, "t": 536.641352, "r": 89.993572, "b": 512.774405 }, "text": "Tc (min)", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 }, { "id": "p115.5.13", "order": 18, "type": "table_cell", "bbox": { "l": 100.682141, "t": 536.641352, "r": 133.545916, "b": 512.774405 }, "text": "Length (feet)", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 12 }, { "id": "p115.5.14", "order": 19, "type": "table_cell", "bbox": { "l": 149.815612, "t": 536.641352, "r": 177.28086, "b": 512.774405 }, "text": "Slope (ft/ft)", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p115.5.15", "order": 20, "type": "table_cell", "bbox": { "l": 188.028505, "t": 536.641352, "r": 225.633446, "b": 512.774405 }, "text": "Velocity (ft/sec)", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p115.5.16", "order": 21, "type": "table_cell", "bbox": { "l": 236.50354, "t": 536.641352, "r": 278.288957, "b": 512.774405 }, "text": "Capacity (cfs)", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p115.5.17", "order": 22, "type": "table_cell", "bbox": { "l": 160.552704, "t": 588.002283, "r": 214.269445, "b": 576.0151040000001 }, "text": "Description", "attrs": { "row": 3, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 16 }, { "id": "p115.5.18", "order": 23, "type": "table_cell", "bbox": { "l": 69, "t": 510.960886, "r": 89.902375, "b": 498.973707 }, "text": "11.3", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p115.5.19", "order": 24, "type": "table_cell", "bbox": { "l": 121.676993, "t": 510.960886, "r": 133.621207, "b": 498.973707 }, "text": "90", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p115.5.20", "order": 25, "type": "table_cell", "bbox": { "l": 144.353814, "t": 510.960886, "r": 177.200404, "b": 498.973707 }, "text": "0.0270", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p115.5.21", "order": 26, "type": "table_cell", "bbox": { "l": 204.707543, "t": 510.960886, "r": 225.609918, "b": 498.973707 }, "text": "0.13", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p115.5.22", "order": 27, "type": "table_cell", "bbox": { "l": 341.9657, "t": 511.0629, "r": 414.3771, "b": 491.3486 }, "text": "", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 21 }, { "id": "p115.5.23", "order": 28, "type": "table_cell", "bbox": { "l": 289.079669, "t": 510.780434, "r": 461.873354, "b": 463.332257 }, "text": "Sheet Flow,\\nGrass: Dense n= 0.240 P2= 3.42\"\\nShallow Concentrated Flow,\\nPaved Kv= 20.3 fps", "attrs": { "row": 4, "col": 5, "rowspan": 2, "colspan": 2, "bbox_refit": true }, "reading_order": 22 }, { "id": "p115.5.24", "order": 29, "type": "table_cell", "bbox": { "l": 75.000034, "t": 487.200277, "r": 89.930302, "b": 475.213098 }, "text": "1.1", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 23 }, { "id": "p115.5.25", "order": 30, "type": "table_cell", "bbox": { "l": 115.679107, "t": 487.200277, "r": 133.595429, "b": 475.213098 }, "text": "160", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 24 }, { "id": "p115.5.26", "order": 31, "type": "table_cell", "bbox": { "l": 144.353814, "t": 487.200277, "r": 177.200404, "b": 475.213098 }, "text": "0.0150", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 25 }, { "id": "p115.5.27", "order": 32, "type": "table_cell", "bbox": { "l": 204.707543, "t": 487.200277, "r": 225.609918, "b": 475.213098 }, "text": "2.49", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 26 }, { "id": "p115.5.28", "order": 33, "type": "table_cell", "bbox": { "l": 341.9657, "t": 491.3486, "r": 414.3771, "b": 471.6343 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 27 }, { "id": "p115.5.29", "order": 34, "type": "table_cell", "bbox": { "l": 69, "t": 461.520786, "r": 89.902375, "b": 449.533607 }, "text": "12.4", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 28 }, { "id": "p115.5.30", "order": 35, "type": "table_cell", "bbox": { "l": 115.676959, "t": 461.520786, "r": 133.59328, "b": 449.533607 }, "text": "250", "attrs": { "row": 6, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 29 }, { "id": "p115.5.31", "order": 36, "type": "table_cell", "bbox": { "l": 144.351666, "t": 461.520786, "r": 168.229354, "b": 449.533607 }, "text": "Total", "attrs": { "row": 6, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 30 }, { "id": "p115.5.32", "order": 37, "type": "table_cell", "bbox": { "l": 269.5543, "t": 471.6343, "r": 341.9657, "b": 451.92 }, "text": "", "attrs": { "row": 6, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 31 }, { "id": "p115.5.33", "order": 38, "type": "table_cell", "bbox": { "l": 341.9657, "t": 471.6343, "r": 414.3771, "b": 451.92 }, "text": "", "attrs": { "row": 6, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 32 }, { "id": "p115.5.34", "order": 39, "type": "table_cell", "bbox": { "l": 414.3771, "t": 471.6343, "r": 486.7886, "b": 451.92 }, "text": "", "attrs": { "row": 6, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 33 }, { "id": "p115.5.35", "order": 40, "type": "table_cell", "bbox": { "l": 486.7886, "t": 471.6343, "r": 559.2, "b": 451.92 }, "text": "", "attrs": { "row": 6, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 34 } ], "reading_order": 4 }, { "id": "p115.6", "order": 41, "type": "caption", "bbox": { "l": 222.48, "t": 437.04, "r": 393.12, "b": 422.4 }, "text": "Subcatchment 6S: POROUS", "attrs": { "block_label": "figure_title" }, "reading_order": 5 }, { "id": "p115.7", "order": 42, "type": "figure", "bbox": { "l": 62.4, "t": 420, "r": 552.48, "b": 149.04 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nRunoff\n0.19\n0.18 cfs\n0.18\n0.17 NOAA 24-hr D\n100 YEAR Rainfall=9.48\"\n0.16\n0.15\n0.14 Runoff Area=0.190 ac\n0.13\n0.12 Runoff Volume=0.025 af\n(cfs) Runoff Depth>1.57\"\n0.11\n0.1\nFlow Flow Length=250'\n0.09\n0.08\n0.07 Tc=12.4 min\n0.05 CN=39\n0.06\n0.04\n0.03\n0.02\n0.01\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 6 } ] }, { "document_id": 11809, "page": 116, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 44, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "table": 1, "table_cell": 36, "text": 3, "title": 1 }, "build_ms": 4, "items": [ { "id": "p116.1", "order": 1, "type": "header", "bbox": { "l": 52.8, "t": 738.48, "r": 560.88, "b": 698.64 }, "text": "POST DEV NOAA 24-hr D 100 YEAR Rainfall=9.48\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 80", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p116.2", "order": 2, "type": "title", "bbox": { "l": 131.76, "t": 687.6, "r": 488.88, "b": 672.48 }, "text": "Summary for Subcatchment 8S: PROP WAREHOUSE BLDG", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p116.3", "order": 3, "type": "text", "bbox": { "l": 51.6, "t": 659.52, "r": 245.04, "b": 646.32 }, "text": "[49] Hint: Tc<2dt may require smaller dt", "reading_order": 2 }, { "id": "p116.4", "order": 4, "type": "text", "bbox": { "l": 51.84, "t": 636.72, "r": 463.68, "b": 610.56 }, "text": "Runoff = 4.15 cfs @ 12.10 hrs, Volume= 0.318 af, Depth> 8.30\"\nRouted to Pond 9P : SSIB #3 UNDERGROUND", "reading_order": 3 }, { "id": "p116.5", "order": 5, "type": "text", "bbox": { "l": 51.84, "t": 600.72, "r": 541.68, "b": 574.8 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Weighted-CN, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs NOAA 24-hr D 100 YEAR Rainfall=9.48\"", "reading_order": 4 }, { "id": "p116.6", "order": 6, "type": "table", "bbox": { "l": 52.56, "t": 566.4, "r": 558.96, "b": 413.52 }, "text": "", "attrs": { "block_label": "table", "n_rows": 7, "n_cols": 6, "integrity": { "cells_checked": 29, "cells_flagged": 0 } }, "children": [ { "id": "p116.6.1", "order": 7, "type": "table_cell", "bbox": { "l": 69.659595, "t": 564.242748, "r": 113.82741, "b": 552.255569 }, "text": "Area (ac)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p116.6.2", "order": 8, "type": "table_cell", "bbox": { "l": 130.796358, "t": 564.242748, "r": 146.30665, "b": 552.255569 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p116.6.3", "order": 9, "type": "table_cell", "bbox": { "l": 289.05701, "t": 512.881252, "r": 342.773751, "b": 500.894072 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p116.6.4", "order": 10, "type": "table_cell", "bbox": { "l": 87, "t": 550.440786, "r": 113.874482, "b": 524.653607 }, "text": "0.460\n0.460", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p116.6.5", "order": 11, "type": "table_cell", "bbox": { "l": 134.275244, "t": 550.440786, "r": 146.219458, "b": 538.453607 }, "text": "98", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p116.6.6", "order": 12, "type": "table_cell", "bbox": { "l": 160.552515, "t": 550.440786, "r": 284.133244, "b": 524.653607 }, "text": "Roofs, HSG A\n100.00% Impervious Area", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p116.6.7", "order": 13, "type": "table_cell", "bbox": { "l": 65.459598, "t": 512.881252, "r": 89.993572, "b": 489.014305 }, "text": "Tc (min)", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p116.6.8", "order": 14, "type": "table_cell", "bbox": { "l": 100.682141, "t": 512.881252, "r": 133.545916, "b": 489.014305 }, "text": "Length (feet)", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p116.6.9", "order": 15, "type": "table_cell", "bbox": { "l": 149.815612, "t": 512.881252, "r": 177.28086, "b": 489.014305 }, "text": "Slope (ft/ft)", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p116.6.10", "order": 16, "type": "table_cell", "bbox": { "l": 188.028505, "t": 512.881252, "r": 225.633446, "b": 489.014305 }, "text": "Velocity (ft/sec)", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p116.6.11", "order": 17, "type": "table_cell", "bbox": { "l": 236.50354, "t": 512.881252, "r": 278.288957, "b": 489.014305 }, "text": "Capacity (cfs)", "attrs": { "row": 2, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p116.6.12", "order": 18, "type": "table_cell", "bbox": { "l": 160.552704, "t": 564.242748, "r": 214.269445, "b": 552.255569 }, "text": "Description", "attrs": { "row": 2, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 }, { "id": "p116.6.13", "order": 19, "type": "table_cell", "bbox": { "l": 75, "t": 487.200786, "r": 89.930268, "b": 475.213607 }, "text": "1.5", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 12 }, { "id": "p116.6.14", "order": 20, "type": "table_cell", "bbox": { "l": 115.679073, "t": 487.200786, "r": 133.595394, "b": 475.213607 }, "text": "100", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p116.6.15", "order": 21, "type": "table_cell", "bbox": { "l": 144.35378, "t": 487.200786, "r": 177.20037, "b": 475.213607 }, "text": "0.0100", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p116.6.16", "order": 22, "type": "table_cell", "bbox": { "l": 204.707509, "t": 487.200786, "r": 225.609884, "b": 475.213607 }, "text": "1.08", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p116.6.17", "order": 23, "type": "table_cell", "bbox": { "l": 390.16, "t": 498.4533, "r": 474.56, "b": 481.4667 }, "text": "", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 16 }, { "id": "p116.6.18", "order": 24, "type": "table_cell", "bbox": { "l": 289.079635, "t": 487.020334, "r": 348.768483, "b": 475.033155 }, "text": "Sheet Flow,", "attrs": { "row": 3, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p116.6.19", "order": 25, "type": "table_cell", "bbox": { "l": 75, "t": 463.440177, "r": 89.930268, "b": 451.452998 }, "text": "0.3", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p116.6.20", "order": 26, "type": "table_cell", "bbox": { "l": 121.678033, "t": 463.440177, "r": 133.622247, "b": 451.452998 }, "text": "40", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p116.6.21", "order": 27, "type": "table_cell", "bbox": { "l": 144.354854, "t": 463.440177, "r": 177.201444, "b": 451.452998 }, "text": "0.0100", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p116.6.22", "order": 28, "type": "table_cell", "bbox": { "l": 204.708583, "t": 463.440177, "r": 225.610958, "b": 451.452998 }, "text": "2.03", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p116.6.23", "order": 29, "type": "table_cell", "bbox": { "l": 390.16, "t": 481.4667, "r": 474.56, "b": 464.48 }, "text": "", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 22 }, { "id": "p116.6.24", "order": 30, "type": "table_cell", "bbox": { "l": 289.079635, "t": 475.319945, "r": 476.803587, "b": 463.332765 }, "text": "Smooth surfaces\\nn= 0.011\\nP2= 3.42\"", "attrs": { "row": 4, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 23 }, { "id": "p116.6.25", "order": 31, "type": "table_cell", "bbox": { "l": 75, "t": 439.679569, "r": 89.930268, "b": 427.69239 }, "text": "0.8", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 24 }, { "id": "p116.6.26", "order": 32, "type": "table_cell", "bbox": { "l": 115.679073, "t": 439.679569, "r": 133.595394, "b": 427.69239 }, "text": "140", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 25 }, { "id": "p116.6.27", "order": 33, "type": "table_cell", "bbox": { "l": 221.36, "t": 464.48, "r": 305.76, "b": 447.4933 }, "text": "", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 26 }, { "id": "p116.6.28", "order": 34, "type": "table_cell", "bbox": { "l": 204.713954, "t": 439.679569, "r": 225.616329, "b": 427.69239 }, "text": "3.00", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 27 }, { "id": "p116.6.29", "order": 35, "type": "table_cell", "bbox": { "l": 390.16, "t": 464.48, "r": 474.56, "b": 447.4933 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 28 }, { "id": "p116.6.30", "order": 36, "type": "table_cell", "bbox": { "l": 289.079635, "t": 463.259725, "r": 432.324278, "b": 427.511938 }, "text": "Shallow Concentrated Flow,\\nPaved Kv= 20.3 fps\nDirect Entry, PIPE FLOW", "attrs": { "row": 5, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 29 }, { "id": "p116.6.31", "order": 37, "type": "table_cell", "bbox": { "l": 75, "t": 425.880786, "r": 89.930268, "b": 413.893607 }, "text": "2.6", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 30 }, { "id": "p116.6.32", "order": 38, "type": "table_cell", "bbox": { "l": 115.679073, "t": 425.880786, "r": 133.595394, "b": 413.893607 }, "text": "280", "attrs": { "row": 6, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 31 }, { "id": "p116.6.33", "order": 39, "type": "table_cell", "bbox": { "l": 144.35378, "t": 425.880786, "r": 168.231468, "b": 413.893607 }, "text": "Total", "attrs": { "row": 6, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 32 }, { "id": "p116.6.34", "order": 40, "type": "table_cell", "bbox": { "l": 305.76, "t": 430.5067, "r": 390.16, "b": 413.52 }, "text": "", "attrs": { "row": 6, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 33 }, { "id": "p116.6.35", "order": 41, "type": "table_cell", "bbox": { "l": 390.16, "t": 430.5067, "r": 474.56, "b": 413.52 }, "text": "", "attrs": { "row": 6, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 34 }, { "id": "p116.6.36", "order": 42, "type": "table_cell", "bbox": { "l": 474.56, "t": 430.5067, "r": 558.96, "b": 413.52 }, "text": "", "attrs": { "row": 6, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 35 } ], "reading_order": 5 }, { "id": "p116.7", "order": 43, "type": "caption", "bbox": { "l": 170.4, "t": 401.76, "r": 447.84, "b": 386.88 }, "text": "Subcatchment 8S: PROP WAREHOUSE BLDG", "attrs": { "block_label": "figure_title" }, "reading_order": 6 }, { "id": "p116.8", "order": 44, "type": "figure", "bbox": { "l": 61.2, "t": 380.16, "r": 553.68, "b": 113.52 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nRunoff\n4.15 cfs\n4 NOAA 24-hr D\n100 YEAR Rainfall=9.48\"\nRunoff Area=0.460 ac\n3\nRunoff Volume=0.318 af\n(cfs) Runoff Depth>8.30\"\nFlow 2 Flow Length=280'\nSlope=0.0100 '/'\nTc=2.6 min\nCN=98\n1\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 7 } ] }, { "document_id": 11809, "page": 117, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 17, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "table": 1, "table_cell": 9, "text": 3, "title": 1 }, "build_ms": 2, "items": [ { "id": "p117.1", "order": 1, "type": "header", "bbox": { "l": 52.8, "t": 738.48, "r": 560.88, "b": 698.64 }, "text": "POST DEV NOAA 24-hr D 100 YEAR Rainfall=9.48\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 81", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p117.2", "order": 2, "type": "title", "bbox": { "l": 151.44, "t": 687.6, "r": 468.24, "b": 672.48 }, "text": "Summary for Subcatchment 10S: BY-PASS POROUS", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p117.3", "order": 3, "type": "text", "bbox": { "l": 51.84, "t": 659.28, "r": 245.04, "b": 646.32 }, "text": "[49] Hint: Tc<2dt may require smaller dt", "reading_order": 2 }, { "id": "p117.4", "order": 4, "type": "text", "bbox": { "l": 52.08, "t": 636.48, "r": 463.68, "b": 610.56 }, "text": "Runoff = 0.12 cfs @ 12.10 hrs, Volume= 0.008 af, Depth> 1.59\"\nRouted to Reach 10 : COMPOSITE", "reading_order": 3 }, { "id": "p117.5", "order": 5, "type": "text", "bbox": { "l": 52.08, "t": 600.72, "r": 541.68, "b": 575.04 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Weighted-CN, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs NOAA 24-hr D 100 YEAR Rainfall=9.48\"", "reading_order": 4 }, { "id": "p117.6", "order": 6, "type": "table", "bbox": { "l": 53.04, "t": 565.2, "r": 559.2, "b": 474.96 }, "text": "", "attrs": { "block_label": "table", "n_rows": 3, "n_cols": 3, "integrity": { "cells_checked": 9, "cells_flagged": 0 } }, "children": [ { "id": "p117.6.1", "order": 7, "type": "table_cell", "bbox": { "l": 69.659595, "t": 564.242748, "r": 113.82741, "b": 552.255569 }, "text": "Area (ac)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p117.6.2", "order": 8, "type": "table_cell", "bbox": { "l": 130.796358, "t": 564.242748, "r": 146.30665, "b": 552.255569 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p117.6.3", "order": 9, "type": "table_cell", "bbox": { "l": 289.05701, "t": 512.881252, "r": 342.773751, "b": 500.894072 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p117.6.4", "order": 10, "type": "table_cell", "bbox": { "l": 87, "t": 550.440786, "r": 113.874482, "b": 524.653607 }, "text": "0.060\n0.060", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p117.6.5", "order": 11, "type": "table_cell", "bbox": { "l": 134.275244, "t": 550.440786, "r": 273.392044, "b": 524.653607 }, "text": "39\n100.00% Pervious Area", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p117.6.6", "order": 12, "type": "table_cell", "bbox": { "l": 160.552515, "t": 550.440786, "r": 320.843443, "b": 538.453607 }, "text": ">75% Grass cover, Good, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p117.6.7", "order": 13, "type": "table_cell", "bbox": { "l": 65.459598, "t": 512.881252, "r": 89.993572, "b": 475.213607 }, "text": "Tc (min)\n2.0", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p117.6.8", "order": 14, "type": "table_cell", "bbox": { "l": 100.682141, "t": 512.881252, "r": 352.94681, "b": 475.033155 }, "text": "Length (feet)\nDirect Entry,", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 7 }, { "id": "p117.6.9", "order": 15, "type": "table_cell", "bbox": { "l": 149.815612, "t": 512.881252, "r": 278.288957, "b": 489.014305 }, "text": "Slope (ft/ft) Velocity (ft/sec) Capacity (cfs)", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 } ], "reading_order": 5 }, { "id": "p117.7", "order": 16, "type": "caption", "bbox": { "l": 190.08, "t": 463.2, "r": 426.96, "b": 447.84 }, "text": "Subcatchment 10S: BY-PASS POROUS", "attrs": { "block_label": "figure_title" }, "reading_order": 6 }, { "id": "p117.8", "order": 17, "type": "figure", "bbox": { "l": 61.68, "t": 443.04, "r": 555.36, "b": 176.64 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n0.125 Runoff\n0.12 0.12 cfs\n0.11 NOAA 24-hr D\n0.115\n0.1 100 YEAR Rainfall=9.48\"\n0.105\n0.09 Runoff Area=0.060 ac\n0.095\n0.085\n0.08 Runoff Volume=0.008 af\n0.075\n(cfs) 0.07 Runoff Depth>1.59\"\n0.065\nFlow 0.055 Tc=2.0 min\n0.06\nCN=39\n0.05\n0.045\n0.04\n0.035\n0.03\n0.025\n0.02\n0.015\n0.01\n0.005\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 7 } ] }, { "document_id": 11809, "page": 118, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 24, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "table": 1, "table_cell": 16, "text": 3, "title": 1 }, "build_ms": 2, "items": [ { "id": "p118.1", "order": 1, "type": "header", "bbox": { "l": 52.8, "t": 738.96, "r": 559.92, "b": 699.12 }, "text": "POST DEV NOAA 24-hr D 100 YEAR Rainfall=9.48\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 82", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p118.2", "order": 2, "type": "title", "bbox": { "l": 139.68, "t": 687.6, "r": 480.72, "b": 672.48 }, "text": "Summary for Subcatchment 11S: BY-PASS IMPERVIOUS", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p118.3", "order": 3, "type": "text", "bbox": { "l": 51.84, "t": 659.52, "r": 245.04, "b": 646.32 }, "text": "[49] Hint: Tc<2dt may require smaller dt", "reading_order": 2 }, { "id": "p118.4", "order": 4, "type": "text", "bbox": { "l": 51.84, "t": 636.24, "r": 463.68, "b": 610.8 }, "text": "Runoff = 0.66 cfs @ 12.09 hrs, Volume= 0.048 af, Depth> 8.30\"\nRouted to Reach 10 : COMPOSITE", "reading_order": 3 }, { "id": "p118.5", "order": 5, "type": "text", "bbox": { "l": 52.08, "t": 600.72, "r": 541.68, "b": 575.04 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Weighted-CN, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs NOAA 24-hr D 100 YEAR Rainfall=9.48\"", "reading_order": 4 }, { "id": "p118.6", "order": 6, "type": "table", "bbox": { "l": 52.8, "t": 564.96, "r": 559.2, "b": 474.96 }, "text": "", "attrs": { "block_label": "table", "n_rows": 4, "n_cols": 4, "integrity": { "cells_checked": 13, "cells_flagged": 1, "flags": [ { "row": 2, "col": 2, "coverage": 0, "text": "Impervious Area" } ] } }, "children": [ { "id": "p118.6.1", "order": 7, "type": "table_cell", "bbox": { "l": 69.659595, "t": 564.242748, "r": 113.82741, "b": 552.255569 }, "text": "Area (ac)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p118.6.2", "order": 8, "type": "table_cell", "bbox": { "l": 130.796358, "t": 564.242748, "r": 146.30665, "b": 552.255569 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p118.6.3", "order": 9, "type": "table_cell", "bbox": { "l": 289.05701, "t": 512.881252, "r": 342.773751, "b": 500.894072 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p118.6.4", "order": 10, "type": "table_cell", "bbox": { "l": 432.6, "t": 564.96, "r": 559.2, "b": 546.96 }, "text": "", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 3 }, { "id": "p118.6.5", "order": 11, "type": "table_cell", "bbox": { "l": 87, "t": 550.440786, "r": 113.874482, "b": 538.453607 }, "text": "0.070", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p118.6.6", "order": 12, "type": "table_cell", "bbox": { "l": 134.275244, "t": 550.440786, "r": 146.219458, "b": 538.453607 }, "text": "98", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p118.6.7", "order": 13, "type": "table_cell", "bbox": { "l": 160.552515, "t": 550.440786, "r": 268.608987, "b": 538.453607 }, "text": "Paved parking, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p118.6.8", "order": 14, "type": "table_cell", "bbox": { "l": 432.6, "t": 546.96, "r": 559.2, "b": 528.96 }, "text": "", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 7 }, { "id": "p118.6.9", "order": 15, "type": "table_cell", "bbox": { "l": 87, "t": 536.6407859999999, "r": 113.874482, "b": 524.653607 }, "text": "0.070", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p118.6.10", "order": 16, "type": "table_cell", "bbox": { "l": 160.555738, "t": 536.6407859999999, "r": 202.951254, "b": 524.653607 }, "text": "100.00%", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p118.6.11", "order": 17, "type": "table_cell", "bbox": { "l": 306, "t": 528.96, "r": 432.6, "b": 510.96 }, "text": "Impervious Area", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 10 }, { "id": "p118.6.12", "order": 18, "type": "table_cell", "bbox": { "l": 432.6, "t": 528.96, "r": 559.2, "b": 510.96 }, "text": "", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 11 }, { "id": "p118.6.13", "order": 19, "type": "table_cell", "bbox": { "l": 65.459598, "t": 512.881252, "r": 352.94681, "b": 475.033155 }, "text": "Tc (min)\nDirect Entry,", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 12 }, { "id": "p118.6.14", "order": 20, "type": "table_cell", "bbox": { "l": 100.682141, "t": 512.881252, "r": 133.545916, "b": 489.014305 }, "text": "Length (feet)", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p118.6.15", "order": 21, "type": "table_cell", "bbox": { "l": 149.815612, "t": 512.881252, "r": 177.28086, "b": 489.014305 }, "text": "Slope (ft/ft)", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p118.6.16", "order": 22, "type": "table_cell", "bbox": { "l": 188.028505, "t": 512.881252, "r": 225.633446, "b": 489.014305 }, "text": "Velocity (ft/sec)", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 } ], "reading_order": 5 }, { "id": "p118.7", "order": 23, "type": "caption", "bbox": { "l": 178.32, "t": 463.2, "r": 439.92, "b": 447.84 }, "text": "Subcatchment 11S: BY-PASS IMPERVIOUS", "attrs": { "block_label": "figure_title" }, "reading_order": 6 }, { "id": "p118.8", "order": 24, "type": "figure", "bbox": { "l": 61.2, "t": 443.52, "r": 551.76, "b": 175.44 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nRunoff\n0.7 0.66 cfs\nNOAA 24-hr D\n0.65\n100 YEAR Rainfall=9.48\"\n0.6\n0.55\nRunoff Area=0.070 ac\n0.5\n0.45 Runoff Volume=0.048 af\n(cfs) 0.4 Runoff Depth>8.30\"\nFlow Tc=2.0 min\n0.35\nCN=98\n0.3\n0.25\n0.2\n0.15\n0.1\n0.05\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 7 } ] }, { "document_id": 11809, "page": 119, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 7, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "heading": 1, "text": 3 }, "build_ms": 0, "items": [ { "id": "p119.1", "order": 1, "type": "header", "bbox": { "l": 52.8, "t": 738.48, "r": 561.12, "b": 698.88 }, "text": "POST DEV NOAA 24-hr D 100 YEAR Rainfall=9.48\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 83", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p119.2", "order": 2, "type": "heading", "bbox": { "l": 198, "t": 687.36, "r": 419.52, "b": 672.48 }, "text": "Summary for Reach 10: COMPOSITE", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p119.3", "order": 3, "type": "text", "bbox": { "l": 52.08, "t": 659.52, "r": 250.8, "b": 646.08 }, "text": "[40] Hint: Not Described (Outflow=Inflow)", "reading_order": 2 }, { "id": "p119.4", "order": 4, "type": "text", "bbox": { "l": 52.32, "t": 636.48, "r": 518.4, "b": 598.32 }, "text": "Inflow Area = 2.340 ac, 64.96% Impervious, Inflow Depth > 2.98\" for 100 YEAR event\nInflow = 3.71 cfs @ 12.31 hrs, Volume= 0.581 af\nOutflow = 3.71 cfs @ 12.31 hrs, Volume= 0.581 af, Atten=0%, Lag=0.0 min", "reading_order": 3 }, { "id": "p119.5", "order": 5, "type": "text", "bbox": { "l": 52.08, "t": 588.48, "r": 420.96, "b": 574.8 }, "text": "Routing by Stor-Ind+Trans method, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs", "reading_order": 4 }, { "id": "p119.6", "order": 6, "type": "caption", "bbox": { "l": 236.88, "t": 563.76, "r": 378.48, "b": 548.64 }, "text": "Reach 10: COMPOSITE", "attrs": { "block_label": "figure_title" }, "reading_order": 5 }, { "id": "p119.7", "order": 7, "type": "figure", "bbox": { "l": 61.68, "t": 547.2, "r": 554.16, "b": 273.84 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nInflow\n4 3.71 cfs Outflow\n3.71 cfs\nInflow Area=2.340 ac\n3\n(cfs)\n2\nFlow\n1\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 6 } ] }, { "document_id": 11809, "page": 120, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 32, "counts_by_type": { "footnote": 2, "header": 1, "heading": 2, "table": 2, "table_cell": 24, "text": 1 }, "build_ms": 7, "items": [ { "id": "p120.1", "order": 1, "type": "header", "bbox": { "l": 53.04, "t": 738.72, "r": 560.64, "b": 698.4 }, "text": "POST DEV NOAA 24-hr D 100 YEAR Rainfall=9.48\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 84", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p120.2", "order": 2, "type": "heading", "bbox": { "l": 162.24, "t": 687.84, "r": 457.44, "b": 672.72 }, "text": "Summary for Pond 3P: SSIB #1 SURFACE BASIN", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p120.3", "order": 3, "type": "heading", "bbox": { "l": 52.32, "t": 659.52, "r": 301.44, "b": 645.84 }, "text": "[82] Warning: Early inflow requires earlier time span", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 2 }, { "id": "p120.4", "order": 4, "type": "text", "bbox": { "l": 51.6, "t": 642, "r": 550.08, "b": 488.88 }, "text": "Inflow Area = 1.290 ac, 55.81% Impervious, Inflow Depth > 5.32\" for 100 YEAR event\nInflow = 4.30 cfs @ 12.23 hrs, Volume= 0.572 af\nOutflow = 2.05 cfs @ 12.70 hrs, Volume= 0.486 af, Atten= 52%, Lag= 28.4 min\nDiscarded = 0.14 cfs @ 12.70 hrs, Volume= 0.101 af\nPrimary = 1.91 cfs @ 12.70 hrs, Volume= 0.385 af\n\nRouted to Reach 10: COMPOSITE\n\nRouting by Stor-Ind method, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs\nPeak Elev= 113.01' @ 12.70 hrs Surf.Area= 4,004 sf Storage= 8,676 cf\n\nPlug-Flow detention time= 108.1 min calculated for 0.486 af (85% of inflow)\nCenter-of-Mass det. time= 59.5 min (818.6 - 759.0)", "attrs": { "block_label": "algorithm" }, "reading_order": 3 }, { "id": "p120.5", "order": 5, "type": "table", "bbox": { "l": 52.32, "t": 481.084378, "r": 558.24, "b": 355.68 }, "text": "", "attrs": { "block_label": "table", "n_rows": 3, "n_cols": 5, "integrity": { "cells_checked": 12, "cells_flagged": 1, "flags": [ { "row": 1, "col": 3, "coverage": 0.33, "text": "Custom Stage Data (Prismatic)Listed below (Recalc)" } ] } }, "children": [ { "id": "p120.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 54, "t": 481.084378, "r": 90.412668, "b": 469.097199 }, "text": "Volume", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p120.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 123.533158, "t": 481.084378, "r": 150.396899, "b": 469.097199 }, "text": "Invert", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p120.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 173.452885, "t": 481.084378, "r": 237.330802, "b": 469.097199 }, "text": "Avail.Storage", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p120.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 249.465135, "t": 481.084378, "r": 343.783612, "b": 469.097199 }, "text": "Storage Description", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 2, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 3 }, { "id": "p120.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 66.12, "t": 467.280786, "r": 78.064214, "b": 455.293607 }, "text": "#1", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p120.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 115.437146, "t": 467.280786, "r": 150.335304, "b": 455.293607 }, "text": "110.00'", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p120.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 193.071317, "t": 467.280786, "r": 237.260614, "b": 455.293607 }, "text": "12,950 cf", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p120.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 355.872, "t": 465.3, "r": 558.24, "b": 449.64 }, "text": "Custom Stage Data (Prismatic)Listed below (Recalc)", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 2 }, "reading_order": 7 }, { "id": "p120.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 57.719307, "t": 443.521252, "r": 101.897863, "b": 358.334538 }, "text": "Elevation\\n(feet)\n110.00\n111.00\n112.00\n113.00\n114.00", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 8 }, { "id": "p120.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 142.191327, "t": 443.521252, "r": 187.562155, "b": 358.334538 }, "text": "Surf.Area\\n(sq-ft)\n2,000\n2,450\n3,200\n4,000\n4,600", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 9 }, { "id": "p120.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 230.21009, "t": 443.521252, "r": 358.898543, "b": 358.334538 }, "text": "Inc.Store\\n(cubic-feet)\n0\n2,225\n2,825\n3,600\n4,300", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 10 }, { "id": "p120.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 219.361478, "t": 443.521252, "r": 358.999511, "b": 358.334538 }, "text": "Cum.Store\\n(cubic-feet)\n0\n2,225\n5,050\n8,650\n12,950", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 11 } ], "reading_order": 4 }, { "id": "p120.6", "order": 18, "type": "table", "bbox": { "l": 51.36, "t": 347.04, "r": 455.28, "b": 259.2 }, "text": "", "attrs": { "block_label": "table", "n_rows": 3, "n_cols": 4, "integrity": { "cells_checked": 12, "cells_flagged": 0 } }, "children": [ { "id": "p120.6.1", "order": 19, "type": "table_cell", "bbox": { "l": 53.999914, "t": 346.562183, "r": 86.825021, "b": 320.773607 }, "text": "Device\n#1", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p120.6.2", "order": 20, "type": "table_cell", "bbox": { "l": 98.873425, "t": 346.562183, "r": 147.222394, "b": 320.773607 }, "text": "Routing\nDiscarded", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p120.6.3", "order": 21, "type": "table_cell", "bbox": { "l": 175.965845, "t": 346.562183, "r": 210.937439, "b": 320.773607 }, "text": "Invert\n110.00'", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p120.6.4", "order": 22, "type": "table_cell", "bbox": { "l": 223.01377, "t": 346.562183, "r": 453.384188, "b": 308.892765 }, "text": "Outlet Devices\n1.000 in/hr Exfiltration over Surface area\\nConductivity to Groundwater Elevation = 106.00'", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p120.6.5", "order": 23, "type": "table_cell", "bbox": { "l": 70.44, "t": 309.000177, "r": 82.384214, "b": 297.012998 }, "text": "#2", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p120.6.6", "order": 24, "type": "table_cell", "bbox": { "l": 98.876253, "t": 309.000177, "r": 135.868946, "b": 297.012998 }, "text": "Primary", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p120.6.7", "order": 25, "type": "table_cell", "bbox": { "l": 175.97229, "t": 309.000177, "r": 210.870449, "b": 297.012998 }, "text": "111.50'", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p120.6.8", "order": 26, "type": "table_cell", "bbox": { "l": 223.01982, "t": 309.000177, "r": 451.453995, "b": 285.133231 }, "text": "12.0\" W x 4.0\" H Vert. Orifice/Grate C= 0.600\\nLimited to weir flow at low heads", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p120.6.9", "order": 27, "type": "table_cell", "bbox": { "l": 70.44, "t": 285.240643, "r": 82.384214, "b": 273.253464 }, "text": "#3", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p120.6.10", "order": 28, "type": "table_cell", "bbox": { "l": 98.876253, "t": 285.240643, "r": 135.868946, "b": 273.253464 }, "text": "Primary", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p120.6.11", "order": 29, "type": "table_cell", "bbox": { "l": 175.97229, "t": 285.240643, "r": 210.870449, "b": 273.253464 }, "text": "113.00'", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p120.6.12", "order": 30, "type": "table_cell", "bbox": { "l": 223.01982, "t": 285.240643, "r": 439.81483, "b": 261.373697 }, "text": "24.0\" x 48.0\" Horiz. Orifice/Grate C= 0.600\\nLimited to weir flow at low heads", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 } ], "reading_order": 5 }, { "id": "p120.7", "order": 31, "type": "footnote", "bbox": { "l": 51.12, "t": 250.56, "r": 439.2, "b": 224.16 }, "text": "Discarded OutFlow Max=0.14 cfs @ 12.70 hrs HW=113.01' (Free Discharge)\n1=Exfiltration (Controls 0.14 cfs)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 6 }, { "id": "p120.8", "order": 32, "type": "footnote", "bbox": { "l": 51.6, "t": 214.56, "r": 426.96, "b": 177.12 }, "text": "Primary OutFlow Max=1.88 cfs @ 12.70 hrs HW=113.01' (Free Discharge)\n2=Orifice/Grate (Orifice Controls 1.86 cfs @ 5.57 fps)\n3=Orifice/Grate (Weir Controls 0.02 cfs @ 0.26 fps)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 7 } ] }, { "document_id": 11809, "page": 121, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 3, "counts_by_type": { "caption": 1, "figure": 1, "header": 1 }, "build_ms": 0, "items": [ { "id": "p121.1", "order": 1, "type": "header", "bbox": { "l": 52.56, "t": 738, "r": 562.08, "b": 698.88 }, "text": "POST DEV NOAA 24-hr D 100 YEAR Rainfall=9.48\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 85", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p121.2", "order": 2, "type": "caption", "bbox": { "l": 201.6, "t": 687.84, "r": 415.68, "b": 673.2 }, "text": "Pond 3P: SSIB #1 SURFACE BASIN", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p121.3", "order": 3, "type": "figure", "bbox": { "l": 62.4, "t": 671.52, "r": 552.24, "b": 399.12 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nInflow\n4.30 cfs Outflow\nInflow Area=1.290 ac Primary\nDiscarded\nPeak Elev=113.01'\nStorage=8,676 cf\n4\n3\n2.05 cfs\n(cfs)\nFlow 2 1.91 cfs\n1\n0.14 cfs\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 2 } ] }, { "document_id": 11809, "page": 122, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 11, "counts_by_type": { "caption": 1, "header": 1, "table": 1, "table_cell": 8 }, "build_ms": 19, "items": [ { "id": "p122.1", "order": 1, "type": "header", "bbox": { "l": 52.08, "t": 737.76, "r": 560.88, "b": 698.64 }, "text": "POST DEV NOAA 24-hr D 100 YEAR Rainfall=9.48\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 86", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p122.2", "order": 2, "type": "caption", "bbox": { "l": 152.88, "t": 687.6, "r": 467.52, "b": 672.72 }, "text": "Stage-Discharge for Pond 3P: SSIB #1 SURFACE BASIN", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p122.3", "order": 3, "type": "table", "bbox": { "l": 54.96, "t": 662.4, "r": 500.16, "b": 55.92 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 8, "integrity": { "cells_checked": 8, "cells_flagged": 0 } }, "children": [ { "id": "p122.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 57.3, "t": 661.21453, "r": 97.73433, "b": 59.66617199999996 }, "text": "Elevation (feet)\n110.00\n110.05\n110.10\n110.15\n110.20\n110.25\n110.30\n110.35\n110.40\n110.45\n110.50\n110.55\n110.60\n110.65\n110.70\n110.75\n110.80\n110.85\n110.90\n110.95\n111.00\n111.05\n111.10\n111.15\n111.20\n111.25\n111.30\n111.35\n111.40\n111.45\n111.50\n111.55\n111.60\n111.65\n111.70\n111.75\n111.80\n111.85\n111.90\n111.95\n112.00\n112.05\n112.10\n112.15\n112.20\n112.25\n112.30\n112.35\n112.40\n112.45\n112.50\n112.55\n112.60", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p122.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 109.260182, "t": 661.21453, "r": 153.49646, "b": 59.66617199999996 }, "text": "Discharge (cfs)\n0.00\n0.05\n0.05\n0.05\n0.05\n0.05\n0.05\n0.05\n0.06\n0.06\n0.06\n0.06\n0.06\n0.06\n0.06\n0.06\n0.06\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.08\n0.08\n0.08\n0.08\n0.08\n0.08\n0.09\n0.12\n0.19\n0.28\n0.38\n0.50\n0.62\n0.75\n0.86\n0.94\n1.02\n1.09\n1.16\n1.22\n1.28\n1.33\n1.39\n1.44\n1.49\n1.54\n1.58\n1.63\n1.67", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p122.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 165.000251, "t": 661.21453, "r": 209.236529, "b": 59.66617199999996 }, "text": "Discarded (cfs)\n0.00\n0.05\n0.05\n0.05\n0.05\n0.05\n0.05\n0.05\n0.06\n0.06\n0.06\n0.06\n0.06\n0.06\n0.06\n0.06\n0.06\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.08\n0.08\n0.08\n0.08\n0.08\n0.08\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.11\n0.11\n0.11\n0.11\n0.11\n0.11\n0.12\n0.12\n0.12\n0.12\n0.12", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p122.3.4", "order": 7, "type": "table_cell", "bbox": { "l": 231.060808, "t": 661.21453, "r": 264.933898, "b": 59.66617199999996 }, "text": "Primary (cfs)\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.04\n0.10\n0.19\n0.29\n0.40\n0.53\n0.66\n0.76\n0.84\n0.92\n0.99\n1.05\n1.11\n1.17\n1.22\n1.27\n1.32\n1.37\n1.42\n1.46\n1.51\n1.55", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p122.3.5", "order": 8, "type": "table_cell", "bbox": { "l": 287.88, "t": 661.21453, "r": 328.31433, "b": 332.666219 }, "text": "Elevation (feet)\n112.65\n112.70\n112.75\n112.80\n112.85\n112.90\n112.95\n113.00\n113.05\n113.10\n113.15\n113.20\n113.25\n113.30\n113.35\n113.40\n113.45\n113.50\n113.55\n113.60\n113.65\n113.70\n113.75\n113.80\n113.85\n113.90\n113.95\n114.00", "attrs": { "row": 0, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p122.3.6", "order": 9, "type": "table_cell", "bbox": { "l": 339.840182, "t": 661.21453, "r": 384.649982, "b": 332.606268 }, "text": "Discharge (cfs)\n1.72\n1.76\n1.80\n1.84\n1.88\n1.92\n1.95\n1.99\n2.47\n3.30\n4.38\n5.64\n7.07\n8.65\n10.36\n12.19\n14.14\n16.20\n18.37\n20.63\n22.98\n25.43\n27.97\n30.59\n33.29\n36.07\n38.93\n41.14", "attrs": { "row": 0, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p122.3.7", "order": 10, "type": "table_cell", "bbox": { "l": 395.580251, "t": 661.21453, "r": 440.261303, "b": 332.606268 }, "text": "Discarded (cfs)\n0.13\n0.13\n0.13\n0.13\n0.13\n0.14\n0.14\n0.14\n0.14\n0.14\n0.14\n0.15\n0.15\n0.15\n0.15\n0.15\n0.15\n0.16\n0.16\n0.16\n0.16\n0.16\n0.17\n0.17\n0.17\n0.17\n0.17\n0.17", "attrs": { "row": 0, "col": 6, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p122.3.8", "order": 11, "type": "table_cell", "bbox": { "l": 461.640808, "t": 661.21453, "r": 496.12324, "b": 332.606268 }, "text": "Primary (cfs)\n1.59\n1.63\n1.67\n1.71\n1.74\n1.78\n1.82\n1.85\n2.33\n3.16\n4.23\n5.50\n6.92\n8.50\n10.21\n12.04\n13.99\n16.05\n18.21\n20.47\n22.82\n25.27\n27.80\n30.42\n33.12\n35.90\n38.76\n40.97", "attrs": { "row": 0, "col": 7, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 7 } ], "reading_order": 2 } ] }, { "document_id": 11809, "page": 123, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 10, "counts_by_type": { "caption": 1, "header": 1, "table": 2, "table_cell": 6 }, "build_ms": 15, "items": [ { "id": "p123.1", "order": 1, "type": "header", "bbox": { "l": 51.84, "t": 738.48, "r": 561.6, "b": 698.88 }, "text": "POST DEV NOAA 24-hr D 100 YEAR Rainfall=9.48\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 87", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p123.2", "order": 2, "type": "caption", "bbox": { "l": 144.24, "t": 687.6, "r": 475.92, "b": 672.72 }, "text": "Stage-Area-Storage for Pond 3P: SSIB #1 SURFACE BASIN", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p123.3", "order": 3, "type": "table", "bbox": { "l": 56.88, "t": 662.64, "r": 255.6, "b": 56.88 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 3, "integrity": { "cells_checked": 3, "cells_flagged": 0 } }, "children": [ { "id": "p123.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 57.3, "t": 661.21453, "r": 97.73433, "b": 59.66617199999996 }, "text": "Elevation (feet)\n110.00\n110.05\n110.10\n110.15\n110.20\n110.25\n110.30\n110.35\n110.40\n110.45\n110.50\n110.55\n110.60\n110.65\n110.70\n110.75\n110.80\n110.85\n110.90\n110.95\n111.00\n111.05\n111.10\n111.15\n111.20\n111.25\n111.30\n111.35\n111.40\n111.45\n111.50\n111.55\n111.60\n111.65\n111.70\n111.75\n111.80\n111.85\n111.90\n111.95\n112.00\n112.05\n112.10\n112.15\n112.20\n112.25\n112.30\n112.35\n112.40\n112.45\n112.50\n112.55\n112.60", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p123.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 138.719912, "t": 661.21453, "r": 172.604796, "b": 59.66617199999996 }, "text": "Surface (sq-ft)\n2,000\n2,022\n2,045\n2,068\n2,090\n2,113\n2,135\n2,157\n2,180\n2,203\n2,225\n2,247\n2,270\n2,293\n2,315\n2,338\n2,360\n2,382\n2,405\n2,428\n2,450\n2,487\n2,525\n2,563\n2,600\n2,638\n2,675\n2,712\n2,750\n2,788\n2,825\n2,862\n2,900\n2,938\n2,975\n3,013\n3,050\n3,087\n3,125\n3,163\n3,200\n3,240\n3,280\n3,320\n3,360\n3,400\n3,440\n3,480\n3,520\n3,560\n3,600\n3,640\n3,680", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p123.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 198.240851, "t": 661.21453, "r": 247.503763, "b": 59.66617199999996 }, "text": "Storage (cubic-feet)\n0\n101\n202\n305\n409\n514\n620\n728\n836\n946\n1,056\n1,168\n1,281\n1,395\n1,510\n1,627\n1,744\n1,863\n1,982\n2,103\n2,225\n2,348\n2,474\n2,601\n2,730\n2,861\n2,994\n3,128\n3,265\n3,403\n3,544\n3,686\n3,830\n3,976\n4,124\n4,273\n4,425\n4,578\n4,734\n4,891\n5,050\n5,211\n5,374\n5,539\n5,706\n5,875\n6,046\n6,219\n6,394\n6,571\n6,750\n6,931\n7,114", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 } ], "reading_order": 2 }, { "id": "p123.4", "order": 7, "type": "table", "bbox": { "l": 266.16, "t": 663.6, "r": 464.64, "b": 331.44 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 3, "integrity": { "cells_checked": 3, "cells_flagged": 0 } }, "children": [ { "id": "p123.4.1", "order": 8, "type": "table_cell", "bbox": { "l": 270.42, "t": 661.21453, "r": 310.85433, "b": 332.666219 }, "text": "Elevation (feet)\n112.65\n112.70\n112.75\n112.80\n112.85\n112.90\n112.95\n113.00\n113.05\n113.10\n113.15\n113.20\n113.25\n113.30\n113.35\n113.40\n113.45\n113.50\n113.55\n113.60\n113.65\n113.70\n113.75\n113.80\n113.85\n113.90\n113.95\n114.00", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p123.4.2", "order": 9, "type": "table_cell", "bbox": { "l": 351.839912, "t": 661.21453, "r": 386.330207, "b": 332.606268 }, "text": "Surface (sq-ft)\n3,720\n3,760\n3,800\n3,840\n3,880\n3,920\n3,960\n4,000\n4,030\n4,060\n4,090\n4,120\n4,150\n4,180\n4,210\n4,240\n4,270\n4,300\n4,330\n4,360\n4,390\n4,420\n4,450\n4,480\n4,510\n4,540\n4,570\n4,600", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p123.4.3", "order": 10, "type": "table_cell", "bbox": { "l": 411.360851, "t": 661.21453, "r": 461.330403, "b": 332.606268 }, "text": "Storage (cubic-feet)\n7,299\n7,486\n7,675\n7,866\n8,059\n8,254\n8,451\n8,650\n8,851\n9,053\n9,257\n9,462\n9,669\n9,877\n10,087\n10,298\n10,511\n10,725\n10,941\n11,158\n11,377\n11,597\n11,819\n12,042\n12,267\n12,493\n12,721\n12,950", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 } ], "reading_order": 3 } ] }, { "document_id": 11809, "page": 124, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 30, "counts_by_type": { "footnote": 3, "header": 1, "heading": 3, "table": 2, "table_cell": 20, "text": 1 }, "build_ms": 6, "items": [ { "id": "p124.1", "order": 1, "type": "header", "bbox": { "l": 53.28, "t": 738.48, "r": 559.92, "b": 698.64 }, "text": "POST DEV NOAA 24-hr D 100 YEAR Rainfall=9.48\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 88", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p124.2", "order": 2, "type": "heading", "bbox": { "l": 163.68, "t": 687.6, "r": 455.52, "b": 672.72 }, "text": "Summary for Pond 8P: SSIB #2 UNDERGROUND", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p124.3", "order": 3, "type": "heading", "bbox": { "l": 52.32, "t": 659.52, "r": 301.44, "b": 645.84 }, "text": "[82] Warning: Early inflow requires earlier time span", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 2 }, { "id": "p124.4", "order": 4, "type": "text", "bbox": { "l": 52.32, "t": 640.56, "r": 550.32, "b": 493.2 }, "text": "Inflow Area = 0.460 ac, 58.70% Impervious, Inflow Depth > 5.52\" for 100 YEAR event\nInflow = 2.68 cfs @ 12.08 hrs, Volume= 0.212 af\nOutflow = 0.74 cfs @ 12.35 hrs, Volume= 0.170 af, Atten=72%, Lag=15.9 min\nDiscarded = 0.12 cfs @ 12.35 hrs, Volume= 0.105 af\nPrimary = 0.63 cfs @ 12.35 hrs, Volume= 0.065 af\nRouted to Reach 10: COMPOSITE\n\nRouting by Stor-Ind method, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs\nPeak Elev= 109.52' @ 12.35 hrs Surf.Area= 0.064 ac Storage= 0.076 af\n\nPlug-Flow detention time= 113.4 min calculated for 0.169 af (80% of inflow)\nCenter-of-Mass det. time= 54.7 min (800.7 - 746.0)", "attrs": { "block_label": "algorithm" }, "reading_order": 3 }, { "id": "p124.5", "order": 5, "type": "table", "bbox": { "l": 52.32, "t": 482.64, "r": 556.8, "b": 370.213607 }, "text": "", "attrs": { "block_label": "table", "n_rows": 3, "n_cols": 4, "integrity": { "cells_checked": 10, "cells_flagged": 0 } }, "children": [ { "id": "p124.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 54, "t": 481.084378, "r": 549.157135, "b": 443.412765 }, "text": "Volume\n#1A\n0.192 af Overall - 0.072 af Embedded = 0.120 af x 40.0% Voids", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p124.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 115.437146, "t": 481.084378, "r": 150.396899, "b": 455.293607 }, "text": "Invert\n107.50'", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p124.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 167.453925, "t": 481.084378, "r": 231.331841, "b": 455.293607 }, "text": "Avail.Storage\n0.048 af", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p124.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 243.466175, "t": 481.084378, "r": 412.943681, "b": 455.113155 }, "text": "Storage Description\n41.95\"W x 66.33\"L x 3.00\"H Field A", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p124.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 66.12, "t": 443.520177, "r": 85.228595, "b": 431.532998 }, "text": "#2A", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p124.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 115.437146, "t": 443.520177, "r": 150.335304, "b": 431.532998 }, "text": "107.83'", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p124.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 192.471958, "t": 443.520177, "r": 231.290655, "b": 431.532998 }, "text": "0.057 af", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p124.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 243.479769, "t": 443.520177, "r": 509.915235, "b": 384.013929 }, "text": "ADS N-12 24\" x 36 Inside #1\\nInside= 23.8\"W x 23.8\"H => 3.10 sf x 20.00\"L = 62.0 cf\\nOutside= 28.0\"W x 28.0\"H => 3.92 sf x 20.00\"L = 78.4 cf\\n36 Chambers in 12 Rows\\n40.28' Header x 3.10 sf x 2 = 249.8 cf Inside", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p124.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 52.32, "t": 398.352, "r": 178.44, "b": 377.28 }, "text": "", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 8 }, { "id": "p124.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 178.44, "t": 398.352, "r": 304.56, "b": 377.28 }, "text": "", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1 }, "reading_order": 9 }, { "id": "p124.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 192.48, "t": 382.200786, "r": 231.298697, "b": 370.213607 }, "text": "0.105 af", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p124.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 243.477069, "t": 382.200786, "r": 354.519595, "b": 370.213607 }, "text": "Total Available Storage", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 } ], "reading_order": 4 }, { "id": "p124.6", "order": 18, "type": "heading", "bbox": { "l": 66.96, "t": 358.8, "r": 295.44, "b": 345.36 }, "text": "Storage Group A created with Chamber Wizard", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 5 }, { "id": "p124.7", "order": 19, "type": "table", "bbox": { "l": 52.08, "t": 335.76, "r": 556.8, "b": 270.24 }, "text": "", "attrs": { "block_label": "table", "n_rows": 2, "n_cols": 4, "integrity": { "cells_checked": 8, "cells_flagged": 0 } }, "children": [ { "id": "p124.7.1", "order": 20, "type": "table_cell", "bbox": { "l": 54.000153, "t": 334.681717, "r": 86.82526, "b": 308.893607 }, "text": "Device\n#1", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p124.7.2", "order": 21, "type": "table_cell", "bbox": { "l": 98.873664, "t": 334.681717, "r": 147.222394, "b": 308.893607 }, "text": "Routing\nDiscarded", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p124.7.3", "order": 22, "type": "table_cell", "bbox": { "l": 175.965845, "t": 334.681717, "r": 210.937678, "b": 308.893607 }, "text": "Invert\n107.50'", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p124.7.4", "order": 23, "type": "table_cell", "bbox": { "l": 223.014009, "t": 334.681717, "r": 453.384188, "b": 297.012765 }, "text": "Outlet Devices\n1.000 in/hr Exfiltration over Surface area\\nConductivity to Groundwater Elevation = 105.00'", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p124.7.5", "order": 24, "type": "table_cell", "bbox": { "l": 70.44, "t": 297.120177, "r": 82.384214, "b": 285.132998 }, "text": "#2", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p124.7.6", "order": 25, "type": "table_cell", "bbox": { "l": 98.876253, "t": 297.120177, "r": 135.868946, "b": 285.132998 }, "text": "Primary", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p124.7.7", "order": 26, "type": "table_cell", "bbox": { "l": 175.97229, "t": 297.120177, "r": 210.870449, "b": 285.132998 }, "text": "109.00'", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p124.7.8", "order": 27, "type": "table_cell", "bbox": { "l": 223.01982, "t": 296.939725, "r": 378.049708, "b": 273.253231 }, "text": "8.0\" W × 4.0\" H Vert. Orifice/Grate C= 0.600\\nLimited to weir flow at low heads", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 } ], "reading_order": 6 }, { "id": "p124.8", "order": 28, "type": "footnote", "bbox": { "l": 190.32, "t": 381.84, "r": 357.36, "b": 368.88 }, "text": "0.105 af Total Available Storage", "attrs": { "block_label": "vision_footnote" }, "reading_order": 7 }, { "id": "p124.9", "order": 29, "type": "footnote", "bbox": { "l": 50.64, "t": 262.32, "r": 438, "b": 235.68 }, "text": "Discarded OutFlow Max=0.12 cfs @ 12.35 hrs HW=109.52' (Free Discharge)\n1=Exfiltration (Controls 0.12 cfs)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 8 }, { "id": "p124.10", "order": 30, "type": "footnote", "bbox": { "l": 51.84, "t": 227.04, "r": 426.72, "b": 200.88 }, "text": "Primary OutFlow Max=0.63 cfs @ 12.35 hrs HW=109.52' (Free Discharge)\n2=Orifice/Grate (Orifice Controls 0.63 cfs @ 2.82 fps)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 9 } ] }, { "document_id": 11809, "page": 125, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 6, "counts_by_type": { "figure": 1, "footer": 1, "header": 1, "text": 2, "title": 1 }, "build_ms": 1, "items": [ { "id": "p125.1", "order": 1, "type": "header", "bbox": { "l": 54.48, "t": 739.44, "r": 562.08, "b": 697.92 }, "text": "POST DEV NOAA 24-hr D 100 YEAR Rainfall=9.48\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 89", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p125.2", "order": 2, "type": "title", "bbox": { "l": 126.48, "t": 687.84, "r": 494.16, "b": 672.72 }, "text": "Pond 8P: SSIB #2 UNDERGROUND - Chamber Wizard Field A", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p125.3", "order": 3, "type": "text", "bbox": { "l": 49.68, "t": 661.68, "r": 544.08, "b": 406.08 }, "text": "Chamber Model = ADS N-12 24\" (ADS N-12® Pipe)\nInside= 23.8\"W x 23.8\"H => 3.10 sf x 20.00'L = 62.0 cf\nOutside= 28.0\"W x 28.0\"H => 3.92 sf x 20.00'L = 78.4 cf\n28.0\" Wide + 13.4\" Spacing = 41.4\" C-C Row Spacing\n3 Chambers/Row x 20.00' Long +2.33' Header x 2 = 64.67' Row Length +10.0\" End Stone x 2 = 66.33' Base Length\n12 Rows x 28.0\" Wide + 13.4\" Spacing x 11 + 10.0\" Side Stone x 2 = 41.95' Base Width\n4.0\" Stone Base + 28.0\" Chamber Height + 4.0\" Stone Cover = 3.00' Field Height\n36 Chambers x 62.0 cf + 40.28' Header x 3.10 sf x 2 = 2,481.8 cf Chamber Storage\n36 Chambers x 78.4 cf + 40.28' Header x 3.92 sf x 2 = 3,137.9 cf Displacement\n8,348.3 cf Field - 3,137.9 cf Chambers = 5,210.4 cf Stone x 40.0% Voids = 2,084.2 cf Stone Storage\nChamber Storage + Stone Storage = 4,565.9 cf = 0.105 af\nOverall Storage Efficiency = 54.7%\nOverall System Size = 66.33' x 41.95' x 3.00'", "attrs": { "block_label": "algorithm" }, "reading_order": 2 }, { "id": "p125.4", "order": 4, "type": "text", "bbox": { "l": 52.08, "t": 400.8, "r": 127.92, "b": 360.48 }, "text": "36 Chambers\n309.2 cy Field\n193.0 cy Stone", "reading_order": 3 }, { "id": "p125.5", "order": 5, "type": "figure", "bbox": { "l": 223.68, "t": 346.8, "r": 387.84, "b": 93.36 }, "text": "", "attrs": { "block_label": "image" }, "reading_order": 4 }, { "id": "p125.6", "order": 6, "type": "footer", "bbox": { "l": 223.2, "t": 66.48, "r": 387.12, "b": 53.76 }, "text": "010101", "attrs": { "block_label": "footer" }, "reading_order": 5 } ] }, { "document_id": 11809, "page": 126, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 3, "counts_by_type": { "caption": 1, "figure": 1, "header": 1 }, "build_ms": 0, "items": [ { "id": "p126.1", "order": 1, "type": "header", "bbox": { "l": 52.8, "t": 737.52, "r": 561.36, "b": 698.88 }, "text": "POST DEV NOAA 24-hr D 100 YEAR Rainfall=9.48\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 90", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p126.2", "order": 2, "type": "caption", "bbox": { "l": 203.28, "t": 687.84, "r": 413.76, "b": 672.96 }, "text": "Pond 8P: SSIB #2 UNDERGROUND", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p126.3", "order": 3, "type": "figure", "bbox": { "l": 62.4, "t": 676.8, "r": 552.48, "b": 398.88 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nInflow\n2.68 cfs Outflow\n3 Inflow Area=0.460 ac Primary\nDiscarded\nPeak Elev=109.52'\nStorage=0.076 af\n2\n(cfs)\nFlow\n0.74 cfs\n1\n0.63 cfs\n0.12 cfs\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 2 } ] }, { "document_id": 11809, "page": 127, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 12, "counts_by_type": { "caption": 1, "header": 1, "table": 2, "table_cell": 8 }, "build_ms": 14, "items": [ { "id": "p127.1", "order": 1, "type": "header", "bbox": { "l": 51.6, "t": 738.48, "r": 561.36, "b": 698.64 }, "text": "POST DEV NOAA 24-hr D 100 YEAR Rainfall=9.48\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 91", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p127.2", "order": 2, "type": "caption", "bbox": { "l": 153.84, "t": 687.84, "r": 466.32, "b": 672.72 }, "text": "Stage-Discharge for Pond 8P: SSIB #2 UNDERGROUND", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p127.3", "order": 3, "type": "table", "bbox": { "l": 56.4, "t": 661.92, "r": 275.04, "b": 56.64 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 4, "integrity": { "cells_checked": 4, "cells_flagged": 0 } }, "children": [ { "id": "p127.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 57.3, "t": 661.21453, "r": 97.73433, "b": 59.66617199999996 }, "text": "Elevation (feet)\n107.50\n107.55\n107.60\n107.65\n107.70\n107.75\n107.80\n107.85\n107.90\n107.95\n108.00\n108.05\n108.10\n108.15\n108.20\n108.25\n108.30\n108.35\n108.40\n108.45\n108.50\n108.55\n108.60\n108.65\n108.70\n108.75\n108.80\n108.85\n108.90\n108.95\n109.00\n109.05\n109.10\n109.15\n109.20\n109.25\n109.30\n109.35\n109.40\n109.45\n109.50\n109.55\n109.60\n109.65\n109.70\n109.75\n109.80\n109.85\n109.90\n109.95\n110.00\n110.05\n110.10", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p127.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 109.260182, "t": 661.21453, "r": 153.49646, "b": 59.66617199999996 }, "text": "Discharge (cfs)\n0.00\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.08\n0.08\n0.08\n0.08\n0.08\n0.08\n0.08\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.13\n0.17\n0.23\n0.30\n0.38\n0.46\n0.55\n0.62\n0.68\n0.73\n0.77\n0.82\n0.86\n0.90\n0.94\n0.97\n1.01\n1.04\n1.07\n1.10\n1.13\n1.16", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p127.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 165.000251, "t": 661.21453, "r": 209.236529, "b": 59.66617199999996 }, "text": "Discarded (cfs)\n0.00\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.07\n0.08\n0.08\n0.08\n0.08\n0.08\n0.08\n0.08\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.11\n0.11\n0.11\n0.11\n0.11\n0.11\n0.11\n0.11\n0.12\n0.12\n0.12\n0.12\n0.12\n0.12\n0.12\n0.12\n0.13\n0.13\n0.13\n0.13\n0.13", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p127.3.4", "order": 7, "type": "table_cell", "bbox": { "l": 231.060808, "t": 661.21453, "r": 264.933898, "b": 59.66617199999996 }, "text": "Primary (cfs)\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.02\n0.07\n0.12\n0.19\n0.27\n0.35\n0.44\n0.50\n0.56\n0.61\n0.66\n0.70\n0.74\n0.78\n0.81\n0.85\n0.88\n0.91\n0.95\n0.98\n1.00\n1.03", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 } ], "reading_order": 2 }, { "id": "p127.4", "order": 8, "type": "table", "bbox": { "l": 282.24, "t": 662.88, "r": 498.24, "b": 550.8 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 4, "integrity": { "cells_checked": 4, "cells_flagged": 0 } }, "children": [ { "id": "p127.4.1", "order": 9, "type": "table_cell", "bbox": { "l": 287.88, "t": 661.21453, "r": 328.31433, "b": 551.0662580000001 }, "text": "Elevation (feet)\n110.15\n110.20\n110.25\n110.30\n110.35\n110.40\n110.45\n110.50", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p127.4.2", "order": 10, "type": "table_cell", "bbox": { "l": 339.840182, "t": 661.21453, "r": 384.526148, "b": 551.006306 }, "text": "Discharge (cfs)\n1.19\n1.22\n1.25\n1.27\n1.30\n1.33\n1.35\n1.38", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p127.4.3", "order": 11, "type": "table_cell", "bbox": { "l": 395.580251, "t": 661.21453, "r": 440.263268, "b": 551.006306 }, "text": "Discarded (cfs)\n0.13\n0.13\n0.14\n0.14\n0.14\n0.14\n0.14\n0.14", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p127.4.4", "order": 12, "type": "table_cell", "bbox": { "l": 461.640808, "t": 661.21453, "r": 496.000389, "b": 551.006306 }, "text": "Primary (cfs)\n1.06\n1.09\n1.11\n1.14\n1.16\n1.19\n1.21\n1.23", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 } ], "reading_order": 3 } ] }, { "document_id": 11809, "page": 128, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 10, "counts_by_type": { "caption": 1, "header": 1, "table": 2, "table_cell": 6 }, "build_ms": 9, "items": [ { "id": "p128.1", "order": 1, "type": "header", "bbox": { "l": 50.4, "t": 738.96, "r": 563.52, "b": 699.12 }, "text": "POST DEV NOAA 24-hr D 100 YEAR Rainfall=9.48\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 92", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p128.2", "order": 2, "type": "caption", "bbox": { "l": 146.16, "t": 687.6, "r": 474.72, "b": 672.96 }, "text": "Stage-Area-Storage for Pond 8P: SSIB #2 UNDERGROUND", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p128.3", "order": 3, "type": "table", "bbox": { "l": 56.64, "t": 661.21453, "r": 235.68, "b": 57.12 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 3, "integrity": { "cells_checked": 3, "cells_flagged": 0 } }, "children": [ { "id": "p128.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 57.3, "t": 661.21453, "r": 97.73433, "b": 59.66617199999996 }, "text": "Elevation (feet)\n107.50\n107.55\n107.60\n107.65\n107.70\n107.75\n107.80\n107.85\n107.90\n107.95\n108.00\n108.05\n108.10\n108.15\n108.20\n108.25\n108.30\n108.35\n108.40\n108.45\n108.50\n108.55\n108.60\n108.65\n108.70\n108.75\n108.80\n108.85\n108.90\n108.95\n109.00\n109.05\n109.10\n109.15\n109.20\n109.25\n109.30\n109.35\n109.40\n109.45\n109.50\n109.55\n109.60\n109.65\n109.70\n109.75\n109.80\n109.85\n109.90\n109.95\n110.00\n110.05\n110.10", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p128.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 125.040179, "t": 661.21453, "r": 159.530474, "b": 59.66617199999996 }, "text": "Surface (acres)\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p128.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 182.880513, "t": 661.21453, "r": 228.350762, "b": 59.66617199999996 }, "text": "Storage (acre-feet)\n0.000\n0.001\n0.003\n0.004\n0.005\n0.006\n0.008\n0.009\n0.010\n0.011\n0.012\n0.013\n0.014\n0.016\n0.018\n0.020\n0.022\n0.024\n0.026\n0.028\n0.030\n0.032\n0.034\n0.036\n0.039\n0.041\n0.043\n0.045\n0.048\n0.050\n0.052\n0.055\n0.057\n0.059\n0.062\n0.064\n0.066\n0.068\n0.071\n0.073\n0.075\n0.077\n0.079\n0.081\n0.083\n0.085\n0.087\n0.089\n0.090\n0.092\n0.093\n0.094\n0.095", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 } ], "reading_order": 2 }, { "id": "p128.4", "order": 7, "type": "table", "bbox": { "l": 246.48, "t": 662.4, "r": 425.04, "b": 551.006306 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 3, "integrity": { "cells_checked": 3, "cells_flagged": 0 } }, "children": [ { "id": "p128.4.1", "order": 8, "type": "table_cell", "bbox": { "l": 251.28, "t": 661.21453, "r": 291.71433, "b": 551.0662580000001 }, "text": "Elevation (feet)\n110.15\n110.20\n110.25\n110.30\n110.35\n110.40\n110.45\n110.50", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p128.4.2", "order": 9, "type": "table_cell", "bbox": { "l": 319.020179, "t": 661.21453, "r": 352.90408, "b": 551.0662580000001 }, "text": "Surface (acres)\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064\n0.064", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p128.4.3", "order": 10, "type": "table_cell", "bbox": { "l": 376.860513, "t": 661.21453, "r": 422.930276, "b": 551.006306 }, "text": "Storage (acre-feet)\n0.096\n0.097\n0.098\n0.100\n0.101\n0.102\n0.104\n0.105", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 } ], "reading_order": 3 } ] }, { "document_id": 11809, "page": 129, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 30, "counts_by_type": { "footnote": 3, "header": 1, "heading": 3, "table": 2, "table_cell": 20, "text": 1 }, "build_ms": 5, "items": [ { "id": "p129.1", "order": 1, "type": "header", "bbox": { "l": 53.28, "t": 738.48, "r": 560.16, "b": 698.64 }, "text": "POST DEV NOAA 24-hr D 100 YEAR Rainfall=9.48\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 93", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p129.2", "order": 2, "type": "heading", "bbox": { "l": 163.68, "t": 687.6, "r": 455.52, "b": 672.48 }, "text": "Summary for Pond 9P: SSIB #3 UNDERGROUND", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p129.3", "order": 3, "type": "heading", "bbox": { "l": 52.32, "t": 659.52, "r": 301.44, "b": 645.84 }, "text": "[82] Warning: Early inflow requires earlier time span", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 2 }, { "id": "p129.4", "order": 4, "type": "text", "bbox": { "l": 52.56, "t": 641.04, "r": 554.4, "b": 490.08 }, "text": "Inflow Area = 0.460 ac, 100.00% Impervious, Inflow Depth > 8.30\" for 100 YEAR event\nInflow = 4.15 cfs @ 12.10 hrs, Volume= 0.318 af\nOutflow = 1.49 cfs @ 12.27 hrs, Volume= 0.228 af, Atten= 64%, Lag= 10.6 min\nDiscarded = 0.17 cfs @ 12.27 hrs, Volume= 0.153 af\nPrimary = 1.32 cfs @ 12.27 hrs, Volume= 0.075 af\nRouted to Reach 10 : COMPOSITE\n\nRouting by Stor-Ind method, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs\nPeak Elev= 113.57' @ 12.27 hrs Surf.Area= 0.085 ac Storage= 0.132 af\n\nPlug-Flow detention time= 134.7 min calculated for 0.228 af (72% of inflow)\nCenter-of-Mass det. time= 64.8 min (797.2 - 732.4)", "attrs": { "block_label": "algorithm" }, "reading_order": 3 }, { "id": "p129.5", "order": 5, "type": "table", "bbox": { "l": 52.32, "t": 482.64, "r": 556.8, "b": 370.213607 }, "text": "", "attrs": { "block_label": "table", "n_rows": 3, "n_cols": 4, "integrity": { "cells_checked": 10, "cells_flagged": 0 } }, "children": [ { "id": "p129.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 54, "t": 481.084378, "r": 549.157135, "b": 443.412765 }, "text": "Volume\n#1A\n0.255 af Overall - 0.096 af Embedded = 0.159 af x 40.0% Voids", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p129.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 115.437146, "t": 481.084378, "r": 150.396899, "b": 455.293607 }, "text": "Invert\n110.80'", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p129.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 167.453925, "t": 481.084378, "r": 231.331841, "b": 455.293607 }, "text": "Avail.Storage\n0.063 af", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p129.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 243.466175, "t": 481.084378, "r": 412.943681, "b": 455.113155 }, "text": "Storage Description\n55.75'W x 66.33'L x 3.00'H Field A", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p129.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 66.12, "t": 443.520177, "r": 85.228595, "b": 431.532998 }, "text": "#2A", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p129.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 115.437146, "t": 443.520177, "r": 150.335304, "b": 431.532998 }, "text": "111.13'", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p129.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 192.471958, "t": 443.520177, "r": 231.290655, "b": 431.532998 }, "text": "0.076 af", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p129.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 243.479769, "t": 443.520177, "r": 509.915235, "b": 384.013929 }, "text": "ADS N-12 24\" x 48 Inside #1\\nInside= 23.8\"W x 23.8\"H => 3.10 sf x 20.00'L = 62.0 cf\\nOutside= 28.0\"W x 28.0\"H => 3.92 sf x 20.00'L = 78.4 cf\\n48 Chambers in 16 Rows\\n54.08' Header x 3.10 sf x 2 = 335.3 cf Inside", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p129.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 52.32, "t": 397.584, "r": 178.44, "b": 376.32 }, "text": "", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 8 }, { "id": "p129.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 178.44, "t": 397.584, "r": 304.56, "b": 376.32 }, "text": "", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1 }, "reading_order": 9 }, { "id": "p129.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 192.48, "t": 382.200786, "r": 231.298697, "b": 370.213607 }, "text": "0.139 af", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p129.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 243.477069, "t": 382.200786, "r": 354.519595, "b": 370.213607 }, "text": "Total Available Storage", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 } ], "reading_order": 4 }, { "id": "p129.6", "order": 18, "type": "heading", "bbox": { "l": 66.96, "t": 358.8, "r": 295.44, "b": 345.36 }, "text": "Storage Group A created with Chamber Wizard", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 5 }, { "id": "p129.7", "order": 19, "type": "table", "bbox": { "l": 52.08, "t": 335.76, "r": 556.8, "b": 270 }, "text": "", "attrs": { "block_label": "table", "n_rows": 2, "n_cols": 4, "integrity": { "cells_checked": 8, "cells_flagged": 0 } }, "children": [ { "id": "p129.7.1", "order": 20, "type": "table_cell", "bbox": { "l": 54.000153, "t": 334.681717, "r": 86.82526, "b": 308.893607 }, "text": "Device\n#1", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p129.7.2", "order": 21, "type": "table_cell", "bbox": { "l": 98.873664, "t": 334.681717, "r": 147.222394, "b": 308.893607 }, "text": "Routing\nDiscarded", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p129.7.3", "order": 22, "type": "table_cell", "bbox": { "l": 175.965845, "t": 334.681717, "r": 210.937678, "b": 308.893607 }, "text": "Invert\n110.80'", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p129.7.4", "order": 23, "type": "table_cell", "bbox": { "l": 223.014009, "t": 334.681717, "r": 453.384188, "b": 297.012765 }, "text": "Outlet Devices\n1.000 in/hr Exfiltration over Surface area\\nConductivity to Groundwater Elevation = 108.00'", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p129.7.5", "order": 24, "type": "table_cell", "bbox": { "l": 70.44, "t": 297.120177, "r": 82.384214, "b": 285.132998 }, "text": "#2", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p129.7.6", "order": 25, "type": "table_cell", "bbox": { "l": 98.876253, "t": 297.120177, "r": 135.868946, "b": 285.132998 }, "text": "Primary", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p129.7.7", "order": 26, "type": "table_cell", "bbox": { "l": 175.97229, "t": 297.120177, "r": 210.870449, "b": 285.132998 }, "text": "113.00'", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p129.7.8", "order": 27, "type": "table_cell", "bbox": { "l": 223.01982, "t": 297.120177, "r": 451.453995, "b": 273.253231 }, "text": "12.0\" W x 6.0\" H Vert. Orifice/Grate C= 0.600\\nLimited to weir flow at low heads", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 } ], "reading_order": 6 }, { "id": "p129.8", "order": 28, "type": "footnote", "bbox": { "l": 190.32, "t": 381.84, "r": 357.36, "b": 368.88 }, "text": "0.139 af Total Available Storage", "attrs": { "block_label": "vision_footnote" }, "reading_order": 7 }, { "id": "p129.9", "order": 29, "type": "footnote", "bbox": { "l": 50.64, "t": 262.32, "r": 438, "b": 235.68 }, "text": "Discarded OutFlow Max=0.17 cfs @ 12.27 hrs HW=113.56' (Free Discharge)\n1=Exfiltration (Controls 0.17 cfs)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 8 }, { "id": "p129.10", "order": 30, "type": "footnote", "bbox": { "l": 51.6, "t": 227.28, "r": 426.72, "b": 200.64 }, "text": "Primary OutFlow Max=1.30 cfs @ 12.27 hrs HW=113.56' (Free Discharge)\n2=Orifice/Grate (Orifice Controls 1.30 cfs @ 2.61 fps)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 9 } ] }, { "document_id": 11809, "page": 130, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 6, "counts_by_type": { "figure": 1, "footer": 1, "header": 1, "text": 2, "title": 1 }, "build_ms": 1, "items": [ { "id": "p130.1", "order": 1, "type": "header", "bbox": { "l": 54, "t": 739.2, "r": 561.6, "b": 698.4 }, "text": "POST DEV NOAA 24-hr D 100 YEAR Rainfall=9.48\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 94", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p130.2", "order": 2, "type": "title", "bbox": { "l": 126.48, "t": 687.84, "r": 494.4, "b": 672.72 }, "text": "Pond 9P: SSIB #3 UNDERGROUND - Chamber Wizard Field A", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p130.3", "order": 3, "type": "text", "bbox": { "l": 49.68, "t": 662.64, "r": 545.04, "b": 405.84 }, "text": "Chamber Model = ADS N-12 24\" (ADS N-12® Pipe)\nInside= 23.8\"W x 23.8\"H => 3.10 sf x 20.00'L = 62.0 cf\nOutside= 28.0\"W x 28.0\"H => 3.92 sf x 20.00'L = 78.4 cf\n28.0\" Wide + 13.4\" Spacing = 41.4\" C-C Row Spacing\n3 Chambers/Row x 20.00' Long +2.33' Header x 2 = 64.67' Row Length +10.0\" End Stone x 2 = 66.33' Base Length\n16 Rows x 28.0\" Wide + 13.4\" Spacing x 15 + 10.0\" Side Stone x 2 = 55.75' Base Width\n4.0\" Stone Base + 28.0\" Chamber Height + 4.0\" Stone Cover = 3.00' Field Height\n48 Chambers x 62.0 cf + 54.08' Header x 3.10 sf x 2 = 3,311.3 cf Chamber Storage\n48 Chambers x 78.4 cf + 54.08' Header x 3.92 sf x 2 = 4,186.8 cf Displacement\n11,094.6 cf Field - 4,186.8 cf Chambers = 6,907.8 cf Stone x 40.0% Voids = 2,763.1 cf Stone Storage\nChamber Storage + Stone Storage = 6,074.4 cf = 0.139 af\nOverall Storage Efficiency = 54.8%\nOverall System Size = 66.33' x 55.75' x 3.00'", "attrs": { "block_label": "algorithm" }, "reading_order": 2 }, { "id": "p130.4", "order": 4, "type": "text", "bbox": { "l": 51.84, "t": 400.56, "r": 127.92, "b": 360.48 }, "text": "48 Chambers\n410.9 cy Field\n255.8 cy Stone", "reading_order": 3 }, { "id": "p130.5", "order": 5, "type": "figure", "bbox": { "l": 196.8, "t": 348.96, "r": 414.72, "b": 92.88 }, "text": "", "attrs": { "block_label": "image" }, "reading_order": 4 }, { "id": "p130.6", "order": 6, "type": "footer", "bbox": { "l": 197.04, "t": 66.48, "r": 414.48, "b": 53.76 }, "text": "[○1○1○", "attrs": { "block_label": "footer" }, "reading_order": 5 } ] }, { "document_id": 11809, "page": 131, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 3, "counts_by_type": { "caption": 1, "figure": 1, "header": 1 }, "build_ms": 0, "items": [ { "id": "p131.1", "order": 1, "type": "header", "bbox": { "l": 52.8, "t": 737.52, "r": 561.36, "b": 698.88 }, "text": "POST DEV NOAA 24-hr D 100 YEAR Rainfall=9.48\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 95", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p131.2", "order": 2, "type": "caption", "bbox": { "l": 203.28, "t": 687.84, "r": 413.76, "b": 672.96 }, "text": "Pond 9P: SSIB #3 UNDERGROUND", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p131.3", "order": 3, "type": "figure", "bbox": { "l": 62.4, "t": 674.64, "r": 552.48, "b": 398.88 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nInflow\n4.15 cfs Outflow\nInflow Area=0.460 ac Primary\nDiscarded\nPeak Elev=113.57'\n4\nStorage=0.132 af\n3\n(cfs)\n1.49 cfs\nFlow 2\n1.32 cfs\n1\n0.17 cfs\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 2 } ] }, { "document_id": 11809, "page": 132, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 12, "counts_by_type": { "caption": 1, "header": 1, "table": 2, "table_cell": 8 }, "build_ms": 16, "items": [ { "id": "p132.1", "order": 1, "type": "header", "bbox": { "l": 51.6, "t": 738.48, "r": 561.6, "b": 698.64 }, "text": "POST DEV NOAA 24-hr D 100 YEAR Rainfall=9.48\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 96", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p132.2", "order": 2, "type": "caption", "bbox": { "l": 154.08, "t": 687.84, "r": 466.08, "b": 672.72 }, "text": "Stage-Discharge for Pond 9P: SSIB #3 UNDERGROUND", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p132.3", "order": 3, "type": "table", "bbox": { "l": 56.88, "t": 661.68, "r": 275.28, "b": 56.64 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 4, "integrity": { "cells_checked": 4, "cells_flagged": 0 } }, "children": [ { "id": "p132.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 57.3, "t": 661.21453, "r": 97.73433, "b": 59.66617199999996 }, "text": "Elevation (feet)\n110.80\n110.85\n110.90\n110.95\n111.00\n111.05\n111.10\n111.15\n111.20\n111.25\n111.30\n111.35\n111.40\n111.45\n111.50\n111.55\n111.60\n111.65\n111.70\n111.75\n111.80\n111.85\n111.90\n111.95\n112.00\n112.05\n112.10\n112.15\n112.20\n112.25\n112.30\n112.35\n112.40\n112.45\n112.50\n112.55\n112.60\n112.65\n112.70\n112.75\n112.80\n112.85\n112.90\n112.95\n113.00\n113.05\n113.10\n113.15\n113.20\n113.25\n113.30\n113.35\n113.40", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p132.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 109.260182, "t": 661.21453, "r": 153.49646, "b": 59.66617199999996 }, "text": "Discharge (cfs)\n0.00\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.11\n0.11\n0.11\n0.11\n0.11\n0.11\n0.11\n0.12\n0.12\n0.12\n0.12\n0.12\n0.12\n0.13\n0.13\n0.13\n0.13\n0.13\n0.13\n0.13\n0.14\n0.14\n0.14\n0.14\n0.14\n0.14\n0.15\n0.15\n0.15\n0.15\n0.15\n0.15\n0.19\n0.26\n0.34\n0.45\n0.56\n0.69\n0.83\n0.98", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p132.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 165.000251, "t": 661.21453, "r": 209.236529, "b": 59.66617199999996 }, "text": "Discarded (cfs)\n0.00\n0.09\n0.09\n0.09\n0.09\n0.09\n0.09\n0.10\n0.10\n0.10\n0.10\n0.10\n0.10\n0.11\n0.11\n0.11\n0.11\n0.11\n0.11\n0.11\n0.12\n0.12\n0.12\n0.12\n0.12\n0.12\n0.13\n0.13\n0.13\n0.13\n0.13\n0.13\n0.13\n0.14\n0.14\n0.14\n0.14\n0.14\n0.14\n0.15\n0.15\n0.15\n0.15\n0.15\n0.15\n0.15\n0.16\n0.16\n0.16\n0.16\n0.16\n0.16\n0.17", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p132.3.4", "order": 7, "type": "table_cell", "bbox": { "l": 231.060808, "t": 661.21453, "r": 264.933898, "b": 59.66617199999996 }, "text": "Primary (cfs)\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.00\n0.04\n0.10\n0.19\n0.29\n0.40\n0.53\n0.66\n0.81", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 } ], "reading_order": 2 }, { "id": "p132.4", "order": 8, "type": "table", "bbox": { "l": 282.24, "t": 662.88, "r": 498.24, "b": 550.56 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 4, "integrity": { "cells_checked": 4, "cells_flagged": 0 } }, "children": [ { "id": "p132.4.1", "order": 9, "type": "table_cell", "bbox": { "l": 287.88, "t": 661.21453, "r": 328.31433, "b": 551.0662580000001 }, "text": "Elevation (feet)\n113.45\n113.50\n113.55\n113.60\n113.65\n113.70\n113.75\n113.80", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p132.4.2", "order": 10, "type": "table_cell", "bbox": { "l": 339.840182, "t": 661.21453, "r": 384.526148, "b": 551.006306 }, "text": "Discharge (cfs)\n1.14\n1.30\n1.44\n1.56\n1.67\n1.77\n1.86\n1.95", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p132.4.3", "order": 11, "type": "table_cell", "bbox": { "l": 395.580251, "t": 661.21453, "r": 440.263268, "b": 551.006306 }, "text": "Discarded (cfs)\n0.17\n0.17\n0.17\n0.17\n0.17\n0.17\n0.18\n0.18", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p132.4.4", "order": 12, "type": "table_cell", "bbox": { "l": 461.640808, "t": 661.21453, "r": 496.000389, "b": 551.006306 }, "text": "Primary (cfs)\n0.97\n1.13\n1.27\n1.39\n1.50\n1.59\n1.68\n1.77", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 } ], "reading_order": 3 } ] }, { "document_id": 11809, "page": 133, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 10, "counts_by_type": { "caption": 1, "header": 1, "table": 2, "table_cell": 6 }, "build_ms": 12, "items": [ { "id": "p133.1", "order": 1, "type": "header", "bbox": { "l": 51.84, "t": 738.48, "r": 561.84, "b": 699.12 }, "text": "POST DEV NOAA 24-hr D 100 YEAR Rainfall=9.48\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 97", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p133.2", "order": 2, "type": "caption", "bbox": { "l": 146.16, "t": 687.6, "r": 474.48, "b": 672.96 }, "text": "Stage-Area-Storage for Pond 9P: SSIB #3 UNDERGROUND", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p133.3", "order": 3, "type": "table", "bbox": { "l": 57.3, "t": 661.21453, "r": 235.68, "b": 56.88 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 3, "integrity": { "cells_checked": 3, "cells_flagged": 0 } }, "children": [ { "id": "p133.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 57.3, "t": 661.21453, "r": 97.73433, "b": 59.66617199999996 }, "text": "Elevation (feet)\n110.80\n110.85\n110.90\n110.95\n111.00\n111.05\n111.10\n111.15\n111.20\n111.25\n111.30\n111.35\n111.40\n111.45\n111.50\n111.55\n111.60\n111.65\n111.70\n111.75\n111.80\n111.85\n111.90\n111.95\n112.00\n112.05\n112.10\n112.15\n112.20\n112.25\n112.30\n112.35\n112.40\n112.45\n112.50\n112.55\n112.60\n112.65\n112.70\n112.75\n112.80\n112.85\n112.90\n112.95\n113.00\n113.05\n113.10\n113.15\n113.20\n113.25\n113.30\n113.35\n113.40", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p133.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 125.040179, "t": 661.21453, "r": 159.530474, "b": 59.66617199999996 }, "text": "Surface (acres)\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p133.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 182.880513, "t": 661.21453, "r": 228.350762, "b": 59.66617199999996 }, "text": "Storage (acre-feet)\n0.000\n0.002\n0.003\n0.005\n0.007\n0.008\n0.010\n0.012\n0.013\n0.015\n0.016\n0.017\n0.019\n0.021\n0.024\n0.026\n0.029\n0.031\n0.034\n0.037\n0.040\n0.042\n0.045\n0.048\n0.051\n0.054\n0.057\n0.060\n0.064\n0.067\n0.070\n0.073\n0.076\n0.079\n0.082\n0.085\n0.088\n0.091\n0.094\n0.097\n0.100\n0.103\n0.105\n0.108\n0.111\n0.113\n0.116\n0.118\n0.120\n0.122\n0.124\n0.125\n0.126", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 } ], "reading_order": 2 }, { "id": "p133.4", "order": 7, "type": "table", "bbox": { "l": 246.48, "t": 662.4, "r": 425.04, "b": 551.006306 }, "text": "", "attrs": { "block_label": "table", "n_rows": 1, "n_cols": 3, "integrity": { "cells_checked": 3, "cells_flagged": 0 } }, "children": [ { "id": "p133.4.1", "order": 8, "type": "table_cell", "bbox": { "l": 251.28, "t": 661.21453, "r": 291.71433, "b": 551.0662580000001 }, "text": "Elevation (feet)\n113.45\n113.50\n113.55\n113.60\n113.65\n113.70\n113.75\n113.80", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p133.4.2", "order": 9, "type": "table_cell", "bbox": { "l": 319.020179, "t": 661.21453, "r": 352.90408, "b": 551.0662580000001 }, "text": "Surface (acres)\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085\n0.085", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p133.4.3", "order": 10, "type": "table_cell", "bbox": { "l": 376.860513, "t": 661.21453, "r": 422.930276, "b": 551.006306 }, "text": "Storage (acre-feet)\n0.128\n0.129\n0.131\n0.133\n0.134\n0.136\n0.138\n0.139", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 } ], "reading_order": 3 } ] }, { "document_id": 11809, "page": 134, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 1, "counts_by_type": { "text": 1 }, "build_ms": 0, "items": [ { "id": "p134.1", "order": 1, "type": "text", "bbox": { "l": 173.76, "t": 623.52, "r": 437.04, "b": 573.6 }, "text": "APPENDIX C\nCOLLECTION SYSTEM CALCULATIONS", "reading_order": 0 } ] }, { "document_id": 11809, "page": 135, "width": 792, "height": 612, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 792, "height_pt": 612, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 343, "counts_by_type": { "heading": 1, "list": 1, "list_item": 3, "table": 1, "table_cell": 335, "text": 2 }, "build_ms": 28, "items": [ { "id": "p135.1", "order": 1, "type": "heading", "bbox": { "l": 292.8, "t": 589.44, "r": 498.24, "b": 573.84 }, "text": "STORM SEWER TABULATION", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 0 }, { "id": "p135.2", "order": 2, "type": "text", "bbox": { "l": 51.6, "t": 556.8, "r": 244.56, "b": 513.12 }, "text": "PROFESSIONAL DESIGN SERVICES, L.L.C.\n1245 AIRPORT ROAD, SUITE 1\nLAKEWOOD, NJ 08701\n(732) 363-0060", "reading_order": 1 }, { "id": "p135.3", "order": 3, "type": "list", "bbox": { "l": 475.44, "t": 554.88, "r": 754.8, "b": 506.64 }, "text": "", "attrs": { "item_count": 3 }, "children": [ { "id": "p135.3.1", "order": 4, "type": "list_item", "bbox": { "l": 475.68, "t": 554.88, "r": 754.8, "b": 542.64 }, "text": "COMPUTED BY: ___ DATE: 12/9/2025", "reading_order": 0 }, { "id": "p135.3.2", "order": 5, "type": "list_item", "bbox": { "l": 475.44, "t": 536.64, "r": 716.16, "b": 524.16 }, "text": "DESIGN STORM FREQUENCY: 25____ YEAR", "reading_order": 1 }, { "id": "p135.3.3", "order": 6, "type": "list_item", "bbox": { "l": 475.68, "t": 519.6, "r": 718.8, "b": 506.64 }, "text": "INTENSITY CURVE: ___", "reading_order": 2 } ], "reading_order": 2 }, { "id": "p135.4", "order": 7, "type": "text", "bbox": { "l": 483.6, "t": 496.32, "r": 550.32, "b": 485.04 }, "text": "PDS# 320157", "reading_order": 3 }, { "id": "p135.5", "order": 8, "type": "table", "bbox": { "l": 21.84, "t": 472.32, "r": 775.2, "b": 52.8 }, "text": "", "attrs": { "block_label": "table", "n_rows": 21, "n_cols": 17, "integrity": { "cells_checked": 206, "cells_flagged": 2, "flags": [ { "row": 1, "col": 10, "coverage": 0.5, "text": "MANNINGS $ AN_{{3}} $" }, { "row": 3, "col": 3, "coverage": 0.5, "text": "(3A × C)" } ] } }, "children": [ { "id": "p135.5.1", "order": 9, "type": "table_cell", "bbox": { "l": 63.120003, "t": 464.200298, "r": 93.861122, "b": 457.49159299999997 }, "text": "LOCATION", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "column_header": true, "header_source": "pdf" }, "reading_order": 0 }, { "id": "p135.5.2", "order": 10, "type": "table_cell", "bbox": { "l": 303.659468, "t": 464.200298, "r": 346.449517, "b": 457.49159299999997 }, "text": "RUNOFF DATA", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 9, "bbox_refit": true, "column_header": true, "header_source": "pdf" }, "reading_order": 1 }, { "id": "p135.5.3", "order": 11, "type": "table_cell", "bbox": { "l": 612.417235, "t": 464.200298, "r": 676.699041, "b": 457.49159299999997 }, "text": "SEWER DESIGN DATA", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 6, "bbox_refit": true, "column_header": true, "header_source": "pdf" }, "reading_order": 2 }, { "id": "p135.5.4", "order": 12, "type": "table_cell", "bbox": { "l": 56.639998, "t": 450.400303, "r": 93.698214, "b": 443.691597 }, "text": "STRUCTURE #", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 3 }, { "id": "p135.5.5", "order": 13, "type": "table_cell", "bbox": { "l": 110.4706, "t": 452.3429, "r": 154.7859, "b": 432.3657 }, "text": "", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1 }, "reading_order": 4 }, { "id": "p135.5.6", "order": 14, "type": "table_cell", "bbox": { "l": 154.7859, "t": 452.3429, "r": 199.1012, "b": 432.3657 }, "text": "", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 5 }, { "id": "p135.5.7", "order": 15, "type": "table_cell", "bbox": { "l": 199.1012, "t": 452.3429, "r": 243.4165, "b": 432.3657 }, "text": "", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 6 }, { "id": "p135.5.8", "order": 16, "type": "table_cell", "bbox": { "l": 243.4165, "t": 452.3429, "r": 287.7318, "b": 432.3657 }, "text": "", "attrs": { "row": 1, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 7 }, { "id": "p135.5.9", "order": 17, "type": "table_cell", "bbox": { "l": 288.057304, "t": 450.400303, "r": 366.564982, "b": 443.691597 }, "text": "TIME OF CONCENTRATION", "attrs": { "row": 1, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 8 }, { "id": "p135.5.10", "order": 18, "type": "table_cell", "bbox": { "l": 376.3624, "t": 452.3429, "r": 420.6776, "b": 432.3657 }, "text": "", "attrs": { "row": 1, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 9 }, { "id": "p135.5.11", "order": 19, "type": "table_cell", "bbox": { "l": 420.6776, "t": 452.3429, "r": 464.9929, "b": 432.3657 }, "text": "", "attrs": { "row": 1, "col": 7, "rowspan": 1, "colspan": 1 }, "reading_order": 10 }, { "id": "p135.5.12", "order": 20, "type": "table_cell", "bbox": { "l": 464.9929, "t": 452.3429, "r": 509.3082, "b": 432.3657 }, "text": "", "attrs": { "row": 1, "col": 8, "rowspan": 1, "colspan": 1 }, "reading_order": 11 }, { "id": "p135.5.13", "order": 21, "type": "table_cell", "bbox": { "l": 555.731245, "t": 450.400303, "r": 600.946864, "b": 443.691597 }, "text": "PIPE MATERIAL", "attrs": { "row": 1, "col": 9, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 12 }, { "id": "p135.5.14", "order": 22, "type": "table_cell", "bbox": { "l": 642.2541, "t": 452.3429, "r": 775.2, "b": 432.3657 }, "text": "MANNINGS $ AN_{{3}} $", "attrs": { "row": 1, "col": 10, "rowspan": 1, "colspan": 3 }, "reading_order": 13 }, { "id": "p135.5.15", "order": 23, "type": "table_cell", "bbox": { "l": 32.520001, "t": 436.120307, "r": 65.751994, "b": 429.411602 }, "text": "UPSTREAM", "attrs": { "row": 2, "col": 0, "rowspan": 2, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p135.5.16", "order": 24, "type": "table_cell", "bbox": { "l": 81.123105, "t": 436.120307, "r": 125.078493, "b": 429.411602 }, "text": "DOWNSTREAM", "attrs": { "row": 2, "col": 1, "rowspan": 2, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p135.5.17", "order": 25, "type": "table_cell", "bbox": { "l": 140.088922, "t": 436.120307, "r": 156.368762, "b": 429.411602 }, "text": "AREA", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p135.5.18", "order": 26, "type": "table_cell", "bbox": { "l": 170.879997, "t": 436.120307, "r": 210.975935, "b": 415.49159299999997 }, "text": "WEIGHT OF RUNOFF COEFFICIENT", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p135.5.19", "order": 27, "type": "table_cell", "bbox": { "l": 199.1012, "t": 432.3657, "r": 243.4165, "b": 412.3886 }, "text": "", "attrs": { "row": 2, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 18 }, { "id": "p135.5.20", "order": 28, "type": "table_cell", "bbox": { "l": 253.195443, "t": 436.120307, "r": 272.635253, "b": 429.411602 }, "text": "TOTAL", "attrs": { "row": 2, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p135.5.21", "order": 29, "type": "table_cell", "bbox": { "l": 288.228786, "t": 436.120307, "r": 321.173101, "b": 387.65159600000004 }, "text": "OVERLAND THROUGH AREA ( ^{{7}} A)", "attrs": { "row": 2, "col": 6, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p135.5.22", "order": 30, "type": "table_cell", "bbox": { "l": 335.879997, "t": 436.120307, "r": 366.275579, "b": 422.40286000000003 }, "text": "THROUGH AREA ( ^{{T}} P)", "attrs": { "row": 2, "col": 7, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p135.5.23", "order": 31, "type": "table_cell", "bbox": { "l": 379.919999, "t": 436.120307, "r": 425.574401, "b": 429.411602 }, "text": "ACCUMULATED", "attrs": { "row": 2, "col": 8, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 22 }, { "id": "p135.5.24", "order": 32, "type": "table_cell", "bbox": { "l": 438.839996, "t": 436.120307, "r": 470.255494, "b": 422.451603 }, "text": "RAINFALL INTENSITY", "attrs": { "row": 2, "col": 9, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 23 }, { "id": "p135.5.25", "order": 33, "type": "table_cell", "bbox": { "l": 484.800018, "t": 436.120307, "r": 509.880526, "b": 422.451603 }, "text": "PEAK RUNOFF", "attrs": { "row": 2, "col": 10, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 24 }, { "id": "p135.5.26", "order": 34, "type": "table_cell", "bbox": { "l": 524.519989, "t": 436.120307, "r": 555.495693, "b": 429.411602 }, "text": "DIAMETER", "attrs": { "row": 2, "col": 11, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 25 }, { "id": "p135.5.27", "order": 35, "type": "table_cell", "bbox": { "l": 570.599991, "t": 436.120307, "r": 594.995107, "b": 429.411602 }, "text": "LENGTH", "attrs": { "row": 2, "col": 12, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 26 }, { "id": "p135.5.28", "order": 36, "type": "table_cell", "bbox": { "l": 610.919999, "t": 436.120307, "r": 630.877703, "b": 429.411602 }, "text": "SLOPE", "attrs": { "row": 2, "col": 13, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 27 }, { "id": "p135.5.29", "order": 37, "type": "table_cell", "bbox": { "l": 645.240005, "t": 436.120307, "r": 675.16569, "b": 415.49159299999997 }, "text": "CAPACITY AT FULL FLOW", "attrs": { "row": 2, "col": 14, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 28 }, { "id": "p135.5.30", "order": 38, "type": "table_cell", "bbox": { "l": 689.160004, "t": 436.120307, "r": 718.856152, "b": 415.49159299999997 }, "text": "VELOCITY AT FULL FLOW", "attrs": { "row": 2, "col": 15, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 29 }, { "id": "p135.5.31", "order": 39, "type": "table_cell", "bbox": { "l": 734.160004, "t": 436.120307, "r": 763.856152, "b": 422.451603 }, "text": "VELOCITY ACTUAL", "attrs": { "row": 2, "col": 16, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 30 }, { "id": "p135.5.32", "order": 40, "type": "table_cell", "bbox": { "l": 142.080002, "t": 408.640308, "r": 154.434407, "b": 401.931602 }, "text": "(AC)", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 31 }, { "id": "p135.5.33", "order": 41, "type": "table_cell", "bbox": { "l": 188.741382, "t": 408.640308, "r": 193.081602, "b": 401.931602 }, "text": "C", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 32 }, { "id": "p135.5.34", "order": 42, "type": "table_cell", "bbox": { "l": 199.1012, "t": 412.3886, "r": 243.4165, "b": 392.4114 }, "text": "A × C", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 33 }, { "id": "p135.5.35", "order": 43, "type": "table_cell", "bbox": { "l": 243.4165, "t": 412.3886, "r": 287.7318, "b": 392.4114 }, "text": "(3A × C)", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 34 }, { "id": "p135.5.36", "order": 44, "type": "table_cell", "bbox": { "l": 297.120003, "t": 408.640308, "r": 312.226614, "b": 401.931602 }, "text": "(MIN)", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 35 }, { "id": "p135.5.37", "order": 45, "type": "table_cell", "bbox": { "l": 343.588009, "t": 408.640308, "r": 358.652587, "b": 401.931602 }, "text": "(MIN)", "attrs": { "row": 3, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 36 }, { "id": "p135.5.38", "order": 46, "type": "table_cell", "bbox": { "l": 395.304001, "t": 408.640308, "r": 410.410612, "b": 401.931602 }, "text": "(MIN)", "attrs": { "row": 3, "col": 6, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 37 }, { "id": "p135.5.39", "order": 47, "type": "table_cell", "bbox": { "l": 444.417017, "t": 408.640308, "r": 464.826678, "b": 401.931602 }, "text": "(IN/HR)", "attrs": { "row": 3, "col": 7, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 38 }, { "id": "p135.5.40", "order": 48, "type": "table_cell", "bbox": { "l": 489.335095, "t": 408.640308, "r": 505.343413, "b": 401.931602 }, "text": "(CFS)", "attrs": { "row": 3, "col": 8, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 39 }, { "id": "p135.5.41", "order": 49, "type": "table_cell", "bbox": { "l": 526.72591, "t": 408.640308, "r": 553.400444, "b": 401.931602 }, "text": "(INCHES)", "attrs": { "row": 3, "col": 9, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 40 }, { "id": "p135.5.42", "order": 50, "type": "table_cell", "bbox": { "l": 577.307723, "t": 408.640308, "r": 588.687274, "b": 401.931602 }, "text": "(FT)", "attrs": { "row": 3, "col": 10, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 41 }, { "id": "p135.5.43", "order": 51, "type": "table_cell", "bbox": { "l": 597.9388, "t": 412.3886, "r": 642.2541, "b": 392.4114 }, "text": "(%)", "attrs": { "row": 3, "col": 11, "rowspan": 1, "colspan": 1 }, "reading_order": 42 }, { "id": "p135.5.44", "order": 52, "type": "table_cell", "bbox": { "l": 652.329807, "t": 408.640308, "r": 668.369239, "b": 401.931602 }, "text": "(CFS)", "attrs": { "row": 3, "col": 12, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 43 }, { "id": "p135.5.45", "order": 53, "type": "table_cell", "bbox": { "l": 696.244032, "t": 408.640308, "r": 711.891667, "b": 401.931602 }, "text": "(FPS)", "attrs": { "row": 3, "col": 13, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 44 }, { "id": "p135.5.46", "order": 54, "type": "table_cell", "bbox": { "l": 730.8847, "t": 412.3886, "r": 775.2, "b": 392.4114 }, "text": "", "attrs": { "row": 3, "col": 14, "rowspan": 1, "colspan": 1 }, "reading_order": 45 }, { "id": "p135.5.47", "order": 55, "type": "table_cell", "bbox": { "l": 45.599999, "t": 394.360302, "r": 52.988907, "b": 387.65159600000004 }, "text": "(1)", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 46 }, { "id": "p135.5.48", "order": 56, "type": "table_cell", "bbox": { "l": 99.498993, "t": 394.360302, "r": 106.887901, "b": 387.65159600000004 }, "text": "(2)", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 47 }, { "id": "p135.5.49", "order": 57, "type": "table_cell", "bbox": { "l": 144.621365, "t": 394.360302, "r": 152.010273, "b": 387.65159600000004 }, "text": "(3)", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 48 }, { "id": "p135.5.50", "order": 58, "type": "table_cell", "bbox": { "l": 187.218954, "t": 394.360302, "r": 194.607862, "b": 387.65159600000004 }, "text": "(4)", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 49 }, { "id": "p135.5.51", "order": 59, "type": "table_cell", "bbox": { "l": 227.772673, "t": 394.360302, "r": 235.161581, "b": 387.65159600000004 }, "text": "(5)", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 50 }, { "id": "p135.5.52", "order": 60, "type": "table_cell", "bbox": { "l": 259.249201, "t": 394.360302, "r": 266.638109, "b": 387.65159600000004 }, "text": "(6)", "attrs": { "row": 4, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 51 }, { "id": "p135.5.53", "order": 61, "type": "table_cell", "bbox": { "l": 101.279995, "t": 102.79076400000002, "r": 105.157098, "b": 95.00866399999995 }, "text": "(7)", "attrs": { "row": 4, "col": 6, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 52 }, { "id": "p135.5.54", "order": 62, "type": "table_cell", "bbox": { "l": 347.450073, "t": 394.360302, "r": 354.838981, "b": 387.65159600000004 }, "text": "(8)", "attrs": { "row": 4, "col": 7, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 53 }, { "id": "p135.5.55", "order": 63, "type": "table_cell", "bbox": { "l": 399.184969, "t": 394.360302, "r": 406.573877, "b": 387.65159600000004 }, "text": "(9)", "attrs": { "row": 4, "col": 8, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 54 }, { "id": "p135.5.56", "order": 64, "type": "table_cell", "bbox": { "l": 449.236676, "t": 394.360302, "r": 459.96883, "b": 387.65159600000004 }, "text": "(10)", "attrs": { "row": 4, "col": 9, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 55 }, { "id": "p135.5.57", "order": 65, "type": "table_cell", "bbox": { "l": 491.931364, "t": 394.360302, "r": 502.746761, "b": 387.65159600000004 }, "text": "(11)", "attrs": { "row": 4, "col": 10, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 56 }, { "id": "p135.5.58", "order": 66, "type": "table_cell", "bbox": { "l": 534.769409, "t": 394.360302, "r": 545.584806, "b": 387.65159600000004 }, "text": "(12)", "attrs": { "row": 4, "col": 11, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 57 }, { "id": "p135.5.59", "order": 67, "type": "table_cell", "bbox": { "l": 577.547341, "t": 394.360302, "r": 588.24251, "b": 387.65159600000004 }, "text": "(13)", "attrs": { "row": 4, "col": 12, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 58 }, { "id": "p135.5.60", "order": 68, "type": "table_cell", "bbox": { "l": 615.714587, "t": 394.360302, "r": 626.409756, "b": 387.65159600000004 }, "text": "(14)", "attrs": { "row": 4, "col": 13, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 59 }, { "id": "p135.5.61", "order": 69, "type": "table_cell", "bbox": { "l": 654.963882, "t": 394.360302, "r": 665.659052, "b": 387.65159600000004 }, "text": "(15)", "attrs": { "row": 4, "col": 14, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 60 }, { "id": "p135.5.62", "order": 70, "type": "table_cell", "bbox": { "l": 698.78183, "t": 394.360302, "r": 709.471951, "b": 387.65159600000004 }, "text": "(16)", "attrs": { "row": 4, "col": 15, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 61 }, { "id": "p135.5.63", "order": 71, "type": "table_cell", "bbox": { "l": 730.8847, "t": 392.4114, "r": 775.2, "b": 372.4343 }, "text": "", "attrs": { "row": 4, "col": 16, "rowspan": 1, "colspan": 1 }, "reading_order": 62 }, { "id": "p135.5.64", "order": 72, "type": "table_cell", "bbox": { "l": 47.280001, "t": 374.470757, "r": 51.157104, "b": 366.68865700000003 }, "text": "5", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 63 }, { "id": "p135.5.65", "order": 73, "type": "table_cell", "bbox": { "l": 93.479999, "t": 374.470757, "r": 112.816649, "b": 366.68865700000003 }, "text": "FES 1", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 64 }, { "id": "p135.5.66", "order": 74, "type": "table_cell", "bbox": { "l": 141.359997, "t": 374.470757, "r": 154.984473, "b": 366.68865700000003 }, "text": "0.18", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 65 }, { "id": "p135.5.67", "order": 75, "type": "table_cell", "bbox": { "l": 186.959999, "t": 374.470757, "r": 194.672367, "b": 366.68865700000003 }, "text": "30", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 66 }, { "id": "p135.5.68", "order": 76, "type": "table_cell", "bbox": { "l": 224.519989, "t": 374.470757, "r": 238.144465, "b": 366.68865700000003 }, "text": "0.05", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 67 }, { "id": "p135.5.69", "order": 77, "type": "table_cell", "bbox": { "l": 256.080002, "t": 374.470757, "r": 269.704478, "b": 366.68865700000003 }, "text": "0.05", "attrs": { "row": 5, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 68 }, { "id": "p135.5.70", "order": 78, "type": "table_cell", "bbox": { "l": 300.719993, "t": 374.470757, "r": 308.432361, "b": 366.68865700000003 }, "text": "15", "attrs": { "row": 5, "col": 6, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 69 }, { "id": "p135.5.71", "order": 79, "type": "table_cell", "bbox": { "l": 332.0471, "t": 372.4343, "r": 376.3624, "b": 352.4571 }, "text": "", "attrs": { "row": 5, "col": 7, "rowspan": 1, "colspan": 1 }, "reading_order": 70 }, { "id": "p135.5.72", "order": 80, "type": "table_cell", "bbox": { "l": 398.88002, "t": 374.470757, "r": 406.592388, "b": 366.68865700000003 }, "text": "15", "attrs": { "row": 5, "col": 8, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 71 }, { "id": "p135.5.73", "order": 81, "type": "table_cell", "bbox": { "l": 449.640015, "t": 374.470757, "r": 459.289763, "b": 366.68865700000003 }, "text": "5.7", "attrs": { "row": 5, "col": 9, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 72 }, { "id": "p135.5.74", "order": 82, "type": "table_cell", "bbox": { "l": 492.359985, "t": 374.470757, "r": 502.009733, "b": 366.68865700000003 }, "text": "0.3", "attrs": { "row": 5, "col": 10, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 73 }, { "id": "p135.5.75", "order": 83, "type": "table_cell", "bbox": { "l": 536.160004, "t": 374.470757, "r": 543.872371, "b": 366.68865700000003 }, "text": "15", "attrs": { "row": 5, "col": 11, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 74 }, { "id": "p135.5.76", "order": 84, "type": "table_cell", "bbox": { "l": 576.960022, "t": 374.470757, "r": 588.507653, "b": 366.68865700000003 }, "text": "153", "attrs": { "row": 5, "col": 12, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 75 }, { "id": "p135.5.77", "order": 85, "type": "table_cell", "bbox": { "l": 614.160004, "t": 374.470757, "r": 627.78448, "b": 366.68865700000003 }, "text": "0.50", "attrs": { "row": 5, "col": 13, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 76 }, { "id": "p135.5.78", "order": 86, "type": "table_cell", "bbox": { "l": 655.320008, "t": 374.470757, "r": 664.969755, "b": 366.68865700000003 }, "text": "5.9", "attrs": { "row": 5, "col": 14, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 77 }, { "id": "p135.5.79", "order": 87, "type": "table_cell", "bbox": { "l": 699.11998, "t": 374.470757, "r": 708.769728, "b": 366.68865700000003 }, "text": "4.8", "attrs": { "row": 5, "col": 15, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 78 }, { "id": "p135.5.80", "order": 88, "type": "table_cell", "bbox": { "l": 730.8847, "t": 372.4343, "r": 775.2, "b": 352.4571 }, "text": "", "attrs": { "row": 5, "col": 16, "rowspan": 1, "colspan": 1 }, "reading_order": 79 }, { "id": "p135.5.81", "order": 89, "type": "table_cell", "bbox": { "l": 21.84, "t": 352.4571, "r": 66.1553, "b": 332.48 }, "text": "", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 80 }, { "id": "p135.5.82", "order": 90, "type": "table_cell", "bbox": { "l": 66.1553, "t": 352.4571, "r": 110.4706, "b": 332.48 }, "text": "", "attrs": { "row": 6, "col": 1, "rowspan": 1, "colspan": 1 }, "reading_order": 81 }, { "id": "p135.5.83", "order": 91, "type": "table_cell", "bbox": { "l": 110.4706, "t": 352.4571, "r": 154.7859, "b": 332.48 }, "text": "", "attrs": { "row": 6, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 82 }, { "id": "p135.5.84", "order": 92, "type": "table_cell", "bbox": { "l": 154.7859, "t": 352.4571, "r": 199.1012, "b": 332.48 }, "text": "", "attrs": { "row": 6, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 83 }, { "id": "p135.5.85", "order": 93, "type": "table_cell", "bbox": { "l": 199.1012, "t": 352.4571, "r": 243.4165, "b": 332.48 }, "text": "", "attrs": { "row": 6, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 84 }, { "id": "p135.5.86", "order": 94, "type": "table_cell", "bbox": { "l": 243.4165, "t": 352.4571, "r": 287.7318, "b": 332.48 }, "text": "", "attrs": { "row": 6, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 85 }, { "id": "p135.5.87", "order": 95, "type": "table_cell", "bbox": { "l": 287.7318, "t": 352.4571, "r": 332.0471, "b": 332.48 }, "text": "", "attrs": { "row": 6, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 86 }, { "id": "p135.5.88", "order": 96, "type": "table_cell", "bbox": { "l": 332.0471, "t": 352.4571, "r": 376.3624, "b": 332.48 }, "text": "", "attrs": { "row": 6, "col": 7, "rowspan": 1, "colspan": 1 }, "reading_order": 87 }, { "id": "p135.5.89", "order": 97, "type": "table_cell", "bbox": { "l": 376.3624, "t": 352.4571, "r": 420.6776, "b": 332.48 }, "text": "", "attrs": { "row": 6, "col": 8, "rowspan": 1, "colspan": 1 }, "reading_order": 88 }, { "id": "p135.5.90", "order": 98, "type": "table_cell", "bbox": { "l": 420.6776, "t": 352.4571, "r": 464.9929, "b": 332.48 }, "text": "", "attrs": { "row": 6, "col": 9, "rowspan": 1, "colspan": 1 }, "reading_order": 89 }, { "id": "p135.5.91", "order": 99, "type": "table_cell", "bbox": { "l": 464.9929, "t": 352.4571, "r": 509.3082, "b": 332.48 }, "text": "", "attrs": { "row": 6, "col": 10, "rowspan": 1, "colspan": 1 }, "reading_order": 90 }, { "id": "p135.5.92", "order": 100, "type": "table_cell", "bbox": { "l": 509.3082, "t": 352.4571, "r": 553.6235, "b": 332.48 }, "text": "", "attrs": { "row": 6, "col": 11, "rowspan": 1, "colspan": 1 }, "reading_order": 91 }, { "id": "p135.5.93", "order": 101, "type": "table_cell", "bbox": { "l": 553.6235, "t": 352.4571, "r": 597.9388, "b": 332.48 }, "text": "", "attrs": { "row": 6, "col": 12, "rowspan": 1, "colspan": 1 }, "reading_order": 92 }, { "id": "p135.5.94", "order": 102, "type": "table_cell", "bbox": { "l": 597.9388, "t": 352.4571, "r": 642.2541, "b": 332.48 }, "text": "", "attrs": { "row": 6, "col": 13, "rowspan": 1, "colspan": 1 }, "reading_order": 93 }, { "id": "p135.5.95", "order": 103, "type": "table_cell", "bbox": { "l": 642.2541, "t": 352.4571, "r": 686.5694, "b": 332.48 }, "text": "", "attrs": { "row": 6, "col": 14, "rowspan": 1, "colspan": 1 }, "reading_order": 94 }, { "id": "p135.5.96", "order": 104, "type": "table_cell", "bbox": { "l": 686.5694, "t": 352.4571, "r": 730.8847, "b": 332.48 }, "text": "", "attrs": { "row": 6, "col": 15, "rowspan": 1, "colspan": 1 }, "reading_order": 95 }, { "id": "p135.5.97", "order": 105, "type": "table_cell", "bbox": { "l": 730.8847, "t": 352.4571, "r": 775.2, "b": 332.48 }, "text": "", "attrs": { "row": 6, "col": 16, "rowspan": 1, "colspan": 1 }, "reading_order": 96 }, { "id": "p135.5.98", "order": 106, "type": "table_cell", "bbox": { "l": 40.319999, "t": 332.59076, "r": 58.092307, "b": 324.80866 }, "text": "O/S 3", "attrs": { "row": 7, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 97 }, { "id": "p135.5.99", "order": 107, "type": "table_cell", "bbox": { "l": 101.279995, "t": 332.59076, "r": 105.157098, "b": 324.80866 }, "text": "2", "attrs": { "row": 7, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 98 }, { "id": "p135.5.100", "order": 108, "type": "table_cell", "bbox": { "l": 110.4706, "t": 332.48, "r": 154.7859, "b": 312.5029 }, "text": "", "attrs": { "row": 7, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 99 }, { "id": "p135.5.101", "order": 109, "type": "table_cell", "bbox": { "l": 154.7859, "t": 332.48, "r": 199.1012, "b": 312.5029 }, "text": "", "attrs": { "row": 7, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 100 }, { "id": "p135.5.102", "order": 110, "type": "table_cell", "bbox": { "l": 199.1012, "t": 332.48, "r": 243.4165, "b": 312.5029 }, "text": "", "attrs": { "row": 7, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 101 }, { "id": "p135.5.103", "order": 111, "type": "table_cell", "bbox": { "l": 243.4165, "t": 332.48, "r": 287.7318, "b": 312.5029 }, "text": "", "attrs": { "row": 7, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 102 }, { "id": "p135.5.104", "order": 112, "type": "table_cell", "bbox": { "l": 287.7318, "t": 332.48, "r": 332.0471, "b": 312.5029 }, "text": "", "attrs": { "row": 7, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 103 }, { "id": "p135.5.105", "order": 113, "type": "table_cell", "bbox": { "l": 332.0471, "t": 332.48, "r": 376.3624, "b": 312.5029 }, "text": "", "attrs": { "row": 7, "col": 7, "rowspan": 1, "colspan": 1 }, "reading_order": 104 }, { "id": "p135.5.106", "order": 114, "type": "table_cell", "bbox": { "l": 376.3624, "t": 332.48, "r": 420.6776, "b": 312.5029 }, "text": "", "attrs": { "row": 7, "col": 8, "rowspan": 1, "colspan": 1 }, "reading_order": 105 }, { "id": "p135.5.107", "order": 115, "type": "table_cell", "bbox": { "l": 420.6776, "t": 332.48, "r": 464.9929, "b": 312.5029 }, "text": "", "attrs": { "row": 7, "col": 9, "rowspan": 1, "colspan": 1 }, "reading_order": 106 }, { "id": "p135.5.108", "order": 116, "type": "table_cell", "bbox": { "l": 492.359985, "t": 332.59076, "r": 502.009733, "b": 324.80866 }, "text": "1.3", "attrs": { "row": 7, "col": 10, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 107 }, { "id": "p135.5.109", "order": 117, "type": "table_cell", "bbox": { "l": 536.160004, "t": 332.59076, "r": 543.872371, "b": 324.80866 }, "text": "15", "attrs": { "row": 7, "col": 11, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 108 }, { "id": "p135.5.110", "order": 118, "type": "table_cell", "bbox": { "l": 578.88002, "t": 332.59076, "r": 586.592388, "b": 324.80866 }, "text": "10", "attrs": { "row": 7, "col": 12, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 109 }, { "id": "p135.5.111", "order": 119, "type": "table_cell", "bbox": { "l": 614.160004, "t": 332.59076, "r": 627.78448, "b": 324.80866 }, "text": "0.50", "attrs": { "row": 7, "col": 13, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 110 }, { "id": "p135.5.112", "order": 120, "type": "table_cell", "bbox": { "l": 655.320008, "t": 332.59076, "r": 664.969755, "b": 324.80866 }, "text": "5.9", "attrs": { "row": 7, "col": 14, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 111 }, { "id": "p135.5.113", "order": 121, "type": "table_cell", "bbox": { "l": 699.11998, "t": 332.59076, "r": 708.769728, "b": 324.80866 }, "text": "4.8", "attrs": { "row": 7, "col": 15, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 112 }, { "id": "p135.5.114", "order": 122, "type": "table_cell", "bbox": { "l": 730.8847, "t": 332.48, "r": 775.2, "b": 312.5029 }, "text": "", "attrs": { "row": 7, "col": 16, "rowspan": 1, "colspan": 1 }, "reading_order": 113 }, { "id": "p135.5.115", "order": 123, "type": "table_cell", "bbox": { "l": 47.280001, "t": 311.710762, "r": 51.157104, "b": 303.928662 }, "text": "2", "attrs": { "row": 8, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 114 }, { "id": "p135.5.116", "order": 124, "type": "table_cell", "bbox": { "l": 101.279995, "t": 311.710762, "r": 105.157098, "b": 303.928662 }, "text": "3", "attrs": { "row": 8, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 115 }, { "id": "p135.5.117", "order": 125, "type": "table_cell", "bbox": { "l": 141.359997, "t": 311.710762, "r": 154.984473, "b": 303.928662 }, "text": "0.16", "attrs": { "row": 8, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 116 }, { "id": "p135.5.118", "order": 126, "type": "table_cell", "bbox": { "l": 186.959999, "t": 311.710762, "r": 194.677099, "b": 303.928662 }, "text": "80", "attrs": { "row": 8, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 117 }, { "id": "p135.5.119", "order": 127, "type": "table_cell", "bbox": { "l": 224.519989, "t": 311.710762, "r": 238.144465, "b": 303.928662 }, "text": "0.13", "attrs": { "row": 8, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 118 }, { "id": "p135.5.120", "order": 128, "type": "table_cell", "bbox": { "l": 256.080002, "t": 311.710762, "r": 269.704478, "b": 303.928662 }, "text": "0.13", "attrs": { "row": 8, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 119 }, { "id": "p135.5.121", "order": 129, "type": "table_cell", "bbox": { "l": 300.719993, "t": 311.710762, "r": 308.432361, "b": 303.928662 }, "text": "15", "attrs": { "row": 8, "col": 6, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 120 }, { "id": "p135.5.122", "order": 130, "type": "table_cell", "bbox": { "l": 332.0471, "t": 312.5029, "r": 376.3624, "b": 292.5257 }, "text": "", "attrs": { "row": 8, "col": 7, "rowspan": 1, "colspan": 1 }, "reading_order": 121 }, { "id": "p135.5.123", "order": 131, "type": "table_cell", "bbox": { "l": 398.88002, "t": 311.710762, "r": 406.592388, "b": 303.928662 }, "text": "15", "attrs": { "row": 8, "col": 8, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 122 }, { "id": "p135.5.124", "order": 132, "type": "table_cell", "bbox": { "l": 449.640015, "t": 311.710762, "r": 459.289763, "b": 303.928662 }, "text": "5.7", "attrs": { "row": 8, "col": 9, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 123 }, { "id": "p135.5.125", "order": 133, "type": "table_cell", "bbox": { "l": 492.359985, "t": 311.710762, "r": 502.009733, "b": 303.928662 }, "text": "2.0", "attrs": { "row": 8, "col": 10, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 124 }, { "id": "p135.5.126", "order": 134, "type": "table_cell", "bbox": { "l": 536.160004, "t": 311.710762, "r": 543.872371, "b": 303.928662 }, "text": "15", "attrs": { "row": 8, "col": 11, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 125 }, { "id": "p135.5.127", "order": 135, "type": "table_cell", "bbox": { "l": 578.88002, "t": 311.710762, "r": 586.592388, "b": 303.928662 }, "text": "47", "attrs": { "row": 8, "col": 12, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 126 }, { "id": "p135.5.128", "order": 136, "type": "table_cell", "bbox": { "l": 614.160004, "t": 311.710762, "r": 627.78448, "b": 303.928662 }, "text": "0.50", "attrs": { "row": 8, "col": 13, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 127 }, { "id": "p135.5.129", "order": 137, "type": "table_cell", "bbox": { "l": 655.320008, "t": 311.710762, "r": 664.969755, "b": 303.928662 }, "text": "5.9", "attrs": { "row": 8, "col": 14, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 128 }, { "id": "p135.5.130", "order": 138, "type": "table_cell", "bbox": { "l": 699.11998, "t": 311.710762, "r": 708.769728, "b": 303.928662 }, "text": "4.8", "attrs": { "row": 8, "col": 15, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 129 }, { "id": "p135.5.131", "order": 139, "type": "table_cell", "bbox": { "l": 730.8847, "t": 312.5029, "r": 775.2, "b": 292.5257 }, "text": "", "attrs": { "row": 8, "col": 16, "rowspan": 1, "colspan": 1 }, "reading_order": 130 }, { "id": "p135.5.132", "order": 140, "type": "table_cell", "bbox": { "l": 47.280001, "t": 290.830742, "r": 51.157104, "b": 283.048642 }, "text": "3", "attrs": { "row": 9, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 131 }, { "id": "p135.5.133", "order": 141, "type": "table_cell", "bbox": { "l": 101.279995, "t": 290.830742, "r": 105.157098, "b": 283.048642 }, "text": "4", "attrs": { "row": 9, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 132 }, { "id": "p135.5.134", "order": 142, "type": "table_cell", "bbox": { "l": 141.359997, "t": 290.830742, "r": 154.984473, "b": 283.048642 }, "text": "0.16", "attrs": { "row": 9, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 133 }, { "id": "p135.5.135", "order": 143, "type": "table_cell", "bbox": { "l": 186.959999, "t": 290.830742, "r": 194.677099, "b": 283.048642 }, "text": "80", "attrs": { "row": 9, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 134 }, { "id": "p135.5.136", "order": 144, "type": "table_cell", "bbox": { "l": 224.519989, "t": 290.830742, "r": 238.144465, "b": 283.048642 }, "text": "0.13", "attrs": { "row": 9, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 135 }, { "id": "p135.5.137", "order": 145, "type": "table_cell", "bbox": { "l": 256.080002, "t": 290.830742, "r": 269.704478, "b": 283.048642 }, "text": "0.26", "attrs": { "row": 9, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 136 }, { "id": "p135.5.138", "order": 146, "type": "table_cell", "bbox": { "l": 300.719993, "t": 290.830742, "r": 308.432361, "b": 283.048642 }, "text": "15", "attrs": { "row": 9, "col": 6, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 137 }, { "id": "p135.5.139", "order": 147, "type": "table_cell", "bbox": { "l": 349.080002, "t": 290.830742, "r": 352.957105, "b": 283.048642 }, "text": "1", "attrs": { "row": 9, "col": 7, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 138 }, { "id": "p135.5.140", "order": 148, "type": "table_cell", "bbox": { "l": 398.88002, "t": 290.830742, "r": 406.592388, "b": 283.048642 }, "text": "16", "attrs": { "row": 9, "col": 8, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 139 }, { "id": "p135.5.141", "order": 149, "type": "table_cell", "bbox": { "l": 449.640015, "t": 290.830742, "r": 459.289763, "b": 283.048642 }, "text": "5.5", "attrs": { "row": 9, "col": 9, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 140 }, { "id": "p135.5.142", "order": 150, "type": "table_cell", "bbox": { "l": 492.359985, "t": 290.830742, "r": 502.009733, "b": 283.048642 }, "text": "2.7", "attrs": { "row": 9, "col": 10, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 141 }, { "id": "p135.5.143", "order": 151, "type": "table_cell", "bbox": { "l": 536.160004, "t": 290.830742, "r": 543.872371, "b": 283.048642 }, "text": "15", "attrs": { "row": 9, "col": 11, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 142 }, { "id": "p135.5.144", "order": 152, "type": "table_cell", "bbox": { "l": 576.960022, "t": 290.830742, "r": 588.507653, "b": 283.048642 }, "text": "161", "attrs": { "row": 9, "col": 12, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 143 }, { "id": "p135.5.145", "order": 153, "type": "table_cell", "bbox": { "l": 614.160004, "t": 290.830742, "r": 627.78448, "b": 283.048642 }, "text": "0.50", "attrs": { "row": 9, "col": 13, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 144 }, { "id": "p135.5.146", "order": 154, "type": "table_cell", "bbox": { "l": 655.320008, "t": 290.830742, "r": 664.969755, "b": 283.048642 }, "text": "5.9", "attrs": { "row": 9, "col": 14, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 145 }, { "id": "p135.5.147", "order": 155, "type": "table_cell", "bbox": { "l": 699.11998, "t": 290.830742, "r": 708.769728, "b": 283.048642 }, "text": "4.8", "attrs": { "row": 9, "col": 15, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 146 }, { "id": "p135.5.148", "order": 156, "type": "table_cell", "bbox": { "l": 730.8847, "t": 292.5257, "r": 775.2, "b": 272.5486 }, "text": "", "attrs": { "row": 9, "col": 16, "rowspan": 1, "colspan": 1 }, "reading_order": 147 }, { "id": "p135.5.149", "order": 157, "type": "table_cell", "bbox": { "l": 47.280001, "t": 269.950745, "r": 51.157104, "b": 262.168645 }, "text": "4", "attrs": { "row": 10, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 148 }, { "id": "p135.5.150", "order": 158, "type": "table_cell", "bbox": { "l": 93.479999, "t": 269.950745, "r": 112.816649, "b": 262.168645 }, "text": "FES 2", "attrs": { "row": 10, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 149 }, { "id": "p135.5.151", "order": 159, "type": "table_cell", "bbox": { "l": 141.359997, "t": 269.950745, "r": 154.984473, "b": 262.168645 }, "text": "0.03", "attrs": { "row": 10, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 150 }, { "id": "p135.5.152", "order": 160, "type": "table_cell", "bbox": { "l": 186.959999, "t": 269.950745, "r": 194.672367, "b": 262.168645 }, "text": "80", "attrs": { "row": 10, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 151 }, { "id": "p135.5.153", "order": 161, "type": "table_cell", "bbox": { "l": 224.519989, "t": 269.950745, "r": 238.144465, "b": 262.168645 }, "text": "0.02", "attrs": { "row": 10, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 152 }, { "id": "p135.5.154", "order": 162, "type": "table_cell", "bbox": { "l": 256.080002, "t": 269.950745, "r": 269.704478, "b": 262.168645 }, "text": "0.28", "attrs": { "row": 10, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 153 }, { "id": "p135.5.155", "order": 163, "type": "table_cell", "bbox": { "l": 300.719993, "t": 269.950745, "r": 308.432361, "b": 262.168645 }, "text": "15", "attrs": { "row": 10, "col": 6, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 154 }, { "id": "p135.5.156", "order": 164, "type": "table_cell", "bbox": { "l": 349.080002, "t": 269.950745, "r": 352.957105, "b": 262.168645 }, "text": "1", "attrs": { "row": 10, "col": 7, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 155 }, { "id": "p135.5.157", "order": 165, "type": "table_cell", "bbox": { "l": 398.88002, "t": 269.950745, "r": 406.592388, "b": 262.168645 }, "text": "17", "attrs": { "row": 10, "col": 8, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 156 }, { "id": "p135.5.158", "order": 166, "type": "table_cell", "bbox": { "l": 449.640015, "t": 269.950745, "r": 459.289763, "b": 262.168645 }, "text": "5.3", "attrs": { "row": 10, "col": 9, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 157 }, { "id": "p135.5.159", "order": 167, "type": "table_cell", "bbox": { "l": 492.359985, "t": 269.950745, "r": 502.009733, "b": 262.168645 }, "text": "2.8", "attrs": { "row": 10, "col": 10, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 158 }, { "id": "p135.5.160", "order": 168, "type": "table_cell", "bbox": { "l": 536.160004, "t": 269.950745, "r": 543.872371, "b": 262.168645 }, "text": "15", "attrs": { "row": 10, "col": 11, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 159 }, { "id": "p135.5.161", "order": 169, "type": "table_cell", "bbox": { "l": 578.88002, "t": 269.950745, "r": 586.592388, "b": 262.168645 }, "text": "52", "attrs": { "row": 10, "col": 12, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 160 }, { "id": "p135.5.162", "order": 170, "type": "table_cell", "bbox": { "l": 614.160004, "t": 269.950745, "r": 627.78448, "b": 262.168645 }, "text": "0.50", "attrs": { "row": 10, "col": 13, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 161 }, { "id": "p135.5.163", "order": 171, "type": "table_cell", "bbox": { "l": 655.320008, "t": 269.950745, "r": 664.969755, "b": 262.168645 }, "text": "5.9", "attrs": { "row": 10, "col": 14, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 162 }, { "id": "p135.5.164", "order": 172, "type": "table_cell", "bbox": { "l": 699.11998, "t": 269.950745, "r": 708.769728, "b": 262.168645 }, "text": "4.8", "attrs": { "row": 10, "col": 15, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 163 }, { "id": "p135.5.165", "order": 173, "type": "table_cell", "bbox": { "l": 730.8847, "t": 272.5486, "r": 775.2, "b": 252.5714 }, "text": "", "attrs": { "row": 10, "col": 16, "rowspan": 1, "colspan": 1 }, "reading_order": 164 }, { "id": "p135.5.166", "order": 174, "type": "table_cell", "bbox": { "l": 21.84, "t": 252.5714, "r": 66.1553, "b": 232.5943 }, "text": "", "attrs": { "row": 11, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 165 }, { "id": "p135.5.167", "order": 175, "type": "table_cell", "bbox": { "l": 66.1553, "t": 252.5714, "r": 110.4706, "b": 232.5943 }, "text": "", "attrs": { "row": 11, "col": 1, "rowspan": 1, "colspan": 1 }, "reading_order": 166 }, { "id": "p135.5.168", "order": 176, "type": "table_cell", "bbox": { "l": 110.4706, "t": 252.5714, "r": 154.7859, "b": 232.5943 }, "text": "", "attrs": { "row": 11, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 167 }, { "id": "p135.5.169", "order": 177, "type": "table_cell", "bbox": { "l": 154.7859, "t": 252.5714, "r": 199.1012, "b": 232.5943 }, "text": "", "attrs": { "row": 11, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 168 }, { "id": "p135.5.170", "order": 178, "type": "table_cell", "bbox": { "l": 199.1012, "t": 252.5714, "r": 243.4165, "b": 232.5943 }, "text": "", "attrs": { "row": 11, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 169 }, { "id": "p135.5.171", "order": 179, "type": "table_cell", "bbox": { "l": 243.4165, "t": 252.5714, "r": 287.7318, "b": 232.5943 }, "text": "", "attrs": { "row": 11, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 170 }, { "id": "p135.5.172", "order": 180, "type": "table_cell", "bbox": { "l": 287.7318, "t": 252.5714, "r": 332.0471, "b": 232.5943 }, "text": "", "attrs": { "row": 11, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 171 }, { "id": "p135.5.173", "order": 181, "type": "table_cell", "bbox": { "l": 332.0471, "t": 252.5714, "r": 376.3624, "b": 232.5943 }, "text": "", "attrs": { "row": 11, "col": 7, "rowspan": 1, "colspan": 1 }, "reading_order": 172 }, { "id": "p135.5.174", "order": 182, "type": "table_cell", "bbox": { "l": 376.3624, "t": 252.5714, "r": 420.6776, "b": 232.5943 }, "text": "", "attrs": { "row": 11, "col": 8, "rowspan": 1, "colspan": 1 }, "reading_order": 173 }, { "id": "p135.5.175", "order": 183, "type": "table_cell", "bbox": { "l": 420.6776, "t": 252.5714, "r": 464.9929, "b": 232.5943 }, "text": "", "attrs": { "row": 11, "col": 9, "rowspan": 1, "colspan": 1 }, "reading_order": 174 }, { "id": "p135.5.176", "order": 184, "type": "table_cell", "bbox": { "l": 464.9929, "t": 252.5714, "r": 509.3082, "b": 232.5943 }, "text": "", "attrs": { "row": 11, "col": 10, "rowspan": 1, "colspan": 1 }, "reading_order": 175 }, { "id": "p135.5.177", "order": 185, "type": "table_cell", "bbox": { "l": 509.3082, "t": 252.5714, "r": 553.6235, "b": 232.5943 }, "text": "", "attrs": { "row": 11, "col": 11, "rowspan": 1, "colspan": 1 }, "reading_order": 176 }, { "id": "p135.5.178", "order": 186, "type": "table_cell", "bbox": { "l": 553.6235, "t": 252.5714, "r": 597.9388, "b": 232.5943 }, "text": "", "attrs": { "row": 11, "col": 12, "rowspan": 1, "colspan": 1 }, "reading_order": 177 }, { "id": "p135.5.179", "order": 187, "type": "table_cell", "bbox": { "l": 597.9388, "t": 252.5714, "r": 642.2541, "b": 232.5943 }, "text": "", "attrs": { "row": 11, "col": 13, "rowspan": 1, "colspan": 1 }, "reading_order": 178 }, { "id": "p135.5.180", "order": 188, "type": "table_cell", "bbox": { "l": 642.2541, "t": 252.5714, "r": 686.5694, "b": 232.5943 }, "text": "", "attrs": { "row": 11, "col": 14, "rowspan": 1, "colspan": 1 }, "reading_order": 179 }, { "id": "p135.5.181", "order": 189, "type": "table_cell", "bbox": { "l": 686.5694, "t": 252.5714, "r": 730.8847, "b": 232.5943 }, "text": "", "attrs": { "row": 11, "col": 15, "rowspan": 1, "colspan": 1 }, "reading_order": 180 }, { "id": "p135.5.182", "order": 190, "type": "table_cell", "bbox": { "l": 730.8847, "t": 252.5714, "r": 775.2, "b": 232.5943 }, "text": "", "attrs": { "row": 11, "col": 16, "rowspan": 1, "colspan": 1 }, "reading_order": 181 }, { "id": "p135.5.183", "order": 191, "type": "table_cell", "bbox": { "l": 47.280001, "t": 228.19077299999998, "r": 51.157104, "b": 220.40867300000002 }, "text": "9", "attrs": { "row": 12, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 182 }, { "id": "p135.5.184", "order": 192, "type": "table_cell", "bbox": { "l": 94.767544, "t": 228.19077299999998, "r": 111.426591, "b": 220.40867300000002 }, "text": "MH 5", "attrs": { "row": 12, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 183 }, { "id": "p135.5.185", "order": 193, "type": "table_cell", "bbox": { "l": 141.369544, "t": 228.19077299999998, "r": 154.99402, "b": 220.40867300000002 }, "text": "0.23", "attrs": { "row": 12, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 184 }, { "id": "p135.5.186", "order": 194, "type": "table_cell", "bbox": { "l": 186.959203, "t": 228.19077299999998, "r": 194.671571, "b": 220.40867300000002 }, "text": "60", "attrs": { "row": 12, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 185 }, { "id": "p135.5.187", "order": 195, "type": "table_cell", "bbox": { "l": 224.544792, "t": 228.19077299999998, "r": 238.169268, "b": 220.40867300000002 }, "text": "0.14", "attrs": { "row": 12, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 186 }, { "id": "p135.5.188", "order": 196, "type": "table_cell", "bbox": { "l": 256.091474, "t": 228.19077299999998, "r": 269.71595, "b": 220.40867300000002 }, "text": "0.14", "attrs": { "row": 12, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 187 }, { "id": "p135.5.189", "order": 197, "type": "table_cell", "bbox": { "l": 300.774616, "t": 228.19077299999998, "r": 308.486983, "b": 220.40867300000002 }, "text": "15", "attrs": { "row": 12, "col": 6, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 188 }, { "id": "p135.5.190", "order": 198, "type": "table_cell", "bbox": { "l": 332.0471, "t": 232.5943, "r": 376.3624, "b": 212.6171 }, "text": "", "attrs": { "row": 12, "col": 7, "rowspan": 1, "colspan": 1 }, "reading_order": 189 }, { "id": "p135.5.191", "order": 199, "type": "table_cell", "bbox": { "l": 398.957378, "t": 228.19077299999998, "r": 406.669745, "b": 220.40867300000002 }, "text": "15", "attrs": { "row": 12, "col": 8, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 190 }, { "id": "p135.5.192", "order": 200, "type": "table_cell", "bbox": { "l": 449.695498, "t": 228.19077299999998, "r": 459.345246, "b": 220.40867300000002 }, "text": "5.7", "attrs": { "row": 12, "col": 9, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 191 }, { "id": "p135.5.193", "order": 201, "type": "table_cell", "bbox": { "l": 492.426142, "t": 228.19077299999998, "r": 502.021275, "b": 220.40867300000002 }, "text": "0.8", "attrs": { "row": 12, "col": 10, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 192 }, { "id": "p135.5.194", "order": 202, "type": "table_cell", "bbox": { "l": 536.217885, "t": 228.19077299999998, "r": 543.930253, "b": 220.40867300000002 }, "text": "15", "attrs": { "row": 12, "col": 11, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 193 }, { "id": "p135.5.195", "order": 203, "type": "table_cell", "bbox": { "l": 578.963647, "t": 228.19077299999998, "r": 586.676014, "b": 220.40867300000002 }, "text": "43", "attrs": { "row": 12, "col": 12, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 194 }, { "id": "p135.5.196", "order": 204, "type": "table_cell", "bbox": { "l": 614.221246, "t": 228.19077299999998, "r": 627.845723, "b": 220.40867300000002 }, "text": "0.50", "attrs": { "row": 12, "col": 13, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 195 }, { "id": "p135.5.197", "order": 205, "type": "table_cell", "bbox": { "l": 655.390955, "t": 228.19077299999998, "r": 665.040702, "b": 220.40867300000002 }, "text": "5.9", "attrs": { "row": 12, "col": 14, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 196 }, { "id": "p135.5.198", "order": 206, "type": "table_cell", "bbox": { "l": 699.16758, "t": 228.19077299999998, "r": 708.817328, "b": 220.40867300000002 }, "text": "4.8", "attrs": { "row": 12, "col": 15, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 197 }, { "id": "p135.5.199", "order": 207, "type": "table_cell", "bbox": { "l": 730.8847, "t": 232.5943, "r": 775.2, "b": 212.6171 }, "text": "", "attrs": { "row": 12, "col": 16, "rowspan": 1, "colspan": 1 }, "reading_order": 198 }, { "id": "p135.5.200", "order": 208, "type": "table_cell", "bbox": { "l": 47.280001, "t": 207.19077299999998, "r": 51.157104, "b": 199.40867300000002 }, "text": "8", "attrs": { "row": 13, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 199 }, { "id": "p135.5.201", "order": 209, "type": "table_cell", "bbox": { "l": 94.800002, "t": 207.19077299999998, "r": 111.404434, "b": 199.40867300000002 }, "text": "MH 7", "attrs": { "row": 13, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 200 }, { "id": "p135.5.202", "order": 210, "type": "table_cell", "bbox": { "l": 141.359997, "t": 207.19077299999998, "r": 154.984473, "b": 199.40867300000002 }, "text": "0.24", "attrs": { "row": 13, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 201 }, { "id": "p135.5.203", "order": 211, "type": "table_cell", "bbox": { "l": 186.959999, "t": 207.19077299999998, "r": 194.672367, "b": 199.40867300000002 }, "text": "70", "attrs": { "row": 13, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 202 }, { "id": "p135.5.204", "order": 212, "type": "table_cell", "bbox": { "l": 224.519989, "t": 207.19077299999998, "r": 238.144465, "b": 199.40867300000002 }, "text": "0.17", "attrs": { "row": 13, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 203 }, { "id": "p135.5.205", "order": 213, "type": "table_cell", "bbox": { "l": 256.080002, "t": 207.19077299999998, "r": 269.704478, "b": 199.40867300000002 }, "text": "0.17", "attrs": { "row": 13, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 204 }, { "id": "p135.5.206", "order": 214, "type": "table_cell", "bbox": { "l": 300.719993, "t": 207.19077299999998, "r": 308.432361, "b": 199.40867300000002 }, "text": "15", "attrs": { "row": 13, "col": 6, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 205 }, { "id": "p135.5.207", "order": 215, "type": "table_cell", "bbox": { "l": 332.0471, "t": 212.6171, "r": 376.3624, "b": 192.64 }, "text": "", "attrs": { "row": 13, "col": 7, "rowspan": 1, "colspan": 1 }, "reading_order": 206 }, { "id": "p135.5.208", "order": 216, "type": "table_cell", "bbox": { "l": 398.88002, "t": 207.19077299999998, "r": 406.592388, "b": 199.40867300000002 }, "text": "15", "attrs": { "row": 13, "col": 8, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 207 }, { "id": "p135.5.209", "order": 217, "type": "table_cell", "bbox": { "l": 449.640015, "t": 207.19077299999998, "r": 459.289763, "b": 199.40867300000002 }, "text": "5.7", "attrs": { "row": 13, "col": 9, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 208 }, { "id": "p135.5.210", "order": 218, "type": "table_cell", "bbox": { "l": 492.359985, "t": 207.19077299999998, "r": 502.009733, "b": 199.40867300000002 }, "text": "1.0", "attrs": { "row": 13, "col": 10, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 209 }, { "id": "p135.5.211", "order": 219, "type": "table_cell", "bbox": { "l": 536.160004, "t": 207.19077299999998, "r": 543.872371, "b": 199.40867300000002 }, "text": "15", "attrs": { "row": 13, "col": 11, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 210 }, { "id": "p135.5.212", "order": 220, "type": "table_cell", "bbox": { "l": 578.88002, "t": 207.19077299999998, "r": 586.592388, "b": 199.40867300000002 }, "text": "47", "attrs": { "row": 13, "col": 12, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 211 }, { "id": "p135.5.213", "order": 221, "type": "table_cell", "bbox": { "l": 614.160004, "t": 207.19077299999998, "r": 627.78448, "b": 199.40867300000002 }, "text": "0.50", "attrs": { "row": 13, "col": 13, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 212 }, { "id": "p135.5.214", "order": 222, "type": "table_cell", "bbox": { "l": 655.320008, "t": 207.19077299999998, "r": 664.969755, "b": 199.40867300000002 }, "text": "5.9", "attrs": { "row": 13, "col": 14, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 213 }, { "id": "p135.5.215", "order": 223, "type": "table_cell", "bbox": { "l": 699.11998, "t": 207.19077299999998, "r": 708.769728, "b": 199.40867300000002 }, "text": "4.8", "attrs": { "row": 13, "col": 15, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 214 }, { "id": "p135.5.216", "order": 224, "type": "table_cell", "bbox": { "l": 730.8847, "t": 212.6171, "r": 775.2, "b": 192.64 }, "text": "", "attrs": { "row": 13, "col": 16, "rowspan": 1, "colspan": 1 }, "reading_order": 215 }, { "id": "p135.5.217", "order": 225, "type": "table_cell", "bbox": { "l": 47.280001, "t": 186.31075299999998, "r": 51.157104, "b": 178.52865300000002 }, "text": "6", "attrs": { "row": 14, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 216 }, { "id": "p135.5.218", "order": 226, "type": "table_cell", "bbox": { "l": 93.479999, "t": 186.31075299999998, "r": 112.816649, "b": 178.52865300000002 }, "text": "FES 3", "attrs": { "row": 14, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 217 }, { "id": "p135.5.219", "order": 227, "type": "table_cell", "bbox": { "l": 141.359997, "t": 186.31075299999998, "r": 154.984473, "b": 178.52865300000002 }, "text": "0.14", "attrs": { "row": 14, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 218 }, { "id": "p135.5.220", "order": 228, "type": "table_cell", "bbox": { "l": 186.959999, "t": 186.31075299999998, "r": 194.672367, "b": 178.52865300000002 }, "text": "90", "attrs": { "row": 14, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 219 }, { "id": "p135.5.221", "order": 229, "type": "table_cell", "bbox": { "l": 224.519989, "t": 186.31075299999998, "r": 238.144465, "b": 178.52865300000002 }, "text": "0.13", "attrs": { "row": 14, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 220 }, { "id": "p135.5.222", "order": 230, "type": "table_cell", "bbox": { "l": 256.080002, "t": 186.31075299999998, "r": 269.704478, "b": 178.52865300000002 }, "text": "0.13", "attrs": { "row": 14, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 221 }, { "id": "p135.5.223", "order": 231, "type": "table_cell", "bbox": { "l": 300.719993, "t": 186.31075299999998, "r": 308.432361, "b": 178.52865300000002 }, "text": "15", "attrs": { "row": 14, "col": 6, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 222 }, { "id": "p135.5.224", "order": 232, "type": "table_cell", "bbox": { "l": 332.0471, "t": 192.64, "r": 376.3624, "b": 172.6629 }, "text": "", "attrs": { "row": 14, "col": 7, "rowspan": 1, "colspan": 1 }, "reading_order": 223 }, { "id": "p135.5.225", "order": 233, "type": "table_cell", "bbox": { "l": 398.88002, "t": 186.31075299999998, "r": 406.592388, "b": 178.52865300000002 }, "text": "15", "attrs": { "row": 14, "col": 8, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 224 }, { "id": "p135.5.226", "order": 234, "type": "table_cell", "bbox": { "l": 449.640015, "t": 186.31075299999998, "r": 459.289763, "b": 178.52865300000002 }, "text": "5.7", "attrs": { "row": 14, "col": 9, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 225 }, { "id": "p135.5.227", "order": 235, "type": "table_cell", "bbox": { "l": 492.359985, "t": 186.31075299999998, "r": 502.009733, "b": 178.52865300000002 }, "text": "0.8", "attrs": { "row": 14, "col": 10, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 226 }, { "id": "p135.5.228", "order": 236, "type": "table_cell", "bbox": { "l": 536.160004, "t": 186.31075299999998, "r": 543.872371, "b": 178.52865300000002 }, "text": "15", "attrs": { "row": 14, "col": 11, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 227 }, { "id": "p135.5.229", "order": 237, "type": "table_cell", "bbox": { "l": 580.919999, "t": 186.31075299999998, "r": 584.797102, "b": 178.52865300000002 }, "text": "5", "attrs": { "row": 14, "col": 12, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 228 }, { "id": "p135.5.230", "order": 238, "type": "table_cell", "bbox": { "l": 614.160004, "t": 186.31075299999998, "r": 627.78448, "b": 178.52865300000002 }, "text": "0.50", "attrs": { "row": 14, "col": 13, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 229 }, { "id": "p135.5.231", "order": 239, "type": "table_cell", "bbox": { "l": 655.320008, "t": 186.31075299999998, "r": 664.969755, "b": 178.52865300000002 }, "text": "5.9", "attrs": { "row": 14, "col": 14, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 230 }, { "id": "p135.5.232", "order": 240, "type": "table_cell", "bbox": { "l": 699.11998, "t": 186.31075299999998, "r": 708.769728, "b": 178.52865300000002 }, "text": "4.8", "attrs": { "row": 14, "col": 15, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 231 }, { "id": "p135.5.233", "order": 241, "type": "table_cell", "bbox": { "l": 730.8847, "t": 192.64, "r": 775.2, "b": 172.6629 }, "text": "", "attrs": { "row": 14, "col": 16, "rowspan": 1, "colspan": 1 }, "reading_order": 232 }, { "id": "p135.5.234", "order": 242, "type": "table_cell", "bbox": { "l": 21.84, "t": 172.6629, "r": 66.1553, "b": 152.6857 }, "text": "", "attrs": { "row": 15, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 233 }, { "id": "p135.5.235", "order": 243, "type": "table_cell", "bbox": { "l": 66.1553, "t": 172.6629, "r": 110.4706, "b": 152.6857 }, "text": "", "attrs": { "row": 15, "col": 1, "rowspan": 1, "colspan": 1 }, "reading_order": 234 }, { "id": "p135.5.236", "order": 244, "type": "table_cell", "bbox": { "l": 110.4706, "t": 172.6629, "r": 154.7859, "b": 152.6857 }, "text": "", "attrs": { "row": 15, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 235 }, { "id": "p135.5.237", "order": 245, "type": "table_cell", "bbox": { "l": 154.7859, "t": 172.6629, "r": 199.1012, "b": 152.6857 }, "text": "", "attrs": { "row": 15, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 236 }, { "id": "p135.5.238", "order": 246, "type": "table_cell", "bbox": { "l": 199.1012, "t": 172.6629, "r": 243.4165, "b": 152.6857 }, "text": "", "attrs": { "row": 15, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 237 }, { "id": "p135.5.239", "order": 247, "type": "table_cell", "bbox": { "l": 243.4165, "t": 172.6629, "r": 287.7318, "b": 152.6857 }, "text": "", "attrs": { "row": 15, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 238 }, { "id": "p135.5.240", "order": 248, "type": "table_cell", "bbox": { "l": 287.7318, "t": 172.6629, "r": 332.0471, "b": 152.6857 }, "text": "", "attrs": { "row": 15, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 239 }, { "id": "p135.5.241", "order": 249, "type": "table_cell", "bbox": { "l": 332.0471, "t": 172.6629, "r": 376.3624, "b": 152.6857 }, "text": "", "attrs": { "row": 15, "col": 7, "rowspan": 1, "colspan": 1 }, "reading_order": 240 }, { "id": "p135.5.242", "order": 250, "type": "table_cell", "bbox": { "l": 376.3624, "t": 172.6629, "r": 420.6776, "b": 152.6857 }, "text": "", "attrs": { "row": 15, "col": 8, "rowspan": 1, "colspan": 1 }, "reading_order": 241 }, { "id": "p135.5.243", "order": 251, "type": "table_cell", "bbox": { "l": 420.6776, "t": 172.6629, "r": 464.9929, "b": 152.6857 }, "text": "", "attrs": { "row": 15, "col": 9, "rowspan": 1, "colspan": 1 }, "reading_order": 242 }, { "id": "p135.5.244", "order": 252, "type": "table_cell", "bbox": { "l": 464.9929, "t": 172.6629, "r": 509.3082, "b": 152.6857 }, "text": "", "attrs": { "row": 15, "col": 10, "rowspan": 1, "colspan": 1 }, "reading_order": 243 }, { "id": "p135.5.245", "order": 253, "type": "table_cell", "bbox": { "l": 509.3082, "t": 172.6629, "r": 553.6235, "b": 152.6857 }, "text": "", "attrs": { "row": 15, "col": 11, "rowspan": 1, "colspan": 1 }, "reading_order": 244 }, { "id": "p135.5.246", "order": 254, "type": "table_cell", "bbox": { "l": 553.6235, "t": 172.6629, "r": 597.9388, "b": 152.6857 }, "text": "", "attrs": { "row": 15, "col": 12, "rowspan": 1, "colspan": 1 }, "reading_order": 245 }, { "id": "p135.5.247", "order": 255, "type": "table_cell", "bbox": { "l": 597.9388, "t": 172.6629, "r": 642.2541, "b": 152.6857 }, "text": "", "attrs": { "row": 15, "col": 13, "rowspan": 1, "colspan": 1 }, "reading_order": 246 }, { "id": "p135.5.248", "order": 256, "type": "table_cell", "bbox": { "l": 642.2541, "t": 172.6629, "r": 686.5694, "b": 152.6857 }, "text": "", "attrs": { "row": 15, "col": 14, "rowspan": 1, "colspan": 1 }, "reading_order": 247 }, { "id": "p135.5.249", "order": 257, "type": "table_cell", "bbox": { "l": 686.5694, "t": 172.6629, "r": 730.8847, "b": 152.6857 }, "text": "", "attrs": { "row": 15, "col": 15, "rowspan": 1, "colspan": 1 }, "reading_order": 248 }, { "id": "p135.5.250", "order": 258, "type": "table_cell", "bbox": { "l": 730.8847, "t": 172.6629, "r": 775.2, "b": 152.6857 }, "text": "", "attrs": { "row": 15, "col": 16, "rowspan": 1, "colspan": 1 }, "reading_order": 249 }, { "id": "p135.5.251", "order": 259, "type": "table_cell", "bbox": { "l": 40.319999, "t": 144.55075799999997, "r": 58.092307, "b": 136.76865800000002 }, "text": "O/S 1", "attrs": { "row": 16, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 250 }, { "id": "p135.5.252", "order": 260, "type": "table_cell", "bbox": { "l": 94.800002, "t": 144.55075799999997, "r": 111.404434, "b": 136.76865800000002 }, "text": "MH 6", "attrs": { "row": 16, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 251 }, { "id": "p135.5.253", "order": 261, "type": "table_cell", "bbox": { "l": 110.4706, "t": 152.6857, "r": 154.7859, "b": 132.7086 }, "text": "", "attrs": { "row": 16, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 252 }, { "id": "p135.5.254", "order": 262, "type": "table_cell", "bbox": { "l": 154.7859, "t": 152.6857, "r": 199.1012, "b": 132.7086 }, "text": "", "attrs": { "row": 16, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 253 }, { "id": "p135.5.255", "order": 263, "type": "table_cell", "bbox": { "l": 199.1012, "t": 152.6857, "r": 243.4165, "b": 132.7086 }, "text": "", "attrs": { "row": 16, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 254 }, { "id": "p135.5.256", "order": 264, "type": "table_cell", "bbox": { "l": 243.4165, "t": 152.6857, "r": 287.7318, "b": 132.7086 }, "text": "", "attrs": { "row": 16, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 255 }, { "id": "p135.5.257", "order": 265, "type": "table_cell", "bbox": { "l": 287.7318, "t": 152.6857, "r": 332.0471, "b": 132.7086 }, "text": "", "attrs": { "row": 16, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 256 }, { "id": "p135.5.258", "order": 266, "type": "table_cell", "bbox": { "l": 332.0471, "t": 152.6857, "r": 376.3624, "b": 132.7086 }, "text": "", "attrs": { "row": 16, "col": 7, "rowspan": 1, "colspan": 1 }, "reading_order": 257 }, { "id": "p135.5.259", "order": 267, "type": "table_cell", "bbox": { "l": 376.3624, "t": 152.6857, "r": 420.6776, "b": 132.7086 }, "text": "", "attrs": { "row": 16, "col": 8, "rowspan": 1, "colspan": 1 }, "reading_order": 258 }, { "id": "p135.5.260", "order": 268, "type": "table_cell", "bbox": { "l": 420.6776, "t": 152.6857, "r": 464.9929, "b": 132.7086 }, "text": "", "attrs": { "row": 16, "col": 9, "rowspan": 1, "colspan": 1 }, "reading_order": 259 }, { "id": "p135.5.261", "order": 269, "type": "table_cell", "bbox": { "l": 492.359985, "t": 144.55075799999997, "r": 502.009733, "b": 136.76865800000002 }, "text": "1.9", "attrs": { "row": 16, "col": 10, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 260 }, { "id": "p135.5.262", "order": 270, "type": "table_cell", "bbox": { "l": 536.160004, "t": 144.55075799999997, "r": 543.872371, "b": 136.76865800000002 }, "text": "15", "attrs": { "row": 16, "col": 11, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 261 }, { "id": "p135.5.263", "order": 271, "type": "table_cell", "bbox": { "l": 578.88002, "t": 144.55075799999997, "r": 586.592388, "b": 136.76865800000002 }, "text": "30", "attrs": { "row": 16, "col": 12, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 262 }, { "id": "p135.5.264", "order": 272, "type": "table_cell", "bbox": { "l": 614.160004, "t": 144.55075799999997, "r": 627.78448, "b": 136.76865800000002 }, "text": "0.50", "attrs": { "row": 16, "col": 13, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 263 }, { "id": "p135.5.265", "order": 273, "type": "table_cell", "bbox": { "l": 655.320008, "t": 144.55075799999997, "r": 664.969755, "b": 136.76865800000002 }, "text": "5.9", "attrs": { "row": 16, "col": 14, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 264 }, { "id": "p135.5.266", "order": 274, "type": "table_cell", "bbox": { "l": 699.11998, "t": 144.55075799999997, "r": 708.769728, "b": 136.76865800000002 }, "text": "4.8", "attrs": { "row": 16, "col": 15, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 265 }, { "id": "p135.5.267", "order": 275, "type": "table_cell", "bbox": { "l": 730.8847, "t": 152.6857, "r": 775.2, "b": 132.7086 }, "text": "", "attrs": { "row": 16, "col": 16, "rowspan": 1, "colspan": 1 }, "reading_order": 266 }, { "id": "p135.5.268", "order": 276, "type": "table_cell", "bbox": { "l": 40.319999, "t": 123.67073799999997, "r": 58.092307, "b": 115.88863800000001 }, "text": "O/S 2", "attrs": { "row": 17, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 267 }, { "id": "p135.5.269", "order": 277, "type": "table_cell", "bbox": { "l": 94.800002, "t": 123.67073799999997, "r": 111.404434, "b": 115.88863800000001 }, "text": "MH 6", "attrs": { "row": 17, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 268 }, { "id": "p135.5.270", "order": 278, "type": "table_cell", "bbox": { "l": 110.4706, "t": 132.7086, "r": 154.7859, "b": 112.7314 }, "text": "", "attrs": { "row": 17, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 269 }, { "id": "p135.5.271", "order": 279, "type": "table_cell", "bbox": { "l": 154.7859, "t": 132.7086, "r": 199.1012, "b": 112.7314 }, "text": "", "attrs": { "row": 17, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 270 }, { "id": "p135.5.272", "order": 280, "type": "table_cell", "bbox": { "l": 199.1012, "t": 132.7086, "r": 243.4165, "b": 112.7314 }, "text": "", "attrs": { "row": 17, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 271 }, { "id": "p135.5.273", "order": 281, "type": "table_cell", "bbox": { "l": 243.4165, "t": 132.7086, "r": 287.7318, "b": 112.7314 }, "text": "", "attrs": { "row": 17, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 272 }, { "id": "p135.5.274", "order": 282, "type": "table_cell", "bbox": { "l": 287.7318, "t": 132.7086, "r": 332.0471, "b": 112.7314 }, "text": "", "attrs": { "row": 17, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 273 }, { "id": "p135.5.275", "order": 283, "type": "table_cell", "bbox": { "l": 332.0471, "t": 132.7086, "r": 376.3624, "b": 112.7314 }, "text": "", "attrs": { "row": 17, "col": 7, "rowspan": 1, "colspan": 1 }, "reading_order": 274 }, { "id": "p135.5.276", "order": 284, "type": "table_cell", "bbox": { "l": 376.3624, "t": 132.7086, "r": 420.6776, "b": 112.7314 }, "text": "", "attrs": { "row": 17, "col": 8, "rowspan": 1, "colspan": 1 }, "reading_order": 275 }, { "id": "p135.5.277", "order": 285, "type": "table_cell", "bbox": { "l": 420.6776, "t": 132.7086, "r": 464.9929, "b": 112.7314 }, "text": "", "attrs": { "row": 17, "col": 9, "rowspan": 1, "colspan": 1 }, "reading_order": 276 }, { "id": "p135.5.278", "order": 286, "type": "table_cell", "bbox": { "l": 492.359985, "t": 123.67073799999997, "r": 502.009733, "b": 115.88863800000001 }, "text": "0.6", "attrs": { "row": 17, "col": 10, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 277 }, { "id": "p135.5.279", "order": 287, "type": "table_cell", "bbox": { "l": 536.160004, "t": 123.67073799999997, "r": 543.872371, "b": 115.88863800000001 }, "text": "15", "attrs": { "row": 17, "col": 11, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 278 }, { "id": "p135.5.280", "order": 288, "type": "table_cell", "bbox": { "l": 578.88002, "t": 123.67073799999997, "r": 586.592388, "b": 115.88863800000001 }, "text": "20", "attrs": { "row": 17, "col": 12, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 279 }, { "id": "p135.5.281", "order": 289, "type": "table_cell", "bbox": { "l": 614.160004, "t": 123.67073799999997, "r": 627.78448, "b": 115.88863800000001 }, "text": "0.50", "attrs": { "row": 17, "col": 13, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 280 }, { "id": "p135.5.282", "order": 290, "type": "table_cell", "bbox": { "l": 655.320008, "t": 123.67073799999997, "r": 664.969755, "b": 115.88863800000001 }, "text": "5.9", "attrs": { "row": 17, "col": 14, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 281 }, { "id": "p135.5.283", "order": 291, "type": "table_cell", "bbox": { "l": 699.11998, "t": 123.67073799999997, "r": 708.769728, "b": 115.88863800000001 }, "text": "4.8", "attrs": { "row": 17, "col": 15, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 282 }, { "id": "p135.5.284", "order": 292, "type": "table_cell", "bbox": { "l": 730.8847, "t": 132.7086, "r": 775.2, "b": 112.7314 }, "text": "", "attrs": { "row": 17, "col": 16, "rowspan": 1, "colspan": 1 }, "reading_order": 283 }, { "id": "p135.5.285", "order": 293, "type": "table_cell", "bbox": { "l": 40.920001, "t": 102.79076400000002, "r": 57.524434, "b": 95.00866399999995 }, "text": "MH 6", "attrs": { "row": 18, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 284 }, { "id": "p135.5.286", "order": 294, "type": "table_cell", "bbox": { "l": 47.280001, "t": 81.79076399999997, "r": 51.157104, "b": 74.00866399999995 }, "text": "7", "attrs": { "row": 18, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 285 }, { "id": "p135.5.287", "order": 295, "type": "table_cell", "bbox": { "l": 110.4706, "t": 112.7314, "r": 154.7859, "b": 92.7543 }, "text": "", "attrs": { "row": 18, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 286 }, { "id": "p135.5.288", "order": 296, "type": "table_cell", "bbox": { "l": 154.7859, "t": 112.7314, "r": 199.1012, "b": 92.7543 }, "text": "", "attrs": { "row": 18, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 287 }, { "id": "p135.5.289", "order": 297, "type": "table_cell", "bbox": { "l": 199.1012, "t": 112.7314, "r": 243.4165, "b": 92.7543 }, "text": "", "attrs": { "row": 18, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 288 }, { "id": "p135.5.290", "order": 298, "type": "table_cell", "bbox": { "l": 243.4165, "t": 112.7314, "r": 287.7318, "b": 92.7543 }, "text": "", "attrs": { "row": 18, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 289 }, { "id": "p135.5.291", "order": 299, "type": "table_cell", "bbox": { "l": 287.7318, "t": 112.7314, "r": 332.0471, "b": 92.7543 }, "text": "", "attrs": { "row": 18, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 290 }, { "id": "p135.5.292", "order": 300, "type": "table_cell", "bbox": { "l": 332.0471, "t": 112.7314, "r": 376.3624, "b": 92.7543 }, "text": "", "attrs": { "row": 18, "col": 7, "rowspan": 1, "colspan": 1 }, "reading_order": 291 }, { "id": "p135.5.293", "order": 301, "type": "table_cell", "bbox": { "l": 376.3624, "t": 112.7314, "r": 420.6776, "b": 92.7543 }, "text": "", "attrs": { "row": 18, "col": 8, "rowspan": 1, "colspan": 1 }, "reading_order": 292 }, { "id": "p135.5.294", "order": 302, "type": "table_cell", "bbox": { "l": 420.6776, "t": 112.7314, "r": 464.9929, "b": 92.7543 }, "text": "", "attrs": { "row": 18, "col": 9, "rowspan": 1, "colspan": 1 }, "reading_order": 293 }, { "id": "p135.5.295", "order": 303, "type": "table_cell", "bbox": { "l": 492.359985, "t": 102.79076400000002, "r": 502.009733, "b": 95.00866399999995 }, "text": "2.5", "attrs": { "row": 18, "col": 10, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 294 }, { "id": "p135.5.296", "order": 304, "type": "table_cell", "bbox": { "l": 536.160004, "t": 102.79076400000002, "r": 543.872371, "b": 95.00866399999995 }, "text": "15", "attrs": { "row": 18, "col": 11, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 295 }, { "id": "p135.5.297", "order": 305, "type": "table_cell", "bbox": { "l": 578.88002, "t": 102.79076400000002, "r": 586.592388, "b": 95.00866399999995 }, "text": "39", "attrs": { "row": 18, "col": 12, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 296 }, { "id": "p135.5.298", "order": 306, "type": "table_cell", "bbox": { "l": 614.160004, "t": 102.79076400000002, "r": 627.78448, "b": 95.00866399999995 }, "text": "0.50", "attrs": { "row": 18, "col": 13, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 297 }, { "id": "p135.5.299", "order": 307, "type": "table_cell", "bbox": { "l": 655.320008, "t": 102.79076400000002, "r": 664.969755, "b": 95.00866399999995 }, "text": "5.9", "attrs": { "row": 18, "col": 14, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 298 }, { "id": "p135.5.300", "order": 308, "type": "table_cell", "bbox": { "l": 699.11998, "t": 102.79076400000002, "r": 708.769728, "b": 95.00866399999995 }, "text": "4.8", "attrs": { "row": 18, "col": 15, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 299 }, { "id": "p135.5.301", "order": 309, "type": "table_cell", "bbox": { "l": 730.8847, "t": 112.7314, "r": 775.2, "b": 92.7543 }, "text": "", "attrs": { "row": 18, "col": 16, "rowspan": 1, "colspan": 1 }, "reading_order": 300 }, { "id": "p135.5.302", "order": 310, "type": "table_cell", "bbox": { "l": 21.84, "t": 92.7543, "r": 66.1553, "b": 72.7771 }, "text": "7", "attrs": { "row": 19, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 301 }, { "id": "p135.5.303", "order": 311, "type": "table_cell", "bbox": { "l": 93.479999, "t": 81.79076399999997, "r": 112.816649, "b": 74.00866399999995 }, "text": "FES 4", "attrs": { "row": 19, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 302 }, { "id": "p135.5.304", "order": 312, "type": "table_cell", "bbox": { "l": 141.359997, "t": 81.79076399999997, "r": 154.984473, "b": 74.00866399999995 }, "text": "0.07", "attrs": { "row": 19, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 303 }, { "id": "p135.5.305", "order": 313, "type": "table_cell", "bbox": { "l": 186.959999, "t": 81.79076399999997, "r": 194.672367, "b": 74.00866399999995 }, "text": "90", "attrs": { "row": 19, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 304 }, { "id": "p135.5.306", "order": 314, "type": "table_cell", "bbox": { "l": 224.519989, "t": 81.79076399999997, "r": 238.144465, "b": 74.00866399999995 }, "text": "0.06", "attrs": { "row": 19, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 305 }, { "id": "p135.5.307", "order": 315, "type": "table_cell", "bbox": { "l": 256.080002, "t": 81.79076399999997, "r": 269.704478, "b": 74.00866399999995 }, "text": "0.06", "attrs": { "row": 19, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 306 }, { "id": "p135.5.308", "order": 316, "type": "table_cell", "bbox": { "l": 300.719993, "t": 81.79076399999997, "r": 308.432361, "b": 74.00866399999995 }, "text": "15", "attrs": { "row": 19, "col": 6, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 307 }, { "id": "p135.5.309", "order": 317, "type": "table_cell", "bbox": { "l": 332.0471, "t": 92.7543, "r": 376.3624, "b": 72.7771 }, "text": "", "attrs": { "row": 19, "col": 7, "rowspan": 1, "colspan": 1 }, "reading_order": 308 }, { "id": "p135.5.310", "order": 318, "type": "table_cell", "bbox": { "l": 398.88002, "t": 81.79076399999997, "r": 406.592388, "b": 74.00866399999995 }, "text": "15", "attrs": { "row": 19, "col": 8, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 309 }, { "id": "p135.5.311", "order": 319, "type": "table_cell", "bbox": { "l": 449.640015, "t": 81.79076399999997, "r": 459.289763, "b": 74.00866399999995 }, "text": "5.7", "attrs": { "row": 19, "col": 9, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 310 }, { "id": "p135.5.312", "order": 320, "type": "table_cell", "bbox": { "l": 492.359985, "t": 81.79076399999997, "r": 502.009733, "b": 74.00866399999995 }, "text": "2.8", "attrs": { "row": 19, "col": 10, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 311 }, { "id": "p135.5.313", "order": 321, "type": "table_cell", "bbox": { "l": 536.160004, "t": 81.79076399999997, "r": 543.872371, "b": 74.00866399999995 }, "text": "15", "attrs": { "row": 19, "col": 11, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 312 }, { "id": "p135.5.314", "order": 322, "type": "table_cell", "bbox": { "l": 578.88002, "t": 81.79076399999997, "r": 586.592388, "b": 74.00866399999995 }, "text": "12", "attrs": { "row": 19, "col": 12, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 313 }, { "id": "p135.5.315", "order": 323, "type": "table_cell", "bbox": { "l": 614.160004, "t": 81.79076399999997, "r": 627.78448, "b": 74.00866399999995 }, "text": "0.50", "attrs": { "row": 19, "col": 13, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 314 }, { "id": "p135.5.316", "order": 324, "type": "table_cell", "bbox": { "l": 655.320008, "t": 81.79076399999997, "r": 664.969755, "b": 74.00866399999995 }, "text": "5.9", "attrs": { "row": 19, "col": 14, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 315 }, { "id": "p135.5.317", "order": 325, "type": "table_cell", "bbox": { "l": 699.11998, "t": 81.79076399999997, "r": 708.769728, "b": 74.00866399999995 }, "text": "4.8", "attrs": { "row": 19, "col": 15, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 316 }, { "id": "p135.5.318", "order": 326, "type": "table_cell", "bbox": { "l": 730.8847, "t": 92.7543, "r": 775.2, "b": 72.7771 }, "text": "", "attrs": { "row": 19, "col": 16, "rowspan": 1, "colspan": 1 }, "reading_order": 317 }, { "id": "p135.5.319", "order": 327, "type": "table_cell", "bbox": { "l": 21.84, "t": 72.7771, "r": 66.1553, "b": 52.8 }, "text": "", "attrs": { "row": 20, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 318 }, { "id": "p135.5.320", "order": 328, "type": "table_cell", "bbox": { "l": 66.1553, "t": 72.7771, "r": 110.4706, "b": 52.8 }, "text": "", "attrs": { "row": 20, "col": 1, "rowspan": 1, "colspan": 1 }, "reading_order": 319 }, { "id": "p135.5.321", "order": 329, "type": "table_cell", "bbox": { "l": 110.4706, "t": 72.7771, "r": 154.7859, "b": 52.8 }, "text": "", "attrs": { "row": 20, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 320 }, { "id": "p135.5.322", "order": 330, "type": "table_cell", "bbox": { "l": 154.7859, "t": 72.7771, "r": 199.1012, "b": 52.8 }, "text": "", "attrs": { "row": 20, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 321 }, { "id": "p135.5.323", "order": 331, "type": "table_cell", "bbox": { "l": 199.1012, "t": 72.7771, "r": 243.4165, "b": 52.8 }, "text": "", "attrs": { "row": 20, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 322 }, { "id": "p135.5.324", "order": 332, "type": "table_cell", "bbox": { "l": 243.4165, "t": 72.7771, "r": 287.7318, "b": 52.8 }, "text": "", "attrs": { "row": 20, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 323 }, { "id": "p135.5.325", "order": 333, "type": "table_cell", "bbox": { "l": 287.7318, "t": 72.7771, "r": 332.0471, "b": 52.8 }, "text": "", "attrs": { "row": 20, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 324 }, { "id": "p135.5.326", "order": 334, "type": "table_cell", "bbox": { "l": 332.0471, "t": 72.7771, "r": 376.3624, "b": 52.8 }, "text": "", "attrs": { "row": 20, "col": 7, "rowspan": 1, "colspan": 1 }, "reading_order": 325 }, { "id": "p135.5.327", "order": 335, "type": "table_cell", "bbox": { "l": 376.3624, "t": 72.7771, "r": 420.6776, "b": 52.8 }, "text": "", "attrs": { "row": 20, "col": 8, "rowspan": 1, "colspan": 1 }, "reading_order": 326 }, { "id": "p135.5.328", "order": 336, "type": "table_cell", "bbox": { "l": 420.6776, "t": 72.7771, "r": 464.9929, "b": 52.8 }, "text": "", "attrs": { "row": 20, "col": 9, "rowspan": 1, "colspan": 1 }, "reading_order": 327 }, { "id": "p135.5.329", "order": 337, "type": "table_cell", "bbox": { "l": 464.9929, "t": 72.7771, "r": 509.3082, "b": 52.8 }, "text": "", "attrs": { "row": 20, "col": 10, "rowspan": 1, "colspan": 1 }, "reading_order": 328 }, { "id": "p135.5.330", "order": 338, "type": "table_cell", "bbox": { "l": 509.3082, "t": 72.7771, "r": 553.6235, "b": 52.8 }, "text": "", "attrs": { "row": 20, "col": 11, "rowspan": 1, "colspan": 1 }, "reading_order": 329 }, { "id": "p135.5.331", "order": 339, "type": "table_cell", "bbox": { "l": 553.6235, "t": 72.7771, "r": 597.9388, "b": 52.8 }, "text": "", "attrs": { "row": 20, "col": 12, "rowspan": 1, "colspan": 1 }, "reading_order": 330 }, { "id": "p135.5.332", "order": 340, "type": "table_cell", "bbox": { "l": 597.9388, "t": 72.7771, "r": 642.2541, "b": 52.8 }, "text": "", "attrs": { "row": 20, "col": 13, "rowspan": 1, "colspan": 1 }, "reading_order": 331 }, { "id": "p135.5.333", "order": 341, "type": "table_cell", "bbox": { "l": 642.2541, "t": 72.7771, "r": 686.5694, "b": 52.8 }, "text": "", "attrs": { "row": 20, "col": 14, "rowspan": 1, "colspan": 1 }, "reading_order": 332 }, { "id": "p135.5.334", "order": 342, "type": "table_cell", "bbox": { "l": 686.5694, "t": 72.7771, "r": 730.8847, "b": 52.8 }, "text": "", "attrs": { "row": 20, "col": 15, "rowspan": 1, "colspan": 1 }, "reading_order": 333 }, { "id": "p135.5.335", "order": 343, "type": "table_cell", "bbox": { "l": 730.8847, "t": 72.7771, "r": 775.2, "b": 52.8 }, "text": "", "attrs": { "row": 20, "col": 16, "rowspan": 1, "colspan": 1 }, "reading_order": 334 } ], "reading_order": 4 } ] }, { "document_id": 11809, "page": 136, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 34, "counts_by_type": { "heading": 2, "table": 1, "table_cell": 24, "text": 7 }, "build_ms": 3, "items": [ { "id": "p136.1", "order": 1, "type": "heading", "bbox": { "l": 197.28, "t": 687.6, "r": 413.76, "b": 638.64 }, "text": "APPENDIX D\nSOIL EROSION COMPUTATIONS", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 0 }, { "id": "p136.2", "order": 2, "type": "text", "bbox": { "l": 68.16, "t": 623.28, "r": 542.88, "b": 523.44 }, "text": "Adherence to the Standards for Soil Erosion and Sediment Control Standards requires basin\nroutings based upon the presumption that the basins and recharge systems are full to the elevation of\nthe first outlet structure for the 2 and 10 year storm events. The enclosed routings show that safe\npassage of the 2 and 10 year storm events will result for all cases, indicating compliance.", "reading_order": 1 }, { "id": "p136.3", "order": 3, "type": "text", "bbox": { "l": 68.4, "t": 485.28, "r": 540.96, "b": 442.08 }, "text": "Note that computations are based upon no ex-filtration from any SSIB, and the presumption that it is full to the first outlet.", "reading_order": 2 }, { "id": "p136.4", "order": 4, "type": "heading", "bbox": { "l": 69.6, "t": 429.36, "r": 179.28, "b": 413.04 }, "text": "1. Rip Rap Apron", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 3 }, { "id": "p136.5", "order": 5, "type": "text", "bbox": { "l": 69.84, "t": 397.68, "r": 157.68, "b": 383.52 }, "text": "a. for Tw >[p136.5.1] Do", "children": [ { "id": "p136.5.1", "order": 6, "type": "text", "bbox": { "l": 69.84, "t": 397.68, "r": 157.68, "b": 383.52 }, "text": "1/2", "attrs": { "inline": true, "text_offset": 11, "text_span": 10, "bbox_estimated": true }, "reading_order": 0 } ], "reading_order": 4 }, { "id": "p136.6", "order": 7, "type": "text", "bbox": { "l": 104.16, "t": 369.6, "r": 205.2, "b": 313.2 }, "text": "q=Q/Wo\nLa=3(q/Do^{0.5})\nWa=3Wo+0.4La\nD50=(0.02q^{1.33})/Tw", "reading_order": 5 }, { "id": "p136.7", "order": 8, "type": "text", "bbox": { "l": 69.84, "t": 301.44, "r": 161.76, "b": 286.8 }, "text": "b. for Tw <1/2 Do", "reading_order": 6 }, { "id": "p136.8", "order": 9, "type": "text", "bbox": { "l": 104.16, "t": 271.44, "r": 223.2, "b": 217.44 }, "text": "q=Q/Wo\nLa= 1.8(q/Do^{0.5}) + 7Do\nW= 3Wo + La\nD50=(0.02q^{1.33})/Tw", "reading_order": 7 }, { "id": "p136.9", "order": 10, "type": "table", "bbox": { "l": 108.24, "t": 192, "r": 502.32, "b": 104.88 }, "text": "", "attrs": { "block_label": "table", "n_rows": 3, "n_cols": 8, "integrity": { "cells_checked": 16, "cells_flagged": 0 } }, "children": [ { "id": "p136.9.1", "order": 11, "type": "table_cell", "bbox": { "l": 138.359997, "t": 190.07176100000004, "r": 150.996116, "b": 176.81291799999997 }, "text": "ID", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "pdf" }, "reading_order": 0 }, { "id": "p136.9.2", "order": 12, "type": "table_cell", "bbox": { "l": 196.485806, "t": 190.07176100000004, "r": 219.987232, "b": 176.81291799999997 }, "text": "Q 25", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "pdf" }, "reading_order": 1 }, { "id": "p136.9.3", "order": 13, "type": "table_cell", "bbox": { "l": 258.314512, "t": 190.07176100000004, "r": 264.303149, "b": 176.81291799999997 }, "text": "q", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "pdf" }, "reading_order": 2 }, { "id": "p136.9.4", "order": 14, "type": "table_cell", "bbox": { "l": 300.594292, "t": 190.07176100000004, "r": 316.558082, "b": 176.81291799999997 }, "text": "Tw", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "pdf" }, "reading_order": 3 }, { "id": "p136.9.5", "order": 15, "type": "table_cell", "bbox": { "l": 342.55078, "t": 190.07176100000004, "r": 359.798056, "b": 176.81291799999997 }, "text": "Wo", "attrs": { "row": 0, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "pdf" }, "reading_order": 4 }, { "id": "p136.9.6", "order": 16, "type": "table_cell", "bbox": { "l": 386.267834, "t": 190.07176100000004, "r": 398.889964, "b": 176.81291799999997 }, "text": "La", "attrs": { "row": 0, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "pdf" }, "reading_order": 5 }, { "id": "p136.9.7", "order": 17, "type": "table_cell", "bbox": { "l": 421.896484, "t": 190.07176100000004, "r": 438.461055, "b": 176.81291799999997 }, "text": "Wa", "attrs": { "row": 0, "col": 6, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "pdf" }, "reading_order": 6 }, { "id": "p136.9.8", "order": 18, "type": "table_cell", "bbox": { "l": 455.160004, "t": 190.07176100000004, "r": 493.625443, "b": 163.01289999999995 }, "text": "D50 (inches)", "attrs": { "row": 0, "col": 7, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "pdf" }, "reading_order": 7 }, { "id": "p136.9.9", "order": 19, "type": "table_cell", "bbox": { "l": 129.959999, "t": 161.99176, "r": 159.58864, "b": 120.05292399999996 }, "text": "FES 1\nFES 2\nFES 3", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 8 }, { "id": "p136.9.10", "order": 20, "type": "table_cell", "bbox": { "l": 197.759995, "t": 161.99176, "r": 218.720226, "b": 120.05292399999996 }, "text": "0.30\n2.8\n0.8", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 9 }, { "id": "p136.9.11", "order": 21, "type": "table_cell", "bbox": { "l": 250.799996, "t": 161.99176, "r": 271.760227, "b": 120.05292399999996 }, "text": "0.24\n2.24\n0.64", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 10 }, { "id": "p136.9.12", "order": 22, "type": "table_cell", "bbox": { "l": 298.080002, "t": 161.99176, "r": 319.040233, "b": 120.05292399999996 }, "text": "0.12\n0.12\n0.12", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 11 }, { "id": "p136.9.13", "order": 23, "type": "table_cell", "bbox": { "l": 340.799996, "t": 161.99176, "r": 361.760227, "b": 120.05292399999996 }, "text": "1.25\n1.25\n1.25", "attrs": { "row": 1, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 12 }, { "id": "p136.9.14", "order": 24, "type": "table_cell", "bbox": { "l": 382.200005, "t": 161.99176, "r": 403.160236, "b": 120.05292399999996 }, "text": "0.65\n6.0\n1.7", "attrs": { "row": 1, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 13 }, { "id": "p136.9.15", "order": 25, "type": "table_cell", "bbox": { "l": 422.88002, "t": 161.99176, "r": 437.851614, "b": 120.05292399999996 }, "text": "4.0\n6.2\n4.5", "attrs": { "row": 1, "col": 6, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 14 }, { "id": "p136.9.16", "order": 26, "type": "table_cell", "bbox": { "l": 463.919999, "t": 161.99176, "r": 484.88023, "b": 120.05292399999996 }, "text": "0.30\n6\n1.1", "attrs": { "row": 1, "col": 7, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 15 }, { "id": "p136.9.17", "order": 27, "type": "table_cell", "bbox": { "l": 108.24, "t": 122.304, "r": 157.5, "b": 104.88 }, "text": "", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 16 }, { "id": "p136.9.18", "order": 28, "type": "table_cell", "bbox": { "l": 157.5, "t": 122.304, "r": 206.76, "b": 104.88 }, "text": "", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1 }, "reading_order": 17 }, { "id": "p136.9.19", "order": 29, "type": "table_cell", "bbox": { "l": 206.76, "t": 122.304, "r": 256.02, "b": 104.88 }, "text": "", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 18 }, { "id": "p136.9.20", "order": 30, "type": "table_cell", "bbox": { "l": 256.02, "t": 122.304, "r": 305.28, "b": 104.88 }, "text": "", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 19 }, { "id": "p136.9.21", "order": 31, "type": "table_cell", "bbox": { "l": 305.28, "t": 122.304, "r": 354.54, "b": 104.88 }, "text": "", "attrs": { "row": 2, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 20 }, { "id": "p136.9.22", "order": 32, "type": "table_cell", "bbox": { "l": 354.54, "t": 122.304, "r": 403.8, "b": 104.88 }, "text": "", "attrs": { "row": 2, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 21 }, { "id": "p136.9.23", "order": 33, "type": "table_cell", "bbox": { "l": 403.8, "t": 122.304, "r": 453.06, "b": 104.88 }, "text": "", "attrs": { "row": 2, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 22 }, { "id": "p136.9.24", "order": 34, "type": "table_cell", "bbox": { "l": 453.06, "t": 122.304, "r": 502.32, "b": 104.88 }, "text": "", "attrs": { "row": 2, "col": 7, "rowspan": 1, "colspan": 1 }, "reading_order": 23 } ], "reading_order": 8 } ] }, { "document_id": 11809, "page": 137, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 7, "counts_by_type": { "formula": 1, "heading": 1, "text": 5 }, "build_ms": 0, "items": [ { "id": "p137.1", "order": 1, "type": "heading", "bbox": { "l": 70.08, "t": 718.32, "r": 150.96, "b": 702.96 }, "text": "2.Scour Hole", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 0 }, { "id": "p137.2", "order": 2, "type": "text", "bbox": { "l": 70.32, "t": 686.16, "r": 202.08, "b": 671.76 }, "text": "FES # 4 use scour hole", "reading_order": 1 }, { "id": "p137.3", "order": 3, "type": "text", "bbox": { "l": 70.32, "t": 653.52, "r": 127.92, "b": 638.4 }, "text": "Let y=Do", "reading_order": 2 }, { "id": "p137.4", "order": 4, "type": "text", "bbox": { "l": 70.08, "t": 623.04, "r": 210.72, "b": 606 }, "text": "D50=0.0082 q [p137.4.1]/(Tw)", "children": [ { "id": "p137.4.1", "order": 5, "type": "formula", "bbox": { "l": 70.08, "t": 623.04, "r": 210.72, "b": 606 }, "text": "D50 = 0.0082\\, q^{1.33} / (Tw)", "attrs": { "latex": "D50 = 0.0082\\, q^{1.33} / (Tw)", "inline": true, "text_offset": 13, "text_span": 10, "bbox_estimated": true, "notation": "latex", "alt": "D50 equals 0.0082, q to the power of 1.33 over Tw", "mathml": "D50=0.0082q1.33/(Tw)" }, "reading_order": 0 } ], "reading_order": 3 }, { "id": "p137.5", "order": 6, "type": "text", "bbox": { "l": 69.84, "t": 590.4, "r": 166.32, "b": 575.28 }, "text": "Find D50 = 0.09", "reading_order": 4 }, { "id": "p137.6", "order": 7, "type": "text", "bbox": { "l": 70.32, "t": 557.76, "r": 184.08, "b": 542.64 }, "text": "Use D50 = 3 inches", "reading_order": 5 } ] }, { "document_id": 11809, "page": 138, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 6, "counts_by_type": { "caption": 1, "figure": 1, "footer": 2, "text": 2 }, "build_ms": 0, "items": [ { "id": "p138.1", "order": 1, "type": "figure", "bbox": { "l": 54, "t": 730.56, "r": 558.72, "b": 67.92 }, "text": "", "attrs": { "block_label": "image" }, "reading_order": 0 }, { "id": "p138.2", "order": 2, "type": "caption", "bbox": { "l": 311.52, "t": 312.72, "r": 355.2, "b": 302.4 }, "text": "COMPOSITE", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p138.3", "order": 3, "type": "text", "bbox": { "l": 229.92, "t": 88.08, "r": 257.76, "b": 64.32 }, "text": "Link\nRouting Diagram for OCSCD\nPrepared by Professional Design Services, Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC", "reading_order": 2 }, { "id": "p138.4", "order": 4, "type": "text", "bbox": { "l": 287.76, "t": 85.68, "r": 550.32, "b": 56.16 }, "text": "Routing Diagram for OCSCD\nPrepared by Professional Design Services, Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC", "reading_order": 3 }, { "id": "p138.5", "order": 5, "type": "footer", "bbox": { "l": 72, "t": 98.64, "r": 112.56, "b": 68.16 }, "text": "", "attrs": { "block_label": "footer_image" }, "reading_order": 4 }, { "id": "p138.6", "order": 6, "type": "footer", "bbox": { "l": 127.92, "t": 85.92, "r": 157.2, "b": 73.44 }, "text": "Reach", "attrs": { "block_label": "footer" }, "reading_order": 5 } ] }, { "document_id": 11809, "page": 139, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 28, "counts_by_type": { "caption": 1, "form_field": 2, "table": 2, "table_cell": 23 }, "build_ms": 1, "items": [ { "id": "p139.1", "order": 1, "type": "table", "bbox": { "l": 51.36, "t": 737.984717, "r": 570.96, "b": 697.92 }, "text": "", "attrs": { "block_label": "table", "n_rows": 3, "n_cols": 3, "integrity": { "cells_checked": 5, "cells_flagged": 0 } }, "children": [ { "id": "p139.1.1", "order": 2, "type": "table_cell", "bbox": { "l": 54, "t": 737.984717, "r": 99.186248, "b": 724.019651 }, "text": "OCSCD", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 0 }, { "id": "p139.1.2", "order": 3, "type": "table_cell", "bbox": { "l": 54, "t": 724.06687, "r": 272.267766, "b": 711.061006 }, "text": "Prepared by Professional Design Services", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 1 }, { "id": "p139.1.3", "order": 4, "type": "table_cell", "bbox": { "l": 463.832107, "t": 724.140786, "r": 557.581301, "b": 712.153607 }, "text": "Printed 12/31/2025", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 2 }, { "id": "p139.1.4", "order": 5, "type": "table_cell", "bbox": { "l": 51.36, "t": 711.04, "r": 397.76, "b": 697.92 }, "text": "HydroCAD ○ledR 10.20-6a s/n 02223 ○ledC 2024 HydroCAD Software Solutions LLC", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 2 }, "children": [ { "id": "p139.1.4.1", "order": 6, "type": "form_field", "bbox": { "l": 92.38, "t": 711.04, "r": 104.38, "b": 699.04 }, "text": "", "attrs": { "field_kind": "radio", "label": "ledR 10.20-6a s/n 02223", "source": "glyph_estimate", "bbox_estimated": true, "row": 2, "col": 0, "rowspan": 1, "colspan": 2, "label_source": "parent_text", "label_ref": "p139.1.4", "text_offset": 9, "text_span": 1 }, "reading_order": 0 }, { "id": "p139.1.4.2", "order": 7, "type": "form_field", "bbox": { "l": 206.33, "t": 711.04, "r": 218.33, "b": 699.04 }, "text": "", "attrs": { "field_kind": "radio", "label": "ledC 2024 HydroCAD Software Solutions LLC", "source": "glyph_estimate", "bbox_estimated": true, "row": 2, "col": 0, "rowspan": 1, "colspan": 2, "label_source": "parent_text", "label_ref": "p139.1.4", "text_offset": 34, "text_span": 1 }, "reading_order": 1 } ], "reading_order": 3 }, { "id": "p139.1.5", "order": 8, "type": "table_cell", "bbox": { "l": 523.86, "t": 711.120786, "r": 557.898863, "b": 699.133607 }, "text": "Page 2", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 } ], "reading_order": 0 }, { "id": "p139.2", "order": 9, "type": "caption", "bbox": { "l": 195.84, "t": 687.36, "r": 421.92, "b": 672.48 }, "text": "Rainfall Events Listing (selected events)", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p139.3", "order": 10, "type": "table", "bbox": { "l": 52.56, "t": 664.08, "r": 464.88, "b": 604.08 }, "text": "", "attrs": { "block_label": "table", "n_rows": 2, "n_cols": 9, "integrity": { "cells_checked": 18, "cells_flagged": 0 } }, "children": [ { "id": "p139.3.1", "order": 11, "type": "table_cell", "bbox": { "l": 67.08, "t": 661.21453, "r": 97.674875, "b": 650.246371 }, "text": "Event#", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 0 }, { "id": "p139.3.2", "order": 12, "type": "table_cell", "bbox": { "l": 110.817011, "t": 661.21453, "r": 137.031502, "b": 636.566639 }, "text": "Event Name", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 1 }, { "id": "p139.3.3", "order": 13, "type": "table_cell", "bbox": { "l": 164.279909, "t": 661.21453, "r": 215.07153, "b": 650.246371 }, "text": "Storm Type", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 2 }, { "id": "p139.3.4", "order": 14, "type": "table_cell", "bbox": { "l": 230.940963, "t": 661.21453, "r": 257.152506, "b": 650.246371 }, "text": "Curve", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 3 }, { "id": "p139.3.5", "order": 15, "type": "table_cell", "bbox": { "l": 270.296607, "t": 661.21453, "r": 294.876685, "b": 650.246371 }, "text": "Mode", "attrs": { "row": 0, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p139.3.6", "order": 16, "type": "table_cell", "bbox": { "l": 314.512246, "t": 661.21453, "r": 351.652635, "b": 636.566639 }, "text": "Duration (hours)", "attrs": { "row": 0, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p139.3.7", "order": 17, "type": "table_cell", "bbox": { "l": 364.740716, "t": 661.21453, "r": 380.583613, "b": 650.246371 }, "text": "B/B", "attrs": { "row": 0, "col": 6, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p139.3.8", "order": 18, "type": "table_cell", "bbox": { "l": 393.660883, "t": 661.21453, "r": 428.644005, "b": 636.566639 }, "text": "Depth (inches)", "attrs": { "row": 0, "col": 7, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p139.3.9", "order": 19, "type": "table_cell", "bbox": { "l": 441.721275, "t": 661.21453, "r": 463.559313, "b": 650.246371 }, "text": "AMC", "attrs": { "row": 0, "col": 8, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p139.3.10", "order": 20, "type": "table_cell", "bbox": { "l": 92.28, "t": 630.19443, "r": 97.744424, "b": 605.5465389999999 }, "text": "1\n2", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 9 }, { "id": "p139.3.11", "order": 21, "type": "table_cell", "bbox": { "l": 110.818745, "t": 630.19443, "r": 151.24172, "b": 605.5465389999999 }, "text": "2 YEAR\n10 YEAR", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 10 }, { "id": "p139.3.12", "order": 22, "type": "table_cell", "bbox": { "l": 164.275747, "t": 630.19443, "r": 217.801545, "b": 605.5465389999999 }, "text": "NOAA 24-hr\nNOAA 24-hr", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 11 }, { "id": "p139.3.13", "order": 23, "type": "table_cell", "bbox": { "l": 230.932869, "t": 630.19443, "r": 238.030723, "b": 605.5465389999999 }, "text": "D\nD", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 12 }, { "id": "p139.3.14", "order": 24, "type": "table_cell", "bbox": { "l": 270.291461, "t": 630.19443, "r": 301.428848, "b": 605.5465389999999 }, "text": "Default\nDefault", "attrs": { "row": 1, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 13 }, { "id": "p139.3.15", "order": 25, "type": "table_cell", "bbox": { "l": 327.046773, "t": 630.19443, "r": 351.638645, "b": 605.5465389999999 }, "text": "24.00\n24.00", "attrs": { "row": 1, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 14 }, { "id": "p139.3.16", "order": 26, "type": "table_cell", "bbox": { "l": 364.722794, "t": 630.19443, "r": 370.189184, "b": 605.5465389999999 }, "text": "1\n1", "attrs": { "row": 1, "col": 6, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 15 }, { "id": "p139.3.17", "order": 27, "type": "table_cell", "bbox": { "l": 409.481927, "t": 630.19443, "r": 428.609376, "b": 605.5465389999999 }, "text": "3.42\n5.38", "attrs": { "row": 1, "col": 7, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 16 }, { "id": "p139.3.18", "order": 28, "type": "table_cell", "bbox": { "l": 441.699422, "t": 630.19443, "r": 447.165811, "b": 605.5465389999999 }, "text": "2\n2", "attrs": { "row": 1, "col": 8, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 17 } ], "reading_order": 2 } ] }, { "document_id": 11809, "page": 140, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 11, "counts_by_type": { "header": 3, "heading": 1, "table": 1, "table_cell": 6 }, "build_ms": 1, "items": [ { "id": "p140.1", "order": 1, "type": "header", "bbox": { "l": 52.08, "t": 738, "r": 100.08, "b": 724.8 }, "text": "OCSCD", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p140.2", "order": 2, "type": "header", "bbox": { "l": 52.08, "t": 724.08, "r": 392.64, "b": 698.88 }, "text": "Prepared by Professional Design Services\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p140.3", "order": 3, "type": "header", "bbox": { "l": 461.52, "t": 724.56, "r": 560.16, "b": 698.88 }, "text": "Printed 12/31/2025\nPage 3", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 2 }, { "id": "p140.4", "order": 4, "type": "heading", "bbox": { "l": 240.96, "t": 687.36, "r": 373.68, "b": 672.72 }, "text": "Area Listing (all nodes)", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 3 }, { "id": "p140.5", "order": 5, "type": "table", "bbox": { "l": 52.32, "t": 663.36, "r": 397.68, "b": 576 }, "text": "", "attrs": { "block_label": "table", "n_rows": 2, "n_cols": 3, "integrity": { "cells_checked": 6, "cells_flagged": 0 } }, "children": [ { "id": "p140.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 97.620155, "t": 661.21453, "r": 128.276947, "b": 636.566639 }, "text": "Area (acres)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 0 }, { "id": "p140.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 150.119899, "t": 661.21453, "r": 164.311676, "b": 650.246371 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 1 }, { "id": "p140.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 183.897114, "t": 661.21453, "r": 293.129565, "b": 636.566639 }, "text": "Description (subcatchment-numbers)", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 2 }, { "id": "p140.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 103.68, "t": 630.19443, "r": 128.870403, "b": 578.127122 }, "text": "0.600\n0.790\n0.730\n2.120", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p140.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 153.356131, "t": 630.19443, "r": 164.524784, "b": 578.127122 }, "text": "39\n98\n98\n81", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p140.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 183.893021, "t": 630.19443, "r": 395.020265, "b": 578.127122 }, "text": ">75% Grass cover, Good, HSG A (1S, 6S, 10S)\nPaved parking, HSG A (2S, 11S)\nRoofs, HSG A (5S, 8S)\nTOTAL AREA", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 } ], "reading_order": 4 } ] }, { "document_id": 11809, "page": 141, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 11, "counts_by_type": { "header": 3, "heading": 1, "table": 1, "table_cell": 6 }, "build_ms": 1, "items": [ { "id": "p141.1", "order": 1, "type": "header", "bbox": { "l": 52.08, "t": 738, "r": 100.32, "b": 724.8 }, "text": "OCSCD", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p141.2", "order": 2, "type": "header", "bbox": { "l": 52.08, "t": 724.8, "r": 392.64, "b": 698.88 }, "text": "Prepared by Professional Design Services\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 1 }, { "id": "p141.3", "order": 3, "type": "header", "bbox": { "l": 461.28, "t": 724.56, "r": 559.92, "b": 699.12 }, "text": "Printed 12/31/2025\nPage 4", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 2 }, { "id": "p141.4", "order": 4, "type": "heading", "bbox": { "l": 243.36, "t": 687.6, "r": 371.04, "b": 672.48 }, "text": "Soil Listing (all nodes)", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 3 }, { "id": "p141.5", "order": 5, "type": "table", "bbox": { "l": 51.6, "t": 663.84, "r": 330.72, "b": 549.6 }, "text": "", "attrs": { "block_label": "table", "n_rows": 2, "n_cols": 3, "integrity": { "cells_checked": 5, "cells_flagged": 0 } }, "children": [ { "id": "p141.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 97.620155, "t": 661.21453, "r": 128.276947, "b": 564.507341 }, "text": "Area (acres)\n2.120\n0.000\n0.000\n0.000\n0.000", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p141.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 147.895639, "t": 661.21453, "r": 179.021232, "b": 564.507341 }, "text": "Soil Group\nHSG A\nHSG B\nHSG C\nHSG D\nOther", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p141.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 198.657776, "t": 661.21453, "r": 326.511528, "b": 619.226271 }, "text": "Subcatchment Numbers\n1S, 2S, 5S, 6S, 8S, 10S, 11S", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p141.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 104.280497, "t": 561.735817, "r": 128.870403, "b": 550.767658 }, "text": "2.120", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 3 }, { "id": "p141.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 144.64, "t": 565.92, "r": 237.68, "b": 549.6 }, "text": "", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1 }, "reading_order": 4 }, { "id": "p141.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 198.656793, "t": 561.735817, "r": 261.989069, "b": 550.767658 }, "text": "TOTAL AREA", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 } ], "reading_order": 4 } ] }, { "document_id": 11809, "page": 142, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 26, "counts_by_type": { "form_field": 2, "table": 2, "table_cell": 22 }, "build_ms": 2, "items": [ { "id": "p142.1", "order": 1, "type": "table", "bbox": { "l": 51.6, "t": 738.24, "r": 567.12, "b": 697.92 }, "text": "", "attrs": { "block_label": "table", "n_rows": 3, "n_cols": 3, "integrity": { "cells_checked": 5, "cells_flagged": 0 } }, "children": [ { "id": "p142.1.1", "order": 2, "type": "table_cell", "bbox": { "l": 54, "t": 737.984717, "r": 99.186248, "b": 724.019651 }, "text": "OCSCD", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 0 }, { "id": "p142.1.2", "order": 3, "type": "table_cell", "bbox": { "l": 54, "t": 724.06687, "r": 272.267766, "b": 711.061006 }, "text": "Prepared by Professional Design Services", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 1 }, { "id": "p142.1.3", "order": 4, "type": "table_cell", "bbox": { "l": 463.832107, "t": 724.140786, "r": 557.581301, "b": 712.153607 }, "text": "Printed 12/31/2025", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 2 }, { "id": "p142.1.4", "order": 5, "type": "table_cell", "bbox": { "l": 51.6, "t": 711.36, "r": 395.28, "b": 697.92 }, "text": "HydroCAD ○ledR 10.20-6a s/n 02223 ○ledC 2024 HydroCAD Software Solutions LLC", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 2 }, "children": [ { "id": "p142.1.4.1", "order": 6, "type": "form_field", "bbox": { "l": 92.3, "t": 711.36, "r": 104.3, "b": 699.36 }, "text": "", "attrs": { "field_kind": "radio", "label": "ledR 10.20-6a s/n 02223", "source": "glyph_estimate", "bbox_estimated": true, "row": 2, "col": 0, "rowspan": 1, "colspan": 2, "label_source": "parent_text", "label_ref": "p142.1.4", "text_offset": 9, "text_span": 1 }, "reading_order": 0 }, { "id": "p142.1.4.2", "order": 7, "type": "form_field", "bbox": { "l": 205.35, "t": 711.36, "r": 217.35, "b": 699.36 }, "text": "", "attrs": { "field_kind": "radio", "label": "ledC 2024 HydroCAD Software Solutions LLC", "source": "glyph_estimate", "bbox_estimated": true, "row": 2, "col": 0, "rowspan": 1, "colspan": 2, "label_source": "parent_text", "label_ref": "p142.1.4", "text_offset": 34, "text_span": 1 }, "reading_order": 1 } ], "reading_order": 3 }, { "id": "p142.1.5", "order": 8, "type": "table_cell", "bbox": { "l": 523.86, "t": 711.120786, "r": 557.898863, "b": 699.133607 }, "text": "Page 5", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 } ], "reading_order": 0 }, { "id": "p142.2", "order": 9, "type": "table", "bbox": { "l": 52.08, "t": 688.8, "r": 577.2, "b": 561.36 }, "text": "", "attrs": { "block_label": "table", "n_rows": 3, "n_cols": 8, "integrity": { "cells_checked": 17, "cells_flagged": 0 } }, "children": [ { "id": "p142.2.1", "order": 10, "type": "table_cell", "bbox": { "l": 234.84, "t": 687.04687, "r": 381.190932, "b": 674.041006 }, "text": "Ground Covers (all nodes)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 8, "bbox_refit": true }, "reading_order": 0 }, { "id": "p142.2.2", "order": 11, "type": "table_cell", "bbox": { "l": 77.52, "t": 661.21453, "r": 108.649906, "b": 619.226271 }, "text": "HSG-A (acres)\n0.600", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p142.2.3", "order": 12, "type": "table_cell", "bbox": { "l": 132.179961, "t": 661.21453, "r": 163.305936, "b": 619.226271 }, "text": "HSG-B (acres)\n0.000", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p142.2.4", "order": 13, "type": "table_cell", "bbox": { "l": 186.299376, "t": 661.21453, "r": 217.965515, "b": 619.226271 }, "text": "HSG-C (acres)\n0.000", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p142.2.5", "order": 14, "type": "table_cell", "bbox": { "l": 240.959337, "t": 661.21453, "r": 272.625476, "b": 619.226271 }, "text": "HSG-D (acres)\n0.000", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p142.2.6", "order": 15, "type": "table_cell", "bbox": { "l": 296.639455, "t": 661.21453, "r": 327.274025, "b": 619.226271 }, "text": "Other (acres)\n0.000", "attrs": { "row": 1, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p142.2.7", "order": 16, "type": "table_cell", "bbox": { "l": 351.300399, "t": 661.21453, "r": 381.968002, "b": 619.226271 }, "text": "Total (acres)\n0.600", "attrs": { "row": 1, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p142.2.8", "order": 17, "type": "table_cell", "bbox": { "l": 395.01617, "t": 661.21453, "r": 505.631435, "b": 619.226271 }, "text": "Ground Cover\n>75% Grass cover, Good", "attrs": { "row": 1, "col": 6, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 7 }, { "id": "p142.2.9", "order": 18, "type": "table_cell", "bbox": { "l": 512.493415, "t": 661.21453, "r": 575.341766, "b": 605.5465389999999 }, "text": "Subcatchment Numbers\n1S, 6S, 10S", "attrs": { "row": 1, "col": 7, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 8 }, { "id": "p142.2.10", "order": 19, "type": "table_cell", "bbox": { "l": 84.06, "t": 602.834966, "r": 109.24942, "b": 564.44739 }, "text": "0.790\n0.730\n2.120", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 9 }, { "id": "p142.2.11", "order": 20, "type": "table_cell", "bbox": { "l": 138.71603, "t": 602.834966, "r": 163.90545, "b": 564.44739 }, "text": "0.000\n0.000\n0.000", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 10 }, { "id": "p142.2.12", "order": 21, "type": "table_cell", "bbox": { "l": 193.372059, "t": 602.834966, "r": 218.56148, "b": 564.44739 }, "text": "0.000\n0.000\n0.000", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 11 }, { "id": "p142.2.13", "order": 22, "type": "table_cell", "bbox": { "l": 248.028089, "t": 602.834966, "r": 273.217509, "b": 564.44739 }, "text": "0.000\n0.000\n0.000", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 12 }, { "id": "p142.2.14", "order": 23, "type": "table_cell", "bbox": { "l": 302.684119, "t": 602.834966, "r": 327.873539, "b": 564.44739 }, "text": "0.000\n0.000\n0.000", "attrs": { "row": 2, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 13 }, { "id": "p142.2.15", "order": 24, "type": "table_cell", "bbox": { "l": 357.340149, "t": 602.834966, "r": 382.529569, "b": 564.44739 }, "text": "0.790\n0.730\n2.120", "attrs": { "row": 2, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 14 }, { "id": "p142.2.16", "order": 25, "type": "table_cell", "bbox": { "l": 395.015187, "t": 602.834966, "r": 458.347464, "b": 564.44739 }, "text": "Paved parking\nRoofs\nTOTAL AREA", "attrs": { "row": 2, "col": 6, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 15 }, { "id": "p142.2.17", "order": 26, "type": "table_cell", "bbox": { "l": 512.486535, "t": 602.834966, "r": 547.454915, "b": 578.1870739999999 }, "text": "2S, 11S\n5S, 8S", "attrs": { "row": 2, "col": 7, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 16 } ], "reading_order": 1 } ] }, { "document_id": 11809, "page": 143, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 20, "counts_by_type": { "footer": 1, "text": 19 }, "build_ms": 2, "items": [ { "id": "p143.1", "order": 1, "type": "text", "bbox": { "l": 120.72, "t": 687.12, "r": 490.32, "b": 651.12 }, "text": "Time span=5.00-20.00 hrs, dt=0.05 hrs, 301 points\nRunoff by SCS TR-20 method, UH=Delmarva, Weighted-CN\nReach routing by Stor-Ind+Trans method - Pond routing by Stor-Ind method", "reading_order": 0 }, { "id": "p143.2", "order": 2, "type": "text", "bbox": { "l": 257.76, "t": 640.08, "r": 560.16, "b": 616.32 }, "text": "Subcatchment1S: POROUS\nRunoff Area=0.350 ac 0.00% Impervious Runoff Depth>0.00\"\nFlow Length=310' Tc=12.9 min CN=39 Runoff=0.00 cfs 0.000 af", "reading_order": 1 }, { "id": "p143.3", "order": 3, "type": "text", "bbox": { "l": 259.44, "t": 605.52, "r": 559.68, "b": 581.04 }, "text": "Subcatchment2S: IMPERVIOUS\nRunoff Area=0.720 ac 100.00% Impervious Runoff Depth>2.91\"\nFlow Length=310' Tc=13.1 min CN=98 Runoff=1.36 cfs 0.175 af", "reading_order": 2 }, { "id": "p143.4", "order": 4, "type": "text", "bbox": { "l": 52.56, "t": 568.8, "r": 559.92, "b": 546 }, "text": "Subcatchment5S: IMPERVIOUS Runoff Area=0.270 ac 100.00% Impervious Runoff Depth>2.92\" Flow Length=180' Slope=0.0100'/' Tc=1.6 min CN=98 Runoff=0.93 cfs 0.066 af", "reading_order": 3 }, { "id": "p143.5", "order": 5, "type": "text", "bbox": { "l": 277.2, "t": 533.28, "r": 559.68, "b": 522 }, "text": "Subcatchment6S: POROUS\nRunoff Area=0.190 ac 0.00% Impervious Runoff Depth>0.00\"", "reading_order": 4 }, { "id": "p143.6", "order": 6, "type": "text", "bbox": { "l": 256.8, "t": 520.8, "r": 560.16, "b": 509.28 }, "text": "Flow Length=250' Tc=12.4 min CN=39 Runoff=0.00 cfs 0.000 af", "reading_order": 5 }, { "id": "p143.7", "order": 7, "type": "text", "bbox": { "l": 52.8, "t": 497.28, "r": 560.4, "b": 473.76 }, "text": "Subcatchment8S: PROP WAREHOUSE Runoff Area=0.460 ac 100.00% Impervious Runoff Depth>2.92\" Flow Length=280' Slope=0.0100'/' Tc=2.6 min CN=98 Runoff=1.48 cfs 0.112 af", "reading_order": 6 }, { "id": "p143.8", "order": 8, "type": "text", "bbox": { "l": 52.32, "t": 462.48, "r": 560.16, "b": 440.16 }, "text": "Runoff Area=0.060 ac 0.00% Impervious Runoff Depth>0.00\"\nTc=2.0 min CN=39 Runoff=0.00 cfs 0.000 af", "reading_order": 7 }, { "id": "p143.9", "order": 9, "type": "text", "bbox": { "l": 51.6, "t": 461.52, "r": 251.76, "b": 449.52 }, "text": "Subcatchment10S: BY-PASS POROUS", "reading_order": 8 }, { "id": "p143.10", "order": 10, "type": "text", "bbox": { "l": 52.32, "t": 426.24, "r": 559.44, "b": 403.2 }, "text": "Runoff Area=0.070 ac 100.00% Impervious Runoff Depth>2.92\"\nTc=2.0 min CN=98 Runoff=0.24 cfs 0.017 af", "reading_order": 9 }, { "id": "p143.11", "order": 11, "type": "text", "bbox": { "l": 51.6, "t": 425.52, "r": 203.76, "b": 413.76 }, "text": "Subcatchment11S: BY-PASS", "reading_order": 10 }, { "id": "p143.12", "order": 12, "type": "text", "bbox": { "l": 51.6, "t": 390, "r": 172.8, "b": 378.48 }, "text": "Reach 10: COMPOSITE", "reading_order": 11 }, { "id": "p143.13", "order": 13, "type": "text", "bbox": { "l": 447.12, "t": 390.72, "r": 559.92, "b": 379.2 }, "text": "Inflow=2.25 cfs 0.362 af", "reading_order": 12 }, { "id": "p143.14", "order": 14, "type": "text", "bbox": { "l": 440.64, "t": 378, "r": 560.16, "b": 366.72 }, "text": "Outflow=2.25 cfs 0.362 af", "reading_order": 13 }, { "id": "p143.15", "order": 15, "type": "text", "bbox": { "l": 52.56, "t": 354.48, "r": 560.16, "b": 331.44 }, "text": "Pond 3P: SSIB #1 SURFACE BASIN Peak Elev=111.97' Storage=4,951 cf Inflow=1.36 cfs 0.175 af Discarded=0.00 cfs 0.000 af Primary=0.87 cfs 0.171 af Outflow=0.87 cfs 0.171 af", "reading_order": 14 }, { "id": "p143.16", "order": 16, "type": "text", "bbox": { "l": 51.6, "t": 319.44, "r": 559.2, "b": 307.44 }, "text": "Pond 8P: SSIB #2 UNDERGROUND Peak Elev=109.35' Storage=0.068 af Inflow=0.93 cfs 0.066 af", "reading_order": 15 }, { "id": "p143.17", "order": 17, "type": "text", "bbox": { "l": 182.4, "t": 306.72, "r": 559.2, "b": 295.68 }, "text": "Discarded=0.00 cfs 0.000 af Primary=0.44 cfs 0.064 af Outflow=0.44 cfs 0.064 af", "reading_order": 16 }, { "id": "p143.18", "order": 18, "type": "text", "bbox": { "l": 53.04, "t": 283.92, "r": 559.44, "b": 259.68 }, "text": "Pond 9P: SSIB #3 UNDERGROUND Peak Elev=113.49' Storage=0.129 af Inflow=1.48 cfs 0.112 af Discarded=0.00 cfs 0.000 af Primary=1.09 cfs 0.110 af Outflow=1.09 cfs 0.110 af", "reading_order": 17 }, { "id": "p143.19", "order": 19, "type": "text", "bbox": { "l": 122.64, "t": 247.68, "r": 568.56, "b": 223.92 }, "text": "Total Runoff Area = 2.120 ac Runoff Volume = 0.369 af Average Runoff Depth = 2.09\"\n28.30% Pervious = 0.600 ac 71.70% Impervious = 1.520 ac", "reading_order": 18 }, { "id": "p143.20", "order": 20, "type": "footer", "bbox": { "l": 51.36, "t": 738.96, "r": 560.64, "b": 700.56 }, "text": "OCSCD NOAA 24-hr D 2 YEAR Rainfall=3.42\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 6", "attrs": { "block_label": "footer" }, "reading_order": 19 } ] }, { "document_id": 11809, "page": 144, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 46, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "heading": 1, "table": 1, "table_cell": 39, "text": 2 }, "build_ms": 4, "items": [ { "id": "p144.1", "order": 1, "type": "header", "bbox": { "l": 51.6, "t": 739.44, "r": 561.6, "b": 698.88 }, "text": "OCSCD NOAA 24-hr D 2 YEAR Rainfall=3.42\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 7", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p144.2", "order": 2, "type": "heading", "bbox": { "l": 183.6, "t": 687.36, "r": 434.64, "b": 672.72 }, "text": "Summary for Subcatchment 1S: POROUS", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p144.3", "order": 3, "type": "text", "bbox": { "l": 52.56, "t": 660, "r": 464.4, "b": 634.32 }, "text": "Runoff = 0.00 cfs @ 20.00 hrs, Volume= 0.000 af, Depth> 0.00\"\nRouted to Pond 3P : SSIB #1 SURFACE BASIN", "reading_order": 2 }, { "id": "p144.4", "order": 4, "type": "text", "bbox": { "l": 52.08, "t": 624.24, "r": 541.44, "b": 598.56 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Weighted-CN, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs NOAA 24-hr D 2 YEAR Rainfall=3.42\"", "reading_order": 3 }, { "id": "p144.5", "order": 5, "type": "table", "bbox": { "l": 52.32, "t": 589.92, "r": 559.2, "b": 436.56 }, "text": "", "attrs": { "block_label": "table", "n_rows": 8, "n_cols": 7, "integrity": { "cells_checked": 31, "cells_flagged": 0 } }, "children": [ { "id": "p144.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 69.659595, "t": 588.002283, "r": 113.82741, "b": 576.0151040000001 }, "text": "Area (ac)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p144.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 130.796358, "t": 588.002283, "r": 146.30665, "b": 576.0151040000001 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p144.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 289.05701, "t": 536.641352, "r": 342.773751, "b": 524.654172 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p144.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 87, "t": 560.400886, "r": 113.874482, "b": 548.4137069999999 }, "text": "0.350", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 3 }, { "id": "p144.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 134.275244, "t": 574.200786, "r": 146.219458, "b": 562.213607 }, "text": "39", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p144.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 160.552515, "t": 574.200786, "r": 320.843443, "b": 562.213607 }, "text": ">75% Grass cover, Good, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true }, "reading_order": 5 }, { "id": "p144.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 87, "t": 574.200786, "r": 113.874482, "b": 562.213607 }, "text": "0.350", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 6 }, { "id": "p144.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 160.555738, "t": 560.400886, "r": 273.392044, "b": 548.4137069999999 }, "text": "100.00% Pervious Area", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 5, "bbox_refit": true }, "reading_order": 7 }, { "id": "p144.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 65.459598, "t": 536.641352, "r": 89.993572, "b": 512.774405 }, "text": "Tc\\n(min)", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p144.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 100.682141, "t": 536.641352, "r": 133.545916, "b": 512.774405 }, "text": "Length\\n(feet)", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p144.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 149.815612, "t": 536.641352, "r": 177.28086, "b": 512.774405 }, "text": "Slope\\n(ft/ft)", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p144.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 188.028505, "t": 536.641352, "r": 225.633446, "b": 512.774405 }, "text": "Velocity\\n(ft/sec)", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 }, { "id": "p144.5.13", "order": 18, "type": "table_cell", "bbox": { "l": 236.50354, "t": 536.641352, "r": 278.288957, "b": 512.774405 }, "text": "Capacity\\n(cfs)", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 12 }, { "id": "p144.5.14", "order": 19, "type": "table_cell", "bbox": { "l": 160.552704, "t": 588.002283, "r": 214.269445, "b": 576.0151040000001 }, "text": "Description", "attrs": { "row": 3, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 13 }, { "id": "p144.5.15", "order": 20, "type": "table_cell", "bbox": { "l": 69, "t": 510.960886, "r": 89.902375, "b": 498.973707 }, "text": "11.7", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p144.5.16", "order": 21, "type": "table_cell", "bbox": { "l": 115.676959, "t": 510.960886, "r": 133.59328, "b": 498.973707 }, "text": "100", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p144.5.17", "order": 22, "type": "table_cell", "bbox": { "l": 144.351666, "t": 510.960886, "r": 177.198256, "b": 498.973707 }, "text": "0.0300", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p144.5.18", "order": 23, "type": "table_cell", "bbox": { "l": 204.705395, "t": 510.960886, "r": 225.60777, "b": 498.973707 }, "text": "0.14", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p144.5.19", "order": 24, "type": "table_cell", "bbox": { "l": 341.9657, "t": 513.24, "r": 414.3771, "b": 494.07 }, "text": "", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 18 }, { "id": "p144.5.20", "order": 25, "type": "table_cell", "bbox": { "l": 289.079669, "t": 510.780434, "r": 461.873354, "b": 487.092865 }, "text": "Sheet Flow,\\nGrass: Dense n= 0.240 P2= 3.42\"", "attrs": { "row": 4, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 19 }, { "id": "p144.5.21", "order": 26, "type": "table_cell", "bbox": { "l": 75.000034, "t": 487.200277, "r": 89.930302, "b": 475.213098 }, "text": "0.3", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p144.5.22", "order": 27, "type": "table_cell", "bbox": { "l": 121.678067, "t": 487.200277, "r": 133.622282, "b": 475.213098 }, "text": "50", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p144.5.23", "order": 28, "type": "table_cell", "bbox": { "l": 144.354889, "t": 487.200277, "r": 177.201478, "b": 475.213098 }, "text": "0.0350", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 22 }, { "id": "p144.5.24", "order": 29, "type": "table_cell", "bbox": { "l": 204.708617, "t": 487.200277, "r": 225.610992, "b": 475.213098 }, "text": "2.81", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 23 }, { "id": "p144.5.25", "order": 30, "type": "table_cell", "bbox": { "l": 341.9657, "t": 494.07, "r": 414.3771, "b": 474.9 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 24 }, { "id": "p144.5.26", "order": 31, "type": "table_cell", "bbox": { "l": 289.079669, "t": 487.019825, "r": 449.370597, "b": 463.332257 }, "text": "Shallow Concentrated Flow,\\nGrassed Waterway Kv= 15.0 fps", "attrs": { "row": 5, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 25 }, { "id": "p144.5.27", "order": 32, "type": "table_cell", "bbox": { "l": 75.000034, "t": 463.439669, "r": 89.930302, "b": 451.45249 }, "text": "0.9", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 26 }, { "id": "p144.5.28", "order": 33, "type": "table_cell", "bbox": { "l": 115.679107, "t": 463.439669, "r": 133.595429, "b": 451.45249 }, "text": "160", "attrs": { "row": 6, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 27 }, { "id": "p144.5.29", "order": 34, "type": "table_cell", "bbox": { "l": 197.1429, "t": 474.9, "r": 269.5543, "b": 455.73 }, "text": "", "attrs": { "row": 6, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 28 }, { "id": "p144.5.30", "order": 35, "type": "table_cell", "bbox": { "l": 204.713988, "t": 463.439669, "r": 225.616363, "b": 451.45249 }, "text": "3.00", "attrs": { "row": 6, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 29 }, { "id": "p144.5.31", "order": 36, "type": "table_cell", "bbox": { "l": 341.9657, "t": 474.9, "r": 414.3771, "b": 455.73 }, "text": "", "attrs": { "row": 6, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 30 }, { "id": "p144.5.32", "order": 37, "type": "table_cell", "bbox": { "l": 289.079669, "t": 463.259217, "r": 415.020239, "b": 451.272038 }, "text": "Direct Entry, PIPE FLOW", "attrs": { "row": 6, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 31 }, { "id": "p144.5.33", "order": 38, "type": "table_cell", "bbox": { "l": 69, "t": 449.640786, "r": 89.902375, "b": 437.653607 }, "text": "12.9", "attrs": { "row": 7, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 32 }, { "id": "p144.5.34", "order": 39, "type": "table_cell", "bbox": { "l": 115.676959, "t": 449.640786, "r": 133.59328, "b": 437.653607 }, "text": "310", "attrs": { "row": 7, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 33 }, { "id": "p144.5.35", "order": 40, "type": "table_cell", "bbox": { "l": 144.351666, "t": 449.640786, "r": 168.229354, "b": 437.653607 }, "text": "Total", "attrs": { "row": 7, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 34 }, { "id": "p144.5.36", "order": 41, "type": "table_cell", "bbox": { "l": 269.5543, "t": 455.73, "r": 341.9657, "b": 436.56 }, "text": "", "attrs": { "row": 7, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 35 }, { "id": "p144.5.37", "order": 42, "type": "table_cell", "bbox": { "l": 341.9657, "t": 455.73, "r": 414.3771, "b": 436.56 }, "text": "", "attrs": { "row": 7, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 36 }, { "id": "p144.5.38", "order": 43, "type": "table_cell", "bbox": { "l": 414.3771, "t": 455.73, "r": 486.7886, "b": 436.56 }, "text": "", "attrs": { "row": 7, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 37 }, { "id": "p144.5.39", "order": 44, "type": "table_cell", "bbox": { "l": 486.7886, "t": 455.73, "r": 559.2, "b": 436.56 }, "text": "", "attrs": { "row": 7, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 38 } ], "reading_order": 4 }, { "id": "p144.6", "order": 45, "type": "caption", "bbox": { "l": 222.48, "t": 425.28, "r": 393.12, "b": 410.64 }, "text": "Subcatchment 1S: POROUS", "attrs": { "block_label": "figure_title" }, "reading_order": 5 }, { "id": "p144.7", "order": 46, "type": "figure", "bbox": { "l": 63.84, "t": 404.4, "r": 550.08, "b": 138 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n0.000 Runoff\n0.000 0.00 cfs\n0.000\n0.000 NOAA 24-hr D\n0.000\n0.000 2 YEAR Rainfall=3.42\"\n0.000\nRunoff Area=0.350 ac\n0.000\n0.000\n0.000 Runoff Volume=0.000 af\n0.000\n(cfs) 0.000 Runoff Depth>0.00\"\n0.000\nFlow 0.000 Flow Length=310'\n0.000\n0.000\n0 Tc=12.9 min\n0\n0 CN=39\n0\n0\n0\n0\n0\n0\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 6 } ] }, { "document_id": 11809, "page": 145, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 44, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "heading": 1, "table": 1, "table_cell": 36, "text": 3 }, "build_ms": 4, "items": [ { "id": "p145.1", "order": 1, "type": "header", "bbox": { "l": 51.36, "t": 739.44, "r": 561.36, "b": 698.64 }, "text": "OCSCD NOAA 24-hr D 2 YEAR Rainfall=3.42\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 8", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p145.2", "order": 2, "type": "heading", "bbox": { "l": 171.84, "t": 687.36, "r": 447.12, "b": 672.72 }, "text": "Summary for Subcatchment 2S: IMPERVIOUS", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p145.3", "order": 3, "type": "text", "bbox": { "l": 52.08, "t": 660, "r": 306.72, "b": 634.56 }, "text": "Runoff = 1.36 cfs @ 12.22 hrs, Volume=\nRouted to Pond 3P : SSIB #1 SURFACE BASIN\n0.175 af, Depth> 2.91\"", "reading_order": 2 }, { "id": "p145.4", "order": 4, "type": "text", "bbox": { "l": 344.88, "t": 659.76, "r": 463.68, "b": 646.8 }, "text": "0.175 af, Depth> 2.91\"", "reading_order": 3 }, { "id": "p145.5", "order": 5, "type": "text", "bbox": { "l": 52.08, "t": 624.48, "r": 541.44, "b": 598.56 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Weighted-CN, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs NOAA 24-hr D 2 YEAR Rainfall=3.42\"", "reading_order": 4 }, { "id": "p145.6", "order": 6, "type": "table", "bbox": { "l": 52.32, "t": 590.16, "r": 559.2, "b": 436.56 }, "text": "", "attrs": { "block_label": "table", "n_rows": 7, "n_cols": 7, "integrity": { "cells_checked": 28, "cells_flagged": 0 } }, "children": [ { "id": "p145.6.1", "order": 7, "type": "table_cell", "bbox": { "l": 69.659595, "t": 588.002283, "r": 113.82741, "b": 576.0151040000001 }, "text": "Area (ac)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p145.6.2", "order": 8, "type": "table_cell", "bbox": { "l": 130.796358, "t": 588.002283, "r": 146.30665, "b": 576.0151040000001 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p145.6.3", "order": 9, "type": "table_cell", "bbox": { "l": 289.05701, "t": 536.641352, "r": 342.773751, "b": 524.654172 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p145.6.4", "order": 10, "type": "table_cell", "bbox": { "l": 87, "t": 574.200786, "r": 113.874482, "b": 548.4137069999999 }, "text": "0.720\n0.720", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p145.6.5", "order": 11, "type": "table_cell", "bbox": { "l": 134.275244, "t": 574.200786, "r": 284.133244, "b": 548.4137069999999 }, "text": "98\n100.00% Impervious Area", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p145.6.6", "order": 12, "type": "table_cell", "bbox": { "l": 160.552515, "t": 574.200786, "r": 268.608987, "b": 562.213607 }, "text": "Paved parking, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true }, "reading_order": 5 }, { "id": "p145.6.7", "order": 13, "type": "table_cell", "bbox": { "l": 65.459598, "t": 536.641352, "r": 89.993572, "b": 512.774405 }, "text": "Tc\\n(min)", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p145.6.8", "order": 14, "type": "table_cell", "bbox": { "l": 100.682141, "t": 536.641352, "r": 133.545916, "b": 512.774405 }, "text": "Length\\n(feet)", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p145.6.9", "order": 15, "type": "table_cell", "bbox": { "l": 149.815612, "t": 536.641352, "r": 177.28086, "b": 512.774405 }, "text": "Slope\\n(ft/ft)", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p145.6.10", "order": 16, "type": "table_cell", "bbox": { "l": 188.028505, "t": 536.641352, "r": 225.633446, "b": 512.774405 }, "text": "Velocity\\n(ft/sec)", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p145.6.11", "order": 17, "type": "table_cell", "bbox": { "l": 236.50354, "t": 536.641352, "r": 278.288957, "b": 512.774405 }, "text": "Capacity\\n(cfs)", "attrs": { "row": 2, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p145.6.12", "order": 18, "type": "table_cell", "bbox": { "l": 160.552704, "t": 588.002283, "r": 214.269445, "b": 576.0151040000001 }, "text": "Description", "attrs": { "row": 2, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 11 }, { "id": "p145.6.13", "order": 19, "type": "table_cell", "bbox": { "l": 69, "t": 510.960886, "r": 89.902375, "b": 498.973707 }, "text": "11.7", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 12 }, { "id": "p145.6.14", "order": 20, "type": "table_cell", "bbox": { "l": 115.676959, "t": 510.960886, "r": 133.59328, "b": 498.973707 }, "text": "100", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p145.6.15", "order": 21, "type": "table_cell", "bbox": { "l": 144.351666, "t": 510.960886, "r": 177.198256, "b": 498.973707 }, "text": "0.0300", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p145.6.16", "order": 22, "type": "table_cell", "bbox": { "l": 204.705395, "t": 510.960886, "r": 225.60777, "b": 498.973707 }, "text": "0.14", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p145.6.17", "order": 23, "type": "table_cell", "bbox": { "l": 341.9657, "t": 513.36, "r": 414.3771, "b": 494.16 }, "text": "", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 16 }, { "id": "p145.6.18", "order": 24, "type": "table_cell", "bbox": { "l": 289.079669, "t": 510.780434, "r": 461.873354, "b": 463.332257 }, "text": "Sheet Flow,\\nGrass: Dense n= 0.240 P2= 3.42\"\\nShallow Concentrated Flow,\\nGrassed Waterway Kv= 15.0 fps", "attrs": { "row": 3, "col": 5, "rowspan": 2, "colspan": 2, "bbox_refit": true }, "reading_order": 17 }, { "id": "p145.6.19", "order": 25, "type": "table_cell", "bbox": { "l": 75.000034, "t": 487.200277, "r": 89.930302, "b": 475.213098 }, "text": "0.5", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p145.6.20", "order": 26, "type": "table_cell", "bbox": { "l": 121.678067, "t": 487.200277, "r": 133.622282, "b": 475.213098 }, "text": "50", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p145.6.21", "order": 27, "type": "table_cell", "bbox": { "l": 144.354889, "t": 487.200277, "r": 177.201478, "b": 475.213098 }, "text": "0.0110", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p145.6.22", "order": 28, "type": "table_cell", "bbox": { "l": 204.708617, "t": 487.200277, "r": 225.610992, "b": 475.213098 }, "text": "1.57", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p145.6.23", "order": 29, "type": "table_cell", "bbox": { "l": 341.9657, "t": 494.16, "r": 414.3771, "b": 474.96 }, "text": "", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 22 }, { "id": "p145.6.24", "order": 30, "type": "table_cell", "bbox": { "l": 75.000034, "t": 463.439669, "r": 89.930302, "b": 451.45249 }, "text": "0.9", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 23 }, { "id": "p145.6.25", "order": 31, "type": "table_cell", "bbox": { "l": 115.679107, "t": 463.439669, "r": 133.595429, "b": 451.45249 }, "text": "160", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 24 }, { "id": "p145.6.26", "order": 32, "type": "table_cell", "bbox": { "l": 197.1429, "t": 474.96, "r": 269.5543, "b": 455.76 }, "text": "", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 25 }, { "id": "p145.6.27", "order": 33, "type": "table_cell", "bbox": { "l": 204.713988, "t": 463.439669, "r": 225.616363, "b": 451.45249 }, "text": "3.00", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 26 }, { "id": "p145.6.28", "order": 34, "type": "table_cell", "bbox": { "l": 341.9657, "t": 474.96, "r": 414.3771, "b": 455.76 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 27 }, { "id": "p145.6.29", "order": 35, "type": "table_cell", "bbox": { "l": 289.079669, "t": 463.259217, "r": 415.020239, "b": 451.272038 }, "text": "Direct Entry, PIPE FLOW", "attrs": { "row": 5, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 28 }, { "id": "p145.6.30", "order": 36, "type": "table_cell", "bbox": { "l": 69, "t": 449.640786, "r": 89.902375, "b": 437.653607 }, "text": "13.1", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 29 }, { "id": "p145.6.31", "order": 37, "type": "table_cell", "bbox": { "l": 115.676959, "t": 449.640786, "r": 133.59328, "b": 437.653607 }, "text": "310", "attrs": { "row": 6, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 30 }, { "id": "p145.6.32", "order": 38, "type": "table_cell", "bbox": { "l": 144.351666, "t": 449.640786, "r": 168.229354, "b": 437.653607 }, "text": "Total", "attrs": { "row": 6, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 31 }, { "id": "p145.6.33", "order": 39, "type": "table_cell", "bbox": { "l": 269.5543, "t": 455.76, "r": 341.9657, "b": 436.56 }, "text": "", "attrs": { "row": 6, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 32 }, { "id": "p145.6.34", "order": 40, "type": "table_cell", "bbox": { "l": 341.9657, "t": 455.76, "r": 414.3771, "b": 436.56 }, "text": "", "attrs": { "row": 6, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 33 }, { "id": "p145.6.35", "order": 41, "type": "table_cell", "bbox": { "l": 414.3771, "t": 455.76, "r": 486.7886, "b": 436.56 }, "text": "", "attrs": { "row": 6, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 34 }, { "id": "p145.6.36", "order": 42, "type": "table_cell", "bbox": { "l": 486.7886, "t": 455.76, "r": 559.2, "b": 436.56 }, "text": "", "attrs": { "row": 6, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 35 } ], "reading_order": 5 }, { "id": "p145.7", "order": 43, "type": "caption", "bbox": { "l": 210.48, "t": 425.52, "r": 405.6, "b": 410.4 }, "text": "Subcatchment 2S: IMPERVIOUS", "attrs": { "block_label": "figure_title" }, "reading_order": 6 }, { "id": "p145.8", "order": 44, "type": "figure", "bbox": { "l": 60.96, "t": 410.16, "r": 553.68, "b": 136.32 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nRunoff\n1.36 cfs\nNOAA 24-hr D\n2 YEAR Rainfall=3.42\"\nRunoff Area=0.720 ac\n1\nRunoff Volume=0.175 af\n(cfs) Runoff Depth>2.91\"\nFlow Flow Length=310'\nTc=13.1 min\nCN=98\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 7 } ] }, { "document_id": 11809, "page": 146, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 40, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "heading": 1, "table": 1, "table_cell": 33, "text": 2 }, "build_ms": 3, "items": [ { "id": "p146.1", "order": 1, "type": "header", "bbox": { "l": 51.6, "t": 739.2, "r": 561.12, "b": 698.64 }, "text": "OCSCD NOAA 24-hr D 2 YEAR Rainfall=3.42\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 9", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p146.2", "order": 2, "type": "heading", "bbox": { "l": 171.84, "t": 687.36, "r": 447.36, "b": 672.72 }, "text": "Summary for Subcatchment 5S: IMPERVIOUS", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p146.3", "order": 3, "type": "text", "bbox": { "l": 52.56, "t": 660.24, "r": 464.16, "b": 634.32 }, "text": "Runoff = 0.93 cfs @ 12.08 hrs, Volume= 0.066 af, Depth> 2.92\"\nRouted to Pond 8P : SSIB #2 UNDERGROUND", "reading_order": 2 }, { "id": "p146.4", "order": 4, "type": "text", "bbox": { "l": 52.08, "t": 624.48, "r": 541.44, "b": 598.56 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Weighted-CN, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs NOAA 24-hr D 2 YEAR Rainfall=3.42\"", "reading_order": 3 }, { "id": "p146.5", "order": 5, "type": "table", "bbox": { "l": 52.32, "t": 589.44, "r": 559.2, "b": 461.28 }, "text": "", "attrs": { "block_label": "table", "n_rows": 7, "n_cols": 6, "integrity": { "cells_checked": 27, "cells_flagged": 1, "flags": [ { "row": 2, "col": 2, "coverage": 0, "text": "Impervious Area" } ] } }, "children": [ { "id": "p146.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 69.659595, "t": 588.002283, "r": 113.82741, "b": 576.0151040000001 }, "text": "Area (ac)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p146.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 130.796358, "t": 588.002283, "r": 146.30665, "b": 576.0151040000001 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p146.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 289.05701, "t": 536.641352, "r": 342.773751, "b": 524.654172 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p146.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 87, "t": 574.200786, "r": 113.874482, "b": 562.213607 }, "text": "0.270", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 3 }, { "id": "p146.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 134.275244, "t": 574.200786, "r": 146.219458, "b": 562.213607 }, "text": "98", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p146.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 160.552515, "t": 574.200786, "r": 228.007251, "b": 562.213607 }, "text": "Roofs, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true }, "reading_order": 5 }, { "id": "p146.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 87, "t": 560.400886, "r": 113.874482, "b": 548.4137069999999 }, "text": "0.270", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p146.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 160.555738, "t": 560.400886, "r": 202.951254, "b": 548.4137069999999 }, "text": "100.00%", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p146.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 221.28, "t": 552.8229, "r": 559.2, "b": 534.5143 }, "text": "Impervious Area", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 4 }, "reading_order": 8 }, { "id": "p146.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 65.459598, "t": 536.641352, "r": 89.993572, "b": 512.774405 }, "text": "Tc (min)", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p146.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 100.682141, "t": 536.641352, "r": 133.545916, "b": 512.774405 }, "text": "Length (feet)", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p146.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 149.815612, "t": 536.641352, "r": 177.28086, "b": 512.774405 }, "text": "Slope (ft/ft)", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 }, { "id": "p146.5.13", "order": 18, "type": "table_cell", "bbox": { "l": 188.028505, "t": 536.641352, "r": 225.633446, "b": 512.774405 }, "text": "Velocity (ft/sec)", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 12 }, { "id": "p146.5.14", "order": 19, "type": "table_cell", "bbox": { "l": 236.50354, "t": 536.641352, "r": 278.288957, "b": 512.774405 }, "text": "Capacity (cfs)", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p146.5.15", "order": 20, "type": "table_cell", "bbox": { "l": 160.552704, "t": 588.002283, "r": 214.269445, "b": 576.0151040000001 }, "text": "Description", "attrs": { "row": 3, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p146.5.16", "order": 21, "type": "table_cell", "bbox": { "l": 75, "t": 510.960886, "r": 89.930268, "b": 498.973707 }, "text": "0.9", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p146.5.17", "order": 22, "type": "table_cell", "bbox": { "l": 121.678033, "t": 510.960886, "r": 133.622247, "b": 498.973707 }, "text": "50", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p146.5.18", "order": 23, "type": "table_cell", "bbox": { "l": 144.354854, "t": 510.960886, "r": 177.201444, "b": 498.973707 }, "text": "0.0100", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p146.5.19", "order": 24, "type": "table_cell", "bbox": { "l": 204.708583, "t": 510.960886, "r": 225.610958, "b": 498.973707 }, "text": "0.94", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p146.5.20", "order": 25, "type": "table_cell", "bbox": { "l": 390.24, "t": 516.2057, "r": 474.72, "b": 497.8971 }, "text": "", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 19 }, { "id": "p146.5.21", "order": 26, "type": "table_cell", "bbox": { "l": 289.079635, "t": 510.780434, "r": 476.803587, "b": 487.092865 }, "text": "Sheet Flow, Smooth surfaces n= 0.011 P2= 3.42\"", "attrs": { "row": 4, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p146.5.22", "order": 27, "type": "table_cell", "bbox": { "l": 75, "t": 487.200277, "r": 89.930268, "b": 475.213098 }, "text": "0.7", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p146.5.23", "order": 28, "type": "table_cell", "bbox": { "l": 115.679073, "t": 487.200277, "r": 133.595394, "b": 475.213098 }, "text": "130", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 22 }, { "id": "p146.5.24", "order": 29, "type": "table_cell", "bbox": { "l": 221.28, "t": 497.8971, "r": 305.76, "b": 479.5886 }, "text": "", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 23 }, { "id": "p146.5.25", "order": 30, "type": "table_cell", "bbox": { "l": 204.713954, "t": 487.200277, "r": 225.616329, "b": 475.213098 }, "text": "3.00", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 24 }, { "id": "p146.5.26", "order": 31, "type": "table_cell", "bbox": { "l": 390.24, "t": 497.8971, "r": 474.72, "b": 479.5886 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 25 }, { "id": "p146.5.27", "order": 32, "type": "table_cell", "bbox": { "l": 289.079635, "t": 487.019825, "r": 415.020205, "b": 475.032646 }, "text": "Direct Entry, PIPE FLOW", "attrs": { "row": 5, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 26 }, { "id": "p146.5.28", "order": 33, "type": "table_cell", "bbox": { "l": 75, "t": 473.400786, "r": 89.930268, "b": 461.413607 }, "text": "1.6", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 27 }, { "id": "p146.5.29", "order": 34, "type": "table_cell", "bbox": { "l": 115.679073, "t": 473.400786, "r": 133.595394, "b": 461.413607 }, "text": "180", "attrs": { "row": 6, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 28 }, { "id": "p146.5.30", "order": 35, "type": "table_cell", "bbox": { "l": 144.35378, "t": 473.400786, "r": 168.231468, "b": 461.413607 }, "text": "Total", "attrs": { "row": 6, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 29 }, { "id": "p146.5.31", "order": 36, "type": "table_cell", "bbox": { "l": 305.76, "t": 479.5886, "r": 390.24, "b": 461.28 }, "text": "", "attrs": { "row": 6, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 30 }, { "id": "p146.5.32", "order": 37, "type": "table_cell", "bbox": { "l": 390.24, "t": 479.5886, "r": 474.72, "b": 461.28 }, "text": "", "attrs": { "row": 6, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 31 }, { "id": "p146.5.33", "order": 38, "type": "table_cell", "bbox": { "l": 474.72, "t": 479.5886, "r": 559.2, "b": 461.28 }, "text": "", "attrs": { "row": 6, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 32 } ], "reading_order": 4 }, { "id": "p146.6", "order": 39, "type": "caption", "bbox": { "l": 210.24, "t": 449.28, "r": 405.84, "b": 434.16 }, "text": "Subcatchment 5S: IMPERVIOUS", "attrs": { "block_label": "figure_title" }, "reading_order": 5 }, { "id": "p146.7", "order": 40, "type": "figure", "bbox": { "l": 60.96, "t": 430.56, "r": 553.92, "b": 161.28 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nRunoff\n1\n0.93 cfs\nNOAA 24-hr D\n2 YEAR Rainfall=3.42\"\nRunoff Area=0.270 ac\nRunoff Volume=0.066 af\n(cfs) Runoff Depth>2.92\"\nFlow Flow Length=180'\nSlope=0.0100 '/'\nTc=1.6 min\nCN=98\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 6 } ] }, { "document_id": 11809, "page": 147, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 43, "counts_by_type": { "caption": 2, "figure": 1, "header": 1, "heading": 1, "table": 1, "table_cell": 35, "text": 2 }, "build_ms": 3, "items": [ { "id": "p147.1", "order": 1, "type": "header", "bbox": { "l": 50.88, "t": 739.44, "r": 561.6, "b": 698.64 }, "text": "OCSCD NOAA 24-hr D 2 YEAR Rainfall=3.42\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 10", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p147.2", "order": 2, "type": "heading", "bbox": { "l": 183.6, "t": 687.36, "r": 434.64, "b": 672.72 }, "text": "Summary for Subcatchment 6S: POROUS", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p147.3", "order": 3, "type": "text", "bbox": { "l": 52.56, "t": 660, "r": 464.4, "b": 634.32 }, "text": "Runoff = 0.00 cfs @ 20.00 hrs, Volume= 0.000 af, Depth> 0.00\"\nRouted to Pond 8P : SSIB #2 UNDERGROUND", "reading_order": 2 }, { "id": "p147.4", "order": 4, "type": "text", "bbox": { "l": 52.08, "t": 624.24, "r": 541.44, "b": 598.8 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Weighted-CN, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs NOAA 24-hr D 2 YEAR Rainfall=3.42\"", "reading_order": 3 }, { "id": "p147.5", "order": 5, "type": "table", "bbox": { "l": 52.32, "t": 589.92, "r": 559.2, "b": 449.533607 }, "text": "", "attrs": { "block_label": "table", "n_rows": 7, "n_cols": 7, "integrity": { "cells_checked": 26, "cells_flagged": 0 } }, "children": [ { "id": "p147.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 69.659595, "t": 588.002283, "r": 113.82741, "b": 576.0151040000001 }, "text": "Area (ac)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p147.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 130.796358, "t": 588.002283, "r": 146.30665, "b": 576.0151040000001 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p147.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 289.05701, "t": 536.641352, "r": 342.773751, "b": 524.654172 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p147.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 52.32, "t": 570.24, "r": 124.7314, "b": 550.56 }, "text": "", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 3 }, { "id": "p147.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 87, "t": 560.400886, "r": 113.874482, "b": 548.4137069999999 }, "text": "0.190", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p147.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 134.275244, "t": 574.200786, "r": 146.219458, "b": 562.213607 }, "text": "39", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p147.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 160.552515, "t": 574.200786, "r": 320.843443, "b": 562.213607 }, "text": ">75% Grass cover, Good, HSG A", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 4, "bbox_refit": true }, "reading_order": 6 }, { "id": "p147.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 52.32, "t": 550.56, "r": 124.7314, "b": 530.88 }, "text": "", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 7 }, { "id": "p147.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 87, "t": 574.200786, "r": 113.874482, "b": 562.213607 }, "text": "0.190", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p147.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 197.1429, "t": 550.56, "r": 269.5543, "b": 530.88 }, "text": "", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 9 }, { "id": "p147.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 160.555738, "t": 560.400886, "r": 273.392044, "b": 548.4137069999999 }, "text": "100.00% Pervious Area", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 4, "bbox_refit": true }, "reading_order": 10 }, { "id": "p147.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 65.459598, "t": 536.641352, "r": 89.993572, "b": 512.774405 }, "text": "Tc (min)", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 }, { "id": "p147.5.13", "order": 18, "type": "table_cell", "bbox": { "l": 100.682141, "t": 536.641352, "r": 133.545916, "b": 512.774405 }, "text": "Length (feet)", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 12 }, { "id": "p147.5.14", "order": 19, "type": "table_cell", "bbox": { "l": 149.815612, "t": 536.641352, "r": 177.28086, "b": 512.774405 }, "text": "Slope (ft/ft)", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p147.5.15", "order": 20, "type": "table_cell", "bbox": { "l": 188.028505, "t": 536.641352, "r": 225.633446, "b": 512.774405 }, "text": "Velocity (ft/sec)", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p147.5.16", "order": 21, "type": "table_cell", "bbox": { "l": 236.50354, "t": 536.641352, "r": 278.288957, "b": 512.774405 }, "text": "Capacity (cfs)", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p147.5.17", "order": 22, "type": "table_cell", "bbox": { "l": 160.552704, "t": 588.002283, "r": 214.269445, "b": 576.0151040000001 }, "text": "Description", "attrs": { "row": 3, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 16 }, { "id": "p147.5.18", "order": 23, "type": "table_cell", "bbox": { "l": 69, "t": 510.960886, "r": 89.902375, "b": 498.973707 }, "text": "11.3", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p147.5.19", "order": 24, "type": "table_cell", "bbox": { "l": 121.676993, "t": 510.960886, "r": 133.621207, "b": 498.973707 }, "text": "90", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p147.5.20", "order": 25, "type": "table_cell", "bbox": { "l": 144.353814, "t": 510.960886, "r": 177.200404, "b": 498.973707 }, "text": "0.0270", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p147.5.21", "order": 26, "type": "table_cell", "bbox": { "l": 204.707543, "t": 510.960886, "r": 225.609918, "b": 498.973707 }, "text": "0.13", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p147.5.22", "order": 27, "type": "table_cell", "bbox": { "l": 341.9657, "t": 511.2, "r": 414.3771, "b": 491.52 }, "text": "", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 21 }, { "id": "p147.5.23", "order": 28, "type": "table_cell", "bbox": { "l": 289.079669, "t": 510.780434, "r": 461.873354, "b": 463.332257 }, "text": "Sheet Flow,\\nGrass: Dense n= 0.240 P2= 3.42\"\\nShallow Concentrated Flow,\\nPaved Kv= 20.3 fps", "attrs": { "row": 4, "col": 5, "rowspan": 2, "colspan": 2, "bbox_refit": true }, "reading_order": 22 }, { "id": "p147.5.24", "order": 29, "type": "table_cell", "bbox": { "l": 75.000034, "t": 487.200277, "r": 89.930302, "b": 475.213098 }, "text": "1.1", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 23 }, { "id": "p147.5.25", "order": 30, "type": "table_cell", "bbox": { "l": 115.679107, "t": 487.200277, "r": 133.595429, "b": 475.213098 }, "text": "160", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 24 }, { "id": "p147.5.26", "order": 31, "type": "table_cell", "bbox": { "l": 144.353814, "t": 487.200277, "r": 177.200404, "b": 475.213098 }, "text": "0.0150", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 25 }, { "id": "p147.5.27", "order": 32, "type": "table_cell", "bbox": { "l": 204.707543, "t": 487.200277, "r": 225.609918, "b": 475.213098 }, "text": "2.49", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 26 }, { "id": "p147.5.28", "order": 33, "type": "table_cell", "bbox": { "l": 341.9657, "t": 491.52, "r": 414.3771, "b": 471.84 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 27 }, { "id": "p147.5.29", "order": 34, "type": "table_cell", "bbox": { "l": 69, "t": 461.520786, "r": 89.902375, "b": 449.533607 }, "text": "12.4", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 28 }, { "id": "p147.5.30", "order": 35, "type": "table_cell", "bbox": { "l": 115.676959, "t": 461.520786, "r": 133.59328, "b": 449.533607 }, "text": "250", "attrs": { "row": 6, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 29 }, { "id": "p147.5.31", "order": 36, "type": "table_cell", "bbox": { "l": 144.351666, "t": 461.520786, "r": 168.229354, "b": 449.533607 }, "text": "Total", "attrs": { "row": 6, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 30 }, { "id": "p147.5.32", "order": 37, "type": "table_cell", "bbox": { "l": 269.5543, "t": 471.84, "r": 341.9657, "b": 452.16 }, "text": "", "attrs": { "row": 6, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 31 }, { "id": "p147.5.33", "order": 38, "type": "table_cell", "bbox": { "l": 341.9657, "t": 471.84, "r": 414.3771, "b": 452.16 }, "text": "", "attrs": { "row": 6, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 32 }, { "id": "p147.5.34", "order": 39, "type": "table_cell", "bbox": { "l": 414.3771, "t": 471.84, "r": 486.7886, "b": 452.16 }, "text": "", "attrs": { "row": 6, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 33 }, { "id": "p147.5.35", "order": 40, "type": "table_cell", "bbox": { "l": 486.7886, "t": 471.84, "r": 559.2, "b": 452.16 }, "text": "", "attrs": { "row": 6, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 34 } ], "reading_order": 4 }, { "id": "p147.6", "order": 41, "type": "caption", "bbox": { "l": 222.72, "t": 437.04, "r": 392.88, "b": 422.4 }, "text": "Subcatchment 6S: POROUS", "attrs": { "block_label": "figure_title" }, "reading_order": 5 }, { "id": "p147.7", "order": 42, "type": "caption", "bbox": { "l": 254.64, "t": 416.88, "r": 306.24, "b": 405.84 }, "text": "Hydrograph", "attrs": { "block_label": "figure_title" }, "reading_order": 6 }, { "id": "p147.8", "order": 43, "type": "figure", "bbox": { "l": 62.64, "t": 413.76, "r": 550.08, "b": 148.56 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nRunoff\n0.000 0.00 cfs\n0.000 NOAA 24-hr D\n2 YEAR Rainfall=3.42\"\n0.000\nRunoff Area=0.190 ac\n0.000\n0\nRunoff Volume=0.000 af\n0\n(cfs) 0 Runoff Depth>0.00\"\nFlow 0 Flow Length=250'\n0 Tc=12.4 min\nCN=39\n0\n0\n0\n0\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 7 } ] }, { "document_id": 11809, "page": 148, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 43, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "table": 1, "table_cell": 36, "text": 2, "title": 1 }, "build_ms": 4, "items": [ { "id": "p148.1", "order": 1, "type": "header", "bbox": { "l": 51.84, "t": 739.44, "r": 560.88, "b": 698.4 }, "text": "OCSCD NOAA 24-hr D 2 YEAR Rainfall=3.42\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 11", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p148.2", "order": 2, "type": "title", "bbox": { "l": 131.76, "t": 687.6, "r": 489.12, "b": 672.72 }, "text": "Summary for Subcatchment 8S: PROP WAREHOUSE BLDG", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p148.3", "order": 3, "type": "text", "bbox": { "l": 52.32, "t": 660, "r": 463.92, "b": 634.56 }, "text": "Runoff = 1.48 cfs @ 12.10 hrs, Volume= 0.112 af, Depth> 2.92\"\nRouted to Pond 9P : SSIB #3 UNDERGROUND", "reading_order": 2 }, { "id": "p148.4", "order": 4, "type": "text", "bbox": { "l": 51.84, "t": 624.48, "r": 541.44, "b": 598.8 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Weighted-CN, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs NOAA 24-hr D 2 YEAR Rainfall=3.42\"", "reading_order": 3 }, { "id": "p148.5", "order": 5, "type": "table", "bbox": { "l": 52.32, "t": 589.92, "r": 559.2, "b": 437.28 }, "text": "", "attrs": { "block_label": "table", "n_rows": 7, "n_cols": 6, "integrity": { "cells_checked": 29, "cells_flagged": 0 } }, "children": [ { "id": "p148.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 69.659595, "t": 588.002283, "r": 113.82741, "b": 576.0151040000001 }, "text": "Area (ac)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p148.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 130.796358, "t": 588.002283, "r": 146.30665, "b": 576.0151040000001 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p148.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 289.05701, "t": 536.641352, "r": 342.773751, "b": 524.654172 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p148.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 87, "t": 574.200786, "r": 113.874482, "b": 548.4137069999999 }, "text": "0.460\n0.460", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p148.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 134.275244, "t": 574.200786, "r": 146.219458, "b": 562.213607 }, "text": "98", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p148.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 160.552515, "t": 574.200786, "r": 284.133244, "b": 548.4137069999999 }, "text": "Roofs, HSG A\n100.00% Impervious Area", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p148.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 65.459598, "t": 536.641352, "r": 89.993572, "b": 512.774405 }, "text": "Tc (min)", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p148.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 100.682141, "t": 536.641352, "r": 133.545916, "b": 512.774405 }, "text": "Length (feet)", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p148.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 149.815612, "t": 536.641352, "r": 177.28086, "b": 512.774405 }, "text": "Slope (ft/ft)", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p148.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 188.028505, "t": 536.641352, "r": 225.633446, "b": 512.774405 }, "text": "Velocity (ft/sec)", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p148.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 236.50354, "t": 536.641352, "r": 278.288957, "b": 512.774405 }, "text": "Capacity (cfs)", "attrs": { "row": 2, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p148.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 160.552704, "t": 588.002283, "r": 214.269445, "b": 576.0151040000001 }, "text": "Description", "attrs": { "row": 2, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 }, { "id": "p148.5.13", "order": 18, "type": "table_cell", "bbox": { "l": 75, "t": 510.960886, "r": 89.930268, "b": 498.973707 }, "text": "1.5", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 12 }, { "id": "p148.5.14", "order": 19, "type": "table_cell", "bbox": { "l": 115.679073, "t": 510.960886, "r": 133.595394, "b": 498.973707 }, "text": "100", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p148.5.15", "order": 20, "type": "table_cell", "bbox": { "l": 144.35378, "t": 510.960886, "r": 177.20037, "b": 498.973707 }, "text": "0.0100", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p148.5.16", "order": 21, "type": "table_cell", "bbox": { "l": 204.707509, "t": 510.960886, "r": 225.609884, "b": 498.973707 }, "text": "1.08", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p148.5.17", "order": 22, "type": "table_cell", "bbox": { "l": 390.24, "t": 522.08, "r": 474.72, "b": 505.12 }, "text": "", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 16 }, { "id": "p148.5.18", "order": 23, "type": "table_cell", "bbox": { "l": 289.079635, "t": 510.780434, "r": 348.768483, "b": 498.793255 }, "text": "Sheet Flow,", "attrs": { "row": 3, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p148.5.19", "order": 24, "type": "table_cell", "bbox": { "l": 75, "t": 487.200277, "r": 89.930268, "b": 475.213098 }, "text": "0.3", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p148.5.20", "order": 25, "type": "table_cell", "bbox": { "l": 121.678033, "t": 487.200277, "r": 133.622247, "b": 475.213098 }, "text": "40", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p148.5.21", "order": 26, "type": "table_cell", "bbox": { "l": 144.354854, "t": 487.200277, "r": 177.201444, "b": 475.213098 }, "text": "0.0100", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p148.5.22", "order": 27, "type": "table_cell", "bbox": { "l": 204.708583, "t": 487.200277, "r": 225.610958, "b": 475.213098 }, "text": "2.03", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p148.5.23", "order": 28, "type": "table_cell", "bbox": { "l": 390.24, "t": 505.12, "r": 474.72, "b": 488.16 }, "text": "", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 22 }, { "id": "p148.5.24", "order": 29, "type": "table_cell", "bbox": { "l": 289.079635, "t": 499.080045, "r": 476.803587, "b": 487.092865 }, "text": "Smooth surfaces\\nn= 0.011\\nP2= 3.42\"", "attrs": { "row": 4, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 23 }, { "id": "p148.5.25", "order": 30, "type": "table_cell", "bbox": { "l": 75, "t": 463.439669, "r": 89.930268, "b": 451.45249 }, "text": "0.8", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 24 }, { "id": "p148.5.26", "order": 31, "type": "table_cell", "bbox": { "l": 115.679073, "t": 463.439669, "r": 133.595394, "b": 451.45249 }, "text": "140", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 25 }, { "id": "p148.5.27", "order": 32, "type": "table_cell", "bbox": { "l": 221.28, "t": 488.16, "r": 305.76, "b": 471.2 }, "text": "", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 26 }, { "id": "p148.5.28", "order": 33, "type": "table_cell", "bbox": { "l": 204.713954, "t": 463.439669, "r": 225.616329, "b": 451.45249 }, "text": "3.00", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 27 }, { "id": "p148.5.29", "order": 34, "type": "table_cell", "bbox": { "l": 390.24, "t": 488.16, "r": 474.72, "b": 471.2 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 28 }, { "id": "p148.5.30", "order": 35, "type": "table_cell", "bbox": { "l": 289.079635, "t": 487.019825, "r": 432.324278, "b": 451.272038 }, "text": "Shallow Concentrated Flow,\\nPaved Kv= 20.3 fps\nDirect Entry, PIPE FLOW", "attrs": { "row": 5, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 29 }, { "id": "p148.5.31", "order": 36, "type": "table_cell", "bbox": { "l": 75, "t": 449.640786, "r": 89.930268, "b": 437.653607 }, "text": "2.6", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 30 }, { "id": "p148.5.32", "order": 37, "type": "table_cell", "bbox": { "l": 115.679073, "t": 449.640786, "r": 133.595394, "b": 437.653607 }, "text": "280", "attrs": { "row": 6, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 31 }, { "id": "p148.5.33", "order": 38, "type": "table_cell", "bbox": { "l": 144.35378, "t": 449.640786, "r": 168.231468, "b": 437.653607 }, "text": "Total", "attrs": { "row": 6, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 32 }, { "id": "p148.5.34", "order": 39, "type": "table_cell", "bbox": { "l": 305.76, "t": 454.24, "r": 390.24, "b": 437.28 }, "text": "", "attrs": { "row": 6, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 33 }, { "id": "p148.5.35", "order": 40, "type": "table_cell", "bbox": { "l": 390.24, "t": 454.24, "r": 474.72, "b": 437.28 }, "text": "", "attrs": { "row": 6, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 34 }, { "id": "p148.5.36", "order": 41, "type": "table_cell", "bbox": { "l": 474.72, "t": 454.24, "r": 559.2, "b": 437.28 }, "text": "", "attrs": { "row": 6, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 35 } ], "reading_order": 4 }, { "id": "p148.6", "order": 42, "type": "caption", "bbox": { "l": 170.4, "t": 425.52, "r": 447.84, "b": 410.64 }, "text": "Subcatchment 8S: PROP WAREHOUSE BLDG", "attrs": { "block_label": "figure_title" }, "reading_order": 5 }, { "id": "p148.7", "order": 43, "type": "figure", "bbox": { "l": 60.48, "t": 407.04, "r": 553.68, "b": 137.04 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nRunoff\n1.48 cfs\nNOAA 24-hr D\n2 YEAR Rainfall=3.42\"\nRunoff Area=0.460 ac\n1 Runoff Volume=0.112 af\n(cfs) Runoff Depth>2.92\"\nFlow Flow Length=280'\nSlope=0.0100 '/'\nTc=2.6 min\nCN=98\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 6 } ] }, { "document_id": 11809, "page": 149, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 17, "counts_by_type": { "caption": 2, "figure": 1, "header": 1, "table": 1, "table_cell": 9, "text": 2, "title": 1 }, "build_ms": 2, "items": [ { "id": "p149.1", "order": 1, "type": "header", "bbox": { "l": 52.08, "t": 738.72, "r": 560.88, "b": 698.4 }, "text": "OCSCD NOAA 24-hr D 2 YEAR Rainfall=3.42\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 12", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p149.2", "order": 2, "type": "title", "bbox": { "l": 151.2, "t": 687.6, "r": 468.72, "b": 672.96 }, "text": "Summary for Subcatchment 10S: BY-PASS POROUS", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p149.3", "order": 3, "type": "text", "bbox": { "l": 52.8, "t": 660.24, "r": 464.4, "b": 634.08 }, "text": "Runoff = 0.00 cfs @ 20.00 hrs, Volume= 0.000 af, Depth> 0.00\"\nRouted to Reach 10 : COMPOSITE", "reading_order": 2 }, { "id": "p149.4", "order": 4, "type": "text", "bbox": { "l": 52.08, "t": 624.48, "r": 541.44, "b": 598.8 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Weighted-CN, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs NOAA 24-hr D 2 YEAR Rainfall=3.42\"", "reading_order": 3 }, { "id": "p149.5", "order": 5, "type": "table", "bbox": { "l": 52.8, "t": 588.72, "r": 559.44, "b": 498.24 }, "text": "", "attrs": { "block_label": "table", "n_rows": 3, "n_cols": 3, "integrity": { "cells_checked": 9, "cells_flagged": 0 } }, "children": [ { "id": "p149.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 69.659595, "t": 588.002283, "r": 113.82741, "b": 576.0151040000001 }, "text": "Area (ac)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p149.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 130.796358, "t": 588.002283, "r": 146.30665, "b": 576.0151040000001 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p149.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 289.05701, "t": 536.641352, "r": 342.773751, "b": 524.654172 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p149.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 87, "t": 574.200786, "r": 113.874482, "b": 548.4137069999999 }, "text": "0.060\n0.060", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p149.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 134.275244, "t": 574.200786, "r": 273.392044, "b": 548.4137069999999 }, "text": "39\n100.00% Pervious Area", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p149.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 160.552515, "t": 574.200786, "r": 320.843443, "b": 562.213607 }, "text": ">75% Grass cover, Good, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p149.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 65.459598, "t": 536.641352, "r": 89.993572, "b": 498.973707 }, "text": "Tc (min)\n2.0", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p149.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 100.682141, "t": 536.641352, "r": 352.94681, "b": 498.793255 }, "text": "Length (feet)\nDirect Entry,", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 7 }, { "id": "p149.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 149.815612, "t": 536.641352, "r": 278.288957, "b": 512.774405 }, "text": "Slope (ft/ft) Velocity (ft/sec) Capacity (cfs)", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 } ], "reading_order": 4 }, { "id": "p149.6", "order": 15, "type": "caption", "bbox": { "l": 190.32, "t": 486.72, "r": 426.96, "b": 471.84 }, "text": "Subcatchment 10S: BY-PASS POROUS", "attrs": { "block_label": "figure_title" }, "reading_order": 5 }, { "id": "p149.7", "order": 16, "type": "caption", "bbox": { "l": 254.4, "t": 466.08, "r": 306.48, "b": 454.56 }, "text": "Hydrograph", "attrs": { "block_label": "figure_title" }, "reading_order": 6 }, { "id": "p149.8", "order": 17, "type": "figure", "bbox": { "l": 63.84, "t": 462.48, "r": 550.08, "b": 199.92 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "0 Runoff\n0 0.00 cfs\n0 NOAA 24-hr D\n0\n0 2 YEAR Rainfall=3.42\"\n0\n0\n0 Runoff Area=0.060 ac\n0\nRunoff Volume=0.000 af\n0\n0\n(cfs) 0\n0 Runoff Depth>0.00\"\nFlow 0\n0 Tc=2.0 min\n0\n0 CN=39\n0\n0\n0\n0\n0\n0\n0\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 7 } ] }, { "document_id": 11809, "page": 150, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 24, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "heading": 1, "table": 1, "table_cell": 16, "text": 3 }, "build_ms": 2, "items": [ { "id": "p150.1", "order": 1, "type": "header", "bbox": { "l": 51.84, "t": 738.72, "r": 561.6, "b": 698.4 }, "text": "OCSCD NOAA 24-hr D 2 YEAR Rainfall=3.42\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 13", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p150.2", "order": 2, "type": "heading", "bbox": { "l": 140.16, "t": 687.36, "r": 481.44, "b": 672.72 }, "text": "Summary for Subcatchment 11S: BY-PASS IMPERVIOUS", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p150.3", "order": 3, "type": "text", "bbox": { "l": 53.76, "t": 660, "r": 307.44, "b": 634.56 }, "text": "Runoff = 0.24 cfs @ 12.09 hrs, Volume=\nRouted to Reach 10 : COMPOSITE\n0.017 af, Depth> 2.92\"", "reading_order": 2 }, { "id": "p150.4", "order": 4, "type": "text", "bbox": { "l": 345.12, "t": 659.76, "r": 463.44, "b": 646.8 }, "text": "0.017 af, Depth> 2.92\"", "reading_order": 3 }, { "id": "p150.5", "order": 5, "type": "text", "bbox": { "l": 52.08, "t": 624.24, "r": 541.44, "b": 598.8 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Weighted-CN, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs NOAA 24-hr D 2 YEAR Rainfall=3.42\"", "reading_order": 4 }, { "id": "p150.6", "order": 6, "type": "table", "bbox": { "l": 52.8, "t": 588.24, "r": 559.44, "b": 497.76 }, "text": "", "attrs": { "block_label": "table", "n_rows": 4, "n_cols": 4, "integrity": { "cells_checked": 13, "cells_flagged": 1, "flags": [ { "row": 2, "col": 2, "coverage": 0, "text": "Impervious Area" } ] } }, "children": [ { "id": "p150.6.1", "order": 7, "type": "table_cell", "bbox": { "l": 69.659595, "t": 588.002283, "r": 113.82741, "b": 576.0151040000001 }, "text": "Area (ac)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p150.6.2", "order": 8, "type": "table_cell", "bbox": { "l": 130.796358, "t": 588.002283, "r": 146.30665, "b": 576.0151040000001 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p150.6.3", "order": 9, "type": "table_cell", "bbox": { "l": 289.05701, "t": 536.641352, "r": 342.773751, "b": 524.654172 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p150.6.4", "order": 10, "type": "table_cell", "bbox": { "l": 432.78, "t": 588.24, "r": 559.44, "b": 570.144 }, "text": "", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 3 }, { "id": "p150.6.5", "order": 11, "type": "table_cell", "bbox": { "l": 87, "t": 560.400886, "r": 113.874482, "b": 548.4137069999999 }, "text": "0.070", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p150.6.6", "order": 12, "type": "table_cell", "bbox": { "l": 134.275244, "t": 574.200786, "r": 146.219458, "b": 562.213607 }, "text": "98", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p150.6.7", "order": 13, "type": "table_cell", "bbox": { "l": 160.552515, "t": 574.200786, "r": 268.608987, "b": 562.213607 }, "text": "Paved parking, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p150.6.8", "order": 14, "type": "table_cell", "bbox": { "l": 432.78, "t": 570.144, "r": 559.44, "b": 552.048 }, "text": "", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 7 }, { "id": "p150.6.9", "order": 15, "type": "table_cell", "bbox": { "l": 87, "t": 574.200786, "r": 113.874482, "b": 562.213607 }, "text": "0.070", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p150.6.10", "order": 16, "type": "table_cell", "bbox": { "l": 160.555738, "t": 560.400886, "r": 202.951254, "b": 548.4137069999999 }, "text": "100.00%", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p150.6.11", "order": 17, "type": "table_cell", "bbox": { "l": 306.12, "t": 552.048, "r": 432.78, "b": 533.952 }, "text": "Impervious Area", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 10 }, { "id": "p150.6.12", "order": 18, "type": "table_cell", "bbox": { "l": 432.78, "t": 552.048, "r": 559.44, "b": 533.952 }, "text": "", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 11 }, { "id": "p150.6.13", "order": 19, "type": "table_cell", "bbox": { "l": 65.459598, "t": 536.641352, "r": 352.94681, "b": 498.793255 }, "text": "Tc (min)\nDirect Entry,", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 12 }, { "id": "p150.6.14", "order": 20, "type": "table_cell", "bbox": { "l": 100.682141, "t": 536.641352, "r": 133.545916, "b": 512.774405 }, "text": "Length (feet)", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p150.6.15", "order": 21, "type": "table_cell", "bbox": { "l": 149.815612, "t": 536.641352, "r": 177.28086, "b": 512.774405 }, "text": "Slope (ft/ft)", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p150.6.16", "order": 22, "type": "table_cell", "bbox": { "l": 188.028505, "t": 536.641352, "r": 225.633446, "b": 512.774405 }, "text": "Velocity (ft/sec)", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 } ], "reading_order": 5 }, { "id": "p150.7", "order": 23, "type": "caption", "bbox": { "l": 178.32, "t": 486.96, "r": 439.68, "b": 471.84 }, "text": "Subcatchment 11S: BY-PASS IMPERVIOUS", "attrs": { "block_label": "figure_title" }, "reading_order": 6 }, { "id": "p150.8", "order": 24, "type": "figure", "bbox": { "l": 61.68, "t": 466.56, "r": 554.88, "b": 199.2 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n0.26 Runoff\n0.25 0.24 cfs\n0.24\n0.23 NOAA 24-hr D\n0.22\n2 YEAR Rainfall=3.42\"\n0.21\n0.2\n0.18 Runoff Area=0.070 ac\n0.19\n0.16 Runoff Volume=0.017 af\n0.17\n0.15\n(cfs) 0.14 Runoff Depth>2.92\"\n0.13\nFlow Tc=2.0 min\n0.12\n0.11\n0.09 CN=98\n0.1\n0.08\n0.07\n0.06\n0.05\n0.04\n0.03\n0.02\n0.01\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 7 } ] }, { "document_id": 11809, "page": 151, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 6, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "heading": 1, "text": 2 }, "build_ms": 0, "items": [ { "id": "p151.1", "order": 1, "type": "header", "bbox": { "l": 52.08, "t": 738.72, "r": 562.08, "b": 698.88 }, "text": "OCSCD NOAA 24-hr D 2 YEAR Rainfall=3.42\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 14", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p151.2", "order": 2, "type": "heading", "bbox": { "l": 198, "t": 687.6, "r": 420, "b": 672.48 }, "text": "Summary for Reach 10: COMPOSITE", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p151.3", "order": 3, "type": "text", "bbox": { "l": 52.08, "t": 660.24, "r": 517.68, "b": 622.8 }, "text": "Inflow Area = 2.120 ac, 71.70% Impervious, Inflow Depth > 2.05\" for 2 YEAR event\nInflow = 2.25 cfs @ 12.18 hrs, Volume= 0.362 af\nOutflow = 2.25 cfs @ 12.18 hrs, Volume= 0.362 af, Atten=0%, Lag=0.0 min", "reading_order": 2 }, { "id": "p151.4", "order": 4, "type": "text", "bbox": { "l": 52.08, "t": 612.48, "r": 421.2, "b": 598.56 }, "text": "Routing by Stor-Ind+Trans method, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs", "reading_order": 3 }, { "id": "p151.5", "order": 5, "type": "caption", "bbox": { "l": 236.4, "t": 587.28, "r": 378.72, "b": 572.4 }, "text": "Reach 10: COMPOSITE", "attrs": { "block_label": "figure_title" }, "reading_order": 4 }, { "id": "p151.6", "order": 6, "type": "figure", "bbox": { "l": 60.48, "t": 571.44, "r": 553.2, "b": 298.08 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nInflow\n2.25 cfs Outflow\n2.25 cfs\nInflow Area=2.120 ac\n2\n(cfs)\nFlow\n1\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 5 } ] }, { "document_id": 11809, "page": 152, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 41, "counts_by_type": { "footnote": 3, "header": 1, "heading": 1, "table": 2, "table_cell": 34 }, "build_ms": 8, "items": [ { "id": "p152.1", "order": 1, "type": "header", "bbox": { "l": 52.08, "t": 739.2, "r": 560.88, "b": 698.4 }, "text": "OCSCD NOAA 24-hr D 2 YEAR Rainfall=3.42\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 15", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p152.2", "order": 2, "type": "heading", "bbox": { "l": 162.24, "t": 687.84, "r": 457.44, "b": 672.96 }, "text": "Summary for Pond 3P: SSIB #1 SURFACE BASIN", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p152.3", "order": 3, "type": "table", "bbox": { "l": 52.08, "t": 664.08, "r": 536.16, "b": 504.7365 }, "text": "", "attrs": { "block_label": "table", "n_rows": 5, "n_cols": 2, "integrity": { "cells_checked": 8, "cells_flagged": 1, "flags": [ { "row": 1, "col": 1, "coverage": 0.17, "text": "0.87 cfs @ 12.51 hrs, Volume= 0.171 af, Atten= 36%, Lag= 16…" } ] } }, "children": [ { "id": "p152.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 54, "t": 659.280886, "r": 107.727482, "b": 635.41394 }, "text": "Inflow Area =\nInflow =", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p152.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 147.777121, "t": 659.280886, "r": 502.735112, "b": 635.41394 }, "text": "1.070 ac, 67.29% Impervious, Inflow Depth > 1.96\" for 2 YEAR event\n1.36 cfs @ 12.22 hrs, Volume= 0.175 af", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p152.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 54, "t": 635.521352, "r": 90.412668, "b": 623.534172 }, "text": "Outflow =", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 2 }, { "id": "p152.3.4", "order": 7, "type": "table_cell", "bbox": { "l": 294.12, "t": 625.14, "r": 536.16, "b": 605.67 }, "text": "0.87 cfs @ 12.51 hrs, Volume= 0.171 af, Atten= 36%, Lag= 16.9 min", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1 }, "reading_order": 3 }, { "id": "p152.3.5", "order": 8, "type": "table_cell", "bbox": { "l": 54, "t": 623.641584, "r": 237.878603, "b": 587.894871 }, "text": "Discarded =\nPrimary =\nRouted to Reach 10 : COMPOSITE", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p152.3.6", "order": 9, "type": "table_cell", "bbox": { "l": 147.769602, "t": 623.641584, "r": 305.136775, "b": 599.774638 }, "text": "0.00 cfs @ 5.00 hrs, Volume= 0.000 af\n0.87 cfs @ 12.51 hrs, Volume= 0.171 af", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p152.3.7", "order": 10, "type": "table_cell", "bbox": { "l": 54, "t": 576.122516, "r": 515.753447, "b": 540.375802 }, "text": "Routing by Stor-Ind method, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs\\nStarting Elev= 111.50' Surf.Area= 2,825 sf Storage= 3,544 cf\\nPeak Elev= 111.97' @ 12.51 hrs Surf.Area= 3,177 sf Storage= 4,951 cf (1,408 cf above start)", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 6 }, { "id": "p152.3.8", "order": 11, "type": "table_cell", "bbox": { "l": 54, "t": 528.603447, "r": 411.725999, "b": 504.7365 }, "text": "Plug-Flow detention time= 220.0 min calculated for 0.089 af (51% of inflow)\\nCenter-of-Mass det. time= 28.4 min (777.9 - 749.5 )", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 7 } ], "reading_order": 2 }, { "id": "p152.4", "order": 12, "type": "table", "bbox": { "l": 50.4, "t": 493.44, "r": 559.68, "b": 248.16 }, "text": "", "attrs": { "block_label": "table", "n_rows": 7, "n_cols": 5, "integrity": { "cells_checked": 26, "cells_flagged": 1, "flags": [ { "row": 1, "col": 4, "coverage": 0.33, "text": "Listed below (Recalc)" } ] } }, "children": [ { "id": "p152.4.1", "order": 13, "type": "table_cell", "bbox": { "l": 54, "t": 492.964145, "r": 90.412668, "b": 480.976966 }, "text": "Volume", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p152.4.2", "order": 14, "type": "table_cell", "bbox": { "l": 123.533158, "t": 492.964145, "r": 150.396899, "b": 480.976966 }, "text": "Invert", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p152.4.3", "order": 15, "type": "table_cell", "bbox": { "l": 173.452885, "t": 492.964145, "r": 237.330802, "b": 480.976966 }, "text": "Avail.Storage", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p152.4.4", "order": 16, "type": "table_cell", "bbox": { "l": 249.465135, "t": 492.964145, "r": 343.783612, "b": 480.976966 }, "text": "Storage Description", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 2, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 3 }, { "id": "p152.4.5", "order": 17, "type": "table_cell", "bbox": { "l": 66.12, "t": 479.160786, "r": 78.064214, "b": 467.173607 }, "text": "#1", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p152.4.6", "order": 18, "type": "table_cell", "bbox": { "l": 115.437146, "t": 479.160786, "r": 150.335304, "b": 467.173607 }, "text": "110.00'", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p152.4.7", "order": 19, "type": "table_cell", "bbox": { "l": 193.071317, "t": 479.160786, "r": 237.260614, "b": 467.173607 }, "text": "12,950 cf", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p152.4.8", "order": 20, "type": "table_cell", "bbox": { "l": 249.479803, "t": 478.980334, "r": 406.4517, "b": 466.993155 }, "text": "Custom Stage Data (Prismatic)", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p152.4.9", "order": 21, "type": "table_cell", "bbox": { "l": 457.824, "t": 474.5723, "r": 559.68, "b": 455.7046 }, "text": "Listed below (Recalc)", "attrs": { "row": 1, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 8 }, { "id": "p152.4.10", "order": 22, "type": "table_cell", "bbox": { "l": 57.719307, "t": 455.401252, "r": 101.897863, "b": 370.214538 }, "text": "Elevation\\n(feet)\n110.00\n111.00\n112.00\n113.00\n114.00", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 9 }, { "id": "p152.4.11", "order": 23, "type": "table_cell", "bbox": { "l": 142.191327, "t": 455.401252, "r": 187.562155, "b": 370.214538 }, "text": "Surf.Area\\n(sq-ft)\n2,000\n2,450\n3,200\n4,000\n4,600", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 10 }, { "id": "p152.4.12", "order": 24, "type": "table_cell", "bbox": { "l": 230.21009, "t": 455.401252, "r": 358.898543, "b": 370.214538 }, "text": "Inc.Store\\n(cubic-feet)\n0\n2,225\n2,825\n3,600\n4,300", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 11 }, { "id": "p152.4.13", "order": 25, "type": "table_cell", "bbox": { "l": 219.361478, "t": 455.401252, "r": 358.999511, "b": 370.214538 }, "text": "Cum.Store\\n(cubic-feet)\n0\n2,225\n5,050\n8,650\n12,950", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 12 }, { "id": "p152.4.14", "order": 26, "type": "table_cell", "bbox": { "l": 53.999914, "t": 358.442183, "r": 86.825021, "b": 332.653607 }, "text": "Device\n#1", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 13 }, { "id": "p152.4.15", "order": 27, "type": "table_cell", "bbox": { "l": 98.873425, "t": 358.442183, "r": 147.222394, "b": 332.653607 }, "text": "Routing\nDiscarded", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 14 }, { "id": "p152.4.16", "order": 28, "type": "table_cell", "bbox": { "l": 175.965845, "t": 358.442183, "r": 210.937439, "b": 332.653607 }, "text": "Invert\n110.00'", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 15 }, { "id": "p152.4.17", "order": 29, "type": "table_cell", "bbox": { "l": 223.01377, "t": 358.442183, "r": 462.419686, "b": 320.772765 }, "text": "Outlet Devices\n1.000 in/hr Exfiltration X 0.00 over Surface area\\nConductivity to Groundwater Elevation = 106.00'", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 16 }, { "id": "p152.4.18", "order": 30, "type": "table_cell", "bbox": { "l": 70.44, "t": 320.880177, "r": 82.384214, "b": 308.892998 }, "text": "#2", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p152.4.19", "order": 31, "type": "table_cell", "bbox": { "l": 98.876253, "t": 297.120643, "r": 135.868946, "b": 285.133464 }, "text": "Primary", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p152.4.20", "order": 32, "type": "table_cell", "bbox": { "l": 175.97229, "t": 320.880177, "r": 210.870449, "b": 308.892998 }, "text": "111.50'", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p152.4.21", "order": 33, "type": "table_cell", "bbox": { "l": 223.01982, "t": 320.880177, "r": 451.453995, "b": 297.013231 }, "text": "12.0\" W x 4.0\" H Vert. Orifice/Grate C= 0.600\\nLimited to weir flow at low heads", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 20 }, { "id": "p152.4.22", "order": 34, "type": "table_cell", "bbox": { "l": 70.44, "t": 297.120643, "r": 82.384214, "b": 285.133464 }, "text": "#3", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p152.4.23", "order": 35, "type": "table_cell", "bbox": { "l": 98.876253, "t": 320.880177, "r": 135.868946, "b": 308.892998 }, "text": "Primary", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 22 }, { "id": "p152.4.24", "order": 36, "type": "table_cell", "bbox": { "l": 175.97229, "t": 297.120643, "r": 210.870449, "b": 285.133464 }, "text": "113.00'", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 23 }, { "id": "p152.4.25", "order": 37, "type": "table_cell", "bbox": { "l": 223.01982, "t": 297.120643, "r": 439.81483, "b": 273.253697 }, "text": "24.0\" x 48.0\" Horiz. Orifice/Grate C= 0.600\\nLimited to weir flow at low heads", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 24 }, { "id": "p152.4.26", "order": 38, "type": "table_cell", "bbox": { "l": 53.999519, "t": 261.48134100000004, "r": 430.987712, "b": 249.31371000000001 }, "text": "Discarded OutFlow Max=0.00 cfs @ 5.00 hrs HW=111.50' (Free Discharge)", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 5, "bbox_refit": true }, "reading_order": 25 } ], "reading_order": 3 }, { "id": "p152.5", "order": 39, "type": "footnote", "bbox": { "l": 52.08, "t": 517.2, "r": 306.72, "b": 503.52 }, "text": "Center-of-Mass det. time= 28.4 min (777.9 - 749.5)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 4 }, { "id": "p152.6", "order": 40, "type": "footnote", "bbox": { "l": 50.64, "t": 262.08, "r": 433.44, "b": 236.16 }, "text": "Discarded OutFlow Max=0.00 cfs @ 5.00 hrs HW=1111.50' (Free Discharge)\n1=Exfiltration (Controls 0.00 cfs)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 5 }, { "id": "p152.7", "order": 41, "type": "footnote", "bbox": { "l": 52.08, "t": 226.8, "r": 426.96, "b": 190.08 }, "text": "Primary OutFlow Max=0.87 cfs @ 12.51 hrs HW=111.97' (Free Discharge)\n2=Orifice/Grate (Orifice Controls 0.87 cfs @ 2.61 fps)\n3=Orifice/Grate (Controls 0.00 cfs)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 6 } ] }, { "document_id": 11809, "page": 153, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 3, "counts_by_type": { "caption": 1, "figure": 1, "header": 1 }, "build_ms": 0, "items": [ { "id": "p153.1", "order": 1, "type": "header", "bbox": { "l": 51.12, "t": 738.24, "r": 563.52, "b": 698.64 }, "text": "OCSCD NOAA 24-hr D 2 YEAR Rainfall=3.42\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 16", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p153.2", "order": 2, "type": "caption", "bbox": { "l": 201.6, "t": 687.84, "r": 415.68, "b": 673.2 }, "text": "Pond 3P: SSIB #1 SURFACE BASIN", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p153.3", "order": 3, "type": "figure", "bbox": { "l": 62.16, "t": 670.56, "r": 552, "b": 399.36 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nInflow\n1.36 cfs Outflow\nInflow Area=1.070 ac Primary\nDiscarded\nPeak Elev=111.97'\nStorage=4,951 cf\n0.87 cfs\n1\n0.87 cfs\n(cfs)\nFlow\n0.00 cfs\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 2 } ] }, { "document_id": 11809, "page": 154, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 37, "counts_by_type": { "footnote": 1, "header": 1, "heading": 2, "table": 3, "table_cell": 29, "text": 1 }, "build_ms": 7, "items": [ { "id": "p154.1", "order": 1, "type": "header", "bbox": { "l": 52.32, "t": 738.72, "r": 560.64, "b": 698.64 }, "text": "OCSCD NOAA 24-hr D 2 YEAR Rainfall=3.42\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 17", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p154.2", "order": 2, "type": "heading", "bbox": { "l": 163.68, "t": 687.6, "r": 455.76, "b": 672.96 }, "text": "Summary for Pond 8P: SSIB #2 UNDERGROUND", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p154.3", "order": 3, "type": "table", "bbox": { "l": 54, "t": 664.8, "r": 536.4, "b": 516.616268 }, "text": "", "attrs": { "block_label": "table", "n_rows": 7, "n_cols": 1, "integrity": { "cells_checked": 7, "cells_flagged": 0 } }, "children": [ { "id": "p154.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 55.44, "t": 664.8, "r": 536.4, "b": 648.64 }, "text": "Inflow Area = 0.460 ac, 58.70% Impervious, Inflow Depth > 1.71\" for 2 YEAR event", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 0 }, { "id": "p154.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 55.44, "t": 648.64, "r": 536.4, "b": 632.48 }, "text": "Outflow = 0.93 cfs @ 12.08 hrs, Volume= 0.066 af", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 1 }, { "id": "p154.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 55.44, "t": 632.48, "r": 536.4, "b": 616.32 }, "text": "Discarded = 0.44 cfs @ 12.18 hrs, Volume= 0.064 af, Atten= 53%, Lag= 5.8 min", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 2 }, { "id": "p154.3.4", "order": 7, "type": "table_cell", "bbox": { "l": 55.44, "t": 616.32, "r": 536.4, "b": 600.16 }, "text": "Primary = 0.00 cfs @ 5.00 hrs, Volume= 0.000 af", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 3 }, { "id": "p154.3.5", "order": 8, "type": "table_cell", "bbox": { "l": 68.930268, "t": 599.8820499999999, "r": 237.878603, "b": 587.894871 }, "text": "Routed to Reach 10 : COMPOSITE", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p154.3.6", "order": 9, "type": "table_cell", "bbox": { "l": 54, "t": 576.122516, "r": 519.953256, "b": 540.375802 }, "text": "Routing by Stor-Ind method, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs\nStarting Elev= 109.00' Surf.Area= 0.064 ac Storage= 0.052 af\nPeak Elev= 109.35' @ 12.18 hrs Surf.Area= 0.064 ac Storage= 0.068 af (0.016 af above start)", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p154.3.7", "order": 10, "type": "table_cell", "bbox": { "l": 54, "t": 528.603447, "r": 411.725999, "b": 516.616268 }, "text": "Plug-Flow detention time= 491.1 min calculated for 0.011 af (17% of inflow)", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 } ], "reading_order": 2 }, { "id": "p154.4", "order": 11, "type": "text", "bbox": { "l": 51.6, "t": 529.44, "r": 413.04, "b": 503.28 }, "text": "Plug-Flow detention time= 491.1 min calculated for 0.011 af (17% of inflow) Center-of-Mass det. time= 34.4 min (770.5 - 736.1)", "reading_order": 3 }, { "id": "p154.5", "order": 12, "type": "table", "bbox": { "l": 52.32, "t": 494.4, "r": 556.56, "b": 392.64 }, "text": "", "attrs": { "block_label": "table", "n_rows": 2, "n_cols": 4, "integrity": { "cells_checked": 8, "cells_flagged": 0 } }, "children": [ { "id": "p154.5.1", "order": 13, "type": "table_cell", "bbox": { "l": 54, "t": 492.964145, "r": 90.412668, "b": 467.173607 }, "text": "Volume\n#1A", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p154.5.2", "order": 14, "type": "table_cell", "bbox": { "l": 115.437146, "t": 492.964145, "r": 150.396899, "b": 467.173607 }, "text": "Invert\n107.50'", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p154.5.3", "order": 15, "type": "table_cell", "bbox": { "l": 167.453925, "t": 492.964145, "r": 231.331841, "b": 467.173607 }, "text": "Avail.Storage\n0.048 af", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p154.5.4", "order": 16, "type": "table_cell", "bbox": { "l": 243.466175, "t": 492.964145, "r": 549.157135, "b": 455.292765 }, "text": "Storage Description\n41.95'W x 66.33'L x 3.00'H Field A\\n0.192 af Overall - 0.072 af Embedded = 0.120 af x 40.0% Voids", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p154.5.5", "order": 17, "type": "table_cell", "bbox": { "l": 66.12, "t": 455.400177, "r": 85.228595, "b": 443.412998 }, "text": "#2A", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p154.5.6", "order": 18, "type": "table_cell", "bbox": { "l": 115.437146, "t": 455.400177, "r": 150.335304, "b": 443.412998 }, "text": "107.83'", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p154.5.7", "order": 19, "type": "table_cell", "bbox": { "l": 192.471958, "t": 455.400177, "r": 231.290655, "b": 443.412998 }, "text": "0.057 af", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p154.5.8", "order": 20, "type": "table_cell", "bbox": { "l": 243.479769, "t": 455.400177, "r": 509.915235, "b": 395.893929 }, "text": "ADS N-12 24\" x 36 Inside #1\\nInside= 23.8\"W x 23.8\"H => 3.10 sf x 20.00'L = 62.0 cf\\nOutside= 28.0\"W x 28.0\"H => 3.92 sf x 20.00'L = 78.4 cf\\n36 Chambers in 12 Rows\\n40.28' Header x 3.10 sf x 2 = 249.8 cf Inside", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 } ], "reading_order": 4 }, { "id": "p154.6", "order": 21, "type": "heading", "bbox": { "l": 66.96, "t": 370.56, "r": 295.44, "b": 356.88 }, "text": "Storage Group A created with Chamber Wizard", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 5 }, { "id": "p154.7", "order": 22, "type": "table", "bbox": { "l": 49.2, "t": 347.04, "r": 558.24, "b": 209.52 }, "text": "", "attrs": { "block_label": "table", "n_rows": 4, "n_cols": 4, "integrity": { "cells_checked": 14, "cells_flagged": 2, "flags": [ { "row": 2, "col": 1, "coverage": 0, "text": "Max=0.00 cfs @ 5.00 hrs" }, { "row": 3, "col": 1, "coverage": 0, "text": "Max=0.44 cfs @ 12.18 hrs" } ] } }, "children": [ { "id": "p154.7.1", "order": 23, "type": "table_cell", "bbox": { "l": 54.000153, "t": 346.561717, "r": 86.82526, "b": 320.773607 }, "text": "Device\n#1", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p154.7.2", "order": 24, "type": "table_cell", "bbox": { "l": 98.873664, "t": 346.561717, "r": 147.222394, "b": 320.773607 }, "text": "Routing\nDiscarded", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p154.7.3", "order": 25, "type": "table_cell", "bbox": { "l": 175.965845, "t": 346.561717, "r": 210.937678, "b": 320.773607 }, "text": "Invert\n107.50'", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p154.7.4", "order": 26, "type": "table_cell", "bbox": { "l": 223.014009, "t": 346.561717, "r": 462.419686, "b": 308.892765 }, "text": "Outlet Devices\n1.000 in/hr Exfiltration X 0.00 over Surface area\\nConductivity to Groundwater Elevation = 105.00'", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p154.7.5", "order": 27, "type": "table_cell", "bbox": { "l": 70.44, "t": 309.000177, "r": 82.384214, "b": 297.012998 }, "text": "#2", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p154.7.6", "order": 28, "type": "table_cell", "bbox": { "l": 98.876253, "t": 309.000177, "r": 135.868946, "b": 297.012998 }, "text": "Primary", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p154.7.7", "order": 29, "type": "table_cell", "bbox": { "l": 175.97229, "t": 309.000177, "r": 210.870449, "b": 297.012998 }, "text": "109.00'", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p154.7.8", "order": 30, "type": "table_cell", "bbox": { "l": 223.01982, "t": 309.000177, "r": 445.634412, "b": 285.133231 }, "text": "8.0\" W x 4.0\" H Vert. Orifice/Grate C= 0.600\\nLimited to weir flow at low heads", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p154.7.9", "order": 31, "type": "table_cell", "bbox": { "l": 53.999519, "t": 273.180424, "r": 231.763157, "b": 249.31347700000003 }, "text": "Discarded OutFlow\n1=Exfiltration ( Controls 0.00 cfs)", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 8 }, { "id": "p154.7.10", "order": 32, "type": "table_cell", "bbox": { "l": 303.72, "t": 288.1029, "r": 430.98, "b": 268.4571 }, "text": "Max=0.00 cfs @ 5.00 hrs", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1 }, "reading_order": 9 }, { "id": "p154.7.11", "order": 33, "type": "table_cell", "bbox": { "l": 282.213499, "t": 273.36087599999996, "r": 430.987712, "b": 261.373697 }, "text": "HW=109.00' (Free Discharge)", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p154.7.12", "order": 34, "type": "table_cell", "bbox": { "l": 54, "t": 237.540886, "r": 326.584803, "b": 213.67394000000002 }, "text": "Primary OutFlow\n2=Orifice/Grate (Orifice Controls 0.44 cfs @ 1.96 fps)", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 11 }, { "id": "p154.7.13", "order": 35, "type": "table_cell", "bbox": { "l": 303.72, "t": 248.8114, "r": 430.98, "b": 229.1657 }, "text": "Max=0.44 cfs @ 12.18 hrs", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1 }, "reading_order": 12 }, { "id": "p154.7.14", "order": 36, "type": "table_cell", "bbox": { "l": 276.4524, "t": 237.72133799999995, "r": 425.226613, "b": 225.73415899999998 }, "text": "HW=109.35' (Free Discharge)", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 } ], "reading_order": 6 }, { "id": "p154.8", "order": 37, "type": "footnote", "bbox": { "l": 190.8, "t": 394.08, "r": 357.36, "b": 381.12 }, "text": "0.105 af Total Available Storage", "attrs": { "block_label": "vision_footnote" }, "reading_order": 7 } ] }, { "document_id": 11809, "page": 155, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 6, "counts_by_type": { "figure": 1, "footer": 1, "header": 1, "text": 2, "title": 1 }, "build_ms": 0, "items": [ { "id": "p155.1", "order": 1, "type": "header", "bbox": { "l": 52.8, "t": 738.48, "r": 560.64, "b": 698.64 }, "text": "OCSCD NOAA 24-hr D 2 YEAR Rainfall=3.42\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 18", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p155.2", "order": 2, "type": "title", "bbox": { "l": 126.24, "t": 687.6, "r": 494.16, "b": 672.96 }, "text": "Pond 8P: SSIB #2 UNDERGROUND - Chamber Wizard Field A", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p155.3", "order": 3, "type": "text", "bbox": { "l": 49.68, "t": 661.2, "r": 543.6, "b": 406.32 }, "text": "Chamber Model = ADS N-12 24\" (ADS N-12® Pipe)\nInside= 23.8\"W x 23.8\"H => 3.10 sf x 20.00'L = 62.0 cf\nOutside= 28.0\"W x 28.0\"H => 3.92 sf x 20.00'L = 78.4 cf\n28.0\" Wide + 13.4\" Spacing = 41.4\" C-C Row Spacing\n3 Chambers/Row x 20.00' Long +2.33' Header x 2 = 64.67' Row Length +10.0\" End Stone x 2 = 66.33' Base Length\n12 Rows x 28.0\" Wide + 13.4\" Spacing x 11 + 10.0\" Side Stone x 2 = 41.95' Base Width\n4.0\" Stone Base + 28.0\" Chamber Height + 4.0\" Stone Cover = 3.00' Field Height\n36 Chambers x 62.0 cf + 40.28' Header x 3.10 sf x 2 = 2,481.8 cf Chamber Storage\n36 Chambers x 78.4 cf + 40.28' Header x 3.92 sf x 2 = 3,137.9 cf Displacement\n8,348.3 cf Field - 3,137.9 cf Chambers = 5,210.4 cf Stone x 40.0% Voids = 2,084.2 cf Stone Storage\nChamber Storage + Stone Storage = 4,565.9 cf = 0.105 af\nOverall Storage Efficiency = 54.7%\nOverall System Size = 66.33' x 41.95' x 3.00'", "attrs": { "block_label": "algorithm" }, "reading_order": 2 }, { "id": "p155.4", "order": 4, "type": "text", "bbox": { "l": 52.32, "t": 400.8, "r": 127.68, "b": 360.48 }, "text": "36 Chambers\n309.2 cy Field\n193.0 cy Stone", "reading_order": 3 }, { "id": "p155.5", "order": 5, "type": "figure", "bbox": { "l": 223.68, "t": 346.56, "r": 387.84, "b": 93.6 }, "text": "", "attrs": { "block_label": "image" }, "reading_order": 4 }, { "id": "p155.6", "order": 6, "type": "footer", "bbox": { "l": 223.2, "t": 66.48, "r": 387.12, "b": 53.76 }, "text": "010101", "attrs": { "block_label": "footer" }, "reading_order": 5 } ] }, { "document_id": 11809, "page": 156, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 3, "counts_by_type": { "caption": 1, "figure": 1, "header": 1 }, "build_ms": 0, "items": [ { "id": "p156.1", "order": 1, "type": "header", "bbox": { "l": 51.36, "t": 738.24, "r": 564, "b": 698.64 }, "text": "OCSCD NOAA 24-hr D 2 YEAR Rainfall=3.42\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 19", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p156.2", "order": 2, "type": "caption", "bbox": { "l": 203.28, "t": 687.84, "r": 413.76, "b": 672.96 }, "text": "Pond 8P: SSIB #2 UNDERGROUND", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p156.3", "order": 3, "type": "figure", "bbox": { "l": 62.64, "t": 673.92, "r": 552.24, "b": 399.6 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nInflow\n0.93 cfs Outflow\nInflow Area=0.460 ac Primary\nDiscarded\n1\nPeak Elev=109.35'\nStorage=0.068 af\n0.44 cfs\n(cfs)\n0.44 cfs\nFlow\n0.00 cfs\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 2 } ] }, { "document_id": 11809, "page": 157, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 37, "counts_by_type": { "footnote": 1, "header": 1, "heading": 2, "table": 3, "table_cell": 28, "text": 2 }, "build_ms": 7, "items": [ { "id": "p157.1", "order": 1, "type": "header", "bbox": { "l": 52.08, "t": 738.72, "r": 560.4, "b": 698.64 }, "text": "OCSCD NOAA 24-hr D 2 YEAR Rainfall=3.42\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 20", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p157.2", "order": 2, "type": "heading", "bbox": { "l": 163.68, "t": 687.6, "r": 455.76, "b": 672.96 }, "text": "Summary for Pond 9P: SSIB #3 UNDERGROUND", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p157.3", "order": 3, "type": "table", "bbox": { "l": 52.8, "t": 661.44, "r": 524.16, "b": 587.894871 }, "text": "", "attrs": { "block_label": "table", "n_rows": 3, "n_cols": 2, "integrity": { "cells_checked": 6, "cells_flagged": 1, "flags": [ { "row": 1, "col": 1, "coverage": 0.58, "text": "1.09 cfs @ 12.16 hrs, Volume= 0.110 af, Atten= 27%, Lag= 4.…" } ] } }, "children": [ { "id": "p157.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 54, "t": 659.280886, "r": 107.727482, "b": 635.41394 }, "text": "Inflow Area =\nInflow =", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p157.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 147.777121, "t": 659.280886, "r": 502.737261, "b": 635.41394 }, "text": "0.460 ac,100.00% Impervious, Inflow Depth > 2.92\" for 2 YEAR event\n1.48 cfs @ 12.10 hrs, Volume= 0.112 af", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p157.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 54, "t": 635.521352, "r": 90.412668, "b": 623.534172 }, "text": "Outflow =", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 2 }, { "id": "p157.3.4", "order": 7, "type": "table_cell", "bbox": { "l": 288.48, "t": 637.2, "r": 524.16, "b": 625.08 }, "text": "1.09 cfs @ 12.16 hrs, Volume= 0.110 af, Atten= 27%, Lag= 4.0 min", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1 }, "reading_order": 3 }, { "id": "p157.3.5", "order": 8, "type": "table_cell", "bbox": { "l": 54, "t": 623.641584, "r": 237.878603, "b": 587.894871 }, "text": "Discarded =\nPrimary =\nRouted to Reach 10 : COMPOSITE", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p157.3.6", "order": 9, "type": "table_cell", "bbox": { "l": 147.769602, "t": 623.641584, "r": 305.136775, "b": 599.774638 }, "text": "0.00 cfs @ 5.00 hrs, Volume= 0.000 af\n1.09 cfs @ 12.16 hrs, Volume= 0.110 af", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 } ], "reading_order": 2 }, { "id": "p157.4", "order": 10, "type": "text", "bbox": { "l": 52.32, "t": 576.72, "r": 522, "b": 539.04 }, "text": "Routing by Stor-Ind method, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs\nStarting Elev= 113.00' Surf.Area= 0.085 ac Storage= 0.111 af\nPeak Elev= 113.49' @ 12.16 hrs Surf.Area= 0.085 ac Storage= 0.129 af (0.018 af above start)", "attrs": { "block_label": "algorithm" }, "reading_order": 3 }, { "id": "p157.5", "order": 11, "type": "text", "bbox": { "l": 51.6, "t": 529.2, "r": 405.84, "b": 503.28 }, "text": "Plug-Flow detention time = (not calculated: initial storage exceeds outflow)\nCenter-of-Mass det. time = 22.4 min (759.6 - 737.2)", "reading_order": 4 }, { "id": "p157.6", "order": 12, "type": "table", "bbox": { "l": 52.32, "t": 494.4, "r": 556.56, "b": 392.4 }, "text": "", "attrs": { "block_label": "table", "n_rows": 2, "n_cols": 4, "integrity": { "cells_checked": 8, "cells_flagged": 0 } }, "children": [ { "id": "p157.6.1", "order": 13, "type": "table_cell", "bbox": { "l": 54, "t": 492.964145, "r": 549.157135, "b": 455.292765 }, "text": "Volume\n#1A\n0.255 af Overall - 0.096 af Embedded = 0.159 af x 40.0% Voids", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p157.6.2", "order": 14, "type": "table_cell", "bbox": { "l": 115.437146, "t": 492.964145, "r": 150.396899, "b": 467.173607 }, "text": "Invert\n110.80'", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p157.6.3", "order": 15, "type": "table_cell", "bbox": { "l": 167.453925, "t": 492.964145, "r": 231.331841, "b": 467.173607 }, "text": "Avail.Storage\n0.063 af", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p157.6.4", "order": 16, "type": "table_cell", "bbox": { "l": 243.466175, "t": 492.964145, "r": 412.943681, "b": 466.993155 }, "text": "Storage Description\n55.75'W x 66.33'L x 3.00'H Field A", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p157.6.5", "order": 17, "type": "table_cell", "bbox": { "l": 66.12, "t": 455.400177, "r": 85.228595, "b": 443.412998 }, "text": "#2A", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p157.6.6", "order": 18, "type": "table_cell", "bbox": { "l": 115.437146, "t": 455.400177, "r": 150.335304, "b": 443.412998 }, "text": "111.13'", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p157.6.7", "order": 19, "type": "table_cell", "bbox": { "l": 192.471958, "t": 455.400177, "r": 231.290655, "b": 443.412998 }, "text": "0.076 af", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p157.6.8", "order": 20, "type": "table_cell", "bbox": { "l": 243.479769, "t": 455.400177, "r": 509.915235, "b": 395.893929 }, "text": "ADS N-12 24\" x 48 Inside #1\\nInside = 23.8\"W x 23.8\"H => 3.10 sf x 20.00'L = 62.0 cf\\nOutside = 28.0\"W x 28.0\"H => 3.92 sf x 20.00'L = 78.4 cf\\n48 Chambers in 16 Rows\\n54.08' Header x 3.10 sf x 2 = 335.3 cf Inside", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 } ], "reading_order": 5 }, { "id": "p157.7", "order": 21, "type": "heading", "bbox": { "l": 66.96, "t": 370.56, "r": 295.44, "b": 356.88 }, "text": "Storage Group A created with Chamber Wizard", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 6 }, { "id": "p157.8", "order": 22, "type": "table", "bbox": { "l": 48.96, "t": 347.04, "r": 558.96, "b": 209.04 }, "text": "", "attrs": { "block_label": "table", "n_rows": 4, "n_cols": 4, "integrity": { "cells_checked": 14, "cells_flagged": 2, "flags": [ { "row": 2, "col": 1, "coverage": 0, "text": "Max=0.00 cfs @ 5.00 hrs" }, { "row": 3, "col": 1, "coverage": 0, "text": "Max=1.07 cfs @ 12.16 hrs" } ] } }, "children": [ { "id": "p157.8.1", "order": 23, "type": "table_cell", "bbox": { "l": 54.000153, "t": 346.561717, "r": 86.82526, "b": 320.773607 }, "text": "Device\n#1", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p157.8.2", "order": 24, "type": "table_cell", "bbox": { "l": 98.873664, "t": 346.561717, "r": 147.222394, "b": 320.773607 }, "text": "Routing\nDiscarded", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p157.8.3", "order": 25, "type": "table_cell", "bbox": { "l": 175.965845, "t": 346.561717, "r": 210.937678, "b": 320.773607 }, "text": "Invert\n110.80'", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p157.8.4", "order": 26, "type": "table_cell", "bbox": { "l": 223.014009, "t": 346.561717, "r": 462.419686, "b": 308.892765 }, "text": "Outlet Devices\n1.000 in/hr Exfiltration X 0.00 over Surface area\\nConductivity to Groundwater Elevation = 108.00'", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p157.8.5", "order": 27, "type": "table_cell", "bbox": { "l": 70.44, "t": 309.000177, "r": 82.384214, "b": 297.012998 }, "text": "#2", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p157.8.6", "order": 28, "type": "table_cell", "bbox": { "l": 98.876253, "t": 309.000177, "r": 135.868946, "b": 297.012998 }, "text": "Primary", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p157.8.7", "order": 29, "type": "table_cell", "bbox": { "l": 175.97229, "t": 309.000177, "r": 210.870449, "b": 297.012998 }, "text": "113.00'", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p157.8.8", "order": 30, "type": "table_cell", "bbox": { "l": 223.01982, "t": 309.000177, "r": 451.453995, "b": 285.133231 }, "text": "12.0\" W x 6.0\" H Vert. Orifice/Grate C= 0.600\\nLimited to weir flow at low heads", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p157.8.9", "order": 31, "type": "table_cell", "bbox": { "l": 53.999519, "t": 273.180424, "r": 231.763157, "b": 249.31347700000003 }, "text": "Discarded OutFlow\n1=Exfiltration ( Controls 0.00 cfs)", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 8 }, { "id": "p157.8.10", "order": 32, "type": "table_cell", "bbox": { "l": 303.96, "t": 287.8971, "r": 431.46, "b": 268.1829 }, "text": "Max=0.00 cfs @ 5.00 hrs", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1 }, "reading_order": 9 }, { "id": "p157.8.11", "order": 33, "type": "table_cell", "bbox": { "l": 282.213499, "t": 273.36087599999996, "r": 430.987712, "b": 261.373697 }, "text": "HW=113.00' (Free Discharge)", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p157.8.12", "order": 34, "type": "table_cell", "bbox": { "l": 54, "t": 237.540886, "r": 326.584803, "b": 213.67394000000002 }, "text": "Primary OutFlow\n2=Orifice/Grate (Orifice Controls 1.07 cfs @ 2.23 fps)", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 11 }, { "id": "p157.8.13", "order": 35, "type": "table_cell", "bbox": { "l": 303.96, "t": 248.4686, "r": 431.46, "b": 228.7543 }, "text": "Max=1.07 cfs @ 12.16 hrs", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1 }, "reading_order": 12 }, { "id": "p157.8.14", "order": 36, "type": "table_cell", "bbox": { "l": 276.4524, "t": 237.72133799999995, "r": 425.226613, "b": 225.73415899999998 }, "text": "HW=113.48' (Free Discharge)", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 } ], "reading_order": 7 }, { "id": "p157.9", "order": 37, "type": "footnote", "bbox": { "l": 190.56, "t": 394.32, "r": 357.6, "b": 381.12 }, "text": "0.139 af Total Available Storage", "attrs": { "block_label": "vision_footnote" }, "reading_order": 8 } ] }, { "document_id": 11809, "page": 158, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 6, "counts_by_type": { "figure": 1, "footer": 1, "header": 1, "text": 2, "title": 1 }, "build_ms": 0, "items": [ { "id": "p158.1", "order": 1, "type": "header", "bbox": { "l": 52.8, "t": 738.96, "r": 559.92, "b": 698.4 }, "text": "OCSCD NOAA 24-hr D 2 YEAR Rainfall=3.42\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 21", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p158.2", "order": 2, "type": "title", "bbox": { "l": 126.48, "t": 687.6, "r": 494.4, "b": 672.96 }, "text": "Pond 9P: SSIB #3 UNDERGROUND - Chamber Wizard Field A", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p158.3", "order": 3, "type": "text", "bbox": { "l": 49.68, "t": 661.92, "r": 544.56, "b": 405.6 }, "text": "Chamber Model = ADS N-12 24\" (ADS N-12® Pipe)\nInside= 23.8\"W x 23.8\"H => 3.10 sf x 20.00'L = 62.0 cf\nOutside= 28.0\"W x 28.0\"H => 3.92 sf x 20.00'L = 78.4 cf\n28.0\" Wide + 13.4\" Spacing = 41.4\" C-C Row Spacing\n3 Chambers/Row x 20.00' Long +2.33' Header x 2 = 64.67' Row Length +10.0\" End Stone x 2 = 66.33' Base Length\n16 Rows x 28.0\" Wide + 13.4\" Spacing x 15 + 10.0\" Side Stone x 2 = 55.75' Base Width\n4.0\" Stone Base + 28.0\" Chamber Height + 4.0\" Stone Cover = 3.00' Field Height\n48 Chambers x 62.0 cf + 54.08' Header x 3.10 sf x 2 = 3,311.3 cf Chamber Storage\n48 Chambers x 78.4 cf + 54.08' Header x 3.92 sf x 2 = 4,186.8 cf Displacement\n11,094.6 cf Field - 4,186.8 cf Chambers = 6,907.8 cf Stone x 40.0% Voids = 2,763.1 cf Stone Storage\nChamber Storage + Stone Storage = 6,074.4 cf = 0.139 af\nOverall Storage Efficiency = 54.8%\nOverall System Size = 66.33' x 55.75' x 3.00'", "attrs": { "block_label": "algorithm" }, "reading_order": 2 }, { "id": "p158.4", "order": 4, "type": "text", "bbox": { "l": 51.84, "t": 400.56, "r": 127.68, "b": 360.48 }, "text": "48 Chambers\n410.9 cy Field\n255.8 cy Stone", "reading_order": 3 }, { "id": "p158.5", "order": 5, "type": "figure", "bbox": { "l": 197.04, "t": 348.72, "r": 414.48, "b": 93.12 }, "text": "", "attrs": { "block_label": "image" }, "reading_order": 4 }, { "id": "p158.6", "order": 6, "type": "footer", "bbox": { "l": 197.04, "t": 66.24, "r": 414.48, "b": 53.76 }, "text": "101010", "attrs": { "block_label": "footer" }, "reading_order": 5 } ] }, { "document_id": 11809, "page": 159, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 3, "counts_by_type": { "caption": 1, "figure": 1, "header": 1 }, "build_ms": 0, "items": [ { "id": "p159.1", "order": 1, "type": "header", "bbox": { "l": 51.36, "t": 738.24, "r": 563.52, "b": 698.64 }, "text": "OCSCD NOAA 24-hr D 2 YEAR Rainfall=3.42\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 22", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p159.2", "order": 2, "type": "caption", "bbox": { "l": 203.28, "t": 687.84, "r": 413.76, "b": 672.96 }, "text": "Pond 9P: SSIB #3 UNDERGROUND", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p159.3", "order": 3, "type": "figure", "bbox": { "l": 60.72, "t": 671.28, "r": 552, "b": 399.36 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nInflow\n1.48 cfs Outflow\nInflow Area=0.460 ac Primary\nDiscarded\nPeak Elev=113.49'\n1.09 cfs Storage=0.129 af\n1.09 cfs\n1\n(cfs)\nFlow\n0.00 cfs\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 2 } ] }, { "document_id": 11809, "page": 160, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 21, "counts_by_type": { "footer": 1, "text": 20 }, "build_ms": 3, "items": [ { "id": "p160.1", "order": 1, "type": "text", "bbox": { "l": 120.48, "t": 687.36, "r": 490.32, "b": 651.12 }, "text": "Time span=5.00-20.00 hrs, dt=0.05 hrs, 301 points\nRunoff by SCS TR-20 method, UH=Delmarva, Weighted-CN\nReach routing by Stor-Ind+Trans method - Pond routing by Stor-Ind method", "reading_order": 0 }, { "id": "p160.2", "order": 2, "type": "text", "bbox": { "l": 257.76, "t": 640.08, "r": 560.16, "b": 616.32 }, "text": "Subcatchment1S: POROUS\nRunoff Area=0.350 ac 0.00% Impervious Runoff Depth>0.21\"\nFlow Length=310' Tc=12.9 min CN=39 Runoff=0.02 cfs 0.006 af", "reading_order": 1 }, { "id": "p160.3", "order": 3, "type": "text", "bbox": { "l": 259.68, "t": 605.04, "r": 559.68, "b": 581.04 }, "text": "Subcatchment2S: IMPERVIOUS\nRunoff Area=0.720 ac 100.00% Impervious Runoff Depth>4.66\"\nFlow Length=310' Tc=13.1 min CN=98 Runoff=2.16 cfs 0.280 af", "reading_order": 2 }, { "id": "p160.4", "order": 4, "type": "text", "bbox": { "l": 52.56, "t": 568.8, "r": 559.92, "b": 546 }, "text": "Subcatchment5S: IMPERVIOUS Runoff Area=0.270 ac 100.00% Impervious Runoff Depth>4.66\" Flow Length=180' Slope=0.0100'/' Tc=1.6 min CN=98 Runoff=1.48 cfs 0.105 af", "reading_order": 3 }, { "id": "p160.5", "order": 5, "type": "text", "bbox": { "l": 48.48, "t": 534.24, "r": 561.12, "b": 520.56 }, "text": "Runoff Area=0.190 ac 0.00% Impervious Runoff Depth>0.22\"", "reading_order": 4 }, { "id": "p160.6", "order": 6, "type": "text", "bbox": { "l": 51.6, "t": 532.56, "r": 196.32, "b": 520.8 }, "text": "Subcatchment6S: POROUS", "reading_order": 5 }, { "id": "p160.7", "order": 7, "type": "text", "bbox": { "l": 256.8, "t": 521.04, "r": 560.16, "b": 509.28 }, "text": "Flow Length=250' Tc=12.4 min CN=39 Runoff=0.01 cfs 0.003 af", "reading_order": 6 }, { "id": "p160.8", "order": 8, "type": "text", "bbox": { "l": 52.56, "t": 497.28, "r": 560.4, "b": 473.76 }, "text": "Subcatchment8S: PROP WAREHOUSE Runoff Area=0.460 ac 100.00% Impervious Runoff Depth>4.66\" Flow Length=280' Slope=0.0100'/' Tc=2.6 min CN=98 Runoff=2.35 cfs 0.179 af", "reading_order": 7 }, { "id": "p160.9", "order": 9, "type": "text", "bbox": { "l": 52.08, "t": 462.24, "r": 559.68, "b": 440.64 }, "text": "Runoff Area=0.060 ac 0.00% Impervious Runoff Depth>0.22\"\nTc=2.0 min CN=39 Runoff=0.00 cfs 0.001 af", "reading_order": 8 }, { "id": "p160.10", "order": 10, "type": "text", "bbox": { "l": 51.6, "t": 461.52, "r": 251.76, "b": 449.52 }, "text": "Subcatchment10S: BY-PASS POROUS", "reading_order": 9 }, { "id": "p160.11", "order": 11, "type": "text", "bbox": { "l": 52.32, "t": 426.48, "r": 559.44, "b": 403.2 }, "text": "Runoff Area=0.070 ac 100.00% Impervious Runoff Depth>4.66\"\nTc=2.0 min CN=98 Runoff=0.37 cfs 0.027 af", "reading_order": 10 }, { "id": "p160.12", "order": 12, "type": "text", "bbox": { "l": 51.6, "t": 425.52, "r": 203.76, "b": 413.76 }, "text": "Subcatchment11S: BY-PASS", "reading_order": 11 }, { "id": "p160.13", "order": 13, "type": "text", "bbox": { "l": 51.6, "t": 390, "r": 172.8, "b": 378.48 }, "text": "Reach 10: COMPOSITE", "reading_order": 12 }, { "id": "p160.14", "order": 14, "type": "text", "bbox": { "l": 447.12, "t": 390.96, "r": 559.92, "b": 379.44 }, "text": "Inflow=3.32 cfs 0.591 af", "reading_order": 13 }, { "id": "p160.15", "order": 15, "type": "text", "bbox": { "l": 440.64, "t": 377.76, "r": 560.16, "b": 366.96 }, "text": "Outflow=3.32 cfs 0.591 af", "reading_order": 14 }, { "id": "p160.16", "order": 16, "type": "text", "bbox": { "l": 52.56, "t": 355.2, "r": 559.68, "b": 330.48 }, "text": "Pond 3P: SSIB #1 SURFACE BASIN Peak Elev= $ 112.25' $ Storage= $ 5{,}884 $ cf Inflow= $ 2.16 $ cfs 0.286 af Discarded= $ 0.00 $ cfs 0.000 af Primary= $ 1.22 $ cfs 0.281 af Outflow= $ 1.22 $ cfs 0.281 af", "reading_order": 15 }, { "id": "p160.17", "order": 17, "type": "text", "bbox": { "l": 51.36, "t": 319.44, "r": 559.44, "b": 307.44 }, "text": "Pond 8P: SSIB #2 UNDERGROUND Peak Elev=109.53' Storage=0.076 af Inflow=1.48 cfs 0.108 af", "reading_order": 16 }, { "id": "p160.18", "order": 18, "type": "text", "bbox": { "l": 182.4, "t": 306.72, "r": 559.44, "b": 295.68 }, "text": "Discarded=0.00 cfs 0.000 af Primary=0.64 cfs 0.106 af Outflow=0.64 cfs 0.106 af", "reading_order": 17 }, { "id": "p160.19", "order": 19, "type": "text", "bbox": { "l": 52.8, "t": 283.92, "r": 559.44, "b": 259.92 }, "text": "Pond 9P: SSIB #3 UNDERGROUND Peak Elev=113.70' Storage=0.136 af Inflow=2.35 cfs 0.179 af Discarded=0.00 cfs 0.000 af Primary=1.59 cfs 0.176 af Outflow=1.59 cfs 0.176 af", "reading_order": 18 }, { "id": "p160.20", "order": 20, "type": "text", "bbox": { "l": 122.64, "t": 247.68, "r": 568.56, "b": 223.92 }, "text": "Total Runoff Area = 2.120 ac Runoff Volume = 0.601 af Average Runoff Depth = 3.40\"\n28.30% Pervious = 0.600 ac 71.70% Impervious = 1.520 ac", "reading_order": 19 }, { "id": "p160.21", "order": 21, "type": "footer", "bbox": { "l": 50.88, "t": 738.72, "r": 561.6, "b": 700.56 }, "text": "OCSCD NOAA 24-hr D 10 YEAR Rainfall=5.38\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 23", "attrs": { "block_label": "footer" }, "reading_order": 20 } ] }, { "document_id": 11809, "page": 161, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 50, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "heading": 1, "table": 1, "table_cell": 43, "text": 2 }, "build_ms": 4, "items": [ { "id": "p161.1", "order": 1, "type": "header", "bbox": { "l": 51.6, "t": 739.44, "r": 561.12, "b": 698.88 }, "text": "OCSCD NOAA 24-hr D 10 YEAR Rainfall=5.38\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 24", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p161.2", "order": 2, "type": "heading", "bbox": { "l": 183.6, "t": 687.36, "r": 434.64, "b": 672.72 }, "text": "Summary for Subcatchment 1S: POROUS", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p161.3", "order": 3, "type": "text", "bbox": { "l": 52.56, "t": 660, "r": 463.68, "b": 634.32 }, "text": "Runoff = 0.02 cfs @ 13.03 hrs, Volume= 0.006 af, Depth> 0.21\"\nRouted to Pond 3P : SSIB #1 SURFACE BASIN", "reading_order": 2 }, { "id": "p161.4", "order": 4, "type": "text", "bbox": { "l": 52.08, "t": 624.24, "r": 541.44, "b": 598.8 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Weighted-CN, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs NOAA 24-hr D 10 YEAR Rainfall=5.38\"", "reading_order": 3 }, { "id": "p161.5", "order": 5, "type": "table", "bbox": { "l": 52.56, "t": 589.92, "r": 559.44, "b": 436.8 }, "text": "", "attrs": { "block_label": "table", "n_rows": 8, "n_cols": 7, "integrity": { "cells_checked": 32, "cells_flagged": 2, "flags": [ { "row": 1, "col": 4, "coverage": 0, "text": "Grass cover, Good, HSG A" }, { "row": 2, "col": 4, "coverage": 0, "text": "Pervious Area" } ] } }, "children": [ { "id": "p161.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 69.659595, "t": 588.002283, "r": 113.82741, "b": 576.0151040000001 }, "text": "Area (ac)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p161.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 130.796358, "t": 588.002283, "r": 146.30665, "b": 576.0151040000001 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p161.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 289.05701, "t": 536.641352, "r": 342.773751, "b": 524.654172 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p161.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 52.56, "t": 570.78, "r": 124.9714, "b": 551.64 }, "text": "", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 3 }, { "id": "p161.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 87, "t": 560.400886, "r": 113.874482, "b": 548.4137069999999 }, "text": "0.350", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p161.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 134.275244, "t": 574.200786, "r": 146.219458, "b": 562.213607 }, "text": "39", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p161.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 160.552515, "t": 574.200786, "r": 188.318517, "b": 562.213607 }, "text": ">75%", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p161.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 342.2057, "t": 570.78, "r": 559.44, "b": 551.64 }, "text": "Grass cover, Good, HSG A", "attrs": { "row": 1, "col": 4, "rowspan": 1, "colspan": 3 }, "reading_order": 7 }, { "id": "p161.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 52.56, "t": 551.64, "r": 124.9714, "b": 532.5 }, "text": "", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 8 }, { "id": "p161.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 87, "t": 574.200786, "r": 113.874482, "b": 562.213607 }, "text": "0.350", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p161.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 197.3829, "t": 551.64, "r": 269.7943, "b": 532.5 }, "text": "", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 10 }, { "id": "p161.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 160.555738, "t": 560.400886, "r": 202.951254, "b": 548.4137069999999 }, "text": "100.00%", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 }, { "id": "p161.5.13", "order": 18, "type": "table_cell", "bbox": { "l": 342.2057, "t": 551.64, "r": 559.44, "b": 532.5 }, "text": "Pervious Area", "attrs": { "row": 2, "col": 4, "rowspan": 1, "colspan": 3 }, "reading_order": 12 }, { "id": "p161.5.14", "order": 19, "type": "table_cell", "bbox": { "l": 65.459598, "t": 536.641352, "r": 89.993572, "b": 512.774405 }, "text": "Tc (min)", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p161.5.15", "order": 20, "type": "table_cell", "bbox": { "l": 100.682141, "t": 536.641352, "r": 133.545916, "b": 512.774405 }, "text": "Length (feet)", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p161.5.16", "order": 21, "type": "table_cell", "bbox": { "l": 149.815612, "t": 536.641352, "r": 177.28086, "b": 512.774405 }, "text": "Slope (ft/ft)", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p161.5.17", "order": 22, "type": "table_cell", "bbox": { "l": 188.028505, "t": 536.641352, "r": 225.633446, "b": 512.774405 }, "text": "Velocity (ft/sec)", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p161.5.18", "order": 23, "type": "table_cell", "bbox": { "l": 236.50354, "t": 536.641352, "r": 278.288957, "b": 512.774405 }, "text": "Capacity (cfs)", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p161.5.19", "order": 24, "type": "table_cell", "bbox": { "l": 160.552704, "t": 588.002283, "r": 214.269445, "b": 576.0151040000001 }, "text": "Description", "attrs": { "row": 3, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 18 }, { "id": "p161.5.20", "order": 25, "type": "table_cell", "bbox": { "l": 69, "t": 510.960886, "r": 89.902375, "b": 498.973707 }, "text": "11.7", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p161.5.21", "order": 26, "type": "table_cell", "bbox": { "l": 115.676959, "t": 510.960886, "r": 133.59328, "b": 498.973707 }, "text": "100", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p161.5.22", "order": 27, "type": "table_cell", "bbox": { "l": 144.351666, "t": 510.960886, "r": 177.198256, "b": 498.973707 }, "text": "0.0300", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p161.5.23", "order": 28, "type": "table_cell", "bbox": { "l": 204.705395, "t": 510.960886, "r": 225.60777, "b": 498.973707 }, "text": "0.14", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 22 }, { "id": "p161.5.24", "order": 29, "type": "table_cell", "bbox": { "l": 342.2057, "t": 513.36, "r": 414.6171, "b": 494.22 }, "text": "", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 23 }, { "id": "p161.5.25", "order": 30, "type": "table_cell", "bbox": { "l": 289.079669, "t": 510.780434, "r": 461.873354, "b": 463.332257 }, "text": "Sheet Flow,\\nGrass: Dense n= 0.240 P2= 3.42\"\\nShallow Concentrated Flow,\\nGrassed Waterway Kv= 15.0 fps", "attrs": { "row": 4, "col": 5, "rowspan": 2, "colspan": 2, "bbox_refit": true }, "reading_order": 24 }, { "id": "p161.5.26", "order": 31, "type": "table_cell", "bbox": { "l": 75.000034, "t": 487.200277, "r": 89.930302, "b": 475.213098 }, "text": "0.3", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 25 }, { "id": "p161.5.27", "order": 32, "type": "table_cell", "bbox": { "l": 121.678067, "t": 487.200277, "r": 133.622282, "b": 475.213098 }, "text": "50", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 26 }, { "id": "p161.5.28", "order": 33, "type": "table_cell", "bbox": { "l": 144.354889, "t": 487.200277, "r": 177.201478, "b": 475.213098 }, "text": "0.0350", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 27 }, { "id": "p161.5.29", "order": 34, "type": "table_cell", "bbox": { "l": 204.708617, "t": 487.200277, "r": 225.610992, "b": 475.213098 }, "text": "2.81", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 28 }, { "id": "p161.5.30", "order": 35, "type": "table_cell", "bbox": { "l": 342.2057, "t": 494.22, "r": 414.6171, "b": 475.08 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 29 }, { "id": "p161.5.31", "order": 36, "type": "table_cell", "bbox": { "l": 75.000034, "t": 463.439669, "r": 89.930302, "b": 451.45249 }, "text": "0.9", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 30 }, { "id": "p161.5.32", "order": 37, "type": "table_cell", "bbox": { "l": 115.679107, "t": 463.439669, "r": 133.595429, "b": 451.45249 }, "text": "160", "attrs": { "row": 6, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 31 }, { "id": "p161.5.33", "order": 38, "type": "table_cell", "bbox": { "l": 197.3829, "t": 475.08, "r": 269.7943, "b": 455.94 }, "text": "", "attrs": { "row": 6, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 32 }, { "id": "p161.5.34", "order": 39, "type": "table_cell", "bbox": { "l": 204.713988, "t": 463.439669, "r": 225.616363, "b": 451.45249 }, "text": "3.00", "attrs": { "row": 6, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 33 }, { "id": "p161.5.35", "order": 40, "type": "table_cell", "bbox": { "l": 342.2057, "t": 475.08, "r": 414.6171, "b": 455.94 }, "text": "", "attrs": { "row": 6, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 34 }, { "id": "p161.5.36", "order": 41, "type": "table_cell", "bbox": { "l": 289.079669, "t": 463.259217, "r": 415.020239, "b": 451.272038 }, "text": "Direct Entry, PIPE FLOW", "attrs": { "row": 6, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 35 }, { "id": "p161.5.37", "order": 42, "type": "table_cell", "bbox": { "l": 69, "t": 449.640786, "r": 89.902375, "b": 437.653607 }, "text": "12.9", "attrs": { "row": 7, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 36 }, { "id": "p161.5.38", "order": 43, "type": "table_cell", "bbox": { "l": 115.676959, "t": 449.640786, "r": 133.59328, "b": 437.653607 }, "text": "310", "attrs": { "row": 7, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 37 }, { "id": "p161.5.39", "order": 44, "type": "table_cell", "bbox": { "l": 144.351666, "t": 449.640786, "r": 168.229354, "b": 437.653607 }, "text": "Total", "attrs": { "row": 7, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 38 }, { "id": "p161.5.40", "order": 45, "type": "table_cell", "bbox": { "l": 269.7943, "t": 455.94, "r": 342.2057, "b": 436.8 }, "text": "", "attrs": { "row": 7, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 39 }, { "id": "p161.5.41", "order": 46, "type": "table_cell", "bbox": { "l": 342.2057, "t": 455.94, "r": 414.6171, "b": 436.8 }, "text": "", "attrs": { "row": 7, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 40 }, { "id": "p161.5.42", "order": 47, "type": "table_cell", "bbox": { "l": 414.6171, "t": 455.94, "r": 487.0286, "b": 436.8 }, "text": "", "attrs": { "row": 7, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 41 }, { "id": "p161.5.43", "order": 48, "type": "table_cell", "bbox": { "l": 487.0286, "t": 455.94, "r": 559.44, "b": 436.8 }, "text": "", "attrs": { "row": 7, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 42 } ], "reading_order": 4 }, { "id": "p161.6", "order": 49, "type": "caption", "bbox": { "l": 222.48, "t": 425.28, "r": 393.36, "b": 410.64 }, "text": "Subcatchment 1S: POROUS", "attrs": { "block_label": "figure_title" }, "reading_order": 5 }, { "id": "p161.7", "order": 50, "type": "figure", "bbox": { "l": 62.64, "t": 408.72, "r": 552.24, "b": 137.28 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nRunoff\n0.02 cfs\n0.019\n0.018\n0.017 NOAA 24-hr D\n10 YEAR Rainfall=5.38\"\n0.016\n0.015\n0.014 Runoff Area=0.350 ac\n0.013\n0.012 Runoff Volume=0.006 af\n(cfs) Runoff Depth>0.21\"\n0.011\n0.01\nFlow Flow Length=310'\n0.009\n0.008\n0.007 Tc=12.9 min\n0.005 CN=39\n0.006\n0.004\n0.003\n0.002\n0.001\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 6 } ] }, { "document_id": 11809, "page": 162, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 45, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "heading": 1, "table": 1, "table_cell": 38, "text": 2 }, "build_ms": 3, "items": [ { "id": "p162.1", "order": 1, "type": "header", "bbox": { "l": 51.84, "t": 739.44, "r": 560.88, "b": 698.64 }, "text": "OCSCD NOAA 24-hr D 10 YEAR Rainfall=5.38\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 25", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p162.2", "order": 2, "type": "heading", "bbox": { "l": 171.84, "t": 687.6, "r": 447.36, "b": 672.72 }, "text": "Summary for Subcatchment 2S: IMPERVIOUS", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p162.3", "order": 3, "type": "text", "bbox": { "l": 52.56, "t": 660, "r": 464.16, "b": 634.32 }, "text": "Runoff = 2.16 cfs @ 12.22 hrs, Volume= 0.280 af, Depth> 4.66\"\nRouted to Pond 3P : SSIB #1 SURFACE BASIN", "reading_order": 2 }, { "id": "p162.4", "order": 4, "type": "text", "bbox": { "l": 52.08, "t": 624.24, "r": 541.44, "b": 598.56 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Weighted-CN, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs NOAA 24-hr D 10 YEAR Rainfall=5.38\"", "reading_order": 3 }, { "id": "p162.5", "order": 5, "type": "table", "bbox": { "l": 52.32, "t": 589.92, "r": 559.2, "b": 436.56 }, "text": "", "attrs": { "block_label": "table", "n_rows": 8, "n_cols": 7, "integrity": { "cells_checked": 30, "cells_flagged": 0 } }, "children": [ { "id": "p162.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 69.659595, "t": 588.002283, "r": 113.82741, "b": 576.0151040000001 }, "text": "Area (ac)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p162.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 130.796358, "t": 588.002283, "r": 146.30665, "b": 576.0151040000001 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p162.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 289.05701, "t": 536.641352, "r": 342.773751, "b": 524.654172 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p162.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 87, "t": 560.400886, "r": 113.874482, "b": 548.4137069999999 }, "text": "0.720", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 3 }, { "id": "p162.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 134.275244, "t": 574.200786, "r": 146.219458, "b": 562.213607 }, "text": "98", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p162.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 160.552515, "t": 574.200786, "r": 268.608987, "b": 562.213607 }, "text": "Paved parking, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true }, "reading_order": 5 }, { "id": "p162.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 87, "t": 574.200786, "r": 113.874482, "b": 562.213607 }, "text": "0.720", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 6 }, { "id": "p162.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 160.555738, "t": 560.400886, "r": 284.133244, "b": 548.4137069999999 }, "text": "100.00% Impervious Area", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 4, "bbox_refit": true }, "reading_order": 7 }, { "id": "p162.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 65.459598, "t": 536.641352, "r": 89.993572, "b": 512.774405 }, "text": "Tc\\n(min)", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p162.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 100.682141, "t": 536.641352, "r": 133.545916, "b": 512.774405 }, "text": "Length\\n(feet)", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p162.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 149.815612, "t": 536.641352, "r": 177.28086, "b": 512.774405 }, "text": "Slope\\n(ft/ft)", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p162.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 188.028505, "t": 536.641352, "r": 225.633446, "b": 512.774405 }, "text": "Velocity\\n(ft/sec)", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 }, { "id": "p162.5.13", "order": 18, "type": "table_cell", "bbox": { "l": 236.50354, "t": 536.641352, "r": 278.288957, "b": 512.774405 }, "text": "Capacity\\n(cfs)", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 12 }, { "id": "p162.5.14", "order": 19, "type": "table_cell", "bbox": { "l": 160.552704, "t": 588.002283, "r": 214.269445, "b": 576.0151040000001 }, "text": "Description", "attrs": { "row": 3, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 13 }, { "id": "p162.5.15", "order": 20, "type": "table_cell", "bbox": { "l": 69, "t": 510.960886, "r": 89.902375, "b": 498.973707 }, "text": "11.7", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p162.5.16", "order": 21, "type": "table_cell", "bbox": { "l": 115.676959, "t": 510.960886, "r": 133.59328, "b": 498.973707 }, "text": "100", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p162.5.17", "order": 22, "type": "table_cell", "bbox": { "l": 144.351666, "t": 510.960886, "r": 177.198256, "b": 498.973707 }, "text": "0.0300", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p162.5.18", "order": 23, "type": "table_cell", "bbox": { "l": 204.705395, "t": 510.960886, "r": 225.60777, "b": 498.973707 }, "text": "0.14", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p162.5.19", "order": 24, "type": "table_cell", "bbox": { "l": 341.9657, "t": 513.24, "r": 414.3771, "b": 494.07 }, "text": "", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 18 }, { "id": "p162.5.20", "order": 25, "type": "table_cell", "bbox": { "l": 289.079669, "t": 510.780434, "r": 461.873354, "b": 463.332257 }, "text": "Sheet Flow,\\nGrass: Dense n= 0.240 P2= 3.42\"\\nShallow Concentrated Flow,\\nGrassed Waterway Kv= 15.0 fps", "attrs": { "row": 4, "col": 5, "rowspan": 2, "colspan": 2, "bbox_refit": true }, "reading_order": 19 }, { "id": "p162.5.21", "order": 26, "type": "table_cell", "bbox": { "l": 75.000034, "t": 487.200277, "r": 89.930302, "b": 475.213098 }, "text": "0.5", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p162.5.22", "order": 27, "type": "table_cell", "bbox": { "l": 121.678067, "t": 487.200277, "r": 133.622282, "b": 475.213098 }, "text": "50", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p162.5.23", "order": 28, "type": "table_cell", "bbox": { "l": 144.354889, "t": 487.200277, "r": 177.201478, "b": 475.213098 }, "text": "0.0110", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 22 }, { "id": "p162.5.24", "order": 29, "type": "table_cell", "bbox": { "l": 204.708617, "t": 487.200277, "r": 225.610992, "b": 475.213098 }, "text": "1.57", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 23 }, { "id": "p162.5.25", "order": 30, "type": "table_cell", "bbox": { "l": 341.9657, "t": 494.07, "r": 414.3771, "b": 474.9 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 24 }, { "id": "p162.5.26", "order": 31, "type": "table_cell", "bbox": { "l": 75.000034, "t": 463.439669, "r": 89.930302, "b": 451.45249 }, "text": "0.9", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 25 }, { "id": "p162.5.27", "order": 32, "type": "table_cell", "bbox": { "l": 115.679107, "t": 463.439669, "r": 133.595429, "b": 451.45249 }, "text": "160", "attrs": { "row": 6, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 26 }, { "id": "p162.5.28", "order": 33, "type": "table_cell", "bbox": { "l": 197.1429, "t": 474.9, "r": 269.5543, "b": 455.73 }, "text": "", "attrs": { "row": 6, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 27 }, { "id": "p162.5.29", "order": 34, "type": "table_cell", "bbox": { "l": 204.713988, "t": 463.439669, "r": 225.616363, "b": 451.45249 }, "text": "3.00", "attrs": { "row": 6, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 28 }, { "id": "p162.5.30", "order": 35, "type": "table_cell", "bbox": { "l": 341.9657, "t": 474.9, "r": 414.3771, "b": 455.73 }, "text": "", "attrs": { "row": 6, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 29 }, { "id": "p162.5.31", "order": 36, "type": "table_cell", "bbox": { "l": 289.079669, "t": 463.259217, "r": 415.020239, "b": 451.272038 }, "text": "Direct Entry, PIPE FLOW", "attrs": { "row": 6, "col": 5, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 30 }, { "id": "p162.5.32", "order": 37, "type": "table_cell", "bbox": { "l": 69, "t": 449.640786, "r": 89.902375, "b": 437.653607 }, "text": "13.1", "attrs": { "row": 7, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 31 }, { "id": "p162.5.33", "order": 38, "type": "table_cell", "bbox": { "l": 115.676959, "t": 449.640786, "r": 133.59328, "b": 437.653607 }, "text": "310", "attrs": { "row": 7, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 32 }, { "id": "p162.5.34", "order": 39, "type": "table_cell", "bbox": { "l": 144.351666, "t": 449.640786, "r": 168.229354, "b": 437.653607 }, "text": "Total", "attrs": { "row": 7, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 33 }, { "id": "p162.5.35", "order": 40, "type": "table_cell", "bbox": { "l": 269.5543, "t": 455.73, "r": 341.9657, "b": 436.56 }, "text": "", "attrs": { "row": 7, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 34 }, { "id": "p162.5.36", "order": 41, "type": "table_cell", "bbox": { "l": 341.9657, "t": 455.73, "r": 414.3771, "b": 436.56 }, "text": "", "attrs": { "row": 7, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 35 }, { "id": "p162.5.37", "order": 42, "type": "table_cell", "bbox": { "l": 414.3771, "t": 455.73, "r": 486.7886, "b": 436.56 }, "text": "", "attrs": { "row": 7, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 36 }, { "id": "p162.5.38", "order": 43, "type": "table_cell", "bbox": { "l": 486.7886, "t": 455.73, "r": 559.2, "b": 436.56 }, "text": "", "attrs": { "row": 7, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 37 } ], "reading_order": 4 }, { "id": "p162.6", "order": 44, "type": "caption", "bbox": { "l": 210.24, "t": 425.52, "r": 405.6, "b": 410.4 }, "text": "Subcatchment 2S: IMPERVIOUS", "attrs": { "block_label": "figure_title" }, "reading_order": 5 }, { "id": "p162.7", "order": 45, "type": "figure", "bbox": { "l": 60.96, "t": 411.6, "r": 553.68, "b": 136.08 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nRunoff\n2.16 cfs\nNOAA 24-hr D\n2\n10 YEAR Rainfall=5.38\"\nRunoff Area=0.720 ac\nRunoff Volume=0.280 af\n(cfs) Runoff Depth>4.66\"\nFlow Flow Length=310'\n1\nTc=13.1 min\nCN=98\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 6 } ] }, { "document_id": 11809, "page": 163, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 38, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "heading": 1, "table": 1, "table_cell": 30, "text": 3 }, "build_ms": 3, "items": [ { "id": "p163.1", "order": 1, "type": "header", "bbox": { "l": 52.08, "t": 739.2, "r": 560.88, "b": 698.4 }, "text": "OCSCD NOAA 24-hr D 10 YEAR Rainfall=5.38\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 26", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p163.2", "order": 2, "type": "heading", "bbox": { "l": 171.84, "t": 687.6, "r": 447.36, "b": 672.72 }, "text": "Summary for Subcatchment 5S: IMPERVIOUS", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p163.3", "order": 3, "type": "text", "bbox": { "l": 53.28, "t": 660, "r": 306.24, "b": 634.56 }, "text": "Runoff = 1.48 cfs @ 12.08 hrs, Volume=\nRouted to Pond 8P : SSIB #2 UNDERGROUND\n0.105 af, Depth> 4.66\"", "reading_order": 2 }, { "id": "p163.4", "order": 4, "type": "text", "bbox": { "l": 344.88, "t": 659.76, "r": 463.92, "b": 646.8 }, "text": "0.105 af, Depth> 4.66\"", "reading_order": 3 }, { "id": "p163.5", "order": 5, "type": "text", "bbox": { "l": 52.08, "t": 624.48, "r": 541.68, "b": 598.56 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Weighted-CN, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs NOAA 24-hr D 10 YEAR Rainfall=5.38\"", "reading_order": 4 }, { "id": "p163.6", "order": 6, "type": "table", "bbox": { "l": 52.32, "t": 589.44, "r": 559.2, "b": 461.04 }, "text": "", "attrs": { "block_label": "table", "n_rows": 6, "n_cols": 6, "integrity": { "cells_checked": 24, "cells_flagged": 0 } }, "children": [ { "id": "p163.6.1", "order": 7, "type": "table_cell", "bbox": { "l": 69.659595, "t": 588.002283, "r": 113.82741, "b": 576.0151040000001 }, "text": "Area (ac)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p163.6.2", "order": 8, "type": "table_cell", "bbox": { "l": 130.796358, "t": 588.002283, "r": 146.30665, "b": 576.0151040000001 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p163.6.3", "order": 9, "type": "table_cell", "bbox": { "l": 289.05701, "t": 536.641352, "r": 342.773751, "b": 524.654172 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p163.6.4", "order": 10, "type": "table_cell", "bbox": { "l": 87, "t": 574.200786, "r": 113.874482, "b": 548.4137069999999 }, "text": "0.270\n0.270", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p163.6.5", "order": 11, "type": "table_cell", "bbox": { "l": 134.275244, "t": 574.200786, "r": 284.133244, "b": 548.4137069999999 }, "text": "98\n100.00% Impervious Area", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p163.6.6", "order": 12, "type": "table_cell", "bbox": { "l": 160.552515, "t": 574.200786, "r": 228.007251, "b": 562.213607 }, "text": "Roofs, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true }, "reading_order": 5 }, { "id": "p163.6.7", "order": 13, "type": "table_cell", "bbox": { "l": 65.459598, "t": 536.641352, "r": 89.993572, "b": 512.774405 }, "text": "Tc (min)", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p163.6.8", "order": 14, "type": "table_cell", "bbox": { "l": 100.682141, "t": 536.641352, "r": 133.545916, "b": 512.774405 }, "text": "Length (feet)", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p163.6.9", "order": 15, "type": "table_cell", "bbox": { "l": 149.815612, "t": 536.641352, "r": 177.28086, "b": 512.774405 }, "text": "Slope (ft/ft)", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p163.6.10", "order": 16, "type": "table_cell", "bbox": { "l": 188.028505, "t": 536.641352, "r": 225.633446, "b": 512.774405 }, "text": "Velocity (ft/sec)", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p163.6.11", "order": 17, "type": "table_cell", "bbox": { "l": 236.50354, "t": 536.641352, "r": 278.288957, "b": 512.774405 }, "text": "Capacity (cfs)", "attrs": { "row": 2, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p163.6.12", "order": 18, "type": "table_cell", "bbox": { "l": 160.552704, "t": 588.002283, "r": 214.269445, "b": 576.0151040000001 }, "text": "Description", "attrs": { "row": 2, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 }, { "id": "p163.6.13", "order": 19, "type": "table_cell", "bbox": { "l": 75, "t": 510.960886, "r": 89.930268, "b": 498.973707 }, "text": "0.9", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 12 }, { "id": "p163.6.14", "order": 20, "type": "table_cell", "bbox": { "l": 121.678033, "t": 510.960886, "r": 133.622247, "b": 498.973707 }, "text": "50", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p163.6.15", "order": 21, "type": "table_cell", "bbox": { "l": 144.354854, "t": 510.960886, "r": 177.201444, "b": 498.973707 }, "text": "0.0100", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p163.6.16", "order": 22, "type": "table_cell", "bbox": { "l": 204.708583, "t": 510.960886, "r": 225.610958, "b": 498.973707 }, "text": "0.94", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p163.6.17", "order": 23, "type": "table_cell", "bbox": { "l": 390.24, "t": 516.0686, "r": 474.72, "b": 497.7257 }, "text": "", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 16 }, { "id": "p163.6.18", "order": 24, "type": "table_cell", "bbox": { "l": 289.079635, "t": 510.780434, "r": 476.803587, "b": 487.092865 }, "text": "Sheet Flow, Smooth surfaces n= 0.011 P2= 3.42\"", "attrs": { "row": 3, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p163.6.19", "order": 25, "type": "table_cell", "bbox": { "l": 75, "t": 487.200277, "r": 89.930268, "b": 475.213098 }, "text": "0.7", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p163.6.20", "order": 26, "type": "table_cell", "bbox": { "l": 115.679073, "t": 487.200277, "r": 133.595394, "b": 475.213098 }, "text": "130", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p163.6.21", "order": 27, "type": "table_cell", "bbox": { "l": 221.28, "t": 497.7257, "r": 305.76, "b": 479.3829 }, "text": "", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 20 }, { "id": "p163.6.22", "order": 28, "type": "table_cell", "bbox": { "l": 204.713954, "t": 487.200277, "r": 225.616329, "b": 475.213098 }, "text": "3.00", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p163.6.23", "order": 29, "type": "table_cell", "bbox": { "l": 390.24, "t": 497.7257, "r": 474.72, "b": 479.3829 }, "text": "", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 22 }, { "id": "p163.6.24", "order": 30, "type": "table_cell", "bbox": { "l": 289.079635, "t": 487.019825, "r": 415.020205, "b": 475.032646 }, "text": "Direct Entry, PIPE FLOW", "attrs": { "row": 4, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 23 }, { "id": "p163.6.25", "order": 31, "type": "table_cell", "bbox": { "l": 75, "t": 473.400786, "r": 89.930268, "b": 461.413607 }, "text": "1.6", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 24 }, { "id": "p163.6.26", "order": 32, "type": "table_cell", "bbox": { "l": 115.679073, "t": 473.400786, "r": 133.595394, "b": 461.413607 }, "text": "180", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 25 }, { "id": "p163.6.27", "order": 33, "type": "table_cell", "bbox": { "l": 144.35378, "t": 473.400786, "r": 168.231468, "b": 461.413607 }, "text": "Total", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 26 }, { "id": "p163.6.28", "order": 34, "type": "table_cell", "bbox": { "l": 305.76, "t": 479.3829, "r": 390.24, "b": 461.04 }, "text": "", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 27 }, { "id": "p163.6.29", "order": 35, "type": "table_cell", "bbox": { "l": 390.24, "t": 479.3829, "r": 474.72, "b": 461.04 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 28 }, { "id": "p163.6.30", "order": 36, "type": "table_cell", "bbox": { "l": 474.72, "t": 479.3829, "r": 559.2, "b": 461.04 }, "text": "", "attrs": { "row": 5, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 29 } ], "reading_order": 5 }, { "id": "p163.7", "order": 37, "type": "caption", "bbox": { "l": 210.24, "t": 449.28, "r": 405.84, "b": 434.16 }, "text": "Subcatchment 5S: IMPERVIOUS", "attrs": { "block_label": "figure_title" }, "reading_order": 6 }, { "id": "p163.8", "order": 38, "type": "figure", "bbox": { "l": 60.48, "t": 430.56, "r": 554.16, "b": 161.04 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nRunoff\n1.48 cfs\nNOAA 24-hr D\n10 YEAR Rainfall=5.38\"\nRunoff Area=0.270 ac\n1 Runoff Volume=0.105 af\n(cfs) Runoff Depth>4.66\"\nFlow Flow Length=180'\nSlope=0.0100 '/'\nTc=1.6 min\nCN=98\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 7 } ] }, { "document_id": 11809, "page": 164, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 39, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "heading": 1, "table": 1, "table_cell": 32, "text": 2 }, "build_ms": 3, "items": [ { "id": "p164.1", "order": 1, "type": "header", "bbox": { "l": 51.6, "t": 739.2, "r": 561.12, "b": 698.88 }, "text": "OCSCD NOAA 24-hr D 10 YEAR Rainfall=5.38\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 27", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p164.2", "order": 2, "type": "heading", "bbox": { "l": 183.6, "t": 687.36, "r": 434.64, "b": 672.72 }, "text": "Summary for Subcatchment 6S: POROUS", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p164.3", "order": 3, "type": "text", "bbox": { "l": 52.8, "t": 660, "r": 463.92, "b": 634.32 }, "text": "Runoff = 0.01 cfs @ 13.01 hrs, Volume= 0.003 af, Depth> 0.22\"\nRouted to Pond 8P : SSIB #2 UNDERGROUND", "reading_order": 2 }, { "id": "p164.4", "order": 4, "type": "text", "bbox": { "l": 52.08, "t": 624.24, "r": 541.44, "b": 598.8 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Weighted-CN, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs NOAA 24-hr D 10 YEAR Rainfall=5.38\"", "reading_order": 3 }, { "id": "p164.5", "order": 5, "type": "table", "bbox": { "l": 52.56, "t": 589.92, "r": 559.2, "b": 449.533607 }, "text": "", "attrs": { "block_label": "table", "n_rows": 7, "n_cols": 6, "integrity": { "cells_checked": 27, "cells_flagged": 0 } }, "children": [ { "id": "p164.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 69.659595, "t": 588.002283, "r": 113.82741, "b": 576.0151040000001 }, "text": "Area (ac)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p164.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 130.796358, "t": 588.002283, "r": 146.30665, "b": 576.0151040000001 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p164.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 289.05701, "t": 536.641352, "r": 342.773751, "b": 524.654172 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p164.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 87, "t": 560.400886, "r": 113.874482, "b": 548.4137069999999 }, "text": "0.190", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 3 }, { "id": "p164.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 134.275244, "t": 574.200786, "r": 146.219458, "b": 562.213607 }, "text": "39", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p164.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 160.552515, "t": 574.200786, "r": 320.843443, "b": 562.213607 }, "text": ">75% Grass cover, Good, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true }, "reading_order": 5 }, { "id": "p164.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 87, "t": 574.200786, "r": 113.874482, "b": 562.213607 }, "text": "0.190", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p164.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 160.555738, "t": 560.400886, "r": 273.392044, "b": 548.4137069999999 }, "text": "100.00% Pervious Area", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 5, "bbox_refit": true }, "reading_order": 7 }, { "id": "p164.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 65.459598, "t": 536.641352, "r": 89.993572, "b": 512.774405 }, "text": "Tc (min)", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p164.5.10", "order": 15, "type": "table_cell", "bbox": { "l": 100.682141, "t": 536.641352, "r": 133.545916, "b": 512.774405 }, "text": "Length (feet)", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p164.5.11", "order": 16, "type": "table_cell", "bbox": { "l": 149.815612, "t": 536.641352, "r": 177.28086, "b": 512.774405 }, "text": "Slope (ft/ft)", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p164.5.12", "order": 17, "type": "table_cell", "bbox": { "l": 188.028505, "t": 536.641352, "r": 225.633446, "b": 512.774405 }, "text": "Velocity (ft/sec)", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 }, { "id": "p164.5.13", "order": 18, "type": "table_cell", "bbox": { "l": 236.50354, "t": 536.641352, "r": 278.288957, "b": 512.774405 }, "text": "Capacity (cfs)", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 12 }, { "id": "p164.5.14", "order": 19, "type": "table_cell", "bbox": { "l": 160.552704, "t": 588.002283, "r": 214.269445, "b": 576.0151040000001 }, "text": "Description", "attrs": { "row": 3, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p164.5.15", "order": 20, "type": "table_cell", "bbox": { "l": 69, "t": 510.960886, "r": 89.902375, "b": 498.973707 }, "text": "11.3", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p164.5.16", "order": 21, "type": "table_cell", "bbox": { "l": 121.676993, "t": 510.960886, "r": 133.621207, "b": 498.973707 }, "text": "90", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p164.5.17", "order": 22, "type": "table_cell", "bbox": { "l": 144.353814, "t": 510.960886, "r": 177.200404, "b": 498.973707 }, "text": "0.0270", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p164.5.18", "order": 23, "type": "table_cell", "bbox": { "l": 204.707543, "t": 510.960886, "r": 225.609918, "b": 498.973707 }, "text": "0.13", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p164.5.19", "order": 24, "type": "table_cell", "bbox": { "l": 390.32, "t": 511.2, "r": 474.76, "b": 491.52 }, "text": "", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 18 }, { "id": "p164.5.20", "order": 25, "type": "table_cell", "bbox": { "l": 289.079669, "t": 510.780434, "r": 461.873354, "b": 487.092865 }, "text": "Sheet Flow, Grass: Dense n= 0.240 P2= 3.42\"", "attrs": { "row": 4, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p164.5.21", "order": 26, "type": "table_cell", "bbox": { "l": 75.000034, "t": 487.200277, "r": 89.930302, "b": 475.213098 }, "text": "1.1", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p164.5.22", "order": 27, "type": "table_cell", "bbox": { "l": 115.679107, "t": 487.200277, "r": 133.595429, "b": 475.213098 }, "text": "160", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p164.5.23", "order": 28, "type": "table_cell", "bbox": { "l": 144.353814, "t": 487.200277, "r": 177.200404, "b": 475.213098 }, "text": "0.0150", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 22 }, { "id": "p164.5.24", "order": 29, "type": "table_cell", "bbox": { "l": 204.707543, "t": 487.200277, "r": 225.609918, "b": 475.213098 }, "text": "2.49", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 23 }, { "id": "p164.5.25", "order": 30, "type": "table_cell", "bbox": { "l": 390.32, "t": 491.52, "r": 474.76, "b": 471.84 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 24 }, { "id": "p164.5.26", "order": 31, "type": "table_cell", "bbox": { "l": 289.079669, "t": 487.019825, "r": 432.324312, "b": 463.332257 }, "text": "Shallow Concentrated Flow, Paved Kv= 20.3 fps", "attrs": { "row": 5, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 25 }, { "id": "p164.5.27", "order": 32, "type": "table_cell", "bbox": { "l": 69, "t": 461.520786, "r": 89.902375, "b": 449.533607 }, "text": "12.4", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 26 }, { "id": "p164.5.28", "order": 33, "type": "table_cell", "bbox": { "l": 115.676959, "t": 461.520786, "r": 133.59328, "b": 449.533607 }, "text": "250", "attrs": { "row": 6, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 27 }, { "id": "p164.5.29", "order": 34, "type": "table_cell", "bbox": { "l": 144.351666, "t": 461.520786, "r": 168.229354, "b": 449.533607 }, "text": "Total", "attrs": { "row": 6, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 28 }, { "id": "p164.5.30", "order": 35, "type": "table_cell", "bbox": { "l": 305.88, "t": 471.84, "r": 390.32, "b": 452.16 }, "text": "", "attrs": { "row": 6, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 29 }, { "id": "p164.5.31", "order": 36, "type": "table_cell", "bbox": { "l": 390.32, "t": 471.84, "r": 474.76, "b": 452.16 }, "text": "", "attrs": { "row": 6, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 30 }, { "id": "p164.5.32", "order": 37, "type": "table_cell", "bbox": { "l": 474.76, "t": 471.84, "r": 559.2, "b": 452.16 }, "text": "", "attrs": { "row": 6, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 31 } ], "reading_order": 4 }, { "id": "p164.6", "order": 38, "type": "caption", "bbox": { "l": 222.72, "t": 437.04, "r": 393.12, "b": 422.4 }, "text": "Subcatchment 6S: POROUS", "attrs": { "block_label": "figure_title" }, "reading_order": 5 }, { "id": "p164.7", "order": 39, "type": "figure", "bbox": { "l": 62.88, "t": 414.24, "r": 552.48, "b": 148.8 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n0.011 Runoff\n0.01 0.01 cfs\n0.009 NOAA 24-hr D\n0.009\n0.008 10 YEAR Rainfall=5.38\"\n0.008\n0.007 Runoff Area=0.190 ac\n0.007\n0.006 Runoff Volume=0.003 af\n(cfs) 0.005 Runoff Depth>0.22\"\n0.006\nFlow Flow Length=250'\n0.005\n0.004\nTc=12.4 min\n0.004\n0.003\n0.003 CN=39\n0.002\n0.002\n0.001\n0.001\n0.000\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 6 } ] }, { "document_id": 11809, "page": 165, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 44, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "table": 1, "table_cell": 36, "text": 3, "title": 1 }, "build_ms": 3, "items": [ { "id": "p165.1", "order": 1, "type": "header", "bbox": { "l": 51.84, "t": 739.44, "r": 560.64, "b": 698.4 }, "text": "OCSCD NOAA 24-hr D 10 YEAR Rainfall=5.38\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 28", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p165.2", "order": 2, "type": "title", "bbox": { "l": 131.76, "t": 687.6, "r": 489.36, "b": 672.72 }, "text": "Summary for Subcatchment 8S: PROP WAREHOUSE BLDG", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p165.3", "order": 3, "type": "text", "bbox": { "l": 53.04, "t": 660, "r": 306.48, "b": 634.56 }, "text": "Runoff = 2.35 cfs @ 12.10 hrs, Volume=\nRouted to Pond 9P : SSIB #3 UNDERGROUND\n0.179 af, Depth> 4.66\"", "reading_order": 2 }, { "id": "p165.4", "order": 4, "type": "text", "bbox": { "l": 345.12, "t": 659.76, "r": 463.92, "b": 646.8 }, "text": "0.179 af, Depth> 4.66\"", "reading_order": 3 }, { "id": "p165.5", "order": 5, "type": "text", "bbox": { "l": 52.08, "t": 624.48, "r": 541.44, "b": 598.56 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Weighted-CN, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs NOAA 24-hr D 10 YEAR Rainfall=5.38\"", "reading_order": 4 }, { "id": "p165.6", "order": 6, "type": "table", "bbox": { "l": 52.32, "t": 590.16, "r": 559.2, "b": 437.28 }, "text": "", "attrs": { "block_label": "table", "n_rows": 7, "n_cols": 6, "integrity": { "cells_checked": 29, "cells_flagged": 0 } }, "children": [ { "id": "p165.6.1", "order": 7, "type": "table_cell", "bbox": { "l": 69.659595, "t": 588.002283, "r": 113.82741, "b": 576.0151040000001 }, "text": "Area (ac)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p165.6.2", "order": 8, "type": "table_cell", "bbox": { "l": 130.796358, "t": 588.002283, "r": 146.30665, "b": 576.0151040000001 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p165.6.3", "order": 9, "type": "table_cell", "bbox": { "l": 289.05701, "t": 536.641352, "r": 342.773751, "b": 524.654172 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p165.6.4", "order": 10, "type": "table_cell", "bbox": { "l": 87, "t": 574.200786, "r": 113.874482, "b": 548.4137069999999 }, "text": "0.460\n0.460", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p165.6.5", "order": 11, "type": "table_cell", "bbox": { "l": 134.275244, "t": 574.200786, "r": 146.219458, "b": 562.213607 }, "text": "98", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p165.6.6", "order": 12, "type": "table_cell", "bbox": { "l": 160.552515, "t": 574.200786, "r": 284.133244, "b": 548.4137069999999 }, "text": "Roofs, HSG A\n100.00% Impervious Area", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 4, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p165.6.7", "order": 13, "type": "table_cell", "bbox": { "l": 65.459598, "t": 536.641352, "r": 89.993572, "b": 512.774405 }, "text": "Tc (min)", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p165.6.8", "order": 14, "type": "table_cell", "bbox": { "l": 100.682141, "t": 536.641352, "r": 133.545916, "b": 512.774405 }, "text": "Length (feet)", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p165.6.9", "order": 15, "type": "table_cell", "bbox": { "l": 149.815612, "t": 536.641352, "r": 177.28086, "b": 512.774405 }, "text": "Slope (ft/ft)", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p165.6.10", "order": 16, "type": "table_cell", "bbox": { "l": 188.028505, "t": 536.641352, "r": 225.633446, "b": 512.774405 }, "text": "Velocity (ft/sec)", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p165.6.11", "order": 17, "type": "table_cell", "bbox": { "l": 236.50354, "t": 536.641352, "r": 278.288957, "b": 512.774405 }, "text": "Capacity (cfs)", "attrs": { "row": 2, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p165.6.12", "order": 18, "type": "table_cell", "bbox": { "l": 160.552704, "t": 588.002283, "r": 214.269445, "b": 576.0151040000001 }, "text": "Description", "attrs": { "row": 2, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 }, { "id": "p165.6.13", "order": 19, "type": "table_cell", "bbox": { "l": 75, "t": 510.960886, "r": 89.930268, "b": 498.973707 }, "text": "1.5", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 12 }, { "id": "p165.6.14", "order": 20, "type": "table_cell", "bbox": { "l": 115.679073, "t": 510.960886, "r": 133.595394, "b": 498.973707 }, "text": "100", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p165.6.15", "order": 21, "type": "table_cell", "bbox": { "l": 144.35378, "t": 510.960886, "r": 177.20037, "b": 498.973707 }, "text": "0.0100", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p165.6.16", "order": 22, "type": "table_cell", "bbox": { "l": 204.707509, "t": 510.960886, "r": 225.609884, "b": 498.973707 }, "text": "1.08", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p165.6.17", "order": 23, "type": "table_cell", "bbox": { "l": 390.24, "t": 513.72, "r": 474.72, "b": 494.61 }, "text": "", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 16 }, { "id": "p165.6.18", "order": 24, "type": "table_cell", "bbox": { "l": 289.079635, "t": 510.780434, "r": 476.803587, "b": 487.092865 }, "text": "Sheet Flow, Smooth surfaces n= 0.011 P2= 3.42\"", "attrs": { "row": 3, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p165.6.19", "order": 25, "type": "table_cell", "bbox": { "l": 75, "t": 487.200277, "r": 89.930268, "b": 475.213098 }, "text": "0.3", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p165.6.20", "order": 26, "type": "table_cell", "bbox": { "l": 121.678033, "t": 487.200277, "r": 133.622247, "b": 475.213098 }, "text": "40", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p165.6.21", "order": 27, "type": "table_cell", "bbox": { "l": 144.354854, "t": 487.200277, "r": 177.201444, "b": 475.213098 }, "text": "0.0100", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p165.6.22", "order": 28, "type": "table_cell", "bbox": { "l": 204.708583, "t": 487.200277, "r": 225.610958, "b": 475.213098 }, "text": "2.03", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p165.6.23", "order": 29, "type": "table_cell", "bbox": { "l": 390.24, "t": 494.61, "r": 474.72, "b": 475.5 }, "text": "", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 22 }, { "id": "p165.6.24", "order": 30, "type": "table_cell", "bbox": { "l": 289.079635, "t": 487.019825, "r": 432.324278, "b": 463.332257 }, "text": "Shallow Concentrated Flow, Paved Kv= 20.3 fps", "attrs": { "row": 4, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 23 }, { "id": "p165.6.25", "order": 31, "type": "table_cell", "bbox": { "l": 75, "t": 463.439669, "r": 89.930268, "b": 451.45249 }, "text": "0.8", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 24 }, { "id": "p165.6.26", "order": 32, "type": "table_cell", "bbox": { "l": 115.679073, "t": 463.439669, "r": 133.595394, "b": 451.45249 }, "text": "140", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 25 }, { "id": "p165.6.27", "order": 33, "type": "table_cell", "bbox": { "l": 221.28, "t": 475.5, "r": 305.76, "b": 456.39 }, "text": "", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 26 }, { "id": "p165.6.28", "order": 34, "type": "table_cell", "bbox": { "l": 204.713954, "t": 463.439669, "r": 225.616329, "b": 451.45249 }, "text": "3.00", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 27 }, { "id": "p165.6.29", "order": 35, "type": "table_cell", "bbox": { "l": 390.24, "t": 475.5, "r": 474.72, "b": 456.39 }, "text": "", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 28 }, { "id": "p165.6.30", "order": 36, "type": "table_cell", "bbox": { "l": 289.079635, "t": 463.259217, "r": 415.020205, "b": 451.272038 }, "text": "Direct Entry, PIPE FLOW", "attrs": { "row": 5, "col": 5, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 29 }, { "id": "p165.6.31", "order": 37, "type": "table_cell", "bbox": { "l": 75, "t": 449.640786, "r": 89.930268, "b": 437.653607 }, "text": "2.6", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 30 }, { "id": "p165.6.32", "order": 38, "type": "table_cell", "bbox": { "l": 115.679073, "t": 449.640786, "r": 133.595394, "b": 437.653607 }, "text": "280", "attrs": { "row": 6, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 31 }, { "id": "p165.6.33", "order": 39, "type": "table_cell", "bbox": { "l": 144.35378, "t": 449.640786, "r": 168.231468, "b": 437.653607 }, "text": "Total", "attrs": { "row": 6, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 32 }, { "id": "p165.6.34", "order": 40, "type": "table_cell", "bbox": { "l": 305.76, "t": 456.39, "r": 390.24, "b": 437.28 }, "text": "", "attrs": { "row": 6, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 33 }, { "id": "p165.6.35", "order": 41, "type": "table_cell", "bbox": { "l": 390.24, "t": 456.39, "r": 474.72, "b": 437.28 }, "text": "", "attrs": { "row": 6, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 34 }, { "id": "p165.6.36", "order": 42, "type": "table_cell", "bbox": { "l": 474.72, "t": 456.39, "r": 559.2, "b": 437.28 }, "text": "", "attrs": { "row": 6, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 35 } ], "reading_order": 5 }, { "id": "p165.7", "order": 43, "type": "caption", "bbox": { "l": 170.4, "t": 425.76, "r": 447.84, "b": 410.64 }, "text": "Subcatchment 8S: PROP WAREHOUSE BLDG", "attrs": { "block_label": "figure_title" }, "reading_order": 6 }, { "id": "p165.8", "order": 44, "type": "figure", "bbox": { "l": 60.72, "t": 407.28, "r": 553.68, "b": 136.8 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nRunoff\n2.35 cfs\nNOAA 24-hr D\n2 10 YEAR Rainfall=5.38\"\nRunoff Area=0.460 ac\nRunoff Volume=0.179 af\n(cfs) Runoff Depth>4.66\"\nFlow Flow Length=280'\nSlope=0.0100 '/'\n1\nTc=2.6 min\nCN=98\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 7 } ] }, { "document_id": 11809, "page": 166, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 18, "counts_by_type": { "caption": 1, "figure": 1, "footnote": 1, "form_field": 1, "header": 1, "heading": 1, "table": 1, "table_cell": 9, "text": 2 }, "build_ms": 2, "items": [ { "id": "p166.1", "order": 1, "type": "header", "bbox": { "l": 52.32, "t": 738.24, "r": 559.92, "b": 698.64 }, "text": "OCSCD NOAA 24-hr D 10 YEAR Rainfall=5.38\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 29", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p166.2", "order": 2, "type": "heading", "bbox": { "l": 151.2, "t": 687.36, "r": 468.72, "b": 672.96 }, "text": "Summary for Subcatchment 10S: BY-PASS POROUS", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p166.3", "order": 3, "type": "text", "bbox": { "l": 53.04, "t": 660, "r": 463.68, "b": 634.32 }, "text": "Runoff = 0.00 cfs @ 12.50 hrs, Volume= 0.001 af, Depth> 0.22\"\nRouted to Reach 10 : COMPOSITE", "reading_order": 2 }, { "id": "p166.4", "order": 4, "type": "text", "bbox": { "l": 52.08, "t": 624.24, "r": 541.44, "b": 598.8 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Weighted-CN, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs NOAA 24-hr D 10 YEAR Rainfall=5.38\"", "reading_order": 3 }, { "id": "p166.5", "order": 5, "type": "table", "bbox": { "l": 53.04, "t": 588.48, "r": 559.44, "b": 498.72 }, "text": "", "attrs": { "block_label": "table", "n_rows": 3, "n_cols": 3, "integrity": { "cells_checked": 9, "cells_flagged": 0 } }, "children": [ { "id": "p166.5.1", "order": 6, "type": "table_cell", "bbox": { "l": 69.659595, "t": 588.002283, "r": 113.82741, "b": 576.0151040000001 }, "text": "Area (ac)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p166.5.2", "order": 7, "type": "table_cell", "bbox": { "l": 130.796358, "t": 588.002283, "r": 146.30665, "b": 576.0151040000001 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p166.5.3", "order": 8, "type": "table_cell", "bbox": { "l": 289.05701, "t": 536.641352, "r": 342.773751, "b": 524.654172 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p166.5.4", "order": 9, "type": "table_cell", "bbox": { "l": 87, "t": 574.200786, "r": 113.874482, "b": 548.4137069999999 }, "text": "0.060\n0.060", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p166.5.5", "order": 10, "type": "table_cell", "bbox": { "l": 134.275244, "t": 574.200786, "r": 273.392044, "b": 548.4137069999999 }, "text": "39\n100.00% Pervious Area", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 4 }, { "id": "p166.5.6", "order": 11, "type": "table_cell", "bbox": { "l": 160.552515, "t": 574.200786, "r": 320.843443, "b": 562.213607 }, "text": ">75% Grass cover, Good, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p166.5.7", "order": 12, "type": "table_cell", "bbox": { "l": 65.459598, "t": 536.641352, "r": 89.993572, "b": 498.973707 }, "text": "Tc (min)\n2.0", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p166.5.8", "order": 13, "type": "table_cell", "bbox": { "l": 100.682141, "t": 536.641352, "r": 352.94681, "b": 498.793255 }, "text": "Length (feet)\nDirect Entry,", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 7 }, { "id": "p166.5.9", "order": 14, "type": "table_cell", "bbox": { "l": 149.815612, "t": 536.641352, "r": 278.288957, "b": 512.774405 }, "text": "Slope (ft/ft) Velocity (ft/sec) Capacity (cfs)", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 } ], "reading_order": 4 }, { "id": "p166.6", "order": 15, "type": "caption", "bbox": { "l": 190.32, "t": 486.72, "r": 426.96, "b": 471.84 }, "text": "Subcatchment 10S: BY-PASS POROUS", "attrs": { "block_label": "figure_title" }, "reading_order": 5 }, { "id": "p166.7", "order": 16, "type": "figure", "bbox": { "l": 62.4, "t": 465.12, "r": 500.64, "b": 199.44 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\n0.004\n0.00 cfs\n0.004\n0.003 NOAA 24-hr D\n10 YEAR Rainfall=5.38\"\n0.003\n0.003\n0.003 Runoff Area=0.060 ac\n0.003\n0.002 Runoff Volume=0.001 af\n(cfs) Runoff Depth>0.22\"\n0.002\n0.002\nFlow Tc=2.0 min\n0.002\n0.002\n0.001 CN=39\n0.001\n0.001\n0.001\n0.001\n0.000\n0.000\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 6 }, { "id": "p166.8", "order": 17, "type": "footnote", "bbox": { "l": 510.24, "t": 444.24, "r": 546.96, "b": 432.48 }, "text": "□ Runoff", "attrs": { "block_label": "vision_footnote" }, "children": [ { "id": "p166.8.1", "order": 18, "type": "form_field", "bbox": { "l": 510.24, "t": 444.24, "r": 522, "b": 432.48 }, "text": "", "attrs": { "field_kind": "checkbox", "label": "□ Runoff", "source": "glyph_estimate", "bbox_estimated": true, "label_source": "parent_text", "label_ref": "p166.8", "text_offset": 0, "text_span": 1 }, "reading_order": 0 } ], "reading_order": 7 } ] }, { "document_id": 11809, "page": 167, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 24, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "heading": 1, "table": 1, "table_cell": 16, "text": 3 }, "build_ms": 2, "items": [ { "id": "p167.1", "order": 1, "type": "header", "bbox": { "l": 52.08, "t": 738.48, "r": 560.16, "b": 698.64 }, "text": "OCSCD NOAA 24-hr D 10 YEAR Rainfall=5.38\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 30", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p167.2", "order": 2, "type": "heading", "bbox": { "l": 140.16, "t": 687.36, "r": 481.44, "b": 672.72 }, "text": "Summary for Subcatchment 11S: BY-PASS IMPERVIOUS", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p167.3", "order": 3, "type": "text", "bbox": { "l": 53.76, "t": 660, "r": 307.2, "b": 634.56 }, "text": "Runoff = 0.37 cfs @ 12.09 hrs, Volume=\nRouted to Reach 10 : COMPOSITE\n0.027 af, Depth> 4.66\"", "reading_order": 2 }, { "id": "p167.4", "order": 4, "type": "text", "bbox": { "l": 345.12, "t": 659.76, "r": 463.92, "b": 646.8 }, "text": "0.027 af, Depth> 4.66\"", "reading_order": 3 }, { "id": "p167.5", "order": 5, "type": "text", "bbox": { "l": 52.08, "t": 624.24, "r": 541.44, "b": 598.8 }, "text": "Runoff by SCS TR-20 method, UH=Delmarva, Weighted-CN, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs NOAA 24-hr D 10 YEAR Rainfall=5.38\"", "reading_order": 4 }, { "id": "p167.6", "order": 6, "type": "table", "bbox": { "l": 52.8, "t": 588.24, "r": 559.44, "b": 497.76 }, "text": "", "attrs": { "block_label": "table", "n_rows": 4, "n_cols": 4, "integrity": { "cells_checked": 13, "cells_flagged": 1, "flags": [ { "row": 2, "col": 2, "coverage": 0, "text": "Impervious Area" } ] } }, "children": [ { "id": "p167.6.1", "order": 7, "type": "table_cell", "bbox": { "l": 69.659595, "t": 588.002283, "r": 113.82741, "b": 576.0151040000001 }, "text": "Area (ac)", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p167.6.2", "order": 8, "type": "table_cell", "bbox": { "l": 130.796358, "t": 588.002283, "r": 146.30665, "b": 576.0151040000001 }, "text": "CN", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p167.6.3", "order": 9, "type": "table_cell", "bbox": { "l": 289.05701, "t": 536.641352, "r": 342.773751, "b": 524.654172 }, "text": "Description", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p167.6.4", "order": 10, "type": "table_cell", "bbox": { "l": 432.78, "t": 588.24, "r": 559.44, "b": 570.144 }, "text": "", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 3 }, { "id": "p167.6.5", "order": 11, "type": "table_cell", "bbox": { "l": 87, "t": 560.400886, "r": 113.874482, "b": 548.4137069999999 }, "text": "0.070", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p167.6.6", "order": 12, "type": "table_cell", "bbox": { "l": 134.275244, "t": 574.200786, "r": 146.219458, "b": 562.213607 }, "text": "98", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p167.6.7", "order": 13, "type": "table_cell", "bbox": { "l": 160.552515, "t": 574.200786, "r": 268.608987, "b": 562.213607 }, "text": "Paved parking, HSG A", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p167.6.8", "order": 14, "type": "table_cell", "bbox": { "l": 432.78, "t": 570.144, "r": 559.44, "b": 552.048 }, "text": "", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 7 }, { "id": "p167.6.9", "order": 15, "type": "table_cell", "bbox": { "l": 87, "t": 574.200786, "r": 113.874482, "b": 562.213607 }, "text": "0.070", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p167.6.10", "order": 16, "type": "table_cell", "bbox": { "l": 160.555738, "t": 560.400886, "r": 202.951254, "b": 548.4137069999999 }, "text": "100.00%", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 9 }, { "id": "p167.6.11", "order": 17, "type": "table_cell", "bbox": { "l": 306.12, "t": 552.048, "r": 432.78, "b": 533.952 }, "text": "Impervious Area", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 10 }, { "id": "p167.6.12", "order": 18, "type": "table_cell", "bbox": { "l": 432.78, "t": 552.048, "r": 559.44, "b": 533.952 }, "text": "", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 11 }, { "id": "p167.6.13", "order": 19, "type": "table_cell", "bbox": { "l": 65.459598, "t": 536.641352, "r": 352.94681, "b": 498.793255 }, "text": "Tc (min)\nDirect Entry,", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 12 }, { "id": "p167.6.14", "order": 20, "type": "table_cell", "bbox": { "l": 100.682141, "t": 536.641352, "r": 133.545916, "b": 512.774405 }, "text": "Length (feet)", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p167.6.15", "order": 21, "type": "table_cell", "bbox": { "l": 149.815612, "t": 536.641352, "r": 177.28086, "b": 512.774405 }, "text": "Slope (ft/ft)", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p167.6.16", "order": 22, "type": "table_cell", "bbox": { "l": 188.028505, "t": 536.641352, "r": 225.633446, "b": 512.774405 }, "text": "Velocity (ft/sec)", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 } ], "reading_order": 5 }, { "id": "p167.7", "order": 23, "type": "caption", "bbox": { "l": 178.32, "t": 486.96, "r": 439.92, "b": 471.84 }, "text": "Subcatchment 11S: BY-PASS IMPERVIOUS", "attrs": { "block_label": "figure_title" }, "reading_order": 6 }, { "id": "p167.8", "order": 24, "type": "figure", "bbox": { "l": 61.92, "t": 465.12, "r": 552, "b": 199.2 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nRunoff\n0.4\n0.37 cfs\n0.38\n0.36 NOAA 24-hr D\n0.32 10 YEAR Rainfall=5.38\"\n0.34\nRunoff Area=0.070 ac\n0.3\n0.28\nRunoff Volume=0.027 af\n0.26\n0.24\n(cfs) 0.22 Runoff Depth>4.66\"\n0.2\nFlow 0.18 Tc=2.0 min\n0.14 CN=98\n0.16\n0.12\n0.1\n0.08\n0.06\n0.04\n0.02\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 7 } ] }, { "document_id": 11809, "page": 168, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 6, "counts_by_type": { "caption": 1, "figure": 1, "header": 1, "heading": 1, "text": 2 }, "build_ms": 0, "items": [ { "id": "p168.1", "order": 1, "type": "header", "bbox": { "l": 52.08, "t": 738.48, "r": 560.64, "b": 699.12 }, "text": "OCSCD NOAA 24-hr D 10 YEAR Rainfall=5.38\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 31", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p168.2", "order": 2, "type": "heading", "bbox": { "l": 198, "t": 687.6, "r": 420, "b": 672.48 }, "text": "Summary for Reach 10: COMPOSITE", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p168.3", "order": 3, "type": "text", "bbox": { "l": 52.08, "t": 660.48, "r": 518.16, "b": 623.04 }, "text": "Inflow Area = 2.120 ac, 71.70% Impervious, Inflow Depth > 3.34\" for 10 YEAR event\nInflow = 3.32 cfs @ 12.18 hrs, Volume= 0.591 af\nOutflow = 3.32 cfs @ 12.18 hrs, Volume= 0.591 af, Atten=0%, Lag=0.0 min", "reading_order": 2 }, { "id": "p168.4", "order": 4, "type": "text", "bbox": { "l": 52.08, "t": 612.24, "r": 421.2, "b": 598.56 }, "text": "Routing by Stor-Ind+Trans method, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs", "reading_order": 3 }, { "id": "p168.5", "order": 5, "type": "caption", "bbox": { "l": 236.4, "t": 587.28, "r": 378.72, "b": 572.4 }, "text": "Reach 10: COMPOSITE", "attrs": { "block_label": "figure_title" }, "reading_order": 4 }, { "id": "p168.6", "order": 6, "type": "figure", "bbox": { "l": 60.72, "t": 571.2, "r": 553.2, "b": 297.84 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nInflow\n3.32 cfs Outflow\n3.32 cfs\nInflow Area=2.120 ac\n3\n(cfs) 2\nFlow\n1\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 5 } ] }, { "document_id": 11809, "page": 169, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 41, "counts_by_type": { "footnote": 3, "header": 1, "heading": 1, "table": 2, "table_cell": 34 }, "build_ms": 7, "items": [ { "id": "p169.1", "order": 1, "type": "header", "bbox": { "l": 52.08, "t": 738.96, "r": 560.64, "b": 698.64 }, "text": "OCSCD NOAA 24-hr D 10 YEAR Rainfall=5.38\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 32", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p169.2", "order": 2, "type": "heading", "bbox": { "l": 162.24, "t": 687.84, "r": 457.44, "b": 672.96 }, "text": "Summary for Pond 3P: SSIB #1 SURFACE BASIN", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p169.3", "order": 3, "type": "table", "bbox": { "l": 54, "t": 671.28, "r": 534.48, "b": 515.76 }, "text": "", "attrs": { "block_label": "table", "n_rows": 8, "n_cols": 1, "integrity": { "cells_checked": 8, "cells_flagged": 2, "flags": [ { "row": 3, "col": 0, "coverage": 0.5, "text": "Discarded = 0.00 cfs @ 5.00 hrs, Volume= 0.000 af" }, { "row": 4, "col": 0, "coverage": 0, "text": "Primary = 1.22 cfs @ 12.58 hrs, Volume= 0.281 af" } ] } }, "children": [ { "id": "p169.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 56.16, "t": 671.28, "r": 534.48, "b": 651.84 }, "text": "nflow Area = 1.070 ac, 67.29% Impervious, Inflow Depth > 3.21\" for 10 YEAR event", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 0 }, { "id": "p169.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 56.16, "t": 651.84, "r": 534.48, "b": 632.4 }, "text": "nflow = 2.16 cfs @ 12.22 hrs, Volume= 0.286 af", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 1 }, { "id": "p169.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 56.16, "t": 632.4, "r": 534.48, "b": 612.96 }, "text": "Outflow = 1.22 cfs @ 12.58 hrs, Volume= 0.281 af, Atten= 43%, Lag= 21.1 min", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 2 }, { "id": "p169.3.4", "order": 7, "type": "table_cell", "bbox": { "l": 56.16, "t": 612.96, "r": 534.48, "b": 593.52 }, "text": "Discarded = 0.00 cfs @ 5.00 hrs, Volume= 0.000 af", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 3 }, { "id": "p169.3.5", "order": 8, "type": "table_cell", "bbox": { "l": 56.16, "t": 593.52, "r": 534.48, "b": 574.08 }, "text": "Primary = 1.22 cfs @ 12.58 hrs, Volume= 0.281 af", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 4 }, { "id": "p169.3.6", "order": 9, "type": "table_cell", "bbox": { "l": 68.930268, "t": 599.8820499999999, "r": 237.878603, "b": 587.894871 }, "text": "Routed to Reach 10 : COMPOSITE", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p169.3.7", "order": 10, "type": "table_cell", "bbox": { "l": 54, "t": 576.122516, "r": 515.753447, "b": 540.375802 }, "text": "Routing by Stor-Ind method, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs\\nStarting Elev= 111.50' Surf.Area= 2,825 sf Storage= 3,544 cf\\nPeak Elev= 112.25' @ 12.58 hrs Surf.Area= 3,402 sf Storage= 5,884 cf (2,340 cf above start)", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p169.3.8", "order": 11, "type": "table_cell", "bbox": { "l": 54, "t": 528.603447, "r": 411.725999, "b": 516.616268 }, "text": "Plug-Flow detention time= 164.2 min calculated for 0.199 af (69% of inflow)", "attrs": { "row": 7, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 } ], "reading_order": 2 }, { "id": "p169.4", "order": 12, "type": "table", "bbox": { "l": 50.64, "t": 494.64, "r": 559.92, "b": 244.8 }, "text": "", "attrs": { "block_label": "table", "n_rows": 7, "n_cols": 5, "integrity": { "cells_checked": 26, "cells_flagged": 1, "flags": [ { "row": 1, "col": 4, "coverage": 0.33, "text": "Listed below (Recalc)" } ] } }, "children": [ { "id": "p169.4.1", "order": 13, "type": "table_cell", "bbox": { "l": 54, "t": 492.964145, "r": 90.412668, "b": 480.976966 }, "text": "Volume", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 0 }, { "id": "p169.4.2", "order": 14, "type": "table_cell", "bbox": { "l": 123.533158, "t": 492.964145, "r": 150.396899, "b": 480.976966 }, "text": "Invert", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 1 }, { "id": "p169.4.3", "order": 15, "type": "table_cell", "bbox": { "l": 173.452885, "t": 492.964145, "r": 237.330802, "b": 480.976966 }, "text": "Avail.Storage", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 2 }, { "id": "p169.4.4", "order": 16, "type": "table_cell", "bbox": { "l": 249.465135, "t": 492.964145, "r": 343.783612, "b": 480.976966 }, "text": "Storage Description", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 2, "bbox_refit": true, "column_header": true, "header_source": "heuristic" }, "reading_order": 3 }, { "id": "p169.4.5", "order": 17, "type": "table_cell", "bbox": { "l": 66.12, "t": 479.160786, "r": 78.064214, "b": 467.173607 }, "text": "#1", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p169.4.6", "order": 18, "type": "table_cell", "bbox": { "l": 115.437146, "t": 479.160786, "r": 150.335304, "b": 467.173607 }, "text": "110.00'", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p169.4.7", "order": 19, "type": "table_cell", "bbox": { "l": 193.071317, "t": 479.160786, "r": 237.260614, "b": 467.173607 }, "text": "12,950 cf", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p169.4.8", "order": 20, "type": "table_cell", "bbox": { "l": 249.479803, "t": 478.980334, "r": 406.4517, "b": 466.993155 }, "text": "Custom Stage Data (Prismatic)", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p169.4.9", "order": 21, "type": "table_cell", "bbox": { "l": 458.064, "t": 475.4215, "r": 559.92, "b": 456.2031 }, "text": "Listed below (Recalc)", "attrs": { "row": 1, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 8 }, { "id": "p169.4.10", "order": 22, "type": "table_cell", "bbox": { "l": 57.719307, "t": 455.401252, "r": 101.897863, "b": 370.214538 }, "text": "Elevation\\n(feet)\n110.00\n111.00\n112.00\n113.00\n114.00", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 9 }, { "id": "p169.4.11", "order": 23, "type": "table_cell", "bbox": { "l": 142.191327, "t": 455.401252, "r": 187.562155, "b": 370.214538 }, "text": "Surf.Area\\n(sq-ft)\n2,000\n2,450\n3,200\n4,000\n4,600", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 10 }, { "id": "p169.4.12", "order": 24, "type": "table_cell", "bbox": { "l": 230.21009, "t": 455.401252, "r": 358.898543, "b": 370.214538 }, "text": "Inc.Store\\n(cubic-feet)\n0\n2,225\n2,825\n3,600\n4,300", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 11 }, { "id": "p169.4.13", "order": 25, "type": "table_cell", "bbox": { "l": 219.361478, "t": 455.401252, "r": 358.999511, "b": 370.214538 }, "text": "Cum.Store\\n(cubic-feet)\n0\n2,225\n5,050\n8,650\n12,950", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 12 }, { "id": "p169.4.14", "order": 26, "type": "table_cell", "bbox": { "l": 53.999914, "t": 358.442183, "r": 86.825021, "b": 332.653607 }, "text": "Device\n#1", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 13 }, { "id": "p169.4.15", "order": 27, "type": "table_cell", "bbox": { "l": 98.873425, "t": 358.442183, "r": 147.222394, "b": 332.653607 }, "text": "Routing\nDiscarded", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 14 }, { "id": "p169.4.16", "order": 28, "type": "table_cell", "bbox": { "l": 175.965845, "t": 358.442183, "r": 210.937439, "b": 332.653607 }, "text": "Invert\n110.00'", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 15 }, { "id": "p169.4.17", "order": 29, "type": "table_cell", "bbox": { "l": 223.01377, "t": 358.442183, "r": 462.419686, "b": 320.772765 }, "text": "Outlet Devices\n1.000 in/hr Exfiltration X 0.00 over Surface area\\nConductivity to Groundwater Elevation = 106.00'", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 16 }, { "id": "p169.4.18", "order": 30, "type": "table_cell", "bbox": { "l": 70.44, "t": 320.880177, "r": 82.384214, "b": 308.892998 }, "text": "#2", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p169.4.19", "order": 31, "type": "table_cell", "bbox": { "l": 98.876253, "t": 297.120643, "r": 135.868946, "b": 285.133464 }, "text": "Primary", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 }, { "id": "p169.4.20", "order": 32, "type": "table_cell", "bbox": { "l": 175.97229, "t": 320.880177, "r": 210.870449, "b": 308.892998 }, "text": "111.50'", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p169.4.21", "order": 33, "type": "table_cell", "bbox": { "l": 223.01982, "t": 320.880177, "r": 451.453995, "b": 297.013231 }, "text": "12.0\" W x 4.0\" H Vert. Orifice/Grate C= 0.600\\nLimited to weir flow at low heads", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 20 }, { "id": "p169.4.22", "order": 34, "type": "table_cell", "bbox": { "l": 70.44, "t": 297.120643, "r": 82.384214, "b": 285.133464 }, "text": "#3", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p169.4.23", "order": 35, "type": "table_cell", "bbox": { "l": 98.876253, "t": 320.880177, "r": 135.868946, "b": 308.892998 }, "text": "Primary", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 22 }, { "id": "p169.4.24", "order": 36, "type": "table_cell", "bbox": { "l": 175.97229, "t": 297.120643, "r": 210.870449, "b": 285.133464 }, "text": "113.00'", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 23 }, { "id": "p169.4.25", "order": 37, "type": "table_cell", "bbox": { "l": 223.01982, "t": 297.120643, "r": 439.81483, "b": 273.253697 }, "text": "24.0\" x 48.0\" Horiz. Orifice/Grate C= 0.600\\nLimited to weir flow at low heads", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 24 }, { "id": "p169.4.26", "order": 38, "type": "table_cell", "bbox": { "l": 53.999519, "t": 261.48134100000004, "r": 430.987712, "b": 249.31371000000001 }, "text": "Discarded OutFlow Max=0.00 cfs @ 5.00 hrs HW=111.50' (Free Discharge)", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 5, "bbox_refit": true }, "reading_order": 25 } ], "reading_order": 3 }, { "id": "p169.5", "order": 39, "type": "footnote", "bbox": { "l": 51.6, "t": 529.44, "r": 413.52, "b": 503.28 }, "text": "Plug-Flow detention time = 164.2 min calculated for 0.199 af (69% of inflow) Center-of-Mass det. time = 27.0 min (777.3 - 750.3)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 4 }, { "id": "p169.6", "order": 40, "type": "footnote", "bbox": { "l": 50.64, "t": 262.08, "r": 433.44, "b": 236.16 }, "text": "Discarded OutFlow Max=0.00 cfs @ 5.00 hrs HW=1111.50' (Free Discharge)\n1=Exfiltration (Controls 0.00 cfs)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 5 }, { "id": "p169.7", "order": 41, "type": "footnote", "bbox": { "l": 52.08, "t": 226.56, "r": 427.2, "b": 189.84 }, "text": "Primary OutFlow Max=1.22 cfs @ 12.58 hrs HW=112.25' (Free Discharge)\n2=Orifice/Grate (Orifice Controls 1.22 cfs @ 3.67 fps)\n3=Orifice/Grate (Controls 0.00 cfs)", "attrs": { "block_label": "vision_footnote" }, "reading_order": 6 } ] }, { "document_id": 11809, "page": 170, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 3, "counts_by_type": { "caption": 1, "figure": 1, "header": 1 }, "build_ms": 0, "items": [ { "id": "p170.1", "order": 1, "type": "header", "bbox": { "l": 52.56, "t": 737.76, "r": 561.12, "b": 698.88 }, "text": "OCSCD NOAA 24-hr D 10 YEAR Rainfall=5.38\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 33", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p170.2", "order": 2, "type": "caption", "bbox": { "l": 201.36, "t": 687.84, "r": 415.92, "b": 673.2 }, "text": "Pond 3P: SSIB #1 SURFACE BASIN", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p170.3", "order": 3, "type": "figure", "bbox": { "l": 61.44, "t": 670.32, "r": 552.24, "b": 399.6 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nInflow\n2.16 cfs Outflow\nInflow Area=1.070 ac Primary\nDiscarded\nPeak Elev=112.25'\nStorage=5,884 cf\n2\n1.22 cfs\n(cfs) 1.22 cfs\nFlow 1\n0.00 cfs\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 2 } ] }, { "document_id": 11809, "page": 171, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 38, "counts_by_type": { "footnote": 1, "header": 1, "heading": 2, "table": 3, "table_cell": 30, "text": 1 }, "build_ms": 7, "items": [ { "id": "p171.1", "order": 1, "type": "header", "bbox": { "l": 52.32, "t": 738.72, "r": 560.16, "b": 698.64 }, "text": "OCSCD NOAA 24-hr D 10 YEAR Rainfall=5.38\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 34", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p171.2", "order": 2, "type": "heading", "bbox": { "l": 163.68, "t": 687.6, "r": 456, "b": 672.96 }, "text": "Summary for Pond 8P: SSIB #2 UNDERGROUND", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p171.3", "order": 3, "type": "table", "bbox": { "l": 54, "t": 666, "r": 528.96, "b": 512.16 }, "text": "", "attrs": { "block_label": "table", "n_rows": 8, "n_cols": 2, "integrity": { "cells_checked": 8, "cells_flagged": 3, "flags": [ { "row": 2, "col": 0, "coverage": 0.31, "text": "Outflow = 0.64 cfs @ 12.19 hrs, Volume= 0.106 af, Atten= 56…" }, { "row": 3, "col": 0, "coverage": 0.5, "text": "Discarded = 0.00 cfs @ 5.00 hrs, Volume= 0.000 af" }, { "row": 4, "col": 0, "coverage": 0.13, "text": "Primary = 0.64 cfs @ 12.19 hrs, Volume= 0.106 af" } ] } }, "children": [ { "id": "p171.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 54, "t": 666, "r": 528.96, "b": 646.77 }, "text": "Inflow Area = 0.460 ac, 58.70% Impervious, Inflow Depth > 2.83\" for 10 YEAR event", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 2 }, "reading_order": 0 }, { "id": "p171.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 54, "t": 646.77, "r": 528.96, "b": 627.54 }, "text": "Inflow = 1.48 cfs @ 12.08 hrs, Volume= 0.108 af", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 2 }, "reading_order": 1 }, { "id": "p171.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 54, "t": 627.54, "r": 528.96, "b": 608.31 }, "text": "Outflow = 0.64 cfs @ 12.19 hrs, Volume= 0.106 af, Atten= 56%, Lag= 6.5 min", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 2 }, "reading_order": 2 }, { "id": "p171.3.4", "order": 7, "type": "table_cell", "bbox": { "l": 54, "t": 608.31, "r": 528.96, "b": 589.08 }, "text": "Discarded = 0.00 cfs @ 5.00 hrs, Volume= 0.000 af", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 2 }, "reading_order": 3 }, { "id": "p171.3.5", "order": 8, "type": "table_cell", "bbox": { "l": 54, "t": 589.08, "r": 528.96, "b": 569.85 }, "text": "Primary = 0.64 cfs @ 12.19 hrs, Volume= 0.106 af", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 2 }, "reading_order": 4 }, { "id": "p171.3.6", "order": 9, "type": "table_cell", "bbox": { "l": 68.930268, "t": 599.8820499999999, "r": 237.878603, "b": 587.894871 }, "text": "Routed to Reach 10 : COMPOSITE", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 5 }, { "id": "p171.3.7", "order": 10, "type": "table_cell", "bbox": { "l": 54, "t": 576.122516, "r": 519.953256, "b": 540.375802 }, "text": "Routing by Stor-Ind method, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs\\nStarting Elev= 109.00' Surf.Area= 0.064 ac Storage= 0.052 af\\nPeak Elev= 109.53' @ 12.19 hrs Surf.Area= 0.064 ac Storage= 0.076 af (0.024 af above start)", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 6 }, { "id": "p171.3.8", "order": 11, "type": "table_cell", "bbox": { "l": 54, "t": 528.603447, "r": 411.725999, "b": 516.616268 }, "text": "Plug-Flow detention time= 236.1 min calculated for 0.053 af (49% of inflow)", "attrs": { "row": 7, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 7 } ], "reading_order": 2 }, { "id": "p171.4", "order": 12, "type": "text", "bbox": { "l": 51.6, "t": 529.44, "r": 413.04, "b": 503.04 }, "text": "Plug-Flow detention time= 236.1 min calculated for 0.053 af (49% of inflow) Center-of-Mass det. time= 29.7 min (769.0 - 739.2)", "reading_order": 3 }, { "id": "p171.5", "order": 13, "type": "table", "bbox": { "l": 52.32, "t": 494.4, "r": 556.56, "b": 392.64 }, "text": "", "attrs": { "block_label": "table", "n_rows": 2, "n_cols": 4, "integrity": { "cells_checked": 8, "cells_flagged": 0 } }, "children": [ { "id": "p171.5.1", "order": 14, "type": "table_cell", "bbox": { "l": 54, "t": 492.964145, "r": 90.412668, "b": 467.173607 }, "text": "Volume\n#1A", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p171.5.2", "order": 15, "type": "table_cell", "bbox": { "l": 115.437146, "t": 492.964145, "r": 150.396899, "b": 467.173607 }, "text": "Invert\n107.50'", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p171.5.3", "order": 16, "type": "table_cell", "bbox": { "l": 167.453925, "t": 492.964145, "r": 231.331841, "b": 467.173607 }, "text": "Avail.Storage\n0.048 af", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p171.5.4", "order": 17, "type": "table_cell", "bbox": { "l": 243.466175, "t": 492.964145, "r": 549.157135, "b": 455.292765 }, "text": "Storage Description\n41.95'W x 66.33'L x 3.00'H Field A\\n0.192 af Overall - 0.072 af Embedded = 0.120 af x 40.0% Voids", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p171.5.5", "order": 18, "type": "table_cell", "bbox": { "l": 66.12, "t": 455.400177, "r": 85.228595, "b": 443.412998 }, "text": "#2A", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p171.5.6", "order": 19, "type": "table_cell", "bbox": { "l": 115.437146, "t": 455.400177, "r": 150.335304, "b": 443.412998 }, "text": "107.83'", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p171.5.7", "order": 20, "type": "table_cell", "bbox": { "l": 192.471958, "t": 455.400177, "r": 231.290655, "b": 443.412998 }, "text": "0.057 af", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p171.5.8", "order": 21, "type": "table_cell", "bbox": { "l": 243.479769, "t": 455.400177, "r": 509.915235, "b": 395.893929 }, "text": "ADS N-12 24\" x 36 Inside #1\\nInside= 23.8\"W x 23.8\"H => 3.10 sf x 20.00'L = 62.0 cf\\nOutside= 28.0\"W x 28.0\"H => 3.92 sf x 20.00'L = 78.4 cf\\n36 Chambers in 12 Rows\\n40.28' Header x 3.10 sf x 2 = 249.8 cf Inside", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 } ], "reading_order": 4 }, { "id": "p171.6", "order": 22, "type": "heading", "bbox": { "l": 66.96, "t": 370.56, "r": 295.44, "b": 356.88 }, "text": "Storage Group A created with Chamber Wizard", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 5 }, { "id": "p171.7", "order": 23, "type": "table", "bbox": { "l": 49.2, "t": 347.04, "r": 558.48, "b": 209.76 }, "text": "", "attrs": { "block_label": "table", "n_rows": 4, "n_cols": 4, "integrity": { "cells_checked": 14, "cells_flagged": 2, "flags": [ { "row": 2, "col": 1, "coverage": 0, "text": "Max=0.00 cfs @ 5.00 hrs" }, { "row": 3, "col": 1, "coverage": 0, "text": "Max=0.64 cfs @ 12.19 hrs" } ] } }, "children": [ { "id": "p171.7.1", "order": 24, "type": "table_cell", "bbox": { "l": 54.000153, "t": 346.561717, "r": 86.82526, "b": 320.773607 }, "text": "Device\n#1", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p171.7.2", "order": 25, "type": "table_cell", "bbox": { "l": 98.873664, "t": 346.561717, "r": 147.222394, "b": 320.773607 }, "text": "Routing\nDiscarded", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p171.7.3", "order": 26, "type": "table_cell", "bbox": { "l": 175.965845, "t": 346.561717, "r": 210.937678, "b": 320.773607 }, "text": "Invert\n107.50'", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p171.7.4", "order": 27, "type": "table_cell", "bbox": { "l": 223.014009, "t": 346.561717, "r": 462.419686, "b": 308.892765 }, "text": "Outlet Devices\n1.000 in/hr Exfiltration X 0.00 over Surface area\\nConductivity to Groundwater Elevation = 105.00'", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p171.7.5", "order": 28, "type": "table_cell", "bbox": { "l": 70.44, "t": 309.000177, "r": 82.384214, "b": 297.012998 }, "text": "#2", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p171.7.6", "order": 29, "type": "table_cell", "bbox": { "l": 98.876253, "t": 309.000177, "r": 135.868946, "b": 297.012998 }, "text": "Primary", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p171.7.7", "order": 30, "type": "table_cell", "bbox": { "l": 175.97229, "t": 309.000177, "r": 210.870449, "b": 297.012998 }, "text": "109.00'", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p171.7.8", "order": 31, "type": "table_cell", "bbox": { "l": 223.01982, "t": 309.000177, "r": 445.634412, "b": 285.133231 }, "text": "8.0\" W x 4.0\" H Vert. Orifice/Grate C= 0.600\\nLimited to weir flow at low heads", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p171.7.9", "order": 32, "type": "table_cell", "bbox": { "l": 53.999519, "t": 273.180424, "r": 231.763157, "b": 249.31347700000003 }, "text": "Discarded OutFlow\n1=Exfiltration ( Controls 0.00 cfs)", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 8 }, { "id": "p171.7.10", "order": 33, "type": "table_cell", "bbox": { "l": 303.84, "t": 288.2057, "r": 431.16, "b": 268.5943 }, "text": "Max=0.00 cfs @ 5.00 hrs", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1 }, "reading_order": 9 }, { "id": "p171.7.11", "order": 34, "type": "table_cell", "bbox": { "l": 282.213499, "t": 273.36087599999996, "r": 430.987712, "b": 261.373697 }, "text": "HW=109.00' (Free Discharge)", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p171.7.12", "order": 35, "type": "table_cell", "bbox": { "l": 54, "t": 237.540886, "r": 326.584803, "b": 213.67394000000002 }, "text": "Primary OutFlow\n2=Orifice/Grate (Orifice Controls 0.64 cfs @ 2.89 fps)", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 11 }, { "id": "p171.7.13", "order": 36, "type": "table_cell", "bbox": { "l": 303.84, "t": 248.9829, "r": 431.16, "b": 229.3714 }, "text": "Max=0.64 cfs @ 12.19 hrs", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1 }, "reading_order": 12 }, { "id": "p171.7.14", "order": 37, "type": "table_cell", "bbox": { "l": 276.4524, "t": 237.72133799999995, "r": 425.226613, "b": 225.73415899999998 }, "text": "HW=109.53' (Free Discharge)", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 } ], "reading_order": 6 }, { "id": "p171.8", "order": 38, "type": "footnote", "bbox": { "l": 190.8, "t": 394.08, "r": 357.6, "b": 381.12 }, "text": "0.105 af Total Available Storage", "attrs": { "block_label": "vision_footnote" }, "reading_order": 7 } ] }, { "document_id": 11809, "page": 172, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 6, "counts_by_type": { "figure": 1, "footer": 1, "header": 1, "text": 2, "title": 1 }, "build_ms": 0, "items": [ { "id": "p172.1", "order": 1, "type": "header", "bbox": { "l": 53.28, "t": 738.96, "r": 559.44, "b": 698.16 }, "text": "OCSCD NOAA 24-hr D 10 YEAR Rainfall=5.38\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 35", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p172.2", "order": 2, "type": "title", "bbox": { "l": 126.24, "t": 687.6, "r": 494.4, "b": 672.96 }, "text": "Pond 8P: SSIB #2 UNDERGROUND - Chamber Wizard Field A", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p172.3", "order": 3, "type": "text", "bbox": { "l": 49.68, "t": 661.44, "r": 543.6, "b": 406.32 }, "text": "Chamber Model = ADS N-12 24\" (ADS N-12® Pipe)\nInside= 23.8\"W x 23.8\"H => 3.10 sf x 20.00'L = 62.0 cf\nOutside= 28.0\"W x 28.0\"H => 3.92 sf x 20.00'L = 78.4 cf\n28.0\" Wide + 13.4\" Spacing = 41.4\" C-C Row Spacing\n3 Chambers/Row x 20.00' Long +2.33' Header x 2 = 64.67' Row Length +10.0\" End Stone x 2 = 66.33' Base Length\n12 Rows x 28.0\" Wide + 13.4\" Spacing x 11 + 10.0\" Side Stone x 2 = 41.95' Base Width\n4.0\" Stone Base + 28.0\" Chamber Height + 4.0\" Stone Cover = 3.00' Field Height\n36 Chambers x 62.0 cf + 40.28' Header x 3.10 sf x 2 = 2,481.8 cf Chamber Storage\n36 Chambers x 78.4 cf + 40.28' Header x 3.92 sf x 2 = 3,137.9 cf Displacement\n8,348.3 cf Field - 3,137.9 cf Chambers = 5,210.4 cf Stone x 40.0% Voids = 2,084.2 cf Stone Storage\nChamber Storage + Stone Storage = 4,565.9 cf = 0.105 af\nOverall Storage Efficiency = 54.7%\nOverall System Size = 66.33' x 41.95' x 3.00'", "attrs": { "block_label": "algorithm" }, "reading_order": 2 }, { "id": "p172.4", "order": 4, "type": "text", "bbox": { "l": 52.32, "t": 400.8, "r": 127.92, "b": 360.48 }, "text": "36 Chambers\n309.2 cy Field\n193.0 cy Stone", "reading_order": 3 }, { "id": "p172.5", "order": 5, "type": "figure", "bbox": { "l": 223.68, "t": 346.8, "r": 387.84, "b": 93.6 }, "text": "", "attrs": { "block_label": "image" }, "reading_order": 4 }, { "id": "p172.6", "order": 6, "type": "footer", "bbox": { "l": 223.2, "t": 66.48, "r": 387.12, "b": 53.76 }, "text": "0101010101010101010", "attrs": { "block_label": "footer" }, "reading_order": 5 } ] }, { "document_id": 11809, "page": 173, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 3, "counts_by_type": { "caption": 1, "figure": 1, "header": 1 }, "build_ms": 0, "items": [ { "id": "p173.1", "order": 1, "type": "header", "bbox": { "l": 51.84, "t": 737.76, "r": 561.84, "b": 698.64 }, "text": "OCSCD NOAA 24-hr D 10 YEAR Rainfall=5.38\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 36", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p173.2", "order": 2, "type": "caption", "bbox": { "l": 203.28, "t": 687.84, "r": 413.76, "b": 672.96 }, "text": "Pond 8P: SSIB #2 UNDERGROUND", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p173.3", "order": 3, "type": "figure", "bbox": { "l": 60.48, "t": 674.16, "r": 552.24, "b": 399.6 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nInflow\n1.48 cfs Outflow\nInflow Area=0.460 ac Primary\nDiscarded\nPeak Elev=109.53'\nStorage=0.076 af\n1\n(cfs) 0.64 cfs\nFlow 0.64 cfs\n0.00 cfs\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 2 } ] }, { "document_id": 11809, "page": 174, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 38, "counts_by_type": { "footnote": 1, "header": 1, "heading": 2, "table": 3, "table_cell": 30, "text": 1 }, "build_ms": 7, "items": [ { "id": "p174.1", "order": 1, "type": "header", "bbox": { "l": 52.32, "t": 738.72, "r": 560.4, "b": 698.64 }, "text": "OCSCD NOAA 24-hr D 10 YEAR Rainfall=5.38\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 37", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p174.2", "order": 2, "type": "heading", "bbox": { "l": 163.68, "t": 687.6, "r": 455.76, "b": 672.96 }, "text": "Summary for Pond 9P: SSIB #3 UNDERGROUND", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 1 }, { "id": "p174.3", "order": 3, "type": "table", "bbox": { "l": 54, "t": 666, "r": 528.48, "b": 516.616268 }, "text": "", "attrs": { "block_label": "table", "n_rows": 8, "n_cols": 2, "integrity": { "cells_checked": 8, "cells_flagged": 3, "flags": [ { "row": 2, "col": 0, "coverage": 0.31, "text": "Outflow = 1.59 cfs @ 12.17 hrs, Volume= 0.176 af, Atten= 32…" }, { "row": 3, "col": 0, "coverage": 0.5, "text": "Discarded = 0.00 cfs @ 5.00 hrs, Volume= 0.000 af" }, { "row": 4, "col": 0, "coverage": 0, "text": "Primary = 1.59 cfs @ 12.17 hrs, Volume= 0.176 af" } ] } }, "children": [ { "id": "p174.3.1", "order": 4, "type": "table_cell", "bbox": { "l": 54, "t": 666, "r": 528.48, "b": 647.4 }, "text": "Inflow Area = 0.460 ac,100.00% Impervious, Inflow Depth > 4.66\" for 10 YEAR event", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 2 }, "reading_order": 0 }, { "id": "p174.3.2", "order": 5, "type": "table_cell", "bbox": { "l": 54, "t": 647.4, "r": 528.48, "b": 628.8 }, "text": "Inflow = 2.35 cfs @ 12.10 hrs, Volume= 0.179 af", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 2 }, "reading_order": 1 }, { "id": "p174.3.3", "order": 6, "type": "table_cell", "bbox": { "l": 54, "t": 628.8, "r": 528.48, "b": 610.2 }, "text": "Outflow = 1.59 cfs @ 12.17 hrs, Volume= 0.176 af, Atten= 32%, Lag= 4.5 min", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 2 }, "reading_order": 2 }, { "id": "p174.3.4", "order": 7, "type": "table_cell", "bbox": { "l": 54, "t": 610.2, "r": 528.48, "b": 591.6 }, "text": "Discarded = 0.00 cfs @ 5.00 hrs, Volume= 0.000 af", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 2 }, "reading_order": 3 }, { "id": "p174.3.5", "order": 8, "type": "table_cell", "bbox": { "l": 54, "t": 591.6, "r": 528.48, "b": 573 }, "text": "Primary = 1.59 cfs @ 12.17 hrs, Volume= 0.176 af", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 2 }, "reading_order": 4 }, { "id": "p174.3.6", "order": 9, "type": "table_cell", "bbox": { "l": 68.930268, "t": 599.8820499999999, "r": 237.878603, "b": 587.894871 }, "text": "Routed to Reach 10 : COMPOSITE", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 5 }, { "id": "p174.3.7", "order": 10, "type": "table_cell", "bbox": { "l": 54, "t": 576.122516, "r": 519.953256, "b": 540.375802 }, "text": "Routing by Stor-Ind method, Time Span= 5.00-20.00 hrs, dt= 0.05 hrs\\nStarting Elev= 113.00' Surf.Area= 0.085 ac Storage= 0.111 af\\nPeak Elev= 113.70' @ 12.17 hrs Surf.Area= 0.085 ac Storage= 0.136 af (0.025 af above start)", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 6 }, { "id": "p174.3.8", "order": 11, "type": "table_cell", "bbox": { "l": 54, "t": 528.603447, "r": 411.725999, "b": 516.616268 }, "text": "Plug-Flow detention time= 288.6 min calculated for 0.065 af (36% of inflow)", "attrs": { "row": 7, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 7 } ], "reading_order": 2 }, { "id": "p174.4", "order": 12, "type": "text", "bbox": { "l": 51.6, "t": 529.44, "r": 413.04, "b": 503.04 }, "text": "Plug-Flow detention time= 288.6 min calculated for 0.065 af (36% of inflow) Center-of-Mass det. time= 18.8 min (753.0 - 734.2)", "reading_order": 3 }, { "id": "p174.5", "order": 13, "type": "table", "bbox": { "l": 52.32, "t": 494.4, "r": 556.56, "b": 392.16 }, "text": "", "attrs": { "block_label": "table", "n_rows": 2, "n_cols": 4, "integrity": { "cells_checked": 8, "cells_flagged": 0 } }, "children": [ { "id": "p174.5.1", "order": 14, "type": "table_cell", "bbox": { "l": 54, "t": 492.964145, "r": 90.412668, "b": 467.173607 }, "text": "Volume\n#1A", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p174.5.2", "order": 15, "type": "table_cell", "bbox": { "l": 115.437146, "t": 492.964145, "r": 150.396899, "b": 467.173607 }, "text": "Invert\n110.80'", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p174.5.3", "order": 16, "type": "table_cell", "bbox": { "l": 167.453925, "t": 492.964145, "r": 231.331841, "b": 467.173607 }, "text": "Avail.Storage\n0.063 af", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p174.5.4", "order": 17, "type": "table_cell", "bbox": { "l": 243.466175, "t": 492.964145, "r": 549.157135, "b": 455.292765 }, "text": "Storage Description\n55.75'W x 66.33'L x 3.00'H Field A\\n0.255 af Overall - 0.096 af Embedded = 0.159 af x 40.0% Voids", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p174.5.5", "order": 18, "type": "table_cell", "bbox": { "l": 66.12, "t": 455.400177, "r": 85.228595, "b": 443.412998 }, "text": "#2A", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p174.5.6", "order": 19, "type": "table_cell", "bbox": { "l": 115.437146, "t": 455.400177, "r": 150.335304, "b": 443.412998 }, "text": "111.13'", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p174.5.7", "order": 20, "type": "table_cell", "bbox": { "l": 192.471958, "t": 455.400177, "r": 231.290655, "b": 443.412998 }, "text": "0.076 af", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p174.5.8", "order": 21, "type": "table_cell", "bbox": { "l": 243.479769, "t": 455.400177, "r": 509.915235, "b": 395.893929 }, "text": "ADS N-12 24\" x 48 Inside #1\\nInside = 23.8\"W x 23.8\"H => 3.10 sf x 20.00'L = 62.0 cf\\nOutside = 28.0\"W x 28.0\"H => 3.92 sf x 20.00'L = 78.4 cf\\n48 Chambers in 16 Rows\\n54.08' Header x 3.10 sf x 2 = 335.3 cf Inside", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 } ], "reading_order": 4 }, { "id": "p174.6", "order": 22, "type": "heading", "bbox": { "l": 66.96, "t": 370.56, "r": 295.44, "b": 356.88 }, "text": "Storage Group A created with Chamber Wizard", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 5 }, { "id": "p174.7", "order": 23, "type": "table", "bbox": { "l": 48.96, "t": 347.28, "r": 558.96, "b": 209.04 }, "text": "", "attrs": { "block_label": "table", "n_rows": 4, "n_cols": 4, "integrity": { "cells_checked": 14, "cells_flagged": 2, "flags": [ { "row": 2, "col": 1, "coverage": 0, "text": "Max=0.00 cfs @ 5.00 hrs" }, { "row": 3, "col": 1, "coverage": 0, "text": "Max=1.57 cfs @ 12.17 hrs" } ] } }, "children": [ { "id": "p174.7.1", "order": 24, "type": "table_cell", "bbox": { "l": 54.000153, "t": 346.561717, "r": 86.82526, "b": 320.773607 }, "text": "Device\n#1", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 0 }, { "id": "p174.7.2", "order": 25, "type": "table_cell", "bbox": { "l": 98.873664, "t": 346.561717, "r": 147.222394, "b": 320.773607 }, "text": "Routing\nDiscarded", "attrs": { "row": 0, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 1 }, { "id": "p174.7.3", "order": 26, "type": "table_cell", "bbox": { "l": 175.965845, "t": 346.561717, "r": 210.937678, "b": 320.773607 }, "text": "Invert\n110.80'", "attrs": { "row": 0, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 2 }, { "id": "p174.7.4", "order": 27, "type": "table_cell", "bbox": { "l": 223.014009, "t": 346.561717, "r": 462.419686, "b": 308.892765 }, "text": "Outlet Devices\n1.000 in/hr Exfiltration X 0.00 over Surface area\\nConductivity to Groundwater Elevation = 108.00'", "attrs": { "row": 0, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p174.7.5", "order": 28, "type": "table_cell", "bbox": { "l": 70.44, "t": 309.000177, "r": 82.384214, "b": 297.012998 }, "text": "#2", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p174.7.6", "order": 29, "type": "table_cell", "bbox": { "l": 98.876253, "t": 309.000177, "r": 135.868946, "b": 297.012998 }, "text": "Primary", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p174.7.7", "order": 30, "type": "table_cell", "bbox": { "l": 175.97229, "t": 309.000177, "r": 210.870449, "b": 297.012998 }, "text": "113.00'", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 6 }, { "id": "p174.7.8", "order": 31, "type": "table_cell", "bbox": { "l": 223.01982, "t": 309.000177, "r": 451.453995, "b": 285.133231 }, "text": "12.0\" W x 6.0\" H Vert. Orifice/Grate C= 0.600\\nLimited to weir flow at low heads", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p174.7.9", "order": 32, "type": "table_cell", "bbox": { "l": 53.999519, "t": 273.180424, "r": 231.763157, "b": 249.31347700000003 }, "text": "Discarded OutFlow\n1=Exfiltration ( Controls 0.00 cfs)", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 8 }, { "id": "p174.7.10", "order": 33, "type": "table_cell", "bbox": { "l": 303.96, "t": 288.0343, "r": 431.46, "b": 268.2857 }, "text": "Max=0.00 cfs @ 5.00 hrs", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1 }, "reading_order": 9 }, { "id": "p174.7.11", "order": 34, "type": "table_cell", "bbox": { "l": 282.213499, "t": 273.36087599999996, "r": 430.987712, "b": 261.373697 }, "text": "HW=113.00' (Free Discharge)", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p174.7.12", "order": 35, "type": "table_cell", "bbox": { "l": 54, "t": 237.540886, "r": 326.584803, "b": 213.67394000000002 }, "text": "Primary OutFlow\n2=Orifice/Grate (Orifice Controls 1.57 cfs @ 3.15 fps)", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 11 }, { "id": "p174.7.13", "order": 36, "type": "table_cell", "bbox": { "l": 303.96, "t": 248.5371, "r": 431.46, "b": 228.7886 }, "text": "Max=1.57 cfs @ 12.17 hrs", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1 }, "reading_order": 12 }, { "id": "p174.7.14", "order": 37, "type": "table_cell", "bbox": { "l": 276.4524, "t": 237.72133799999995, "r": 425.226613, "b": 225.73415899999998 }, "text": "HW=113.69' (Free Discharge)", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 } ], "reading_order": 6 }, { "id": "p174.8", "order": 38, "type": "footnote", "bbox": { "l": 190.56, "t": 394.32, "r": 357.6, "b": 381.12 }, "text": "0.139 af Total Available Storage", "attrs": { "block_label": "vision_footnote" }, "reading_order": 7 } ] }, { "document_id": 11809, "page": 175, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 6, "counts_by_type": { "figure": 1, "footer": 1, "header": 1, "text": 2, "title": 1 }, "build_ms": 0, "items": [ { "id": "p175.1", "order": 1, "type": "header", "bbox": { "l": 53.04, "t": 739.2, "r": 559.92, "b": 698.16 }, "text": "OCSCD NOAA 24-hr D 10 YEAR Rainfall=5.38\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 38", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p175.2", "order": 2, "type": "title", "bbox": { "l": 126.48, "t": 687.6, "r": 494.4, "b": 672.72 }, "text": "Pond 9P: SSIB #3 UNDERGROUND - Chamber Wizard Field A", "attrs": { "block_label": "doc_title" }, "level": 2, "reading_order": 1 }, { "id": "p175.3", "order": 3, "type": "text", "bbox": { "l": 49.68, "t": 661.92, "r": 544.56, "b": 406.08 }, "text": "Chamber Model = ADS N-12 24\" (ADS N-12® Pipe)\nInside= 23.8\"W x 23.8\"H => 3.10 sf x 20.00\"L = 62.0 cf\nOutside= 28.0\"W x 28.0\"H => 3.92 sf x 20.00\"L = 78.4 cf\n28.0\" Wide + 13.4\" Spacing = 41.4\" C-C Row Spacing\n3 Chambers/Row x 20.00' Long +2.33' Header x 2 = 64.67' Row Length +10.0\" End Stone x 2 = 66.33' Base Length\n16 Rows x 28.0\" Wide + 13.4\" Spacing x 15 + 10.0\" Side Stone x 2 = 55.75' Base Width\n4.0\" Stone Base + 28.0\" Chamber Height + 4.0\" Stone Cover = 3.00' Field Height\n48 Chambers x 62.0 cf + 54.08' Header x 3.10 sf x 2 = 3,311.3 cf Chamber Storage\n48 Chambers x 78.4 cf + 54.08' Header x 3.92 sf x 2 = 4,186.8 cf Displacement\n11,094.6 cf Field - 4,186.8 cf Chambers = 6,907.8 cf Stone x 40.0% Voids = 2,763.1 cf Stone Storage\nChamber Storage + Stone Storage = 6,074.4 cf = 0.139 af\nOverall Storage Efficiency = 54.8%\nOverall System Size = 66.33' x 55.75' x 3.00'", "attrs": { "block_label": "algorithm" }, "reading_order": 2 }, { "id": "p175.4", "order": 4, "type": "text", "bbox": { "l": 51.84, "t": 400.56, "r": 127.68, "b": 360.48 }, "text": "48 Chambers\n410.9 cy Field\n255.8 cy Stone", "reading_order": 3 }, { "id": "p175.5", "order": 5, "type": "figure", "bbox": { "l": 197.04, "t": 348.72, "r": 414.48, "b": 93.12 }, "text": "", "attrs": { "block_label": "image" }, "reading_order": 4 }, { "id": "p175.6", "order": 6, "type": "footer", "bbox": { "l": 197.04, "t": 66.24, "r": 414.48, "b": 53.76 }, "text": "101010", "attrs": { "block_label": "footer" }, "reading_order": 5 } ] }, { "document_id": 11809, "page": 176, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 3, "counts_by_type": { "caption": 1, "figure": 1, "header": 1 }, "build_ms": 0, "items": [ { "id": "p176.1", "order": 1, "type": "header", "bbox": { "l": 51.36, "t": 738.24, "r": 562.8, "b": 698.64 }, "text": "OCSCD NOAA 24-hr D 10 YEAR Rainfall=5.38\"\nPrepared by Professional Design Services Printed 12/31/2025\nHydroCAD® 10.20-6a s/n 02223 © 2024 HydroCAD Software Solutions LLC Page 39", "attrs": { "block_label": "header" }, "level": 2, "reading_order": 0 }, { "id": "p176.2", "order": 2, "type": "caption", "bbox": { "l": 203.28, "t": 687.84, "r": 414, "b": 672.96 }, "text": "Pond 9P: SSIB #3 UNDERGROUND", "attrs": { "block_label": "figure_title" }, "reading_order": 1 }, { "id": "p176.3", "order": 3, "type": "figure", "bbox": { "l": 60.96, "t": 675.12, "r": 552.48, "b": 399.36 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Hydrograph\nInflow\n2.35 cfs Outflow\nInflow Area=0.460 ac Primary\nDiscarded\nPeak Elev=113.70'\nStorage=0.136 af\n2 1.59 cfs\n1.59 cfs\n(cfs)\nFlow\n1\n0.00 cfs\n0\n5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nTime (hours)" }, "reading_order": 2 } ] }, { "document_id": 11809, "page": 177, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 1, "counts_by_type": { "heading": 1 }, "build_ms": 0, "items": [ { "id": "p177.1", "order": 1, "type": "heading", "bbox": { "l": 206.88, "t": 654.24, "r": 404.16, "b": 606 }, "text": "APPENDIX E\nGROUNDWATER MOUNDING", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 0 } ] }, { "document_id": 11809, "page": 178, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 44, "counts_by_type": { "figure": 1, "heading": 2, "table": 2, "table_cell": 38, "text": 1 }, "build_ms": 9, "items": [ { "id": "p178.1", "order": 1, "type": "heading", "bbox": { "l": 200.64, "t": 770.88, "r": 301.44, "b": 742.8 }, "text": "SSIB #1\nSURFACE BASIN", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 0 }, { "id": "p178.2", "order": 2, "type": "table", "bbox": { "l": 50.16, "t": 738.48, "r": 174.48, "b": 464.16 }, "text": "", "attrs": { "block_label": "table", "n_rows": 10, "n_cols": 3, "integrity": { "cells_checked": 19, "cells_flagged": 3, "flags": [ { "row": 4, "col": 1, "coverage": 0, "text": "$ h(0) $" }, { "row": 6, "col": 1, "coverage": 0.5, "text": "Δ h(max)" }, { "row": 8, "col": 1, "coverage": 0, "text": "direction, in feet" } ] } }, "children": [ { "id": "p178.2.1", "order": 3, "type": "table_cell", "bbox": { "l": 52.320002, "t": 737.155437, "r": 89.365547, "b": 728.241955 }, "text": "Input Values", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 0 }, { "id": "p178.2.2", "order": 4, "type": "table_cell", "bbox": { "l": 92.280001, "t": 727.279584, "r": 106.618362, "b": 717.489358 }, "text": "1.00", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 1 }, { "id": "p178.2.3", "order": 5, "type": "table_cell", "bbox": { "l": 137.759995, "t": 726.790072, "r": 143.104495, "b": 717.906646 }, "text": "R", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 2 }, { "id": "p178.2.4", "order": 6, "type": "table_cell", "bbox": { "l": 88.199999, "t": 706.279584, "r": 106.605604, "b": 696.489358 }, "text": "0.150", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 3 }, { "id": "p178.2.5", "order": 7, "type": "table_cell", "bbox": { "l": 137.399998, "t": 706.279584, "r": 145.047608, "b": 696.489358 }, "text": "Sy", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p178.2.6", "order": 8, "type": "table_cell", "bbox": { "l": 85.560002, "t": 685.639586, "r": 108.045603, "b": 644.169357 }, "text": "20.00\n35.000\n15.000\n24.00", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p178.2.7", "order": 9, "type": "table_cell", "bbox": { "l": 136.806396, "t": 685.639586, "r": 145.496225, "b": 644.169357 }, "text": "Kh\nx\ny\nt", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p178.2.8", "order": 10, "type": "table_cell", "bbox": { "l": 89.639998, "t": 643.399581, "r": 108.045603, "b": 633.609355 }, "text": "10.00", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 7 }, { "id": "p178.2.9", "order": 11, "type": "table_cell", "bbox": { "l": 133.04, "t": 651.1964, "r": 174.48, "b": 638.7273 }, "text": "$ h(0) $", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1 }, "reading_order": 8 }, { "id": "p178.2.10", "order": 12, "type": "table_cell", "bbox": { "l": 87.719999, "t": 622.435437, "r": 108.180338, "b": 613.521956 }, "text": "12.337", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 9 }, { "id": "p178.2.11", "order": 13, "type": "table_cell", "bbox": { "l": 129.359997, "t": 623.119585, "r": 152.810552, "b": 613.32936 }, "text": "$ h(max) $", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p178.2.12", "order": 14, "type": "table_cell", "bbox": { "l": 91.439999, "t": 611.875437, "r": 108.145528, "b": 602.961955 }, "text": "2.337", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 11 }, { "id": "p178.2.13", "order": 15, "type": "table_cell", "bbox": { "l": 133.04, "t": 626.2582, "r": 174.48, "b": 613.7891 }, "text": "Δ h(max)", "attrs": { "row": 6, "col": 1, "rowspan": 1, "colspan": 1 }, "reading_order": 12 }, { "id": "p178.2.14", "order": 16, "type": "table_cell", "bbox": { "l": 52.320002, "t": 591.955438, "r": 95.550901, "b": 583.041956 }, "text": "Ground-water", "attrs": { "row": 7, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 13 }, { "id": "p178.2.15", "order": 17, "type": "table_cell", "bbox": { "l": 111.120003, "t": 601.675431, "r": 168.875523, "b": 583.041956 }, "text": "Distance from center of basin in x", "attrs": { "row": 7, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p178.2.16", "order": 18, "type": "table_cell", "bbox": { "l": 52.320002, "t": 582.235445, "r": 106.993446, "b": 573.321963 }, "text": "Mounding, in feet", "attrs": { "row": 8, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 15 }, { "id": "p178.2.17", "order": 19, "type": "table_cell", "bbox": { "l": 133.04, "t": 601.32, "r": 174.48, "b": 588.8509 }, "text": "direction, in feet", "attrs": { "row": 8, "col": 1, "rowspan": 1, "colspan": 1 }, "reading_order": 16 }, { "id": "p178.2.18", "order": 20, "type": "table_cell", "bbox": { "l": 91.800002, "t": 570.59543, "r": 108.505531, "b": 466.641947 }, "text": "2.337\n2.289\n2.133\n1.840\n1.397\n1.044\n0.786\n0.592\n0.445\n0.332", "attrs": { "row": 9, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 17 }, { "id": "p178.2.19", "order": 21, "type": "table_cell", "bbox": { "l": 137.160004, "t": 571.039595, "r": 145.287784, "b": 466.209369 }, "text": "0\n10\n20\n30\n40\n50\n60\n70\n80\n90", "attrs": { "row": 9, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 18 } ], "reading_order": 1 }, { "id": "p178.3", "order": 22, "type": "table", "bbox": { "l": 49.68, "t": 737.155437, "r": 501.36, "b": 587.04 }, "text": "", "attrs": { "block_label": "table", "n_rows": 7, "n_cols": 3, "integrity": { "cells_checked": 19, "cells_flagged": 2, "flags": [ { "row": 3, "col": 2, "coverage": 0, "text": "Kh = 5xRecharge Rate (R) in the costal plan; Kh=R outside t…" }, { "row": 6, "col": 1, "coverage": 0, "text": "Δ h(max)" } ] } }, "children": [ { "id": "p178.3.1", "order": 23, "type": "table_cell", "bbox": { "l": 52.320002, "t": 737.155437, "r": 89.365547, "b": 728.241955 }, "text": "Input Values", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 3, "bbox_refit": true }, "reading_order": 0 }, { "id": "p178.3.2", "order": 24, "type": "table_cell", "bbox": { "l": 92.280001, "t": 727.279584, "r": 106.618362, "b": 717.489358 }, "text": "1.00", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 1 }, { "id": "p178.3.3", "order": 25, "type": "table_cell", "bbox": { "l": 137.759995, "t": 726.790072, "r": 143.104495, "b": 717.906646 }, "text": "R", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 2 }, { "id": "p178.3.4", "order": 26, "type": "table_cell", "bbox": { "l": 194.040001, "t": 727.279584, "r": 328.979758, "b": 706.929362 }, "text": "Recharge rate (permeability rate) (in/hr)\nSpecific yield, Sy (dimensionless)", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 3 }, { "id": "p178.3.5", "order": 27, "type": "table_cell", "bbox": { "l": 88.199999, "t": 706.279584, "r": 106.605604, "b": 696.489358 }, "text": "0.150", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p178.3.6", "order": 28, "type": "table_cell", "bbox": { "l": 137.399998, "t": 706.279584, "r": 145.047608, "b": 696.489358 }, "text": "Sy", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p178.3.7", "order": 29, "type": "table_cell", "bbox": { "l": 194.040001, "t": 706.279584, "r": 457.391989, "b": 686.289359 }, "text": "default value is 0.15; max value is 0.2 provided that a lab test data is submitted\nHorizontal hydraulic conductivity (in/hr)", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p178.3.8", "order": 30, "type": "table_cell", "bbox": { "l": 89.639998, "t": 685.639586, "r": 108.045603, "b": 675.84936 }, "text": "20.00", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 7 }, { "id": "p178.3.9", "order": 31, "type": "table_cell", "bbox": { "l": 194.040001, "t": 685.639586, "r": 202.729829, "b": 675.84936 }, "text": "Kh", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p178.3.10", "order": 32, "type": "table_cell", "bbox": { "l": 350.8, "t": 676.8369, "r": 501.36, "b": 665.6123 }, "text": "Kh = 5xRecharge Rate (R) in the costal plan; Kh=R outside the coastal plan", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 9 }, { "id": "p178.3.11", "order": 33, "type": "table_cell", "bbox": { "l": 85.560002, "t": 675.079584, "r": 108.045603, "b": 633.609355 }, "text": "35.000\n15.000\n24.00\n10.00", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 10 }, { "id": "p178.3.12", "order": 34, "type": "table_cell", "bbox": { "l": 133.516239, "t": 675.079584, "r": 148.824469, "b": 633.609355 }, "text": "x\ny\nt\nhi(0)", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 11 }, { "id": "p178.3.13", "order": 35, "type": "table_cell", "bbox": { "l": 193.995927, "t": 675.079584, "r": 326.448161, "b": 633.609355 }, "text": "1/2 length of basin (x direction, in feet)\n1/2 width of basin (y direction, in feet)\nDuration of infiltration period (hours)\nInitial thickness of saturated zone (feet)", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 12 }, { "id": "p178.3.14", "order": 36, "type": "table_cell", "bbox": { "l": 87.719999, "t": 622.435437, "r": 108.180338, "b": 613.521956 }, "text": "12.337", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p178.3.15", "order": 37, "type": "table_cell", "bbox": { "l": 129.359997, "t": 623.119585, "r": 152.810552, "b": 613.32936 }, "text": "h(max)", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 14 }, { "id": "p178.3.16", "order": 38, "type": "table_cell", "bbox": { "l": 194.049871, "t": 623.119585, "r": 499.63114, "b": 613.32936 }, "text": "Maximum thickness of saturated zone (beneath center of basin at end of infiltration period)", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p178.3.17", "order": 39, "type": "table_cell", "bbox": { "l": 91.439999, "t": 611.875437, "r": 153.657048, "b": 592.7619500000001 }, "text": "2.337\nDistance from", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 16 }, { "id": "p178.3.18", "order": 40, "type": "table_cell", "bbox": { "l": 200.24, "t": 609.4892, "r": 350.8, "b": 598.2646 }, "text": "Δ h(max)", "attrs": { "row": 6, "col": 1, "rowspan": 1, "colspan": 1 }, "reading_order": 17 }, { "id": "p178.3.19", "order": 41, "type": "table_cell", "bbox": { "l": 193.985623, "t": 612.559584, "r": 487.365315, "b": 602.769359 }, "text": "Maximum groundwater mounding (beneath center of basin at end of infiltration period)", "attrs": { "row": 6, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 18 } ], "reading_order": 2 }, { "id": "p178.4", "order": 42, "type": "figure", "bbox": { "l": 50.4, "t": 580.56, "r": 549.36, "b": 386.4 }, "text": "", "attrs": { "kind": "chart", "block_label": "chart", "embedded_text": "Mounding, in feet direction, in feet\n2.337 0\n2.289 10 Re-Calculate Now\n2.133 20\n1.840 30 Groundwater Mounding, in feet\n1.397 40 2.500\n1.044 50\n0.786 60\n2.000\n0.592 70\n0.445 80\n0.332 1.500\n90\n1.000\n0.500\n0.000\n0 10 20 30 40 50 60 70 80 90 100" }, "reading_order": 3 }, { "id": "p178.5", "order": 43, "type": "heading", "bbox": { "l": 58.32, "t": 384, "r": 115.68, "b": 372.48 }, "text": "Disclaimer", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 4 }, { "id": "p178.6", "order": 44, "type": "text", "bbox": { "l": 49.68, "t": 362.4, "r": 556.56, "b": 266.88 }, "text": "This spreadsheet solving the Hantush (1967) equation for ground-water mounding beneath an infiltration basin is made available to the general public as a convenience for those wishing to replicate values documented in the USGS Scientific Investigations Report 2010-5102 \"Groundwater mounding beneath hypothetical stormwater infiltration basins\" or to calculate values based on user-specified site conditions. Any changes made to the spreadsheet (other than values identified as user-specified) after transmission from the USGS could have unintended, undesirable consequences. These consequences could include, but may not be limited to: erroneous output, numerical instabilities, and violations of underlying assumptions that are inherent in results presented in the accompanying USGS published report. The USGS assumes no responsibility for the consequences of any changes made to the spreadsheet. If changes are made to the spreadsheet, the user is responsible for documenting the changes and justifying the results and conclusions.", "reading_order": 5 } ] }, { "document_id": 11809, "page": 179, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 41, "counts_by_type": { "header": 1, "heading": 1, "table": 1, "table_cell": 37, "text": 1 }, "build_ms": 7, "items": [ { "id": "p179.1", "order": 1, "type": "header", "bbox": { "l": 205.2, "t": 769.68, "r": 304.8, "b": 740.64 }, "text": "SSIB #3\nUNDERGROUND", "attrs": { "block_label": "figure_title" }, "level": 2, "reading_order": 0 }, { "id": "p179.2", "order": 2, "type": "table", "bbox": { "l": 49.2, "t": 755.04, "r": 547.68, "b": 387.84 }, "text": "", "attrs": { "block_label": "table", "n_rows": 20, "n_cols": 2, "integrity": { "cells_checked": 37, "cells_flagged": 3, "flags": [ { "row": 5, "col": 1, "coverage": 0, "text": "$ \\Delta h(\\text{{max}}) $" }, { "row": 8, "col": 1, "coverage": 0, "text": "direction, in feet" }, { "row": 10, "col": 1, "coverage": 0, "text": "0" } ] } }, "children": [ { "id": "p179.2.1", "order": 3, "type": "table_cell", "bbox": { "l": 52.320002, "t": 737.155437, "r": 89.365547, "b": 728.241955 }, "text": "Input Values", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 0 }, { "id": "p179.2.2", "order": 4, "type": "table_cell", "bbox": { "l": 92.280001, "t": 727.279584, "r": 106.618362, "b": 717.489358 }, "text": "1.00", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 1 }, { "id": "p179.2.3", "order": 5, "type": "table_cell", "bbox": { "l": 137.759995, "t": 726.790072, "r": 143.104495, "b": 717.906646 }, "text": "R", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 2 }, { "id": "p179.2.4", "order": 6, "type": "table_cell", "bbox": { "l": 88.199999, "t": 706.279584, "r": 106.605604, "b": 696.489358 }, "text": "0.150", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 3 }, { "id": "p179.2.5", "order": 7, "type": "table_cell", "bbox": { "l": 137.399998, "t": 706.279584, "r": 145.047608, "b": 696.489358 }, "text": "Sy", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 4 }, { "id": "p179.2.6", "order": 8, "type": "table_cell", "bbox": { "l": 85.560002, "t": 685.639586, "r": 108.045603, "b": 633.609355 }, "text": "20.00\n33.000\n28.000\n12.00\n10.00", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 5 }, { "id": "p179.2.7", "order": 9, "type": "table_cell", "bbox": { "l": 133.516239, "t": 685.639586, "r": 202.729829, "b": 633.609355 }, "text": "Kh\nx\ny\nt\nhi(0)", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 6 }, { "id": "p179.2.8", "order": 10, "type": "table_cell", "bbox": { "l": 129.359997, "t": 623.119585, "r": 152.810552, "b": 613.32936 }, "text": "h(max)", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true }, "reading_order": 7 }, { "id": "p179.2.9", "order": 11, "type": "table_cell", "bbox": { "l": 91.439999, "t": 611.875437, "r": 108.145528, "b": 602.961955 }, "text": "2.756", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 8 }, { "id": "p179.2.10", "order": 12, "type": "table_cell", "bbox": { "l": 298.44, "t": 622.848, "r": 547.68, "b": 608.16 }, "text": "$ \\Delta h(\\text{{max}}) $", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1 }, "reading_order": 9 }, { "id": "p179.2.11", "order": 13, "type": "table_cell", "bbox": { "l": 193.985623, "t": 623.119585, "r": 499.63114, "b": 602.769359 }, "text": "Maximum thickness of saturated zone (beneath center of basin at end of infiltration period)\nMaximum groundwater mounding (beneath center of basin at end of infiltration period)", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 2, "bbox_refit": true, "merged_continuation": true }, "reading_order": 10 }, { "id": "p179.2.12", "order": 14, "type": "table_cell", "bbox": { "l": 52.320002, "t": 591.955438, "r": 95.550901, "b": 583.041956 }, "text": "Ground-water", "attrs": { "row": 7, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 }, { "id": "p179.2.13", "order": 15, "type": "table_cell", "bbox": { "l": 111.120003, "t": 591.955438, "r": 168.875523, "b": 583.041956 }, "text": "center of basin in x", "attrs": { "row": 7, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 12 }, { "id": "p179.2.14", "order": 16, "type": "table_cell", "bbox": { "l": 52.320002, "t": 582.235445, "r": 106.993446, "b": 573.321963 }, "text": "Mounding, in feet", "attrs": { "row": 8, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p179.2.15", "order": 17, "type": "table_cell", "bbox": { "l": 298.44, "t": 564.096, "r": 547.68, "b": 549.408 }, "text": "direction, in feet", "attrs": { "row": 8, "col": 1, "rowspan": 1, "colspan": 1 }, "reading_order": 14 }, { "id": "p179.2.16", "order": 18, "type": "table_cell", "bbox": { "l": 139.200005, "t": 571.039595, "r": 143.260541, "b": 561.249369 }, "text": "0", "attrs": { "row": 9, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 15 }, { "id": "p179.2.17", "order": 19, "type": "table_cell", "bbox": { "l": 258.717861, "t": 397.558224, "r": 262.09446, "b": 389.417016 }, "text": "0", "attrs": { "row": 9, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 16 }, { "id": "p179.2.18", "order": 20, "type": "table_cell", "bbox": { "l": 91.800002, "t": 570.59543, "r": 108.505531, "b": 561.681948 }, "text": "2.756", "attrs": { "row": 10, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 17 }, { "id": "p179.2.19", "order": 21, "type": "table_cell", "bbox": { "l": 298.44, "t": 534.72, "r": 547.68, "b": 520.032 }, "text": "0", "attrs": { "row": 10, "col": 1, "rowspan": 1, "colspan": 1 }, "reading_order": 18 }, { "id": "p179.2.20", "order": 22, "type": "table_cell", "bbox": { "l": 91.800002, "t": 560.03544, "r": 108.505531, "b": 551.121958 }, "text": "2.681", "attrs": { "row": 11, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 19 }, { "id": "p179.2.21", "order": 23, "type": "table_cell", "bbox": { "l": 284.609571, "t": 397.558224, "r": 291.389462, "b": 389.417016 }, "text": "10", "attrs": { "row": 11, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 20 }, { "id": "p179.2.22", "order": 24, "type": "table_cell", "bbox": { "l": 91.800002, "t": 549.475427, "r": 108.505531, "b": 540.561945 }, "text": "2.446", "attrs": { "row": 12, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 21 }, { "id": "p179.2.23", "order": 25, "type": "table_cell", "bbox": { "l": 312.10283, "t": 397.558224, "r": 318.949452, "b": 389.417016 }, "text": "20", "attrs": { "row": 12, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 22 }, { "id": "p179.2.24", "order": 26, "type": "table_cell", "bbox": { "l": 91.800002, "t": 538.915437, "r": 108.505531, "b": 530.0019560000001 }, "text": "2.018", "attrs": { "row": 13, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 23 }, { "id": "p179.2.25", "order": 27, "type": "table_cell", "bbox": { "l": 339.729552, "t": 397.558224, "r": 346.442711, "b": 389.417016 }, "text": "30", "attrs": { "row": 13, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 24 }, { "id": "p179.2.26", "order": 28, "type": "table_cell", "bbox": { "l": 91.800002, "t": 528.355447, "r": 108.505531, "b": 519.441965 }, "text": "1.451", "attrs": { "row": 14, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 25 }, { "id": "p179.2.27", "order": 29, "type": "table_cell", "bbox": { "l": 367.289542, "t": 397.558224, "r": 374.069433, "b": 389.417016 }, "text": "40", "attrs": { "row": 14, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 26 }, { "id": "p179.2.28", "order": 30, "type": "table_cell", "bbox": { "l": 91.800002, "t": 517.795434, "r": 108.505531, "b": 508.881953 }, "text": "1.011", "attrs": { "row": 15, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 27 }, { "id": "p179.2.29", "order": 31, "type": "table_cell", "bbox": { "l": 394.916263, "t": 397.558224, "r": 401.629423, "b": 389.417016 }, "text": "50", "attrs": { "row": 15, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 28 }, { "id": "p179.2.30", "order": 32, "type": "table_cell", "bbox": { "l": 91.800002, "t": 507.235445, "r": 108.505531, "b": 498.321963 }, "text": "0.690", "attrs": { "row": 16, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 29 }, { "id": "p179.2.31", "order": 33, "type": "table_cell", "bbox": { "l": 422.542985, "t": 397.558224, "r": 429.256145, "b": 389.417016 }, "text": "60", "attrs": { "row": 16, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 30 }, { "id": "p179.2.32", "order": 34, "type": "table_cell", "bbox": { "l": 91.800002, "t": 496.675431, "r": 108.505531, "b": 487.76195 }, "text": "0.461", "attrs": { "row": 17, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 31 }, { "id": "p179.2.33", "order": 35, "type": "table_cell", "bbox": { "l": 450.102975, "t": 397.558224, "r": 456.882866, "b": 389.417016 }, "text": "70", "attrs": { "row": 17, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 32 }, { "id": "p179.2.34", "order": 36, "type": "table_cell", "bbox": { "l": 91.800002, "t": 486.115442, "r": 108.505531, "b": 477.20196 }, "text": "0.302", "attrs": { "row": 18, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 33 }, { "id": "p179.2.35", "order": 37, "type": "table_cell", "bbox": { "l": 477.729697, "t": 397.558224, "r": 484.442857, "b": 389.417016 }, "text": "80", "attrs": { "row": 18, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 34 }, { "id": "p179.2.36", "order": 38, "type": "table_cell", "bbox": { "l": 91.800002, "t": 475.555429, "r": 108.505531, "b": 466.641947 }, "text": "0.194", "attrs": { "row": 19, "col": 0, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 35 }, { "id": "p179.2.37", "order": 39, "type": "table_cell", "bbox": { "l": 505.289687, "t": 397.558224, "r": 512.069578, "b": 389.417016 }, "text": "90", "attrs": { "row": 19, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 36 } ], "reading_order": 1 }, { "id": "p179.3", "order": 40, "type": "heading", "bbox": { "l": 58.32, "t": 384, "r": 115.68, "b": 372.48 }, "text": "Disclaimer", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 2 }, { "id": "p179.4", "order": 41, "type": "text", "bbox": { "l": 49.68, "t": 362.4, "r": 556.56, "b": 266.88 }, "text": "This spreadsheet solving the Hantush (1967) equation for ground-water mounding beneath an infiltration basin is made available to the general public as a convenience for those wishing to replicate values documented in the USGS Scientific Investigations Report 2010-5102 \"Groundwater Mounding Beneath Hypothetical Stormwater Infiltration Basins\" or to calculate values based on user-specified site conditions. Any changes made to the spreadsheet (other than values identified as user-specified) after transmission from the USGS could have unintended, undesirable consequences. These consequences could include, but may not be limited to: erroneous output, numerical instabilities, and violations of underlying assumptions that are inherent in results presented in the accompanying USGS published report. The USGS assumes no responsibility for the consequences of any changes made to the spreadsheet. If changes are made to the spreadsheet, the user is responsible for documenting the changes and justifying the results and conclusions.", "reading_order": 3 } ] }, { "document_id": 11809, "page": 180, "width": 612, "height": 792, "rotation": 0, "pipeline_version": "paddleocr-vl-1.6+paul-48", "width_pt": 612, "height_pt": 792, "engine": "paddleocr_vl", "source_run_id": 11920, "item_count": 157, "counts_by_type": { "figure": 1, "heading": 1, "table": 1, "table_cell": 153, "text": 1 }, "build_ms": 10, "items": [ { "id": "p180.1", "order": 1, "type": "figure", "bbox": { "l": 204.24, "t": 780.48, "r": 355.2, "b": 743.04 }, "text": "", "attrs": { "role": "page_header", "block_label": "header_image", "embedded_text": "SSIB #2\nUNDERGROUND" }, "reading_order": 0 }, { "id": "p180.2", "order": 2, "type": "table", "bbox": { "l": 49.44, "t": 739.2, "r": 549.12, "b": 386.88 }, "text": "", "attrs": { "block_label": "table", "n_rows": 20, "n_cols": 8, "integrity": { "cells_checked": 58, "cells_flagged": 12, "flags": [ { "row": 4, "col": 4, "coverage": 0, "text": "Kh = 5xRecharge Rate (R) in the costal plan; Kh=R outside t…" }, { "row": 7, "col": 2, "coverage": 0, "text": "Δ h(max)" }, { "row": 9, "col": 2, "coverage": 0, "text": "direction, in feet" }, { "row": 11, "col": 4, "coverage": 0, "text": "Groundwater Mounding, in feet" }, { "row": 12, "col": 4, "coverage": 0, "text": "Groundwater Mounding, in feet" }, { "row": 13, "col": 4, "coverage": 0, "text": "Groundwater Mounding, in feet" }, { "row": 14, "col": 4, "coverage": 0, "text": "Groundwater Mounding, in feet" }, { "row": 15, "col": 4, "coverage": 0, "text": "Groundwater Mounding, in feet" }, { "row": 16, "col": 4, "coverage": 0, "text": "Groundwater Mounding, in feet" }, { "row": 17, "col": 4, "coverage": 0, "text": "Groundwater Mounding, in feet" }, { "row": 18, "col": 4, "coverage": 0, "text": "Groundwater Mounding, in feet" }, { "row": 19, "col": 4, "coverage": 0, "text": "Groundwater Mounding, in feet" } ] } }, "children": [ { "id": "p180.2.1", "order": 3, "type": "table_cell", "bbox": { "l": 52.320002, "t": 737.155437, "r": 89.365547, "b": 728.241955 }, "text": "Input Values", "attrs": { "row": 0, "col": 0, "rowspan": 1, "colspan": 8, "bbox_refit": true }, "reading_order": 0 }, { "id": "p180.2.2", "order": 4, "type": "table_cell", "bbox": { "l": 49.44, "t": 723.1855, "r": 111.9, "b": 707.1709 }, "text": "", "attrs": { "row": 1, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 1 }, { "id": "p180.2.3", "order": 5, "type": "table_cell", "bbox": { "l": 92.280001, "t": 727.279584, "r": 106.618362, "b": 717.489358 }, "text": "1.00", "attrs": { "row": 1, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 2 }, { "id": "p180.2.4", "order": 6, "type": "table_cell", "bbox": { "l": 137.759995, "t": 726.790072, "r": 143.104495, "b": 717.906646 }, "text": "R", "attrs": { "row": 1, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 3 }, { "id": "p180.2.5", "order": 7, "type": "table_cell", "bbox": { "l": 236.82, "t": 723.1855, "r": 299.28, "b": 707.1709 }, "text": "", "attrs": { "row": 1, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 4 }, { "id": "p180.2.6", "order": 8, "type": "table_cell", "bbox": { "l": 194.040001, "t": 727.279584, "r": 328.979758, "b": 717.489358 }, "text": "Recharge rate (permeability rate) (in/hr)", "attrs": { "row": 1, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 5 }, { "id": "p180.2.7", "order": 9, "type": "table_cell", "bbox": { "l": 361.74, "t": 723.1855, "r": 424.2, "b": 707.1709 }, "text": "", "attrs": { "row": 1, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 6 }, { "id": "p180.2.8", "order": 10, "type": "table_cell", "bbox": { "l": 424.2, "t": 723.1855, "r": 486.66, "b": 707.1709 }, "text": "", "attrs": { "row": 1, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 7 }, { "id": "p180.2.9", "order": 11, "type": "table_cell", "bbox": { "l": 486.66, "t": 723.1855, "r": 549.12, "b": 707.1709 }, "text": "", "attrs": { "row": 1, "col": 7, "rowspan": 1, "colspan": 1 }, "reading_order": 8 }, { "id": "p180.2.10", "order": 12, "type": "table_cell", "bbox": { "l": 49.44, "t": 707.1709, "r": 111.9, "b": 691.1564 }, "text": "", "attrs": { "row": 2, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 9 }, { "id": "p180.2.11", "order": 13, "type": "table_cell", "bbox": { "l": 88.199999, "t": 706.279584, "r": 106.605604, "b": 696.489358 }, "text": "0.150", "attrs": { "row": 2, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 10 }, { "id": "p180.2.12", "order": 14, "type": "table_cell", "bbox": { "l": 137.399998, "t": 706.279584, "r": 145.047608, "b": 696.489358 }, "text": "Sy", "attrs": { "row": 2, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 11 }, { "id": "p180.2.13", "order": 15, "type": "table_cell", "bbox": { "l": 236.82, "t": 707.1709, "r": 299.28, "b": 691.1564 }, "text": "", "attrs": { "row": 2, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 12 }, { "id": "p180.2.14", "order": 16, "type": "table_cell", "bbox": { "l": 194.040001, "t": 716.719587, "r": 302.904255, "b": 706.929362 }, "text": "Specific yield, Sy (dimensionless)", "attrs": { "row": 2, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 13 }, { "id": "p180.2.15", "order": 17, "type": "table_cell", "bbox": { "l": 361.74, "t": 707.1709, "r": 424.2, "b": 691.1564 }, "text": "", "attrs": { "row": 2, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 14 }, { "id": "p180.2.16", "order": 18, "type": "table_cell", "bbox": { "l": 424.2, "t": 707.1709, "r": 486.66, "b": 691.1564 }, "text": "", "attrs": { "row": 2, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 15 }, { "id": "p180.2.17", "order": 19, "type": "table_cell", "bbox": { "l": 486.66, "t": 707.1709, "r": 549.12, "b": 691.1564 }, "text": "", "attrs": { "row": 2, "col": 7, "rowspan": 1, "colspan": 1 }, "reading_order": 16 }, { "id": "p180.2.18", "order": 20, "type": "table_cell", "bbox": { "l": 49.44, "t": 691.1564, "r": 111.9, "b": 675.1418 }, "text": "", "attrs": { "row": 3, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 17 }, { "id": "p180.2.19", "order": 21, "type": "table_cell", "bbox": { "l": 85.560002, "t": 685.639586, "r": 108.045603, "b": 665.289359 }, "text": "20.00\n33.000", "attrs": { "row": 3, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 18 }, { "id": "p180.2.20", "order": 22, "type": "table_cell", "bbox": { "l": 139.281325, "t": 685.639586, "r": 202.729829, "b": 665.289359 }, "text": "Kh\nx", "attrs": { "row": 3, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 19 }, { "id": "p180.2.21", "order": 23, "type": "table_cell", "bbox": { "l": 236.82, "t": 691.1564, "r": 299.28, "b": 675.1418 }, "text": "", "attrs": { "row": 3, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 20 }, { "id": "p180.2.22", "order": 24, "type": "table_cell", "bbox": { "l": 194.040001, "t": 706.279584, "r": 457.391989, "b": 686.289359 }, "text": "default value is 0.15; max value is 0.2 provided that a lab test data is submitted\nHorizontal hydraulic conductivity (in/hr)", "attrs": { "row": 3, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 21 }, { "id": "p180.2.23", "order": 25, "type": "table_cell", "bbox": { "l": 361.74, "t": 691.1564, "r": 424.2, "b": 675.1418 }, "text": "", "attrs": { "row": 3, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 22 }, { "id": "p180.2.24", "order": 26, "type": "table_cell", "bbox": { "l": 424.2, "t": 691.1564, "r": 486.66, "b": 675.1418 }, "text": "", "attrs": { "row": 3, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 23 }, { "id": "p180.2.25", "order": 27, "type": "table_cell", "bbox": { "l": 486.66, "t": 691.1564, "r": 549.12, "b": 675.1418 }, "text": "", "attrs": { "row": 3, "col": 7, "rowspan": 1, "colspan": 1 }, "reading_order": 24 }, { "id": "p180.2.26", "order": 28, "type": "table_cell", "bbox": { "l": 49.44, "t": 659.1273, "r": 111.9, "b": 643.1127 }, "text": "", "attrs": { "row": 4, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 25 }, { "id": "p180.2.27", "order": 29, "type": "table_cell", "bbox": { "l": 85.560002, "t": 664.519583, "r": 108.032851, "b": 654.7293569999999 }, "text": "21.000", "attrs": { "row": 4, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 26 }, { "id": "p180.2.28", "order": 30, "type": "table_cell", "bbox": { "l": 139.281325, "t": 664.519583, "r": 143.077043, "b": 654.7293569999999 }, "text": "y", "attrs": { "row": 4, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 27 }, { "id": "p180.2.29", "order": 31, "type": "table_cell", "bbox": { "l": 236.82, "t": 659.1273, "r": 299.28, "b": 643.1127 }, "text": "", "attrs": { "row": 4, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 28 }, { "id": "p180.2.30", "order": 32, "type": "table_cell", "bbox": { "l": 299.28, "t": 659.1273, "r": 361.74, "b": 643.1127 }, "text": "Kh = 5xRecharge Rate (R) in the costal plan; Kh=R outside the coastal plan", "attrs": { "row": 4, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 29 }, { "id": "p180.2.31", "order": 33, "type": "table_cell", "bbox": { "l": 361.74, "t": 659.1273, "r": 424.2, "b": 643.1127 }, "text": "", "attrs": { "row": 4, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 30 }, { "id": "p180.2.32", "order": 34, "type": "table_cell", "bbox": { "l": 424.2, "t": 659.1273, "r": 486.66, "b": 643.1127 }, "text": "", "attrs": { "row": 4, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 31 }, { "id": "p180.2.33", "order": 35, "type": "table_cell", "bbox": { "l": 486.66, "t": 659.1273, "r": 549.12, "b": 643.1127 }, "text": "", "attrs": { "row": 4, "col": 7, "rowspan": 1, "colspan": 1 }, "reading_order": 32 }, { "id": "p180.2.34", "order": 36, "type": "table_cell", "bbox": { "l": 49.44, "t": 643.1127, "r": 111.9, "b": 627.0982 }, "text": "", "attrs": { "row": 5, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 33 }, { "id": "p180.2.35", "order": 37, "type": "table_cell", "bbox": { "l": 89.639998, "t": 653.959582, "r": 108.045603, "b": 633.609355 }, "text": "20.00\n10.00", "attrs": { "row": 5, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 34 }, { "id": "p180.2.36", "order": 38, "type": "table_cell", "bbox": { "l": 133.516239, "t": 653.959582, "r": 148.824469, "b": 633.609355 }, "text": "t\nhi(0)", "attrs": { "row": 5, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 35 }, { "id": "p180.2.37", "order": 39, "type": "table_cell", "bbox": { "l": 236.82, "t": 643.1127, "r": 299.28, "b": 627.0982 }, "text": "", "attrs": { "row": 5, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 36 }, { "id": "p180.2.38", "order": 40, "type": "table_cell", "bbox": { "l": 194.01029, "t": 675.079584, "r": 324.218722, "b": 654.7293569999999 }, "text": "1/2 length of basin (x direction, in feet)\n1/2 width of basin (y direction, in feet)", "attrs": { "row": 5, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true, "merged_continuation": true }, "reading_order": 37 }, { "id": "p180.2.39", "order": 41, "type": "table_cell", "bbox": { "l": 361.74, "t": 643.1127, "r": 424.2, "b": 627.0982 }, "text": "", "attrs": { "row": 5, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 38 }, { "id": "p180.2.40", "order": 42, "type": "table_cell", "bbox": { "l": 424.2, "t": 643.1127, "r": 486.66, "b": 627.0982 }, "text": "", "attrs": { "row": 5, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 39 }, { "id": "p180.2.41", "order": 43, "type": "table_cell", "bbox": { "l": 486.66, "t": 643.1127, "r": 549.12, "b": 627.0982 }, "text": "", "attrs": { "row": 5, "col": 7, "rowspan": 1, "colspan": 1 }, "reading_order": 40 }, { "id": "p180.2.42", "order": 44, "type": "table_cell", "bbox": { "l": 49.44, "t": 611.0836, "r": 111.9, "b": 595.0691 }, "text": "", "attrs": { "row": 6, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 41 }, { "id": "p180.2.43", "order": 45, "type": "table_cell", "bbox": { "l": 87.719999, "t": 622.435437, "r": 108.180338, "b": 613.521956 }, "text": "12.745", "attrs": { "row": 6, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 42 }, { "id": "p180.2.44", "order": 46, "type": "table_cell", "bbox": { "l": 129.359997, "t": 623.119585, "r": 152.810552, "b": 613.32936 }, "text": "h(max)", "attrs": { "row": 6, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 43 }, { "id": "p180.2.45", "order": 47, "type": "table_cell", "bbox": { "l": 236.82, "t": 611.0836, "r": 299.28, "b": 595.0691 }, "text": "", "attrs": { "row": 6, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 44 }, { "id": "p180.2.46", "order": 48, "type": "table_cell", "bbox": { "l": 194.023042, "t": 653.959582, "r": 318.887005, "b": 644.169357 }, "text": "Duration of infiltration period (hours)", "attrs": { "row": 6, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 45 }, { "id": "p180.2.47", "order": 49, "type": "table_cell", "bbox": { "l": 361.74, "t": 611.0836, "r": 424.2, "b": 595.0691 }, "text": "", "attrs": { "row": 6, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 46 }, { "id": "p180.2.48", "order": 50, "type": "table_cell", "bbox": { "l": 424.2, "t": 611.0836, "r": 486.66, "b": 595.0691 }, "text": "", "attrs": { "row": 6, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 47 }, { "id": "p180.2.49", "order": 51, "type": "table_cell", "bbox": { "l": 486.66, "t": 611.0836, "r": 549.12, "b": 595.0691 }, "text": "", "attrs": { "row": 6, "col": 7, "rowspan": 1, "colspan": 1 }, "reading_order": 48 }, { "id": "p180.2.50", "order": 52, "type": "table_cell", "bbox": { "l": 49.44, "t": 595.0691, "r": 111.9, "b": 579.0545 }, "text": "", "attrs": { "row": 7, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 49 }, { "id": "p180.2.51", "order": 53, "type": "table_cell", "bbox": { "l": 91.800002, "t": 570.59543, "r": 108.505531, "b": 561.681948 }, "text": "2.745", "attrs": { "row": 7, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 50 }, { "id": "p180.2.52", "order": 54, "type": "table_cell", "bbox": { "l": 174.36, "t": 595.0691, "r": 236.82, "b": 579.0545 }, "text": "Δ h(max)", "attrs": { "row": 7, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 51 }, { "id": "p180.2.53", "order": 55, "type": "table_cell", "bbox": { "l": 236.82, "t": 595.0691, "r": 299.28, "b": 579.0545 }, "text": "", "attrs": { "row": 7, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 52 }, { "id": "p180.2.54", "order": 56, "type": "table_cell", "bbox": { "l": 193.995927, "t": 643.399581, "r": 326.448161, "b": 633.609355 }, "text": "Initial thickness of saturated zone (feet)", "attrs": { "row": 7, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 53 }, { "id": "p180.2.55", "order": 57, "type": "table_cell", "bbox": { "l": 361.74, "t": 595.0691, "r": 424.2, "b": 579.0545 }, "text": "", "attrs": { "row": 7, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 54 }, { "id": "p180.2.56", "order": 58, "type": "table_cell", "bbox": { "l": 424.2, "t": 595.0691, "r": 486.66, "b": 579.0545 }, "text": "", "attrs": { "row": 7, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 55 }, { "id": "p180.2.57", "order": 59, "type": "table_cell", "bbox": { "l": 486.66, "t": 595.0691, "r": 549.12, "b": 579.0545 }, "text": "", "attrs": { "row": 7, "col": 7, "rowspan": 1, "colspan": 1 }, "reading_order": 56 }, { "id": "p180.2.58", "order": 60, "type": "table_cell", "bbox": { "l": 49.44, "t": 579.0545, "r": 111.9, "b": 563.04 }, "text": "", "attrs": { "row": 8, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 57 }, { "id": "p180.2.59", "order": 61, "type": "table_cell", "bbox": { "l": 52.320002, "t": 591.955438, "r": 95.550901, "b": 583.041956 }, "text": "Ground-water", "attrs": { "row": 8, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 58 }, { "id": "p180.2.60", "order": 62, "type": "table_cell", "bbox": { "l": 111.120003, "t": 601.675431, "r": 168.875523, "b": 583.041956 }, "text": "Distance from center of basin in x", "attrs": { "row": 8, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 59 }, { "id": "p180.2.61", "order": 63, "type": "table_cell", "bbox": { "l": 236.82, "t": 579.0545, "r": 299.28, "b": 563.04 }, "text": "", "attrs": { "row": 8, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 60 }, { "id": "p180.2.62", "order": 64, "type": "table_cell", "bbox": { "l": 194.049871, "t": 623.119585, "r": 499.63114, "b": 613.32936 }, "text": "Maximum thickness of saturated zone (beneath center of basin at end of infiltration period)", "attrs": { "row": 8, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 61 }, { "id": "p180.2.63", "order": 65, "type": "table_cell", "bbox": { "l": 361.74, "t": 579.0545, "r": 424.2, "b": 563.04 }, "text": "", "attrs": { "row": 8, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 62 }, { "id": "p180.2.64", "order": 66, "type": "table_cell", "bbox": { "l": 424.2, "t": 579.0545, "r": 486.66, "b": 563.04 }, "text": "", "attrs": { "row": 8, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 63 }, { "id": "p180.2.65", "order": 67, "type": "table_cell", "bbox": { "l": 486.66, "t": 579.0545, "r": 549.12, "b": 563.04 }, "text": "", "attrs": { "row": 8, "col": 7, "rowspan": 1, "colspan": 1 }, "reading_order": 64 }, { "id": "p180.2.66", "order": 68, "type": "table_cell", "bbox": { "l": 49.44, "t": 563.04, "r": 111.9, "b": 547.0255 }, "text": "", "attrs": { "row": 9, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 65 }, { "id": "p180.2.67", "order": 69, "type": "table_cell", "bbox": { "l": 52.320002, "t": 582.235445, "r": 106.993446, "b": 573.321963 }, "text": "Mounding, in feet", "attrs": { "row": 9, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 66 }, { "id": "p180.2.68", "order": 70, "type": "table_cell", "bbox": { "l": 174.36, "t": 563.04, "r": 236.82, "b": 547.0255 }, "text": "direction, in feet", "attrs": { "row": 9, "col": 2, "rowspan": 1, "colspan": 1 }, "reading_order": 67 }, { "id": "p180.2.69", "order": 71, "type": "table_cell", "bbox": { "l": 236.82, "t": 563.04, "r": 299.28, "b": 547.0255 }, "text": "", "attrs": { "row": 9, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 68 }, { "id": "p180.2.70", "order": 72, "type": "table_cell", "bbox": { "l": 193.985623, "t": 612.559584, "r": 487.365315, "b": 602.769359 }, "text": "Maximum groundwater mounding (beneath center of basin at end of infiltration period)", "attrs": { "row": 9, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 69 }, { "id": "p180.2.71", "order": 73, "type": "table_cell", "bbox": { "l": 361.74, "t": 563.04, "r": 424.2, "b": 547.0255 }, "text": "", "attrs": { "row": 9, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 70 }, { "id": "p180.2.72", "order": 74, "type": "table_cell", "bbox": { "l": 424.2, "t": 563.04, "r": 486.66, "b": 547.0255 }, "text": "", "attrs": { "row": 9, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 71 }, { "id": "p180.2.73", "order": 75, "type": "table_cell", "bbox": { "l": 486.66, "t": 563.04, "r": 549.12, "b": 547.0255 }, "text": "", "attrs": { "row": 9, "col": 7, "rowspan": 1, "colspan": 1 }, "reading_order": 72 }, { "id": "p180.2.74", "order": 76, "type": "table_cell", "bbox": { "l": 49.44, "t": 547.0255, "r": 111.9, "b": 531.0109 }, "text": "", "attrs": { "row": 10, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 73 }, { "id": "p180.2.75", "order": 77, "type": "table_cell", "bbox": { "l": 91.439999, "t": 611.875437, "r": 108.145528, "b": 602.961955 }, "text": "2.745", "attrs": { "row": 10, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 74 }, { "id": "p180.2.76", "order": 78, "type": "table_cell", "bbox": { "l": 139.200005, "t": 571.039595, "r": 143.260541, "b": 561.249369 }, "text": "0", "attrs": { "row": 10, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 75 }, { "id": "p180.2.77", "order": 79, "type": "table_cell", "bbox": { "l": 236.82, "t": 547.0255, "r": 299.28, "b": 531.0109 }, "text": "", "attrs": { "row": 10, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 76 }, { "id": "p180.2.78", "order": 80, "type": "table_cell", "bbox": { "l": 311.997823, "t": 544.763656, "r": 471.261318, "b": 530.050536 }, "text": "Groundwater Mounding, in feet", "attrs": { "row": 10, "col": 4, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 77 }, { "id": "p180.2.79", "order": 81, "type": "table_cell", "bbox": { "l": 361.74, "t": 547.0255, "r": 424.2, "b": 531.0109 }, "text": "", "attrs": { "row": 10, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 78 }, { "id": "p180.2.80", "order": 82, "type": "table_cell", "bbox": { "l": 424.2, "t": 547.0255, "r": 486.66, "b": 531.0109 }, "text": "", "attrs": { "row": 10, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 79 }, { "id": "p180.2.81", "order": 83, "type": "table_cell", "bbox": { "l": 486.66, "t": 547.0255, "r": 549.12, "b": 531.0109 }, "text": "", "attrs": { "row": 10, "col": 7, "rowspan": 1, "colspan": 1 }, "reading_order": 80 }, { "id": "p180.2.82", "order": 84, "type": "table_cell", "bbox": { "l": 49.44, "t": 531.0109, "r": 111.9, "b": 514.9964 }, "text": "", "attrs": { "row": 11, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 81 }, { "id": "p180.2.83", "order": 85, "type": "table_cell", "bbox": { "l": 91.800002, "t": 560.03544, "r": 108.505531, "b": 551.121958 }, "text": "2.680", "attrs": { "row": 11, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 82 }, { "id": "p180.2.84", "order": 86, "type": "table_cell", "bbox": { "l": 137.160004, "t": 560.4795819999999, "r": 145.287784, "b": 550.689357 }, "text": "10", "attrs": { "row": 11, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 83 }, { "id": "p180.2.85", "order": 87, "type": "table_cell", "bbox": { "l": 236.82, "t": 531.0109, "r": 299.28, "b": 514.9964 }, "text": "", "attrs": { "row": 11, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 84 }, { "id": "p180.2.86", "order": 88, "type": "table_cell", "bbox": { "l": 299.28, "t": 531.0109, "r": 361.74, "b": 514.9964 }, "text": "Groundwater Mounding, in feet", "attrs": { "row": 11, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 85 }, { "id": "p180.2.87", "order": 89, "type": "table_cell", "bbox": { "l": 361.74, "t": 531.0109, "r": 424.2, "b": 514.9964 }, "text": "", "attrs": { "row": 11, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 86 }, { "id": "p180.2.88", "order": 90, "type": "table_cell", "bbox": { "l": 424.2, "t": 531.0109, "r": 486.66, "b": 514.9964 }, "text": "", "attrs": { "row": 11, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 87 }, { "id": "p180.2.89", "order": 91, "type": "table_cell", "bbox": { "l": 486.66, "t": 531.0109, "r": 549.12, "b": 514.9964 }, "text": "", "attrs": { "row": 11, "col": 7, "rowspan": 1, "colspan": 1 }, "reading_order": 88 }, { "id": "p180.2.90", "order": 92, "type": "table_cell", "bbox": { "l": 49.44, "t": 514.9964, "r": 111.9, "b": 498.9818 }, "text": "", "attrs": { "row": 12, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 89 }, { "id": "p180.2.91", "order": 93, "type": "table_cell", "bbox": { "l": 91.800002, "t": 549.475427, "r": 108.505531, "b": 540.561945 }, "text": "2.472", "attrs": { "row": 12, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 90 }, { "id": "p180.2.92", "order": 94, "type": "table_cell", "bbox": { "l": 137.160004, "t": 549.919593, "r": 145.287784, "b": 540.129367 }, "text": "20", "attrs": { "row": 12, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 91 }, { "id": "p180.2.93", "order": 95, "type": "table_cell", "bbox": { "l": 236.82, "t": 514.9964, "r": 299.28, "b": 498.9818 }, "text": "", "attrs": { "row": 12, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 92 }, { "id": "p180.2.94", "order": 96, "type": "table_cell", "bbox": { "l": 299.28, "t": 514.9964, "r": 361.74, "b": 498.9818 }, "text": "Groundwater Mounding, in feet", "attrs": { "row": 12, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 93 }, { "id": "p180.2.95", "order": 97, "type": "table_cell", "bbox": { "l": 361.74, "t": 514.9964, "r": 424.2, "b": 498.9818 }, "text": "", "attrs": { "row": 12, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 94 }, { "id": "p180.2.96", "order": 98, "type": "table_cell", "bbox": { "l": 424.2, "t": 514.9964, "r": 486.66, "b": 498.9818 }, "text": "", "attrs": { "row": 12, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 95 }, { "id": "p180.2.97", "order": 99, "type": "table_cell", "bbox": { "l": 486.66, "t": 514.9964, "r": 549.12, "b": 498.9818 }, "text": "", "attrs": { "row": 12, "col": 7, "rowspan": 1, "colspan": 1 }, "reading_order": 96 }, { "id": "p180.2.98", "order": 100, "type": "table_cell", "bbox": { "l": 49.44, "t": 498.9818, "r": 111.9, "b": 482.9673 }, "text": "", "attrs": { "row": 13, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 97 }, { "id": "p180.2.99", "order": 101, "type": "table_cell", "bbox": { "l": 91.800002, "t": 538.915437, "r": 108.505531, "b": 530.0019560000001 }, "text": "2.086", "attrs": { "row": 13, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 98 }, { "id": "p180.2.100", "order": 102, "type": "table_cell", "bbox": { "l": 137.160004, "t": 539.3595789999999, "r": 145.287784, "b": 529.569354 }, "text": "30", "attrs": { "row": 13, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 99 }, { "id": "p180.2.101", "order": 103, "type": "table_cell", "bbox": { "l": 236.82, "t": 498.9818, "r": 299.28, "b": 482.9673 }, "text": "", "attrs": { "row": 13, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 100 }, { "id": "p180.2.102", "order": 104, "type": "table_cell", "bbox": { "l": 299.28, "t": 498.9818, "r": 361.74, "b": 482.9673 }, "text": "Groundwater Mounding, in feet", "attrs": { "row": 13, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 101 }, { "id": "p180.2.103", "order": 105, "type": "table_cell", "bbox": { "l": 361.74, "t": 498.9818, "r": 424.2, "b": 482.9673 }, "text": "", "attrs": { "row": 13, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 102 }, { "id": "p180.2.104", "order": 106, "type": "table_cell", "bbox": { "l": 424.2, "t": 498.9818, "r": 486.66, "b": 482.9673 }, "text": "", "attrs": { "row": 13, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 103 }, { "id": "p180.2.105", "order": 107, "type": "table_cell", "bbox": { "l": 486.66, "t": 498.9818, "r": 549.12, "b": 482.9673 }, "text": "", "attrs": { "row": 13, "col": 7, "rowspan": 1, "colspan": 1 }, "reading_order": 104 }, { "id": "p180.2.106", "order": 108, "type": "table_cell", "bbox": { "l": 49.44, "t": 482.9673, "r": 111.9, "b": 466.9527 }, "text": "", "attrs": { "row": 14, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 105 }, { "id": "p180.2.107", "order": 109, "type": "table_cell", "bbox": { "l": 91.800002, "t": 528.355447, "r": 108.505531, "b": 519.441965 }, "text": "1.569", "attrs": { "row": 14, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 106 }, { "id": "p180.2.108", "order": 110, "type": "table_cell", "bbox": { "l": 137.160004, "t": 528.7995900000001, "r": 145.287784, "b": 519.009364 }, "text": "40", "attrs": { "row": 14, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 107 }, { "id": "p180.2.109", "order": 111, "type": "table_cell", "bbox": { "l": 236.82, "t": 482.9673, "r": 299.28, "b": 466.9527 }, "text": "", "attrs": { "row": 14, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 108 }, { "id": "p180.2.110", "order": 112, "type": "table_cell", "bbox": { "l": 299.28, "t": 482.9673, "r": 361.74, "b": 466.9527 }, "text": "Groundwater Mounding, in feet", "attrs": { "row": 14, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 109 }, { "id": "p180.2.111", "order": 113, "type": "table_cell", "bbox": { "l": 361.74, "t": 482.9673, "r": 424.2, "b": 466.9527 }, "text": "", "attrs": { "row": 14, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 110 }, { "id": "p180.2.112", "order": 114, "type": "table_cell", "bbox": { "l": 424.2, "t": 482.9673, "r": 486.66, "b": 466.9527 }, "text": "", "attrs": { "row": 14, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 111 }, { "id": "p180.2.113", "order": 115, "type": "table_cell", "bbox": { "l": 486.66, "t": 482.9673, "r": 549.12, "b": 466.9527 }, "text": "", "attrs": { "row": 14, "col": 7, "rowspan": 1, "colspan": 1 }, "reading_order": 112 }, { "id": "p180.2.114", "order": 116, "type": "table_cell", "bbox": { "l": 49.44, "t": 466.9527, "r": 111.9, "b": 450.9382 }, "text": "", "attrs": { "row": 15, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 113 }, { "id": "p180.2.115", "order": 117, "type": "table_cell", "bbox": { "l": 91.800002, "t": 517.795434, "r": 108.505531, "b": 508.881953 }, "text": "1.166", "attrs": { "row": 15, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 114 }, { "id": "p180.2.116", "order": 118, "type": "table_cell", "bbox": { "l": 137.160004, "t": 518.239577, "r": 145.287784, "b": 508.449351 }, "text": "50", "attrs": { "row": 15, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 115 }, { "id": "p180.2.117", "order": 119, "type": "table_cell", "bbox": { "l": 236.82, "t": 466.9527, "r": 299.28, "b": 450.9382 }, "text": "", "attrs": { "row": 15, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 116 }, { "id": "p180.2.118", "order": 120, "type": "table_cell", "bbox": { "l": 299.28, "t": 466.9527, "r": 361.74, "b": 450.9382 }, "text": "Groundwater Mounding, in feet", "attrs": { "row": 15, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 117 }, { "id": "p180.2.119", "order": 121, "type": "table_cell", "bbox": { "l": 361.74, "t": 466.9527, "r": 424.2, "b": 450.9382 }, "text": "", "attrs": { "row": 15, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 118 }, { "id": "p180.2.120", "order": 122, "type": "table_cell", "bbox": { "l": 424.2, "t": 466.9527, "r": 486.66, "b": 450.9382 }, "text": "", "attrs": { "row": 15, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 119 }, { "id": "p180.2.121", "order": 123, "type": "table_cell", "bbox": { "l": 486.66, "t": 466.9527, "r": 549.12, "b": 450.9382 }, "text": "", "attrs": { "row": 15, "col": 7, "rowspan": 1, "colspan": 1 }, "reading_order": 120 }, { "id": "p180.2.122", "order": 124, "type": "table_cell", "bbox": { "l": 49.44, "t": 450.9382, "r": 111.9, "b": 434.9236 }, "text": "", "attrs": { "row": 16, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 121 }, { "id": "p180.2.123", "order": 125, "type": "table_cell", "bbox": { "l": 91.800002, "t": 507.235445, "r": 108.505531, "b": 498.321963 }, "text": "0.864", "attrs": { "row": 16, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 122 }, { "id": "p180.2.124", "order": 126, "type": "table_cell", "bbox": { "l": 137.160004, "t": 507.679587, "r": 145.287784, "b": 497.889361 }, "text": "60", "attrs": { "row": 16, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 123 }, { "id": "p180.2.125", "order": 127, "type": "table_cell", "bbox": { "l": 236.82, "t": 450.9382, "r": 299.28, "b": 434.9236 }, "text": "", "attrs": { "row": 16, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 124 }, { "id": "p180.2.126", "order": 128, "type": "table_cell", "bbox": { "l": 299.28, "t": 450.9382, "r": 361.74, "b": 434.9236 }, "text": "Groundwater Mounding, in feet", "attrs": { "row": 16, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 125 }, { "id": "p180.2.127", "order": 129, "type": "table_cell", "bbox": { "l": 361.74, "t": 450.9382, "r": 424.2, "b": 434.9236 }, "text": "", "attrs": { "row": 16, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 126 }, { "id": "p180.2.128", "order": 130, "type": "table_cell", "bbox": { "l": 424.2, "t": 450.9382, "r": 486.66, "b": 434.9236 }, "text": "", "attrs": { "row": 16, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 127 }, { "id": "p180.2.129", "order": 131, "type": "table_cell", "bbox": { "l": 486.66, "t": 450.9382, "r": 549.12, "b": 434.9236 }, "text": "", "attrs": { "row": 16, "col": 7, "rowspan": 1, "colspan": 1 }, "reading_order": 128 }, { "id": "p180.2.130", "order": 132, "type": "table_cell", "bbox": { "l": 49.44, "t": 434.9236, "r": 111.9, "b": 418.9091 }, "text": "", "attrs": { "row": 17, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 129 }, { "id": "p180.2.131", "order": 133, "type": "table_cell", "bbox": { "l": 91.800002, "t": 496.675431, "r": 108.505531, "b": 487.76195 }, "text": "0.636", "attrs": { "row": 17, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 130 }, { "id": "p180.2.132", "order": 134, "type": "table_cell", "bbox": { "l": 137.160004, "t": 497.119597, "r": 145.287784, "b": 487.329372 }, "text": "70", "attrs": { "row": 17, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 131 }, { "id": "p180.2.133", "order": 135, "type": "table_cell", "bbox": { "l": 236.82, "t": 434.9236, "r": 299.28, "b": 418.9091 }, "text": "", "attrs": { "row": 17, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 132 }, { "id": "p180.2.134", "order": 136, "type": "table_cell", "bbox": { "l": 299.28, "t": 434.9236, "r": 361.74, "b": 418.9091 }, "text": "Groundwater Mounding, in feet", "attrs": { "row": 17, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 133 }, { "id": "p180.2.135", "order": 137, "type": "table_cell", "bbox": { "l": 361.74, "t": 434.9236, "r": 424.2, "b": 418.9091 }, "text": "", "attrs": { "row": 17, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 134 }, { "id": "p180.2.136", "order": 138, "type": "table_cell", "bbox": { "l": 424.2, "t": 434.9236, "r": 486.66, "b": 418.9091 }, "text": "", "attrs": { "row": 17, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 135 }, { "id": "p180.2.137", "order": 139, "type": "table_cell", "bbox": { "l": 486.66, "t": 434.9236, "r": 549.12, "b": 418.9091 }, "text": "", "attrs": { "row": 17, "col": 7, "rowspan": 1, "colspan": 1 }, "reading_order": 136 }, { "id": "p180.2.138", "order": 140, "type": "table_cell", "bbox": { "l": 49.44, "t": 418.9091, "r": 111.9, "b": 402.8945 }, "text": "", "attrs": { "row": 18, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 137 }, { "id": "p180.2.139", "order": 141, "type": "table_cell", "bbox": { "l": 91.800002, "t": 486.115442, "r": 108.505531, "b": 477.20196 }, "text": "0.464", "attrs": { "row": 18, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 138 }, { "id": "p180.2.140", "order": 142, "type": "table_cell", "bbox": { "l": 137.160004, "t": 486.559584, "r": 145.287784, "b": 476.769359 }, "text": "80", "attrs": { "row": 18, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 139 }, { "id": "p180.2.141", "order": 143, "type": "table_cell", "bbox": { "l": 236.82, "t": 418.9091, "r": 299.28, "b": 402.8945 }, "text": "", "attrs": { "row": 18, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 140 }, { "id": "p180.2.142", "order": 144, "type": "table_cell", "bbox": { "l": 299.28, "t": 418.9091, "r": 361.74, "b": 402.8945 }, "text": "Groundwater Mounding, in feet", "attrs": { "row": 18, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 141 }, { "id": "p180.2.143", "order": 145, "type": "table_cell", "bbox": { "l": 361.74, "t": 418.9091, "r": 424.2, "b": 402.8945 }, "text": "", "attrs": { "row": 18, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 142 }, { "id": "p180.2.144", "order": 146, "type": "table_cell", "bbox": { "l": 424.2, "t": 418.9091, "r": 486.66, "b": 402.8945 }, "text": "", "attrs": { "row": 18, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 143 }, { "id": "p180.2.145", "order": 147, "type": "table_cell", "bbox": { "l": 486.66, "t": 418.9091, "r": 549.12, "b": 402.8945 }, "text": "", "attrs": { "row": 18, "col": 7, "rowspan": 1, "colspan": 1 }, "reading_order": 144 }, { "id": "p180.2.146", "order": 148, "type": "table_cell", "bbox": { "l": 49.44, "t": 402.8945, "r": 111.9, "b": 386.88 }, "text": "", "attrs": { "row": 19, "col": 0, "rowspan": 1, "colspan": 1 }, "reading_order": 145 }, { "id": "p180.2.147", "order": 149, "type": "table_cell", "bbox": { "l": 91.800002, "t": 475.555429, "r": 108.505531, "b": 466.641947 }, "text": "0.335", "attrs": { "row": 19, "col": 1, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 146 }, { "id": "p180.2.148", "order": 150, "type": "table_cell", "bbox": { "l": 137.160004, "t": 475.999594, "r": 145.287784, "b": 466.209369 }, "text": "90", "attrs": { "row": 19, "col": 2, "rowspan": 1, "colspan": 1, "bbox_refit": true }, "reading_order": 147 }, { "id": "p180.2.149", "order": 151, "type": "table_cell", "bbox": { "l": 236.82, "t": 402.8945, "r": 299.28, "b": 386.88 }, "text": "", "attrs": { "row": 19, "col": 3, "rowspan": 1, "colspan": 1 }, "reading_order": 148 }, { "id": "p180.2.150", "order": 152, "type": "table_cell", "bbox": { "l": 299.28, "t": 402.8945, "r": 361.74, "b": 386.88 }, "text": "Groundwater Mounding, in feet", "attrs": { "row": 19, "col": 4, "rowspan": 1, "colspan": 1 }, "reading_order": 149 }, { "id": "p180.2.151", "order": 153, "type": "table_cell", "bbox": { "l": 361.74, "t": 402.8945, "r": 424.2, "b": 386.88 }, "text": "", "attrs": { "row": 19, "col": 5, "rowspan": 1, "colspan": 1 }, "reading_order": 150 }, { "id": "p180.2.152", "order": 154, "type": "table_cell", "bbox": { "l": 424.2, "t": 402.8945, "r": 486.66, "b": 386.88 }, "text": "", "attrs": { "row": 19, "col": 6, "rowspan": 1, "colspan": 1 }, "reading_order": 151 }, { "id": "p180.2.153", "order": 155, "type": "table_cell", "bbox": { "l": 486.66, "t": 402.8945, "r": 549.12, "b": 386.88 }, "text": "", "attrs": { "row": 19, "col": 7, "rowspan": 1, "colspan": 1 }, "reading_order": 152 } ], "reading_order": 1 }, { "id": "p180.3", "order": 156, "type": "heading", "bbox": { "l": 58.32, "t": 384, "r": 115.68, "b": 372.48 }, "text": "Disclaimer", "attrs": { "block_label": "paragraph_title" }, "level": 3, "reading_order": 2 }, { "id": "p180.4", "order": 157, "type": "text", "bbox": { "l": 49.68, "t": 362.4, "r": 556.56, "b": 266.88 }, "text": "This spreadsheet solving the Hantush (1967) equation for ground-water mounding beneath an infiltration basin is made available to the general public as a convenience for those wishing to replicate values documented in the USGS Scientific Investigations Report 2010-5102 \"Groundwater mounding beneath hypothetical stormwater infiltration basins\" or to calculate values based on user-specified site conditions. Any changes made to the spreadsheet (other than values identified as user-specified) after transmission from the USGS could have unintended, undesirable consequences. These consequences could include, but may not be limited to: erroneous output, numerical instabilities, and violations of underlying assumptions that are inherent in results presented in the accompanying USGS published report. The USGS assumes no responsibility for the consequences of any changes made to the spreadsheet. If changes are made to the spreadsheet, the user is responsible for documenting the changes and justifying the results and conclusions.", "reading_order": 3 } ] } ] }